instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_1566>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1566>.
**Token:** <BB_1566> **SMILES:** OCC(F)(F)c1ccc(Br)nc1 **Molecular Formula:** C7H6BrF2NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1567>.
Cl.Cn1ncc2c(CCl)cccc21
What is the building block token for the following molecule?
Cl.Cn1ncc2c(CCl)cccc21
<BB_1567>
What is the molecular formula for <BB_1567>?
The molecular formula for <BB_1567> (Cl.Cn1ncc2c(CCl)cccc21) is C9H10Cl2N2.
Describe the ring structures in building block <BB_1567>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1567>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1567>.
**Token:** <BB_1567> **SMILES:** Cl.Cn1ncc2c(CCl)cccc21 **Molecular Formula:** C9H10Cl2N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1568>.
Nc1nnc2ccccc2n1
What is the building block token for the following molecule?
Nc1nnc2ccccc2n1
<BB_1568>
What is the molecular formula for <BB_1568>?
The molecular formula for <BB_1568> (Nc1nnc2ccccc2n1) is C7H6N4.
Describe the ring structures in building block <BB_1568>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1568>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_1568>.
**Token:** <BB_1568> **SMILES:** Nc1nnc2ccccc2n1 **Molecular Formula:** C7H6N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_1569>.
Cc1c(N)cnn1C(C)C.Cl.Cl
What is the building block token for the following molecule?
Cc1c(N)cnn1C(C)C.Cl.Cl
<BB_1569>
What is the molecular formula for <BB_1569>?
The molecular formula for <BB_1569> (Cc1c(N)cnn1C(C)C.Cl.Cl) is C7H15Cl2N3.
Describe the ring structures in building block <BB_1569>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1569>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1569>.
**Token:** <BB_1569> **SMILES:** Cc1c(N)cnn1C(C)C.Cl.Cl **Molecular Formula:** C7H15Cl2N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1570>.
NC(CO)C12CC3CC(CC(C3)C1)C2
What is the building block token for the following molecule?
NC(CO)C12CC3CC(CC(C3)C1)C2
<BB_1570>
What is the molecular formula for <BB_1570>?
The molecular formula for <BB_1570> (NC(CO)C12CC3CC(CC(C3)C1)C2) is C12H21NO.
Describe the ring structures in building block <BB_1570>.
The molecule contains 4 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1570>.
The molecule contains the following groups: Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_1570>.
**Token:** <BB_1570> **SMILES:** NC(CO)C12CC3CC(CC(C3)C1)C2 **Molecular Formula:** C12H21NO **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Alcohol
Provide the SMILES representation for the building block token <BB_1571>.
CC(C)(C)OC(=O)N(CC1CCNCC1)C1CC1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N(CC1CCNCC1)C1CC1
<BB_1571>
What is the molecular formula for <BB_1571>?
The molecular formula for <BB_1571> (CC(C)(C)OC(=O)N(CC1CCNCC1)C1CC1) is C14H26N2O2.
Describe the ring structures in building block <BB_1571>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1571>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1571>.
**Token:** <BB_1571> **SMILES:** CC(C)(C)OC(=O)N(CC1CCNCC1)C1CC1 **Molecular Formula:** C14H26N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_1572>.
CC(=O)Cc1ccc(F)cc1Cl
What is the building block token for the following molecule?
CC(=O)Cc1ccc(F)cc1Cl
<BB_1572>
What is the molecular formula for <BB_1572>?
The molecular formula for <BB_1572> (CC(=O)Cc1ccc(F)cc1Cl) is C9H8ClFO.
Describe the ring structures in building block <BB_1572>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1572>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1572>.
**Token:** <BB_1572> **SMILES:** CC(=O)Cc1ccc(F)cc1Cl **Molecular Formula:** C9H8ClFO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1573>.
CC(=O)c1cccc2c1OC(F)(F)O2
What is the building block token for the following molecule?
CC(=O)c1cccc2c1OC(F)(F)O2
<BB_1573>
What is the molecular formula for <BB_1573>?
The molecular formula for <BB_1573> (CC(=O)c1cccc2c1OC(F)(F)O2) is C9H6F2O3.
Describe the ring structures in building block <BB_1573>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1573>.
The molecule contains the following groups: Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1573>.
**Token:** <BB_1573> **SMILES:** CC(=O)c1cccc2c1OC(F)(F)O2 **Molecular Formula:** C9H6F2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1574>.
Nc1ccc(Br)nc1[N+](=O)[O-]
What is the building block token for the following molecule?
Nc1ccc(Br)nc1[N+](=O)[O-]
<BB_1574>
What is the molecular formula for <BB_1574>?
The molecular formula for <BB_1574> (Nc1ccc(Br)nc1[N+](=O)[O-]) is C5H4BrN3O2.
Describe the ring structures in building block <BB_1574>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1574>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_1574>.
**Token:** <BB_1574> **SMILES:** Nc1ccc(Br)nc1[N+](=O)[O-] **Molecular Formula:** C5H4BrN3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_1575>.
C[C@@H]1CN(Cc2cccc(N)c2)C[C@H](C)O1
What is the building block token for the following molecule?
C[C@@H]1CN(Cc2cccc(N)c2)C[C@H](C)O1
<BB_1575>
What is the molecular formula for <BB_1575>?
The molecular formula for <BB_1575> (C[C@@H]1CN(Cc2cccc(N)c2)C[C@H](C)O1) is C13H20N2O.
Describe the ring structures in building block <BB_1575>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1575>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1575>.
**Token:** <BB_1575> **SMILES:** C[C@@H]1CN(Cc2cccc(N)c2)C[C@H](C)O1 **Molecular Formula:** C13H20N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_1576>.
Cc1cccc(OCc2ccc(C(=O)NN)o2)c1
What is the building block token for the following molecule?
Cc1cccc(OCc2ccc(C(=O)NN)o2)c1
<BB_1576>
What is the molecular formula for <BB_1576>?
The molecular formula for <BB_1576> (Cc1cccc(OCc2ccc(C(=O)NN)o2)c1) is C13H14N2O3.
Describe the ring structures in building block <BB_1576>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1576>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1576>.
**Token:** <BB_1576> **SMILES:** Cc1cccc(OCc2ccc(C(=O)NN)o2)c1 **Molecular Formula:** C13H14N2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_1577>.
CC(C)(C)OC(=O)N1CC(C(=O)N2CC(N)C2)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC(C(=O)N2CC(N)C2)C1
<BB_1577>
What is the molecular formula for <BB_1577>?
The molecular formula for <BB_1577> (CC(C)(C)OC(=O)N1CC(C(=O)N2CC(N)C2)C1) is C12H21N3O3.
Describe the ring structures in building block <BB_1577>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1577>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1577>.
**Token:** <BB_1577> **SMILES:** CC(C)(C)OC(=O)N1CC(C(=O)N2CC(N)C2)C1 **Molecular Formula:** C12H21N3O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_1578>.
CC(C)C1(N)CCOCC1.Cl
What is the building block token for the following molecule?
CC(C)C1(N)CCOCC1.Cl
<BB_1578>
What is the molecular formula for <BB_1578>?
The molecular formula for <BB_1578> (CC(C)C1(N)CCOCC1.Cl) is C8H18ClNO.
Describe the ring structures in building block <BB_1578>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1578>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1578>.
**Token:** <BB_1578> **SMILES:** CC(C)C1(N)CCOCC1.Cl **Molecular Formula:** C8H18ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1579>.
CN(C)c1oc(CC#N)nc1C#N
What is the building block token for the following molecule?
CN(C)c1oc(CC#N)nc1C#N
<BB_1579>
What is the molecular formula for <BB_1579>?
The molecular formula for <BB_1579> (CN(C)c1oc(CC#N)nc1C#N) is C8H8N4O.
Describe the ring structures in building block <BB_1579>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1579>.
The molecule contains the following groups: Tertiary Amine, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1579>.
**Token:** <BB_1579> **SMILES:** CN(C)c1oc(CC#N)nc1C#N **Molecular Formula:** C8H8N4O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Tertiary Amine, Nitrile
Provide the SMILES representation for the building block token <BB_1580>.
Br.O=C(CBr)c1ccncc1Br
What is the building block token for the following molecule?
Br.O=C(CBr)c1ccncc1Br
<BB_1580>
What is the molecular formula for <BB_1580>?
The molecular formula for <BB_1580> (Br.O=C(CBr)c1ccncc1Br) is C7H6Br3NO.
Describe the ring structures in building block <BB_1580>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1580>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1580>.
**Token:** <BB_1580> **SMILES:** Br.O=C(CBr)c1ccncc1Br **Molecular Formula:** C7H6Br3NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1581>.
CCOc1ccc2cc(C(=O)OC)[nH]c2c1
What is the building block token for the following molecule?
CCOc1ccc2cc(C(=O)OC)[nH]c2c1
<BB_1581>
What is the molecular formula for <BB_1581>?
The molecular formula for <BB_1581> (CCOc1ccc2cc(C(=O)OC)[nH]c2c1) is C12H13NO3.
Describe the ring structures in building block <BB_1581>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_1581>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1581>.
**Token:** <BB_1581> **SMILES:** CCOc1ccc2cc(C(=O)OC)[nH]c2c1 **Molecular Formula:** C12H13NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_1582>.
OCc1cn(C2CCCNC2)nn1
What is the building block token for the following molecule?
OCc1cn(C2CCCNC2)nn1
<BB_1582>
What is the molecular formula for <BB_1582>?
The molecular formula for <BB_1582> (OCc1cn(C2CCCNC2)nn1) is C8H14N4O.
Describe the ring structures in building block <BB_1582>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1582>.
The molecule contains the following groups: Secondary Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_1582>.
**Token:** <BB_1582> **SMILES:** OCc1cn(C2CCCNC2)nn1 **Molecular Formula:** C8H14N4O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Alcohol
Provide the SMILES representation for the building block token <BB_1583>.
O=CC1(n2cc(Br)cn2)CC1
What is the building block token for the following molecule?
O=CC1(n2cc(Br)cn2)CC1
<BB_1583>