instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_1500>.
CCC(c1nnc(S)n1Cc1ccccc1)N(C)C
What is the building block token for the following molecule?
CCC(c1nnc(S)n1Cc1ccccc1)N(C)C
<BB_1500>
What is the molecular formula for <BB_1500>?
The molecular formula for <BB_1500> (CCC(c1nnc(S)n1Cc1ccccc1)N(C)C) is C14H20N4S.
Describe the ring structures in building block <BB_1500>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1500>.
The molecule contains the following groups: Tertiary Amine, Thiol.
Provide a comprehensive chemical profile for the building block <BB_1500>.
**Token:** <BB_1500> **SMILES:** CCC(c1nnc(S)n1Cc1ccccc1)N(C)C **Molecular Formula:** C14H20N4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Thiol
Provide the SMILES representation for the building block token <BB_1501>.
O=c1ccc2c(Br)ccc(F)c2[nH]1
What is the building block token for the following molecule?
O=c1ccc2c(Br)ccc(F)c2[nH]1
<BB_1501>
What is the molecular formula for <BB_1501>?
The molecular formula for <BB_1501> (O=c1ccc2c(Br)ccc(F)c2[nH]1) is C9H5BrFNO.
Describe the ring structures in building block <BB_1501>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1501>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1501>.
**Token:** <BB_1501> **SMILES:** O=c1ccc2c(Br)ccc(F)c2[nH]1 **Molecular Formula:** C9H5BrFNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1502>.
Cn1ccnc1S(C)(=N)=O
What is the building block token for the following molecule?
Cn1ccnc1S(C)(=N)=O
<BB_1502>
What is the molecular formula for <BB_1502>?
The molecular formula for <BB_1502> (Cn1ccnc1S(C)(=N)=O) is C5H9N3OS.
Describe the ring structures in building block <BB_1502>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1502>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1502>.
**Token:** <BB_1502> **SMILES:** Cn1ccnc1S(C)(=N)=O **Molecular Formula:** C5H9N3OS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1503>.
O=C([O-])c1cnc(C(F)F)o1.[Li+]
What is the building block token for the following molecule?
O=C([O-])c1cnc(C(F)F)o1.[Li+]
<BB_1503>
What is the molecular formula for <BB_1503>?
The molecular formula for <BB_1503> (O=C([O-])c1cnc(C(F)F)o1.[Li+]) is C5H2F2LiNO3.
Describe the ring structures in building block <BB_1503>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1503>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1503>.
**Token:** <BB_1503> **SMILES:** O=C([O-])c1cnc(C(F)F)o1.[Li+] **Molecular Formula:** C5H2F2LiNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1504>.
Cc1nc2cc(F)ccc2s1
What is the building block token for the following molecule?
Cc1nc2cc(F)ccc2s1
<BB_1504>
What is the molecular formula for <BB_1504>?
The molecular formula for <BB_1504> (Cc1nc2cc(F)ccc2s1) is C8H6FNS.
Describe the ring structures in building block <BB_1504>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1504>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1504>.
**Token:** <BB_1504> **SMILES:** Cc1nc2cc(F)ccc2s1 **Molecular Formula:** C8H6FNS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1505>.
Cl.NCc1cccc(OC(F)F)c1F
What is the building block token for the following molecule?
Cl.NCc1cccc(OC(F)F)c1F
<BB_1505>
What is the molecular formula for <BB_1505>?
The molecular formula for <BB_1505> (Cl.NCc1cccc(OC(F)F)c1F) is C8H9ClF3NO.
Describe the ring structures in building block <BB_1505>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1505>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1505>.
**Token:** <BB_1505> **SMILES:** Cl.NCc1cccc(OC(F)F)c1F **Molecular Formula:** C8H9ClF3NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1506>.
Cc1nc(-c2ccccc2)oc1CN
What is the building block token for the following molecule?
Cc1nc(-c2ccccc2)oc1CN
<BB_1506>
What is the molecular formula for <BB_1506>?
The molecular formula for <BB_1506> (Cc1nc(-c2ccccc2)oc1CN) is C11H12N2O.
Describe the ring structures in building block <BB_1506>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1506>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1506>.
**Token:** <BB_1506> **SMILES:** Cc1nc(-c2ccccc2)oc1CN **Molecular Formula:** C11H12N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1507>.
CCNc1ccc(C)c(C)c1.Cl
What is the building block token for the following molecule?
CCNc1ccc(C)c(C)c1.Cl
<BB_1507>
What is the molecular formula for <BB_1507>?
The molecular formula for <BB_1507> (CCNc1ccc(C)c(C)c1.Cl) is C10H16ClN.
Describe the ring structures in building block <BB_1507>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1507>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1507>.
**Token:** <BB_1507> **SMILES:** CCNc1ccc(C)c(C)c1.Cl **Molecular Formula:** C10H16ClN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1508>.
Cl.Cl.Cn1c(CCN)nc2cc(Cl)ccc21
What is the building block token for the following molecule?
Cl.Cl.Cn1c(CCN)nc2cc(Cl)ccc21
<BB_1508>
What is the molecular formula for <BB_1508>?
The molecular formula for <BB_1508> (Cl.Cl.Cn1c(CCN)nc2cc(Cl)ccc21) is C10H14Cl3N3.
Describe the ring structures in building block <BB_1508>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1508>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1508>.
**Token:** <BB_1508> **SMILES:** Cl.Cl.Cn1c(CCN)nc2cc(Cl)ccc21 **Molecular Formula:** C10H14Cl3N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1509>.
Nc1c(Cl)cc(Cl)cc1C(=O)O
What is the building block token for the following molecule?
Nc1c(Cl)cc(Cl)cc1C(=O)O
<BB_1509>
What is the molecular formula for <BB_1509>?
The molecular formula for <BB_1509> (Nc1c(Cl)cc(Cl)cc1C(=O)O) is C7H5Cl2NO2.
Describe the ring structures in building block <BB_1509>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1509>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1509>.
**Token:** <BB_1509> **SMILES:** Nc1c(Cl)cc(Cl)cc1C(=O)O **Molecular Formula:** C7H5Cl2NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1510>.
OB(O)c1c(Cl)ccc(F)c1F
What is the building block token for the following molecule?
OB(O)c1c(Cl)ccc(F)c1F
<BB_1510>
What is the molecular formula for <BB_1510>?
The molecular formula for <BB_1510> (OB(O)c1c(Cl)ccc(F)c1F) is C6H4BClF2O2.
Describe the ring structures in building block <BB_1510>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1510>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1510>.
**Token:** <BB_1510> **SMILES:** OB(O)c1c(Cl)ccc(F)c1F **Molecular Formula:** C6H4BClF2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1511>.
CCN1CCN(c2ccc([N+](=O)[O-])nc2)CC1
What is the building block token for the following molecule?
CCN1CCN(c2ccc([N+](=O)[O-])nc2)CC1
<BB_1511>
What is the molecular formula for <BB_1511>?
The molecular formula for <BB_1511> (CCN1CCN(c2ccc([N+](=O)[O-])nc2)CC1) is C11H16N4O2.
Describe the ring structures in building block <BB_1511>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1511>.
The molecule contains the following groups: Tertiary Amine, Nitro.
Provide a comprehensive chemical profile for the building block <BB_1511>.
**Token:** <BB_1511> **SMILES:** CCN1CCN(c2ccc([N+](=O)[O-])nc2)CC1 **Molecular Formula:** C11H16N4O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Nitro
Provide the SMILES representation for the building block token <BB_1512>.
[N-]=[N+]=Nc1cc(Br)ccn1
What is the building block token for the following molecule?
[N-]=[N+]=Nc1cc(Br)ccn1
<BB_1512>
What is the molecular formula for <BB_1512>?
The molecular formula for <BB_1512> ([N-]=[N+]=Nc1cc(Br)ccn1) is C5H3BrN4.
Describe the ring structures in building block <BB_1512>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1512>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1512>.
**Token:** <BB_1512> **SMILES:** [N-]=[N+]=Nc1cc(Br)ccn1 **Molecular Formula:** C5H3BrN4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1513>.
O=S1(=O)OCC2(CCC2)CO1
What is the building block token for the following molecule?
O=S1(=O)OCC2(CCC2)CO1
<BB_1513>
What is the molecular formula for <BB_1513>?
The molecular formula for <BB_1513> (O=S1(=O)OCC2(CCC2)CO1) is C6H10O4S.
Describe the ring structures in building block <BB_1513>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1513>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1513>.
**Token:** <BB_1513> **SMILES:** O=S1(=O)OCC2(CCC2)CO1 **Molecular Formula:** C6H10O4S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1514>.
COc1cc(CCl)cnc1Cl
What is the building block token for the following molecule?
COc1cc(CCl)cnc1Cl
<BB_1514>
What is the molecular formula for <BB_1514>?
The molecular formula for <BB_1514> (COc1cc(CCl)cnc1Cl) is C7H7Cl2NO.
Describe the ring structures in building block <BB_1514>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1514>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1514>.
**Token:** <BB_1514> **SMILES:** COc1cc(CCl)cnc1Cl **Molecular Formula:** C7H7Cl2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1515>.
CO[C@@H](C)CC(=O)O
What is the building block token for the following molecule?
CO[C@@H](C)CC(=O)O
<BB_1515>
What is the molecular formula for <BB_1515>?
The molecular formula for <BB_1515> (CO[C@@H](C)CC(=O)O) is C5H10O3.
Describe the ring structures in building block <BB_1515>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1515>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_1515>.
**Token:** <BB_1515> **SMILES:** CO[C@@H](C)CC(=O)O **Molecular Formula:** C5H10O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_1516>.
CC(C)c1ccccc1B(O)O
What is the building block token for the following molecule?
CC(C)c1ccccc1B(O)O
<BB_1516>
What is the molecular formula for <BB_1516>?
The molecular formula for <BB_1516> (CC(C)c1ccccc1B(O)O) is C9H13BO2.
Describe the ring structures in building block <BB_1516>.
The molecule contains 1 ring(s): an aromatic ring of size 6.