instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_1483>?
The molecular formula for <BB_1483> (Cl.c1ccc2c(c1)CC(C1CC1)N2) is C11H14ClN.
Describe the ring structures in building block <BB_1483>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1483>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1483>.
**Token:** <BB_1483> **SMILES:** Cl.c1ccc2c(c1)CC(C1CC1)N2 **Molecular Formula:** C11H14ClN **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1484>.
Cl.N#Cc1c(N)cccc1OC(F)(F)F
What is the building block token for the following molecule?
Cl.N#Cc1c(N)cccc1OC(F)(F)F
<BB_1484>
What is the molecular formula for <BB_1484>?
The molecular formula for <BB_1484> (Cl.N#Cc1c(N)cccc1OC(F)(F)F) is C8H6ClF3N2O.
Describe the ring structures in building block <BB_1484>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1484>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1484>.
**Token:** <BB_1484> **SMILES:** Cl.N#Cc1c(N)cccc1OC(F)(F)F **Molecular Formula:** C8H6ClF3N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1485>.
O=C1OC(=O)[C@@H]2CCC[C@H]12
What is the building block token for the following molecule?
O=C1OC(=O)[C@@H]2CCC[C@H]12
<BB_1485>
What is the molecular formula for <BB_1485>?
The molecular formula for <BB_1485> (O=C1OC(=O)[C@@H]2CCC[C@H]12) is C7H8O3.
Describe the ring structures in building block <BB_1485>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1485>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1485>.
**Token:** <BB_1485> **SMILES:** O=C1OC(=O)[C@@H]2CCC[C@H]12 **Molecular Formula:** C7H8O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_1486>.
CCOC(=O)COc1cc(C(F)(F)F)nn1C
What is the building block token for the following molecule?
CCOC(=O)COc1cc(C(F)(F)F)nn1C
<BB_1486>
What is the molecular formula for <BB_1486>?
The molecular formula for <BB_1486> (CCOC(=O)COc1cc(C(F)(F)F)nn1C) is C9H11F3N2O3.
Describe the ring structures in building block <BB_1486>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1486>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1486>.
**Token:** <BB_1486> **SMILES:** CCOC(=O)COc1cc(C(F)(F)F)nn1C **Molecular Formula:** C9H11F3N2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1487>.
COCCc1noc(CN)n1.Cl
What is the building block token for the following molecule?
COCCc1noc(CN)n1.Cl
<BB_1487>
What is the molecular formula for <BB_1487>?
The molecular formula for <BB_1487> (COCCc1noc(CN)n1.Cl) is C6H12ClN3O2.
Describe the ring structures in building block <BB_1487>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1487>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1487>.
**Token:** <BB_1487> **SMILES:** COCCc1noc(CN)n1.Cl **Molecular Formula:** C6H12ClN3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1488>.
Cn1nc(C(F)F)nc1C(=O)[O-].[Li+]
What is the building block token for the following molecule?
Cn1nc(C(F)F)nc1C(=O)[O-].[Li+]
<BB_1488>
What is the molecular formula for <BB_1488>?
The molecular formula for <BB_1488> (Cn1nc(C(F)F)nc1C(=O)[O-].[Li+]) is C5H4F2LiN3O2.
Describe the ring structures in building block <BB_1488>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1488>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1488>.
**Token:** <BB_1488> **SMILES:** Cn1nc(C(F)F)nc1C(=O)[O-].[Li+] **Molecular Formula:** C5H4F2LiN3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1489>.
O=C1CCN(C2CC2)CC1
What is the building block token for the following molecule?
O=C1CCN(C2CC2)CC1
<BB_1489>
What is the molecular formula for <BB_1489>?
The molecular formula for <BB_1489> (O=C1CCN(C2CC2)CC1) is C8H13NO.
Describe the ring structures in building block <BB_1489>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1489>.
The molecule contains the following groups: Tertiary Amine, Ketone.
Provide a comprehensive chemical profile for the building block <BB_1489>.
**Token:** <BB_1489> **SMILES:** O=C1CCN(C2CC2)CC1 **Molecular Formula:** C8H13NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Tertiary Amine, Ketone
Provide the SMILES representation for the building block token <BB_1490>.
Cn1ccc2cc(S(=O)(=O)Cl)cnc21
What is the building block token for the following molecule?
Cn1ccc2cc(S(=O)(=O)Cl)cnc21
<BB_1490>
What is the molecular formula for <BB_1490>?
The molecular formula for <BB_1490> (Cn1ccc2cc(S(=O)(=O)Cl)cnc21) is C8H7ClN2O2S.
Describe the ring structures in building block <BB_1490>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1490>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1490>.
**Token:** <BB_1490> **SMILES:** Cn1ccc2cc(S(=O)(=O)Cl)cnc21 **Molecular Formula:** C8H7ClN2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1491>.
Br.CS(=O)(=O)SCCN
What is the building block token for the following molecule?
Br.CS(=O)(=O)SCCN
<BB_1491>
What is the molecular formula for <BB_1491>?
The molecular formula for <BB_1491> (Br.CS(=O)(=O)SCCN) is C3H10BrNO2S2.
Describe the ring structures in building block <BB_1491>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1491>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1491>.
**Token:** <BB_1491> **SMILES:** Br.CS(=O)(=O)SCCN **Molecular Formula:** C3H10BrNO2S2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1492>.
CC1(C)C2C(=O)N(c3ccc(Br)cc3N)C(=O)C21
What is the building block token for the following molecule?
CC1(C)C2C(=O)N(c3ccc(Br)cc3N)C(=O)C21
<BB_1492>
What is the molecular formula for <BB_1492>?
The molecular formula for <BB_1492> (CC1(C)C2C(=O)N(c3ccc(Br)cc3N)C(=O)C21) is C13H13BrN2O2.
Describe the ring structures in building block <BB_1492>.
The molecule contains 3 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1492>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1492>.
**Token:** <BB_1492> **SMILES:** CC1(C)C2C(=O)N(c3ccc(Br)cc3N)C(=O)C21 **Molecular Formula:** C13H13BrN2O2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1493>.
O=C(c1ccccc1)c1cccc(Br)n1
What is the building block token for the following molecule?
O=C(c1ccccc1)c1cccc(Br)n1
<BB_1493>
What is the molecular formula for <BB_1493>?
The molecular formula for <BB_1493> (O=C(c1ccccc1)c1cccc(Br)n1) is C12H8BrNO.
Describe the ring structures in building block <BB_1493>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1493>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1493>.
**Token:** <BB_1493> **SMILES:** O=C(c1ccccc1)c1cccc(Br)n1 **Molecular Formula:** C12H8BrNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1494>.
CCOC(=O)CC1(O)COC1
What is the building block token for the following molecule?
CCOC(=O)CC1(O)COC1
<BB_1494>
What is the molecular formula for <BB_1494>?
The molecular formula for <BB_1494> (CCOC(=O)CC1(O)COC1) is C7H12O4.
Describe the ring structures in building block <BB_1494>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1494>.
The molecule contains the following groups: Ester, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1494>.
**Token:** <BB_1494> **SMILES:** CCOC(=O)CC1(O)COC1 **Molecular Formula:** C7H12O4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Ester, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1495>.
CC(C)(C)c1ncncc1C(=O)O
What is the building block token for the following molecule?
CC(C)(C)c1ncncc1C(=O)O
<BB_1495>
What is the molecular formula for <BB_1495>?
The molecular formula for <BB_1495> (CC(C)(C)c1ncncc1C(=O)O) is C9H12N2O2.
Describe the ring structures in building block <BB_1495>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1495>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1495>.
**Token:** <BB_1495> **SMILES:** CC(C)(C)c1ncncc1C(=O)O **Molecular Formula:** C9H12N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1496>.
CC(C)(C)OC(=O)N1CCCC[C@]12C[C@H](C(=O)O)C2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCCC[C@]12C[C@H](C(=O)O)C2
<BB_1496>
What is the molecular formula for <BB_1496>?
The molecular formula for <BB_1496> (CC(C)(C)OC(=O)N1CCCC[C@]12C[C@H](C(=O)O)C2) is C14H23NO4.
Describe the ring structures in building block <BB_1496>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1496>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1496>.
**Token:** <BB_1496> **SMILES:** CC(C)(C)OC(=O)N1CCCC[C@]12C[C@H](C(=O)O)C2 **Molecular Formula:** C14H23NO4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_1497>.
CNCCC(C)(C)c1ccccc1.Cl
What is the building block token for the following molecule?
CNCCC(C)(C)c1ccccc1.Cl
<BB_1497>
What is the molecular formula for <BB_1497>?
The molecular formula for <BB_1497> (CNCCC(C)(C)c1ccccc1.Cl) is C12H20ClN.
Describe the ring structures in building block <BB_1497>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1497>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1497>.
**Token:** <BB_1497> **SMILES:** CNCCC(C)(C)c1ccccc1.Cl **Molecular Formula:** C12H20ClN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1498>.
CC(C)(C)OC(=O)N1CCC(n2ccc(Br)n2)CC1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC(n2ccc(Br)n2)CC1
<BB_1498>
What is the molecular formula for <BB_1498>?
The molecular formula for <BB_1498> (CC(C)(C)OC(=O)N1CCC(n2ccc(Br)n2)CC1) is C13H20BrN3O2.
Describe the ring structures in building block <BB_1498>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1498>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1498>.
**Token:** <BB_1498> **SMILES:** CC(C)(C)OC(=O)N1CCC(n2ccc(Br)n2)CC1 **Molecular Formula:** C13H20BrN3O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1499>.
CNC1CCCN(Cc2noc(C3CC3)n2)C1.Cl
What is the building block token for the following molecule?
CNC1CCCN(Cc2noc(C3CC3)n2)C1.Cl
<BB_1499>
What is the molecular formula for <BB_1499>?
The molecular formula for <BB_1499> (CNC1CCCN(Cc2noc(C3CC3)n2)C1.Cl) is C12H21ClN4O.
Describe the ring structures in building block <BB_1499>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1499>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1499>.
**Token:** <BB_1499> **SMILES:** CNC1CCCN(Cc2noc(C3CC3)n2)C1.Cl **Molecular Formula:** C12H21ClN4O **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)