instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_1616>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1616>.
**Token:** <BB_1616> **SMILES:** O=Cc1ccc(-c2ccc(Cl)cc2)nc1 **Molecular Formula:** C12H8ClNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1617>.
O=C(O)C1OCCOC12CCC2
What is the building block token for the following molecule?
O=C(O)C1OCCOC12CCC2
<BB_1617>
What is the molecular formula for <BB_1617>?
The molecular formula for <BB_1617> (O=C(O)C1OCCOC12CCC2) is C8H12O4.
Describe the ring structures in building block <BB_1617>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_1617>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_1617>.
**Token:** <BB_1617> **SMILES:** O=C(O)C1OCCOC12CCC2 **Molecular Formula:** C8H12O4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_1618>.
c1ccc(Cn2ccnc2-c2nnn[nH]2)cc1
What is the building block token for the following molecule?
c1ccc(Cn2ccnc2-c2nnn[nH]2)cc1
<BB_1618>
What is the molecular formula for <BB_1618>?
The molecular formula for <BB_1618> (c1ccc(Cn2ccnc2-c2nnn[nH]2)cc1) is C11H10N6.
Describe the ring structures in building block <BB_1618>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_1618>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_1618>.
**Token:** <BB_1618> **SMILES:** c1ccc(Cn2ccnc2-c2nnn[nH]2)cc1 **Molecular Formula:** C11H10N6 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_1619>.
Cc1ccc(C(O)c2ccccn2)cc1[N+](=O)[O-]
What is the building block token for the following molecule?
Cc1ccc(C(O)c2ccccn2)cc1[N+](=O)[O-]
<BB_1619>
What is the molecular formula for <BB_1619>?
The molecular formula for <BB_1619> (Cc1ccc(C(O)c2ccccn2)cc1[N+](=O)[O-]) is C13H12N2O3.
Describe the ring structures in building block <BB_1619>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1619>.
The molecule contains the following groups: Tertiary Amine, Alcohol, Nitro.
Provide a comprehensive chemical profile for the building block <BB_1619>.
**Token:** <BB_1619> **SMILES:** Cc1ccc(C(O)c2ccccn2)cc1[N+](=O)[O-] **Molecular Formula:** C13H12N2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Alcohol, Nitro
Provide the SMILES representation for the building block token <BB_1620>.
N#Cc1ccc(Cl)c(N=C=S)c1
What is the building block token for the following molecule?
N#Cc1ccc(Cl)c(N=C=S)c1
<BB_1620>
What is the molecular formula for <BB_1620>?
The molecular formula for <BB_1620> (N#Cc1ccc(Cl)c(N=C=S)c1) is C8H3ClN2S.
Describe the ring structures in building block <BB_1620>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1620>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_1620>.
**Token:** <BB_1620> **SMILES:** N#Cc1ccc(Cl)c(N=C=S)c1 **Molecular Formula:** C8H3ClN2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_1621>.
CC(C)(C)OC(=O)COc1cc(Br)ccc1C=O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)COc1cc(Br)ccc1C=O
<BB_1621>
What is the molecular formula for <BB_1621>?
The molecular formula for <BB_1621> (CC(C)(C)OC(=O)COc1cc(Br)ccc1C=O) is C13H15BrO4.
Describe the ring structures in building block <BB_1621>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1621>.
The molecule contains the following groups: Ester, Aldehyde, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1621>.
**Token:** <BB_1621> **SMILES:** CC(C)(C)OC(=O)COc1cc(Br)ccc1C=O **Molecular Formula:** C13H15BrO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Aldehyde, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1622>.
Cl.Cl.NCCc1cc(N)[nH]n1
What is the building block token for the following molecule?
Cl.Cl.NCCc1cc(N)[nH]n1
<BB_1622>
What is the molecular formula for <BB_1622>?
The molecular formula for <BB_1622> (Cl.Cl.NCCc1cc(N)[nH]n1) is C5H12Cl2N4.
Describe the ring structures in building block <BB_1622>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1622>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1622>.
**Token:** <BB_1622> **SMILES:** Cl.Cl.NCCc1cc(N)[nH]n1 **Molecular Formula:** C5H12Cl2N4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1623>.
Cc1[nH]c(C(=O)O)c(C)c1Br
What is the building block token for the following molecule?
Cc1[nH]c(C(=O)O)c(C)c1Br
<BB_1623>
What is the molecular formula for <BB_1623>?
The molecular formula for <BB_1623> (Cc1[nH]c(C(=O)O)c(C)c1Br) is C7H8BrNO2.
Describe the ring structures in building block <BB_1623>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1623>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1623>.
**Token:** <BB_1623> **SMILES:** Cc1[nH]c(C(=O)O)c(C)c1Br **Molecular Formula:** C7H8BrNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1624>.
C1CO[C@H]2COC[C@H]2N1.Cl
What is the building block token for the following molecule?
C1CO[C@H]2COC[C@H]2N1.Cl
<BB_1624>
What is the molecular formula for <BB_1624>?
The molecular formula for <BB_1624> (C1CO[C@H]2COC[C@H]2N1.Cl) is C6H12ClNO2.
Describe the ring structures in building block <BB_1624>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_1624>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1624>.
**Token:** <BB_1624> **SMILES:** C1CO[C@H]2COC[C@H]2N1.Cl **Molecular Formula:** C6H12ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1625>.
O=C(CCl)c1c[nH]c(C(=O)C(Cl)(Cl)Cl)c1
What is the building block token for the following molecule?
O=C(CCl)c1c[nH]c(C(=O)C(Cl)(Cl)Cl)c1
<BB_1625>
What is the molecular formula for <BB_1625>?
The molecular formula for <BB_1625> (O=C(CCl)c1c[nH]c(C(=O)C(Cl)(Cl)Cl)c1) is C8H5Cl4NO2.
Describe the ring structures in building block <BB_1625>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_1625>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1625>.
**Token:** <BB_1625> **SMILES:** O=C(CCl)c1c[nH]c(C(=O)C(Cl)(Cl)Cl)c1 **Molecular Formula:** C8H5Cl4NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1626>.
CCCNc1cccc(F)c1N
What is the building block token for the following molecule?
CCCNc1cccc(F)c1N
<BB_1626>
What is the molecular formula for <BB_1626>?
The molecular formula for <BB_1626> (CCCNc1cccc(F)c1N) is C9H13FN2.
Describe the ring structures in building block <BB_1626>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1626>.
The molecule contains the following groups: Amine, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1626>.
**Token:** <BB_1626> **SMILES:** CCCNc1cccc(F)c1N **Molecular Formula:** C9H13FN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1627>.
Cc1ccc2c(c1)CC(C)(C)NC2=O
What is the building block token for the following molecule?
Cc1ccc2c(c1)CC(C)(C)NC2=O
<BB_1627>
What is the molecular formula for <BB_1627>?
The molecular formula for <BB_1627> (Cc1ccc2c(c1)CC(C)(C)NC2=O) is C12H15NO.
Describe the ring structures in building block <BB_1627>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_1627>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_1627>.
**Token:** <BB_1627> **SMILES:** Cc1ccc2c(c1)CC(C)(C)NC2=O **Molecular Formula:** C12H15NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_1628>.
O=C1OC(CF)C(CF)O1
What is the building block token for the following molecule?
O=C1OC(CF)C(CF)O1
<BB_1628>
What is the molecular formula for <BB_1628>?
The molecular formula for <BB_1628> (O=C1OC(CF)C(CF)O1) is C5H6F2O3.
Describe the ring structures in building block <BB_1628>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1628>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1628>.
**Token:** <BB_1628> **SMILES:** O=C1OC(CF)C(CF)O1 **Molecular Formula:** C5H6F2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1629>.
Cl.NCC1CCC(C(N)=O)O1
What is the building block token for the following molecule?
Cl.NCC1CCC(C(N)=O)O1
<BB_1629>
What is the molecular formula for <BB_1629>?
The molecular formula for <BB_1629> (Cl.NCC1CCC(C(N)=O)O1) is C6H13ClN2O2.
Describe the ring structures in building block <BB_1629>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_1629>.
The molecule contains the following groups: Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1629>.
**Token:** <BB_1629> **SMILES:** Cl.NCC1CCC(C(N)=O)O1 **Molecular Formula:** C6H13ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1630>.
CNC1CC(C(=O)OC)C1.Cl
What is the building block token for the following molecule?
CNC1CC(C(=O)OC)C1.Cl
<BB_1630>
What is the molecular formula for <BB_1630>?
The molecular formula for <BB_1630> (CNC1CC(C(=O)OC)C1.Cl) is C7H14ClNO2.
Describe the ring structures in building block <BB_1630>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_1630>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_1630>.
**Token:** <BB_1630> **SMILES:** CNC1CC(C(=O)OC)C1.Cl **Molecular Formula:** C7H14ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_1631>.
COC(=O)c1c[nH]c(=O)c2ncccc12
What is the building block token for the following molecule?
COC(=O)c1c[nH]c(=O)c2ncccc12
<BB_1631>
What is the molecular formula for <BB_1631>?
The molecular formula for <BB_1631> (COC(=O)c1c[nH]c(=O)c2ncccc12) is C10H8N2O3.
Describe the ring structures in building block <BB_1631>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_1631>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_1631>.
**Token:** <BB_1631> **SMILES:** COC(=O)c1c[nH]c(=O)c2ncccc12 **Molecular Formula:** C10H8N2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_1632>.
CC(C)(C)c1ccccc1CCC(=O)O
What is the building block token for the following molecule?
CC(C)(C)c1ccccc1CCC(=O)O
<BB_1632>
What is the molecular formula for <BB_1632>?
The molecular formula for <BB_1632> (CC(C)(C)c1ccccc1CCC(=O)O) is C13H18O2.
Describe the ring structures in building block <BB_1632>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_1632>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_1632>.
**Token:** <BB_1632> **SMILES:** CC(C)(C)c1ccccc1CCC(=O)O **Molecular Formula:** C13H18O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_1633>.
Cn1cccc1-c1cc(C(=O)O)[nH]n1
What is the building block token for the following molecule?
Cn1cccc1-c1cc(C(=O)O)[nH]n1
<BB_1633>