instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_1450>.
Cl.NS(=O)(=O)c1cccc(C2CCNCC2)c1
What is the building block token for the following molecule?
Cl.NS(=O)(=O)c1cccc(C2CCNCC2)c1
<BB_1450>
What is the molecular formula for <BB_1450>?
The molecular formula for <BB_1450> (Cl.NS(=O)(=O)c1cccc(C2CCNCC2)c1) is C11H17ClN2O2S.
Describe the ring structures in building block <BB_1450>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1450>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1450>.
**Token:** <BB_1450> **SMILES:** Cl.NS(=O)(=O)c1cccc(C2CCNCC2)c1 **Molecular Formula:** C11H17ClN2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_1451>.
Cn1cc(C(N)=O)cn1
What is the building block token for the following molecule?
Cn1cc(C(N)=O)cn1
<BB_1451>
What is the molecular formula for <BB_1451>?
The molecular formula for <BB_1451> (Cn1cc(C(N)=O)cn1) is C5H7N3O.
Describe the ring structures in building block <BB_1451>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1451>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_1451>.
**Token:** <BB_1451> **SMILES:** Cn1cc(C(N)=O)cn1 **Molecular Formula:** C5H7N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_1452>.
CN(C[C@H]1C[C@H](O)C1)C(=O)OC(C)(C)C
What is the building block token for the following molecule?
CN(C[C@H]1C[C@H](O)C1)C(=O)OC(C)(C)C
<BB_1452>
What is the molecular formula for <BB_1452>?
The molecular formula for <BB_1452> (CN(C[C@H]1C[C@H](O)C1)C(=O)OC(C)(C)C) is C11H21NO3.
Describe the ring structures in building block <BB_1452>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1452>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1452>.
**Token:** <BB_1452> **SMILES:** CN(C[C@H]1C[C@H](O)C1)C(=O)OC(C)(C)C **Molecular Formula:** C11H21NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1453>.
Cl.Cl.O=C(O)c1ccn(C2CCNCC2)n1
What is the building block token for the following molecule?
Cl.Cl.O=C(O)c1ccn(C2CCNCC2)n1
<BB_1453>
What is the molecular formula for <BB_1453>?
The molecular formula for <BB_1453> (Cl.Cl.O=C(O)c1ccn(C2CCNCC2)n1) is C9H15Cl2N3O2.
Describe the ring structures in building block <BB_1453>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1453>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1453>.
**Token:** <BB_1453> **SMILES:** Cl.Cl.O=C(O)c1ccn(C2CCNCC2)n1 **Molecular Formula:** C9H15Cl2N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1454>.
CNCc1ccc2c(c1)OCO2
What is the building block token for the following molecule?
CNCc1ccc2c(c1)OCO2
<BB_1454>
What is the molecular formula for <BB_1454>?
The molecular formula for <BB_1454> (CNCc1ccc2c(c1)OCO2) is C9H11NO2.
Describe the ring structures in building block <BB_1454>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1454>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1454>.
**Token:** <BB_1454> **SMILES:** CNCc1ccc2c(c1)OCO2 **Molecular Formula:** C9H11NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_1455>.
O=C(CCl)Cc1ccccc1F
What is the building block token for the following molecule?
O=C(CCl)Cc1ccccc1F
<BB_1455>
What is the molecular formula for <BB_1455>?
The molecular formula for <BB_1455> (O=C(CCl)Cc1ccccc1F) is C9H8ClFO.
Describe the ring structures in building block <BB_1455>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1455>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1455>.
**Token:** <BB_1455> **SMILES:** O=C(CCl)Cc1ccccc1F **Molecular Formula:** C9H8ClFO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1456>.
O=C(O)c1ccc(Cl)cc1Br
What is the building block token for the following molecule?
O=C(O)c1ccc(Cl)cc1Br
<BB_1456>
What is the molecular formula for <BB_1456>?
The molecular formula for <BB_1456> (O=C(O)c1ccc(Cl)cc1Br) is C7H4BrClO2.
Describe the ring structures in building block <BB_1456>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1456>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1456>.
**Token:** <BB_1456> **SMILES:** O=C(O)c1ccc(Cl)cc1Br **Molecular Formula:** C7H4BrClO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1457>.
CC(C)(C)COC(=O)Cl
What is the building block token for the following molecule?
CC(C)(C)COC(=O)Cl
<BB_1457>
What is the molecular formula for <BB_1457>?
The molecular formula for <BB_1457> (CC(C)(C)COC(=O)Cl) is C6H11ClO2.
Describe the ring structures in building block <BB_1457>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1457>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1457>.
**Token:** <BB_1457> **SMILES:** CC(C)(C)COC(=O)Cl **Molecular Formula:** C6H11ClO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1458>.
Cl.NCc1cc(C(F)(F)F)c(=O)[nH]n1
What is the building block token for the following molecule?
Cl.NCc1cc(C(F)(F)F)c(=O)[nH]n1
<BB_1458>
What is the molecular formula for <BB_1458>?
The molecular formula for <BB_1458> (Cl.NCc1cc(C(F)(F)F)c(=O)[nH]n1) is C6H7ClF3N3O.
Describe the ring structures in building block <BB_1458>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1458>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1458>.
**Token:** <BB_1458> **SMILES:** Cl.NCc1cc(C(F)(F)F)c(=O)[nH]n1 **Molecular Formula:** C6H7ClF3N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1459>.
O=C(C(F)F)C(Cl)C(=O)C1CC1
What is the building block token for the following molecule?
O=C(C(F)F)C(Cl)C(=O)C1CC1
<BB_1459>
What is the molecular formula for <BB_1459>?
The molecular formula for <BB_1459> (O=C(C(F)F)C(Cl)C(=O)C1CC1) is C7H7ClF2O2.
Describe the ring structures in building block <BB_1459>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_1459>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1459>.
**Token:** <BB_1459> **SMILES:** O=C(C(F)F)C(Cl)C(=O)C1CC1 **Molecular Formula:** C7H7ClF2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1460>.
CCOC(=O)c1c(Br)cccc1CBr
What is the building block token for the following molecule?
CCOC(=O)c1c(Br)cccc1CBr
<BB_1460>
What is the molecular formula for <BB_1460>?
The molecular formula for <BB_1460> (CCOC(=O)c1c(Br)cccc1CBr) is C10H10Br2O2.
Describe the ring structures in building block <BB_1460>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1460>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1460>.
**Token:** <BB_1460> **SMILES:** CCOC(=O)c1c(Br)cccc1CBr **Molecular Formula:** C10H10Br2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1461>.
CCC1(CC)C(O)CC1OC
What is the building block token for the following molecule?
CCC1(CC)C(O)CC1OC
<BB_1461>
What is the molecular formula for <BB_1461>?
The molecular formula for <BB_1461> (CCC1(CC)C(O)CC1OC) is C9H18O2.
Describe the ring structures in building block <BB_1461>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1461>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1461>.
**Token:** <BB_1461> **SMILES:** CCC1(CC)C(O)CC1OC **Molecular Formula:** C9H18O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1462>.
C[Si](C)(C)C#Cc1cc(Cl)nnc1Cl
What is the building block token for the following molecule?
C[Si](C)(C)C#Cc1cc(Cl)nnc1Cl
<BB_1462>
What is the molecular formula for <BB_1462>?
The molecular formula for <BB_1462> (C[Si](C)(C)C#Cc1cc(Cl)nnc1Cl) is C9H10Cl2N2Si.
Describe the ring structures in building block <BB_1462>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1462>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1462>.
**Token:** <BB_1462> **SMILES:** C[Si](C)(C)C#Cc1cc(Cl)nnc1Cl **Molecular Formula:** C9H10Cl2N2Si **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1463>.
O=C1CC(CCl)(CCl)C12CCC2
What is the building block token for the following molecule?
O=C1CC(CCl)(CCl)C12CCC2
<BB_1463>
What is the molecular formula for <BB_1463>?
The molecular formula for <BB_1463> (O=C1CC(CCl)(CCl)C12CCC2) is C9H12Cl2O.
Describe the ring structures in building block <BB_1463>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1463>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1463>.
**Token:** <BB_1463> **SMILES:** O=C1CC(CCl)(CCl)C12CCC2 **Molecular Formula:** C9H12Cl2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1464>.
O=C(c1ccccc1Cl)C(F)F
What is the building block token for the following molecule?
O=C(c1ccccc1Cl)C(F)F
<BB_1464>
What is the molecular formula for <BB_1464>?
The molecular formula for <BB_1464> (O=C(c1ccccc1Cl)C(F)F) is C8H5ClF2O.
Describe the ring structures in building block <BB_1464>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1464>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1464>.
**Token:** <BB_1464> **SMILES:** O=C(c1ccccc1Cl)C(F)F **Molecular Formula:** C8H5ClF2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1465>.
O=C[C@@H]1C[C@H]1c1ccccc1
What is the building block token for the following molecule?
O=C[C@@H]1C[C@H]1c1ccccc1
<BB_1465>
What is the molecular formula for <BB_1465>?
The molecular formula for <BB_1465> (O=C[C@@H]1C[C@H]1c1ccccc1) is C10H10O.
Describe the ring structures in building block <BB_1465>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6.
List the primary functional groups present in <BB_1465>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_1465>.
**Token:** <BB_1465> **SMILES:** O=C[C@@H]1C[C@H]1c1ccccc1 **Molecular Formula:** C10H10O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_1466>.
CC1(C)OB(C=C2CCSC2)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(C=C2CCSC2)OC1(C)C
<BB_1466>
What is the molecular formula for <BB_1466>?
The molecular formula for <BB_1466> (CC1(C)OB(C=C2CCSC2)OC1(C)C) is C11H19BO2S.
Describe the ring structures in building block <BB_1466>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.