prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CN1CCC[NH+](C[C@@H]2CN(C(=O)c3ccc(O)cc3)C[C@@H]2CO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC[NH+](C[C@@H]2CN(SC(=O)Cc3ccc(O)cc3)C[C@@H]2CO)CC1 | CN1CCC[NH+](C[C@@H]2CN(C(=O)c3ccc(O)cc3)C[C@@H]2CO)CC1 | CN1CCC[NH+](C[C@@H]2CN(SC(=O)Cc3ccc(O)cc3)C[C@@H]2CO)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule CN1CCC[NH+](C[C@@H]2CN(C(=O)c3ccc(O)cc3)C[C@@H]2CO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC[NH+](C[C@@H]2CN(C(=O)CCCC(=O)c3ccc(O)cc3)C[C@@H]2CO)CC1 | CN1CCC[NH+](C[C@@H]2CN(C(=O)c3ccc(O)cc3)C[C@@H]2CO)CC1 | CN1CCC[NH+](C[C@@H]2CN(C(=O)CCCC(=O)c3ccc(O)cc3)C[C@@H]2CO)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule CN1CCC[NH+](C[C@@H]2CN(C(=O)c3ccc(O)cc3)C[C@@H]2CO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC[NH+](C[C@@H]2CN(C(=O)CC(C)(C)c3ccc(O)cc3)C[C@@H]2CO)CC1 | CN1CCC[NH+](C[C@@H]2CN(C(=O)c3ccc(O)cc3)C[C@@H]2CO)CC1 | CN1CCC[NH+](C[C@@H]2CN(C(=O)CC(C)(C)c3ccc(O)cc3)C[C@@H]2CO)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CN1CCC[NH+](C[C@@H]2CN(C(=O)c3ccc(O)cc3)C[C@@H]2CO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC[NH+](C[C@@H]2CN(C(=O)CCC(C)(C)c3ccc(O)cc3)C[C@@H]2CO)CC1 | CN1CCC[NH+](C[C@@H]2CN(C(=O)c3ccc(O)cc3)C[C@@H]2CO)CC1 | CN1CCC[NH+](C[C@@H]2CN(C(=O)CCC(C)(C)c3ccc(O)cc3)C[C@@H]2CO)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CN1CCC[NH+](C[C@@H]2CN(C(=O)c3ccc(O)cc3)C[C@@H]2CO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SN1C[C@H](CO)[C@H](C[NH+]2CCCN(C)CC2)C1)c1ccc(O)cc1 | CN1CCC[NH+](C[C@@H]2CN(C(=O)c3ccc(O)cc3)C[C@@H]2CO)CC1 | C[C@H](C(=O)SN1C[C@H](CO)[C@H](C[NH+]2CCCN(C)CC2)C1)c1ccc(O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule O=C(CS[C@H]1NN=C(C[C@@H]2CCS(=O)(=O)C2)O1)C1=c2ccccc2=[NH+][C@@H]1c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS[C@H]1NN=C(C[C@@H]2CCS(=O)(=O)C2)O1)C1=c2ccccc2=[NH+][C@@H]1c1ccccc1Cl | O=C(CS[C@H]1NN=C(C[C@@H]2CCS(=O)(=O)C2)O1)C1=c2ccccc2=[NH+][C@@H]1c1ccccc1 | O=C(CS[C@H]1NN=C(C[C@@H]2CCS(=O)(=O)C2)O1)C1=c2ccccc2=[NH+][C@@H]1c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c16ccccc1"
} |
Can you make molecule O=C(CS[C@H]1NN=C(C[C@@H]2CCS(=O)(=O)C2)O1)C1=c2ccccc2=[NH+][C@@H]1c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS[C@H]1NN=C(C[C@@H]2CCS(=O)(=O)C2)O1)C1=c2ccccc2=[NH+][C@@H]1c1ccc(I)cc1 | O=C(CS[C@H]1NN=C(C[C@@H]2CCS(=O)(=O)C2)O1)C1=c2ccccc2=[NH+][C@@H]1c1ccccc1 | O=C(CS[C@H]1NN=C(C[C@@H]2CCS(=O)(=O)C2)O1)C1=c2ccccc2=[NH+][C@@H]1c1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c16ccccc1"
} |
Can you make molecule O=C(CS[C@H]1NN=C(C[C@@H]2CCS(=O)(=O)C2)O1)C1=c2ccccc2=[NH+][C@@H]1c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H]2[NH+]=c3ccccc3=C2C(=O)CS[C@H]2NN=C(C[C@@H]3CCS(=O)(=O)C3)O2)cc1I | O=C(CS[C@H]1NN=C(C[C@@H]2CCS(=O)(=O)C2)O1)C1=c2ccccc2=[NH+][C@@H]1c1ccccc1 | Cc1ccc([C@H]2[NH+]=c3ccccc3=C2C(=O)CS[C@H]2NN=C(C[C@@H]3CCS(=O)(=O)C3)O2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c16ccccc1"
} |
Can you make molecule O=C(CS[C@H]1NN=C(C[C@@H]2CCS(=O)(=O)C2)O1)C1=c2ccccc2=[NH+][C@@H]1c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS[C@H]1NN=C(C[C@@H]2CCS(=O)(=O)C2)O1)C1=c2ccccc2=[NH+][C@@H]1c1cccc(Br)c1 | O=C(CS[C@H]1NN=C(C[C@@H]2CCS(=O)(=O)C2)O1)C1=c2ccccc2=[NH+][C@@H]1c1ccccc1 | O=C(CS[C@H]1NN=C(C[C@@H]2CCS(=O)(=O)C2)O1)C1=c2ccccc2=[NH+][C@@H]1c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c16ccccc1"
} |
Can you make molecule O=C(CS[C@H]1NN=C(C[C@@H]2CCS(=O)(=O)C2)O1)C1=c2ccccc2=[NH+][C@@H]1c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H]2[NH+]=c3ccccc3=C2C(=O)CS[C@H]2NN=C(C[C@@H]3CCS(=O)(=O)C3)O2)c1C | O=C(CS[C@H]1NN=C(C[C@@H]2CCS(=O)(=O)C2)O1)C1=c2ccccc2=[NH+][C@@H]1c1ccccc1 | Cc1cccc([C@H]2[NH+]=c3ccccc3=C2C(=O)CS[C@H]2NN=C(C[C@@H]3CCS(=O)(=O)C3)O2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1ccc(C[NH+](C)[C@@H](C)C(=O)NCCc2ccc3c(c2)OCCO3)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C[NH+](C)[C@@H](C)C(=O)NCCc2ccc3c(c2)OCCO3)sc1C | Cc1ccc(C[NH+](C)[C@@H](C)C(=O)NCCc2ccc3c(c2)OCCO3)o1 | Cc1cc(C[NH+](C)[C@@H](C)C(=O)NCCc2ccc3c(c2)OCCO3)sc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&sc1C",
"old_substring": "Cc1ccc8o1"
} |
Can you make molecule Cc1ccc(C[NH+](C)[C@@H](C)C(=O)NCCc2ccc3c(c2)OCCO3)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc2cc(C[NH+](C)[C@@H](C)C(=O)NCCc3ccc4c(c3)OCCO4)oc12 | Cc1ccc(C[NH+](C)[C@@H](C)C(=O)NCCc2ccc3c(c2)OCCO3)o1 | Cc1cccc2cc(C[NH+](C)[C@@H](C)C(=O)NCCc3ccc4c(c3)OCCO4)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cccc2cc&oc12",
"old_substring": "Cc1ccc8o1"
} |
Can you make molecule Cc1ccc(C[NH+](C)[C@@H](C)C(=O)NCCc2ccc3c(c2)OCCO3)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[NH+](C)[C@@H](C)C(=O)NCCc2ccc3c(c2)OCCO3)cc1I | Cc1ccc(C[NH+](C)[C@@H](C)C(=O)NCCc2ccc3c(c2)OCCO3)o1 | Cc1ccc(C[NH+](C)[C@@H](C)C(=O)NCCc2ccc3c(c2)OCCO3)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "Cc1ccc8o1"
} |
Can you make molecule Cc1ccc(C[NH+](C)[C@@H](C)C(=O)NCCc2ccc3c(c2)OCCO3)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1C=C[NH+](C)[C@@H](C)C(=O)NCCc1ccc2c(c1)OCCO2 | Cc1ccc(C[NH+](C)[C@@H](C)C(=O)NCCc2ccc3c(c2)OCCO3)o1 | Cc1ccsc1C=C[NH+](C)[C@@H](C)C(=O)NCCc1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccsc1C=&",
"old_substring": "Cc1ccc8o1"
} |
Can you make molecule Cc1ccc(C[NH+](C)[C@@H](C)C(=O)NCCc2ccc3c(c2)OCCO3)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(C[NH+](C)[C@@H](C)C(=O)NCCc2ccc3c(c2)OCCO3)c1Cl | Cc1ccc(C[NH+](C)[C@@H](C)C(=O)NCCc2ccc3c(c2)OCCO3)o1 | Cc1csc(C[NH+](C)[C@@H](C)C(=O)NCCc2ccc3c(c2)OCCO3)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1csc&c1Cl",
"old_substring": "Cc1ccc8o1"
} |
Can you make molecule C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@@H](CO)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@@H]1CC[C@H](c2ccccc2F)O1 | C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@@H](CO)c1ccccc1F | C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@@H]1CC[C@H](c2ccccc2F)O1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@H]&O1",
"old_substring": "[C@@H]46CO"
} |
Can you make molecule C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@@H](CO)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@@H]1CCCCN(c2ccccc2F)C1=O | C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@@H](CO)c1ccccc1F | C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@@H]1CCCCN(c2ccccc2F)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCCN&C1=O",
"old_substring": "[C@@H]46CO"
} |
Can you make molecule C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@@H](CO)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@@H]1CC[C@@H](c2ccccc2F)O1 | C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@@H](CO)c1ccccc1F | C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@@H]1CC[C@@H](c2ccccc2F)O1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&O1",
"old_substring": "[C@@H]46CO"
} |
Can you make molecule C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@@H](CO)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@@H]1CN(c2ccccc2F)CCS1 | C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@@H](CO)c1ccccc1F | C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@@H]1CN(c2ccccc2F)CCS1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CN&CCS1",
"old_substring": "[C@@H]46CO"
} |
Can you make molecule C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@@H](CO)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@@H]1CCCN(c2ccccc2F)CC1 | C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@@H](CO)c1ccccc1F | C[C@H](CCc1ccc2c(c1)OCO2)[NH2+][C@@H]1CCCN(c2ccccc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCN&CC1",
"old_substring": "[C@@H]46CO"
} |
Can you make molecule Cc1ccc(Nc2nc(NCCN3CCOCC3)nc3c2cnn3C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Nc2nc(NCCCCN3CCOCC3)nc3c2cnn3C)cc1 | Cc1ccc(Nc2nc(NCCN3CCOCC3)nc3c2cnn3C)cc1 | Cc1ccc(Nc2nc(NCCCCN3CCOCC3)nc3c2cnn3C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C4C5"
} |
Can you make molecule Cc1ccc(Nc2nc(NCCN3CCOCC3)nc3c2cnn3C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Nc2nc(N=CCCN3CCOCC3)nc3c2cnn3C)cc1 | Cc1ccc(Nc2nc(NCCN3CCOCC3)nc3c2cnn3C)cc1 | Cc1ccc(Nc2nc(N=CCCN3CCOCC3)nc3c2cnn3C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C4C5"
} |
Can you make molecule Cc1ccc(Nc2nc(NCCN3CCOCC3)nc3c2cnn3C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Nc2nc(NCCCCCN3CCOCC3)nc3c2cnn3C)cc1 | Cc1ccc(Nc2nc(NCCN3CCOCC3)nc3c2cnn3C)cc1 | Cc1ccc(Nc2nc(NCCCCCN3CCOCC3)nc3c2cnn3C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4C5"
} |
Can you make molecule Cc1ccc(Nc2nc(NCCN3CCOCC3)nc3c2cnn3C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Nc2nc(NC3CC(N4CCOCC4)C3)nc3c2cnn3C)cc1 | Cc1ccc(Nc2nc(NCCN3CCOCC3)nc3c2cnn3C)cc1 | Cc1ccc(Nc2nc(NC3CC(N4CCOCC4)C3)nc3c2cnn3C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C4C5"
} |
Can you make molecule Cc1ccc(Nc2nc(NCCN3CCOCC3)nc3c2cnn3C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(CCN1CCOCC1)=Nc1nc(Nc2ccc(C)cc2)c2cnn(C)c2n1 | Cc1ccc(Nc2nc(NCCN3CCOCC3)nc3c2cnn3C)cc1 | CC(CCN1CCOCC1)=Nc1nc(Nc2ccc(C)cc2)c2cnn(C)c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C4C5"
} |
Can you make molecule O=C(NCc1cccc(OC(F)F)c1)NC[C@H](O)c1ccc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CNC(=O)NCc1cccc(OC(F)F)c1)C(=O)c1ccc2ccccc2c1 | O=C(NCc1cccc(OC(F)F)c1)NC[C@H](O)c1ccc2ccccc2c1 | C[C@H](CNC(=O)NCc1cccc(OC(F)F)c1)C(=O)c1ccc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](C)C&=O",
"old_substring": "C7[C@@H]9O"
} |
Can you make molecule O=C(NCc1cccc(OC(F)F)c1)NC[C@H](O)c1ccc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNC(=O)NCc1cccc(OC(F)F)c1)CC(=O)c1ccc2ccccc2c1 | O=C(NCc1cccc(OC(F)F)c1)NC[C@H](O)c1ccc2ccccc2c1 | C[C@@H](CCNC(=O)NCc1cccc(OC(F)F)c1)CC(=O)c1ccc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C7[C@@H]9O"
} |
Can you make molecule O=C(NCc1cccc(OC(F)F)c1)NC[C@H](O)c1ccc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(c1ccc2ccccc2c1)[C@H](O)CNC(=O)NCc1cccc(OC(F)F)c1 | O=C(NCc1cccc(OC(F)F)c1)NC[C@H](O)c1ccc2ccccc2c1 | CC(C)(c1ccc2ccccc2c1)[C@H](O)CNC(=O)NCc1cccc(OC(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](O)C&(C)C",
"old_substring": "C7[C@@H]9O"
} |
Can you make molecule O=C(NCc1cccc(OC(F)F)c1)NC[C@H](O)c1ccc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CC(=O)c1ccc2ccccc2c1)NC(=O)NCc1cccc(OC(F)F)c1 | O=C(NCc1cccc(OC(F)F)c1)NC[C@H](O)c1ccc2ccccc2c1 | CC[C@H](CC(=O)c1ccc2ccccc2c1)NC(=O)NCc1cccc(OC(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H]&CC&=O",
"old_substring": "C7[C@@H]9O"
} |
Can you make molecule O=C(NCc1cccc(OC(F)F)c1)NC[C@H](O)c1ccc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CC(=O)NC(=O)NCc1cccc(OC(F)F)c1)C(=O)c1ccc2ccccc2c1 | O=C(NCc1cccc(OC(F)F)c1)NC[C@H](O)c1ccc2ccccc2c1 | C[C@@H](CC(=O)NC(=O)NCc1cccc(OC(F)F)c1)C(=O)c1ccc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&=O)C&=O",
"old_substring": "C7[C@@H]9O"
} |
Can you make molecule COc1ccc(C=C2SC(Nc3cc(C)ccc3O)=NC2=O)c(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(C=C2SC(Nc3cc(C)ccc3O)=NC2=O)c(OC)c1OC | COc1ccc(C=C2SC(Nc3cc(C)ccc3O)=NC2=O)c(OC)c1OC | COCc1ccc(C=C2SC(Nc3cc(C)ccc3O)=NC2=O)c(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(C=C2SC(Nc3cc(C)ccc3O)=NC2=O)c(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(C=C2SC(Nc3cc(C)ccc3O)=NC2=O)c(OC)c1OC | COc1ccc(C=C2SC(Nc3cc(C)ccc3O)=NC2=O)c(OC)c1OC | COCSc1ccc(C=C2SC(Nc3cc(C)ccc3O)=NC2=O)c(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(C=C2SC(Nc3cc(C)ccc3O)=NC2=O)c(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1c(C=C2SC(Nc3cc(C)ccc3O)=NC2=O)ccc(SC(C)=O)c1OC | COc1ccc(C=C2SC(Nc3cc(C)ccc3O)=NC2=O)c(OC)c1OC | COc1c(C=C2SC(Nc3cc(C)ccc3O)=NC2=O)ccc(SC(C)=O)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(C=C2SC(Nc3cc(C)ccc3O)=NC2=O)c(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1c(C=C2SC(Nc3cc(C)ccc3O)=NC2=O)ccc(C(=O)CS)c1OC | COc1ccc(C=C2SC(Nc3cc(C)ccc3O)=NC2=O)c(OC)c1OC | COc1c(C=C2SC(Nc3cc(C)ccc3O)=NC2=O)ccc(C(=O)CS)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(C=C2SC(Nc3cc(C)ccc3O)=NC2=O)c(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1c(C=C2SC(Nc3cc(C)ccc3O)=NC2=O)ccc(C(=O)CI)c1OC | COc1ccc(C=C2SC(Nc3cc(C)ccc3O)=NC2=O)c(OC)c1OC | COc1c(C=C2SC(Nc3cc(C)ccc3O)=NC2=O)ccc(C(=O)CI)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule CNS(=O)(=O)c1cccc([C@@H](C)[NH2+]C[C@H](C)SC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CS[C@@H](C)C[NH2+][C@H](C)c1cccc(S(=O)(=O)CN=C=S)c1 | CNS(=O)(=O)c1cccc([C@@H](C)[NH2+]C[C@H](C)SC)c1 | CS[C@@H](C)C[NH2+][C@H](C)c1cccc(S(=O)(=O)CN=C=S)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N=C=S",
"old_substring": "CN5"
} |
Can you make molecule CNS(=O)(=O)c1cccc([C@@H](C)[NH2+]C[C@H](C)SC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CS[C@@H](C)C[NH2+][C@H](C)c1cccc(S(=O)(=O)C2N=N2)c1 | CNS(=O)(=O)c1cccc([C@@H](C)[NH2+]C[C@H](C)SC)c1 | CS[C@@H](C)C[NH2+][C@H](C)c1cccc(S(=O)(=O)C2N=N2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&N=N1",
"old_substring": "CN5"
} |
Can you make molecule CNS(=O)(=O)c1cccc([C@@H](C)[NH2+]C[C@H](C)SC)c1 less soluble in water? The output molecule should be similar to the input molecule. | C/C=N/OS(=O)(=O)c1cccc([C@@H](C)[NH2+]C[C@H](C)SC)c1 | CNS(=O)(=O)c1cccc([C@@H](C)[NH2+]C[C@H](C)SC)c1 | C/C=N/OS(=O)(=O)c1cccc([C@@H](C)[NH2+]C[C@H](C)SC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C=N/O&",
"old_substring": "CN5"
} |
Can you make molecule CNS(=O)(=O)c1cccc([C@@H](C)[NH2+]C[C@H](C)SC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CS[C@@H](C)C[NH2+][C@H](C)c1cccc(S(=O)(=O)CCCN=C=S)c1 | CNS(=O)(=O)c1cccc([C@@H](C)[NH2+]C[C@H](C)SC)c1 | CS[C@@H](C)C[NH2+][C@H](C)c1cccc(S(=O)(=O)CCCN=C=S)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCN=C=S",
"old_substring": "CN5"
} |
Can you make molecule CNS(=O)(=O)c1cccc([C@@H](C)[NH2+]C[C@H](C)SC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CS[C@@H](C)C[NH2+][C@H](C)c1cccc(S(=O)(=O)C(=O)N=C=S)c1 | CNS(=O)(=O)c1cccc([C@@H](C)[NH2+]C[C@H](C)SC)c1 | CS[C@@H](C)C[NH2+][C@H](C)c1cccc(S(=O)(=O)C(=O)N=C=S)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&N=C=S",
"old_substring": "CN5"
} |
Can you make molecule CCC(=O)Oc1ccc2c(c1C)OC(=Cc1ccc(C)o1)C2=O less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Oc1ccc2c(c1C)OC(=Cc1ccc(C)o1)C2=O | CCC(=O)Oc1ccc2c(c1C)OC(=Cc1ccc(C)o1)C2=O | CCCCC(=O)Oc1ccc2c(c1C)OC(=Cc1ccc(C)o1)C2=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CCC3=O"
} |
Can you make molecule CCC(=O)Oc1ccc2c(c1C)OC(=Cc1ccc(C)o1)C2=O less soluble in water? The output molecule should be similar to the input molecule. | CCCCCC(=O)Oc1ccc2c(c1C)OC(=Cc1ccc(C)o1)C2=O | CCC(=O)Oc1ccc2c(c1C)OC(=Cc1ccc(C)o1)C2=O | CCCCCC(=O)Oc1ccc2c(c1C)OC(=Cc1ccc(C)o1)C2=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCC&=O",
"old_substring": "CCC3=O"
} |
Can you make molecule CCC(=O)Oc1ccc2c(c1C)OC(=Cc1ccc(C)o1)C2=O less soluble in water? The output molecule should be similar to the input molecule. | CCCCCCC(=O)Oc1ccc2c(c1C)OC(=Cc1ccc(C)o1)C2=O | CCC(=O)Oc1ccc2c(c1C)OC(=Cc1ccc(C)o1)C2=O | CCCCCCC(=O)Oc1ccc2c(c1C)OC(=Cc1ccc(C)o1)C2=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCCC&=O",
"old_substring": "CCC3=O"
} |
Can you make molecule CCC(=O)Oc1ccc2c(c1C)OC(=Cc1ccc(C)o1)C2=O less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)CCCOc1ccc2c(c1C)OC(=Cc1ccc(C)o1)C2=O | CCC(=O)Oc1ccc2c(c1C)OC(=Cc1ccc(C)o1)C2=O | CCC(=O)CCCOc1ccc2c(c1C)OC(=Cc1ccc(C)o1)C2=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC(=O)CCC&",
"old_substring": "CCC3=O"
} |
Can you make molecule CCC(=O)Oc1ccc2c(c1C)OC(=Cc1ccc(C)o1)C2=O less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)=NOOc1ccc2c(c1C)OC(=Cc1ccc(C)o1)C2=O | CCC(=O)Oc1ccc2c(c1C)OC(=Cc1ccc(C)o1)C2=O | CCC(CC)=NOOc1ccc2c(c1C)OC(=Cc1ccc(C)o1)C2=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC(CC)=NO&",
"old_substring": "CCC3=O"
} |
Can you make molecule O=C(NCCCN1CCOCC1)C1(c2cc(-c3cccs3)on2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCCN1CCOCC1)C1(c2ccc(-c3cccs3)o2)CC1 | O=C(NCCCN1CCOCC1)C1(c2cc(-c3cccs3)on2)CC1 | O=C(NCCCN1CCOCC1)C1(c2ccc(-c3cccs3)o2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&o1",
"old_substring": "c19cc8on1"
} |
Can you make molecule O=C(NCCCN1CCOCC1)C1(c2cc(-c3cccs3)on2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc(-c2cccs2)cc1C1(C(=O)NCCCN2CCOCC2)CC1 | O=C(NCCCN1CCOCC1)C1(c2cc(-c3cccs3)on2)CC1 | Cc1oc(-c2cccs2)cc1C1(C(=O)NCCCN2CCOCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&oc1C",
"old_substring": "c19cc8on1"
} |
Can you make molecule O=C(NCCCN1CCOCC1)C1(c2cc(-c3cccs3)on2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCCN1CCOCC1)C1(c2ccc3oc(-c4cccs4)nc3c2)CC1 | O=C(NCCCN1CCOCC1)C1(c2cc(-c3cccs3)on2)CC1 | O=C(NCCCN1CCOCC1)C1(c2ccc3oc(-c4cccs4)nc3c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2oc&nc2c1",
"old_substring": "c19cc8on1"
} |
Can you make molecule O=C(NCCCN1CCOCC1)C1(c2cc(-c3cccs3)on2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCCN1CCOCC1)C1(c2cc3occc3c(-c3cccs3)n2)CC1 | O=C(NCCCN1CCOCC1)C1(c2cc(-c3cccs3)on2)CC1 | O=C(NCCCN1CCOCC1)C1(c2cc3occc3c(-c3cccs3)n2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2occc2c&n1",
"old_substring": "c19cc8on1"
} |
Can you make molecule O=C(NCCCN1CCOCC1)C1(c2cc(-c3cccs3)on2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2cccs2)ccc1C1(C(=O)NCCCN2CCOCC2)CC1 | O=C(NCCCN1CCOCC1)C1(c2cc(-c3cccs3)on2)CC1 | Cc1nc(-c2cccs2)ccc1C1(C(=O)NCCCN2CCOCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&nc1C",
"old_substring": "c19cc8on1"
} |
Can you make molecule C[C@H](CNC(=O)Nc1cc(F)ccc1-n1cccn1)C[C@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CNC(=O)CC(C)(C)Nc1cc(F)ccc1-n1cccn1)C[C@H](C)O | C[C@H](CNC(=O)Nc1cc(F)ccc1-n1cccn1)C[C@H](C)O | C[C@H](CNC(=O)CC(C)(C)Nc1cc(F)ccc1-n1cccn1)C[C@H](C)O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule C[C@H](CNC(=O)Nc1cc(F)ccc1-n1cccn1)C[C@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CNC(=O)CCC(C)(C)Nc1cc(F)ccc1-n1cccn1)C[C@H](C)O | C[C@H](CNC(=O)Nc1cc(F)ccc1-n1cccn1)C[C@H](C)O | C[C@H](CNC(=O)CCC(C)(C)Nc1cc(F)ccc1-n1cccn1)C[C@H](C)O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule C[C@H](CNC(=O)Nc1cc(F)ccc1-n1cccn1)C[C@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CNC(=O)C[C@@H](Br)Nc1cc(F)ccc1-n1cccn1)C[C@H](C)O | C[C@H](CNC(=O)Nc1cc(F)ccc1-n1cccn1)C[C@H](C)O | C[C@H](CNC(=O)C[C@@H](Br)Nc1cc(F)ccc1-n1cccn1)C[C@H](C)O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule C[C@H](CNC(=O)Nc1cc(F)ccc1-n1cccn1)C[C@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC[C@@H](C)C[C@H](C)O)cc(=O)n1Nc1cc(F)ccc1-n1cccn1 | C[C@H](CNC(=O)Nc1cc(F)ccc1-n1cccn1)C[C@H](C)O | Cc1cc(NC[C@@H](C)C[C@H](C)O)cc(=O)n1Nc1cc(F)ccc1-n1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C23=O"
} |
Can you make molecule C[C@H](CNC(=O)Nc1cc(F)ccc1-n1cccn1)C[C@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(NC[C@@H](C)C[C@H](C)O)c(=O)ccn1Nc1cc(F)ccc1-n1cccn1 | C[C@H](CNC(=O)Nc1cc(F)ccc1-n1cccn1)C[C@H](C)O | Cc1c(NC[C@@H](C)C[C@H](C)O)c(=O)ccn1Nc1cc(F)ccc1-n1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C23=O"
} |
Can you make molecule Cc1n[nH]c(C)c1NC(=O)Nc1ccccc1N1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1n[nH]c(C)c1NC(=O)CC(C)(C)Nc1ccccc1N1CCCC1=O | Cc1n[nH]c(C)c1NC(=O)Nc1ccccc1N1CCCC1=O | Cc1n[nH]c(C)c1NC(=O)CC(C)(C)Nc1ccccc1N1CCCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule Cc1n[nH]c(C)c1NC(=O)Nc1ccccc1N1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1n[nH]c(C)c1NC(=O)CCC(C)(C)Nc1ccccc1N1CCCC1=O | Cc1n[nH]c(C)c1NC(=O)Nc1ccccc1N1CCCC1=O | Cc1n[nH]c(C)c1NC(=O)CCC(C)(C)Nc1ccccc1N1CCCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule Cc1n[nH]c(C)c1NC(=O)Nc1ccccc1N1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1n[nH]c(C)c1NC(=O)C[C@@H](Br)Nc1ccccc1N1CCCC1=O | Cc1n[nH]c(C)c1NC(=O)Nc1ccccc1N1CCCC1=O | Cc1n[nH]c(C)c1NC(=O)C[C@@H](Br)Nc1ccccc1N1CCCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule Cc1n[nH]c(C)c1NC(=O)Nc1ccccc1N1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1n[nH]c(C)c1Nc1cc(C)n(Nc2ccccc2N2CCCC2=O)c(=O)c1 | Cc1n[nH]c(C)c1NC(=O)Nc1ccccc1N1CCCC1=O | Cc1n[nH]c(C)c1Nc1cc(C)n(Nc2ccccc2N2CCCC2=O)c(=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C23=O"
} |
Can you make molecule Cc1n[nH]c(C)c1NC(=O)Nc1ccccc1N1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1n[nH]c(C)c1Nc1c(C)n(Nc2ccccc2N2CCCC2=O)ccc1=O | Cc1n[nH]c(C)c1NC(=O)Nc1ccccc1N1CCCC1=O | Cc1n[nH]c(C)c1Nc1c(C)n(Nc2ccccc2N2CCCC2=O)ccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C23=O"
} |
Can you make molecule COc1ccc(O)c(C[NH2+][C@@H]2CCOc3c(OC)cccc32)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(O)c(CCCC[NH2+][C@@H]2CCOc3c(OC)cccc32)c1 | COc1ccc(O)c(C[NH2+][C@@H]2CCOc3c(OC)cccc32)c1 | COc1ccc(O)c(CCCC[NH2+][C@@H]2CCOc3c(OC)cccc32)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C67"
} |
Can you make molecule COc1ccc(O)c(C[NH2+][C@@H]2CCOc3c(OC)cccc32)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(O)c(CCCCC[NH2+][C@@H]2CCOc3c(OC)cccc32)c1 | COc1ccc(O)c(C[NH2+][C@@H]2CCOc3c(OC)cccc32)c1 | COc1ccc(O)c(CCCCC[NH2+][C@@H]2CCOc3c(OC)cccc32)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C67"
} |
Can you make molecule COc1ccc(O)c(C[NH2+][C@@H]2CCOc3c(OC)cccc32)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(O)c(C2CC([NH2+][C@@H]3CCOc4c(OC)cccc43)C2)c1 | COc1ccc(O)c(C[NH2+][C@@H]2CCOc3c(OC)cccc32)c1 | COc1ccc(O)c(C2CC([NH2+][C@@H]3CCOc4c(OC)cccc43)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C67"
} |
Can you make molecule COc1ccc(O)c(C[NH2+][C@@H]2CCOc3c(OC)cccc32)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(O)c(SC(=S)O[NH2+][C@@H]2CCOc3c(OC)cccc32)c1 | COc1ccc(O)c(C[NH2+][C@@H]2CCOc3c(OC)cccc32)c1 | COc1ccc(O)c(SC(=S)O[NH2+][C@@H]2CCOc3c(OC)cccc32)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C67"
} |
Can you make molecule COc1ccc(O)c(C[NH2+][C@@H]2CCOc3c(OC)cccc32)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(O)c(NC(=S)S[NH2+][C@@H]2CCOc3c(OC)cccc32)c1 | COc1ccc(O)c(C[NH2+][C@@H]2CCOc3c(OC)cccc32)c1 | COc1ccc(O)c(NC(=S)S[NH2+][C@@H]2CCOc3c(OC)cccc32)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C67"
} |
Can you make molecule COc1ccc(F)c(NC(=O)C(=O)NC[C@H](O)c2ccco2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)c(NC(=O)CCCC(=O)NC[C@H](O)c2ccco2)c1 | COc1ccc(F)c(NC(=O)C(=O)NC[C@H](O)c2ccco2)c1 | COc1ccc(F)c(NC(=O)CCCC(=O)NC[C@H](O)c2ccco2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule COc1ccc(F)c(NC(=O)C(=O)NC[C@H](O)c2ccco2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)c(NC(=O)CCC(=O)CNC[C@H](O)c2ccco2)c1 | COc1ccc(F)c(NC(=O)C(=O)NC[C@H](O)c2ccco2)c1 | COc1ccc(F)c(NC(=O)CCC(=O)CNC[C@H](O)c2ccco2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC(=O)C&",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule COc1ccc(F)c(NC(=O)C(=O)NC[C@H](O)c2ccco2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)c(NC[S@+]([O-])CCC(=O)NC[C@H](O)c2ccco2)c1 | COc1ccc(F)c(NC(=O)C(=O)NC[C@H](O)c2ccco2)c1 | COc1ccc(F)c(NC[S@+]([O-])CCC(=O)NC[C@H](O)c2ccco2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule COc1ccc(F)c(NC(=O)C(=O)NC[C@H](O)c2ccco2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)c(NC(=O)CCCS(=O)(=O)NC[C@H](O)c2ccco2)c1 | COc1ccc(F)c(NC(=O)C(=O)NC[C@H](O)c2ccco2)c1 | COc1ccc(F)c(NC(=O)CCCS(=O)(=O)NC[C@H](O)c2ccco2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCS&(=O)=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule COc1ccc(F)c(NC(=O)C(=O)NC[C@H](O)c2ccco2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)c(NC(=O)C(C)(F)C(=O)NC[C@H](O)c2ccco2)c1 | COc1ccc(F)c(NC(=O)C(=O)NC[C@H](O)c2ccco2)c1 | COc1ccc(F)c(NC(=O)C(C)(F)C(=O)NC[C@H](O)c2ccco2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(F)C&=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule O=C(c1cc2ccccc2[nH]1)N1CCC(/C=C(\[O-])NC2CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1cc2ccccc2[nH]1)N1CCC(/C=C(\[O-])NC2CCCCCCC2)CC1 | O=C(c1cc2ccccc2[nH]1)N1CCC(/C=C(\[O-])NC2CCCCC2)CC1 | O=C(c1cc2ccccc2[nH]1)N1CCC(/C=C(\[O-])NC2CCCCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C14CCCCC1"
} |
Can you make molecule O=C(c1cc2ccccc2[nH]1)N1CCC(/C=C(\[O-])NC2CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1cc2ccccc2[nH]1)N1CCC(/C=C(\[O-])NSC2=CCCCCC2)CC1 | O=C(c1cc2ccccc2[nH]1)N1CCC(/C=C(\[O-])NC2CCCCC2)CC1 | O=C(c1cc2ccccc2[nH]1)N1CCC(/C=C(\[O-])NSC2=CCCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C14CCCCC1"
} |
Can you make molecule O=C(c1cc2ccccc2[nH]1)N1CCC(/C=C(\[O-])NC2CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1cc2ccccc2[nH]1)N1CCC(/C=C(\[O-])N=CC2CCCCC2)CC1 | O=C(c1cc2ccccc2[nH]1)N1CCC(/C=C(\[O-])NC2CCCCC2)CC1 | O=C(c1cc2ccccc2[nH]1)N1CCC(/C=C(\[O-])N=CC2CCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&C1CCCCC1",
"old_substring": "C14CCCCC1"
} |
Can you make molecule O=C(c1cc2ccccc2[nH]1)N1CCC(/C=C(\[O-])NC2CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1cc2ccccc2[nH]1)N1CCC(/C=C(\[O-])NC2CCCCCCCCCCC2)CC1 | O=C(c1cc2ccccc2[nH]1)N1CCC(/C=C(\[O-])NC2CCCCC2)CC1 | O=C(c1cc2ccccc2[nH]1)N1CCC(/C=C(\[O-])NC2CCCCCCCCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCCCCCC1",
"old_substring": "C14CCCCC1"
} |
Can you make molecule O=C(c1cc2ccccc2[nH]1)N1CCC(/C=C(\[O-])NC2CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(N/C([O-])=C/C2CCN(C(=O)c3cc4ccccc4[nH]3)CC2)CCCCCCC1 | O=C(c1cc2ccccc2[nH]1)N1CCC(/C=C(\[O-])NC2CCCCC2)CC1 | N#CC1(N/C([O-])=C/C2CCN(C(=O)c3cc4ccccc4[nH]3)CC2)CCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCCCCCC1",
"old_substring": "C14CCCCC1"
} |
Can you make molecule c1cc(CN2CCc3c([nH+]cn3C3CC3)C2)c2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | c1cc(CN2CCc3c([nH+]cn3C3SCCS3)C2)c2c(c1)OCCO2 | c1cc(CN2CCc3c([nH+]cn3C3CC3)C2)c2c(c1)OCCO2 | c1cc(CN2CCc3c([nH+]cn3C3SCCS3)C2)c2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C16CC1"
} |
Can you make molecule c1cc(CN2CCc3c([nH+]cn3C3CC3)C2)c2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | c1cc(CN2CCc3c([nH+]cn3C3CCCCC3)C2)c2c(c1)OCCO2 | c1cc(CN2CCc3c([nH+]cn3C3CC3)C2)c2c(c1)OCCO2 | c1cc(CN2CCc3c([nH+]cn3C3CCCCC3)C2)c2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule c1cc(CN2CCc3c([nH+]cn3C3CC3)C2)c2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | c1cc(CN2CCc3c([nH+]cn3C3SCCCS3)C2)c2c(c1)OCCO2 | c1cc(CN2CCc3c([nH+]cn3C3CC3)C2)c2c(c1)OCCO2 | c1cc(CN2CCc3c([nH+]cn3C3SCCCS3)C2)c2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C16CC1"
} |
Can you make molecule c1cc(CN2CCc3c([nH+]cn3C3CC3)C2)c2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | c1cc(CN2CCc3c([nH+]cn3C3SCSCS3)C2)c2c(c1)OCCO2 | c1cc(CN2CCc3c([nH+]cn3C3CC3)C2)c2c(c1)OCCO2 | c1cc(CN2CCc3c([nH+]cn3C3SCSCS3)C2)c2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C16CC1"
} |
Can you make molecule c1cc(CN2CCc3c([nH+]cn3C3CC3)C2)c2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | c1cc(CN2CCc3c([nH+]cn3C3CCCCCC3)C2)c2c(c1)OCCO2 | c1cc(CN2CCc3c([nH+]cn3C3CC3)C2)c2c(c1)OCCO2 | c1cc(CN2CCc3c([nH+]cn3C3CCCCCC3)C2)c2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule O[C@H](COc1ccc(Cl)cc1)CSc1nccc(C(F)(F)F)n1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H](COc1ccc(Cl)cc1)CSc1nccc(SC(F)(F)F)n1 | O[C@H](COc1ccc(Cl)cc1)CSc1nccc(C(F)(F)F)n1 | O[C@H](COc1ccc(Cl)cc1)CSc1nccc(SC(F)(F)F)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C5(F)(F)F"
} |
Can you make molecule O[C@H](COc1ccc(Cl)cc1)CSc1nccc(C(F)(F)F)n1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H](COc1ccc(Cl)cc1)CSc1nccc(CCCC(F)(F)F)n1 | O[C@H](COc1ccc(Cl)cc1)CSc1nccc(C(F)(F)F)n1 | O[C@H](COc1ccc(Cl)cc1)CSc1nccc(CCCC(F)(F)F)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C5(F)(F)F"
} |
Can you make molecule O[C@H](COc1ccc(Cl)cc1)CSc1nccc(C(F)(F)F)n1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H](COc1ccc(Cl)cc1)CSc1nccc(CCCCC(F)(F)F)n1 | O[C@H](COc1ccc(Cl)cc1)CSc1nccc(C(F)(F)F)n1 | O[C@H](COc1ccc(Cl)cc1)CSc1nccc(CCCCC(F)(F)F)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C5(F)(F)F"
} |
Can you make molecule O[C@H](COc1ccc(Cl)cc1)CSc1nccc(C(F)(F)F)n1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H](COc1ccc(Cl)cc1)CSc1nccc(C(F)(F)C(F)(F)F)n1 | O[C@H](COc1ccc(Cl)cc1)CSc1nccc(C(F)(F)F)n1 | O[C@H](COc1ccc(Cl)cc1)CSc1nccc(C(F)(F)C(F)(F)F)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C5(F)(F)F"
} |
Can you make molecule O[C@H](COc1ccc(Cl)cc1)CSc1nccc(C(F)(F)F)n1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H](COc1ccc(Cl)cc1)CSc1nccc(CC(F)(F)C(F)(F)F)n1 | O[C@H](COc1ccc(Cl)cc1)CSc1nccc(C(F)(F)F)n1 | O[C@H](COc1ccc(Cl)cc1)CSc1nccc(CC(F)(F)C(F)(F)F)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C5(F)(F)F"
} |
Can you make molecule Cc1ncccc1NCc1ccc(O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncccc1C1=C(Cc2ccc(O)cc2)CN2CCC2=NO1 | Cc1ncccc1NCc1ccc(O)cc1 | Cc1ncccc1C1=C(Cc2ccc(O)cc2)CN2CCC2=NO1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N23"
} |
Can you make molecule Cc1ncccc1NCc1ccc(O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncccc1C1=CC=C(Cc2ccc(O)cc2)N2CCC2=C1 | Cc1ncccc1NCc1ccc(O)cc1 | Cc1ncccc1C1=CC=C(Cc2ccc(O)cc2)N2CCC2=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N23"
} |
Can you make molecule Cc1ncccc1NCc1ccc(O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncccc1-c1snc2sc-2c(N)c1Cc1ccc(O)cc1 | Cc1ncccc1NCc1ccc(O)cc1 | Cc1ncccc1-c1snc2sc-2c(N)c1Cc1ccc(O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&sc2nsc&c12",
"old_substring": "N23"
} |
Can you make molecule Cc1ncccc1NCc1ccc(O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncccc1C1=C(Cc2ccc(O)cc2)CN2CCN2N=N1 | Cc1ncccc1NCc1ccc(O)cc1 | Cc1ncccc1C1=C(Cc2ccc(O)cc2)CN2CCN2N=N1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCn2nnc&c2C1",
"old_substring": "N23"
} |
Can you make molecule Cc1ncccc1NCc1ccc(O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncccc1C1=CC=C2SCCN2C(Cc2ccc(O)cc2)=C1 | Cc1ncccc1NCc1ccc(O)cc1 | Cc1ncccc1C1=CC=C2SCCN2C(Cc2ccc(O)cc2)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "N23"
} |
Can you make molecule CCn1cc[nH+]c1[C@@H]1CCCN(C(=O)CSCC[NH+]2CCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc([C@@H]2CCCN(C(=O)CSCC[NH+]3CCCC3)C2)[nH]c1=O | CCn1cc[nH+]c1[C@@H]1CCCN(C(=O)CSCC[NH+]2CCCC2)C1 | CCn1cc([C@@H]2CCCN(C(=O)CSCC[NH+]3CCCC3)C2)[nH]c1=O | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc&[nH]c1=O",
"old_substring": "n17cc[nH+]c18"
} |
Can you make molecule CCn1cc[nH+]c1[C@@H]1CCCN(C(=O)CSCC[NH+]2CCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1n[nH]c([C@@H]2CCCN(C(=O)CSCC[NH+]3CCCC3)C2)c1C | CCn1cc[nH+]c1[C@@H]1CCCN(C(=O)CSCC[NH+]2CCCC2)C1 | CCc1n[nH]c([C@@H]2CCCN(C(=O)CSCC[NH+]3CCCC3)C2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&n[nH]c1&",
"old_substring": "n17cc[nH+]c18"
} |
Can you make molecule CCn1cc[nH+]c1[C@@H]1CCCN(C(=O)CSCC[NH+]2CCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc(C)c([C@@H]2CCCN(C(=O)CSCC[NH+]3CCCC3)C2)[nH]1 | CCn1cc[nH+]c1[C@@H]1CCCN(C(=O)CSCC[NH+]2CCCC2)C1 | CCc1nc(C)c([C@@H]2CCCN(C(=O)CSCC[NH+]3CCCC3)C2)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc&[nH]c1&",
"old_substring": "n17cc[nH+]c18"
} |
Can you make molecule CCn1cc[nH+]c1[C@@H]1CCCN(C(=O)CSCC[NH+]2CCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1[nH]c([C@@H]2CCCN(C(=O)CSCC[NH+]3CCCC3)C2)cc1=O | CCn1cc[nH+]c1[C@@H]1CCCN(C(=O)CSCC[NH+]2CCCC2)C1 | CCn1[nH]c([C@@H]2CCCN(C(=O)CSCC[NH+]3CCCC3)C2)cc1=O | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH]c&cc1=O",
"old_substring": "n17cc[nH+]c18"
} |
Can you make molecule CCn1cc[nH+]c1[C@@H]1CCCN(C(=O)CSCC[NH+]2CCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1ccn([C@@H]2CCCN(C(=O)CSCC[NH+]3CCCC3)C2)c1=S | CCn1cc[nH+]c1[C@@H]1CCCN(C(=O)CSCC[NH+]2CCCC2)C1 | CCn1ccn([C@@H]2CCCN(C(=O)CSCC[NH+]3CCCC3)C2)c1=S | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccn&c1=S",
"old_substring": "n17cc[nH+]c18"
} |
Can you make molecule CN(C[C@H]1C=c2ccccc2=[NH+]C1=O)C(=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C[C@H]1C=c2ccccc2=[NH+]C1=O)SC(=O)Cc1ccccc1 | CN(C[C@H]1C=c2ccccc2=[NH+]C1=O)C(=O)c1ccccc1 | CN(C[C@H]1C=c2ccccc2=[NH+]C1=O)SC(=O)Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule CN(C[C@H]1C=c2ccccc2=[NH+]C1=O)C(=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C[C@H]1C=c2ccccc2=[NH+]C1=O)C(=O)CCCC(=O)c1ccccc1 | CN(C[C@H]1C=c2ccccc2=[NH+]C1=O)C(=O)c1ccccc1 | CN(C[C@H]1C=c2ccccc2=[NH+]C1=O)C(=O)CCCC(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule CN(C[C@H]1C=c2ccccc2=[NH+]C1=O)C(=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C[C@H]1C=c2ccccc2=[NH+]C1=O)C(=O)CC(C)(C)c1ccccc1 | CN(C[C@H]1C=c2ccccc2=[NH+]C1=O)C(=O)c1ccccc1 | CN(C[C@H]1C=c2ccccc2=[NH+]C1=O)C(=O)CC(C)(C)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CN(C[C@H]1C=c2ccccc2=[NH+]C1=O)C(=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C[C@H]1C=c2ccccc2=[NH+]C1=O)C(=O)CCC(C)(C)c1ccccc1 | CN(C[C@H]1C=c2ccccc2=[NH+]C1=O)C(=O)c1ccccc1 | CN(C[C@H]1C=c2ccccc2=[NH+]C1=O)C(=O)CCC(C)(C)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CN(C[C@H]1C=c2ccccc2=[NH+]C1=O)C(=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SN(C)C[C@H]1C=c2ccccc2=[NH+]C1=O)c1ccccc1 | CN(C[C@H]1C=c2ccccc2=[NH+]C1=O)C(=O)c1ccccc1 | C[C@H](C(=O)SN(C)C[C@H]1C=c2ccccc2=[NH+]C1=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.