instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_1583>?
The molecular formula for <BB_1583> (O=CC1(n2cc(Br)cn2)CC1) is C7H7BrN2O.
Describe the ring structures in building block <BB_1583>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_1583>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1583>.
**Token:** <BB_1583> **SMILES:** O=CC1(n2cc(Br)cn2)CC1 **Molecular Formula:** C7H7BrN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1584>.
O=C(O)C12CCCC(C(=O)O)(C1)C2
What is the building block token for the following molecule?
O=C(O)C12CCCC(C(=O)O)(C1)C2
<BB_1584>
What is the molecular formula for <BB_1584>?
The molecular formula for <BB_1584> (O=C(O)C12CCCC(C(=O)O)(C1)C2) is C9H12O4.
Describe the ring structures in building block <BB_1584>.
The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1584>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1584>.
**Token:** <BB_1584> **SMILES:** O=C(O)C12CCCC(C(=O)O)(C1)C2 **Molecular Formula:** C9H12O4 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1585>.
CCCCOc1ccc(CCS)cc1
What is the building block token for the following molecule?
CCCCOc1ccc(CCS)cc1
<BB_1585>
What is the molecular formula for <BB_1585>?
The molecular formula for <BB_1585> (CCCCOc1ccc(CCS)cc1) is C12H18OS.
Describe the ring structures in building block <BB_1585>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1585>.
The molecule contains the following groups: Ether, Thiol.
Provide a comprehensive chemical profile for the building block <BB_1585>.
**Token:** <BB_1585> **SMILES:** CCCCOc1ccc(CCS)cc1 **Molecular Formula:** C12H18OS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Thiol
Provide the SMILES representation for the building block token <BB_1586>.
C#CCN1CCCCCC1=O
What is the building block token for the following molecule?
C#CCN1CCCCCC1=O
<BB_1586>
What is the molecular formula for <BB_1586>?
The molecular formula for <BB_1586> (C#CCN1CCCCCC1=O) is C9H13NO.
Describe the ring structures in building block <BB_1586>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.
List the primary functional groups present in <BB_1586>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_1586>.
**Token:** <BB_1586> **SMILES:** C#CCN1CCCCCC1=O **Molecular Formula:** C9H13NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_1587>.
Cl.O=C1CC2CCC(CN1)N2
What is the building block token for the following molecule?
Cl.O=C1CC2CCC(CN1)N2
<BB_1587>
What is the molecular formula for <BB_1587>?
The molecular formula for <BB_1587> (Cl.O=C1CC2CCC(CN1)N2) is C7H13ClN2O.
Describe the ring structures in building block <BB_1587>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1587>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1587>.
**Token:** <BB_1587> **SMILES:** Cl.O=C1CC2CCC(CN1)N2 **Molecular Formula:** C7H13ClN2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1588>.
Cl.NCCS(=O)(=O)N1CCOCC1
What is the building block token for the following molecule?
Cl.NCCS(=O)(=O)N1CCOCC1
<BB_1588>
What is the molecular formula for <BB_1588>?
The molecular formula for <BB_1588> (Cl.NCCS(=O)(=O)N1CCOCC1) is C6H15ClN2O3S.
Describe the ring structures in building block <BB_1588>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1588>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_1588>.
**Token:** <BB_1588> **SMILES:** Cl.NCCS(=O)(=O)N1CCOCC1 **Molecular Formula:** C6H15ClN2O3S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_1589>.
CC(C)c1ccc(CC(=O)O)cc1F
What is the building block token for the following molecule?
CC(C)c1ccc(CC(=O)O)cc1F
<BB_1589>
What is the molecular formula for <BB_1589>?
The molecular formula for <BB_1589> (CC(C)c1ccc(CC(=O)O)cc1F) is C11H13FO2.
Describe the ring structures in building block <BB_1589>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1589>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1589>.
**Token:** <BB_1589> **SMILES:** CC(C)c1ccc(CC(=O)O)cc1F **Molecular Formula:** C11H13FO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1590>.
Cc1cc(C(F)(F)F)cnc1C#N
What is the building block token for the following molecule?
Cc1cc(C(F)(F)F)cnc1C#N
<BB_1590>
What is the molecular formula for <BB_1590>?
The molecular formula for <BB_1590> (Cc1cc(C(F)(F)F)cnc1C#N) is C8H5F3N2.
Describe the ring structures in building block <BB_1590>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1590>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1590>.
**Token:** <BB_1590> **SMILES:** Cc1cc(C(F)(F)F)cnc1C#N **Molecular Formula:** C8H5F3N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1591>.
O=C(O)c1oncc1Br
What is the building block token for the following molecule?
O=C(O)c1oncc1Br
<BB_1591>
What is the molecular formula for <BB_1591>?
The molecular formula for <BB_1591> (O=C(O)c1oncc1Br) is C4H2BrNO3.
Describe the ring structures in building block <BB_1591>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1591>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1591>.
**Token:** <BB_1591> **SMILES:** O=C(O)c1oncc1Br **Molecular Formula:** C4H2BrNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1592>.
CCc1c[nH]c2cc(Br)ccc12
What is the building block token for the following molecule?
CCc1c[nH]c2cc(Br)ccc12
<BB_1592>
What is the molecular formula for <BB_1592>?
The molecular formula for <BB_1592> (CCc1c[nH]c2cc(Br)ccc12) is C10H10BrN.
Describe the ring structures in building block <BB_1592>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_1592>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1592>.
**Token:** <BB_1592> **SMILES:** CCc1c[nH]c2cc(Br)ccc12 **Molecular Formula:** C10H10BrN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1593>.
O=C(O)Cc1ccccc1C(F)(F)F
What is the building block token for the following molecule?
O=C(O)Cc1ccccc1C(F)(F)F
<BB_1593>
What is the molecular formula for <BB_1593>?
The molecular formula for <BB_1593> (O=C(O)Cc1ccccc1C(F)(F)F) is C9H7F3O2.
Describe the ring structures in building block <BB_1593>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1593>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1593>.
**Token:** <BB_1593> **SMILES:** O=C(O)Cc1ccccc1C(F)(F)F **Molecular Formula:** C9H7F3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1594>.
CC1CC(C)CN(Cc2ccc(CN)cc2)C1
What is the building block token for the following molecule?
CC1CC(C)CN(Cc2ccc(CN)cc2)C1
<BB_1594>
What is the molecular formula for <BB_1594>?
The molecular formula for <BB_1594> (CC1CC(C)CN(Cc2ccc(CN)cc2)C1) is C15H24N2.
Describe the ring structures in building block <BB_1594>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1594>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_1594>.
**Token:** <BB_1594> **SMILES:** CC1CC(C)CN(Cc2ccc(CN)cc2)C1 **Molecular Formula:** C15H24N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_1595>.
ClCc1noc(N2CCOCC2)n1
What is the building block token for the following molecule?
ClCc1noc(N2CCOCC2)n1
<BB_1595>
What is the molecular formula for <BB_1595>?
The molecular formula for <BB_1595> (ClCc1noc(N2CCOCC2)n1) is C7H10ClN3O2.
Describe the ring structures in building block <BB_1595>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1595>.
The molecule contains the following groups: Tertiary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1595>.
**Token:** <BB_1595> **SMILES:** ClCc1noc(N2CCOCC2)n1 **Molecular Formula:** C7H10ClN3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1596>.
O=C(O)c1cccc(CN2C(=O)CSC2=O)c1
What is the building block token for the following molecule?
O=C(O)c1cccc(CN2C(=O)CSC2=O)c1
<BB_1596>
What is the molecular formula for <BB_1596>?
The molecular formula for <BB_1596> (O=C(O)c1cccc(CN2C(=O)CSC2=O)c1) is C11H9NO4S.
Describe the ring structures in building block <BB_1596>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1596>.
The molecule contains the following groups: Carboxylic Acid, Amide, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_1596>.
**Token:** <BB_1596> **SMILES:** O=C(O)c1cccc(CN2C(=O)CSC2=O)c1 **Molecular Formula:** C11H9NO4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide, Sulfide
Provide the SMILES representation for the building block token <BB_1597>.
O=C(O)COc1cc([N+](=O)[O-])ccc1F
What is the building block token for the following molecule?
O=C(O)COc1cc([N+](=O)[O-])ccc1F
<BB_1597>
What is the molecular formula for <BB_1597>?
The molecular formula for <BB_1597> (O=C(O)COc1cc([N+](=O)[O-])ccc1F) is C8H6FNO5.
Describe the ring structures in building block <BB_1597>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1597>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_1597>.
**Token:** <BB_1597> **SMILES:** O=C(O)COc1cc([N+](=O)[O-])ccc1F **Molecular Formula:** C8H6FNO5 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Ether, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_1598>.
Nc1ncccc1F
What is the building block token for the following molecule?
Nc1ncccc1F
<BB_1598>
What is the molecular formula for <BB_1598>?
The molecular formula for <BB_1598> (Nc1ncccc1F) is C5H5FN2.
Describe the ring structures in building block <BB_1598>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1598>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1598>.
**Token:** <BB_1598> **SMILES:** Nc1ncccc1F **Molecular Formula:** C5H5FN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1599>.
Cc1cc(N2CCCC(N)C2=O)ccc1Br
What is the building block token for the following molecule?
Cc1cc(N2CCCC(N)C2=O)ccc1Br
<BB_1599>
What is the molecular formula for <BB_1599>?
The molecular formula for <BB_1599> (Cc1cc(N2CCCC(N)C2=O)ccc1Br) is C12H15BrN2O.
Describe the ring structures in building block <BB_1599>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1599>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1599>.
**Token:** <BB_1599> **SMILES:** Cc1cc(N2CCCC(N)C2=O)ccc1Br **Molecular Formula:** C12H15BrN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)