instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_1416>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1416>.
**Token:** <BB_1416> **SMILES:** Cl.NC1C2CC3C(C2)C13C(=O)O **Molecular Formula:** C8H12ClNO2 **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1417>.
Cc1nn(-c2ccccc2)c(C)c1C(=O)C(F)(F)F
What is the building block token for the following molecule?
Cc1nn(-c2ccccc2)c(C)c1C(=O)C(F)(F)F
<BB_1417>
What is the molecular formula for <BB_1417>?
The molecular formula for <BB_1417> (Cc1nn(-c2ccccc2)c(C)c1C(=O)C(F)(F)F) is C13H11F3N2O.
Describe the ring structures in building block <BB_1417>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1417>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1417>.
**Token:** <BB_1417> **SMILES:** Cc1nn(-c2ccccc2)c(C)c1C(=O)C(F)(F)F **Molecular Formula:** C13H11F3N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1418>.
FC1(F)C2(CC2)C12CNC2.O=C(O)C(F)(F)F
What is the building block token for the following molecule?
FC1(F)C2(CC2)C12CNC2.O=C(O)C(F)(F)F
<BB_1418>
What is the molecular formula for <BB_1418>?
The molecular formula for <BB_1418> (FC1(F)C2(CC2)C12CNC2.O=C(O)C(F)(F)F) is C9H10F5NO2.
Describe the ring structures in building block <BB_1418>.
The molecule contains 3 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 3, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1418>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1418>.
**Token:** <BB_1418> **SMILES:** FC1(F)C2(CC2)C12CNC2.O=C(O)C(F)(F)F **Molecular Formula:** C9H10F5NO2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 3, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1419>.
Cc1ccc(NC(=O)N(C)C)cc1N
What is the building block token for the following molecule?
Cc1ccc(NC(=O)N(C)C)cc1N
<BB_1419>
What is the molecular formula for <BB_1419>?
The molecular formula for <BB_1419> (Cc1ccc(NC(=O)N(C)C)cc1N) is C10H15N3O.
Describe the ring structures in building block <BB_1419>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1419>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_1419>.
**Token:** <BB_1419> **SMILES:** Cc1ccc(NC(=O)N(C)C)cc1N **Molecular Formula:** C10H15N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_1420>.
CNCc1ccc(C)c(F)c1F.Cl
What is the building block token for the following molecule?
CNCc1ccc(C)c(F)c1F.Cl
<BB_1420>
What is the molecular formula for <BB_1420>?
The molecular formula for <BB_1420> (CNCc1ccc(C)c(F)c1F.Cl) is C9H12ClF2N.
Describe the ring structures in building block <BB_1420>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1420>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1420>.
**Token:** <BB_1420> **SMILES:** CNCc1ccc(C)c(F)c1F.Cl **Molecular Formula:** C9H12ClF2N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1421>.
Cc1cc(C)c(C)c(C(=O)O)c1
What is the building block token for the following molecule?
Cc1cc(C)c(C)c(C(=O)O)c1
<BB_1421>
What is the molecular formula for <BB_1421>?
The molecular formula for <BB_1421> (Cc1cc(C)c(C)c(C(=O)O)c1) is C10H12O2.
Describe the ring structures in building block <BB_1421>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1421>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1421>.
**Token:** <BB_1421> **SMILES:** Cc1cc(C)c(C)c(C(=O)O)c1 **Molecular Formula:** C10H12O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1422>.
CC1CN(C(=O)C(C)(C)C)CC(C)N1.Cl
What is the building block token for the following molecule?
CC1CN(C(=O)C(C)(C)C)CC(C)N1.Cl
<BB_1422>
What is the molecular formula for <BB_1422>?
The molecular formula for <BB_1422> (CC1CN(C(=O)C(C)(C)C)CC(C)N1.Cl) is C11H23ClN2O.
Describe the ring structures in building block <BB_1422>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1422>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1422>.
**Token:** <BB_1422> **SMILES:** CC1CN(C(=O)C(C)(C)C)CC(C)N1.Cl **Molecular Formula:** C11H23ClN2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1423>.
Cl.c1nnc(C2CCNCC2)o1
What is the building block token for the following molecule?
Cl.c1nnc(C2CCNCC2)o1
<BB_1423>
What is the molecular formula for <BB_1423>?
The molecular formula for <BB_1423> (Cl.c1nnc(C2CCNCC2)o1) is C7H12ClN3O.
Describe the ring structures in building block <BB_1423>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1423>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1423>.
**Token:** <BB_1423> **SMILES:** Cl.c1nnc(C2CCNCC2)o1 **Molecular Formula:** C7H12ClN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1424>.
O=C(c1ccc([N+](=O)[O-])cc1)C(F)(F)CBr
What is the building block token for the following molecule?
O=C(c1ccc([N+](=O)[O-])cc1)C(F)(F)CBr
<BB_1424>
What is the molecular formula for <BB_1424>?
The molecular formula for <BB_1424> (O=C(c1ccc([N+](=O)[O-])cc1)C(F)(F)CBr) is C9H6BrF2NO3.
Describe the ring structures in building block <BB_1424>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1424>.
The molecule contains the following groups: Tertiary Amine, Ketone, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_1424>.
**Token:** <BB_1424> **SMILES:** O=C(c1ccc([N+](=O)[O-])cc1)C(F)(F)CBr **Molecular Formula:** C9H6BrF2NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Ketone, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_1425>.
CC(C)(C)OC(=O)N1CCC(N)C1CO
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC(N)C1CO
<BB_1425>
What is the molecular formula for <BB_1425>?
The molecular formula for <BB_1425> (CC(C)(C)OC(=O)N1CCC(N)C1CO) is C10H20N2O3.
Describe the ring structures in building block <BB_1425>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1425>.
The molecule contains the following groups: Amine, Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1425>.
**Token:** <BB_1425> **SMILES:** CC(C)(C)OC(=O)N1CCC(N)C1CO **Molecular Formula:** C10H20N2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1426>.
CCCS(=O)(=O)Nc1cccc(O)c1
What is the building block token for the following molecule?
CCCS(=O)(=O)Nc1cccc(O)c1
<BB_1426>
What is the molecular formula for <BB_1426>?
The molecular formula for <BB_1426> (CCCS(=O)(=O)Nc1cccc(O)c1) is C9H13NO3S.
Describe the ring structures in building block <BB_1426>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1426>.
The molecule contains the following groups: Secondary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1426>.
**Token:** <BB_1426> **SMILES:** CCCS(=O)(=O)Nc1cccc(O)c1 **Molecular Formula:** C9H13NO3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_1427>.
O=C=NCC1CC=CC1
What is the building block token for the following molecule?
O=C=NCC1CC=CC1
<BB_1427>
What is the molecular formula for <BB_1427>?
The molecular formula for <BB_1427> (O=C=NCC1CC=CC1) is C7H9NO.
Describe the ring structures in building block <BB_1427>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1427>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1427>.
**Token:** <BB_1427> **SMILES:** O=C=NCC1CC=CC1 **Molecular Formula:** C7H9NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1428>.
N#CCc1ccc(C(F)(F)F)cn1
What is the building block token for the following molecule?
N#CCc1ccc(C(F)(F)F)cn1
<BB_1428>
What is the molecular formula for <BB_1428>?
The molecular formula for <BB_1428> (N#CCc1ccc(C(F)(F)F)cn1) is C8H5F3N2.
Describe the ring structures in building block <BB_1428>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1428>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1428>.
**Token:** <BB_1428> **SMILES:** N#CCc1ccc(C(F)(F)F)cn1 **Molecular Formula:** C8H5F3N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1429>.
Cc1cccc(-n2ncc(C(=O)O)n2)c1
What is the building block token for the following molecule?
Cc1cccc(-n2ncc(C(=O)O)n2)c1
<BB_1429>
What is the molecular formula for <BB_1429>?
The molecular formula for <BB_1429> (Cc1cccc(-n2ncc(C(=O)O)n2)c1) is C10H9N3O2.
Describe the ring structures in building block <BB_1429>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1429>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1429>.
**Token:** <BB_1429> **SMILES:** Cc1cccc(-n2ncc(C(=O)O)n2)c1 **Molecular Formula:** C10H9N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1430>.
FC(F)Oc1ccccc1N1CCNCC1
What is the building block token for the following molecule?
FC(F)Oc1ccccc1N1CCNCC1
<BB_1430>
What is the molecular formula for <BB_1430>?
The molecular formula for <BB_1430> (FC(F)Oc1ccccc1N1CCNCC1) is C11H14F2N2O.
Describe the ring structures in building block <BB_1430>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1430>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1430>.
**Token:** <BB_1430> **SMILES:** FC(F)Oc1ccccc1N1CCNCC1 **Molecular Formula:** C11H14F2N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1431>.
CC(C)(C)C(N)CCc1cccc(F)c1
What is the building block token for the following molecule?
CC(C)(C)C(N)CCc1cccc(F)c1
<BB_1431>
What is the molecular formula for <BB_1431>?
The molecular formula for <BB_1431> (CC(C)(C)C(N)CCc1cccc(F)c1) is C13H20FN.
Describe the ring structures in building block <BB_1431>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1431>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1431>.
**Token:** <BB_1431> **SMILES:** CC(C)(C)C(N)CCc1cccc(F)c1 **Molecular Formula:** C13H20FN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1432>.
Cc1ccc(C)c(S(=O)(=O)NN)c1
What is the building block token for the following molecule?
Cc1ccc(C)c(S(=O)(=O)NN)c1
<BB_1432>
What is the molecular formula for <BB_1432>?
The molecular formula for <BB_1432> (Cc1ccc(C)c(S(=O)(=O)NN)c1) is C8H12N2O2S.
Describe the ring structures in building block <BB_1432>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1432>.
The molecule contains the following groups: Amine, Secondary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1432>.
**Token:** <BB_1432> **SMILES:** Cc1ccc(C)c(S(=O)(=O)NN)c1 **Molecular Formula:** C8H12N2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_1433>.
CC(C)(C)OC(=O)N1CCC(F)(F)C(C#N)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC(F)(F)C(C#N)C1
<BB_1433>