instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_1533>?
The molecular formula for <BB_1533> (C1CSCN1) is C3H7NS.
Describe the ring structures in building block <BB_1533>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1533>.
The molecule contains the following groups: Secondary Amine, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_1533>.
**Token:** <BB_1533> **SMILES:** C1CSCN1 **Molecular Formula:** C3H7NS **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Sulfide
Provide the SMILES representation for the building block token <BB_1534>.
CCOC(=O)C=C(C)N1CCCC1
What is the building block token for the following molecule?
CCOC(=O)C=C(C)N1CCCC1
<BB_1534>
What is the molecular formula for <BB_1534>?
The molecular formula for <BB_1534> (CCOC(=O)C=C(C)N1CCCC1) is C10H17NO2.
Describe the ring structures in building block <BB_1534>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1534>.
The molecule contains the following groups: Tertiary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1534>.
**Token:** <BB_1534> **SMILES:** CCOC(=O)C=C(C)N1CCCC1 **Molecular Formula:** C10H17NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Tertiary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_1535>.
CC(Cl)OC(=O)Cl
What is the building block token for the following molecule?
CC(Cl)OC(=O)Cl
<BB_1535>
What is the molecular formula for <BB_1535>?
The molecular formula for <BB_1535> (CC(Cl)OC(=O)Cl) is C3H4Cl2O2.
Describe the ring structures in building block <BB_1535>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1535>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1535>.
**Token:** <BB_1535> **SMILES:** CC(Cl)OC(=O)Cl **Molecular Formula:** C3H4Cl2O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1536>.
CC(C)c1nc(C(=O)O)cs1
What is the building block token for the following molecule?
CC(C)c1nc(C(=O)O)cs1
<BB_1536>
What is the molecular formula for <BB_1536>?
The molecular formula for <BB_1536> (CC(C)c1nc(C(=O)O)cs1) is C7H9NO2S.
Describe the ring structures in building block <BB_1536>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1536>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1536>.
**Token:** <BB_1536> **SMILES:** CC(C)c1nc(C(=O)O)cs1 **Molecular Formula:** C7H9NO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1537>.
CCC1CCCC(C=O)C1
What is the building block token for the following molecule?
CCC1CCCC(C=O)C1
<BB_1537>
What is the molecular formula for <BB_1537>?
The molecular formula for <BB_1537> (CCC1CCCC(C=O)C1) is C9H16O.
Describe the ring structures in building block <BB_1537>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1537>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_1537>.
**Token:** <BB_1537> **SMILES:** CCC1CCCC(C=O)C1 **Molecular Formula:** C9H16O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_1538>.
CC1(C)CC(C=O)CC(C)(C)C1
What is the building block token for the following molecule?
CC1(C)CC(C=O)CC(C)(C)C1
<BB_1538>
What is the molecular formula for <BB_1538>?
The molecular formula for <BB_1538> (CC1(C)CC(C=O)CC(C)(C)C1) is C11H20O.
Describe the ring structures in building block <BB_1538>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1538>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_1538>.
**Token:** <BB_1538> **SMILES:** CC1(C)CC(C=O)CC(C)(C)C1 **Molecular Formula:** C11H20O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_1539>.
Cn1nccc1C1=CC2CCC(C1)N2
What is the building block token for the following molecule?
Cn1nccc1C1=CC2CCC(C1)N2
<BB_1539>
What is the molecular formula for <BB_1539>?
The molecular formula for <BB_1539> (Cn1nccc1C1=CC2CCC(C1)N2) is C11H15N3.
Describe the ring structures in building block <BB_1539>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1539>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_1539>.
**Token:** <BB_1539> **SMILES:** Cn1nccc1C1=CC2CCC(C1)N2 **Molecular Formula:** C11H15N3 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_1540>.
COC(=O)c1ccc(CO)cc1C
What is the building block token for the following molecule?
COC(=O)c1ccc(CO)cc1C
<BB_1540>
What is the molecular formula for <BB_1540>?
The molecular formula for <BB_1540> (COC(=O)c1ccc(CO)cc1C) is C10H12O3.
Describe the ring structures in building block <BB_1540>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1540>.
The molecule contains the following groups: Ester, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1540>.
**Token:** <BB_1540> **SMILES:** COC(=O)c1ccc(CO)cc1C **Molecular Formula:** C10H12O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1541>.
O=C(O)[C@H]1C[C@H]1c1nc(C(F)(F)F)no1
What is the building block token for the following molecule?
O=C(O)[C@H]1C[C@H]1c1nc(C(F)(F)F)no1
<BB_1541>
What is the molecular formula for <BB_1541>?
The molecular formula for <BB_1541> (O=C(O)[C@H]1C[C@H]1c1nc(C(F)(F)F)no1) is C7H5F3N2O3.
Describe the ring structures in building block <BB_1541>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 5.
List the primary functional groups present in <BB_1541>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1541>.
**Token:** <BB_1541> **SMILES:** O=C(O)[C@H]1C[C@H]1c1nc(C(F)(F)F)no1 **Molecular Formula:** C7H5F3N2O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1542>.
O=C(O)c1cccc(-n2cnnn2)c1
What is the building block token for the following molecule?
O=C(O)c1cccc(-n2cnnn2)c1
<BB_1542>
What is the molecular formula for <BB_1542>?
The molecular formula for <BB_1542> (O=C(O)c1cccc(-n2cnnn2)c1) is C8H6N4O2.
Describe the ring structures in building block <BB_1542>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1542>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1542>.
**Token:** <BB_1542> **SMILES:** O=C(O)c1cccc(-n2cnnn2)c1 **Molecular Formula:** C8H6N4O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1543>.
COC(=O)CCCOc1ccc(CN)cc1.Cl
What is the building block token for the following molecule?
COC(=O)CCCOc1ccc(CN)cc1.Cl
<BB_1543>
What is the molecular formula for <BB_1543>?
The molecular formula for <BB_1543> (COC(=O)CCCOc1ccc(CN)cc1.Cl) is C12H18ClNO3.
Describe the ring structures in building block <BB_1543>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1543>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1543>.
**Token:** <BB_1543> **SMILES:** COC(=O)CCCOc1ccc(CN)cc1.Cl **Molecular Formula:** C12H18ClNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1544>.
Cc1cc(C(=O)O)c2cnn(C(C)C)c2n1
What is the building block token for the following molecule?
Cc1cc(C(=O)O)c2cnn(C(C)C)c2n1
<BB_1544>
What is the molecular formula for <BB_1544>?
The molecular formula for <BB_1544> (Cc1cc(C(=O)O)c2cnn(C(C)C)c2n1) is C11H13N3O2.
Describe the ring structures in building block <BB_1544>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1544>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1544>.
**Token:** <BB_1544> **SMILES:** Cc1cc(C(=O)O)c2cnn(C(C)C)c2n1 **Molecular Formula:** C11H13N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1545>.
O=C(O)C1(n2cncn2)CC1
What is the building block token for the following molecule?
O=C(O)C1(n2cncn2)CC1
<BB_1545>
What is the molecular formula for <BB_1545>?
The molecular formula for <BB_1545> (O=C(O)C1(n2cncn2)CC1) is C6H7N3O2.
Describe the ring structures in building block <BB_1545>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1545>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1545>.
**Token:** <BB_1545> **SMILES:** O=C(O)C1(n2cncn2)CC1 **Molecular Formula:** C6H7N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1546>.
CSCCCN
What is the building block token for the following molecule?
CSCCCN
<BB_1546>
What is the molecular formula for <BB_1546>?
The molecular formula for <BB_1546> (CSCCCN) is C4H11NS.
Describe the ring structures in building block <BB_1546>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1546>.
The molecule contains the following groups: Amine, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_1546>.
**Token:** <BB_1546> **SMILES:** CSCCCN **Molecular Formula:** C4H11NS **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Sulfide
Provide the SMILES representation for the building block token <BB_1547>.
Cc1ccc(-c2nnn[nH]2)cc1N
What is the building block token for the following molecule?
Cc1ccc(-c2nnn[nH]2)cc1N
<BB_1547>
What is the molecular formula for <BB_1547>?
The molecular formula for <BB_1547> (Cc1ccc(-c2nnn[nH]2)cc1N) is C8H9N5.
Describe the ring structures in building block <BB_1547>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1547>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1547>.
**Token:** <BB_1547> **SMILES:** Cc1ccc(-c2nnn[nH]2)cc1N **Molecular Formula:** C8H9N5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1548>.
CC(C)c1noc(CN2CCNCC2)n1.Cl.Cl
What is the building block token for the following molecule?
CC(C)c1noc(CN2CCNCC2)n1.Cl.Cl
<BB_1548>
What is the molecular formula for <BB_1548>?
The molecular formula for <BB_1548> (CC(C)c1noc(CN2CCNCC2)n1.Cl.Cl) is C10H20Cl2N4O.
Describe the ring structures in building block <BB_1548>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1548>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1548>.
**Token:** <BB_1548> **SMILES:** CC(C)c1noc(CN2CCNCC2)n1.Cl.Cl **Molecular Formula:** C10H20Cl2N4O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1549>.
CNCC(O)COC
What is the building block token for the following molecule?
CNCC(O)COC
<BB_1549>
What is the molecular formula for <BB_1549>?
The molecular formula for <BB_1549> (CNCC(O)COC) is C5H13NO2.
Describe the ring structures in building block <BB_1549>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1549>.
The molecule contains the following groups: Secondary Amine, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1549>.
**Token:** <BB_1549> **SMILES:** CNCC(O)COC **Molecular Formula:** C5H13NO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Alcohol, Ether