prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule O=C(C=Cc1ccco1)N1CC[C@@H]2CCCC[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C=Cc1ccc(I)o1)N1CC[C@@H]2CCCC[C@@H]21 | O=C(C=Cc1ccco1)N1CC[C@@H]2CCCC[C@@H]21 | O=C(C=Cc1ccc(I)o1)N1CC[C@@H]2CCCC[C@@H]21 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccc(I)o1",
"old_substring": "C=4c1ccco1"
} |
Can you make molecule O=C(C=Cc1ccco1)N1CC[C@@H]2CCCC[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C=Cc1ccc(Br)o1)N1CC[C@@H]2CCCC[C@@H]21 | O=C(C=Cc1ccco1)N1CC[C@@H]2CCCC[C@@H]21 | O=C(C=Cc1ccc(Br)o1)N1CC[C@@H]2CCCC[C@@H]21 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccc(Br)o1",
"old_substring": "C=4c1ccco1"
} |
Can you make molecule O=C(C=Cc1ccco1)N1CC[C@@H]2CCCC[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C=Cc1ccc(Cl)o1)N1CC[C@@H]2CCCC[C@@H]21 | O=C(C=Cc1ccco1)N1CC[C@@H]2CCCC[C@@H]21 | O=C(C=Cc1ccc(Cl)o1)N1CC[C@@H]2CCCC[C@@H]21 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccc(Cl)o1",
"old_substring": "C=4c1ccco1"
} |
Can you make molecule O=C(C=Cc1ccco1)N1CC[C@@H]2CCCC[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C=Cc1ccccc1I)N1CC[C@@H]2CCCC[C@@H]21 | O=C(C=Cc1ccco1)N1CC[C@@H]2CCCC[C@@H]21 | O=C(C=Cc1ccccc1I)N1CC[C@@H]2CCCC[C@@H]21 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccccc1I",
"old_substring": "C=4c1ccco1"
} |
Can you make molecule O=C(C=Cc1ccco1)N1CC[C@@H]2CCCC[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C=Cc1ccccc1F)N1CC[C@@H]2CCCC[C@@H]21 | O=C(C=Cc1ccco1)N1CC[C@@H]2CCCC[C@@H]21 | O=C(C=Cc1ccccc1F)N1CC[C@@H]2CCCC[C@@H]21 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccccc1F",
"old_substring": "C=4c1ccco1"
} |
Can you make molecule N#Cc1ccc(C=C2S[C@@H]3c4ccccc4C(=O)N3Cc3ccccc3C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C=C2S[C@@H]3c4ccccc4C(=O)N3Cc3ccccc3C2=O)cc1C | N#Cc1ccc(C=C2S[C@@H]3c4ccccc4C(=O)N3Cc3ccccc3C2=O)cc1 | Cc1ccc(C=C2S[C@@H]3c4ccccc4C(=O)N3Cc3ccccc3C2=O)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(C=&)cc1C",
"old_substring": "N#Cc1ccc(C=5)cc1"
} |
Can you make molecule N#Cc1ccc(C=C2S[C@@H]3c4ccccc4C(=O)N3Cc3ccccc3C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C=C2S[C@@H]3c4ccccc4C(=O)N3Cc3ccccc3C2=O)cc1F | N#Cc1ccc(C=C2S[C@@H]3c4ccccc4C(=O)N3Cc3ccccc3C2=O)cc1 | Cc1ccc(C=C2S[C@@H]3c4ccccc4C(=O)N3Cc3ccccc3C2=O)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(C=&)cc1F",
"old_substring": "N#Cc1ccc(C=5)cc1"
} |
Can you make molecule N#Cc1ccc(C=C2S[C@@H]3c4ccccc4C(=O)N3Cc3ccccc3C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC(=C1S[C@@H]2c3ccccc3C(=O)N2Cc2ccccc2C1=O)c1cccc(Cl)c1 | N#Cc1ccc(C=C2S[C@@H]3c4ccccc4C(=O)N3Cc3ccccc3C2=O)cc1 | N#CC(=C1S[C@@H]2c3ccccc3C(=O)N2Cc2ccccc2C1=O)c1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC=&c1cccc(Cl)c1",
"old_substring": "N#Cc1ccc(C=5)cc1"
} |
Can you make molecule N#Cc1ccc(C=C2S[C@@H]3c4ccccc4C(=O)N3Cc3ccccc3C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C=C2S[C@@H]3c4ccccc4C(=O)N3Cc3ccccc3C2=O)cc1Br | N#Cc1ccc(C=C2S[C@@H]3c4ccccc4C(=O)N3Cc3ccccc3C2=O)cc1 | Cc1ccc(C=C2S[C@@H]3c4ccccc4C(=O)N3Cc3ccccc3C2=O)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(C=&)cc1Br",
"old_substring": "N#Cc1ccc(C=5)cc1"
} |
Can you make molecule N#Cc1ccc(C=C2S[C@@H]3c4ccccc4C(=O)N3Cc3ccccc3C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C=C2S[C@@H]3c4ccccc4C(=O)N3Cc3ccccc3C2=O)c(C)c1 | N#Cc1ccc(C=C2S[C@@H]3c4ccccc4C(=O)N3Cc3ccccc3C2=O)cc1 | Cc1ccc(C=C2S[C@@H]3c4ccccc4C(=O)N3Cc3ccccc3C2=O)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccc(C)cc1C",
"old_substring": "N#Cc1ccc(C=5)cc1"
} |
Can you make molecule CC(C)C1(CNC(=O)N(C)C[C@H](C)O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C1(CNC(=O)N(C)C[C@@H](C)N=O)CC1 | CC(C)C1(CNC(=O)N(C)C[C@H](C)O)CC1 | CC(C)C1(CNC(=O)N(C)C[C@@H](C)N=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](C&)N=O",
"old_substring": "C5[C@H](C)O"
} |
Can you make molecule CC(C)C1(CNC(=O)N(C)C[C@H](C)O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C1(CNC(=O)N(C)C(=O)[C@@H](C)Cl)CC1 | CC(C)C1(CNC(=O)N(C)C[C@H](C)O)CC1 | CC(C)C1(CNC(=O)N(C)C(=O)[C@@H](C)Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](Cl)C&=O",
"old_substring": "C5[C@H](C)O"
} |
Can you make molecule CC(C)C1(CNC(=O)N(C)C[C@H](C)O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C1(CNC(=O)N(C)C[C@@H](C)CS)CC1 | CC(C)C1(CNC(=O)N(C)C[C@H](C)O)CC1 | CC(C)C1(CNC(=O)N(C)C[C@@H](C)CS)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](C&)CS",
"old_substring": "C5[C@H](C)O"
} |
Can you make molecule CC(C)C1(CNC(=O)N(C)C[C@H](C)O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C1(CNC(=O)N(C)C(=O)[C@@H](C)CCl)CC1 | CC(C)C1(CNC(=O)N(C)C[C@H](C)O)CC1 | CC(C)C1(CNC(=O)N(C)C(=O)[C@@H](C)CCl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CCl)C&=O",
"old_substring": "C5[C@H](C)O"
} |
Can you make molecule CC(C)C1(CNC(=O)N(C)C[C@H](C)O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C1(CNC(=O)N(C)C(=O)[C@H](C)Br)CC1 | CC(C)C1(CNC(=O)N(C)C[C@H](C)O)CC1 | CC(C)C1(CNC(=O)N(C)C(=O)[C@H](C)Br)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](Br)C&=O",
"old_substring": "C5[C@H](C)O"
} |
Can you make molecule [NH3+][C@@H](CCCCC(=O)[O-])c1ccc2[nH]c(=O)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]CCCCCC(=O)c1ccc2[nH]c(=O)[nH]c2c1 | [NH3+][C@@H](CCCCC(=O)[O-])c1ccc2[nH]c(=O)[nH]c2c1 | [NH3+]CCCCCC(=O)c1ccc2[nH]c(=O)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH3+]CCCCCC3=O",
"old_substring": "[NH3+][C@H]3CCCCC(=O)[O-]"
} |
Can you make molecule [NH3+][C@@H](CCCCC(=O)[O-])c1ccc2[nH]c(=O)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]CCCCc1ccc2[nH]c(=O)[nH]c2c1 | [NH3+][C@@H](CCCCC(=O)[O-])c1ccc2[nH]c(=O)[nH]c2c1 | [NH3+]CCCCc1ccc2[nH]c(=O)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH3+]CCCC3",
"old_substring": "[NH3+][C@H]3CCCCC(=O)[O-]"
} |
Can you make molecule [NH3+][C@@H](CCCCC(=O)[O-])c1ccc2[nH]c(=O)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H]([NH3+])Cc1ccc2[nH]c(=O)[nH]c2c1 | [NH3+][C@@H](CCCCC(=O)[O-])c1ccc2[nH]c(=O)[nH]c2c1 | CCCC[C@H]([NH3+])Cc1ccc2[nH]c(=O)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]([NH3+])C3",
"old_substring": "[NH3+][C@H]3CCCCC(=O)[O-]"
} |
Can you make molecule [NH3+][C@@H](CCCCC(=O)[O-])c1ccc2[nH]c(=O)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]([NH3+])CCc1ccc2[nH]c(=O)[nH]c2c1 | [NH3+][C@@H](CCCCC(=O)[O-])c1ccc2[nH]c(=O)[nH]c2c1 | CCC[C@H]([NH3+])CCc1ccc2[nH]c(=O)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]([NH3+])CC3",
"old_substring": "[NH3+][C@H]3CCCCC(=O)[O-]"
} |
Can you make molecule [NH3+][C@@H](CCCCC(=O)[O-])c1ccc2[nH]c(=O)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC([NH3+])(CC)C(=O)c1ccc2[nH]c(=O)[nH]c2c1 | [NH3+][C@@H](CCCCC(=O)[O-])c1ccc2[nH]c(=O)[nH]c2c1 | CCC([NH3+])(CC)C(=O)c1ccc2[nH]c(=O)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC([NH3+])(CC)C3=O",
"old_substring": "[NH3+][C@H]3CCCCC(=O)[O-]"
} |
Can you make molecule Cc1cc(C)nc([C@@H](C#N)C(=O)c2cn(CC(C)C)c3ccccc23)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)nc([C@H]2CC(Cc3cn(CC(C)C)c4ccccc34)=NO2)n1 | Cc1cc(C)nc([C@@H](C#N)C(=O)c2cn(CC(C)C)c3ccccc23)n1 | Cc1cc(C)nc([C@H]2CC(Cc3cn(CC(C)C)c4ccccc34)=NO2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC(C&)=NO1",
"old_substring": "[C@H]6(C#N)C4=O"
} |
Can you make molecule Cc1cc(C)nc([C@@H](C#N)C(=O)c2cn(CC(C)C)c3ccccc23)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)nc([C@@H](C)/C(O)=N/Cc2cn(CC(C)C)c3ccccc23)n1 | Cc1cc(C)nc([C@@H](C#N)C(=O)c2cn(CC(C)C)c3ccccc23)n1 | Cc1cc(C)nc([C@@H](C)/C(O)=N/Cc2cn(CC(C)C)c3ccccc23)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)/C(O)=N/C&",
"old_substring": "[C@H]6(C#N)C4=O"
} |
Can you make molecule Cc1cc(C)nc([C@@H](C#N)C(=O)c2cn(CC(C)C)c3ccccc23)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)nc([C@@H](CBr)CCc2cn(CC(C)C)c3ccccc23)n1 | Cc1cc(C)nc([C@@H](C#N)C(=O)c2cn(CC(C)C)c3ccccc23)n1 | Cc1cc(C)nc([C@@H](CBr)CCc2cn(CC(C)C)c3ccccc23)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]6(C#N)C4=O"
} |
Can you make molecule Cc1cc(C)nc([C@@H](C#N)C(=O)c2cn(CC(C)C)c3ccccc23)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)nc([C@@H](CBr)CCCc2cn(CC(C)C)c3ccccc23)n1 | Cc1cc(C)nc([C@@H](C#N)C(=O)c2cn(CC(C)C)c3ccccc23)n1 | Cc1cc(C)nc([C@@H](CBr)CCCc2cn(CC(C)C)c3ccccc23)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]6(C#N)C4=O"
} |
Can you make molecule Cc1cc(C)nc([C@@H](C#N)C(=O)c2cn(CC(C)C)c3ccccc23)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)nc([C@H]2SC(=O)N=C2Nc2cn(CC(C)C)c3ccccc23)n1 | Cc1cc(C)nc([C@@H](C#N)C(=O)c2cn(CC(C)C)c3ccccc23)n1 | Cc1cc(C)nc([C@H]2SC(=O)N=C2Nc2cn(CC(C)C)c3ccccc23)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&SC(=O)N=C1N&",
"old_substring": "[C@H]6(C#N)C4=O"
} |
Can you make molecule C=CCN(C(=O)c1cc(S(=O)(=O)N(C)C)oc1C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC1=C2CCN2CC(C(=O)c2cc(S(=O)(=O)N(C)C)oc2C)=NC(c2ccccc2)=N1 | C=CCN(C(=O)c1cc(S(=O)(=O)N(C)C)oc1C)c1ccccc1 | C=CCC1=C2CCN2CC(C(=O)c2cc(S(=O)(=O)N(C)C)oc2C)=NC(c2ccccc2)=N1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c&nc&nc2C1",
"old_substring": "N235"
} |
Can you make molecule C=CCN(C(=O)c1cc(S(=O)(=O)N(C)C)oc1C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC1=C2OCCN2CC(C(=O)c2cc(S(=O)(=O)N(C)C)oc2C)=CC(c2ccccc2)=C1 | C=CCN(C(=O)c1cc(S(=O)(=O)N(C)C)oc1C)c1ccccc1 | C=CCC1=C2OCCN2CC(C(=O)c2cc(S(=O)(=O)N(C)C)oc2C)=CC(c2ccccc2)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2c&cc&cc2C1",
"old_substring": "N235"
} |
Can you make molecule C=CCN(C(=O)c1cc(S(=O)(=O)N(C)C)oc1C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC1(c2ccccc2)CCN(C(=O)c2cc(S(=O)(=O)N(C)C)oc2C)C1 | C=CCN(C(=O)c1cc(S(=O)(=O)N(C)C)oc1C)c1ccccc1 | C=CCC1(c2ccccc2)CCN(C(=O)c2cc(S(=O)(=O)N(C)C)oc2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N235"
} |
Can you make molecule C=CCN(C(=O)c1cc(S(=O)(=O)N(C)C)oc1C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC1(c2ccccc2)CCCN(C(=O)c2cc(S(=O)(=O)N(C)C)oc2C)C1 | C=CCN(C(=O)c1cc(S(=O)(=O)N(C)C)oc1C)c1ccccc1 | C=CCC1(c2ccccc2)CCCN(C(=O)c2cc(S(=O)(=O)N(C)C)oc2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N235"
} |
Can you make molecule C=CCN(C(=O)c1cc(S(=O)(=O)N(C)C)oc1C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCc1oc(C(=O)c2cc(S(=O)(=O)N(C)C)oc2C)c(C#N)c1-c1ccccc1 | C=CCN(C(=O)c1cc(S(=O)(=O)N(C)C)oc1C)c1ccccc1 | C=CCc1oc(C(=O)c2cc(S(=O)(=O)N(C)C)oc2C)c(C#N)c1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N235"
} |
Can you make molecule C[C@@H](NC(=O)N[C@H](C)c1ccc(-c2ccccc2)cc1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1ccncc1)NC(=O)N[C@H](C)c1ccc(-c2ccccc2)cc1 | C[C@@H](NC(=O)N[C@H](C)c1ccc(-c2ccccc2)cc1)c1ccncc1 | C[C@H](CC(C)(C)c1ccncc1)NC(=O)N[C@H](C)c1ccc(-c2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@@H]57"
} |
Can you make molecule C[C@@H](NC(=O)N[C@H](C)c1ccc(-c2ccccc2)cc1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNC(=O)N[C@H](C)c1ccc(-c2ccccc2)cc1)CC(=O)c1ccncc1 | C[C@@H](NC(=O)N[C@H](C)c1ccc(-c2ccccc2)cc1)c1ccncc1 | C[C@@H](CCNC(=O)N[C@H](C)c1ccc(-c2ccccc2)cc1)CC(=O)c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@@H]57"
} |
Can you make molecule C[C@@H](NC(=O)N[C@H](C)c1ccc(-c2ccccc2)cc1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)NCC[C@H](Cl)c1ccncc1)c1ccc(-c2ccccc2)cc1 | C[C@@H](NC(=O)N[C@H](C)c1ccc(-c2ccccc2)cc1)c1ccncc1 | C[C@@H](NC(=O)NCC[C@H](Cl)c1ccncc1)c1ccc(-c2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "C[C@@H]57"
} |
Can you make molecule C[C@@H](NC(=O)N[C@H](C)c1ccc(-c2ccccc2)cc1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](CC(=O)c1ccncc1)NC(=O)N[C@H](C)c1ccc(-c2ccccc2)cc1 | C[C@@H](NC(=O)N[C@H](C)c1ccc(-c2ccccc2)cc1)c1ccncc1 | CCC[C@H](CC(=O)c1ccncc1)NC(=O)N[C@H](C)c1ccc(-c2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@@H]&CC&=O",
"old_substring": "C[C@@H]57"
} |
Can you make molecule C[C@@H](NC(=O)N[C@H](C)c1ccc(-c2ccccc2)cc1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CCc1ccncc1)NC(=O)N[C@H](C)c1ccc(-c2ccccc2)cc1 | C[C@@H](NC(=O)N[C@H](C)c1ccc(-c2ccccc2)cc1)c1ccncc1 | CC(C)[C@H](CCc1ccncc1)NC(=O)N[C@H](C)c1ccc(-c2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "C[C@@H]57"
} |
Can you make molecule Cc1cc(OCCN2C(=O)N[C@](C)(c3ccccn3)C2=O)ccc1C(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(OCCCCN2C(=O)N[C@](C)(c3ccccn3)C2=O)ccc1C(C)C | Cc1cc(OCCN2C(=O)N[C@](C)(c3ccccn3)C2=O)ccc1C(C)C | Cc1cc(OCCCCN2C(=O)N[C@](C)(c3ccccn3)C2=O)ccc1C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C4C6"
} |
Can you make molecule Cc1cc(OCCN2C(=O)N[C@](C)(c3ccccn3)C2=O)ccc1C(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(OCCCCCN2C(=O)N[C@](C)(c3ccccn3)C2=O)ccc1C(C)C | Cc1cc(OCCN2C(=O)N[C@](C)(c3ccccn3)C2=O)ccc1C(C)C | Cc1cc(OCCCCCN2C(=O)N[C@](C)(c3ccccn3)C2=O)ccc1C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4C6"
} |
Can you make molecule Cc1cc(OCCN2C(=O)N[C@](C)(c3ccccn3)C2=O)ccc1C(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(OC2CC(N3C(=O)N[C@](C)(c4ccccn4)C3=O)C2)ccc1C(C)C | Cc1cc(OCCN2C(=O)N[C@](C)(c3ccccn3)C2=O)ccc1C(C)C | Cc1cc(OC2CC(N3C(=O)N[C@](C)(c4ccccn4)C3=O)C2)ccc1C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C4C6"
} |
Can you make molecule Cc1cc(OCCN2C(=O)N[C@](C)(c3ccccn3)C2=O)ccc1C(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(O[C@@H](C)CCN2C(=O)N[C@](C)(c3ccccn3)C2=O)ccc1C(C)C | Cc1cc(OCCN2C(=O)N[C@](C)(c3ccccn3)C2=O)ccc1C(C)C | Cc1cc(O[C@@H](C)CCN2C(=O)N[C@](C)(c3ccccn3)C2=O)ccc1C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C4C6"
} |
Can you make molecule Cc1cc(OCCN2C(=O)N[C@](C)(c3ccccn3)C2=O)ccc1C(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(OC2CCC(N3C(=O)N[C@](C)(c4ccccn4)C3=O)CC2)ccc1C(C)C | Cc1cc(OCCN2C(=O)N[C@](C)(c3ccccn3)C2=O)ccc1C(C)C | Cc1cc(OC2CCC(N3C(=O)N[C@](C)(c4ccccn4)C3=O)CC2)ccc1C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C4C6"
} |
Can you make molecule FC(F)(F)c1nc2ccccc2n1CC1CC[NH2+]CC1 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)CCCc1nc2ccccc2n1CC1CC[NH2+]CC1 | FC(F)(F)c1nc2ccccc2n1CC1CC[NH2+]CC1 | FC(F)(F)CCCc1nc2ccccc2n1CC1CC[NH2+]CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "FC4(F)F"
} |
Can you make molecule FC(F)(F)c1nc2ccccc2n1CC1CC[NH2+]CC1 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)Sc1nc2ccccc2n1CC1CC[NH2+]CC1 | FC(F)(F)c1nc2ccccc2n1CC1CC[NH2+]CC1 | FC(F)(F)Sc1nc2ccccc2n1CC1CC[NH2+]CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "FC4(F)F"
} |
Can you make molecule FC(F)(F)c1nc2ccccc2n1CC1CC[NH2+]CC1 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)CCCCc1nc2ccccc2n1CC1CC[NH2+]CC1 | FC(F)(F)c1nc2ccccc2n1CC1CC[NH2+]CC1 | FC(F)(F)CCCCc1nc2ccccc2n1CC1CC[NH2+]CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "FC4(F)F"
} |
Can you make molecule FC(F)(F)c1nc2ccccc2n1CC1CC[NH2+]CC1 less soluble in water? The output molecule should be similar to the input molecule. | FC1(F)CCC(c2nc3ccccc3n2CC2CC[NH2+]CC2)CC1 | FC(F)(F)c1nc2ccccc2n1CC1CC[NH2+]CC1 | FC1(F)CCC(c2nc3ccccc3n2CC2CC[NH2+]CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC(F)(F)CC1",
"old_substring": "FC4(F)F"
} |
Can you make molecule FC(F)(F)c1nc2ccccc2n1CC1CC[NH2+]CC1 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)/C=C/Sc1nc2ccccc2n1CC1CC[NH2+]CC1 | FC(F)(F)c1nc2ccccc2n1CC1CC[NH2+]CC1 | FC(F)(F)/C=C/Sc1nc2ccccc2n1CC1CC[NH2+]CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&/C=C/C(F)(F)F",
"old_substring": "FC4(F)F"
} |
Can you make molecule C[C@H](Sc1ccc(F)c(F)c1)C(=O)N(C)[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Sc1ccc(F)c(F)c1)C(=O)n1cc(C#N)c([C@H]2CCS(=O)(=O)C2)n1 | C[C@H](Sc1ccc(F)c(F)c1)C(=O)N(C)[C@H]1CCS(=O)(=O)C1 | C[C@H](Sc1ccc(F)c(F)c1)C(=O)n1cc(C#N)c([C@H]2CCS(=O)(=O)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cn&nc1&",
"old_substring": "N24C"
} |
Can you make molecule C[C@H](Sc1ccc(F)c(F)c1)C(=O)N(C)[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Sc1ccc(F)c(F)c1)C(=O)c1nc(C#N)c([C@H]2CCS(=O)(=O)C2)o1 | C[C@H](Sc1ccc(F)c(F)c1)C(=O)N(C)[C@H]1CCS(=O)(=O)C1 | C[C@H](Sc1ccc(F)c(F)c1)C(=O)c1nc(C#N)c([C@H]2CCS(=O)(=O)C2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1nc&oc1&",
"old_substring": "N24C"
} |
Can you make molecule C[C@H](Sc1ccc(F)c(F)c1)C(=O)N(C)[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Sc1ccc(F)c(F)c1)C(=O)c1cc(C#N)c([C@H]2CCS(=O)(=O)C2)s1 | C[C@H](Sc1ccc(F)c(F)c1)C(=O)N(C)[C@H]1CCS(=O)(=O)C1 | C[C@H](Sc1ccc(F)c(F)c1)C(=O)c1cc(C#N)c([C@H]2CCS(=O)(=O)C2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N24C"
} |
Can you make molecule C[C@H](Sc1ccc(F)c(F)c1)C(=O)N(C)[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Sc1ccc(F)c(F)c1)C(=O)c1ccc([C@H]2CCS(=O)(=O)C2)c(C#N)c1 | C[C@H](Sc1ccc(F)c(F)c1)C(=O)N(C)[C@H]1CCS(=O)(=O)C1 | C[C@H](Sc1ccc(F)c(F)c1)C(=O)c1ccc([C@H]2CCS(=O)(=O)C2)c(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N24C"
} |
Can you make molecule C[C@H](Sc1ccc(F)c(F)c1)C(=O)N(C)[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Sc1ccc(F)c(F)c1)C(=O)ON=C1CCN([C@H]2CCS(=O)(=O)C2)CC1 | C[C@H](Sc1ccc(F)c(F)c1)C(=O)N(C)[C@H]1CCS(=O)(=O)C1 | C[C@H](Sc1ccc(F)c(F)c1)C(=O)ON=C1CCN([C@H]2CCS(=O)(=O)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N24C"
} |
Can you make molecule O=C(CSc1ccc(C(=O)N2CCCC2)cn1)c1ccc(O)cc1O less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SSc1ccc(C(=O)N2CCCC2)cn1)c1ccc(O)cc1O | O=C(CSc1ccc(C(=O)N2CCCC2)cn1)c1ccc(O)cc1O | O=C(/C=C/SSc1ccc(C(=O)N2CCCC2)cn1)c1ccc(O)cc1O | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C5C4"
} |
Can you make molecule O=C(CSc1ccc(C(=O)N2CCCC2)cn1)c1ccc(O)cc1O less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(Sc2ccc(C(=O)N3CCCC3)cn2)CC1)c1ccc(O)cc1O | O=C(CSc1ccc(C(=O)N2CCCC2)cn1)c1ccc(O)cc1O | O=C(NN=C1CCC(Sc2ccc(C(=O)N3CCCC3)cn2)CC1)c1ccc(O)cc1O | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C5C4"
} |
Can you make molecule O=C(CSc1ccc(C(=O)N2CCCC2)cn1)c1ccc(O)cc1O less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccc(SN2CC[C@@H](c3ccc(O)cc3O)CCC2=O)nc1)N1CCCC1 | O=C(CSc1ccc(C(=O)N2CCCC2)cn1)c1ccc(O)cc1O | O=C(c1ccc(SN2CC[C@@H](c3ccc(O)cc3O)CCC2=O)nc1)N1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1CC[C@H]&CCN1&",
"old_substring": "O=C5C4"
} |
Can you make molecule O=C(CSc1ccc(C(=O)N2CCCC2)cn1)c1ccc(O)cc1O less soluble in water? The output molecule should be similar to the input molecule. | O=C(C1=CC[C@H](Sc2ccc(C(=O)N3CCCC3)cn2)S1)c1ccc(O)cc1O | O=C(CSc1ccc(C(=O)N2CCCC2)cn1)c1ccc(O)cc1O | O=C(C1=CC[C@H](Sc2ccc(C(=O)N3CCCC3)cn2)S1)c1ccc(O)cc1O | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C5C4"
} |
Can you make molecule O=C(CSc1ccc(C(=O)N2CCCC2)cn1)c1ccc(O)cc1O less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=Cc1ccc(Sc2ccc(C(=O)N3CCCC3)cn2)cc1)c1ccc(O)cc1O | O=C(CSc1ccc(C(=O)N2CCCC2)cn1)c1ccc(O)cc1O | O=C(NN=Cc1ccc(Sc2ccc(C(=O)N3CCCC3)cn2)cc1)c1ccc(O)cc1O | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=Cc1ccc&cc1",
"old_substring": "O=C5C4"
} |
Can you make molecule N#Cc1ccc(OC2CCC(NC(=O)[C@@H]3CCOc4ccccc43)CC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(OC(=S)SC2CCC(NC(=O)[C@@H]3CCOc4ccccc43)CC2)nc1 | N#Cc1ccc(OC2CCC(NC(=O)[C@@H]3CCOc4ccccc43)CC2)nc1 | N#Cc1ccc(OC(=S)SC2CCC(NC(=O)[C@@H]3CCOc4ccccc43)CC2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O67"
} |
Can you make molecule N#Cc1ccc(OC2CCC(NC(=O)[C@@H]3CCOc4ccccc43)CC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(OC(=N)CC2CCC(NC(=O)[C@@H]3CCOc4ccccc43)CC2)nc1 | N#Cc1ccc(OC2CCC(NC(=O)[C@@H]3CCOc4ccccc43)CC2)nc1 | N#Cc1ccc(OC(=N)CC2CCC(NC(=O)[C@@H]3CCOc4ccccc43)CC2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O67"
} |
Can you make molecule N#Cc1ccc(OC2CCC(NC(=O)[C@@H]3CCOc4ccccc43)CC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(C(=O)CCC(=O)C2CCC(NC(=O)[C@@H]3CCOc4ccccc43)CC2)nc1 | N#Cc1ccc(OC2CCC(NC(=O)[C@@H]3CCOc4ccccc43)CC2)nc1 | N#Cc1ccc(C(=O)CCC(=O)C2CCC(NC(=O)[C@@H]3CCOc4ccccc43)CC2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O67"
} |
Can you make molecule N#Cc1ccc(OC2CCC(NC(=O)[C@@H]3CCOc4ccccc43)CC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc([C@H](O)CCC2CCC(NC(=O)[C@@H]3CCOc4ccccc43)CC2)nc1 | N#Cc1ccc(OC2CCC(NC(=O)[C@@H]3CCOc4ccccc43)CC2)nc1 | N#Cc1ccc([C@H](O)CCC2CCC(NC(=O)[C@@H]3CCOc4ccccc43)CC2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O67"
} |
Can you make molecule N#Cc1ccc(OC2CCC(NC(=O)[C@@H]3CCOc4ccccc43)CC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(C(=O)/C=C/SC2CCC(NC(=O)[C@@H]3CCOc4ccccc43)CC2)nc1 | N#Cc1ccc(OC2CCC(NC(=O)[C@@H]3CCOc4ccccc43)CC2)nc1 | N#Cc1ccc(C(=O)/C=C/SC2CCC(NC(=O)[C@@H]3CCOc4ccccc43)CC2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O67"
} |
Can you make molecule Cc1cc(-n2cc(CCCO)cn2)nc(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-n2cc(Br)c(CCCO)n2)nc(C)n1 | Cc1cc(-n2cc(CCCO)cn2)nc(C)n1 | Cc1cc(-n2cc(Br)c(CCCO)n2)nc(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc(Br)c&n1",
"old_substring": "n14cc3cn1"
} |
Can you make molecule Cc1cc(-n2cc(CCCO)cn2)nc(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-n2ccn(CCCO)c2=S)nc(C)n1 | Cc1cc(-n2cc(CCCO)cn2)nc(C)n1 | Cc1cc(-n2ccn(CCCO)c2=S)nc(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccn&c1=S",
"old_substring": "n14cc3cn1"
} |
Can you make molecule Cc1cc(-n2cc(CCCO)cn2)nc(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-n2cc3cc(CCCO)ccc3n2)nc(C)n1 | Cc1cc(-n2cc(CCCO)cn2)nc(C)n1 | Cc1cc(-n2cc3cc(CCCO)ccc3n2)nc(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc2cc&ccc2n1",
"old_substring": "n14cc3cn1"
} |
Can you make molecule Cc1cc(-n2cc(CCCO)cn2)nc(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-n2cc(CCCO)c3cccnc32)nc(C)n1 | Cc1cc(-n2cc(CCCO)cn2)nc(C)n1 | Cc1cc(-n2cc(CCCO)c3cccnc32)nc(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc&c2cccnc21",
"old_substring": "n14cc3cn1"
} |
Can you make molecule Cc1cc(-n2cc(CCCO)cn2)nc(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-n2ccc3nc(CCCO)ccc32)nc(C)n1 | Cc1cc(-n2cc(CCCO)cn2)nc(C)n1 | Cc1cc(-n2ccc3nc(CCCO)ccc32)nc(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccc2nc&ccc21",
"old_substring": "n14cc3cn1"
} |
Can you make molecule CCN[C@]1(C#N)CC[C@@H](Oc2cccc(COC)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCN[C@]1(C#N)CC[C@@H](Oc2ccc(COC)cc2I)C1 | CCN[C@]1(C#N)CC[C@@H](Oc2cccc(COC)c2)C1 | CCN[C@]1(C#N)CC[C@@H](Oc2ccc(COC)cc2I)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15cccc8c1"
} |
Can you make molecule CCN[C@]1(C#N)CC[C@@H](Oc2cccc(COC)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCN[C@]1(C#N)CC[C@@H](Oc2cc(COC)ccc2Br)C1 | CCN[C@]1(C#N)CC[C@@H](Oc2cccc(COC)c2)C1 | CCN[C@]1(C#N)CC[C@@H](Oc2cc(COC)ccc2Br)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15cccc8c1"
} |
Can you make molecule CCN[C@]1(C#N)CC[C@@H](Oc2cccc(COC)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCN[C@]1(C#N)CC[C@@H](Oc2ccc(COC)cc2Cl)C1 | CCN[C@]1(C#N)CC[C@@H](Oc2cccc(COC)c2)C1 | CCN[C@]1(C#N)CC[C@@H](Oc2ccc(COC)cc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15cccc8c1"
} |
Can you make molecule CCN[C@]1(C#N)CC[C@@H](Oc2cccc(COC)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCN[C@]1(C#N)CC[C@@H](Oc2cccc(COC)c2Br)C1 | CCN[C@]1(C#N)CC[C@@H](Oc2cccc(COC)c2)C1 | CCN[C@]1(C#N)CC[C@@H](Oc2cccc(COC)c2Br)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15cccc8c1"
} |
Can you make molecule CCN[C@]1(C#N)CC[C@@H](Oc2cccc(COC)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCN[C@]1(C#N)CC[C@@H](Oc2cccc(COC)c2Cl)C1 | CCN[C@]1(C#N)CC[C@@H](Oc2cccc(COC)c2)C1 | CCN[C@]1(C#N)CC[C@@H](Oc2cccc(COC)c2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15cccc8c1"
} |
Can you make molecule Cc1nc(CC(=O)NCCC[NH+]2CCCC[C@H]2C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(CC(=O)NCCCCC[NH+]2CCCC[C@H]2C)cs1 | Cc1nc(CC(=O)NCCC[NH+]2CCCC[C@H]2C)cs1 | Cc1nc(CC(=O)NCCCCC[NH+]2CCCC[C@H]2C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4CC5"
} |
Can you make molecule Cc1nc(CC(=O)NCCC[NH+]2CCCC[C@H]2C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(CC[NH+]1CCCC[C@H]1C)=NC(=O)Cc1csc(C)n1 | Cc1nc(CC(=O)NCCC[NH+]2CCCC[C@H]2C)cs1 | CC(CC[NH+]1CCCC[C@H]1C)=NC(=O)Cc1csc(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C4CC5"
} |
Can you make molecule Cc1nc(CC(=O)NCCC[NH+]2CCCC[C@H]2C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(CC(=O)NC2CCC([NH+]3CCCC[C@H]3C)CC2)cs1 | Cc1nc(CC(=O)NCCC[NH+]2CCCC[C@H]2C)cs1 | Cc1nc(CC(=O)NC2CCC([NH+]3CCCC[C@H]3C)CC2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C4CC5"
} |
Can you make molecule Cc1nc(CC(=O)NCCC[NH+]2CCCC[C@H]2C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(CC(=O)NCC(C)(C)C[NH+]2CCCC[C@H]2C)cs1 | Cc1nc(CC(=O)NCCC[NH+]2CCCC[C@H]2C)cs1 | Cc1nc(CC(=O)NCC(C)(C)C[NH+]2CCCC[C@H]2C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)C&",
"old_substring": "C4CC5"
} |
Can you make molecule Cc1nc(CC(=O)NCCC[NH+]2CCCC[C@H]2C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CC[NH+]1CCCC[C@H]1C)NC(=O)Cc1csc(C)n1 | Cc1nc(CC(=O)NCCC[NH+]2CCCC[C@H]2C)cs1 | CCC[C@@H](CC[NH+]1CCCC[C@H]1C)NC(=O)Cc1csc(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C4CC5"
} |
Can you make molecule CN(C)C1=C(C(=O)Nc2ccccc2)CSc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)C1=C(C(=O)Nc2ccccc2Cl)CSc2ccccc21 | CN(C)C1=C(C(=O)Nc2ccccc2)CSc2ccccc21 | CN(C)C1=C(C(=O)Nc2ccccc2Cl)CSc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c14ccccc1"
} |
Can you make molecule CN(C)C1=C(C(=O)Nc2ccccc2)CSc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)C1=C(C(=O)Nc2ccc(I)cc2)CSc2ccccc21 | CN(C)C1=C(C(=O)Nc2ccccc2)CSc2ccccc21 | CN(C)C1=C(C(=O)Nc2ccc(I)cc2)CSc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c14ccccc1"
} |
Can you make molecule CN(C)C1=C(C(=O)Nc2ccccc2)CSc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C2=C(N(C)C)c3ccccc3SC2)cc1I | CN(C)C1=C(C(=O)Nc2ccccc2)CSc2ccccc21 | Cc1ccc(NC(=O)C2=C(N(C)C)c3ccccc3SC2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c14ccccc1"
} |
Can you make molecule CN(C)C1=C(C(=O)Nc2ccccc2)CSc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)C1=C(C(=O)Nc2cccc(Br)c2)CSc2ccccc21 | CN(C)C1=C(C(=O)Nc2ccccc2)CSc2ccccc21 | CN(C)C1=C(C(=O)Nc2cccc(Br)c2)CSc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c14ccccc1"
} |
Can you make molecule CN(C)C1=C(C(=O)Nc2ccccc2)CSc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)C2=C(N(C)C)c3ccccc3SC2)c1C | CN(C)C1=C(C(=O)Nc2ccccc2)CSc2ccccc21 | Cc1cccc(NC(=O)C2=C(N(C)C)c3ccccc3SC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c14ccccc1"
} |
Can you make molecule COc1ccc(OC)c(CNC(=O)c2sccc2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)c(CNC(=O)c2sccc2Br)c1 | COc1ccc(OC)c(CNC(=O)c2sccc2C)c1 | COc1ccc(OC)c(CNC(=O)c2sccc2Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c17sccc1C"
} |
Can you make molecule COc1ccc(OC)c(CNC(=O)c2sccc2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)c(CNC(=O)c2scc3c2CCCC3)c1 | COc1ccc(OC)c(CNC(=O)c2sccc2C)c1 | COc1ccc(OC)c(CNC(=O)c2scc3c2CCCC3)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&scc2c1CCCC2",
"old_substring": "c17sccc1C"
} |
Can you make molecule COc1ccc(OC)c(CNC(=O)c2sccc2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)c(CNC(=O)c2sc3ccccc3c2C)c1 | COc1ccc(OC)c(CNC(=O)c2sccc2C)c1 | COc1ccc(OC)c(CNC(=O)c2sc3ccccc3c2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2ccccc2c1C",
"old_substring": "c17sccc1C"
} |
Can you make molecule COc1ccc(OC)c(CNC(=O)c2sccc2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)c(CNC(=O)c2sc3sccc3c2Cl)c1 | COc1ccc(OC)c(CNC(=O)c2sccc2C)c1 | COc1ccc(OC)c(CNC(=O)c2sc3sccc3c2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2sccc2c1Cl",
"old_substring": "c17sccc1C"
} |
Can you make molecule COc1ccc(OC)c(CNC(=O)c2sccc2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)c(CNC(=O)c2sc3ccccc3c2Cl)c1 | COc1ccc(OC)c(CNC(=O)c2sccc2C)c1 | COc1ccc(OC)c(CNC(=O)c2sc3ccccc3c2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2ccccc2c1Cl",
"old_substring": "c17sccc1C"
} |
Can you make molecule CC1(C[NH2+][C@@H]2CCc3c(O)cccc32)COC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC(C[NH2+][C@@H]2CCc3c(O)cccc32)C1 | CC1(C[NH2+][C@@H]2CCc3c(O)cccc32)COC1 | CC1CC(C[NH2+][C@@H]2CCc3c(O)cccc32)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1CC&C1",
"old_substring": "CC15COC1"
} |
Can you make molecule CC1(C[NH2+][C@@H]2CCc3c(O)cccc32)COC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C[NH2+][C@@H]2CCc3c(O)cccc32)CCOCC1 | CC1(C[NH2+][C@@H]2CCc3c(O)cccc32)COC1 | CC1(C[NH2+][C@@H]2CCc3c(O)cccc32)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&CCOCC1",
"old_substring": "CC15COC1"
} |
Can you make molecule CC1(C[NH2+][C@@H]2CCc3c(O)cccc32)COC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C[NH2+][C@@H]2CCc3c(O)cccc32)SCCS1 | CC1(C[NH2+][C@@H]2CCc3c(O)cccc32)COC1 | CC1(C[NH2+][C@@H]2CCc3c(O)cccc32)SCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&SCCS1",
"old_substring": "CC15COC1"
} |
Can you make molecule CC1(C[NH2+][C@@H]2CCc3c(O)cccc32)COC1 less soluble in water? The output molecule should be similar to the input molecule. | Oc1cccc2c1CC[C@H]2[NH2+]C=CC1CC1 | CC1(C[NH2+][C@@H]2CCc3c(O)cccc32)COC1 | Oc1cccc2c1CC[C@H]2[NH2+]C=CC1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&C1CC1",
"old_substring": "CC15COC1"
} |
Can you make molecule CC1(C[NH2+][C@@H]2CCc3c(O)cccc32)COC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=CCN(C[NH2+][C@@H]2CCc3c(O)cccc32)CC1 | CC1(C[NH2+][C@@H]2CCc3c(O)cccc32)COC1 | CC1=CCN(C[NH2+][C@@H]2CCc3c(O)cccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1=CCN&CC1",
"old_substring": "CC15COC1"
} |
Can you make molecule Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CCCCCCC1 | Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CCCCC1 | Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1",
"old_substring": "N14CCCCC1"
} |
Can you make molecule Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CCCCCCCC1 | Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CCCCC1 | Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CCCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCCC1",
"old_substring": "N14CCCCC1"
} |
Can you make molecule Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CCCC(C)(C)C1 | Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CCCCC1 | Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CCCC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(C)(C)C1",
"old_substring": "N14CCCCC1"
} |
Can you make molecule Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CCCC(C)(C)CC1 | Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CCCCC1 | Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CCCC(C)(C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(C)(C)CC1",
"old_substring": "N14CCCCC1"
} |
Can you make molecule Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CC2(CCCCC2)C1 | Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CCCCC1 | Cc1nc([C@@H]2CCCN(Cc3ccccc3)C2)ncc1C(=O)N1CC2(CCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC2(CCCCC2)C1",
"old_substring": "N14CCCCC1"
} |
Can you make molecule C[C@@H]1CCN(C(=O)Cc2cc(Cl)ccc2Br)C[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCN(C(=O)Cc2cc(Cl)cc(Cl)c2Br)C[C@@H]1O | C[C@@H]1CCN(C(=O)Cc2cc(Cl)ccc2Br)C[C@@H]1O | C[C@@H]1CCN(C(=O)Cc2cc(Cl)cc(Cl)c2Br)C[C@@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)cc(Cl)c1Br",
"old_substring": "c14cc(Cl)ccc1Br"
} |
Can you make molecule C[C@@H]1CCN(C(=O)Cc2cc(Cl)ccc2Br)C[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCN(C(=O)Cc2c(Br)cc(Cl)cc2Br)C[C@@H]1O | C[C@@H]1CCN(C(=O)Cc2cc(Cl)ccc2Br)C[C@@H]1O | C[C@@H]1CCN(C(=O)Cc2c(Br)cc(Cl)cc2Br)C[C@@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Br)cc(Cl)cc1Br",
"old_substring": "c14cc(Cl)ccc1Br"
} |
Can you make molecule C[C@@H]1CCN(C(=O)Cc2cc(Cl)ccc2Br)C[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCN(C(=O)Cc2c(Cl)cc(Br)cc2Cl)C[C@@H]1O | C[C@@H]1CCN(C(=O)Cc2cc(Cl)ccc2Br)C[C@@H]1O | C[C@@H]1CCN(C(=O)Cc2c(Cl)cc(Br)cc2Cl)C[C@@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc(Br)cc1Cl",
"old_substring": "c14cc(Cl)ccc1Br"
} |
Can you make molecule C[C@@H]1CCN(C(=O)Cc2cc(Cl)ccc2Br)C[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCN(C(=O)Cc2c(Cl)ccc(Cl)c2Cl)C[C@@H]1O | C[C@@H]1CCN(C(=O)Cc2cc(Cl)ccc2Br)C[C@@H]1O | C[C@@H]1CCN(C(=O)Cc2c(Cl)ccc(Cl)c2Cl)C[C@@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)ccc(Cl)c1Cl",
"old_substring": "c14cc(Cl)ccc1Br"
} |
Can you make molecule C[C@@H]1CCN(C(=O)Cc2cc(Cl)ccc2Br)C[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCN(C(=O)Cc2ccc(Cl)c(Cl)c2Cl)C[C@@H]1O | C[C@@H]1CCN(C(=O)Cc2cc(Cl)ccc2Br)C[C@@H]1O | C[C@@H]1CCN(C(=O)Cc2ccc(Cl)c(Cl)c2Cl)C[C@@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1Cl",
"old_substring": "c14cc(Cl)ccc1Br"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.