instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_1550>.
COc1cc(C(=O)O)c(N)cn1
What is the building block token for the following molecule?
COc1cc(C(=O)O)c(N)cn1
<BB_1550>
What is the molecular formula for <BB_1550>?
The molecular formula for <BB_1550> (COc1cc(C(=O)O)c(N)cn1) is C7H8N2O3.
Describe the ring structures in building block <BB_1550>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1550>.
The molecule contains the following groups: Carboxylic Acid, Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1550>.
**Token:** <BB_1550> **SMILES:** COc1cc(C(=O)O)c(N)cn1 **Molecular Formula:** C7H8N2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Ether
Provide the SMILES representation for the building block token <BB_1551>.
OCc1ncccc1F
What is the building block token for the following molecule?
OCc1ncccc1F
<BB_1551>
What is the molecular formula for <BB_1551>?
The molecular formula for <BB_1551> (OCc1ncccc1F) is C6H6FNO.
Describe the ring structures in building block <BB_1551>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1551>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1551>.
**Token:** <BB_1551> **SMILES:** OCc1ncccc1F **Molecular Formula:** C6H6FNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1552>.
OCc1cc(Br)cnc1N1CCOCC1
What is the building block token for the following molecule?
OCc1cc(Br)cnc1N1CCOCC1
<BB_1552>
What is the molecular formula for <BB_1552>?
The molecular formula for <BB_1552> (OCc1cc(Br)cnc1N1CCOCC1) is C10H13BrN2O2.
Describe the ring structures in building block <BB_1552>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1552>.
The molecule contains the following groups: Tertiary Amine, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1552>.
**Token:** <BB_1552> **SMILES:** OCc1cc(Br)cnc1N1CCOCC1 **Molecular Formula:** C10H13BrN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1553>.
Clc1ccc([C@@H]2CO2)cc1
What is the building block token for the following molecule?
Clc1ccc([C@@H]2CO2)cc1
<BB_1553>
What is the molecular formula for <BB_1553>?
The molecular formula for <BB_1553> (Clc1ccc([C@@H]2CO2)cc1) is C8H7ClO.
Describe the ring structures in building block <BB_1553>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1553>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1553>.
**Token:** <BB_1553> **SMILES:** Clc1ccc([C@@H]2CO2)cc1 **Molecular Formula:** C8H7ClO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1554>.
Cl.O=C(O)c1ccc(N2CCOCC2)cc1Cl
What is the building block token for the following molecule?
Cl.O=C(O)c1ccc(N2CCOCC2)cc1Cl
<BB_1554>
What is the molecular formula for <BB_1554>?
The molecular formula for <BB_1554> (Cl.O=C(O)c1ccc(N2CCOCC2)cc1Cl) is C11H13Cl2NO3.
Describe the ring structures in building block <BB_1554>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1554>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1554>.
**Token:** <BB_1554> **SMILES:** Cl.O=C(O)c1ccc(N2CCOCC2)cc1Cl **Molecular Formula:** C11H13Cl2NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1555>.
OB(O)c1cc2cccc(Cl)c2s1
What is the building block token for the following molecule?
OB(O)c1cc2cccc(Cl)c2s1
<BB_1555>
What is the molecular formula for <BB_1555>?
The molecular formula for <BB_1555> (OB(O)c1cc2cccc(Cl)c2s1) is C8H6BClO2S.
Describe the ring structures in building block <BB_1555>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1555>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1555>.
**Token:** <BB_1555> **SMILES:** OB(O)c1cc2cccc(Cl)c2s1 **Molecular Formula:** C8H6BClO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1556>.
COC(=O)C12CC(CBr)(C1)C2(F)F
What is the building block token for the following molecule?
COC(=O)C12CC(CBr)(C1)C2(F)F
<BB_1556>
What is the molecular formula for <BB_1556>?
The molecular formula for <BB_1556> (COC(=O)C12CC(CBr)(C1)C2(F)F) is C8H9BrF2O2.
Describe the ring structures in building block <BB_1556>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1556>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1556>.
**Token:** <BB_1556> **SMILES:** COC(=O)C12CC(CBr)(C1)C2(F)F **Molecular Formula:** C8H9BrF2O2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1557>.
CSc1ncc(C=O)c(Cl)n1
What is the building block token for the following molecule?
CSc1ncc(C=O)c(Cl)n1
<BB_1557>
What is the molecular formula for <BB_1557>?
The molecular formula for <BB_1557> (CSc1ncc(C=O)c(Cl)n1) is C6H5ClN2OS.
Describe the ring structures in building block <BB_1557>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1557>.
The molecule contains the following groups: Aldehyde, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1557>.
**Token:** <BB_1557> **SMILES:** CSc1ncc(C=O)c(Cl)n1 **Molecular Formula:** C6H5ClN2OS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1558>.
OB(O)[C@@H]1C[C@H]1c1ccc(Cl)cc1
What is the building block token for the following molecule?
OB(O)[C@@H]1C[C@H]1c1ccc(Cl)cc1
<BB_1558>
What is the molecular formula for <BB_1558>?
The molecular formula for <BB_1558> (OB(O)[C@@H]1C[C@H]1c1ccc(Cl)cc1) is C9H10BClO2.
Describe the ring structures in building block <BB_1558>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6.
List the primary functional groups present in <BB_1558>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1558>.
**Token:** <BB_1558> **SMILES:** OB(O)[C@@H]1C[C@H]1c1ccc(Cl)cc1 **Molecular Formula:** C9H10BClO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1559>.
Clc1cnc(Br)c2[nH]ccc12
What is the building block token for the following molecule?
Clc1cnc(Br)c2[nH]ccc12
<BB_1559>
What is the molecular formula for <BB_1559>?
The molecular formula for <BB_1559> (Clc1cnc(Br)c2[nH]ccc12) is C7H4BrClN2.
Describe the ring structures in building block <BB_1559>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1559>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1559>.
**Token:** <BB_1559> **SMILES:** Clc1cnc(Br)c2[nH]ccc12 **Molecular Formula:** C7H4BrClN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1560>.
CC(C)(C)OC(=O)NC1CCCC(CC(=O)O)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC1CCCC(CC(=O)O)C1
<BB_1560>
What is the molecular formula for <BB_1560>?
The molecular formula for <BB_1560> (CC(C)(C)OC(=O)NC1CCCC(CC(=O)O)C1) is C13H23NO4.
Describe the ring structures in building block <BB_1560>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1560>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1560>.
**Token:** <BB_1560> **SMILES:** CC(C)(C)OC(=O)NC1CCCC(CC(=O)O)C1 **Molecular Formula:** C13H23NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_1561>.
CSCC(=O)NOCC(N)=O
What is the building block token for the following molecule?
CSCC(=O)NOCC(N)=O
<BB_1561>
What is the molecular formula for <BB_1561>?
The molecular formula for <BB_1561> (CSCC(=O)NOCC(N)=O) is C5H10N2O3S.
Describe the ring structures in building block <BB_1561>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1561>.
The molecule contains the following groups: Amide, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_1561>.
**Token:** <BB_1561> **SMILES:** CSCC(=O)NOCC(N)=O **Molecular Formula:** C5H10N2O3S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Sulfide
Provide the SMILES representation for the building block token <BB_1562>.
CC1(C)CC(=O)c2c([nH]c3ccc(F)cc23)C1
What is the building block token for the following molecule?
CC1(C)CC(=O)c2c([nH]c3ccc(F)cc23)C1
<BB_1562>
What is the molecular formula for <BB_1562>?
The molecular formula for <BB_1562> (CC1(C)CC(=O)c2c([nH]c3ccc(F)cc23)C1) is C14H14FNO.
Describe the ring structures in building block <BB_1562>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1562>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1562>.
**Token:** <BB_1562> **SMILES:** CC1(C)CC(=O)c2c([nH]c3ccc(F)cc23)C1 **Molecular Formula:** C14H14FNO **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1563>.
Clc1ccc(OC[C@H]2CO2)cc1
What is the building block token for the following molecule?
Clc1ccc(OC[C@H]2CO2)cc1
<BB_1563>
What is the molecular formula for <BB_1563>?
The molecular formula for <BB_1563> (Clc1ccc(OC[C@H]2CO2)cc1) is C9H9ClO2.
Describe the ring structures in building block <BB_1563>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1563>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1563>.
**Token:** <BB_1563> **SMILES:** Clc1ccc(OC[C@H]2CO2)cc1 **Molecular Formula:** C9H9ClO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1564>.
Fc1cc(CCl)cnc1Cl
What is the building block token for the following molecule?
Fc1cc(CCl)cnc1Cl
<BB_1564>
What is the molecular formula for <BB_1564>?
The molecular formula for <BB_1564> (Fc1cc(CCl)cnc1Cl) is C6H4Cl2FN.
Describe the ring structures in building block <BB_1564>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1564>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1564>.
**Token:** <BB_1564> **SMILES:** Fc1cc(CCl)cnc1Cl **Molecular Formula:** C6H4Cl2FN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1565>.
Cl.N#CC=CCN
What is the building block token for the following molecule?
Cl.N#CC=CCN
<BB_1565>
What is the molecular formula for <BB_1565>?
The molecular formula for <BB_1565> (Cl.N#CC=CCN) is C4H7ClN2.
Describe the ring structures in building block <BB_1565>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1565>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1565>.
**Token:** <BB_1565> **SMILES:** Cl.N#CC=CCN **Molecular Formula:** C4H7ClN2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1566>.
OCC(F)(F)c1ccc(Br)nc1
What is the building block token for the following molecule?
OCC(F)(F)c1ccc(Br)nc1
<BB_1566>
What is the molecular formula for <BB_1566>?
The molecular formula for <BB_1566> (OCC(F)(F)c1ccc(Br)nc1) is C7H6BrF2NO.
Describe the ring structures in building block <BB_1566>.
The molecule contains 1 ring(s): an aromatic ring of size 6.