instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_1516>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1516>.
**Token:** <BB_1516> **SMILES:** CC(C)c1ccccc1B(O)O **Molecular Formula:** C9H13BO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1517>.
Cl.Cl.NCc1cc(Cl)c(Cl)cn1
What is the building block token for the following molecule?
Cl.Cl.NCc1cc(Cl)c(Cl)cn1
<BB_1517>
What is the molecular formula for <BB_1517>?
The molecular formula for <BB_1517> (Cl.Cl.NCc1cc(Cl)c(Cl)cn1) is C6H8Cl4N2.
Describe the ring structures in building block <BB_1517>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1517>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1517>.
**Token:** <BB_1517> **SMILES:** Cl.Cl.NCc1cc(Cl)c(Cl)cn1 **Molecular Formula:** C6H8Cl4N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1518>.
CC(C)(C)OC(=O)N1[C@H]2CC[C@H]2[C@H](Cl)S1=O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1[C@H]2CC[C@H]2[C@H](Cl)S1=O
<BB_1518>
What is the molecular formula for <BB_1518>?
The molecular formula for <BB_1518> (CC(C)(C)OC(=O)N1[C@H]2CC[C@H]2[C@H](Cl)S1=O) is C10H16ClNO3S.
Describe the ring structures in building block <BB_1518>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1518>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1518>.
**Token:** <BB_1518> **SMILES:** CC(C)(C)OC(=O)N1[C@H]2CC[C@H]2[C@H](Cl)S1=O **Molecular Formula:** C10H16ClNO3S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1519>.
CC(=O)N(c1nc(CCl)cs1)c1ccc(C)cc1C
What is the building block token for the following molecule?
CC(=O)N(c1nc(CCl)cs1)c1ccc(C)cc1C
<BB_1519>
What is the molecular formula for <BB_1519>?
The molecular formula for <BB_1519> (CC(=O)N(c1nc(CCl)cs1)c1ccc(C)cc1C) is C14H15ClN2OS.
Describe the ring structures in building block <BB_1519>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1519>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1519>.
**Token:** <BB_1519> **SMILES:** CC(=O)N(c1nc(CCl)cs1)c1ccc(C)cc1C **Molecular Formula:** C14H15ClN2OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1520>.
CNC(C)(C)CC(=O)OC
What is the building block token for the following molecule?
CNC(C)(C)CC(=O)OC
<BB_1520>
What is the molecular formula for <BB_1520>?
The molecular formula for <BB_1520> (CNC(C)(C)CC(=O)OC) is C7H15NO2.
Describe the ring structures in building block <BB_1520>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1520>.
The molecule contains the following groups: Secondary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1520>.
**Token:** <BB_1520> **SMILES:** CNC(C)(C)CC(=O)OC **Molecular Formula:** C7H15NO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_1521>.
Nc1nccc2ccccc12
What is the building block token for the following molecule?
Nc1nccc2ccccc12
<BB_1521>
What is the molecular formula for <BB_1521>?
The molecular formula for <BB_1521> (Nc1nccc2ccccc12) is C9H8N2.
Describe the ring structures in building block <BB_1521>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1521>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1521>.
**Token:** <BB_1521> **SMILES:** Nc1nccc2ccccc12 **Molecular Formula:** C9H8N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1522>.
CCCCNc1nc2ccc(C)cc2s1
What is the building block token for the following molecule?
CCCCNc1nc2ccc(C)cc2s1
<BB_1522>
What is the molecular formula for <BB_1522>?
The molecular formula for <BB_1522> (CCCCNc1nc2ccc(C)cc2s1) is C12H16N2S.
Describe the ring structures in building block <BB_1522>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1522>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_1522>.
**Token:** <BB_1522> **SMILES:** CCCCNc1nc2ccc(C)cc2s1 **Molecular Formula:** C12H16N2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_1523>.
Cc1noc(C2(F)CCCNC2)n1.Cl
What is the building block token for the following molecule?
Cc1noc(C2(F)CCCNC2)n1.Cl
<BB_1523>
What is the molecular formula for <BB_1523>?
The molecular formula for <BB_1523> (Cc1noc(C2(F)CCCNC2)n1.Cl) is C8H13ClFN3O.
Describe the ring structures in building block <BB_1523>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1523>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1523>.
**Token:** <BB_1523> **SMILES:** Cc1noc(C2(F)CCCNC2)n1.Cl **Molecular Formula:** C8H13ClFN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1524>.
O=S(=O)(c1cccc(S(=O)(=O)N(Br)Br)c1)N(Br)Br
What is the building block token for the following molecule?
O=S(=O)(c1cccc(S(=O)(=O)N(Br)Br)c1)N(Br)Br
<BB_1524>
What is the molecular formula for <BB_1524>?
The molecular formula for <BB_1524> (O=S(=O)(c1cccc(S(=O)(=O)N(Br)Br)c1)N(Br)Br) is C6H4Br4N2O4S2.
Describe the ring structures in building block <BB_1524>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1524>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1524>.
**Token:** <BB_1524> **SMILES:** O=S(=O)(c1cccc(S(=O)(=O)N(Br)Br)c1)N(Br)Br **Molecular Formula:** C6H4Br4N2O4S2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_1525>.
CCn1ncc(Cl)c1C(=O)NN
What is the building block token for the following molecule?
CCn1ncc(Cl)c1C(=O)NN
<BB_1525>
What is the molecular formula for <BB_1525>?
The molecular formula for <BB_1525> (CCn1ncc(Cl)c1C(=O)NN) is C6H9ClN4O.
Describe the ring structures in building block <BB_1525>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1525>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1525>.
**Token:** <BB_1525> **SMILES:** CCn1ncc(Cl)c1C(=O)NN **Molecular Formula:** C6H9ClN4O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1526>.
Cl.NC(Cc1cc(Cl)ccc1Cl)C(=O)O
What is the building block token for the following molecule?
Cl.NC(Cc1cc(Cl)ccc1Cl)C(=O)O
<BB_1526>
What is the molecular formula for <BB_1526>?
The molecular formula for <BB_1526> (Cl.NC(Cc1cc(Cl)ccc1Cl)C(=O)O) is C9H10Cl3NO2.
Describe the ring structures in building block <BB_1526>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1526>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1526>.
**Token:** <BB_1526> **SMILES:** Cl.NC(Cc1cc(Cl)ccc1Cl)C(=O)O **Molecular Formula:** C9H10Cl3NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1527>.
O=C(Nc1cccc(Br)c1)c1cccnc1
What is the building block token for the following molecule?
O=C(Nc1cccc(Br)c1)c1cccnc1
<BB_1527>
What is the molecular formula for <BB_1527>?
The molecular formula for <BB_1527> (O=C(Nc1cccc(Br)c1)c1cccnc1) is C12H9BrN2O.
Describe the ring structures in building block <BB_1527>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1527>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1527>.
**Token:** <BB_1527> **SMILES:** O=C(Nc1cccc(Br)c1)c1cccnc1 **Molecular Formula:** C12H9BrN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1528>.
CC(C)Oc1ccc(C(=O)O)cc1C#N
What is the building block token for the following molecule?
CC(C)Oc1ccc(C(=O)O)cc1C#N
<BB_1528>
What is the molecular formula for <BB_1528>?
The molecular formula for <BB_1528> (CC(C)Oc1ccc(C(=O)O)cc1C#N) is C11H11NO3.
Describe the ring structures in building block <BB_1528>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1528>.
The molecule contains the following groups: Carboxylic Acid, Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1528>.
**Token:** <BB_1528> **SMILES:** CC(C)Oc1ccc(C(=O)O)cc1C#N **Molecular Formula:** C11H11NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Nitrile
Provide the SMILES representation for the building block token <BB_1529>.
Cc1nnc(Br)cc1-c1ccncc1
What is the building block token for the following molecule?
Cc1nnc(Br)cc1-c1ccncc1
<BB_1529>
What is the molecular formula for <BB_1529>?
The molecular formula for <BB_1529> (Cc1nnc(Br)cc1-c1ccncc1) is C10H8BrN3.
Describe the ring structures in building block <BB_1529>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1529>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1529>.
**Token:** <BB_1529> **SMILES:** Cc1nnc(Br)cc1-c1ccncc1 **Molecular Formula:** C10H8BrN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1530>.
Nc1c(F)cc(I)c(F)c1F
What is the building block token for the following molecule?
Nc1c(F)cc(I)c(F)c1F
<BB_1530>
What is the molecular formula for <BB_1530>?
The molecular formula for <BB_1530> (Nc1c(F)cc(I)c(F)c1F) is C6H3F3IN.
Describe the ring structures in building block <BB_1530>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1530>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1530>.
**Token:** <BB_1530> **SMILES:** Nc1c(F)cc(I)c(F)c1F **Molecular Formula:** C6H3F3IN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1531>.
CSc1ccc(I)c(C#N)c1
What is the building block token for the following molecule?
CSc1ccc(I)c(C#N)c1
<BB_1531>
What is the molecular formula for <BB_1531>?
The molecular formula for <BB_1531> (CSc1ccc(I)c(C#N)c1) is C8H6INS.
Describe the ring structures in building block <BB_1531>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1531>.
The molecule contains the following groups: Sulfide, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1531>.
**Token:** <BB_1531> **SMILES:** CSc1ccc(I)c(C#N)c1 **Molecular Formula:** C8H6INS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Sulfide, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1532>.
Fc1cc(C(F)(F)F)c(Br)cn1
What is the building block token for the following molecule?
Fc1cc(C(F)(F)F)c(Br)cn1
<BB_1532>
What is the molecular formula for <BB_1532>?
The molecular formula for <BB_1532> (Fc1cc(C(F)(F)F)c(Br)cn1) is C6H2BrF4N.
Describe the ring structures in building block <BB_1532>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1532>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1532>.
**Token:** <BB_1532> **SMILES:** Fc1cc(C(F)(F)F)c(Br)cn1 **Molecular Formula:** C6H2BrF4N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1533>.
C1CSCN1
What is the building block token for the following molecule?
C1CSCN1
<BB_1533>