instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_1433>?
The molecular formula for <BB_1433> (CC(C)(C)OC(=O)N1CCC(F)(F)C(C#N)C1) is C11H16F2N2O2.
Describe the ring structures in building block <BB_1433>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1433>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1433>.
**Token:** <BB_1433> **SMILES:** CC(C)(C)OC(=O)N1CCC(F)(F)C(C#N)C1 **Molecular Formula:** C11H16F2N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1434>.
N#Cc1cc(Cl)ccc1Sc1ccc(N)cc1
What is the building block token for the following molecule?
N#Cc1cc(Cl)ccc1Sc1ccc(N)cc1
<BB_1434>
What is the molecular formula for <BB_1434>?
The molecular formula for <BB_1434> (N#Cc1cc(Cl)ccc1Sc1ccc(N)cc1) is C13H9ClN2S.
Describe the ring structures in building block <BB_1434>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1434>.
The molecule contains the following groups: Amine, Sulfide, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1434>.
**Token:** <BB_1434> **SMILES:** N#Cc1cc(Cl)ccc1Sc1ccc(N)cc1 **Molecular Formula:** C13H9ClN2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Sulfide, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1435>.
C#Cc1ccc(OCC(F)F)nc1
What is the building block token for the following molecule?
C#Cc1ccc(OCC(F)F)nc1
<BB_1435>
What is the molecular formula for <BB_1435>?
The molecular formula for <BB_1435> (C#Cc1ccc(OCC(F)F)nc1) is C9H7F2NO.
Describe the ring structures in building block <BB_1435>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1435>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1435>.
**Token:** <BB_1435> **SMILES:** C#Cc1ccc(OCC(F)F)nc1 **Molecular Formula:** C9H7F2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1436>.
C[C@@H](N)C(=O)NC1CCC1.Cl
What is the building block token for the following molecule?
C[C@@H](N)C(=O)NC1CCC1.Cl
<BB_1436>
What is the molecular formula for <BB_1436>?
The molecular formula for <BB_1436> (C[C@@H](N)C(=O)NC1CCC1.Cl) is C7H15ClN2O.
Describe the ring structures in building block <BB_1436>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1436>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1436>.
**Token:** <BB_1436> **SMILES:** C[C@@H](N)C(=O)NC1CCC1.Cl **Molecular Formula:** C7H15ClN2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1437>.
CCOC(=O)c1[nH]ncc1CCl
What is the building block token for the following molecule?
CCOC(=O)c1[nH]ncc1CCl
<BB_1437>
What is the molecular formula for <BB_1437>?
The molecular formula for <BB_1437> (CCOC(=O)c1[nH]ncc1CCl) is C7H9ClN2O2.
Describe the ring structures in building block <BB_1437>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1437>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1437>.
**Token:** <BB_1437> **SMILES:** CCOC(=O)c1[nH]ncc1CCl **Molecular Formula:** C7H9ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1438>.
CC(c1ccccc1)N1CCC(N)C1
What is the building block token for the following molecule?
CC(c1ccccc1)N1CCC(N)C1
<BB_1438>
What is the molecular formula for <BB_1438>?
The molecular formula for <BB_1438> (CC(c1ccccc1)N1CCC(N)C1) is C12H18N2.
Describe the ring structures in building block <BB_1438>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1438>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_1438>.
**Token:** <BB_1438> **SMILES:** CC(c1ccccc1)N1CCC(N)C1 **Molecular Formula:** C12H18N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_1439>.
Cc1cnc2c(c1)NCCO2
What is the building block token for the following molecule?
Cc1cnc2c(c1)NCCO2
<BB_1439>
What is the molecular formula for <BB_1439>?
The molecular formula for <BB_1439> (Cc1cnc2c(c1)NCCO2) is C8H10N2O.
Describe the ring structures in building block <BB_1439>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1439>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1439>.
**Token:** <BB_1439> **SMILES:** Cc1cnc2c(c1)NCCO2 **Molecular Formula:** C8H10N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_1440>.
CS(=O)(=O)c1ccc(F)c(C(F)(F)F)c1
What is the building block token for the following molecule?
CS(=O)(=O)c1ccc(F)c(C(F)(F)F)c1
<BB_1440>
What is the molecular formula for <BB_1440>?
The molecular formula for <BB_1440> (CS(=O)(=O)c1ccc(F)c(C(F)(F)F)c1) is C8H6F4O2S.
Describe the ring structures in building block <BB_1440>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1440>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1440>.
**Token:** <BB_1440> **SMILES:** CS(=O)(=O)c1ccc(F)c(C(F)(F)F)c1 **Molecular Formula:** C8H6F4O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1441>.
CC(N)c1ccc(Br)cc1
What is the building block token for the following molecule?
CC(N)c1ccc(Br)cc1
<BB_1441>
What is the molecular formula for <BB_1441>?
The molecular formula for <BB_1441> (CC(N)c1ccc(Br)cc1) is C8H10BrN.
Describe the ring structures in building block <BB_1441>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1441>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1441>.
**Token:** <BB_1441> **SMILES:** CC(N)c1ccc(Br)cc1 **Molecular Formula:** C8H10BrN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1442>.
CN(CC(=O)O)CC(C)(C)C.Cl
What is the building block token for the following molecule?
CN(CC(=O)O)CC(C)(C)C.Cl
<BB_1442>
What is the molecular formula for <BB_1442>?
The molecular formula for <BB_1442> (CN(CC(=O)O)CC(C)(C)C.Cl) is C8H18ClNO2.
Describe the ring structures in building block <BB_1442>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1442>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1442>.
**Token:** <BB_1442> **SMILES:** CN(CC(=O)O)CC(C)(C)C.Cl **Molecular Formula:** C8H18ClNO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1443>.
CC1(Nc2ccccc2N)CCCC1
What is the building block token for the following molecule?
CC1(Nc2ccccc2N)CCCC1
<BB_1443>
What is the molecular formula for <BB_1443>?
The molecular formula for <BB_1443> (CC1(Nc2ccccc2N)CCCC1) is C12H18N2.
Describe the ring structures in building block <BB_1443>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1443>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_1443>.
**Token:** <BB_1443> **SMILES:** CC1(Nc2ccccc2N)CCCC1 **Molecular Formula:** C12H18N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_1444>.
NCC1CCCN(S(=O)(=O)c2cn[nH]c2)C1
What is the building block token for the following molecule?
NCC1CCCN(S(=O)(=O)c2cn[nH]c2)C1
<BB_1444>
What is the molecular formula for <BB_1444>?
The molecular formula for <BB_1444> (NCC1CCCN(S(=O)(=O)c2cn[nH]c2)C1) is C9H16N4O2S.
Describe the ring structures in building block <BB_1444>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1444>.
The molecule contains the following groups: Amine, Tertiary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1444>.
**Token:** <BB_1444> **SMILES:** NCC1CCCN(S(=O)(=O)c2cn[nH]c2)C1 **Molecular Formula:** C9H16N4O2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_1445>.
Sc1nc(-c2ccccc2Cl)nc2ccccc12
What is the building block token for the following molecule?
Sc1nc(-c2ccccc2Cl)nc2ccccc12
<BB_1445>
What is the molecular formula for <BB_1445>?
The molecular formula for <BB_1445> (Sc1nc(-c2ccccc2Cl)nc2ccccc12) is C14H9ClN2S.
Describe the ring structures in building block <BB_1445>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1445>.
The molecule contains the following groups: Thiol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1445>.
**Token:** <BB_1445> **SMILES:** Sc1nc(-c2ccccc2Cl)nc2ccccc12 **Molecular Formula:** C14H9ClN2S **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Thiol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1446>.
Cc1c(Cl)c(C(F)F)nn1CC(=O)O
What is the building block token for the following molecule?
Cc1c(Cl)c(C(F)F)nn1CC(=O)O
<BB_1446>
What is the molecular formula for <BB_1446>?
The molecular formula for <BB_1446> (Cc1c(Cl)c(C(F)F)nn1CC(=O)O) is C7H7ClF2N2O2.
Describe the ring structures in building block <BB_1446>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1446>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1446>.
**Token:** <BB_1446> **SMILES:** Cc1c(Cl)c(C(F)F)nn1CC(=O)O **Molecular Formula:** C7H7ClF2N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1447>.
O=C(O)C1CCc2nnc(-c3ccc(O)cc3)n2C1
What is the building block token for the following molecule?
O=C(O)C1CCc2nnc(-c3ccc(O)cc3)n2C1
<BB_1447>
What is the molecular formula for <BB_1447>?
The molecular formula for <BB_1447> (O=C(O)C1CCc2nnc(-c3ccc(O)cc3)n2C1) is C13H13N3O3.
Describe the ring structures in building block <BB_1447>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1447>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1447>.
**Token:** <BB_1447> **SMILES:** O=C(O)C1CCc2nnc(-c3ccc(O)cc3)n2C1 **Molecular Formula:** C13H13N3O3 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1448>.
CN1C(=O)C[C@H](N)[C@H]1c1ccc(F)c(F)c1.Cl
What is the building block token for the following molecule?
CN1C(=O)C[C@H](N)[C@H]1c1ccc(F)c(F)c1.Cl
<BB_1448>
What is the molecular formula for <BB_1448>?
The molecular formula for <BB_1448> (CN1C(=O)C[C@H](N)[C@H]1c1ccc(F)c(F)c1.Cl) is C11H13ClF2N2O.
Describe the ring structures in building block <BB_1448>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1448>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1448>.
**Token:** <BB_1448> **SMILES:** CN1C(=O)C[C@H](N)[C@H]1c1ccc(F)c(F)c1.Cl **Molecular Formula:** C11H13ClF2N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1449>.
Cc1cc(Br)ccc1C(C)O
What is the building block token for the following molecule?
Cc1cc(Br)ccc1C(C)O
<BB_1449>
What is the molecular formula for <BB_1449>?
The molecular formula for <BB_1449> (Cc1cc(Br)ccc1C(C)O) is C9H11BrO.
Describe the ring structures in building block <BB_1449>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1449>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1449>.
**Token:** <BB_1449> **SMILES:** Cc1cc(Br)ccc1C(C)O **Molecular Formula:** C9H11BrO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)