prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCC[C@H]1C(=O)N[C@@](C)(CC)C(=O)N1Cc1nc(C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[C@]1(C)NC(=O)[C@H](CCC)N(Cc2nc(C)cs2)C1=O | CCC[C@H]1C(=O)N[C@@](C)(CC)C(=O)N1Cc1nc(C)cs1 | C=CCC[C@]1(C)NC(=O)[C@H](CCC)N(Cc2nc(C)cs2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "C4C"
} |
Can you make molecule CCC[C@H]1C(=O)N[C@@](C)(CC)C(=O)N1Cc1nc(C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]1C(=O)N[C@@](C)(CCCCl)C(=O)N1Cc1nc(C)cs1 | CCC[C@H]1C(=O)N[C@@](C)(CC)C(=O)N1Cc1nc(C)cs1 | CCC[C@H]1C(=O)N[C@@](C)(CCCCl)C(=O)N1Cc1nc(C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "C4C"
} |
Can you make molecule CCC[C@H]1C(=O)N[C@@](C)(CC)C(=O)N1Cc1nc(C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]1C(=O)N[C@@](C)(CCCCS)C(=O)N1Cc1nc(C)cs1 | CCC[C@H]1C(=O)N[C@@](C)(CC)C(=O)N1Cc1nc(C)cs1 | CCC[C@H]1C(=O)N[C@@](C)(CCCCS)C(=O)N1Cc1nc(C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "C4C"
} |
Can you make molecule CCC[C@H]1C(=O)N[C@@](C)(CC)C(=O)N1Cc1nc(C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]1C(=O)N[C@@](C)(CCCBr)C(=O)N1Cc1nc(C)cs1 | CCC[C@H]1C(=O)N[C@@](C)(CC)C(=O)N1Cc1nc(C)cs1 | CCC[C@H]1C(=O)N[C@@](C)(CCCBr)C(=O)N1Cc1nc(C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "C4C"
} |
Can you make molecule CCC[C@H]1C(=O)N[C@@](C)(CC)C(=O)N1Cc1nc(C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]1C(=O)N[C@@](C)(CCCCF)C(=O)N1Cc1nc(C)cs1 | CCC[C@H]1C(=O)N[C@@](C)(CC)C(=O)N1Cc1nc(C)cs1 | CCC[C@H]1C(=O)N[C@@](C)(CCCCF)C(=O)N1Cc1nc(C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCF",
"old_substring": "C4C"
} |
Can you make molecule Cc1cc(C)n([C@H]2CCC[NH2+]C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n([C@H]2CNC[C@@H]2C)n1 | Cc1cc(C)n([C@H]2CCC[NH2+]C2)n1 | Cc1cc(C)n([C@H]2CNC[C@@H]2C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C[C@@H]1C",
"old_substring": "[C@H]13CCC[NH2+]C1"
} |
Can you make molecule Cc1cc(C)n([C@H]2CCC[NH2+]C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n([C@H]2C=CCC2)n1 | Cc1cc(C)n([C@H]2CCC[NH2+]C2)n1 | Cc1cc(C)n([C@H]2C=CCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@H]&C1",
"old_substring": "[C@H]13CCC[NH2+]C1"
} |
Can you make molecule Cc1cc(C)n([C@H]2CCC[NH2+]C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n(C2CCCCC2)n1 | Cc1cc(C)n([C@H]2CCC[NH2+]C2)n1 | Cc1cc(C)n(C2CCCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]13CCC[NH2+]C1"
} |
Can you make molecule Cc1cc(C)n([C@H]2CCC[NH2+]C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n([C@H]2C=CCC2)n1 | Cc1cc(C)n([C@H]2CCC[NH2+]C2)n1 | Cc1cc(C)n([C@H]2C=CCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@@H]&C1",
"old_substring": "[C@H]13CCC[NH2+]C1"
} |
Can you make molecule Cc1cc(C)n([C@H]2CCC[NH2+]C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n(C2CCCCCC2)n1 | Cc1cc(C)n([C@H]2CCC[NH2+]C2)n1 | Cc1cc(C)n(C2CCCCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&CC1",
"old_substring": "[C@H]13CCC[NH2+]C1"
} |
Can you make molecule C[C@H]1CCCN(C(=O)CNc2c(F)cccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(SC(=O)CNc2c(F)cccc2F)C1 | C[C@H]1CCCN(C(=O)CNc2c(F)cccc2F)C1 | C[C@H]1CCCN(SC(=O)CNc2c(F)cccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C4"
} |
Can you make molecule C[C@H]1CCCN(C(=O)CNc2c(F)cccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(C(=O)CCCC(=O)Nc2c(F)cccc2F)C1 | C[C@H]1CCCN(C(=O)CNc2c(F)cccc2F)C1 | C[C@H]1CCCN(C(=O)CCCC(=O)Nc2c(F)cccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C4"
} |
Can you make molecule C[C@H]1CCCN(C(=O)CNc2c(F)cccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(C(=O)CC(C)(C)Nc2c(F)cccc2F)C1 | C[C@H]1CCCN(C(=O)CNc2c(F)cccc2F)C1 | C[C@H]1CCCN(C(=O)CC(C)(C)Nc2c(F)cccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C4"
} |
Can you make molecule C[C@H]1CCCN(C(=O)CNc2c(F)cccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(C[S@+]([O-])CCCNc2c(F)cccc2F)C1 | C[C@H]1CCCN(C(=O)CNc2c(F)cccc2F)C1 | C[C@H]1CCCN(C[S@+]([O-])CCCNc2c(F)cccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C4"
} |
Can you make molecule C[C@H]1CCCN(C(=O)CNc2c(F)cccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(C(=O)CCC(C)(C)Nc2c(F)cccc2F)C1 | C[C@H]1CCCN(C(=O)CNc2c(F)cccc2F)C1 | C[C@H]1CCCN(C(=O)CCC(C)(C)Nc2c(F)cccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C4"
} |
Can you make molecule CCNC(=O)N1CC[C@@H]([NH2+][C@H](c2ccc(Br)cc2)C2CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)N1CC[C@@H]([NH2+][C@H]2CC[C@@](c3ccc(Br)cc3)(C3CC3)C2)C1 | CCNC(=O)N1CC[C@@H]([NH2+][C@H](c2ccc(Br)cc2)C2CC2)C1 | CCNC(=O)N1CC[C@@H]([NH2+][C@H]2CC[C@@](c3ccc(Br)cc3)(C3CC3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@]&&C1",
"old_substring": "[C@H]689"
} |
Can you make molecule CCNC(=O)N1CC[C@@H]([NH2+][C@H](c2ccc(Br)cc2)C2CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)N1CC[C@@H]([NH2+][C@H]2CC[C@](c3ccc(Br)cc3)(C3CC3)C2)C1 | CCNC(=O)N1CC[C@@H]([NH2+][C@H](c2ccc(Br)cc2)C2CC2)C1 | CCNC(=O)N1CC[C@@H]([NH2+][C@H]2CC[C@](c3ccc(Br)cc3)(C3CC3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@@]&&C1",
"old_substring": "[C@H]689"
} |
Can you make molecule CCNC(=O)N1CC[C@@H]([NH2+][C@H](c2ccc(Br)cc2)C2CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)N1CC[C@@H]([NH2+][C@@H](CCCC2CC2)C(C)(C)c2ccc(Br)cc2)C1 | CCNC(=O)N1CC[C@@H]([NH2+][C@H](c2ccc(Br)cc2)C2CC2)C1 | CCNC(=O)N1CC[C@@H]([NH2+][C@@H](CCCC2CC2)C(C)(C)c2ccc(Br)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCC&)C&(C)C",
"old_substring": "[C@H]689"
} |
Can you make molecule CCNC(=O)N1CC[C@@H]([NH2+][C@H](c2ccc(Br)cc2)C2CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)N1CC[C@@H]([NH2+][C@@H]2CCC[C@@](c3ccc(Br)cc3)(C3CC3)C2)C1 | CCNC(=O)N1CC[C@@H]([NH2+][C@H](c2ccc(Br)cc2)C2CC2)C1 | CCNC(=O)N1CC[C@@H]([NH2+][C@@H]2CCC[C@@](c3ccc(Br)cc3)(C3CC3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCC[C@]&&C1",
"old_substring": "[C@H]689"
} |
Can you make molecule CCNC(=O)N1CC[C@@H]([NH2+][C@H](c2ccc(Br)cc2)C2CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)N1CC[C@@H]([NH2+]CC[C@H](CC2CC2)C(=O)c2ccc(Br)cc2)C1 | CCNC(=O)N1CC[C@@H]([NH2+][C@H](c2ccc(Br)cc2)C2CC2)C1 | CCNC(=O)N1CC[C@@H]([NH2+]CC[C@H](CC2CC2)C(=O)c2ccc(Br)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@H](C&)C&=O",
"old_substring": "[C@H]689"
} |
Can you make molecule CC[C@H](CBr)C[C@H]1Cc2ccccc2S1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C[C@H](CC)[C@H]1Cc2ccccc2S1 | CC[C@H](CBr)C[C@H]1Cc2ccccc2S1 | CC[C@@H](C)C[C@H](CC)[C@H]1Cc2ccccc2S1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&C[C@H](C)CC",
"old_substring": "CC[C@@H](C3)CBr"
} |
Can you make molecule CC[C@H](CBr)C[C@H]1Cc2ccccc2S1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](Br)CC[C@H]1Cc2ccccc2S1 | CC[C@H](CBr)C[C@H]1Cc2ccccc2S1 | CCC[C@H](Br)CC[C@H]1Cc2ccccc2S1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H](Br)CC&",
"old_substring": "CC[C@@H](C3)CBr"
} |
Can you make molecule CC[C@H](CBr)C[C@H]1Cc2ccccc2S1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)CC[C@@H](CBr)[C@H]1Cc2ccccc2S1 | CC[C@H](CBr)C[C@H]1Cc2ccccc2S1 | CC(C)(C)CC[C@@H](CBr)[C@H]1Cc2ccccc2S1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)CC[C@H]&CBr",
"old_substring": "CC[C@@H](C3)CBr"
} |
Can you make molecule CC[C@H](CBr)C[C@H]1Cc2ccccc2S1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@H](Br)C[C@H]1Cc2ccccc2S1 | CC[C@H](CBr)C[C@H]1Cc2ccccc2S1 | CC(C)CC[C@H](Br)C[C@H]1Cc2ccccc2S1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](Br)CCC(C)C",
"old_substring": "CC[C@@H](C3)CBr"
} |
Can you make molecule CC[C@H](CBr)C[C@H]1Cc2ccccc2S1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H](CC)C[C@H]1Cc2ccccc2S1 | CC[C@H](CBr)C[C@H]1Cc2ccccc2S1 | CCCC[C@H](CC)C[C@H]1Cc2ccccc2S1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@@H](C&)CC",
"old_substring": "CC[C@@H](C3)CBr"
} |
Can you make molecule O=C(NNC(=O)[C@H]1Cc2ccccc2O1)[C@H]1COc2ccc(F)cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NNC(=O)[C@H]1Cc2ccccc2S1)[C@H]1COc2ccc(F)cc2C1 | O=C(NNC(=O)[C@H]1Cc2ccccc2O1)[C@H]1COc2ccc(F)cc2C1 | O=C(NNC(=O)[C@H]1Cc2ccccc2S1)[C@H]1COc2ccc(F)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&Cc2ccccc2S1",
"old_substring": "[C@H]13Cc2ccccc2O1"
} |
Can you make molecule O=C(NNC(=O)[C@H]1Cc2ccccc2O1)[C@H]1COc2ccc(F)cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NNC(=O)[C@@H]1Nc2ccccc2S1)[C@H]1COc2ccc(F)cc2C1 | O=C(NNC(=O)[C@H]1Cc2ccccc2O1)[C@H]1COc2ccc(F)cc2C1 | O=C(NNC(=O)[C@@H]1Nc2ccccc2S1)[C@H]1COc2ccc(F)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&Nc2ccccc2S1",
"old_substring": "[C@H]13Cc2ccccc2O1"
} |
Can you make molecule O=C(NNC(=O)[C@H]1Cc2ccccc2O1)[C@H]1COc2ccc(F)cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NNC(=O)[C@H]1COc2ccc(F)cc2C1)N[C@H]1CCc2ccccc21 | O=C(NNC(=O)[C@H]1Cc2ccccc2O1)[C@H]1COc2ccc(F)cc2C1 | O=C(NNC(=O)[C@H]1COc2ccc(F)cc2C1)N[C@H]1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N&[C@H]1CCc2ccccc21",
"old_substring": "[C@H]13Cc2ccccc2O1"
} |
Can you make molecule O=C(NNC(=O)[C@H]1Cc2ccccc2O1)[C@H]1COc2ccc(F)cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1Cc2cc(C(=O)NNC(=O)[C@H]3COc4ccc(F)cc4C3)ccc2O1 | O=C(NNC(=O)[C@H]1Cc2ccccc2O1)[C@H]1COc2ccc(F)cc2C1 | C[C@H]1Cc2cc(C(=O)NNC(=O)[C@H]3COc4ccc(F)cc4C3)ccc2O1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1Cc2cc&ccc2O1",
"old_substring": "[C@H]13Cc2ccccc2O1"
} |
Can you make molecule O=C(NNC(=O)[C@H]1Cc2ccccc2O1)[C@H]1COc2ccc(F)cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C[C@H]1Cc2ccccc21)NNC(=O)[C@H]1COc2ccc(F)cc2C1 | O=C(NNC(=O)[C@H]1Cc2ccccc2O1)[C@H]1COc2ccc(F)cc2C1 | O=C(C[C@H]1Cc2ccccc21)NNC(=O)[C@H]1COc2ccc(F)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@H]1Cc2ccccc21",
"old_substring": "[C@H]13Cc2ccccc2O1"
} |
Can you make molecule CCOC(=O)[C@]1(CC)O[C@]12CCCc1ccc(OC)cc12 less soluble in water? The output molecule should be similar to the input molecule. | CCSC(=S)OC(=O)[C@]1(CC)O[C@]12CCCc1ccc(OC)cc12 | CCOC(=O)[C@]1(CC)O[C@]12CCCc1ccc(OC)cc12 | CCSC(=S)OC(=O)[C@]1(CC)O[C@]12CCCc1ccc(OC)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O34"
} |
Can you make molecule CCOC(=O)[C@]1(CC)O[C@]12CCCc1ccc(OC)cc12 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=N)OC(=O)[C@]1(CC)O[C@]12CCCc1ccc(OC)cc12 | CCOC(=O)[C@]1(CC)O[C@]12CCCc1ccc(OC)cc12 | CCCC(=N)OC(=O)[C@]1(CC)O[C@]12CCCc1ccc(OC)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O34"
} |
Can you make molecule CCOC(=O)[C@]1(CC)O[C@]12CCCc1ccc(OC)cc12 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](O)C(=O)[C@]1(CC)O[C@]12CCCc1ccc(OC)cc12 | CCOC(=O)[C@]1(CC)O[C@]12CCCc1ccc(OC)cc12 | CCCC[C@@H](O)C(=O)[C@]1(CC)O[C@]12CCCc1ccc(OC)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O34"
} |
Can you make molecule CCOC(=O)[C@]1(CC)O[C@]12CCCc1ccc(OC)cc12 less soluble in water? The output molecule should be similar to the input molecule. | CCS/C=C/C(=O)C(=O)[C@]1(CC)O[C@]12CCCc1ccc(OC)cc12 | CCOC(=O)[C@]1(CC)O[C@]12CCCc1ccc(OC)cc12 | CCS/C=C/C(=O)C(=O)[C@]1(CC)O[C@]12CCCc1ccc(OC)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O34"
} |
Can you make molecule CCOC(=O)[C@]1(CC)O[C@]12CCCc1ccc(OC)cc12 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC[C@@H](O)C(=O)[C@]1(CC)O[C@]12CCCc1ccc(OC)cc12 | CCOC(=O)[C@]1(CC)O[C@]12CCCc1ccc(OC)cc12 | CCCCC[C@@H](O)C(=O)[C@]1(CC)O[C@]12CCCc1ccc(OC)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CCC&",
"old_substring": "O34"
} |
Can you make molecule CN(Cc1ccccc1N1CCOCC1)c1ccc(Cl)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc(N2CCC(Cc3ccccc3N3CCOCC3)CC2)nc1 | CN(Cc1ccccc1N1CCOCC1)c1ccc(Cl)cn1 | Clc1ccc(N2CCC(Cc3ccccc3N3CCOCC3)CC2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "CN23"
} |
Can you make molecule CN(Cc1ccccc1N1CCOCC1)c1ccc(Cl)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1ccccc1N1CCOCC1)C(=S)Sc1ccc(Cl)cn1 | CN(Cc1ccccc1N1CCOCC1)c1ccc(Cl)cn1 | CN(Cc1ccccc1N1CCOCC1)C(=S)Sc1ccc(Cl)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "CN23"
} |
Can you make molecule CN(Cc1ccccc1N1CCOCC1)c1ccc(Cl)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc(C2CCN(CCc3ccccc3N3CCOCC3)CC2)nc1 | CN(Cc1ccccc1N1CCOCC1)c1ccc(Cl)cn1 | Clc1ccc(C2CCN(CCc3ccccc3N3CCOCC3)CC2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "CN23"
} |
Can you make molecule CN(Cc1ccccc1N1CCOCC1)c1ccc(Cl)cn1 less soluble in water? The output molecule should be similar to the input molecule. | S=C1SCN(Cc2ccccc2N2CCOCC2)CN1c1ccc(Cl)cn1 | CN(Cc1ccccc1N1CCOCC1)c1ccc(Cl)cn1 | S=C1SCN(Cc2ccccc2N2CCOCC2)CN1c1ccc(Cl)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "S=C1SCN&CN1&",
"old_substring": "CN23"
} |
Can you make molecule CN(Cc1ccccc1N1CCOCC1)c1ccc(Cl)cn1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(Cc2ccccc2N2CCOCC2)CCC(c2ccc(Cl)cn2)CC1 | CN(Cc1ccccc1N1CCOCC1)c1ccc(Cl)cn1 | N#CC1(Cc2ccccc2N2CCOCC2)CCC(c2ccc(Cl)cn2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "CN23"
} |
Can you make molecule COc1cc(C)ccc1OCC(=O)NNC(=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(C)ccc1OCC(=O)NNC(=O)c1ccccc1 | COc1cc(C)ccc1OCC(=O)NNC(=O)c1ccccc1 | COCc1cc(C)ccc1OCC(=O)NNC(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(C)ccc1OCC(=O)NNC(=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc(C)ccc1OCC(=O)NNC(=O)c1ccccc1 | COc1cc(C)ccc1OCC(=O)NNC(=O)c1ccccc1 | COCSc1cc(C)ccc1OCC(=O)NNC(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(C)ccc1OCC(=O)NNC(=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1cc(C)ccc1OCC(=O)NNC(=O)c1ccccc1 | COc1cc(C)ccc1OCC(=O)NNC(=O)c1ccccc1 | CC(=O)Sc1cc(C)ccc1OCC(=O)NNC(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(C)ccc1OCC(=O)NNC(=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(OCC(=O)NNC(=O)c2ccccc2)c(C(=O)CS)c1 | COc1cc(C)ccc1OCC(=O)NNC(=O)c1ccccc1 | Cc1ccc(OCC(=O)NNC(=O)c2ccccc2)c(C(=O)CS)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(C)ccc1OCC(=O)NNC(=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(OCC(=O)NNC(=O)c2ccccc2)c(C(=O)CI)c1 | COc1cc(C)ccc1OCC(=O)NNC(=O)c1ccccc1 | Cc1ccc(OCC(=O)NNC(=O)c2ccccc2)c(C(=O)CI)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule CC[S@@+]([O-])CC(=O)Nc1cc(Cl)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)S(=O)(=O)Nc1cc(Cl)ccc1Cl | CC[S@@+]([O-])CC(=O)Nc1cc(Cl)ccc1Cl | CC[C@@H](C)S(=O)(=O)Nc1cc(Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](C)S&(=O)=O",
"old_substring": "CC[S@@](=O)CC2=O"
} |
Can you make molecule CC[S@@+]([O-])CC(=O)Nc1cc(Cl)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCCC[S@@+]([O-])CNc1cc(Cl)ccc1Cl | CC[S@@+]([O-])CC(=O)Nc1cc(Cl)ccc1Cl | CCCC[S@@+]([O-])CNc1cc(Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[S@@](=O)C&",
"old_substring": "CC[S@@](=O)CC2=O"
} |
Can you make molecule CC[S@@+]([O-])CC(=O)Nc1cc(Cl)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)S(=O)(=O)Nc1cc(Cl)ccc1Cl | CC[S@@+]([O-])CC(=O)Nc1cc(Cl)ccc1Cl | CC[C@H](C)S(=O)(=O)Nc1cc(Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C)S&(=O)=O",
"old_substring": "CC[S@@](=O)CC2=O"
} |
Can you make molecule CC[S@@+]([O-])CC(=O)Nc1cc(Cl)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCCC[S@+]([O-])CNc1cc(Cl)ccc1Cl | CC[S@@+]([O-])CC(=O)Nc1cc(Cl)ccc1Cl | CCCC[S@+]([O-])CNc1cc(Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[S@](=O)C&",
"old_substring": "CC[S@@](=O)CC2=O"
} |
Can you make molecule CC[S@@+]([O-])CC(=O)Nc1cc(Cl)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)CS(=O)(=O)Nc1cc(Cl)ccc1Cl | CC[S@@+]([O-])CC(=O)Nc1cc(Cl)ccc1Cl | CC[C@H](C)CS(=O)(=O)Nc1cc(Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C)CS&(=O)=O",
"old_substring": "CC[S@@](=O)CC2=O"
} |
Can you make molecule CCc1ccc(C(=O)CN2CCO[C@H](C#N)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(C(=O)CCCC(=O)N2CCO[C@H](C#N)C2)cc1 | CCc1ccc(C(=O)CN2CCO[C@H](C#N)C2)cc1 | CCc1ccc(C(=O)CCCC(=O)N2CCO[C@H](C#N)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C4(=O)C3"
} |
Can you make molecule CCc1ccc(C(=O)CN2CCO[C@H](C#N)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(C(=O)CC(C)(C)N2CCO[C@H](C#N)C2)cc1 | CCc1ccc(C(=O)CN2CCO[C@H](C#N)C2)cc1 | CCc1ccc(C(=O)CC(C)(C)N2CCO[C@H](C#N)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)C3"
} |
Can you make molecule CCc1ccc(C(=O)CN2CCO[C@H](C#N)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(C(=O)CCC(C)(C)N2CCO[C@H](C#N)C2)cc1 | CCc1ccc(C(=O)CN2CCO[C@H](C#N)C2)cc1 | CCc1ccc(C(=O)CCC(C)(C)N2CCO[C@H](C#N)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C4(=O)C3"
} |
Can you make molecule CCc1ccc(C(=O)CN2CCO[C@H](C#N)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(C(=O)C[C@H](C)N2CCO[C@H](C#N)C2)cc1 | CCc1ccc(C(=O)CN2CCO[C@H](C#N)C2)cc1 | CCc1ccc(C(=O)C[C@H](C)N2CCO[C@H](C#N)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@@H]&C",
"old_substring": "C4(=O)C3"
} |
Can you make molecule CCc1ccc(C(=O)CN2CCO[C@H](C#N)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(C(=O)C[C@@H](Br)N2CCO[C@H](C#N)C2)cc1 | CCc1ccc(C(=O)CN2CCO[C@H](C#N)C2)cc1 | CCc1ccc(C(=O)C[C@@H](Br)N2CCO[C@H](C#N)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C4(=O)C3"
} |
Can you make molecule Oc1ccccc1[C@@H]1C=C(c2ccc3c(c2)OCCO3)N=[NH+]1 less soluble in water? The output molecule should be similar to the input molecule. | Oc1cc(Br)cc([C@@H]2C=C(c3ccc4c(c3)OCCO4)N=[NH+]2)c1 | Oc1ccccc1[C@@H]1C=C(c2ccc3c(c2)OCCO3)N=[NH+]1 | Oc1cc(Br)cc([C@@H]2C=C(c3ccc4c(c3)OCCO4)N=[NH+]2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Oc1cc&cc(Br)c1",
"old_substring": "Oc1ccccc14"
} |
Can you make molecule Oc1ccccc1[C@@H]1C=C(c2ccc3c(c2)OCCO3)N=[NH+]1 less soluble in water? The output molecule should be similar to the input molecule. | Oc1ccc(Br)cc1[C@@H]1C=C(c2ccc3c(c2)OCCO3)N=[NH+]1 | Oc1ccccc1[C@@H]1C=C(c2ccc3c(c2)OCCO3)N=[NH+]1 | Oc1ccc(Br)cc1[C@@H]1C=C(c2ccc3c(c2)OCCO3)N=[NH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "Oc1ccc(Br)cc1&",
"old_substring": "Oc1ccccc14"
} |
Can you make molecule Oc1ccccc1[C@@H]1C=C(c2ccc3c(c2)OCCO3)N=[NH+]1 less soluble in water? The output molecule should be similar to the input molecule. | C1=C(c2ccc3c(c2)OCCO3)N=[NH+][C@@H]1c1ccccc1 | Oc1ccccc1[C@@H]1C=C(c2ccc3c(c2)OCCO3)N=[NH+]1 | C1=C(c2ccc3c(c2)OCCO3)N=[NH+][C@@H]1c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "Oc1ccccc14"
} |
Can you make molecule Oc1ccccc1[C@@H]1C=C(c2ccc3c(c2)OCCO3)N=[NH+]1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cccc([C@@H]2C=C(c3ccc4c(c3)OCCO4)N=[NH+]2)c1 | Oc1ccccc1[C@@H]1C=C(c2ccc3c(c2)OCCO3)N=[NH+]1 | Fc1cccc([C@@H]2C=C(c3ccc4c(c3)OCCO4)N=[NH+]2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Fc1cccc&c1",
"old_substring": "Oc1ccccc14"
} |
Can you make molecule Oc1ccccc1[C@@H]1C=C(c2ccc3c(c2)OCCO3)N=[NH+]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@@H]2C=C(c3ccc4c(c3)OCCO4)N=[NH+]2)c1 | Oc1ccccc1[C@@H]1C=C(c2ccc3c(c2)OCCO3)N=[NH+]1 | Cc1cccc([C@@H]2C=C(c3ccc4c(c3)OCCO4)N=[NH+]2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cccc&c1",
"old_substring": "Oc1ccccc14"
} |
Can you make molecule CC(C)(C)CS(=O)(=O)/N=C(\[O-])Cc1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)CS(=O)(=O)/N=C(\[O-])Cc1ccc(Cl)s1 | CC(C)(C)CS(=O)(=O)/N=C(\[O-])Cc1cccs1 | CC(C)(C)CS(=O)(=O)/N=C(\[O-])Cc1ccc(Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c12cccs1"
} |
Can you make molecule CC(C)(C)CS(=O)(=O)/N=C(\[O-])Cc1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)CS(=O)(=O)/N=C(\[O-])Cc1ccc(Br)s1 | CC(C)(C)CS(=O)(=O)/N=C(\[O-])Cc1cccs1 | CC(C)(C)CS(=O)(=O)/N=C(\[O-])Cc1ccc(Br)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c12cccs1"
} |
Can you make molecule CC(C)(C)CS(=O)(=O)/N=C(\[O-])Cc1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)CS(=O)(=O)/N=C(\[O-])Cc1scc2c1CCCC2 | CC(C)(C)CS(=O)(=O)/N=C(\[O-])Cc1cccs1 | CC(C)(C)CS(=O)(=O)/N=C(\[O-])Cc1scc2c1CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&scc2c1CCCC2",
"old_substring": "c12cccs1"
} |
Can you make molecule CC(C)(C)CS(=O)(=O)/N=C(\[O-])Cc1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)CS(=O)(=O)/N=C(\[O-])Cc1sccc1Br | CC(C)(C)CS(=O)(=O)/N=C(\[O-])Cc1cccs1 | CC(C)(C)CS(=O)(=O)/N=C(\[O-])Cc1sccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c12cccs1"
} |
Can you make molecule CC(C)(C)CS(=O)(=O)/N=C(\[O-])Cc1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C/C([O-])=N/S(=O)(=O)CC(C)(C)C)sc2ccccc12 | CC(C)(C)CS(=O)(=O)/N=C(\[O-])Cc1cccs1 | Cc1c(C/C([O-])=N/S(=O)(=O)CC(C)(C)C)sc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2ccccc2c1C",
"old_substring": "c12cccs1"
} |
Can you make molecule COc1ccc(OC)c2sc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)nc12 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(OC)c2sc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)nc12 | COc1ccc(OC)c2sc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)nc12 | COCc1ccc(OC)c2sc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)nc12 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO7"
} |
Can you make molecule COc1ccc(OC)c2sc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)nc12 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(OC)c2sc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)nc12 | COc1ccc(OC)c2sc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)nc12 | COCSc1ccc(OC)c2sc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)nc12 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO7"
} |
Can you make molecule COc1ccc(OC)c2sc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)nc12 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(SC(C)=O)c2nc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)sc12 | COc1ccc(OC)c2sc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)nc12 | COc1ccc(SC(C)=O)c2nc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)sc12 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO7"
} |
Can you make molecule COc1ccc(OC)c2sc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)nc12 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)CS)c2nc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)sc12 | COc1ccc(OC)c2sc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)nc12 | COc1ccc(C(=O)CS)c2nc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)sc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO7"
} |
Can you make molecule COc1ccc(OC)c2sc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)nc12 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)CI)c2nc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)sc12 | COc1ccc(OC)c2sc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)nc12 | COc1ccc(C(=O)CI)c2nc(NC(=O)c3cc4c(ccc5ccccc54)oc3=O)sc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO7"
} |
Can you make molecule Cc1ccc(O)c(C(=O)NC[C@H]2CCC[C@@H](O)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(O)c(C(=O)NCSC[C@H]2CCC[C@@H](O)C2)c1 | Cc1ccc(O)c(C(=O)NC[C@H]2CCC[C@@H](O)C2)c1 | Cc1ccc(O)c(C(=O)NCSC[C@H]2CCC[C@@H](O)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N34"
} |
Can you make molecule Cc1ccc(O)c(C(=O)NC[C@H]2CCC[C@@H](O)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(O)c(C(=O)N2CC(C[C@H]3CCC[C@@H](O)C3)C2)c1 | Cc1ccc(O)c(C(=O)NC[C@H]2CCC[C@@H](O)C2)c1 | Cc1ccc(O)c(C(=O)N2CC(C[C@H]3CCC[C@@H](O)C3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N34"
} |
Can you make molecule Cc1ccc(O)c(C(=O)NC[C@H]2CCC[C@@H](O)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(O)c(C(=O)NC(=N)SC[C@H]2CCC[C@@H](O)C2)c1 | Cc1ccc(O)c(C(=O)NC[C@H]2CCC[C@@H](O)C2)c1 | Cc1ccc(O)c(C(=O)NC(=N)SC[C@H]2CCC[C@@H](O)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N34"
} |
Can you make molecule Cc1ccc(O)c(C(=O)NC[C@H]2CCC[C@@H](O)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(O)c(C(=O)c2nsc(C[C@H]3CCC[C@@H](O)C3)c2N)c1 | Cc1ccc(O)c(C(=O)NC[C@H]2CCC[C@@H](O)C2)c1 | Cc1ccc(O)c(C(=O)c2nsc(C[C@H]3CCC[C@@H](O)C3)c2N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N34"
} |
Can you make molecule Cc1ccc(O)c(C(=O)NC[C@H]2CCC[C@@H](O)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(O)c(C(=O)N(C)C(=S)SC[C@H]2CCC[C@@H](O)C2)c1 | Cc1ccc(O)c(C(=O)NC[C@H]2CCC[C@@H](O)C2)c1 | Cc1ccc(O)c(C(=O)N(C)C(=S)SC[C@H]2CCC[C@@H](O)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N34"
} |
Can you make molecule O=C(c1cc(=O)c2cc(Cl)ccc2o1)N1CCN([C@H]2CCS(=O)(=O)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C=CO[C@@H](N2CCN(C(=O)c3cc(=O)c4cc(Cl)ccc4o3)CC2)C1 | O=C(c1cc(=O)c2cc(Cl)ccc2o1)N1CCN([C@H]2CCS(=O)(=O)C2)CC1 | O=C1C=CO[C@@H](N2CCN(C(=O)c3cc(=O)c4cc(Cl)ccc4o3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC(=O)C=CO1",
"old_substring": "[C@H]14CCS(=O)(=O)C1"
} |
Can you make molecule O=C(c1cc(=O)c2cc(Cl)ccc2o1)N1CCN([C@H]2CCS(=O)(=O)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@@H](N2CCN(C(=O)c3cc(=O)c4cc(Cl)ccc4o3)CC2)CS1 | O=C(c1cc(=O)c2cc(Cl)ccc2o1)N1CCN([C@H]2CCS(=O)(=O)C2)CC1 | O=C1C[C@@H](N2CCN(C(=O)c3cc(=O)c4cc(Cl)ccc4o3)CC2)CS1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CSC(=O)C1",
"old_substring": "[C@H]14CCS(=O)(=O)C1"
} |
Can you make molecule O=C(c1cc(=O)c2cc(Cl)ccc2o1)N1CCN([C@H]2CCS(=O)(=O)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1cc(=O)c2cc(Cl)ccc2o1)N1CCN([C@H]2CC=CS2)CC1 | O=C(c1cc(=O)c2cc(Cl)ccc2o1)N1CCN([C@H]2CCS(=O)(=O)C2)CC1 | O=C(c1cc(=O)c2cc(Cl)ccc2o1)N1CCN([C@H]2CC=CS2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC=CS1",
"old_substring": "[C@H]14CCS(=O)(=O)C1"
} |
Can you make molecule O=C(c1cc(=O)c2cc(Cl)ccc2o1)N1CCN([C@H]2CCS(=O)(=O)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | N=C1C=C[C@H](N2CCN(C(=O)c3cc(=O)c4cc(Cl)ccc4o3)CC2)S1 | O=C(c1cc(=O)c2cc(Cl)ccc2o1)N1CCN([C@H]2CCS(=O)(=O)C2)CC1 | N=C1C=C[C@H](N2CCN(C(=O)c3cc(=O)c4cc(Cl)ccc4o3)CC2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=CC(=N)S1",
"old_substring": "[C@H]14CCS(=O)(=O)C1"
} |
Can you make molecule O=C(c1cc(=O)c2cc(Cl)ccc2o1)N1CCN([C@H]2CCS(=O)(=O)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C)[C@@H](N2CCN(C(=O)c3cc(=O)c4cc(Cl)ccc4o3)CC2)N=N1 | O=C(c1cc(=O)c2cc(Cl)ccc2o1)N1CCN([C@H]2CCS(=O)(=O)C2)CC1 | CC1=C(C)[C@@H](N2CCN(C(=O)c3cc(=O)c4cc(Cl)ccc4o3)CC2)N=N1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&N=NC(C)=C1C",
"old_substring": "[C@H]14CCS(=O)(=O)C1"
} |
Can you make molecule COc1ccc(/C=N/NC(=O)c2cccnc2)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(/C=N/NC(=O)c2ccccc2)cc1[N+](=O)[O-] | COc1ccc(/C=N/NC(=O)c2cccnc2)cc1[N+](=O)[O-] | COc1ccc(/C=N/NC(=O)c2ccccc2)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c14cccnc1"
} |
Can you make molecule COc1ccc(/C=N/NC(=O)c2cccnc2)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(/C=N/NC(=O)c2ccc(I)nc2)cc1[N+](=O)[O-] | COc1ccc(/C=N/NC(=O)c2cccnc2)cc1[N+](=O)[O-] | COc1ccc(/C=N/NC(=O)c2ccc(I)nc2)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)nc1",
"old_substring": "c14cccnc1"
} |
Can you make molecule COc1ccc(/C=N/NC(=O)c2cccnc2)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(/C=N/NC(=O)c2cc3cnsc3s2)cc1[N+](=O)[O-] | COc1ccc(/C=N/NC(=O)c2cccnc2)cc1[N+](=O)[O-] | COc1ccc(/C=N/NC(=O)c2cc3cnsc3s2)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cnsc2s1",
"old_substring": "c14cccnc1"
} |
Can you make molecule COc1ccc(/C=N/NC(=O)c2cccnc2)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(/C=N/NC(=O)c2ccc(C)nc2C)cc1[N+](=O)[O-] | COc1ccc(/C=N/NC(=O)c2cccnc2)cc1[N+](=O)[O-] | COc1ccc(/C=N/NC(=O)c2ccc(C)nc2C)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)nc1C",
"old_substring": "c14cccnc1"
} |
Can you make molecule COc1ccc(/C=N/NC(=O)c2cccnc2)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(/C=N/NC(=O)c2ccncc2Cl)cc1[N+](=O)[O-] | COc1ccc(/C=N/NC(=O)c2cccnc2)cc1[N+](=O)[O-] | COc1ccc(/C=N/NC(=O)c2ccncc2Cl)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c14cccnc1"
} |
Can you make molecule O=Cc1cn([C@H]2CCS(=O)(=O)C2)nc1-c1ccoc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1cn([C@H]2CC(=O)C=CO2)nc1-c1ccoc1 | O=Cc1cn([C@H]2CCS(=O)(=O)C2)nc1-c1ccoc1 | O=Cc1cn([C@H]2CC(=O)C=CO2)nc1-c1ccoc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC(=O)C=CO1",
"old_substring": "[C@H]13CCS(=O)(=O)C1"
} |
Can you make molecule O=Cc1cn([C@H]2CCS(=O)(=O)C2)nc1-c1ccoc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1cn([C@H]2CSC(=O)C2)nc1-c1ccoc1 | O=Cc1cn([C@H]2CCS(=O)(=O)C2)nc1-c1ccoc1 | O=Cc1cn([C@H]2CSC(=O)C2)nc1-c1ccoc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CSC(=O)C1",
"old_substring": "[C@H]13CCS(=O)(=O)C1"
} |
Can you make molecule O=Cc1cn([C@H]2CCS(=O)(=O)C2)nc1-c1ccoc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1cn([C@H]2CC=CS2)nc1-c1ccoc1 | O=Cc1cn([C@H]2CCS(=O)(=O)C2)nc1-c1ccoc1 | O=Cc1cn([C@H]2CC=CS2)nc1-c1ccoc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC=CS1",
"old_substring": "[C@H]13CCS(=O)(=O)C1"
} |
Can you make molecule O=Cc1cn([C@H]2CCS(=O)(=O)C2)nc1-c1ccoc1 less soluble in water? The output molecule should be similar to the input molecule. | N=C1C=C[C@H](n2cc(C=O)c(-c3ccoc3)n2)S1 | O=Cc1cn([C@H]2CCS(=O)(=O)C2)nc1-c1ccoc1 | N=C1C=C[C@H](n2cc(C=O)c(-c3ccoc3)n2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=CC(=N)S1",
"old_substring": "[C@H]13CCS(=O)(=O)C1"
} |
Can you make molecule O=Cc1cn([C@H]2CCS(=O)(=O)C2)nc1-c1ccoc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C)[C@@H](n2cc(C=O)c(-c3ccoc3)n2)N=N1 | O=Cc1cn([C@H]2CCS(=O)(=O)C2)nc1-c1ccoc1 | CC1=C(C)[C@@H](n2cc(C=O)c(-c3ccoc3)n2)N=N1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&N=NC(C)=C1C",
"old_substring": "[C@H]13CCS(=O)(=O)C1"
} |
Can you make molecule Cc1cc(C(=O)C(C#N)=Cc2cn(C)nc2C(C)(C)C)c(C)n1CC(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)C(C#N)=Cc2cn(C)nc2C(C)(C)C)c(C)n1CCCC(F)(F)F | Cc1cc(C(=O)C(C#N)=Cc2cn(C)nc2C(C)(C)C)c(C)n1CC(F)(F)F | Cc1cc(C(=O)C(C#N)=Cc2cn(C)nc2C(C)(C)C)c(C)n1CCCC(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C5C(F)(F)F"
} |
Can you make molecule Cc1cc(C(=O)C(C#N)=Cc2cn(C)nc2C(C)(C)C)c(C)n1CC(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)C(C#N)=Cc2cn(C)nc2C(C)(C)C)c(C)n1CCCCC(F)(F)F | Cc1cc(C(=O)C(C#N)=Cc2cn(C)nc2C(C)(C)C)c(C)n1CC(F)(F)F | Cc1cc(C(=O)C(C#N)=Cc2cn(C)nc2C(C)(C)C)c(C)n1CCCCC(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C5C(F)(F)F"
} |
Can you make molecule Cc1cc(C(=O)C(C#N)=Cc2cn(C)nc2C(C)(C)C)c(C)n1CC(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)C(C#N)=Cc2cn(C)nc2C(C)(C)C)c(C)n1S/C=C/C(F)(F)F | Cc1cc(C(=O)C(C#N)=Cc2cn(C)nc2C(C)(C)C)c(C)n1CC(F)(F)F | Cc1cc(C(=O)C(C#N)=Cc2cn(C)nc2C(C)(C)C)c(C)n1S/C=C/C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "S&/C=C/C(F)(F)F",
"old_substring": "C5C(F)(F)F"
} |
Can you make molecule Cc1cc(C(=O)C(C#N)=Cc2cn(C)nc2C(C)(C)C)c(C)n1CC(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)C(C#N)=Cc2cn(C)nc2C(C)(C)C)c(C)n1CC(F)(F)C(F)(F)F | Cc1cc(C(=O)C(C#N)=Cc2cn(C)nc2C(C)(C)C)c(C)n1CC(F)(F)F | Cc1cc(C(=O)C(C#N)=Cc2cn(C)nc2C(C)(C)C)c(C)n1CC(F)(F)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C5C(F)(F)F"
} |
Can you make molecule Cc1cc(C(=O)C(C#N)=Cc2cn(C)nc2C(C)(C)C)c(C)n1CC(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)C(C#N)=Cc2cn(C)nc2C(C)(C)C)c(C)n1C1CCC(F)(F)CC1 | Cc1cc(C(=O)C(C#N)=Cc2cn(C)nc2C(C)(C)C)c(C)n1CC(F)(F)F | Cc1cc(C(=O)C(C#N)=Cc2cn(C)nc2C(C)(C)C)c(C)n1C1CCC(F)(F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC(F)(F)CC1",
"old_substring": "C5C(F)(F)F"
} |
Can you make molecule C/[NH+]=C(/NCc1[nH+]ccn1CC(C)C)N1C[C@H]2CC=CC[C@@H]2C1 less soluble in water? The output molecule should be similar to the input molecule. | C/[NH+]=C(/NCc1[nH+]ccn1C(C)(C)CCBr)N1C[C@H]2CC=CC[C@@H]2C1 | C/[NH+]=C(/NCc1[nH+]ccn1CC(C)C)N1C[C@H]2CC=CC[C@@H]2C1 | C/[NH+]=C(/NCc1[nH+]ccn1C(C)(C)CCBr)N1C[C@H]2CC=CC[C@@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC&(C)CCBr",
"old_substring": "C4C(C)C"
} |
Can you make molecule C/[NH+]=C(/NCc1[nH+]ccn1CC(C)C)N1C[C@H]2CC=CC[C@@H]2C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)n1cc[nH+]c1CN/C(=[NH+]/C)N1C[C@H]2CC=CC[C@@H]2C1 | C/[NH+]=C(/NCc1[nH+]ccn1CC(C)C)N1C[C@H]2CC=CC[C@@H]2C1 | CCCC(C)(C)n1cc[nH+]c1CN/C(=[NH+]/C)N1C[C@H]2CC=CC[C@@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "C4C(C)C"
} |
Can you make molecule C/[NH+]=C(/NCc1[nH+]ccn1CC(C)C)N1C[C@H]2CC=CC[C@@H]2C1 less soluble in water? The output molecule should be similar to the input molecule. | C/[NH+]=C(/NCc1[nH+]ccn1CC(C)(C)CBr)N1C[C@H]2CC=CC[C@@H]2C1 | C/[NH+]=C(/NCc1[nH+]ccn1CC(C)C)N1C[C@H]2CC=CC[C@@H]2C1 | C/[NH+]=C(/NCc1[nH+]ccn1CC(C)(C)CBr)N1C[C@H]2CC=CC[C@@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)(C)CBr",
"old_substring": "C4C(C)C"
} |
Can you make molecule C/[NH+]=C(/NCc1[nH+]ccn1CC(C)C)N1C[C@H]2CC=CC[C@@H]2C1 less soluble in water? The output molecule should be similar to the input molecule. | C/[NH+]=C(/NCc1[nH+]ccn1C(C(C)C)C(C)C)N1C[C@H]2CC=CC[C@@H]2C1 | C/[NH+]=C(/NCc1[nH+]ccn1CC(C)C)N1C[C@H]2CC=CC[C@@H]2C1 | C/[NH+]=C(/NCc1[nH+]ccn1C(C(C)C)C(C)C)N1C[C@H]2CC=CC[C@@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&C(C)C",
"old_substring": "C4C(C)C"
} |
Can you make molecule C/[NH+]=C(/NCc1[nH+]ccn1CC(C)C)N1C[C@H]2CC=CC[C@@H]2C1 less soluble in water? The output molecule should be similar to the input molecule. | C/[NH+]=C(/NCc1[nH+]ccn1C(=O)CCCC(C)C)N1C[C@H]2CC=CC[C@@H]2C1 | C/[NH+]=C(/NCc1[nH+]ccn1CC(C)C)N1C[C@H]2CC=CC[C@@H]2C1 | C/[NH+]=C(/NCc1[nH+]ccn1C(=O)CCCC(C)C)N1C[C@H]2CC=CC[C@@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCCC&=O",
"old_substring": "C4C(C)C"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.