prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Fc1ccc([C@@H]2C[C@@H](c3ccc(Br)cc3)Nc3ncnn32)cc1Br less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc([C@@H]2C[C@@H](c3ccc(Br)cc3I)Nc3ncnn32)cc1Br | Fc1ccc([C@@H]2C[C@@H](c3ccc(Br)cc3)Nc3ncnn32)cc1Br | Fc1ccc([C@@H]2C[C@@H](c3ccc(Br)cc3I)Nc3ncnn32)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1I",
"old_substring": "c14ccc(Br)cc1"
} |
Can you make molecule Fc1ccc([C@@H]2C[C@@H](c3ccc(Br)cc3)Nc3ncnn32)cc1Br less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc([C@@H]2C[C@@H](c3ccc(Br)cc3Br)Nc3ncnn32)cc1Br | Fc1ccc([C@@H]2C[C@@H](c3ccc(Br)cc3)Nc3ncnn32)cc1Br | Fc1ccc([C@@H]2C[C@@H](c3ccc(Br)cc3Br)Nc3ncnn32)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1Br",
"old_substring": "c14ccc(Br)cc1"
} |
Can you make molecule Fc1ccc([C@@H]2C[C@@H](c3ccc(Br)cc3)Nc3ncnn32)cc1Br less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc([C@@H]2C[C@@H](c3cc(Br)ccc3I)Nc3ncnn32)cc1Br | Fc1ccc([C@@H]2C[C@@H](c3ccc(Br)cc3)Nc3ncnn32)cc1Br | Fc1ccc([C@@H]2C[C@@H](c3cc(Br)ccc3I)Nc3ncnn32)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1I",
"old_substring": "c14ccc(Br)cc1"
} |
Can you make molecule Fc1ccc([C@@H]2C[C@@H](c3ccc(Br)cc3)Nc3ncnn32)cc1Br less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc([C@@H]2C[C@@H](c3ccc(Br)c(Cl)c3F)Nc3ncnn32)cc1Br | Fc1ccc([C@@H]2C[C@@H](c3ccc(Br)cc3)Nc3ncnn32)cc1Br | Fc1ccc([C@@H]2C[C@@H](c3ccc(Br)c(Cl)c3F)Nc3ncnn32)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)c(Cl)c1F",
"old_substring": "c14ccc(Br)cc1"
} |
Can you make molecule Fc1ccc([C@@H]2C[C@@H](c3ccc(Br)cc3)Nc3ncnn32)cc1Br less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc([C@@H]2C[C@@H](c3cc(Br)ccc3Cl)Nc3ncnn32)cc1Br | Fc1ccc([C@@H]2C[C@@H](c3ccc(Br)cc3)Nc3ncnn32)cc1Br | Fc1ccc([C@@H]2C[C@@H](c3cc(Br)ccc3Cl)Nc3ncnn32)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Cl",
"old_substring": "c14ccc(Br)cc1"
} |
Can you make molecule COc1ccc(O)c(CNC2CC[NH+](Cc3ccccc3Cl)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(O)c(CNC2CCN(Cc3ccccc3Cl)CC2)c1 | COc1ccc(O)c(CNC2CC[NH+](Cc3ccccc3Cl)CC2)c1 | COc1ccc(O)c(CNC2CCN(Cc3ccccc3Cl)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "C17CC[NH+]6CC1"
} |
Can you make molecule COc1ccc(O)c(CNC2CC[NH+](Cc3ccccc3Cl)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(O)c(CNC2CCC(Cc3ccccc3Cl)CC2)c1 | COc1ccc(O)c(CNC2CC[NH+](Cc3ccccc3Cl)CC2)c1 | COc1ccc(O)c(CNC2CCC(Cc3ccccc3Cl)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C17CC[NH+]6CC1"
} |
Can you make molecule COc1ccc(O)c(CNC2CC[NH+](Cc3ccccc3Cl)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(O)c(CNC2CC(Cc3ccccc3Cl)C2)c1 | COc1ccc(O)c(CNC2CC[NH+](Cc3ccccc3Cl)CC2)c1 | COc1ccc(O)c(CNC2CC(Cc3ccccc3Cl)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C17CC[NH+]6CC1"
} |
Can you make molecule COc1ccc(O)c(CNC2CC[NH+](Cc3ccccc3Cl)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(O)c(CNN2CCN(Cc3ccccc3Cl)[C@H](C)C2)c1 | COc1ccc(O)c(CNC2CC[NH+](Cc3ccccc3Cl)CC2)c1 | COc1ccc(O)c(CNN2CCN(Cc3ccccc3Cl)[C@H](C)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&[C@H](C)C1",
"old_substring": "C17CC[NH+]6CC1"
} |
Can you make molecule COc1ccc(O)c(CNC2CC[NH+](Cc3ccccc3Cl)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(O)c(CNCC2=CN=N[C@H]2Cc2ccccc2Cl)c1 | COc1ccc(O)c(CNC2CC[NH+](Cc3ccccc3Cl)CC2)c1 | COc1ccc(O)c(CNCC2=CN=N[C@H]2Cc2ccccc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(C&)[C@H]&N=N1",
"old_substring": "C17CC[NH+]6CC1"
} |
Can you make molecule Cc1ccc(NCc2cccc(C(=O)NCc3ccco3)c2)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NCc2cccc(CC(=O)SNCc3ccco3)c2)c(F)c1 | Cc1ccc(NCc2cccc(C(=O)NCc3ccco3)c2)c(F)c1 | Cc1ccc(NCc2cccc(CC(=O)SNCc3ccco3)c2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule Cc1ccc(NCc2cccc(C(=O)NCc3ccco3)c2)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NCc2cccc(C(=O)CCCC(=O)NCc3ccco3)c2)c(F)c1 | Cc1ccc(NCc2cccc(C(=O)NCc3ccco3)c2)c(F)c1 | Cc1ccc(NCc2cccc(C(=O)CCCC(=O)NCc3ccco3)c2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C48=O"
} |
Can you make molecule Cc1ccc(NCc2cccc(C(=O)NCc3ccco3)c2)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NCc2cccc(C(C)(C)CC(=O)NCc3ccco3)c2)c(F)c1 | Cc1ccc(NCc2cccc(C(=O)NCc3ccco3)c2)c(F)c1 | Cc1ccc(NCc2cccc(C(C)(C)CC(=O)NCc3ccco3)c2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule Cc1ccc(NCc2cccc(C(=O)NCc3ccco3)c2)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NCc2cccc(C(C)(C)CCC(=O)NCc3ccco3)c2)c(F)c1 | Cc1ccc(NCc2cccc(C(=O)NCc3ccco3)c2)c(F)c1 | Cc1ccc(NCc2cccc(C(C)(C)CCC(=O)NCc3ccco3)c2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule Cc1ccc(NCc2cccc(C(=O)NCc3ccco3)c2)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NCc2cccc([C@H](C)C(=O)SNCc3ccco3)c2)c(F)c1 | Cc1ccc(NCc2cccc(C(=O)NCc3ccco3)c2)c(F)c1 | Cc1ccc(NCc2cccc([C@H](C)C(=O)SNCc3ccco3)c2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C48=O"
} |
Can you make molecule Cc1c(C(=O)N(C)[C@@H]2CCN(c3ccccc3Cl)C2=O)cnn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(CC(=O)SN(C)[C@@H]2CCN(c3ccccc3Cl)C2=O)cnn1C | Cc1c(C(=O)N(C)[C@@H]2CCN(c3ccccc3Cl)C2=O)cnn1C | Cc1c(CC(=O)SN(C)[C@@H]2CCN(c3ccccc3Cl)C2=O)cnn1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1c(C(=O)N(C)[C@@H]2CCN(c3ccccc3Cl)C2=O)cnn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C(=O)CCCC(=O)N(C)[C@@H]2CCN(c3ccccc3Cl)C2=O)cnn1C | Cc1c(C(=O)N(C)[C@@H]2CCN(c3ccccc3Cl)C2=O)cnn1C | Cc1c(C(=O)CCCC(=O)N(C)[C@@H]2CCN(c3ccccc3Cl)C2=O)cnn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule Cc1c(C(=O)N(C)[C@@H]2CCN(c3ccccc3Cl)C2=O)cnn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C(C)(C)CC(=O)N(C)[C@@H]2CCN(c3ccccc3Cl)C2=O)cnn1C | Cc1c(C(=O)N(C)[C@@H]2CCN(c3ccccc3Cl)C2=O)cnn1C | Cc1c(C(C)(C)CC(=O)N(C)[C@@H]2CCN(c3ccccc3Cl)C2=O)cnn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1c(C(=O)N(C)[C@@H]2CCN(c3ccccc3Cl)C2=O)cnn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C(C)(C)CCC(=O)N(C)[C@@H]2CCN(c3ccccc3Cl)C2=O)cnn1C | Cc1c(C(=O)N(C)[C@@H]2CCN(c3ccccc3Cl)C2=O)cnn1C | Cc1c(C(C)(C)CCC(=O)N(C)[C@@H]2CCN(c3ccccc3Cl)C2=O)cnn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1c(C(=O)N(C)[C@@H]2CCN(c3ccccc3Cl)C2=O)cnn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c([C@H](C)C(=O)SN(C)[C@@H]2CCN(c3ccccc3Cl)C2=O)cnn1C | Cc1c(C(=O)N(C)[C@@H]2CCN(c3ccccc3Cl)C2=O)cnn1C | Cc1c([C@H](C)C(=O)SN(C)[C@@H]2CCN(c3ccccc3Cl)C2=O)cnn1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1nc(C(C)(C)C)[nH]c(=O)c1C(=O)Nc1cccc(Cl)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C(C)(C)C)[nH]c(=O)c1CC(=O)SNc1cccc(Cl)c1C | Cc1nc(C(C)(C)C)[nH]c(=O)c1C(=O)Nc1cccc(Cl)c1C | Cc1nc(C(C)(C)C)[nH]c(=O)c1CC(=O)SNc1cccc(Cl)c1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule Cc1nc(C(C)(C)C)[nH]c(=O)c1C(=O)Nc1cccc(Cl)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C(C)(C)C)[nH]c(=O)c1C(=O)CCCC(=O)Nc1cccc(Cl)c1C | Cc1nc(C(C)(C)C)[nH]c(=O)c1C(=O)Nc1cccc(Cl)c1C | Cc1nc(C(C)(C)C)[nH]c(=O)c1C(=O)CCCC(=O)Nc1cccc(Cl)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C24=O"
} |
Can you make molecule Cc1nc(C(C)(C)C)[nH]c(=O)c1C(=O)Nc1cccc(Cl)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C(C)(C)C)[nH]c(=O)c1C(C)(C)CC(=O)Nc1cccc(Cl)c1C | Cc1nc(C(C)(C)C)[nH]c(=O)c1C(=O)Nc1cccc(Cl)c1C | Cc1nc(C(C)(C)C)[nH]c(=O)c1C(C)(C)CC(=O)Nc1cccc(Cl)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule Cc1nc(C(C)(C)C)[nH]c(=O)c1C(=O)Nc1cccc(Cl)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C(C)(C)C)[nH]c(=O)c1C(C)(C)CCC(=O)Nc1cccc(Cl)c1C | Cc1nc(C(C)(C)C)[nH]c(=O)c1C(=O)Nc1cccc(Cl)c1C | Cc1nc(C(C)(C)C)[nH]c(=O)c1C(C)(C)CCC(=O)Nc1cccc(Cl)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule Cc1nc(C(C)(C)C)[nH]c(=O)c1C(=O)Nc1cccc(Cl)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C(C)(C)C)[nH]c(=O)c1[C@H](C)C(=O)SNc1cccc(Cl)c1C | Cc1nc(C(C)(C)C)[nH]c(=O)c1C(=O)Nc1cccc(Cl)c1C | Cc1nc(C(C)(C)C)[nH]c(=O)c1[C@H](C)C(=O)SNc1cccc(Cl)c1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C24=O"
} |
Can you make molecule CCOC(=O)[C@H]1CCCN(C(=O)c2cn(CCc3ccccc3)nn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOSC(=O)C[C@H]1CCCN(C(=O)c2cn(CCc3ccccc3)nn2)C1 | CCOC(=O)[C@H]1CCCN(C(=O)c2cn(CCc3ccccc3)nn2)C1 | CCOSC(=O)C[C@H]1CCCN(C(=O)c2cn(CCc3ccccc3)nn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule CCOC(=O)[C@H]1CCCN(C(=O)c2cn(CCc3ccccc3)nn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOCC(=C=O)C[C@H]1CCCN(C(=O)c2cn(CCc3ccccc3)nn2)C1 | CCOC(=O)[C@H]1CCCN(C(=O)c2cn(CCc3ccccc3)nn2)C1 | CCOCC(=C=O)C[C@H]1CCCN(C(=O)c2cn(CCc3ccccc3)nn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule CCOC(=O)[C@H]1CCCN(C(=O)c2cn(CCc3ccccc3)nn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCCC(=O)[C@H]1CCCN(C(=O)c2cn(CCc3ccccc3)nn2)C1 | CCOC(=O)[C@H]1CCCN(C(=O)c2cn(CCc3ccccc3)nn2)C1 | CCOC(=O)CCCC(=O)[C@H]1CCCN(C(=O)c2cn(CCc3ccccc3)nn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C48=O"
} |
Can you make molecule CCOC(=O)[C@H]1CCCN(C(=O)c2cn(CCc3ccccc3)nn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CC(C)(C)[C@H]1CCCN(C(=O)c2cn(CCc3ccccc3)nn2)C1 | CCOC(=O)[C@H]1CCCN(C(=O)c2cn(CCc3ccccc3)nn2)C1 | CCOC(=O)CC(C)(C)[C@H]1CCCN(C(=O)c2cn(CCc3ccccc3)nn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule CCOC(=O)[C@H]1CCCN(C(=O)c2cn(CCc3ccccc3)nn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC[S@+]([O-])CCC[C@H]1CCCN(C(=O)c2cn(CCc3ccccc3)nn2)C1 | CCOC(=O)[C@H]1CCCN(C(=O)c2cn(CCc3ccccc3)nn2)C1 | CCOC[S@+]([O-])CCC[C@H]1CCCN(C(=O)c2cn(CCc3ccccc3)nn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C48=O"
} |
Can you make molecule C[C@@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)c1ccc(F)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCN(C(=O)[O-])C[C@H]1S(=O)(=O)c1ccc(F)c(Cl)c1 | C[C@@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)c1ccc(F)c(Cl)c1 | C[C@H]1CCN(C(=O)[O-])C[C@H]1S(=O)(=O)c1ccc(F)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCN&C[C@H]1&",
"old_substring": "C[C@@H]1[C@H]3CCN12"
} |
Can you make molecule C[C@@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)c1ccc(F)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CS(=O)(=O)c1ccc(F)c(Cl)c1)[C@H](C)C(=O)[O-] | C[C@@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)c1ccc(F)c(Cl)c1 | C[C@H](CS(=O)(=O)c1ccc(F)c(Cl)c1)[C@H](C)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "C[C@@H]1[C@H]3CCN12"
} |
Can you make molecule C[C@@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)c1ccc(F)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)S(=O)(=O)c1ccc(F)c(Cl)c1)C(=O)[O-] | C[C@@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)c1ccc(F)c(Cl)c1 | C[C@H](CC(C)(C)S(=O)(=O)c1ccc(F)c(Cl)c1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@@H]1[C@H]3CCN12"
} |
Can you make molecule C[C@@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)c1ccc(F)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCC(=O)[O-])CC(=O)S(=O)(=O)c1ccc(F)c(Cl)c1 | C[C@@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)c1ccc(F)c(Cl)c1 | C[C@@H](CCC(=O)[O-])CC(=O)S(=O)(=O)c1ccc(F)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@@H]1[C@H]3CCN12"
} |
Can you make molecule C[C@@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)c1ccc(F)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])[C@@H]1CC[C@@H](S(=O)(=O)c2ccc(F)c(Cl)c2)C1 | C[C@@H]1[C@H](C(=O)[O-])CCN1S(=O)(=O)c1ccc(F)c(Cl)c1 | O=C([O-])[C@@H]1CC[C@@H](S(=O)(=O)c2ccc(F)c(Cl)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "C[C@@H]1[C@H]3CCN12"
} |
Can you make molecule CC1CCC(OC(=O)C2=NC3=C(C(=O)C[C@@H](c4ccccc4)C3)[C@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCC(OC(=O)C2=NC3=C(C(=O)C[C@@H](c4ccccc4Cl)C3)[C@H]2C)CC1 | CC1CCC(OC(=O)C2=NC3=C(C(=O)C[C@@H](c4ccccc4)C3)[C@H]2C)CC1 | CC1CCC(OC(=O)C2=NC3=C(C(=O)C[C@@H](c4ccccc4Cl)C3)[C@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c17ccccc1"
} |
Can you make molecule CC1CCC(OC(=O)C2=NC3=C(C(=O)C[C@@H](c4ccccc4)C3)[C@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCC(OC(=O)C2=NC3=C(C(=O)C[C@@H](c4ccc(I)cc4)C3)[C@H]2C)CC1 | CC1CCC(OC(=O)C2=NC3=C(C(=O)C[C@@H](c4ccccc4)C3)[C@H]2C)CC1 | CC1CCC(OC(=O)C2=NC3=C(C(=O)C[C@@H](c4ccc(I)cc4)C3)[C@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c17ccccc1"
} |
Can you make molecule CC1CCC(OC(=O)C2=NC3=C(C(=O)C[C@@H](c4ccccc4)C3)[C@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@H]2CC(=O)C3=C(C2)N=C(C(=O)OC2CCC(C)CC2)[C@@H]3C)cc1I | CC1CCC(OC(=O)C2=NC3=C(C(=O)C[C@@H](c4ccccc4)C3)[C@H]2C)CC1 | Cc1ccc([C@@H]2CC(=O)C3=C(C2)N=C(C(=O)OC2CCC(C)CC2)[C@@H]3C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c17ccccc1"
} |
Can you make molecule CC1CCC(OC(=O)C2=NC3=C(C(=O)C[C@@H](c4ccccc4)C3)[C@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCC(OC(=O)C2=NC3=C(C(=O)C[C@@H](c4cccc(Br)c4)C3)[C@H]2C)CC1 | CC1CCC(OC(=O)C2=NC3=C(C(=O)C[C@@H](c4ccccc4)C3)[C@H]2C)CC1 | CC1CCC(OC(=O)C2=NC3=C(C(=O)C[C@@H](c4cccc(Br)c4)C3)[C@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c17ccccc1"
} |
Can you make molecule CC1CCC(OC(=O)C2=NC3=C(C(=O)C[C@@H](c4ccccc4)C3)[C@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@@H]2CC(=O)C3=C(C2)N=C(C(=O)OC2CCC(C)CC2)[C@@H]3C)c1C | CC1CCC(OC(=O)C2=NC3=C(C(=O)C[C@@H](c4ccccc4)C3)[C@H]2C)CC1 | Cc1cccc([C@@H]2CC(=O)C3=C(C2)N=C(C(=O)OC2CCC(C)CC2)[C@@H]3C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c17ccccc1"
} |
Can you make molecule CN(Cc1ccno1)Cc1c(C(=O)N2CC[NH+](C3CCCCC3)CC2)nc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1ccoc1)Cc1c(C(=O)N2CC[NH+](C3CCCCC3)CC2)nc2ccccn12 | CN(Cc1ccno1)Cc1c(C(=O)N2CC[NH+](C3CCCCC3)CC2)nc2ccccn12 | CN(Cc1ccoc1)Cc1c(C(=O)N2CC[NH+](C3CCCCC3)CC2)nc2ccccn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccoc1",
"old_substring": "c19ccno1"
} |
Can you make molecule CN(Cc1ccno1)Cc1c(C(=O)N2CC[NH+](C3CCCCC3)CC2)nc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1cc(Cl)no1)Cc1c(C(=O)N2CC[NH+](C3CCCCC3)CC2)nc2ccccn12 | CN(Cc1ccno1)Cc1c(C(=O)N2CC[NH+](C3CCCCC3)CC2)nc2ccccn12 | CN(Cc1cc(Cl)no1)Cc1c(C(=O)N2CC[NH+](C3CCCCC3)CC2)nc2ccccn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)no1",
"old_substring": "c19ccno1"
} |
Can you make molecule CN(Cc1ccno1)Cc1c(C(=O)N2CC[NH+](C3CCCCC3)CC2)nc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1occc1CN(C)Cc1c(C(=O)N2CC[NH+](C3CCCCC3)CC2)nc2ccccn12 | CN(Cc1ccno1)Cc1c(C(=O)N2CC[NH+](C3CCCCC3)CC2)nc2ccccn12 | Cc1occc1CN(C)Cc1c(C(=O)N2CC[NH+](C3CCCCC3)CC2)nc2ccccn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccoc1C",
"old_substring": "c19ccno1"
} |
Can you make molecule CN(Cc1ccno1)Cc1c(C(=O)N2CC[NH+](C3CCCCC3)CC2)nc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnccc1CN(C)Cc1c(C(=O)N2CC[NH+](C3CCCCC3)CC2)nc2ccccn12 | CN(Cc1ccno1)Cc1c(C(=O)N2CC[NH+](C3CCCCC3)CC2)nc2ccccn12 | Cc1cnccc1CN(C)Cc1c(C(=O)N2CC[NH+](C3CCCCC3)CC2)nc2ccccn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1C",
"old_substring": "c19ccno1"
} |
Can you make molecule CN(Cc1ccno1)Cc1c(C(=O)N2CC[NH+](C3CCCCC3)CC2)nc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1CN(C)Cc1c(C(=O)N2CC[NH+](C3CCCCC3)CC2)nc2ccccn12 | CN(Cc1ccno1)Cc1c(C(=O)N2CC[NH+](C3CCCCC3)CC2)nc2ccccn12 | Cc1noc(C)c1CN(C)Cc1c(C(=O)N2CC[NH+](C3CCCCC3)CC2)nc2ccccn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(C)noc1C",
"old_substring": "c19ccno1"
} |
Can you make molecule Cc1cc(F)c([C@@H]([NH3+])[C@H]2Cc3ccccc3O2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)c([C@@H]([NH3+])[C@H]2Cc3ccccc3S2)cc1F | Cc1cc(F)c([C@@H]([NH3+])[C@H]2Cc3ccccc3O2)cc1F | Cc1cc(F)c([C@@H]([NH3+])[C@H]2Cc3ccccc3S2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&Cc2ccccc2S1",
"old_substring": "[C@H]14Cc2ccccc2O1"
} |
Can you make molecule Cc1cc(F)c([C@@H]([NH3+])[C@H]2Cc3ccccc3O2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)c([C@@H]([NH3+])[C@@H]2Nc3ccccc3S2)cc1F | Cc1cc(F)c([C@@H]([NH3+])[C@H]2Cc3ccccc3O2)cc1F | Cc1cc(F)c([C@@H]([NH3+])[C@@H]2Nc3ccccc3S2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&Nc2ccccc2S1",
"old_substring": "[C@H]14Cc2ccccc2O1"
} |
Can you make molecule Cc1cc(F)c([C@@H]([NH3+])[C@H]2Cc3ccccc3O2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)c([C@@H]([NH3+])N[C@H]2CCc3ccccc32)cc1F | Cc1cc(F)c([C@@H]([NH3+])[C@H]2Cc3ccccc3O2)cc1F | Cc1cc(F)c([C@@H]([NH3+])N[C@H]2CCc3ccccc32)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "N&[C@H]1CCc2ccccc21",
"old_substring": "[C@H]14Cc2ccccc2O1"
} |
Can you make molecule Cc1cc(F)c([C@@H]([NH3+])[C@H]2Cc3ccccc3O2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)c([C@@H]([NH3+])C[C@H]2Cc3ccccc32)cc1F | Cc1cc(F)c([C@@H]([NH3+])[C@H]2Cc3ccccc3O2)cc1F | Cc1cc(F)c([C@@H]([NH3+])C[C@H]2Cc3ccccc32)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@H]1Cc2ccccc21",
"old_substring": "[C@H]14Cc2ccccc2O1"
} |
Can you make molecule Cc1cc(F)c([C@@H]([NH3+])[C@H]2Cc3ccccc3O2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)c([C@@H]([NH3+])C[C@@H]2Cc3ccccc32)cc1F | Cc1cc(F)c([C@@H]([NH3+])[C@H]2Cc3ccccc3O2)cc1F | Cc1cc(F)c([C@@H]([NH3+])C[C@@H]2Cc3ccccc32)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H]1Cc2ccccc21",
"old_substring": "[C@H]14Cc2ccccc2O1"
} |
Can you make molecule COc1ccc(OCC(=O)N/N=C2\CCCc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(OCC(=O)N/N=C2\CCCc3ccccc32)cc1 | COc1ccc(OCC(=O)N/N=C2\CCCc3ccccc32)cc1 | COCc1ccc(OCC(=O)N/N=C2\CCCc3ccccc32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(OCC(=O)N/N=C2\CCCc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(OCC(=O)N/N=C2\CCCc3ccccc32)cc1 | COc1ccc(OCC(=O)N/N=C2\CCCc3ccccc32)cc1 | COCSc1ccc(OCC(=O)N/N=C2\CCCc3ccccc32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(OCC(=O)N/N=C2\CCCc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(OCC(=O)N/N=C2\CCCc3ccccc32)cc1 | COc1ccc(OCC(=O)N/N=C2\CCCc3ccccc32)cc1 | CC(=O)Sc1ccc(OCC(=O)N/N=C2\CCCc3ccccc32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(OCC(=O)N/N=C2\CCCc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COc1ccc(C(=O)CS)cc1)N/N=C1\CCCc2ccccc21 | COc1ccc(OCC(=O)N/N=C2\CCCc3ccccc32)cc1 | O=C(COc1ccc(C(=O)CS)cc1)N/N=C1\CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(OCC(=O)N/N=C2\CCCc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COc1ccc(C(=O)CI)cc1)N/N=C1\CCCc2ccccc21 | COc1ccc(OCC(=O)N/N=C2\CCCc3ccccc32)cc1 | O=C(COc1ccc(C(=O)CI)cc1)N/N=C1\CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule CC(C)[NH+]1CCC(N2CC[NH+](Cc3c(F)ccc(F)c3F)C[C@@H]2CCO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[NH+]1CCC(N2CC[NH+](Cc3c(F)ccc(F)c3F)C[C@@H]2CCO)CC1 | CC(C)[NH+]1CCC(N2CC[NH+](Cc3c(F)ccc(F)c3F)C[C@@H]2CCO)CC1 | CC(C)CC[NH+]1CCC(N2CC[NH+](Cc3c(F)ccc(F)c3F)C[C@@H]2CCO)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)[NH+]1CCC(N2CC[NH+](Cc3c(F)ccc(F)c3F)C[C@@H]2CCO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | OCC[C@H]1C[NH+](Cc2c(F)ccc(F)c2F)CCN1C1CC[NH+](CCCCBr)CC1 | CC(C)[NH+]1CCC(N2CC[NH+](Cc3c(F)ccc(F)c3F)C[C@@H]2CCO)CC1 | OCC[C@H]1C[NH+](Cc2c(F)ccc(F)c2F)CCN1C1CC[NH+](CCCCBr)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)[NH+]1CCC(N2CC[NH+](Cc3c(F)ccc(F)c3F)C[C@@H]2CCO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[NH+]1CCC(N2CC[NH+](Cc3c(F)ccc(F)c3F)C[C@@H]2CCO)CC1 | CC(C)[NH+]1CCC(N2CC[NH+](Cc3c(F)ccc(F)c3F)C[C@@H]2CCO)CC1 | C=CCCC[NH+]1CCC(N2CC[NH+](Cc3c(F)ccc(F)c3F)C[C@@H]2CCO)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)[NH+]1CCC(N2CC[NH+](Cc3c(F)ccc(F)c3F)C[C@@H]2CCO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | OCC[C@H]1C[NH+](Cc2c(F)ccc(F)c2F)CCN1C1CC[NH+](CCCCCl)CC1 | CC(C)[NH+]1CCC(N2CC[NH+](Cc3c(F)ccc(F)c3F)C[C@@H]2CCO)CC1 | OCC[C@H]1C[NH+](Cc2c(F)ccc(F)c2F)CCN1C1CC[NH+](CCCCCl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)[NH+]1CCC(N2CC[NH+](Cc3c(F)ccc(F)c3F)C[C@@H]2CCO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC[NH+]1CCC(N2CC[NH+](Cc3c(F)ccc(F)c3F)C[C@@H]2CCO)CC1 | CC(C)[NH+]1CCC(N2CC[NH+](Cc3c(F)ccc(F)c3F)C[C@@H]2CCO)CC1 | C=CCCCC[NH+]1CCC(N2CC[NH+](Cc3c(F)ccc(F)c3F)C[C@@H]2CCO)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CC4C"
} |
Can you make molecule CC[NH2+][C@@H](C)c1cc(F)c(C)cc1N1C[C@@H](C)S[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2C[C@@H](C)S[C@@H](C)C2)c([C@H](C)[NH2+]C2=CC=CC=C3CC3(C)C2)cc1F | CC[NH2+][C@@H](C)c1cc(F)c(C)cc1N1C[C@@H](C)S[C@@H](C)C1 | Cc1cc(N2C[C@@H](C)S[C@@H](C)C2)c([C@H](C)[NH2+]C2=CC=CC=C3CC3(C)C2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "CC1&Cc2ccccc2C1",
"old_substring": "CC2"
} |
Can you make molecule CC[NH2+][C@@H](C)c1cc(F)c(C)cc1N1C[C@@H](C)S[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2C[C@@H](C)S[C@@H](C)C2)c([C@H](C)[NH2+]C2=NC3=C(CCCC2(C)C)S3)cc1F | CC[NH2+][C@@H](C)c1cc(F)c(C)cc1N1C[C@@H](C)S[C@@H](C)C1 | Cc1cc(N2C[C@@H](C)S[C@@H](C)C2)c([C@H](C)[NH2+]C2=NC3=C(CCCC2(C)C)S3)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCCc2sc&nc21",
"old_substring": "CC2"
} |
Can you make molecule CC[NH2+][C@@H](C)c1cc(F)c(C)cc1N1C[C@@H](C)S[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2C[C@@H](C)S[C@@H](C)C2)c([C@H](C)[NH2+]C2=CC=C3C=C3CC(C)(C)O2)cc1F | CC[NH2+][C@@H](C)c1cc(F)c(C)cc1N1C[C@@H](C)S[C@@H](C)C1 | Cc1cc(N2C[C@@H](C)S[C@@H](C)C2)c([C@H](C)[NH2+]C2=CC=C3C=C3CC(C)(C)O2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)Cc2cc&ccc2O1",
"old_substring": "CC2"
} |
Can you make molecule CC[NH2+][C@@H](C)c1cc(F)c(C)cc1N1C[C@@H](C)S[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2C[C@@H](C)S[C@@H](C)C2)c([C@H](C)[NH2+]C2=CC=C3C=C3CCN2C)cc1F | CC[NH2+][C@@H](C)c1cc(F)c(C)cc1N1C[C@@H](C)S[C@@H](C)C1 | Cc1cc(N2C[C@@H](C)S[C@@H](C)C2)c([C@H](C)[NH2+]C2=CC=C3C=C3CCN2C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "CN1CCc2cc&ccc21",
"old_substring": "CC2"
} |
Can you make molecule CC[NH2+][C@@H](C)c1cc(F)c(C)cc1N1C[C@@H](C)S[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2C[C@@H](C)S[C@@H](C)C2)c([C@H](C)[NH2+]CCCCC23CC2C3)cc1F | CC[NH2+][C@@H](C)c1cc(F)c(C)cc1N1C[C@@H](C)S[C@@H](C)C1 | Cc1cc(N2C[C@@H](C)S[C@@H](C)C2)c([C@H](C)[NH2+]CCCCC23CC2C3)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC2(CCCC2)C1",
"old_substring": "CC2"
} |
Can you make molecule CC(C)c1nsc(NC[C@H](C2CC2)[NH+](C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1nsc(NC[C@H](C2CCCCC2)[NH+](C)C)n1 | CC(C)c1nsc(NC[C@H](C2CC2)[NH+](C)C)n1 | CC(C)c1nsc(NC[C@H](C2CCCCC2)[NH+](C)C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule CC(C)c1nsc(NC[C@H](C2CC2)[NH+](C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1nsc(NC[C@H](C2SCCCS2)[NH+](C)C)n1 | CC(C)c1nsc(NC[C@H](C2CC2)[NH+](C)C)n1 | CC(C)c1nsc(NC[C@H](C2SCCCS2)[NH+](C)C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C17CC1"
} |
Can you make molecule CC(C)c1nsc(NC[C@H](C2CC2)[NH+](C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1nsc(NC[C@H](C2SCSCS2)[NH+](C)C)n1 | CC(C)c1nsc(NC[C@H](C2CC2)[NH+](C)C)n1 | CC(C)c1nsc(NC[C@H](C2SCSCS2)[NH+](C)C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C17CC1"
} |
Can you make molecule CC(C)c1nsc(NC[C@H](C2CC2)[NH+](C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1nsc(NC[C@H](C2CCCCCC2)[NH+](C)C)n1 | CC(C)c1nsc(NC[C@H](C2CC2)[NH+](C)C)n1 | CC(C)c1nsc(NC[C@H](C2CCCCCC2)[NH+](C)C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule CC(C)c1nsc(NC[C@H](C2CC2)[NH+](C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1nsc(NC[C@H](C2CSCCSC2)[NH+](C)C)n1 | CC(C)c1nsc(NC[C@H](C2CC2)[NH+](C)C)n1 | CC(C)c1nsc(NC[C@H](C2CSCCSC2)[NH+](C)C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CSCCSC1",
"old_substring": "C17CC1"
} |
Can you make molecule Cc1ccc(-c2nc(C[NH+]3CCCC[C@H]3c3cccnc3)c(C)o2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc(C[NH+]3CCCC[C@H]3c3ccccc3)c(C)o2)s1 | Cc1ccc(-c2nc(C[NH+]3CCCC[C@H]3c3cccnc3)c(C)o2)s1 | Cc1ccc(-c2nc(C[NH+]3CCCC[C@H]3c3ccccc3)c(C)o2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c16cccnc1"
} |
Can you make molecule Cc1ccc(-c2nc(C[NH+]3CCCC[C@H]3c3cccnc3)c(C)o2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc(C[NH+]3CCCC[C@H]3c3ccc(I)nc3)c(C)o2)s1 | Cc1ccc(-c2nc(C[NH+]3CCCC[C@H]3c3cccnc3)c(C)o2)s1 | Cc1ccc(-c2nc(C[NH+]3CCCC[C@H]3c3ccc(I)nc3)c(C)o2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)nc1",
"old_substring": "c16cccnc1"
} |
Can you make molecule Cc1ccc(-c2nc(C[NH+]3CCCC[C@H]3c3cccnc3)c(C)o2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc(C[NH+]3CCCC[C@H]3c3cc4cnsc4s3)c(C)o2)s1 | Cc1ccc(-c2nc(C[NH+]3CCCC[C@H]3c3cccnc3)c(C)o2)s1 | Cc1ccc(-c2nc(C[NH+]3CCCC[C@H]3c3cc4cnsc4s3)c(C)o2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cnsc2s1",
"old_substring": "c16cccnc1"
} |
Can you make molecule Cc1ccc(-c2nc(C[NH+]3CCCC[C@H]3c3cccnc3)c(C)o2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@H]2CCCC[NH+]2Cc2nc(-c3ccc(C)s3)oc2C)c(C)n1 | Cc1ccc(-c2nc(C[NH+]3CCCC[C@H]3c3cccnc3)c(C)o2)s1 | Cc1ccc([C@@H]2CCCC[NH+]2Cc2nc(-c3ccc(C)s3)oc2C)c(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)nc1C",
"old_substring": "c16cccnc1"
} |
Can you make molecule Cc1ccc(-c2nc(C[NH+]3CCCC[C@H]3c3cccnc3)c(C)o2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc(C[NH+]3CCCC[C@H]3c3ccncc3Cl)c(C)o2)s1 | Cc1ccc(-c2nc(C[NH+]3CCCC[C@H]3c3cccnc3)c(C)o2)s1 | Cc1ccc(-c2nc(C[NH+]3CCCC[C@H]3c3ccncc3Cl)c(C)o2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c16cccnc1"
} |
Can you make molecule COc1cccc(C2=C[C@H](C(=O)N3CCCCC3)N=N2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C2=C[C@H](CC(=O)SN3CCCCC3)N=N2)c1 | COc1cccc(C2=C[C@H](C(=O)N3CCCCC3)N=N2)c1 | COc1cccc(C2=C[C@H](CC(=O)SN3CCCCC3)N=N2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule COc1cccc(C2=C[C@H](C(=O)N3CCCCC3)N=N2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C2=C[C@H](CC(=C=O)CN3CCCCC3)N=N2)c1 | COc1cccc(C2=C[C@H](C(=O)N3CCCCC3)N=N2)c1 | COc1cccc(C2=C[C@H](CC(=C=O)CN3CCCCC3)N=N2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule COc1cccc(C2=C[C@H](C(=O)N3CCCCC3)N=N2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C2=C[C@H](C(=O)CCCC(=O)N3CCCCC3)N=N2)c1 | COc1cccc(C2=C[C@H](C(=O)N3CCCCC3)N=N2)c1 | COc1cccc(C2=C[C@H](C(=O)CCCC(=O)N3CCCCC3)N=N2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule COc1cccc(C2=C[C@H](C(=O)N3CCCCC3)N=N2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C2=C[C@H](C(C)(C)CC(=O)N3CCCCC3)N=N2)c1 | COc1cccc(C2=C[C@H](C(=O)N3CCCCC3)N=N2)c1 | COc1cccc(C2=C[C@H](C(C)(C)CC(=O)N3CCCCC3)N=N2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule COc1cccc(C2=C[C@H](C(=O)N3CCCCC3)N=N2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C2=C[C@H](CCC[S@@+]([O-])CN3CCCCC3)N=N2)c1 | COc1cccc(C2=C[C@H](C(=O)N3CCCCC3)N=N2)c1 | COc1cccc(C2=C[C@H](CCC[S@@+]([O-])CN3CCCCC3)N=N2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C46=O"
} |
Can you make molecule O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc(S(=O)(=O)NC2CC2)ccc1Br less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc(S(=O)(=O)NC2SCCS2)ccc1Br | O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc(S(=O)(=O)NC2CC2)ccc1Br | O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc(S(=O)(=O)NC2SCCS2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C16CC1"
} |
Can you make molecule O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc(S(=O)(=O)NC2CC2)ccc1Br less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc(S(=O)(=O)N=C2CCC2)ccc1Br | O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc(S(=O)(=O)NC2CC2)ccc1Br | O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc(S(=O)(=O)N=C2CCC2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCC1",
"old_substring": "C16CC1"
} |
Can you make molecule O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc(S(=O)(=O)NC2CC2)ccc1Br less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc(S(=O)(=O)NC2CCCCC2)ccc1Br | O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc(S(=O)(=O)NC2CC2)ccc1Br | O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc(S(=O)(=O)NC2CCCCC2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc(S(=O)(=O)NC2CC2)ccc1Br less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc(S(=O)(=O)N=C2CCCC2)ccc1Br | O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc(S(=O)(=O)NC2CC2)ccc1Br | O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc(S(=O)(=O)N=C2CCCC2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc(S(=O)(=O)NC2CC2)ccc1Br less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc(S(=O)(=O)NC2SCCCS2)ccc1Br | O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc(S(=O)(=O)NC2CC2)ccc1Br | O=C(Nc1ccc2[nH]c(=O)[nH]c2c1)c1cc(S(=O)(=O)NC2SCCCS2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C16CC1"
} |
Can you make molecule Cc1ccc(NC(=S)NC(C)C)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=N)SC(C)C)cc1C | Cc1ccc(NC(=S)NC(C)C)cc1C | Cc1ccc(NC(=N)SC(C)C)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N3C(=S)N2"
} |
Can you make molecule Cc1ccc(NC(=S)NC(C)C)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(SC(=S)NC(C)C)cc1C | Cc1ccc(NC(=S)NC(C)C)cc1C | Cc1ccc(SC(=S)NC(C)C)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "N3C(=S)N2"
} |
Can you make molecule Cc1ccc(NC(=S)NC(C)C)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C/N=C(\N)SC(C)C)cc1C | Cc1ccc(NC(=S)NC(C)C)cc1C | Cc1ccc(C/N=C(\N)SC(C)C)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "N/C(=N\\C&)S&",
"old_substring": "N3C(=S)N2"
} |
Can you make molecule Cc1ccc(NC(=S)NC(C)C)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=S)N2CCC(C(C)C)CC2)cc1C | Cc1ccc(NC(=S)NC(C)C)cc1C | Cc1ccc(NC(=S)N2CCC(C(C)C)CC2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=S)N1CCC&CC1",
"old_substring": "N3C(=S)N2"
} |
Can you make molecule Cc1ccc(NC(=S)NC(C)C)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=S)N2CC[C@H](C(C)C)C2)cc1C | Cc1ccc(NC(=S)NC(C)C)cc1C | Cc1ccc(NC(=S)N2CC[C@H](C(C)C)C2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=S)N1CC[C@H]&C1",
"old_substring": "N3C(=S)N2"
} |
Can you make molecule C[C@@H](Nc1ccc2c(c1)CCC2)C(=O)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Nc1ccc2c(c1)CCC2)C(=O)N1CCCCCC1 | C[C@@H](Nc1ccc2c(c1)CCC2)C(=O)N1CCCC1 | C[C@@H](Nc1ccc2c(c1)CCC2)C(=O)N1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCC1",
"old_substring": "N13CCCC1"
} |
Can you make molecule C[C@@H](Nc1ccc2c(c1)CCC2)C(=O)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Nc1ccc2c(c1)CCC2)C(=O)N1CCCCCCC1 | C[C@@H](Nc1ccc2c(c1)CCC2)C(=O)N1CCCC1 | C[C@@H](Nc1ccc2c(c1)CCC2)C(=O)N1CCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1",
"old_substring": "N13CCCC1"
} |
Can you make molecule C[C@@H](Nc1ccc2c(c1)CCC2)C(=O)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(C(=O)[C@@H](C)Nc2ccc3c(c2)CCC3)CC1 | C[C@@H](Nc1ccc2c(c1)CCC2)C(=O)N1CCCC1 | CC1CCN(C(=O)[C@@H](C)Nc2ccc3c(c2)CCC3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)CC1",
"old_substring": "N13CCCC1"
} |
Can you make molecule C[C@@H](Nc1ccc2c(c1)CCC2)C(=O)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Nc1ccc2c(c1)CCC2)C(=O)N1CCCCCCCC1 | C[C@@H](Nc1ccc2c(c1)CCC2)C(=O)N1CCCC1 | C[C@@H](Nc1ccc2c(c1)CCC2)C(=O)N1CCCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCCC1",
"old_substring": "N13CCCC1"
} |
Can you make molecule C[C@@H](Nc1ccc2c(c1)CCC2)C(=O)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Nc1ccc2c(c1)CCC2)C(=O)N1CCCCCCC1=O | C[C@@H](Nc1ccc2c(c1)CCC2)C(=O)N1CCCC1 | C[C@@H](Nc1ccc2c(c1)CCC2)C(=O)N1CCCCCCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1=O",
"old_substring": "N13CCCC1"
} |
Can you make molecule CCOc1ccc(Nc2ccc(C#N)c([N+](=O)[O-])c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=S)Sc1ccc(Nc2ccc(C#N)c([N+](=O)[O-])c2)cc1 | CCOc1ccc(Nc2ccc(C#N)c([N+](=O)[O-])c2)cc1 | CCOC(=S)Sc1ccc(Nc2ccc(C#N)c([N+](=O)[O-])c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O34"
} |
Can you make molecule CCOc1ccc(Nc2ccc(C#N)c([N+](=O)[O-])c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=N)Cc1ccc(Nc2ccc(C#N)c([N+](=O)[O-])c2)cc1 | CCOc1ccc(Nc2ccc(C#N)c([N+](=O)[O-])c2)cc1 | CCOC(=N)Cc1ccc(Nc2ccc(C#N)c([N+](=O)[O-])c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O34"
} |
Can you make molecule CCOc1ccc(Nc2ccc(C#N)c([N+](=O)[O-])c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)CCC(=O)c1ccc(Nc2ccc(C#N)c([N+](=O)[O-])c2)cc1 | CCOc1ccc(Nc2ccc(C#N)c([N+](=O)[O-])c2)cc1 | CCC(=O)CCC(=O)c1ccc(Nc2ccc(C#N)c([N+](=O)[O-])c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O34"
} |
Can you make molecule CCOc1ccc(Nc2ccc(C#N)c([N+](=O)[O-])c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](O)CCc1ccc(Nc2ccc(C#N)c([N+](=O)[O-])c2)cc1 | CCOc1ccc(Nc2ccc(C#N)c([N+](=O)[O-])c2)cc1 | CC[C@H](O)CCc1ccc(Nc2ccc(C#N)c([N+](=O)[O-])c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O34"
} |
Can you make molecule CCOc1ccc(Nc2ccc(C#N)c([N+](=O)[O-])c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)/C=C/Sc1ccc(Nc2ccc(C#N)c([N+](=O)[O-])c2)cc1 | CCOc1ccc(Nc2ccc(C#N)c([N+](=O)[O-])c2)cc1 | CCC(=O)/C=C/Sc1ccc(Nc2ccc(C#N)c([N+](=O)[O-])c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O34"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.