instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_1400>.
Cc1nc2cc(Br)c(F)cc2[nH]1
What is the building block token for the following molecule?
Cc1nc2cc(Br)c(F)cc2[nH]1
<BB_1400>
What is the molecular formula for <BB_1400>?
The molecular formula for <BB_1400> (Cc1nc2cc(Br)c(F)cc2[nH]1) is C8H6BrFN2.
Describe the ring structures in building block <BB_1400>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1400>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1400>.
**Token:** <BB_1400> **SMILES:** Cc1nc2cc(Br)c(F)cc2[nH]1 **Molecular Formula:** C8H6BrFN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1401>.
NC1CC2c3ccccc3C1c1ccccc12
What is the building block token for the following molecule?
NC1CC2c3ccccc3C1c1ccccc12
<BB_1401>
What is the molecular formula for <BB_1401>?
The molecular formula for <BB_1401> (NC1CC2c3ccccc3C1c1ccccc12) is C16H15N.
Describe the ring structures in building block <BB_1401>.
The molecule contains 5 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1401>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1401>.
**Token:** <BB_1401> **SMILES:** NC1CC2c3ccccc3C1c1ccccc12 **Molecular Formula:** C16H15N **Ring System:** The molecule contains 5 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1402>.
CC(C)(C)OC(=O)N[C@H]1C[C@@H](CO)CC[C@H]1CN
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N[C@H]1C[C@@H](CO)CC[C@H]1CN
<BB_1402>
What is the molecular formula for <BB_1402>?
The molecular formula for <BB_1402> (CC(C)(C)OC(=O)N[C@H]1C[C@@H](CO)CC[C@H]1CN) is C13H26N2O3.
Describe the ring structures in building block <BB_1402>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1402>.
The molecule contains the following groups: Amine, Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1402>.
**Token:** <BB_1402> **SMILES:** CC(C)(C)OC(=O)N[C@H]1C[C@@H](CO)CC[C@H]1CN **Molecular Formula:** C13H26N2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1403>.
CCC(=O)NC1CN(C(=O)OC(C)(C)C)C1
What is the building block token for the following molecule?
CCC(=O)NC1CN(C(=O)OC(C)(C)C)C1
<BB_1403>
What is the molecular formula for <BB_1403>?
The molecular formula for <BB_1403> (CCC(=O)NC1CN(C(=O)OC(C)(C)C)C1) is C11H20N2O3.
Describe the ring structures in building block <BB_1403>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1403>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1403>.
**Token:** <BB_1403> **SMILES:** CCC(=O)NC1CN(C(=O)OC(C)(C)C)C1 **Molecular Formula:** C11H20N2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_1404>.
CN(C)c1noc(C2CCCCN2)n1
What is the building block token for the following molecule?
CN(C)c1noc(C2CCCCN2)n1
<BB_1404>
What is the molecular formula for <BB_1404>?
The molecular formula for <BB_1404> (CN(C)c1noc(C2CCCCN2)n1) is C9H16N4O.
Describe the ring structures in building block <BB_1404>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1404>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_1404>.
**Token:** <BB_1404> **SMILES:** CN(C)c1noc(C2CCCCN2)n1 **Molecular Formula:** C9H16N4O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_1405>.
CC(C)(C)c1cc(Br)c(N)cc1[N+](=O)[O-].Cl
What is the building block token for the following molecule?
CC(C)(C)c1cc(Br)c(N)cc1[N+](=O)[O-].Cl
<BB_1405>
What is the molecular formula for <BB_1405>?
The molecular formula for <BB_1405> (CC(C)(C)c1cc(Br)c(N)cc1[N+](=O)[O-].Cl) is C10H14BrClN2O2.
Describe the ring structures in building block <BB_1405>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1405>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_1405>.
**Token:** <BB_1405> **SMILES:** CC(C)(C)c1cc(Br)c(N)cc1[N+](=O)[O-].Cl **Molecular Formula:** C10H14BrClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_1406>.
CC1(C)OCC(CCI)O1
What is the building block token for the following molecule?
CC1(C)OCC(CCI)O1
<BB_1406>
What is the molecular formula for <BB_1406>?
The molecular formula for <BB_1406> (CC1(C)OCC(CCI)O1) is C7H13IO2.
Describe the ring structures in building block <BB_1406>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1406>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1406>.
**Token:** <BB_1406> **SMILES:** CC1(C)OCC(CCI)O1 **Molecular Formula:** C7H13IO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1407>.
Nc1ccc2[nH]c(CC3CCCCC3)nc2c1
What is the building block token for the following molecule?
Nc1ccc2[nH]c(CC3CCCCC3)nc2c1
<BB_1407>
What is the molecular formula for <BB_1407>?
The molecular formula for <BB_1407> (Nc1ccc2[nH]c(CC3CCCCC3)nc2c1) is C14H19N3.
Describe the ring structures in building block <BB_1407>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1407>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1407>.
**Token:** <BB_1407> **SMILES:** Nc1ccc2[nH]c(CC3CCCCC3)nc2c1 **Molecular Formula:** C14H19N3 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1408>.
O=C1NCCCN1Cc1ccccc1
What is the building block token for the following molecule?
O=C1NCCCN1Cc1ccccc1
<BB_1408>
What is the molecular formula for <BB_1408>?
The molecular formula for <BB_1408> (O=C1NCCCN1Cc1ccccc1) is C11H14N2O.
Describe the ring structures in building block <BB_1408>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1408>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_1408>.
**Token:** <BB_1408> **SMILES:** O=C1NCCCN1Cc1ccccc1 **Molecular Formula:** C11H14N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_1409>.
CC(=O)c1cc(C)ccc1OC(F)F
What is the building block token for the following molecule?
CC(=O)c1cc(C)ccc1OC(F)F
<BB_1409>
What is the molecular formula for <BB_1409>?
The molecular formula for <BB_1409> (CC(=O)c1cc(C)ccc1OC(F)F) is C10H10F2O2.
Describe the ring structures in building block <BB_1409>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1409>.
The molecule contains the following groups: Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1409>.
**Token:** <BB_1409> **SMILES:** CC(=O)c1cc(C)ccc1OC(F)F **Molecular Formula:** C10H10F2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1410>.
Br.Nc1nc2ccc(F)cc2n1-c1ccccc1F
What is the building block token for the following molecule?
Br.Nc1nc2ccc(F)cc2n1-c1ccccc1F
<BB_1410>
What is the molecular formula for <BB_1410>?
The molecular formula for <BB_1410> (Br.Nc1nc2ccc(F)cc2n1-c1ccccc1F) is C13H10BrF2N3.
Describe the ring structures in building block <BB_1410>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1410>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1410>.
**Token:** <BB_1410> **SMILES:** Br.Nc1nc2ccc(F)cc2n1-c1ccccc1F **Molecular Formula:** C13H10BrF2N3 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1411>.
ClCc1cc(Cl)ccn1
What is the building block token for the following molecule?
ClCc1cc(Cl)ccn1
<BB_1411>
What is the molecular formula for <BB_1411>?
The molecular formula for <BB_1411> (ClCc1cc(Cl)ccn1) is C6H5Cl2N.
Describe the ring structures in building block <BB_1411>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1411>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1411>.
**Token:** <BB_1411> **SMILES:** ClCc1cc(Cl)ccn1 **Molecular Formula:** C6H5Cl2N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1412>.
[N-]=[N+]=N[C@H]1C[C@]2(C(=O)O)C[C@H]12
What is the building block token for the following molecule?
[N-]=[N+]=N[C@H]1C[C@]2(C(=O)O)C[C@H]12
<BB_1412>
What is the molecular formula for <BB_1412>?
The molecular formula for <BB_1412> ([N-]=[N+]=N[C@H]1C[C@]2(C(=O)O)C[C@H]12) is C6H7N3O2.
Describe the ring structures in building block <BB_1412>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1412>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1412>.
**Token:** <BB_1412> **SMILES:** [N-]=[N+]=N[C@H]1C[C@]2(C(=O)O)C[C@H]12 **Molecular Formula:** C6H7N3O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1413>.
COC(=O)C1CCN(c2nccc(OC)n2)CC1
What is the building block token for the following molecule?
COC(=O)C1CCN(c2nccc(OC)n2)CC1
<BB_1413>
What is the molecular formula for <BB_1413>?
The molecular formula for <BB_1413> (COC(=O)C1CCN(c2nccc(OC)n2)CC1) is C12H17N3O3.
Describe the ring structures in building block <BB_1413>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1413>.
The molecule contains the following groups: Tertiary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1413>.
**Token:** <BB_1413> **SMILES:** COC(=O)C1CCN(c2nccc(OC)n2)CC1 **Molecular Formula:** C12H17N3O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_1414>.
CCOP(=O)(CNC)OCC
What is the building block token for the following molecule?
CCOP(=O)(CNC)OCC
<BB_1414>
What is the molecular formula for <BB_1414>?
The molecular formula for <BB_1414> (CCOP(=O)(CNC)OCC) is C6H16NO3P.
Describe the ring structures in building block <BB_1414>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1414>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_1414>.
**Token:** <BB_1414> **SMILES:** CCOP(=O)(CNC)OCC **Molecular Formula:** C6H16NO3P **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_1415>.
Cl.O=C(Cc1cccc(F)c1)N1CCCNCC1
What is the building block token for the following molecule?
Cl.O=C(Cc1cccc(F)c1)N1CCCNCC1
<BB_1415>
What is the molecular formula for <BB_1415>?
The molecular formula for <BB_1415> (Cl.O=C(Cc1cccc(F)c1)N1CCCNCC1) is C13H18ClFN2O.
Describe the ring structures in building block <BB_1415>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 7.
List the primary functional groups present in <BB_1415>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1415>.
**Token:** <BB_1415> **SMILES:** Cl.O=C(Cc1cccc(F)c1)N1CCCNCC1 **Molecular Formula:** C13H18ClFN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 7. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1416>.
Cl.NC1C2CC3C(C2)C13C(=O)O
What is the building block token for the following molecule?
Cl.NC1C2CC3C(C2)C13C(=O)O
<BB_1416>
What is the molecular formula for <BB_1416>?
The molecular formula for <BB_1416> (Cl.NC1C2CC3C(C2)C13C(=O)O) is C8H12ClNO2.
Describe the ring structures in building block <BB_1416>.
The molecule contains 4 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 5.