prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule O=C(c1cccs1)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccc(Cl)s1)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 | O=C(c1cccs1)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 | O=C(c1ccc(Cl)s1)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c16cccs1"
} |
Can you make molecule O=C(c1cccs1)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccc(Br)s1)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 | O=C(c1cccs1)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 | O=C(c1ccc(Br)s1)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c16cccs1"
} |
Can you make molecule O=C(c1cccs1)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1sccc1Br)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 | O=C(c1cccs1)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 | O=C(c1sccc1Br)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c16cccs1"
} |
Can you make molecule O=C(c1cccs1)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1csc(I)c1)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 | O=C(c1cccs1)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 | O=C(c1csc(I)c1)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(I)c1",
"old_substring": "c16cccs1"
} |
Can you make molecule O=C(c1cccs1)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1cc2c(s1)CSC2)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 | O=C(c1cccs1)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 | O=C(c1cc2c(s1)CSC2)N(Cc1ccc(F)cc1)Cc1cc(-c2ccccc2)cn2nnnc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(s1)CSC2",
"old_substring": "c16cccs1"
} |
Can you make molecule COc1ccccc1CC(=O)N[C@@H]1CS(=O)(=O)C[C@H]1Cl less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccccc1CC(=O)N[C@@H]1CS(=O)(=O)C[C@H]1Cl | COc1ccccc1CC(=O)N[C@@H]1CS(=O)(=O)C[C@H]1Cl | COCc1ccccc1CC(=O)N[C@@H]1CS(=O)(=O)C[C@H]1Cl | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccccc1CC(=O)N[C@@H]1CS(=O)(=O)C[C@H]1Cl less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccccc1CC(=O)N[C@@H]1CS(=O)(=O)C[C@H]1Cl | COc1ccccc1CC(=O)N[C@@H]1CS(=O)(=O)C[C@H]1Cl | COCSc1ccccc1CC(=O)N[C@@H]1CS(=O)(=O)C[C@H]1Cl | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccccc1CC(=O)N[C@@H]1CS(=O)(=O)C[C@H]1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccccc1CC(=O)N[C@@H]1CS(=O)(=O)C[C@H]1Cl | COc1ccccc1CC(=O)N[C@@H]1CS(=O)(=O)C[C@H]1Cl | CC(=O)Sc1ccccc1CC(=O)N[C@@H]1CS(=O)(=O)C[C@H]1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccccc1CC(=O)N[C@@H]1CS(=O)(=O)C[C@H]1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1ccccc1C(=O)CS)N[C@@H]1CS(=O)(=O)C[C@H]1Cl | COc1ccccc1CC(=O)N[C@@H]1CS(=O)(=O)C[C@H]1Cl | O=C(Cc1ccccc1C(=O)CS)N[C@@H]1CS(=O)(=O)C[C@H]1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1ccccc1CC(=O)N[C@@H]1CS(=O)(=O)C[C@H]1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1ccccc1C(=O)CI)N[C@@H]1CS(=O)(=O)C[C@H]1Cl | COc1ccccc1CC(=O)N[C@@H]1CS(=O)(=O)C[C@H]1Cl | O=C(Cc1ccccc1C(=O)CI)N[C@@H]1CS(=O)(=O)C[C@H]1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule c1cc(-c2nc3c4cn[nH]c4ncn3n2)ccc1COc1ccc2c(c1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | c1cc(-c2nc3c4cn[nH]c4ncn3n2)ccc1CCCCOc1ccc2c(c1)CCC2 | c1cc(-c2nc3c4cn[nH]c4ncn3n2)ccc1COc1ccc2c(c1)CCC2 | c1cc(-c2nc3c4cn[nH]c4ncn3n2)ccc1CCCCOc1ccc2c(c1)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C57"
} |
Can you make molecule c1cc(-c2nc3c4cn[nH]c4ncn3n2)ccc1COc1ccc2c(c1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | c1cc(-c2nc3c4cn[nH]c4ncn3n2)ccc1CCCCCOc1ccc2c(c1)CCC2 | c1cc(-c2nc3c4cn[nH]c4ncn3n2)ccc1COc1ccc2c(c1)CCC2 | c1cc(-c2nc3c4cn[nH]c4ncn3n2)ccc1CCCCCOc1ccc2c(c1)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C57"
} |
Can you make molecule c1cc(-c2nc3c4cn[nH]c4ncn3n2)ccc1COc1ccc2c(c1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | c1cc2c(cc1OC1CC(c3ccc(-c4nc5c6cn[nH]c6ncn5n4)cc3)C1)CCC2 | c1cc(-c2nc3c4cn[nH]c4ncn3n2)ccc1COc1ccc2c(c1)CCC2 | c1cc2c(cc1OC1CC(c3ccc(-c4nc5c6cn[nH]c6ncn5n4)cc3)C1)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C57"
} |
Can you make molecule c1cc(-c2nc3c4cn[nH]c4ncn3n2)ccc1COc1ccc2c(c1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | S=C(OOc1ccc2c(c1)CCC2)Sc1ccc(-c2nc3c4cn[nH]c4ncn3n2)cc1 | c1cc(-c2nc3c4cn[nH]c4ncn3n2)ccc1COc1ccc2c(c1)CCC2 | S=C(OOc1ccc2c(c1)CCC2)Sc1ccc(-c2nc3c4cn[nH]c4ncn3n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C57"
} |
Can you make molecule c1cc(-c2nc3c4cn[nH]c4ncn3n2)ccc1COc1ccc2c(c1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | S=C(Nc1ccc(-c2nc3c4cn[nH]c4ncn3n2)cc1)SOc1ccc2c(c1)CCC2 | c1cc(-c2nc3c4cn[nH]c4ncn3n2)ccc1COc1ccc2c(c1)CCC2 | S=C(Nc1ccc(-c2nc3c4cn[nH]c4ncn3n2)cc1)SOc1ccc2c(c1)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C57"
} |
Can you make molecule CN(C(=O)c1ccc(Cl)cc1O)C1CCC(=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CCC(N2CCC(C(=O)c3ccc(Cl)cc3O)CC2)CC1 | CN(C(=O)c1ccc(Cl)cc1O)C1CCC(=O)CC1 | O=C1CCC(N2CCC(C(=O)c3ccc(Cl)cc3O)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "CN23"
} |
Can you make molecule CN(C(=O)c1ccc(Cl)cc1O)C1CCC(=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)c1ccc(Cl)cc1O)C(=S)SC1CCC(=O)CC1 | CN(C(=O)c1ccc(Cl)cc1O)C1CCC(=O)CC1 | CN(C(=O)c1ccc(Cl)cc1O)C(=S)SC1CCC(=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "CN23"
} |
Can you make molecule CN(C(=O)c1ccc(Cl)cc1O)C1CCC(=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CCC(C2CCN(CC(=O)c3ccc(Cl)cc3O)CC2)CC1 | CN(C(=O)c1ccc(Cl)cc1O)C1CCC(=O)CC1 | O=C1CCC(C2CCN(CC(=O)c3ccc(Cl)cc3O)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "CN23"
} |
Can you make molecule CN(C(=O)c1ccc(Cl)cc1O)C1CCC(=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CCC(N2CN(C(=O)c3ccc(Cl)cc3O)CSC2=S)CC1 | CN(C(=O)c1ccc(Cl)cc1O)C1CCC(=O)CC1 | O=C1CCC(N2CN(C(=O)c3ccc(Cl)cc3O)CSC2=S)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S=C1SCN&CN1&",
"old_substring": "CN23"
} |
Can you make molecule CN(C(=O)c1ccc(Cl)cc1O)C1CCC(=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(C(=O)c2ccc(Cl)cc2O)CCC(C2CCC(=O)CC2)CC1 | CN(C(=O)c1ccc(Cl)cc1O)C1CCC(=O)CC1 | N#CC1(C(=O)c2ccc(Cl)cc2O)CCC(C2CCC(=O)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "CN23"
} |
Can you make molecule CNC(=O)CNS(=O)(=O)c1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC(C(=O)CNS(=O)(=O)c2cccc(C(F)(F)F)c2)=CC2=CC=C21 | CNC(=O)CNS(=O)(=O)c1cccc(C(F)(F)F)c1 | CN1CCC(C(=O)CNS(=O)(=O)c2cccc(C(F)(F)F)c2)=CC2=CC=C21 | 102 | {
"fragment_index": 0,
"new_substring": "CN1CCc2cc&ccc21",
"old_substring": "CN2"
} |
Can you make molecule CNC(=O)CNS(=O)(=O)c1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC(C(=O)CNS(=O)(=O)c2cccc(C(F)(F)F)c2)=NC2=C(C1)S2 | CNC(=O)CNS(=O)(=O)c1cccc(C(F)(F)F)c1 | CN1CCC(C(=O)CNS(=O)(=O)c2cccc(C(F)(F)F)c2)=NC2=C(C1)S2 | 102 | {
"fragment_index": 0,
"new_substring": "CN1CCc2nc&sc2C1",
"old_substring": "CN2"
} |
Can you make molecule CNC(=O)CNS(=O)(=O)c1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCCC(C(=O)CNS(=O)(=O)c2cccc(C(F)(F)F)c2)=CC2=C1S2 | CNC(=O)CNS(=O)(=O)c1cccc(C(F)(F)F)c1 | CN1CCCC(C(=O)CNS(=O)(=O)c2cccc(C(F)(F)F)c2)=CC2=C1S2 | 102 | {
"fragment_index": 0,
"new_substring": "CN1CCCc2cc&sc21",
"old_substring": "CN2"
} |
Can you make molecule CNC(=O)CNS(=O)(=O)c1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC(C(=O)CNS(=O)(=O)c2cccc(C(F)(F)F)c2)=CC=C2C=C2C1=O | CNC(=O)CNS(=O)(=O)c1cccc(C(F)(F)F)c1 | CN1CCC(C(=O)CNS(=O)(=O)c2cccc(C(F)(F)F)c2)=CC=C2C=C2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CN1CCc2ccc&cc2C1=O",
"old_substring": "CN2"
} |
Can you make molecule CNC(=O)CNS(=O)(=O)c1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN1C(C(=O)CNS(=O)(=O)c2cccc(C(F)(F)F)c2)=CC=CC=C2C1N2C | CNC(=O)CNS(=O)(=O)c1cccc(C(F)(F)F)c1 | CN1C(C(=O)CNS(=O)(=O)c2cccc(C(F)(F)F)c2)=CC=CC=C2C1N2C | 102 | {
"fragment_index": 0,
"new_substring": "CN1c2ccccc2N(C)C1&",
"old_substring": "CN2"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2C[C@@H](CC(=O)[O-])c3ccccc32)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(N2C[C@@H](CC(=O)[O-])c3ccccc32)c1 | Cc1ccc(S(=O)(=O)N2C[C@@H](CC(=O)[O-])c3ccccc32)c(C)c1 | Cc1ccc(C)c(N2C[C@@H](CC(=O)[O-])c3ccccc32)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(C)c&c1",
"old_substring": "Cc1ccc(S4(=O)=O)c(C)c1"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2C[C@@H](CC(=O)[O-])c3ccccc32)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(I)c(N2C[C@@H](CC(=O)[O-])c3ccccc32)c1 | Cc1ccc(S(=O)(=O)N2C[C@@H](CC(=O)[O-])c3ccccc32)c(C)c1 | Cc1ccc(I)c(N2C[C@@H](CC(=O)[O-])c3ccccc32)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(I)c&c1",
"old_substring": "Cc1ccc(S4(=O)=O)c(C)c1"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2C[C@@H](CC(=O)[O-])c3ccccc32)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2C[C@@H](CC(=O)[O-])c3ccccc32)c(C)cc1I | Cc1ccc(S(=O)(=O)N2C[C@@H](CC(=O)[O-])c3ccccc32)c(C)c1 | Cc1cc(N2C[C@@H](CC(=O)[O-])c3ccccc32)c(C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1I",
"old_substring": "Cc1ccc(S4(=O)=O)c(C)c1"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2C[C@@H](CC(=O)[O-])c3ccccc32)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2C[C@@H](CC(=O)[O-])c3ccccc32)c(C)c(F)c1F | Cc1ccc(S(=O)(=O)N2C[C@@H](CC(=O)[O-])c3ccccc32)c(C)c1 | Cc1cc(N2C[C@@H](CC(=O)[O-])c3ccccc32)c(C)c(F)c1F | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)c(F)c1F",
"old_substring": "Cc1ccc(S4(=O)=O)c(C)c1"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2C[C@@H](CC(=O)[O-])c3ccccc32)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)oc(C)c1N1C[C@@H](CC(=O)[O-])c2ccccc21 | Cc1ccc(S(=O)(=O)N2C[C@@H](CC(=O)[O-])c3ccccc32)c(C)c1 | Cc1cc(=O)oc(C)c1N1C[C@@H](CC(=O)[O-])c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(=O)oc(C)c1&",
"old_substring": "Cc1ccc(S4(=O)=O)c(C)c1"
} |
Can you make molecule Cc1cc(N)nc(SCC(=O)NC[C@@H](c2ccccc2)C(C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N)nc(SCCC(CO)=NC[C@@H](c2ccccc2)C(C)C)n1 | Cc1cc(N)nc(SCC(=O)NC[C@@H](c2ccccc2)C(C)C)n1 | Cc1cc(N)nc(SCCC(CO)=NC[C@@H](c2ccccc2)C(C)C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C5C3=O"
} |
Can you make molecule Cc1cc(N)nc(SCC(=O)NC[C@@H](c2ccccc2)C(C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(CSc1nc(C)cc(N)n1)=N/ONC[C@@H](c1ccccc1)C(C)C | Cc1cc(N)nc(SCC(=O)NC[C@@H](c2ccccc2)C(C)C)n1 | C/C(CSc1nc(C)cc(N)n1)=N/ONC[C@@H](c1ccccc1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C5C3=O"
} |
Can you make molecule Cc1cc(N)nc(SCC(=O)NC[C@@H](c2ccccc2)C(C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Sc1nc(C)cc(N)n1)C(=O)CNC[C@@H](c1ccccc1)C(C)C | Cc1cc(N)nc(SCC(=O)NC[C@@H](c2ccccc2)C(C)C)n1 | CCC(CC)(Sc1nc(C)cc(N)n1)C(=O)CNC[C@@H](c1ccccc1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C5C3=O"
} |
Can you make molecule Cc1cc(N)nc(SCC(=O)NC[C@@H](c2ccccc2)C(C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N)nc(SSSC(=O)NC[C@@H](c2ccccc2)C(C)C)n1 | Cc1cc(N)nc(SCC(=O)NC[C@@H](c2ccccc2)C(C)C)n1 | Cc1cc(N)nc(SSSC(=O)NC[C@@H](c2ccccc2)C(C)C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C5C3=O"
} |
Can you make molecule Cc1cc(N)nc(SCC(=O)NC[C@@H](c2ccccc2)C(C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)n1nc(Sc2nc(C)cc(N)n2)nc1NC[C@@H](c1ccccc1)C(C)C | Cc1cc(N)nc(SCC(=O)NC[C@@H](c2ccccc2)C(C)C)n1 | CCC(=O)n1nc(Sc2nc(C)cc(N)n2)nc1NC[C@@H](c1ccccc1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CCC(=O)n1nc&nc1&",
"old_substring": "C5C3=O"
} |
Can you make molecule Cn1cc(C(N)=O)c(NC(=O)c2ccc3sccc3c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(N)=O)c(NSC(=O)Cc2ccc3sccc3c2)n1 | Cn1cc(C(N)=O)c(NC(=O)c2ccc3sccc3c2)n1 | Cn1cc(C(N)=O)c(NSC(=O)Cc2ccc3sccc3c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule Cn1cc(C(N)=O)c(NC(=O)c2ccc3sccc3c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(N)=O)c(NC(=O)CCCC(=O)c2ccc3sccc3c2)n1 | Cn1cc(C(N)=O)c(NC(=O)c2ccc3sccc3c2)n1 | Cn1cc(C(N)=O)c(NC(=O)CCCC(=O)c2ccc3sccc3c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule Cn1cc(C(N)=O)c(NC(=O)c2ccc3sccc3c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(N)=O)c(NC(=O)CC(C)(C)c2ccc3sccc3c2)n1 | Cn1cc(C(N)=O)c(NC(=O)c2ccc3sccc3c2)n1 | Cn1cc(C(N)=O)c(NC(=O)CC(C)(C)c2ccc3sccc3c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule Cn1cc(C(N)=O)c(NC(=O)c2ccc3sccc3c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(N)=O)c(NC(=O)CCC(C)(C)c2ccc3sccc3c2)n1 | Cn1cc(C(N)=O)c(NC(=O)c2ccc3sccc3c2)n1 | Cn1cc(C(N)=O)c(NC(=O)CCC(C)(C)c2ccc3sccc3c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule Cn1cc(C(N)=O)c(NC(=O)c2ccc3sccc3c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SNc1nn(C)cc1C(N)=O)c1ccc2sccc2c1 | Cn1cc(C(N)=O)c(NC(=O)c2ccc3sccc3c2)n1 | C[C@H](C(=O)SNc1nn(C)cc1C(N)=O)c1ccc2sccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C47=O"
} |
Can you make molecule COc1cc2c(cc1O)[C@H](c1cnc(-c3cccc(C)c3)nc1)CC(=O)N2 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc2c(cc1O)[C@H](c1cnc(-c3c(Cl)cccc3Cl)nc1)CC(=O)N2 | COc1cc2c(cc1O)[C@H](c1cnc(-c3cccc(C)c3)nc1)CC(=O)N2 | COc1cc2c(cc1O)[C@H](c1cnc(-c3c(Cl)cccc3Cl)nc1)CC(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1cccc(Cl)c1&",
"old_substring": "c15cccc(C)c1"
} |
Can you make molecule COc1cc2c(cc1O)[C@H](c1cnc(-c3cccc(C)c3)nc1)CC(=O)N2 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc2c(cc1O)[C@H](c1cnc(-c3cc(C)c(Cl)c(C)c3)nc1)CC(=O)N2 | COc1cc2c(cc1O)[C@H](c1cnc(-c3cccc(C)c3)nc1)CC(=O)N2 | COc1cc2c(cc1O)[C@H](c1cnc(-c3cc(C)c(Cl)c(C)c3)nc1)CC(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(C)c1Cl",
"old_substring": "c15cccc(C)c1"
} |
Can you make molecule COc1cc2c(cc1O)[C@H](c1cnc(-c3cccc(C)c3)nc1)CC(=O)N2 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc2c(cc1O)[C@H](c1cnc(-c3cc4cc(Cl)ccc4o3)nc1)CC(=O)N2 | COc1cc2c(cc1O)[C@H](c1cnc(-c3cccc(C)c3)nc1)CC(=O)N2 | COc1cc2c(cc1O)[C@H](c1cnc(-c3cc4cc(Cl)ccc4o3)nc1)CC(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc(Cl)ccc2o1",
"old_substring": "c15cccc(C)c1"
} |
Can you make molecule COc1cc2c(cc1O)[C@H](c1cnc(-c3cccc(C)c3)nc1)CC(=O)N2 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc2c(cc1O)[C@H](c1cnc(-c3cccc(/C=C/Br)c3)nc1)CC(=O)N2 | COc1cc2c(cc1O)[C@H](c1cnc(-c3cccc(C)c3)nc1)CC(=O)N2 | COc1cc2c(cc1O)[C@H](c1cnc(-c3cccc(/C=C/Br)c3)nc1)CC(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(/C=C/Br)c1",
"old_substring": "c15cccc(C)c1"
} |
Can you make molecule COc1cc2c(cc1O)[C@H](c1cnc(-c3cccc(C)c3)nc1)CC(=O)N2 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc2c(cc1O)[C@H](c1cnc(-c3ccc4sc(Cl)nc4c3)nc1)CC(=O)N2 | COc1cc2c(cc1O)[C@H](c1cnc(-c3cccc(C)c3)nc1)CC(=O)N2 | COc1cc2c(cc1O)[C@H](c1cnc(-c3ccc4sc(Cl)nc4c3)nc1)CC(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2sc(Cl)nc2c1",
"old_substring": "c15cccc(C)c1"
} |
Can you make molecule CC(=O)Nc1ccc(O[C@H](C)c2nc(C(C)(C)C)no2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(O[C@H](C)c2nc(C(C)(C)C)co2)cc1 | CC(=O)Nc1ccc(O[C@H](C)c2nc(C(C)(C)C)no2)cc1 | CC(=O)Nc1ccc(O[C@H](C)c2nc(C(C)(C)C)co2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&co1",
"old_substring": "c17nc8no1"
} |
Can you make molecule CC(=O)Nc1ccc(O[C@H](C)c2nc(C(C)(C)C)no2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(O[C@H](C)c2ncnc(C(C)(C)C)c2C)cc1 | CC(=O)Nc1ccc(O[C@H](C)c2nc(C(C)(C)C)no2)cc1 | CC(=O)Nc1ccc(O[C@H](C)c2ncnc(C(C)(C)C)c2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1C",
"old_substring": "c17nc8no1"
} |
Can you make molecule CC(=O)Nc1ccc(O[C@H](C)c2nc(C(C)(C)C)no2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(O[C@H](C)c2nc(C(C)(C)C)ncc2C)cc1 | CC(=O)Nc1ccc(O[C@H](C)c2nc(C(C)(C)C)no2)cc1 | CC(=O)Nc1ccc(O[C@H](C)c2nc(C(C)(C)C)ncc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1C",
"old_substring": "c17nc8no1"
} |
Can you make molecule CC(=O)Nc1ccc(O[C@H](C)c2nc(C(C)(C)C)no2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(O[C@H](C)c2ncnc(C(C)(C)C)c2F)cc1 | CC(=O)Nc1ccc(O[C@H](C)c2nc(C(C)(C)C)no2)cc1 | CC(=O)Nc1ccc(O[C@H](C)c2ncnc(C(C)(C)C)c2F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1F",
"old_substring": "c17nc8no1"
} |
Can you make molecule CC(=O)Nc1ccc(O[C@H](C)c2nc(C(C)(C)C)no2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(O[C@H](C)c2nc(C(C)(C)C)ncc2I)cc1 | CC(=O)Nc1ccc(O[C@H](C)c2nc(C(C)(C)C)no2)cc1 | CC(=O)Nc1ccc(O[C@H](C)c2nc(C(C)(C)C)ncc2I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1I",
"old_substring": "c17nc8no1"
} |
Can you make molecule O=C(c1c(-c2ccccc2)nc2sc3c(n12)CCCC3)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1c(-c2ccccc2)nc2sc3c(n12)CCCC3)C(F)(F)C(F)(F)F | O=C(c1c(-c2ccccc2)nc2sc3c(n12)CCCC3)C(F)(F)F | O=C(c1c(-c2ccccc2)nc2sc3c(n12)CCCC3)C(F)(F)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C(F)(F)C(F)(F)F",
"old_substring": "O=C4C(F)(F)F"
} |
Can you make molecule O=C(c1c(-c2ccccc2)nc2sc3c(n12)CCCC3)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)CCCc1c(-c2ccccc2)nc2sc3c(n12)CCCC3 | O=C(c1c(-c2ccccc2)nc2sc3c(n12)CCCC3)C(F)(F)F | FC(F)(F)CCCc1c(-c2ccccc2)nc2sc3c(n12)CCCC3 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "O=C4C(F)(F)F"
} |
Can you make molecule O=C(c1c(-c2ccccc2)nc2sc3c(n12)CCCC3)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O[C@@H](CCC(F)(F)F)c1c(-c2ccccc2)nc2sc3c(n12)CCCC3 | O=C(c1c(-c2ccccc2)nc2sc3c(n12)CCCC3)C(F)(F)F | O[C@@H](CCC(F)(F)F)c1c(-c2ccccc2)nc2sc3c(n12)CCCC3 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@H]&CCC(F)(F)F",
"old_substring": "O=C4C(F)(F)F"
} |
Can you make molecule O=C(c1c(-c2ccccc2)nc2sc3c(n12)CCCC3)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCc1c(-c2ccccc2)nc2sc3c(n12)CCCC3)CCC(F)(F)F | O=C(c1c(-c2ccccc2)nc2sc3c(n12)CCCC3)C(F)(F)F | O=C(CCc1c(-c2ccccc2)nc2sc3c(n12)CCCC3)CCC(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "O=C(CC&)CCC(F)(F)F",
"old_substring": "O=C4C(F)(F)F"
} |
Can you make molecule O=C(c1c(-c2ccccc2)nc2sc3c(n12)CCCC3)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1cc(F)c(-c2c(-c3ccccc3)nc3sc4c(n23)CCCC4)c(F)c1 | O=C(c1c(-c2ccccc2)nc2sc3c(n12)CCCC3)C(F)(F)F | O=Cc1cc(F)c(-c2c(-c3ccccc3)nc3sc4c(n23)CCCC4)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1cc(F)c&c(F)c1",
"old_substring": "O=C4C(F)(F)F"
} |
Can you make molecule CC(C)CNC(=O)NC(=O)[C@@H](C)Nc1ccc(OC(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CNC(=O)CC(C)(C)NC(=O)[C@@H](C)Nc1ccc(OC(C)C)cc1 | CC(C)CNC(=O)NC(=O)[C@@H](C)Nc1ccc(OC(C)C)cc1 | CC(C)CNC(=O)CC(C)(C)NC(=O)[C@@H](C)Nc1ccc(OC(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CC(C)CNC(=O)NC(=O)[C@@H](C)Nc1ccc(OC(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CNC(=O)CCC(C)(C)NC(=O)[C@@H](C)Nc1ccc(OC(C)C)cc1 | CC(C)CNC(=O)NC(=O)[C@@H](C)Nc1ccc(OC(C)C)cc1 | CC(C)CNC(=O)CCC(C)(C)NC(=O)[C@@H](C)Nc1ccc(OC(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CC(C)CNC(=O)NC(=O)[C@@H](C)Nc1ccc(OC(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(NCC(C)C)c(=O)n(NC(=O)[C@@H](C)Nc2ccc(OC(C)C)cc2)n1C | CC(C)CNC(=O)NC(=O)[C@@H](C)Nc1ccc(OC(C)C)cc1 | Cc1c(NCC(C)C)c(=O)n(NC(=O)[C@@H](C)Nc2ccc(OC(C)C)cc2)n1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)n&n1C",
"old_substring": "C23=O"
} |
Can you make molecule CC(C)CNC(=O)NC(=O)[C@@H](C)Nc1ccc(OC(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)c(NCC(C)C)nn1NC(=O)[C@@H](C)Nc1ccc(OC(C)C)cc1 | CC(C)CNC(=O)NC(=O)[C@@H](C)Nc1ccc(OC(C)C)cc1 | Cc1cc(=O)c(NCC(C)C)nn1NC(=O)[C@@H](C)Nc1ccc(OC(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(=O)c&nn1&",
"old_substring": "C23=O"
} |
Can you make molecule CC(C)CNC(=O)NC(=O)[C@@H](C)Nc1ccc(OC(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CNC(=O)C[C@@H](Br)NC(=O)[C@@H](C)Nc1ccc(OC(C)C)cc1 | CC(C)CNC(=O)NC(=O)[C@@H](C)Nc1ccc(OC(C)C)cc1 | CC(C)CNC(=O)C[C@@H](Br)NC(=O)[C@@H](C)Nc1ccc(OC(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule C=C[C@](C)(O)CC[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@]12C less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C[C@@H](CC(C)C)[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@]12C | C=C[C@](C)(O)CC[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@]12C | C=C(C)C[C@@H](CC(C)C)[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@]12C | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)C[C@H]&CC(C)C",
"old_substring": "C=C[C@](C)(O)CC3"
} |
Can you make molecule C=C[C@](C)(O)CC[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@]12C less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)CC(C)(C)[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@]12C | C=C[C@](C)(O)CC[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@]12C | C=C(C)CC(C)(C)[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@]12C | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)CC&(C)C",
"old_substring": "C=C[C@](C)(O)CC3"
} |
Can you make molecule C=C[C@](C)(O)CC[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@]12C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCCl)C[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@]12C | C=C[C@](C)(O)CC[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@]12C | CC[C@@H](CCCl)C[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@]12C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&)CCCl",
"old_substring": "C=C[C@](C)(O)CC3"
} |
Can you make molecule C=C[C@](C)(O)CC[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@]12C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CC(=O)[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@]12C)C(C)C | C=C[C@](C)(O)CC[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@]12C | CC[C@H](CC(=O)[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@]12C)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](CC&=O)C(C)C",
"old_substring": "C=C[C@](C)(O)CC3"
} |
Can you make molecule C=C[C@](C)(O)CC[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@]12C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CS)C[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@]12C | C=C[C@](C)(O)CC[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@]12C | CC[C@@H](CS)C[C@H]1C(C)=CC(=O)[C@H]2C(C)(C)CCC[C@]12C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&)CS",
"old_substring": "C=C[C@](C)(O)CC3"
} |
Can you make molecule CC[C@H](C)Sc1nncn1-c1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CBr)CSc1nncn1-c1ccccc1C | CC[C@H](C)Sc1nncn1-c1ccccc1C | CC[C@H](CBr)CSc1nncn1-c1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](C&)CBr",
"old_substring": "CC[C@@H]2C"
} |
Can you make molecule CC[C@H](C)Sc1nncn1-c1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CCCl)CSc1nncn1-c1ccccc1C | CC[C@H](C)Sc1nncn1-c1ccccc1C | CC[C@H](CCCl)CSc1nncn1-c1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](C&)CCCl",
"old_substring": "CC[C@@H]2C"
} |
Can you make molecule CC[C@H](C)Sc1nncn1-c1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](Cl)CCCSc1nncn1-c1ccccc1C | CC[C@H](C)Sc1nncn1-c1ccccc1C | CC[C@@H](Cl)CCCSc1nncn1-c1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](Cl)CCC&",
"old_substring": "CC[C@@H]2C"
} |
Can you make molecule CC[C@H](C)Sc1nncn1-c1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](Cl)[C@@H](C)Sc1nncn1-c1ccccc1C | CC[C@H](C)Sc1nncn1-c1ccccc1C | CC[C@@H](Cl)[C@@H](C)Sc1nncn1-c1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](Cl)[C@H]&C",
"old_substring": "CC[C@@H]2C"
} |
Can you make molecule CC[C@H](C)Sc1nncn1-c1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CBr)CSc1nncn1-c1ccccc1C | CC[C@H](C)Sc1nncn1-c1ccccc1C | CC[C@@H](CBr)CSc1nncn1-c1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&)CBr",
"old_substring": "CC[C@@H]2C"
} |
Can you make molecule COCC(=O)N1CCCc2ccc(NC(=O)c3cccc(Br)c3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | COCC(=O)N1CCCc2ccc(NSC(=O)Cc3cccc(Br)c3)cc21 | COCC(=O)N1CCCc2ccc(NC(=O)c3cccc(Br)c3)cc21 | COCC(=O)N1CCCc2ccc(NSC(=O)Cc3cccc(Br)c3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C58=O"
} |
Can you make molecule COCC(=O)N1CCCc2ccc(NC(=O)c3cccc(Br)c3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | COCC(=O)N1CCCc2ccc(NC(=O)CCCC(=O)c3cccc(Br)c3)cc21 | COCC(=O)N1CCCc2ccc(NC(=O)c3cccc(Br)c3)cc21 | COCC(=O)N1CCCc2ccc(NC(=O)CCCC(=O)c3cccc(Br)c3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C58=O"
} |
Can you make molecule COCC(=O)N1CCCc2ccc(NC(=O)c3cccc(Br)c3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | COCC(=O)N1CCCc2ccc(NC(=O)CC(C)(C)c3cccc(Br)c3)cc21 | COCC(=O)N1CCCc2ccc(NC(=O)c3cccc(Br)c3)cc21 | COCC(=O)N1CCCc2ccc(NC(=O)CC(C)(C)c3cccc(Br)c3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C58=O"
} |
Can you make molecule COCC(=O)N1CCCc2ccc(NC(=O)c3cccc(Br)c3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | COCC(=O)N1CCCc2ccc(NC(=O)CCC(C)(C)c3cccc(Br)c3)cc21 | COCC(=O)N1CCCc2ccc(NC(=O)c3cccc(Br)c3)cc21 | COCC(=O)N1CCCc2ccc(NC(=O)CCC(C)(C)c3cccc(Br)c3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C58=O"
} |
Can you make molecule COCC(=O)N1CCCc2ccc(NC(=O)c3cccc(Br)c3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | COCC(=O)N1CCCc2ccc(NSC(=O)[C@@H](C)c3cccc(Br)c3)cc21 | COCC(=O)N1CCCc2ccc(NC(=O)c3cccc(Br)c3)cc21 | COCC(=O)N1CCCc2ccc(NSC(=O)[C@@H](C)c3cccc(Br)c3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C58=O"
} |
Can you make molecule C[C@H](Oc1cccc(Cl)c1)C(=O)Nc1ccc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=S)Sc1cccc(Cl)c1)C(=O)Nc1ccc2ccccc2c1 | C[C@H](Oc1cccc(Cl)c1)C(=O)Nc1ccc2ccccc2c1 | C[C@H](OC(=S)Sc1cccc(Cl)c1)C(=O)Nc1ccc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O45"
} |
Can you make molecule C[C@H](Oc1cccc(Cl)c1)C(=O)Nc1ccc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=N)Cc1cccc(Cl)c1)C(=O)Nc1ccc2ccccc2c1 | C[C@H](Oc1cccc(Cl)c1)C(=O)Nc1ccc2ccccc2c1 | C[C@H](OC(=N)Cc1cccc(Cl)c1)C(=O)Nc1ccc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O45"
} |
Can you make molecule C[C@H](Oc1cccc(Cl)c1)C(=O)Nc1ccc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)CCC(=O)c1cccc(Cl)c1)C(=O)Nc1ccc2ccccc2c1 | C[C@H](Oc1cccc(Cl)c1)C(=O)Nc1ccc2ccccc2c1 | C[C@H](C(=O)CCC(=O)c1cccc(Cl)c1)C(=O)Nc1ccc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O45"
} |
Can you make molecule C[C@H](Oc1cccc(Cl)c1)C(=O)Nc1ccc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)Nc1ccc2ccccc2c1)[C@H](O)CCc1cccc(Cl)c1 | C[C@H](Oc1cccc(Cl)c1)C(=O)Nc1ccc2ccccc2c1 | C[C@@H](C(=O)Nc1ccc2ccccc2c1)[C@H](O)CCc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O45"
} |
Can you make molecule C[C@H](Oc1cccc(Cl)c1)C(=O)Nc1ccc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)/C=C/Sc1cccc(Cl)c1)C(=O)Nc1ccc2ccccc2c1 | C[C@H](Oc1cccc(Cl)c1)C(=O)Nc1ccc2ccccc2c1 | C[C@H](C(=O)/C=C/Sc1cccc(Cl)c1)C(=O)Nc1ccc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O45"
} |
Can you make molecule Cc1cc(Br)ccc1SCC(=O)N1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(CSc1ccc(Br)cc1C)=N/ON1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 | Cc1cc(Br)ccc1SCC(=O)N1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 | C/C(CSc1ccc(Br)cc1C)=N/ON1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C5C4=O"
} |
Can you make molecule Cc1cc(Br)ccc1SCC(=O)N1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Sc1ccc(Br)cc1C)C(=O)CN1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 | Cc1cc(Br)ccc1SCC(=O)N1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 | CCC(CC)(Sc1ccc(Br)cc1C)C(=O)CN1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C5C4=O"
} |
Can you make molecule Cc1cc(Br)ccc1SCC(=O)N1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)ccc1SSSC(=O)N1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 | Cc1cc(Br)ccc1SCC(=O)N1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 | Cc1cc(Br)ccc1SSSC(=O)N1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C5C4=O"
} |
Can you make molecule Cc1cc(Br)ccc1SCC(=O)N1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Sc1ccc(Br)cc1C)C(=O)CCN1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 | Cc1cc(Br)ccc1SCC(=O)N1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 | CCC(CC)(Sc1ccc(Br)cc1C)C(=O)CCN1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C5C4=O"
} |
Can you make molecule Cc1cc(Br)ccc1SCC(=O)N1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)Sc1ccc(Br)cc1C)C(=O)N1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 | Cc1cc(Br)ccc1SCC(=O)N1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 | CC[C@H](C(=O)Sc1ccc(Br)cc1C)C(=O)N1CCC(C(=O)c2ccc3c(c2)OCCO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C5C4=O"
} |
Can you make molecule Nc1ccc2c(c1)CN(C(=O)c1ccc(Cl)cn1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc2c(c1)CN(C(=O)c1ccc(Cl)cc1I)CC2 | Nc1ccc2c(c1)CN(C(=O)c1ccc(Cl)cn1)CC2 | Nc1ccc2c(c1)CN(C(=O)c1ccc(Cl)cc1I)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c14ccc(Cl)cn1"
} |
Can you make molecule Nc1ccc2c(c1)CN(C(=O)c1ccc(Cl)cn1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc2c(c1)CN(C(=O)c1ccc(Cl)s1)CC2 | Nc1ccc2c(c1)CN(C(=O)c1ccc(Cl)cn1)CC2 | Nc1ccc2c(c1)CN(C(=O)c1ccc(Cl)s1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c14ccc(Cl)cn1"
} |
Can you make molecule Nc1ccc2c(c1)CN(C(=O)c1ccc(Cl)cn1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc2c(c1)CN(C(=O)c1ccc(Cl)cc1Br)CC2 | Nc1ccc2c(c1)CN(C(=O)c1ccc(Cl)cn1)CC2 | Nc1ccc2c(c1)CN(C(=O)c1ccc(Cl)cc1Br)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c14ccc(Cl)cn1"
} |
Can you make molecule Nc1ccc2c(c1)CN(C(=O)c1ccc(Cl)cn1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(C(=O)N2CCc3ccc(N)cc3C2)cc2c(Cl)cccc21 | Nc1ccc2c(c1)CN(C(=O)c1ccc(Cl)cn1)CC2 | Cn1c(C(=O)N2CCc3ccc(N)cc3C2)cc2c(Cl)cccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(Cl)cccc2n1C",
"old_substring": "c14ccc(Cl)cn1"
} |
Can you make molecule Nc1ccc2c(c1)CN(C(=O)c1ccc(Cl)cn1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc2c(c1)CN(C(=O)c1ccc(Cl)c3ncccc13)CC2 | Nc1ccc2c(c1)CN(C(=O)c1ccc(Cl)cn1)CC2 | Nc1ccc2c(c1)CN(C(=O)c1ccc(Cl)c3ncccc13)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c2ncccc12",
"old_substring": "c14ccc(Cl)cn1"
} |
Can you make molecule C[C@H](CN(C)C(=O)c1ccc(F)c(F)c1F)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCC[C@@H](N)C(=O)c1ccc(F)c(F)c1F)C(=O)[O-] | C[C@H](CN(C)C(=O)c1ccc(F)c(F)c1F)C(=O)[O-] | C[C@H](CCC[C@@H](N)C(=O)c1ccc(F)c(F)c1F)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "N[C@@H]&CC&",
"old_substring": "N23C"
} |
Can you make molecule C[C@H](CN(C)C(=O)c1ccc(F)c(F)c1F)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCC1=NCCN1C(=O)c1ccc(F)c(F)c1F)C(=O)[O-] | C[C@H](CN(C)C(=O)c1ccc(F)c(F)c1F)C(=O)[O-] | C[C@H](CCC1=NCCN1C(=O)c1ccc(F)c(F)c1F)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1C&",
"old_substring": "N23C"
} |
Can you make molecule C[C@H](CN(C)C(=O)c1ccc(F)c(F)c1F)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1sc(C(=O)c2ccc(F)c(F)c2F)cc1C#N)C(=O)[O-] | C[C@H](CN(C)C(=O)c1ccc(F)c(F)c1F)C(=O)[O-] | C[C@H](Cc1sc(C(=O)c2ccc(F)c(F)c2F)cc1C#N)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N23C"
} |
Can you make molecule C[C@H](CN(C)C(=O)c1ccc(F)c(F)c1F)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1ccc(C(=O)c2ccc(F)c(F)c2F)cc1C#N)C(=O)[O-] | C[C@H](CN(C)C(=O)c1ccc(F)c(F)c1F)C(=O)[O-] | C[C@H](Cc1ccc(C(=O)c2ccc(F)c(F)c2F)cc1C#N)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N23C"
} |
Can you make molecule C[C@H](CN(C)C(=O)c1ccc(F)c(F)c1F)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CN1CCC(=NOC(=O)c2ccc(F)c(F)c2F)CC1)C(=O)[O-] | C[C@H](CN(C)C(=O)c1ccc(F)c(F)c1F)C(=O)[O-] | C[C@H](CN1CCC(=NOC(=O)c2ccc(F)c(F)c2F)CC1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N23C"
} |
Can you make molecule NC(=O)c1ccc(SCC(=O)Nc2ccc3c(c2)Cc2ccccc2-3)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)CCCc1ccc(SCC(=O)Nc2ccc3c(c2)Cc2ccccc2-3)c([N+](=O)[O-])c1 | NC(=O)c1ccc(SCC(=O)Nc2ccc3c(c2)Cc2ccccc2-3)c([N+](=O)[O-])c1 | NC(=O)CCCc1ccc(SCC(=O)Nc2ccc3c(c2)Cc2ccccc2-3)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "NC(=O)CCC&",
"old_substring": "NC7=O"
} |
Can you make molecule NC(=O)c1ccc(SCC(=O)Nc2ccc3c(c2)Cc2ccccc2-3)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CCCN(c2ccc(SCC(=O)Nc3ccc4c(c3)Cc3ccccc3-4)c([N+](=O)[O-])c2)C1 | NC(=O)c1ccc(SCC(=O)Nc2ccc3c(c2)Cc2ccccc2-3)c([N+](=O)[O-])c1 | O=C1CCCN(c2ccc(SCC(=O)Nc3ccc4c(c3)Cc3ccccc3-4)c([N+](=O)[O-])c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(=O)C1",
"old_substring": "NC7=O"
} |
Can you make molecule NC(=O)c1ccc(SCC(=O)Nc2ccc3c(c2)Cc2ccccc2-3)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)c1ccc(SCC(=O)Nc2ccc3c(c2)Cc2ccccc2-3)c([N+](=O)[O-])c1 | NC(=O)c1ccc(SCC(=O)Nc2ccc3c(c2)Cc2ccccc2-3)c([N+](=O)[O-])c1 | CCC(=O)c1ccc(SCC(=O)Nc2ccc3c(c2)Cc2ccccc2-3)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&=O",
"old_substring": "NC7=O"
} |
Can you make molecule NC(=O)c1ccc(SCC(=O)Nc2ccc3c(c2)Cc2ccccc2-3)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | O=CC1CCN(c2ccc(SCC(=O)Nc3ccc4c(c3)Cc3ccccc3-4)c([N+](=O)[O-])c2)CC1 | NC(=O)c1ccc(SCC(=O)Nc2ccc3c(c2)Cc2ccccc2-3)c([N+](=O)[O-])c1 | O=CC1CCN(c2ccc(SCC(=O)Nc3ccc4c(c3)Cc3ccccc3-4)c([N+](=O)[O-])c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C=O)CC1",
"old_substring": "NC7=O"
} |
Can you make molecule NC(=O)c1ccc(SCC(=O)Nc2ccc3c(c2)Cc2ccccc2-3)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1ccc(N2C(=O)CSC2=S)cc1[N+](=O)[O-])Nc1ccc2c(c1)Cc1ccccc1-2 | NC(=O)c1ccc(SCC(=O)Nc2ccc3c(c2)Cc2ccccc2-3)c([N+](=O)[O-])c1 | O=C(CSc1ccc(N2C(=O)CSC2=S)cc1[N+](=O)[O-])Nc1ccc2c(c1)Cc1ccccc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&C(=O)CSC1=S",
"old_substring": "NC7=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.