prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CN(C(=O)CSCC(F)(F)F)c1cccc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSCC(F)(F)F)C1CCN(c2cccc([N+](=O)[O-])c2)CC1 | CN(C(=O)CSCC(F)(F)F)c1cccc([N+](=O)[O-])c1 | O=C(CSCC(F)(F)F)C1CCN(c2cccc([N+](=O)[O-])c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "CN25"
} |
Can you make molecule CN(C(=O)CSCC(F)(F)F)c1cccc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)CSCC(F)(F)F)C(=S)Sc1cccc([N+](=O)[O-])c1 | CN(C(=O)CSCC(F)(F)F)c1cccc([N+](=O)[O-])c1 | CN(C(=O)CSCC(F)(F)F)C(=S)Sc1cccc([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "CN25"
} |
Can you make molecule CN(C(=O)CSCC(F)(F)F)c1cccc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSCC(F)(F)F)CN1CCC(c2cccc([N+](=O)[O-])c2)CC1 | CN(C(=O)CSCC(F)(F)F)c1cccc([N+](=O)[O-])c1 | O=C(CSCC(F)(F)F)CN1CCC(c2cccc([N+](=O)[O-])c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "CN25"
} |
Can you make molecule CN(C(=O)CSCC(F)(F)F)c1cccc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSCC(F)(F)F)N1CSC(=S)N(c2cccc([N+](=O)[O-])c2)C1 | CN(C(=O)CSCC(F)(F)F)c1cccc([N+](=O)[O-])c1 | O=C(CSCC(F)(F)F)N1CSC(=S)N(c2cccc([N+](=O)[O-])c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S=C1SCN&CN1&",
"old_substring": "CN25"
} |
Can you make molecule CN(C(=O)CSCC(F)(F)F)c1cccc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(C(=O)CSCC(F)(F)F)CCC(c2cccc([N+](=O)[O-])c2)CC1 | CN(C(=O)CSCC(F)(F)F)c1cccc([N+](=O)[O-])c1 | N#CC1(C(=O)CSCC(F)(F)F)CCC(c2cccc([N+](=O)[O-])c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "CN25"
} |
Can you make molecule C=CCn1c(SCC(=O)Nc2cc(C)on2)nnc1[C@H]1COc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCc1cn(SCC(=O)Nc2cc(C)on2)nc1[C@H]1COc2ccccc2O1 | C=CCn1c(SCC(=O)Nc2cc(C)on2)nnc1[C@H]1COc2ccccc2O1 | C=CCc1cn(SCC(=O)Nc2cc(C)on2)nc1[C@H]1COc2ccccc2O1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cn&nc1&",
"old_substring": "n16c7nnc18"
} |
Can you make molecule C=CCn1c(SCC(=O)Nc2cc(C)on2)nnc1[C@H]1COc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCc1cc(SCC(=O)Nc2cc(C)on2)nc2c([C@H]3COc4ccccc4O3)ncn12 | C=CCn1c(SCC(=O)Nc2cc(C)on2)nnc1[C@H]1COc2ccccc2O1 | C=CCc1cc(SCC(=O)Nc2cc(C)on2)nc2c([C@H]3COc4ccccc4O3)ncn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&nc2c&ncn12",
"old_substring": "n16c7nnc18"
} |
Can you make molecule C=CCn1c(SCC(=O)Nc2cc(C)on2)nnc1[C@H]1COc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCn1cc(SCC(=O)Nc2cc(C)on2)c2c([C@H]3COc4ccccc4O3)ncnc21 | C=CCn1c(SCC(=O)Nc2cc(C)on2)nnc1[C@H]1COc2ccccc2O1 | C=CCn1cc(SCC(=O)Nc2cc(C)on2)c2c([C@H]3COc4ccccc4O3)ncnc21 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc&c2c&ncnc21",
"old_substring": "n16c7nnc18"
} |
Can you make molecule C=CCn1c(SCC(=O)Nc2cc(C)on2)nnc1[C@H]1COc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCn1ccc2nc(SCC(=O)Nc3cc(C)on3)nc([C@H]3COc4ccccc4O3)c21 | C=CCn1c(SCC(=O)Nc2cc(C)on2)nnc1[C@H]1COc2ccccc2O1 | C=CCn1ccc2nc(SCC(=O)Nc3cc(C)on3)nc([C@H]3COc4ccccc4O3)c21 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccc2nc&nc&c21",
"old_substring": "n16c7nnc18"
} |
Can you make molecule C=CCn1c(SCC(=O)Nc2cc(C)on2)nnc1[C@H]1COc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCn1cnc2c(SCC(=O)Nc3cc(C)on3)cn([C@H]3COc4ccccc4O3)c2c1=O | C=CCn1c(SCC(=O)Nc2cc(C)on2)nnc1[C@H]1COc2ccccc2O1 | C=CCn1cnc2c(SCC(=O)Nc3cc(C)on3)cn([C@H]3COc4ccccc4O3)c2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "n1&cnc2c&cn&c2c1=O",
"old_substring": "n16c7nnc18"
} |
Can you make molecule CC(=O)N[C@@H](CC(=O)Nc1ccnn1Cc1ccc(C)o1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@@H](CC(=O)Nc1ccnn1Cc1ccc(C)o1)c1ccccc1Cl | CC(=O)N[C@@H](CC(=O)Nc1ccnn1Cc1ccc(C)o1)c1ccccc1 | CC(=O)N[C@@H](CC(=O)Nc1ccnn1Cc1ccc(C)o1)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c18ccccc1"
} |
Can you make molecule CC(=O)N[C@@H](CC(=O)Nc1ccnn1Cc1ccc(C)o1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@@H](CC(=O)Nc1ccnn1Cc1ccc(C)o1)c1ccc(I)cc1 | CC(=O)N[C@@H](CC(=O)Nc1ccnn1Cc1ccc(C)o1)c1ccccc1 | CC(=O)N[C@@H](CC(=O)Nc1ccnn1Cc1ccc(C)o1)c1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c18ccccc1"
} |
Can you make molecule CC(=O)N[C@@H](CC(=O)Nc1ccnn1Cc1ccc(C)o1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@@H](CC(=O)Nc1ccnn1Cc1ccc(C)o1)c1ccc(C)c(I)c1 | CC(=O)N[C@@H](CC(=O)Nc1ccnn1Cc1ccc(C)o1)c1ccccc1 | CC(=O)N[C@@H](CC(=O)Nc1ccnn1Cc1ccc(C)o1)c1ccc(C)c(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c18ccccc1"
} |
Can you make molecule CC(=O)N[C@@H](CC(=O)Nc1ccnn1Cc1ccc(C)o1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@@H](CC(=O)Nc1ccnn1Cc1ccc(C)o1)c1cccc(Br)c1 | CC(=O)N[C@@H](CC(=O)Nc1ccnn1Cc1ccc(C)o1)c1ccccc1 | CC(=O)N[C@@H](CC(=O)Nc1ccnn1Cc1ccc(C)o1)c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c18ccccc1"
} |
Can you make molecule CC(=O)N[C@@H](CC(=O)Nc1ccnn1Cc1ccc(C)o1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@@H](CC(=O)Nc1ccnn1Cc1ccc(C)o1)c1cccc(C)c1C | CC(=O)N[C@@H](CC(=O)Nc1ccnn1Cc1ccc(C)o1)c1ccccc1 | CC(=O)N[C@@H](CC(=O)Nc1ccnn1Cc1ccc(C)o1)c1cccc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c18ccccc1"
} |
Can you make molecule CNC(=O)Cc1nc(C[NH+](C)C2CCC(c3ccccc3)CC2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)Cc1ccc(C[NH+](C)C2CCC(c3ccccc3)CC2)s1 | CNC(=O)Cc1nc(C[NH+](C)C2CCC(c3ccccc3)CC2)cs1 | CNC(=O)Cc1ccc(C[NH+](C)C2CCC(c3ccccc3)CC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&s1",
"old_substring": "c17nc8cs1"
} |
Can you make molecule CNC(=O)Cc1nc(C[NH+](C)C2CCC(c3ccccc3)CC2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)Cc1sc(C[NH+](C)C2CCC(c3ccccc3)CC2)nc1Cl | CNC(=O)Cc1nc(C[NH+](C)C2CCC(c3ccccc3)CC2)cs1 | CNC(=O)Cc1sc(C[NH+](C)C2CCC(c3ccccc3)CC2)nc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc&nc1Cl",
"old_substring": "c17nc8cs1"
} |
Can you make molecule CNC(=O)Cc1nc(C[NH+](C)C2CCC(c3ccccc3)CC2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)Cc1nc2c(C[NH+](C)C3CCC(c4ccccc4)CC3)cccc2s1 | CNC(=O)Cc1nc(C[NH+](C)C2CCC(c3ccccc3)CC2)cs1 | CNC(=O)Cc1nc2c(C[NH+](C)C3CCC(c4ccccc4)CC3)cccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2c&cccc2s1",
"old_substring": "c17nc8cs1"
} |
Can you make molecule CNC(=O)Cc1nc(C[NH+](C)C2CCC(c3ccccc3)CC2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)Cc1nccc(C[NH+](C)C2CCC(c3ccccc3)CC2)c1I | CNC(=O)Cc1nc(C[NH+](C)C2CCC(c3ccccc3)CC2)cs1 | CNC(=O)Cc1nccc(C[NH+](C)C2CCC(c3ccccc3)CC2)c1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&nccc&c1I",
"old_substring": "c17nc8cs1"
} |
Can you make molecule CNC(=O)Cc1nc(C[NH+](C)C2CCC(c3ccccc3)CC2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)Cc1cc(C[NH+](C)C2CCC(c3ccccc3)CC2)sc1Br | CNC(=O)Cc1nc(C[NH+](C)C2CCC(c3ccccc3)CC2)cs1 | CNC(=O)Cc1cc(C[NH+](C)C2CCC(c3ccccc3)CC2)sc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&sc1Br",
"old_substring": "c17nc8cs1"
} |
Can you make molecule COCCOc1c(Cl)cccc1NC(=O)Cc1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | COCCOc1cc(Br)cc(NC(=O)Cc2c[nH]c3ccccc23)c1Cl | COCCOc1c(Cl)cccc1NC(=O)Cc1c[nH]c2ccccc12 | COCCOc1cc(Br)cc(NC(=O)Cc2c[nH]c3ccccc23)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)cc&c1Cl",
"old_substring": "c16c7cccc1Cl"
} |
Can you make molecule COCCOc1c(Cl)cccc1NC(=O)Cc1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | COCCOc1c(Cl)cc(NC(=O)Cc2c[nH]c3ccccc23)cc1Cl | COCCOc1c(Cl)cccc1NC(=O)Cc1c[nH]c2ccccc12 | COCCOc1c(Cl)cc(NC(=O)Cc2c[nH]c3ccccc23)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc&cc1Cl",
"old_substring": "c16c7cccc1Cl"
} |
Can you make molecule COCCOc1c(Cl)cccc1NC(=O)Cc1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | COCCOc1cc(Cl)c(NC(=O)Cc2c[nH]c3ccccc23)cc1Cl | COCCOc1c(Cl)cccc1NC(=O)Cc1c[nH]c2ccccc12 | COCCOc1cc(Cl)c(NC(=O)Cc2c[nH]c3ccccc23)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)c&cc1Cl",
"old_substring": "c16c7cccc1Cl"
} |
Can you make molecule COCCOc1c(Cl)cccc1NC(=O)Cc1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | COCCOc1cc(NC(=O)Cc2c[nH]c3ccccc23)c(Cl)cc1Cl | COCCOc1c(Cl)cccc1NC(=O)Cc1c[nH]c2ccccc12 | COCCOc1cc(NC(=O)Cc2c[nH]c3ccccc23)c(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c(Cl)cc1Cl",
"old_substring": "c16c7cccc1Cl"
} |
Can you make molecule COCCOc1c(Cl)cccc1NC(=O)Cc1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | COCCOc1ccc(NC(=O)Cc2c[nH]c3ccccc23)c(Cl)c1Cl | COCCOc1c(Cl)cccc1NC(=O)Cc1c[nH]c2ccccc12 | COCCOc1ccc(NC(=O)Cc2c[nH]c3ccccc23)c(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&c(Cl)c1Cl",
"old_substring": "c16c7cccc1Cl"
} |
Can you make molecule COCCN1[C@H](C)CN(C(=O)C[NH+](C)C2CC2)C[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | COCCN1[C@H](C)CN(C(=O)C[NH+]2CCC(C3CC3)CC2)C[C@@H]1C | COCCN1[C@H](C)CN(C(=O)C[NH+](C)C2CC2)C[C@@H]1C | COCCN1[C@H](C)CN(C(=O)C[NH+]2CCC(C3CC3)CC2)C[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&CC1",
"old_substring": "[NH+]67C"
} |
Can you make molecule COCCN1[C@H](C)CN(C(=O)C[NH+](C)C2CC2)C[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | COCCN1[C@H](C)CN(C(=O)CC[NH+](C)CC2CC2)C[C@@H]1C | COCCN1[C@H](C)CN(C(=O)C[NH+](C)C2CC2)C[C@@H]1C | COCCN1[C@H](C)CN(C(=O)CC[NH+](C)CC2CC2)C[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C[NH+](C&)C&",
"old_substring": "[NH+]67C"
} |
Can you make molecule COCCN1[C@H](C)CN(C(=O)C[NH+](C)C2CC2)C[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | COCCN1[C@H](C)CN(C(=O)CC[NH+]2CCC(C3CC3)CC2)C[C@@H]1C | COCCN1[C@H](C)CN(C(=O)C[NH+](C)C2CC2)C[C@@H]1C | COCCN1[C@H](C)CN(C(=O)CC[NH+]2CCC(C3CC3)CC2)C[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&CC1",
"old_substring": "[NH+]67C"
} |
Can you make molecule COCCN1[C@H](C)CN(C(=O)C[NH+](C)C2CC2)C[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | COCCN1[C@H](C)CN(C(=O)C[NH+]2CC=C(CC3CC3)CC2)C[C@@H]1C | COCCN1[C@H](C)CN(C(=O)C[NH+](C)C2CC2)C[C@@H]1C | COCCN1[C@H](C)CN(C(=O)C[NH+]2CC=C(CC3CC3)CC2)C[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC=C(C&)CC1",
"old_substring": "[NH+]67C"
} |
Can you make molecule COCCN1[C@H](C)CN(C(=O)C[NH+](C)C2CC2)C[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | COCCN1[C@H](C)CN(C(=O)C[NH+]2Cc3cc(C4CC4)sc3C2)C[C@@H]1C | COCCN1[C@H](C)CN(C(=O)C[NH+](C)C2CC2)C[C@@H]1C | COCCN1[C@H](C)CN(C(=O)C[NH+]2Cc3cc(C4CC4)sc3C2)C[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&Cc2cc&sc2C1",
"old_substring": "[NH+]67C"
} |
Can you make molecule CSc1nncn1/N=C\c1cc(Cl)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc(Cl)cc1/C=N\n1cnnc1N1CCSc2ccccc21 | CSc1nncn1/N=C\c1cc(Cl)ccc1F | Fc1ccc(Cl)cc1/C=N\n1cnnc1N1CCSc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccccc21",
"old_substring": "CS2"
} |
Can you make molecule CSc1nncn1/N=C\c1cc(Cl)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc(Cl)cc1/C=N\n1cnnc1N1CCCSc2ccccc21 | CSc1nncn1/N=C\c1cc(Cl)ccc1F | Fc1ccc(Cl)cc1/C=N\n1cnnc1N1CCCSc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCSc2ccccc21",
"old_substring": "CS2"
} |
Can you make molecule CSc1nncn1/N=C\c1cc(Cl)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C1CCSC(c2nncn2/N=C\c2cc(Cl)ccc2F)=C2C=CC=C12 | CSc1nncn1/N=C\c1cc(Cl)ccc1F | O=C1CCSC(c2nncn2/N=C\c2cc(Cl)ccc2F)=C2C=CC=C12 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1CCSc2c&cccc21",
"old_substring": "CS2"
} |
Can you make molecule CSc1nncn1/N=C\c1cc(Cl)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc(Cl)cc1/C=N\n1cnnc1N1CCSC2(CCCCC2)C1 | CSc1nncn1/N=C\c1cc(Cl)ccc1F | Fc1ccc(Cl)cc1/C=N\n1cnnc1N1CCSC2(CCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSC2(CCCCC2)C1",
"old_substring": "CS2"
} |
Can you make molecule CSc1nncn1/N=C\c1cc(Cl)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc(Cl)cc1/C=N\n1cnnc1N1CCSc2ccc(Cl)cc21 | CSc1nncn1/N=C\c1cc(Cl)ccc1F | Fc1ccc(Cl)cc1/C=N\n1cnnc1N1CCSc2ccc(Cl)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc(Cl)cc21",
"old_substring": "CS2"
} |
Can you make molecule CC(C)(C)OC(=O)N1CC[C@H]2CC(=O)[C@H]2C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)OC(=O)CC(C)(C)N1CC[C@H]2CC(=O)[C@H]2C1 | CC(C)(C)OC(=O)N1CC[C@H]2CC(=O)[C@H]2C1 | CC(C)(C)OC(=O)CC(C)(C)N1CC[C@H]2CC(=O)[C@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CC(C)(C)OC(=O)N1CC[C@H]2CC(=O)[C@H]2C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)OC(=O)CCC(C)(C)N1CC[C@H]2CC(=O)[C@H]2C1 | CC(C)(C)OC(=O)N1CC[C@H]2CC(=O)[C@H]2C1 | CC(C)(C)OC(=O)CCC(C)(C)N1CC[C@H]2CC(=O)[C@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CC(C)(C)OC(=O)N1CC[C@H]2CC(=O)[C@H]2C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)OC(=O)C[C@@H](Br)N1CC[C@H]2CC(=O)[C@H]2C1 | CC(C)(C)OC(=O)N1CC[C@H]2CC(=O)[C@H]2C1 | CC(C)(C)OC(=O)C[C@@H](Br)N1CC[C@H]2CC(=O)[C@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule CC(C)(C)OC(=O)N1CC[C@H]2CC(=O)[C@H]2C1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(OOC(C)(C)C)c1ccc(N2CC[C@H]3CC(=O)[C@H]3C2)cc1 | CC(C)(C)OC(=O)N1CC[C@H]2CC(=O)[C@H]2C1 | C=C(OOC(C)(C)C)c1ccc(N2CC[C@H]3CC(=O)[C@H]3C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(O&)c1ccc&cc1",
"old_substring": "C34=O"
} |
Can you make molecule CC(C)(C)OC(=O)N1CC[C@H]2CC(=O)[C@H]2C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(OC(C)(C)C)C(=O)CCN1CC[C@H]2CC(=O)[C@H]2C1 | CC(C)(C)OC(=O)N1CC[C@H]2CC(=O)[C@H]2C1 | CCC(CC)(OC(C)(C)C)C(=O)CCN1CC[C@H]2CC(=O)[C@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C34=O"
} |
Can you make molecule C[C@@H](CCO)SCc1ccccc1OC(F)F less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCO)SCSCc1ccccc1OC(F)F | C[C@@H](CCO)SCc1ccccc1OC(F)F | C[C@@H](CCO)SCSCc1ccccc1OC(F)F | 102 | {
"fragment_index": 0,
"new_substring": "S&CS&",
"old_substring": "S34"
} |
Can you make molecule C[C@@H](CCO)SCc1ccccc1OC(F)F less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCO)N1CCSc2ccc(Cc3ccccc3OC(F)F)cc21 | C[C@@H](CCO)SCc1ccccc1OC(F)F | C[C@@H](CCO)N1CCSc2ccc(Cc3ccccc3OC(F)F)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "S34"
} |
Can you make molecule C[C@@H](CCO)SCc1ccccc1OC(F)F less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCO)S/C(Cl)=C(\C#N)NCc1ccccc1OC(F)F | C[C@@H](CCO)SCc1ccccc1OC(F)F | C[C@@H](CCO)S/C(Cl)=C(\C#N)NCc1ccccc1OC(F)F | 102 | {
"fragment_index": 0,
"new_substring": "S&/C(Cl)=C(\\C#N)N&",
"old_substring": "S34"
} |
Can you make molecule C[C@@H](CCO)SCc1ccccc1OC(F)F less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCO)n1c(=S)n(Cc2ccccc2OC(F)F)c2ccccc21 | C[C@@H](CCO)SCc1ccccc1OC(F)F | C[C@@H](CCO)n1c(=S)n(Cc2ccccc2OC(F)F)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "n1&c(=S)n&c2ccccc21",
"old_substring": "S34"
} |
Can you make molecule C[C@@H](CCO)SCc1ccccc1OC(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1sc(S(=O)(=O)Cc2ccccc2OC(F)F)cc1[C@@H](C)CCO | C[C@@H](CCO)SCc1ccccc1OC(F)F | Cc1sc(S(=O)(=O)Cc2ccccc2OC(F)F)cc1[C@@H](C)CCO | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(S&(=O)=O)sc1C",
"old_substring": "S34"
} |
Can you make molecule C[C@@H]1C[C@@H]1C(=O)Nc1ccc(F)cc1C(=O)NC1CCC(O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@@H]1C(=O)Nc1ccc(F)cc1C(=O)N=C1CCC(=O)CC1 | C[C@@H]1C[C@@H]1C(=O)Nc1ccc(F)cc1C(=O)NC1CCC(O)CC1 | C[C@@H]1C[C@@H]1C(=O)Nc1ccc(F)cc1C(=O)N=C1CCC(=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCC(=O)CC1",
"old_substring": "C15CCC(O)CC1"
} |
Can you make molecule C[C@@H]1C[C@@H]1C(=O)Nc1ccc(F)cc1C(=O)NC1CCC(O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@@H]1C(=O)Nc1ccc(F)cc1C(=O)NC1CCCCC1 | C[C@@H]1C[C@@H]1C(=O)Nc1ccc(F)cc1C(=O)NC1CCC(O)CC1 | C[C@@H]1C[C@@H]1C(=O)Nc1ccc(F)cc1C(=O)NC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C15CCC(O)CC1"
} |
Can you make molecule C[C@@H]1C[C@@H]1C(=O)Nc1ccc(F)cc1C(=O)NC1CCC(O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@@H]1C(=O)Nc1ccc(F)cc1C(=O)NC1(C)CCCC1 | C[C@@H]1C[C@@H]1C(=O)Nc1ccc(F)cc1C(=O)NC1CCC(O)CC1 | C[C@@H]1C[C@@H]1C(=O)Nc1ccc(F)cc1C(=O)NC1(C)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C15CCC(O)CC1"
} |
Can you make molecule C[C@@H]1C[C@@H]1C(=O)Nc1ccc(F)cc1C(=O)NC1CCC(O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(O)(CCC)NC(=O)c1cc(F)ccc1NC(=O)[C@H]1C[C@H]1C | C[C@@H]1C[C@@H]1C(=O)Nc1ccc(F)cc1C(=O)NC1CCC(O)CC1 | CCCC(O)(CCC)NC(=O)c1cc(F)ccc1NC(=O)[C@H]1C[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(O)CCC",
"old_substring": "C15CCC(O)CC1"
} |
Can you make molecule C[C@@H]1C[C@@H]1C(=O)Nc1ccc(F)cc1C(=O)NC1CCC(O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@@H]1C(=O)Nc1ccc(F)cc1C(=O)NCC1=CCCSC1 | C[C@@H]1C[C@@H]1C(=O)Nc1ccc(F)cc1C(=O)NC1CCC(O)CC1 | C[C@@H]1C[C@@H]1C(=O)Nc1ccc(F)cc1C(=O)NCC1=CCCSC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(C&)CSCC1",
"old_substring": "C15CCC(O)CC1"
} |
Can you make molecule COc1ccccc1CNC(=O)COc1ncnc2oc(C)c(C)c12 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CNC(=O)COc2ncnc3oc(C)c(C)c23)cc1I | COc1ccccc1CNC(=O)COc1ncnc2oc(C)c(C)c12 | COc1ccc(CNC(=O)COc2ncnc3oc(C)c(C)c23)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16ccccc18"
} |
Can you make molecule COc1ccccc1CNC(=O)COc1ncnc2oc(C)c(C)c12 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(CNC(=O)COc2ncnc3oc(C)c(C)c23)ccc1Br | COc1ccccc1CNC(=O)COc1ncnc2oc(C)c(C)c12 | COc1cc(CNC(=O)COc2ncnc3oc(C)c(C)c23)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16ccccc18"
} |
Can you make molecule COc1ccccc1CNC(=O)COc1ncnc2oc(C)c(C)c12 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CNC(=O)COc2ncnc3oc(C)c(C)c23)cc1Cl | COc1ccccc1CNC(=O)COc1ncnc2oc(C)c(C)c12 | COc1ccc(CNC(=O)COc2ncnc3oc(C)c(C)c23)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16ccccc18"
} |
Can you make molecule COc1ccccc1CNC(=O)COc1ncnc2oc(C)c(C)c12 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CNC(=O)COc2ncnc3oc(C)c(C)c23)c1Br | COc1ccccc1CNC(=O)COc1ncnc2oc(C)c(C)c12 | COc1cccc(CNC(=O)COc2ncnc3oc(C)c(C)c23)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c16ccccc18"
} |
Can you make molecule COc1ccccc1CNC(=O)COc1ncnc2oc(C)c(C)c12 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CNC(=O)COc2ncnc3oc(C)c(C)c23)c1Cl | COc1ccccc1CNC(=O)COc1ncnc2oc(C)c(C)c12 | COc1cccc(CNC(=O)COc2ncnc3oc(C)c(C)c23)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c16ccccc18"
} |
Can you make molecule Fc1ccc(F)c(C[NH+]2CCC(n3cc(-c4cccnc4)nn3)CC2)c1F less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc(F)c(C[NH+]2CCC(n3cc(-c4ccccc4)nn3)CC2)c1F | Fc1ccc(F)c(C[NH+]2CCC(n3cc(-c4cccnc4)nn3)CC2)c1F | Fc1ccc(F)c(C[NH+]2CCC(n3cc(-c4ccccc4)nn3)CC2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c18cccnc1"
} |
Can you make molecule Fc1ccc(F)c(C[NH+]2CCC(n3cc(-c4cccnc4)nn3)CC2)c1F less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc(F)c(C[NH+]2CCC(n3cc(-c4ccc(I)nc4)nn3)CC2)c1F | Fc1ccc(F)c(C[NH+]2CCC(n3cc(-c4cccnc4)nn3)CC2)c1F | Fc1ccc(F)c(C[NH+]2CCC(n3cc(-c4ccc(I)nc4)nn3)CC2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)nc1",
"old_substring": "c18cccnc1"
} |
Can you make molecule Fc1ccc(F)c(C[NH+]2CCC(n3cc(-c4cccnc4)nn3)CC2)c1F less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc(F)c(C[NH+]2CCC(n3cc(-c4cc5cnsc5s4)nn3)CC2)c1F | Fc1ccc(F)c(C[NH+]2CCC(n3cc(-c4cccnc4)nn3)CC2)c1F | Fc1ccc(F)c(C[NH+]2CCC(n3cc(-c4cc5cnsc5s4)nn3)CC2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cnsc2s1",
"old_substring": "c18cccnc1"
} |
Can you make molecule Fc1ccc(F)c(C[NH+]2CCC(n3cc(-c4cccnc4)nn3)CC2)c1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2cn(C3CC[NH+](Cc4c(F)ccc(F)c4F)CC3)nn2)c(C)n1 | Fc1ccc(F)c(C[NH+]2CCC(n3cc(-c4cccnc4)nn3)CC2)c1F | Cc1ccc(-c2cn(C3CC[NH+](Cc4c(F)ccc(F)c4F)CC3)nn2)c(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)nc1C",
"old_substring": "c18cccnc1"
} |
Can you make molecule Fc1ccc(F)c(C[NH+]2CCC(n3cc(-c4cccnc4)nn3)CC2)c1F less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc(F)c(C[NH+]2CCC(n3cc(-c4ccncc4Cl)nn3)CC2)c1F | Fc1ccc(F)c(C[NH+]2CCC(n3cc(-c4cccnc4)nn3)CC2)c1F | Fc1ccc(F)c(C[NH+]2CCC(n3cc(-c4ccncc4Cl)nn3)CC2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c18cccnc1"
} |
Can you make molecule O=C(C[NH+]1CCC(C(=O)c2ccc(Cl)cc2)CC1)NC[C@H]1COCCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C[NH+]1CCC(C(=O)c2ccc(Cl)cc2I)CC1)NC[C@H]1COCCO1 | O=C(C[NH+]1CCC(C(=O)c2ccc(Cl)cc2)CC1)NC[C@H]1COCCO1 | O=C(C[NH+]1CCC(C(=O)c2ccc(Cl)cc2I)CC1)NC[C@H]1COCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c17ccc(Cl)cc1"
} |
Can you make molecule O=C(C[NH+]1CCC(C(=O)c2ccc(Cl)cc2)CC1)NC[C@H]1COCCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C[NH+]1CCC(C(=O)c2ccc(Cl)cc2Br)CC1)NC[C@H]1COCCO1 | O=C(C[NH+]1CCC(C(=O)c2ccc(Cl)cc2)CC1)NC[C@H]1COCCO1 | O=C(C[NH+]1CCC(C(=O)c2ccc(Cl)cc2Br)CC1)NC[C@H]1COCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c17ccc(Cl)cc1"
} |
Can you make molecule O=C(C[NH+]1CCC(C(=O)c2ccc(Cl)cc2)CC1)NC[C@H]1COCCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C[NH+]1CCC(C(=O)c2ccc(Cl)c(I)c2)CC1)NC[C@H]1COCCO1 | O=C(C[NH+]1CCC(C(=O)c2ccc(Cl)cc2)CC1)NC[C@H]1COCCO1 | O=C(C[NH+]1CCC(C(=O)c2ccc(Cl)c(I)c2)CC1)NC[C@H]1COCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c17ccc(Cl)cc1"
} |
Can you make molecule O=C(C[NH+]1CCC(C(=O)c2ccc(Cl)cc2)CC1)NC[C@H]1COCCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C[NH+]1CCC(C(=O)c2cc(Cl)ccc2Cl)CC1)NC[C@H]1COCCO1 | O=C(C[NH+]1CCC(C(=O)c2ccc(Cl)cc2)CC1)NC[C@H]1COCCO1 | O=C(C[NH+]1CCC(C(=O)c2cc(Cl)ccc2Cl)CC1)NC[C@H]1COCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1ccc(Cl)c&c1",
"old_substring": "c17ccc(Cl)cc1"
} |
Can you make molecule O=C(C[NH+]1CCC(C(=O)c2ccc(Cl)cc2)CC1)NC[C@H]1COCCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C[NH+]1CCC(C(=O)c2ccc(Cl)c(Cl)c2)CC1)NC[C@H]1COCCO1 | O=C(C[NH+]1CCC(C(=O)c2ccc(Cl)cc2)CC1)NC[C@H]1COCCO1 | O=C(C[NH+]1CCC(C(=O)c2ccc(Cl)c(Cl)c2)CC1)NC[C@H]1COCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c17ccc(Cl)cc1"
} |
Can you make molecule CCC[NH+](C)C[C@H]1CCN(C(=O)Nc2cc(NC(C)=O)ccc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH+]1CCC(C[C@H]2CCN(C(=O)Nc3cc(NC(C)=O)ccc3C)C2)CC1 | CCC[NH+](C)C[C@H]1CCN(C(=O)Nc2cc(NC(C)=O)ccc2C)C1 | CCC[NH+]1CCC(C[C@H]2CCN(C(=O)Nc3cc(NC(C)=O)ccc3C)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&CC1",
"old_substring": "[NH+]67C"
} |
Can you make molecule CCC[NH+](C)C[C@H]1CCN(C(=O)Nc2cc(NC(C)=O)ccc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[NH+](C)CC[C@H]1CCN(C(=O)Nc2cc(NC(C)=O)ccc2C)C1 | CCC[NH+](C)C[C@H]1CCN(C(=O)Nc2cc(NC(C)=O)ccc2C)C1 | CCCC[NH+](C)CC[C@H]1CCN(C(=O)Nc2cc(NC(C)=O)ccc2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[NH+](C&)C&",
"old_substring": "[NH+]67C"
} |
Can you make molecule CCC[NH+](C)C[C@H]1CCN(C(=O)Nc2cc(NC(C)=O)ccc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[NH+]1CCC(C[C@H]2CCN(C(=O)Nc3cc(NC(C)=O)ccc3C)C2)CC1 | CCC[NH+](C)C[C@H]1CCN(C(=O)Nc2cc(NC(C)=O)ccc2C)C1 | CCCC[NH+]1CCC(C[C@H]2CCN(C(=O)Nc3cc(NC(C)=O)ccc3C)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&CC1",
"old_substring": "[NH+]67C"
} |
Can you make molecule CCC[NH+](C)C[C@H]1CCN(C(=O)Nc2cc(NC(C)=O)ccc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH+]1CC=C(CC[C@H]2CCN(C(=O)Nc3cc(NC(C)=O)ccc3C)C2)CC1 | CCC[NH+](C)C[C@H]1CCN(C(=O)Nc2cc(NC(C)=O)ccc2C)C1 | CCC[NH+]1CC=C(CC[C@H]2CCN(C(=O)Nc3cc(NC(C)=O)ccc3C)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC=C(C&)CC1",
"old_substring": "[NH+]67C"
} |
Can you make molecule CCC[NH+](C)C[C@H]1CCN(C(=O)Nc2cc(NC(C)=O)ccc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH+]1Cc2cc(C[C@H]3CCN(C(=O)Nc4cc(NC(C)=O)ccc4C)C3)sc2C1 | CCC[NH+](C)C[C@H]1CCN(C(=O)Nc2cc(NC(C)=O)ccc2C)C1 | CCC[NH+]1Cc2cc(C[C@H]3CCN(C(=O)Nc4cc(NC(C)=O)ccc4C)C3)sc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&Cc2cc&sc2C1",
"old_substring": "[NH+]67C"
} |
Can you make molecule Cc1nc2ncnn2c(NCCOC2CCCCCC2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2ncnn2c(SC(=S)N(C)CCOC2CCCCCC2)c1C | Cc1nc2ncnn2c(NCCOC2CCCCCC2)c1C | Cc1nc2ncnn2c(SC(=S)N(C)CCOC2CCCCCC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N56"
} |
Can you make molecule Cc1nc2ncnn2c(NCCOC2CCCCCC2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2ncnn2c(-c2cc(CCOC3CCCCCC3)oc2N)c1C | Cc1nc2ncnn2c(NCCOC2CCCCCC2)c1C | Cc1nc2ncnn2c(-c2cc(CCOC3CCCCCC3)oc2N)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N56"
} |
Can you make molecule Cc1nc2ncnn2c(NCCOC2CCCCCC2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2ncnn2c(SC2=NCCN2CCOC2CCCCCC2)c1C | Cc1nc2ncnn2c(NCCOC2CCCCCC2)c1C | Cc1nc2ncnn2c(SC2=NCCN2CCOC2CCCCCC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N56"
} |
Can you make molecule Cc1nc2ncnn2c(NCCOC2CCCCCC2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2ncnn2c(C2CCN(CCCOC3CCCCCC3)CC2)c1C | Cc1nc2ncnn2c(NCCOC2CCCCCC2)c1C | Cc1nc2ncnn2c(C2CCN(CCCOC3CCCCCC3)CC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N56"
} |
Can you make molecule Cc1nc2ncnn2c(NCCOC2CCCCCC2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2ncnn2c(-c2cccc(CCOC3CCCCCC3)c2N)c1C | Cc1nc2ncnn2c(NCCOC2CCCCCC2)c1C | Cc1nc2ncnn2c(-c2cccc(CCOC3CCCCCC3)c2N)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&cccc1&",
"old_substring": "N56"
} |
Can you make molecule C[C@H]1CN(Cc2cnn(-c3ccccc3)n2)C[C@H](C)S1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(Cc2cnn(-c3ccccc3Cl)n2)C[C@H](C)S1 | C[C@H]1CN(Cc2cnn(-c3ccccc3)n2)C[C@H](C)S1 | C[C@H]1CN(Cc2cnn(-c3ccccc3Cl)n2)C[C@H](C)S1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c16ccccc1"
} |
Can you make molecule C[C@H]1CN(Cc2cnn(-c3ccccc3)n2)C[C@H](C)S1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(Cc2cnn(-c3ccc(I)cc3)n2)C[C@H](C)S1 | C[C@H]1CN(Cc2cnn(-c3ccccc3)n2)C[C@H](C)S1 | C[C@H]1CN(Cc2cnn(-c3ccc(I)cc3)n2)C[C@H](C)S1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c16ccccc1"
} |
Can you make molecule C[C@H]1CN(Cc2cnn(-c3ccccc3)n2)C[C@H](C)S1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2ncc(CN3C[C@H](C)S[C@@H](C)C3)n2)cc1I | C[C@H]1CN(Cc2cnn(-c3ccccc3)n2)C[C@H](C)S1 | Cc1ccc(-n2ncc(CN3C[C@H](C)S[C@@H](C)C3)n2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c16ccccc1"
} |
Can you make molecule C[C@H]1CN(Cc2cnn(-c3ccccc3)n2)C[C@H](C)S1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(Cc2cnn(-c3cccc(Br)c3)n2)C[C@H](C)S1 | C[C@H]1CN(Cc2cnn(-c3ccccc3)n2)C[C@H](C)S1 | C[C@H]1CN(Cc2cnn(-c3cccc(Br)c3)n2)C[C@H](C)S1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c16ccccc1"
} |
Can you make molecule C[C@H]1CN(Cc2cnn(-c3ccccc3)n2)C[C@H](C)S1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-n2ncc(CN3C[C@H](C)S[C@@H](C)C3)n2)c1C | C[C@H]1CN(Cc2cnn(-c3ccccc3)n2)C[C@H](C)S1 | Cc1cccc(-n2ncc(CN3C[C@H](C)S[C@@H](C)C3)n2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c16ccccc1"
} |
Can you make molecule COc1cc(OC)cc([C@@H](N[C@@H](C)c2ccc(F)cn2)c2[nH+]ccn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(OC)cc([C@@]2(c3[nH+]ccn3C)CC[C@H](N[C@@H](C)c3ccc(F)cn3)C2)c1 | COc1cc(OC)cc([C@@H](N[C@@H](C)c2ccc(F)cn2)c2[nH+]ccn2C)c1 | COc1cc(OC)cc([C@@]2(c3[nH+]ccn3C)CC[C@H](N[C@@H](C)c3ccc(F)cn3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@]&&C1",
"old_substring": "[C@H]579"
} |
Can you make molecule COc1cc(OC)cc([C@@H](N[C@@H](C)c2ccc(F)cn2)c2[nH+]ccn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(OC)cc([C@]2(c3[nH+]ccn3C)CC[C@H](N[C@@H](C)c3ccc(F)cn3)C2)c1 | COc1cc(OC)cc([C@@H](N[C@@H](C)c2ccc(F)cn2)c2[nH+]ccn2C)c1 | COc1cc(OC)cc([C@]2(c3[nH+]ccn3C)CC[C@H](N[C@@H](C)c3ccc(F)cn3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@@]&&C1",
"old_substring": "[C@H]579"
} |
Can you make molecule COc1cc(OC)cc([C@@H](N[C@@H](C)c2ccc(F)cn2)c2[nH+]ccn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(OC)cc(C(C)(C)[C@H](CCCc2[nH+]ccn2C)N[C@@H](C)c2ccc(F)cn2)c1 | COc1cc(OC)cc([C@@H](N[C@@H](C)c2ccc(F)cn2)c2[nH+]ccn2C)c1 | COc1cc(OC)cc(C(C)(C)[C@H](CCCc2[nH+]ccn2C)N[C@@H](C)c2ccc(F)cn2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCC&)C&(C)C",
"old_substring": "[C@H]579"
} |
Can you make molecule COc1cc(OC)cc([C@@H](N[C@@H](C)c2ccc(F)cn2)c2[nH+]ccn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(OC)cc([C@@]2(c3[nH+]ccn3C)CCC[C@@H](N[C@@H](C)c3ccc(F)cn3)C2)c1 | COc1cc(OC)cc([C@@H](N[C@@H](C)c2ccc(F)cn2)c2[nH+]ccn2C)c1 | COc1cc(OC)cc([C@@]2(c3[nH+]ccn3C)CCC[C@@H](N[C@@H](C)c3ccc(F)cn3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCC[C@]&&C1",
"old_substring": "[C@H]579"
} |
Can you make molecule COc1cc(OC)cc([C@@H](N[C@@H](C)c2ccc(F)cn2)c2[nH+]ccn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(OC)cc([C@@H]2CC(N[C@@H](C)c3ccc(F)cn3)C[C@H](c3[nH+]ccn3C)C2)c1 | COc1cc(OC)cc([C@@H](N[C@@H](C)c2ccc(F)cn2)c2[nH+]ccn2C)c1 | COc1cc(OC)cc([C@@H]2CC(N[C@@H](C)c3ccc(F)cn3)C[C@H](c3[nH+]ccn3C)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C[C@H]&C[C@H]&C1",
"old_substring": "[C@H]579"
} |
Can you make molecule CC(C)CCc1noc(C[NH+](C)[C@H]2CCC[C@@H]2S(C)(=O)=O)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCc1noc(C[NH+]2CCC([C@H]3CCC[C@@H]3S(C)(=O)=O)CC2)n1 | CC(C)CCc1noc(C[NH+](C)[C@H]2CCC[C@@H]2S(C)(=O)=O)n1 | CC(C)CCc1noc(C[NH+]2CCC([C@H]3CCC[C@@H]3S(C)(=O)=O)CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&CC1",
"old_substring": "[NH+]34C"
} |
Can you make molecule CC(C)CCc1noc(C[NH+](C)[C@H]2CCC[C@@H]2S(C)(=O)=O)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCc1noc(CC[NH+]2CCC([C@H]3CCC[C@@H]3S(C)(=O)=O)CC2)n1 | CC(C)CCc1noc(C[NH+](C)[C@H]2CCC[C@@H]2S(C)(=O)=O)n1 | CC(C)CCc1noc(CC[NH+]2CCC([C@H]3CCC[C@@H]3S(C)(=O)=O)CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&CC1",
"old_substring": "[NH+]34C"
} |
Can you make molecule CC(C)CCc1noc(C[NH+](C)[C@H]2CCC[C@@H]2S(C)(=O)=O)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCc1noc(C[NH+]2CC=C(C[C@H]3CCC[C@@H]3S(C)(=O)=O)CC2)n1 | CC(C)CCc1noc(C[NH+](C)[C@H]2CCC[C@@H]2S(C)(=O)=O)n1 | CC(C)CCc1noc(C[NH+]2CC=C(C[C@H]3CCC[C@@H]3S(C)(=O)=O)CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC=C(C&)CC1",
"old_substring": "[NH+]34C"
} |
Can you make molecule CC(C)CCc1noc(C[NH+](C)[C@H]2CCC[C@@H]2S(C)(=O)=O)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCc1noc(C[NH+]2Cc3cc([C@H]4CCC[C@@H]4S(C)(=O)=O)sc3C2)n1 | CC(C)CCc1noc(C[NH+](C)[C@H]2CCC[C@@H]2S(C)(=O)=O)n1 | CC(C)CCc1noc(C[NH+]2Cc3cc([C@H]4CCC[C@@H]4S(C)(=O)=O)sc3C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&Cc2cc&sc2C1",
"old_substring": "[NH+]34C"
} |
Can you make molecule CC(C)CCc1noc(C[NH+](C)[C@H]2CCC[C@@H]2S(C)(=O)=O)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCc1noc(C[NH+]2CCC[C@H]([C@H]3CCC[C@@H]3S(C)(=O)=O)CC2)n1 | CC(C)CCc1noc(C[NH+](C)[C@H]2CCC[C@@H]2S(C)(=O)=O)n1 | CC(C)CCc1noc(C[NH+]2CCC[C@H]([C@H]3CCC[C@@H]3S(C)(=O)=O)CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@H]&CC1",
"old_substring": "[NH+]34C"
} |
Can you make molecule CCc1nc2n(n1)CCC[C@H]2NC(=O)c1ccc(-n2cc(C)cn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2n(n1)CCC[C@H]2NSC(=O)Cc1ccc(-n2cc(C)cn2)cc1 | CCc1nc2n(n1)CCC[C@H]2NC(=O)c1ccc(-n2cc(C)cn2)cc1 | CCc1nc2n(n1)CCC[C@H]2NSC(=O)Cc1ccc(-n2cc(C)cn2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C34=O"
} |
Can you make molecule CCc1nc2n(n1)CCC[C@H]2NC(=O)c1ccc(-n2cc(C)cn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2n(n1)CCC[C@H]2NC(=O)CCCC(=O)c1ccc(-n2cc(C)cn2)cc1 | CCc1nc2n(n1)CCC[C@H]2NC(=O)c1ccc(-n2cc(C)cn2)cc1 | CCc1nc2n(n1)CCC[C@H]2NC(=O)CCCC(=O)c1ccc(-n2cc(C)cn2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C34=O"
} |
Can you make molecule CCc1nc2n(n1)CCC[C@H]2NC(=O)c1ccc(-n2cc(C)cn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2n(n1)CCC[C@H]2NC(=O)CC(C)(C)c1ccc(-n2cc(C)cn2)cc1 | CCc1nc2n(n1)CCC[C@H]2NC(=O)c1ccc(-n2cc(C)cn2)cc1 | CCc1nc2n(n1)CCC[C@H]2NC(=O)CC(C)(C)c1ccc(-n2cc(C)cn2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCc1nc2n(n1)CCC[C@H]2NC(=O)c1ccc(-n2cc(C)cn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2n(n1)CCC[C@H]2NC(=O)CCC(C)(C)c1ccc(-n2cc(C)cn2)cc1 | CCc1nc2n(n1)CCC[C@H]2NC(=O)c1ccc(-n2cc(C)cn2)cc1 | CCc1nc2n(n1)CCC[C@H]2NC(=O)CCC(C)(C)c1ccc(-n2cc(C)cn2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCc1nc2n(n1)CCC[C@H]2NC(=O)c1ccc(-n2cc(C)cn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2n(n1)CCC[C@H]2NSC(=O)[C@@H](C)c1ccc(-n2cc(C)cn2)cc1 | CCc1nc2n(n1)CCC[C@H]2NC(=O)c1ccc(-n2cc(C)cn2)cc1 | CCc1nc2n(n1)CCC[C@H]2NSC(=O)[C@@H](C)c1ccc(-n2cc(C)cn2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C34=O"
} |
Can you make molecule C[C@@H](NC(=O)c1ccccc1CSc1nc2ccccc2[nH]1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NSC(=O)Cc1ccccc1CSc1nc2ccccc2[nH]1)C1CC1 | C[C@@H](NC(=O)c1ccccc1CSc1nc2ccccc2[nH]1)C1CC1 | C[C@@H](NSC(=O)Cc1ccccc1CSc1nc2ccccc2[nH]1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule C[C@@H](NC(=O)c1ccccc1CSc1nc2ccccc2[nH]1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)CCCC(=O)c1ccccc1CSc1nc2ccccc2[nH]1)C1CC1 | C[C@@H](NC(=O)c1ccccc1CSc1nc2ccccc2[nH]1)C1CC1 | C[C@@H](NC(=O)CCCC(=O)c1ccccc1CSc1nc2ccccc2[nH]1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule C[C@@H](NC(=O)c1ccccc1CSc1nc2ccccc2[nH]1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)CC(C)(C)c1ccccc1CSc1nc2ccccc2[nH]1)C1CC1 | C[C@@H](NC(=O)c1ccccc1CSc1nc2ccccc2[nH]1)C1CC1 | C[C@@H](NC(=O)CC(C)(C)c1ccccc1CSc1nc2ccccc2[nH]1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule C[C@@H](NC(=O)c1ccccc1CSc1nc2ccccc2[nH]1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)CCC(C)(C)c1ccccc1CSc1nc2ccccc2[nH]1)C1CC1 | C[C@@H](NC(=O)c1ccccc1CSc1nc2ccccc2[nH]1)C1CC1 | C[C@@H](NC(=O)CCC(C)(C)c1ccccc1CSc1nc2ccccc2[nH]1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule C[C@@H](NC(=O)c1ccccc1CSc1nc2ccccc2[nH]1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SN[C@H](C)C1CC1)c1ccccc1CSc1nc2ccccc2[nH]1 | C[C@@H](NC(=O)c1ccccc1CSc1nc2ccccc2[nH]1)C1CC1 | C[C@H](C(=O)SN[C@H](C)C1CC1)c1ccccc1CSc1nc2ccccc2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.