instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_1466>.
The molecule contains the following groups: Sulfide.
Provide a comprehensive chemical profile for the building block <BB_1466>.
**Token:** <BB_1466> **SMILES:** CC1(C)OB(C=C2CCSC2)OC1(C)C **Molecular Formula:** C11H19BO2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Sulfide
Provide the SMILES representation for the building block token <BB_1467>.
CC(C)(C)OC(=O)N[C@]12CC[C@](F)(C1)NC2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N[C@]12CC[C@](F)(C1)NC2
<BB_1467>
What is the molecular formula for <BB_1467>?
The molecular formula for <BB_1467> (CC(C)(C)OC(=O)N[C@]12CC[C@](F)(C1)NC2) is C11H19FN2O2.
Describe the ring structures in building block <BB_1467>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1467>.
The molecule contains the following groups: Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1467>.
**Token:** <BB_1467> **SMILES:** CC(C)(C)OC(=O)N[C@]12CC[C@](F)(C1)NC2 **Molecular Formula:** C11H19FN2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1468>.
C=C(C)B(O)O
What is the building block token for the following molecule?
C=C(C)B(O)O
<BB_1468>
What is the molecular formula for <BB_1468>?
The molecular formula for <BB_1468> (C=C(C)B(O)O) is C3H7BO2.
Describe the ring structures in building block <BB_1468>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1468>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1468>.
**Token:** <BB_1468> **SMILES:** C=C(C)B(O)O **Molecular Formula:** C3H7BO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1469>.
OCCCC(O)C(F)(F)F
What is the building block token for the following molecule?
OCCCC(O)C(F)(F)F
<BB_1469>
What is the molecular formula for <BB_1469>?
The molecular formula for <BB_1469> (OCCCC(O)C(F)(F)F) is C5H9F3O2.
Describe the ring structures in building block <BB_1469>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1469>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1469>.
**Token:** <BB_1469> **SMILES:** OCCCC(O)C(F)(F)F **Molecular Formula:** C5H9F3O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1470>.
N[C@H](Cc1ccccc1Br)C(=O)O
What is the building block token for the following molecule?
N[C@H](Cc1ccccc1Br)C(=O)O
<BB_1470>
What is the molecular formula for <BB_1470>?
The molecular formula for <BB_1470> (N[C@H](Cc1ccccc1Br)C(=O)O) is C9H10BrNO2.
Describe the ring structures in building block <BB_1470>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1470>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1470>.
**Token:** <BB_1470> **SMILES:** N[C@H](Cc1ccccc1Br)C(=O)O **Molecular Formula:** C9H10BrNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1471>.
Cc1ccc(S)c(C)c1
What is the building block token for the following molecule?
Cc1ccc(S)c(C)c1
<BB_1471>
What is the molecular formula for <BB_1471>?
The molecular formula for <BB_1471> (Cc1ccc(S)c(C)c1) is C8H10S.
Describe the ring structures in building block <BB_1471>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1471>.
The molecule contains the following groups: Thiol.
Provide a comprehensive chemical profile for the building block <BB_1471>.
**Token:** <BB_1471> **SMILES:** Cc1ccc(S)c(C)c1 **Molecular Formula:** C8H10S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Thiol
Provide the SMILES representation for the building block token <BB_1472>.
Cl.OC1COCC2(CCNCC2)OC1
What is the building block token for the following molecule?
Cl.OC1COCC2(CCNCC2)OC1
<BB_1472>
What is the molecular formula for <BB_1472>?
The molecular formula for <BB_1472> (Cl.OC1COCC2(CCNCC2)OC1) is C9H18ClNO3.
Describe the ring structures in building block <BB_1472>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1472>.
The molecule contains the following groups: Secondary Amine, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1472>.
**Token:** <BB_1472> **SMILES:** Cl.OC1COCC2(CCNCC2)OC1 **Molecular Formula:** C9H18ClNO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1473>.
Nc1cnncc1Br
What is the building block token for the following molecule?
Nc1cnncc1Br
<BB_1473>
What is the molecular formula for <BB_1473>?
The molecular formula for <BB_1473> (Nc1cnncc1Br) is C4H4BrN3.
Describe the ring structures in building block <BB_1473>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1473>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1473>.
**Token:** <BB_1473> **SMILES:** Nc1cnncc1Br **Molecular Formula:** C4H4BrN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1474>.
Cc1noc2cc(N)ccc12.Cl
What is the building block token for the following molecule?
Cc1noc2cc(N)ccc12.Cl
<BB_1474>
What is the molecular formula for <BB_1474>?
The molecular formula for <BB_1474> (Cc1noc2cc(N)ccc12.Cl) is C8H9ClN2O.
Describe the ring structures in building block <BB_1474>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1474>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1474>.
**Token:** <BB_1474> **SMILES:** Cc1noc2cc(N)ccc12.Cl **Molecular Formula:** C8H9ClN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1475>.
CN(C)C1CCN(C(=O)CC#N)CC1
What is the building block token for the following molecule?
CN(C)C1CCN(C(=O)CC#N)CC1
<BB_1475>
What is the molecular formula for <BB_1475>?
The molecular formula for <BB_1475> (CN(C)C1CCN(C(=O)CC#N)CC1) is C10H17N3O.
Describe the ring structures in building block <BB_1475>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1475>.
The molecule contains the following groups: Tertiary Amine, Amide, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1475>.
**Token:** <BB_1475> **SMILES:** CN(C)C1CCN(C(=O)CC#N)CC1 **Molecular Formula:** C10H17N3O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide, Nitrile
Provide the SMILES representation for the building block token <BB_1476>.
N#CCc1cccc(Cl)c1F
What is the building block token for the following molecule?
N#CCc1cccc(Cl)c1F
<BB_1476>
What is the molecular formula for <BB_1476>?
The molecular formula for <BB_1476> (N#CCc1cccc(Cl)c1F) is C8H5ClFN.
Describe the ring structures in building block <BB_1476>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1476>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1476>.
**Token:** <BB_1476> **SMILES:** N#CCc1cccc(Cl)c1F **Molecular Formula:** C8H5ClFN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1477>.
COC(=O)C1(C)CO1
What is the building block token for the following molecule?
COC(=O)C1(C)CO1
<BB_1477>
What is the molecular formula for <BB_1477>?
The molecular formula for <BB_1477> (COC(=O)C1(C)CO1) is C5H8O3.
Describe the ring structures in building block <BB_1477>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_1477>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1477>.
**Token:** <BB_1477> **SMILES:** COC(=O)C1(C)CO1 **Molecular Formula:** C5H8O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_1478>.
N=c1c2ccccc2nc2n1CCCCC2
What is the building block token for the following molecule?
N=c1c2ccccc2nc2n1CCCCC2
<BB_1478>
What is the molecular formula for <BB_1478>?
The molecular formula for <BB_1478> (N=c1c2ccccc2nc2n1CCCCC2) is C13H15N3.
Describe the ring structures in building block <BB_1478>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 7.
List the primary functional groups present in <BB_1478>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1478>.
**Token:** <BB_1478> **SMILES:** N=c1c2ccccc2nc2n1CCCCC2 **Molecular Formula:** C13H15N3 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 7. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1479>.
Cc1cc(Br)nc(N)n1
What is the building block token for the following molecule?
Cc1cc(Br)nc(N)n1
<BB_1479>
What is the molecular formula for <BB_1479>?
The molecular formula for <BB_1479> (Cc1cc(Br)nc(N)n1) is C5H6BrN3.
Describe the ring structures in building block <BB_1479>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1479>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1479>.
**Token:** <BB_1479> **SMILES:** Cc1cc(Br)nc(N)n1 **Molecular Formula:** C5H6BrN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1480>.
Cc1cc(N)cc(N2CCN(C(C)C)CC2)c1
What is the building block token for the following molecule?
Cc1cc(N)cc(N2CCN(C(C)C)CC2)c1
<BB_1480>
What is the molecular formula for <BB_1480>?
The molecular formula for <BB_1480> (Cc1cc(N)cc(N2CCN(C(C)C)CC2)c1) is C14H23N3.
Describe the ring structures in building block <BB_1480>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1480>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_1480>.
**Token:** <BB_1480> **SMILES:** Cc1cc(N)cc(N2CCN(C(C)C)CC2)c1 **Molecular Formula:** C14H23N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_1481>.
COC(=O)c1ccc(CO)nc1
What is the building block token for the following molecule?
COC(=O)c1ccc(CO)nc1
<BB_1481>
What is the molecular formula for <BB_1481>?
The molecular formula for <BB_1481> (COC(=O)c1ccc(CO)nc1) is C8H9NO3.
Describe the ring structures in building block <BB_1481>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1481>.
The molecule contains the following groups: Ester, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1481>.
**Token:** <BB_1481> **SMILES:** COC(=O)c1ccc(CO)nc1 **Molecular Formula:** C8H9NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1482>.
COc1ccc(OS(=O)(=O)c2ccc(C)cc2)cc1
What is the building block token for the following molecule?
COc1ccc(OS(=O)(=O)c2ccc(C)cc2)cc1
<BB_1482>
What is the molecular formula for <BB_1482>?
The molecular formula for <BB_1482> (COc1ccc(OS(=O)(=O)c2ccc(C)cc2)cc1) is C14H14O4S.
Describe the ring structures in building block <BB_1482>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1482>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_1482>.
**Token:** <BB_1482> **SMILES:** COc1ccc(OS(=O)(=O)c2ccc(C)cc2)cc1 **Molecular Formula:** C14H14O4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_1483>.
Cl.c1ccc2c(c1)CC(C1CC1)N2
What is the building block token for the following molecule?
Cl.c1ccc2c(c1)CC(C1CC1)N2
<BB_1483>