instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_1600>.
O=C(O)CC1CCCS1(=O)=O
What is the building block token for the following molecule?
O=C(O)CC1CCCS1(=O)=O
<BB_1600>
What is the molecular formula for <BB_1600>?
The molecular formula for <BB_1600> (O=C(O)CC1CCCS1(=O)=O) is C6H10O4S.
Describe the ring structures in building block <BB_1600>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1600>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1600>.
**Token:** <BB_1600> **SMILES:** O=C(O)CC1CCCS1(=O)=O **Molecular Formula:** C6H10O4S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1601>.
CC(=O)CC(C)(C)C
What is the building block token for the following molecule?
CC(=O)CC(C)(C)C
<BB_1601>
What is the molecular formula for <BB_1601>?
The molecular formula for <BB_1601> (CC(=O)CC(C)(C)C) is C7H14O.
Describe the ring structures in building block <BB_1601>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1601>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_1601>.
**Token:** <BB_1601> **SMILES:** CC(=O)CC(C)(C)C **Molecular Formula:** C7H14O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_1602>.
O=C1CCC2(CCCCO2)CC1
What is the building block token for the following molecule?
O=C1CCC2(CCCCO2)CC1
<BB_1602>
What is the molecular formula for <BB_1602>?
The molecular formula for <BB_1602> (O=C1CCC2(CCCCO2)CC1) is C10H16O2.
Describe the ring structures in building block <BB_1602>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1602>.
The molecule contains the following groups: Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_1602>.
**Token:** <BB_1602> **SMILES:** O=C1CCC2(CCCCO2)CC1 **Molecular Formula:** C10H16O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Ketone, Ether
Provide the SMILES representation for the building block token <BB_1603>.
CCOC(=O)[C@@]12CCCCC[C@@H]1NCC2.Cl
What is the building block token for the following molecule?
CCOC(=O)[C@@]12CCCCC[C@@H]1NCC2.Cl
<BB_1603>
What is the molecular formula for <BB_1603>?
The molecular formula for <BB_1603> (CCOC(=O)[C@@]12CCCCC[C@@H]1NCC2.Cl) is C12H22ClNO2.
Describe the ring structures in building block <BB_1603>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1603>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1603>.
**Token:** <BB_1603> **SMILES:** CCOC(=O)[C@@]12CCCCC[C@@H]1NCC2.Cl **Molecular Formula:** C12H22ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1604>.
Br.CN(C)CC(C(=O)O)N(C)C
What is the building block token for the following molecule?
Br.CN(C)CC(C(=O)O)N(C)C
<BB_1604>
What is the molecular formula for <BB_1604>?
The molecular formula for <BB_1604> (Br.CN(C)CC(C(=O)O)N(C)C) is C7H17BrN2O2.
Describe the ring structures in building block <BB_1604>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1604>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1604>.
**Token:** <BB_1604> **SMILES:** Br.CN(C)CC(C(=O)O)N(C)C **Molecular Formula:** C7H17BrN2O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1605>.
COC(=O)Cc1cc(I)ccc1Cl
What is the building block token for the following molecule?
COC(=O)Cc1cc(I)ccc1Cl
<BB_1605>
What is the molecular formula for <BB_1605>?
The molecular formula for <BB_1605> (COC(=O)Cc1cc(I)ccc1Cl) is C9H8ClIO2.
Describe the ring structures in building block <BB_1605>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1605>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1605>.
**Token:** <BB_1605> **SMILES:** COC(=O)Cc1cc(I)ccc1Cl **Molecular Formula:** C9H8ClIO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1606>.
CC(C)(CCC(O)C(=O)O)NC(=O)OC(C)(C)C
What is the building block token for the following molecule?
CC(C)(CCC(O)C(=O)O)NC(=O)OC(C)(C)C
<BB_1606>
What is the molecular formula for <BB_1606>?
The molecular formula for <BB_1606> (CC(C)(CCC(O)C(=O)O)NC(=O)OC(C)(C)C) is C12H23NO5.
Describe the ring structures in building block <BB_1606>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_1606>.
The molecule contains the following groups: Carboxylic Acid, Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1606>.
**Token:** <BB_1606> **SMILES:** CC(C)(CCC(O)C(=O)O)NC(=O)OC(C)(C)C **Molecular Formula:** C12H23NO5 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1607>.
CC(C)(C)OC(=O)N1CCN[C@@H](CO)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCN[C@@H](CO)C1
<BB_1607>
What is the molecular formula for <BB_1607>?
The molecular formula for <BB_1607> (CC(C)(C)OC(=O)N1CCN[C@@H](CO)C1) is C10H20N2O3.
Describe the ring structures in building block <BB_1607>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1607>.
The molecule contains the following groups: Secondary Amine, Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_1607>.
**Token:** <BB_1607> **SMILES:** CC(C)(C)OC(=O)N1CCN[C@@H](CO)C1 **Molecular Formula:** C10H20N2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_1608>.
CC(C)(C)OC(=O)N1CCCN(S(C)(=N)=O)CC1.Cl
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCCN(S(C)(=N)=O)CC1.Cl
<BB_1608>
What is the molecular formula for <BB_1608>?
The molecular formula for <BB_1608> (CC(C)(C)OC(=O)N1CCCN(S(C)(=N)=O)CC1.Cl) is C11H24ClN3O3S.
Describe the ring structures in building block <BB_1608>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.
List the primary functional groups present in <BB_1608>.
The molecule contains the following groups: Tertiary Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1608>.
**Token:** <BB_1608> **SMILES:** CC(C)(C)OC(=O)N1CCCN(S(C)(=N)=O)CC1.Cl **Molecular Formula:** C11H24ClN3O3S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Tertiary Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1609>.
Cc1cc(C#N)ccc1NC1CCC(O)CC1
What is the building block token for the following molecule?
Cc1cc(C#N)ccc1NC1CCC(O)CC1
<BB_1609>
What is the molecular formula for <BB_1609>?
The molecular formula for <BB_1609> (Cc1cc(C#N)ccc1NC1CCC(O)CC1) is C14H18N2O.
Describe the ring structures in building block <BB_1609>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1609>.
The molecule contains the following groups: Secondary Amine, Alcohol, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1609>.
**Token:** <BB_1609> **SMILES:** Cc1cc(C#N)ccc1NC1CCC(O)CC1 **Molecular Formula:** C14H18N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Alcohol, Nitrile
Provide the SMILES representation for the building block token <BB_1610>.
CCOc1ccc(CN)cc1OCC
What is the building block token for the following molecule?
CCOc1ccc(CN)cc1OCC
<BB_1610>
What is the molecular formula for <BB_1610>?
The molecular formula for <BB_1610> (CCOc1ccc(CN)cc1OCC) is C11H17NO2.
Describe the ring structures in building block <BB_1610>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1610>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_1610>.
**Token:** <BB_1610> **SMILES:** CCOc1ccc(CN)cc1OCC **Molecular Formula:** C11H17NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_1611>.
COc1cccc(O)c1N.Cl
What is the building block token for the following molecule?
COc1cccc(O)c1N.Cl
<BB_1611>
What is the molecular formula for <BB_1611>?
The molecular formula for <BB_1611> (COc1cccc(O)c1N.Cl) is C7H10ClNO2.
Describe the ring structures in building block <BB_1611>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1611>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1611>.
**Token:** <BB_1611> **SMILES:** COc1cccc(O)c1N.Cl **Molecular Formula:** C7H10ClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1612>.
Cl.Cl.NC(=O)CC1(N)CCNCC1
What is the building block token for the following molecule?
Cl.Cl.NC(=O)CC1(N)CCNCC1
<BB_1612>
What is the molecular formula for <BB_1612>?
The molecular formula for <BB_1612> (Cl.Cl.NC(=O)CC1(N)CCNCC1) is C7H17Cl2N3O.
Describe the ring structures in building block <BB_1612>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_1612>.
The molecule contains the following groups: Amine, Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1612>.
**Token:** <BB_1612> **SMILES:** Cl.Cl.NC(=O)CC1(N)CCNCC1 **Molecular Formula:** C7H17Cl2N3O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1613>.
Cl.NC[C@@H]1C[C@H]1C(=O)O
What is the building block token for the following molecule?
Cl.NC[C@@H]1C[C@H]1C(=O)O
<BB_1613>
What is the molecular formula for <BB_1613>?
The molecular formula for <BB_1613> (Cl.NC[C@@H]1C[C@H]1C(=O)O) is C5H10ClNO2.
Describe the ring structures in building block <BB_1613>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_1613>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1613>.
**Token:** <BB_1613> **SMILES:** Cl.NC[C@@H]1C[C@H]1C(=O)O **Molecular Formula:** C5H10ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1614>.
Cl.Cl.N#Cc1ccccc1NC1CCNCC1
What is the building block token for the following molecule?
Cl.Cl.N#Cc1ccccc1NC1CCNCC1
<BB_1614>
What is the molecular formula for <BB_1614>?
The molecular formula for <BB_1614> (Cl.Cl.N#Cc1ccccc1NC1CCNCC1) is C12H17Cl2N3.
Describe the ring structures in building block <BB_1614>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1614>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1614>.
**Token:** <BB_1614> **SMILES:** Cl.Cl.N#Cc1ccccc1NC1CCNCC1 **Molecular Formula:** C12H17Cl2N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1615>.
CC(C)(C)OC(=O)NC(C[C@@H]1CCCO1)C(=O)O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC(C[C@@H]1CCCO1)C(=O)O
<BB_1615>
What is the molecular formula for <BB_1615>?
The molecular formula for <BB_1615> (CC(C)(C)OC(=O)NC(C[C@@H]1CCCO1)C(=O)O) is C12H21NO5.
Describe the ring structures in building block <BB_1615>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1615>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_1615>.
**Token:** <BB_1615> **SMILES:** CC(C)(C)OC(=O)NC(C[C@@H]1CCCO1)C(=O)O **Molecular Formula:** C12H21NO5 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_1616>.
O=Cc1ccc(-c2ccc(Cl)cc2)nc1
What is the building block token for the following molecule?
O=Cc1ccc(-c2ccc(Cl)cc2)nc1
<BB_1616>
What is the molecular formula for <BB_1616>?
The molecular formula for <BB_1616> (O=Cc1ccc(-c2ccc(Cl)cc2)nc1) is C12H8ClNO.
Describe the ring structures in building block <BB_1616>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.