prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(C)OC(=O)CCNC(=O)c1cnn(-c2ccc(F)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)OC(=O)CCNC(=O)c1ccn(-c2ccc(F)cc2)n1 | CC(C)OC(=O)CCNC(=O)c1cnn(-c2ccc(F)cc2)n1 | CC(C)OC(=O)CCNC(=O)c1ccn(-c2ccc(F)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccn&n1",
"old_substring": "c17cnn8n1"
} |
Can you make molecule CC(C)OC(=O)CCNC(=O)c1cnn(-c2ccc(F)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)OC(=O)CCNC(=O)c1csc2nc(-c3ccc(F)cc3)nn12 | CC(C)OC(=O)CCNC(=O)c1cnn(-c2ccc(F)cc2)n1 | CC(C)OC(=O)CCNC(=O)c1csc2nc(-c3ccc(F)cc3)nn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc2nc&nn12",
"old_substring": "c17cnn8n1"
} |
Can you make molecule CC(C)OC(=O)CCNC(=O)c1cnn(-c2ccc(F)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)OC(=O)CCNC(=O)c1cncc(-c2ccc(F)cc2)n1 | CC(C)OC(=O)CCNC(=O)c1cnn(-c2ccc(F)cc2)n1 | CC(C)OC(=O)CCNC(=O)c1cncc(-c2ccc(F)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cncc&n1",
"old_substring": "c17cnn8n1"
} |
Can you make molecule CC(C)OC(=O)CCNC(=O)c1cnn(-c2ccc(F)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)OC(=O)CCNC(=O)c1cc(-c2ccc(F)cc2)nn1C | CC(C)OC(=O)CCNC(=O)c1cnn(-c2ccc(F)cc2)n1 | CC(C)OC(=O)CCNC(=O)c1cc(-c2ccc(F)cc2)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&nn1C",
"old_substring": "c17cnn8n1"
} |
Can you make molecule CC(C)OC(=O)CCNC(=O)c1cnn(-c2ccc(F)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)OC(=O)CCNC(=O)c1cc(-c2ccc(F)cc2)ncn1 | CC(C)OC(=O)CCNC(=O)c1cnn(-c2ccc(F)cc2)n1 | CC(C)OC(=O)CCNC(=O)c1cc(-c2ccc(F)cc2)ncn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ncn1",
"old_substring": "c17cnn8n1"
} |
Can you make molecule CCCCOc1ccccc1NC(=O)c1scnc1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCOc1ccccc1NC(=O)c1sc(C2CC2)nc1Cl | CCCCOc1ccccc1NC(=O)c1scnc1C1CC1 | CCCCOc1ccccc1NC(=O)c1sc(C2CC2)nc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc&nc1Cl",
"old_substring": "c16scnc17"
} |
Can you make molecule CCCCOc1ccccc1NC(=O)c1scnc1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCOc1ccccc1NC(=O)c1sc2ncc(C3CC3)cc2c1C | CCCCOc1ccccc1NC(=O)c1scnc1C1CC1 | CCCCOc1ccccc1NC(=O)c1sc2ncc(C3CC3)cc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2ncc&cc2c1C",
"old_substring": "c16scnc17"
} |
Can you make molecule CCCCOc1ccccc1NC(=O)c1scnc1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCOc1ccccc1NC(=O)c1sc(C2CC2)cc1Br | CCCCOc1ccccc1NC(=O)c1scnc1C1CC1 | CCCCOc1ccccc1NC(=O)c1sc(C2CC2)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc&cc1Br",
"old_substring": "c16scnc17"
} |
Can you make molecule CCCCOc1ccccc1NC(=O)c1scnc1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCOc1ccccc1NC(=O)c1csc(C2CC2)c1 | CCCCOc1ccccc1NC(=O)c1scnc1C1CC1 | CCCCOc1ccccc1NC(=O)c1csc(C2CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc&c1",
"old_substring": "c16scnc17"
} |
Can you make molecule CCCCOc1ccccc1NC(=O)c1scnc1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCOc1ccccc1NC(=O)c1nc2sc(C3CC3)cc2s1 | CCCCOc1ccccc1NC(=O)c1scnc1C1CC1 | CCCCOc1ccccc1NC(=O)c1nc2sc(C3CC3)cc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2sc&cc2s1",
"old_substring": "c16scnc17"
} |
Can you make molecule O=C1N=C(N2CCCCC2)SC1=C1C(=O)Nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C1N=C(N2CCCCC2)SC1=C1C=Nc2ccccc21 | O=C1N=C(N2CCCCC2)SC1=C1C(=O)Nc2ccccc21 | O=C1N=C(N2CCCCC2)SC1=C1C=Nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&C=Nc2ccccc21",
"old_substring": "C1=3C(=O)Nc2ccccc21"
} |
Can you make molecule O=C1N=C(N2CCCCC2)SC1=C1C(=O)Nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C1N=C(N2CCCCC2)SC1=C1OC(=O)c2ccccc21 | O=C1N=C(N2CCCCC2)SC1=C1C(=O)Nc2ccccc21 | O=C1N=C(N2CCCCC2)SC1=C1OC(=O)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&OC(=O)c2ccccc21",
"old_substring": "C1=3C(=O)Nc2ccccc21"
} |
Can you make molecule O=C1N=C(N2CCCCC2)SC1=C1C(=O)Nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C1N=C(N2CCCCC2)SC1=C1C=Cc2ccccc21 | O=C1N=C(N2CCCCC2)SC1=C1C(=O)Nc2ccccc21 | O=C1N=C(N2CCCCC2)SC1=C1C=Cc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&C=Cc2ccccc21",
"old_substring": "C1=3C(=O)Nc2ccccc21"
} |
Can you make molecule O=C1N=C(N2CCCCC2)SC1=C1C(=O)Nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C1N=C(N2CCCCC2)SC1=C1CCc2ccccc21 | O=C1N=C(N2CCCCC2)SC1=C1C(=O)Nc2ccccc21 | O=C1N=C(N2CCCCC2)SC1=C1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCc2ccccc21",
"old_substring": "C1=3C(=O)Nc2ccccc21"
} |
Can you make molecule O=C1N=C(N2CCCCC2)SC1=C1C(=O)Nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc2c(c1)CCC2=C1SC(N2CCCCC2)=NC1=O | O=C1N=C(N2CCCCC2)SC1=C1C(=O)Nc2ccccc21 | Nc1ccc2c(c1)CCC2=C1SC(N2CCCCC2)=NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCc2cc(N)ccc21",
"old_substring": "C1=3C(=O)Nc2ccccc21"
} |
Can you make molecule Cc1c([C@H](C)NC(=O)c2[nH]c3ccccc3c2Cl)cnn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c([C@H](C)NSC(=O)Cc2[nH]c3ccccc3c2Cl)cnn1C | Cc1c([C@H](C)NC(=O)c2[nH]c3ccccc3c2Cl)cnn1C | Cc1c([C@H](C)NSC(=O)Cc2[nH]c3ccccc3c2Cl)cnn1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1c([C@H](C)NC(=O)c2[nH]c3ccccc3c2Cl)cnn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c([C@H](C)NC(=O)CCCC(=O)c2[nH]c3ccccc3c2Cl)cnn1C | Cc1c([C@H](C)NC(=O)c2[nH]c3ccccc3c2Cl)cnn1C | Cc1c([C@H](C)NC(=O)CCCC(=O)c2[nH]c3ccccc3c2Cl)cnn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule Cc1c([C@H](C)NC(=O)c2[nH]c3ccccc3c2Cl)cnn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c([C@H](C)NC(=O)CC(C)(C)c2[nH]c3ccccc3c2Cl)cnn1C | Cc1c([C@H](C)NC(=O)c2[nH]c3ccccc3c2Cl)cnn1C | Cc1c([C@H](C)NC(=O)CC(C)(C)c2[nH]c3ccccc3c2Cl)cnn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1c([C@H](C)NC(=O)c2[nH]c3ccccc3c2Cl)cnn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c([C@H](C)NC(=O)CCC(C)(C)c2[nH]c3ccccc3c2Cl)cnn1C | Cc1c([C@H](C)NC(=O)c2[nH]c3ccccc3c2Cl)cnn1C | Cc1c([C@H](C)NC(=O)CCC(C)(C)c2[nH]c3ccccc3c2Cl)cnn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1c([C@H](C)NC(=O)c2[nH]c3ccccc3c2Cl)cnn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c([C@H](C)NSC(=O)[C@@H](C)c2[nH]c3ccccc3c2Cl)cnn1C | Cc1c([C@H](C)NC(=O)c2[nH]c3ccccc3c2Cl)cnn1C | Cc1c([C@H](C)NSC(=O)[C@@H](C)c2[nH]c3ccccc3c2Cl)cnn1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule CSc1cccc2sc(N3CCN(C(=O)c4ccn(C(C)C)n4)CC3)nc12 less soluble in water? The output molecule should be similar to the input molecule. | CSc1cccc2sc(N3CCN(SC(=O)Cc4ccn(C(C)C)n4)CC3)nc12 | CSc1cccc2sc(N3CCN(C(=O)c4ccn(C(C)C)n4)CC3)nc12 | CSc1cccc2sc(N3CCN(SC(=O)Cc4ccn(C(C)C)n4)CC3)nc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C57=O"
} |
Can you make molecule CSc1cccc2sc(N3CCN(C(=O)c4ccn(C(C)C)n4)CC3)nc12 less soluble in water? The output molecule should be similar to the input molecule. | CSc1cccc2sc(N3CCN(C(=O)CCCC(=O)c4ccn(C(C)C)n4)CC3)nc12 | CSc1cccc2sc(N3CCN(C(=O)c4ccn(C(C)C)n4)CC3)nc12 | CSc1cccc2sc(N3CCN(C(=O)CCCC(=O)c4ccn(C(C)C)n4)CC3)nc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C57=O"
} |
Can you make molecule CSc1cccc2sc(N3CCN(C(=O)c4ccn(C(C)C)n4)CC3)nc12 less soluble in water? The output molecule should be similar to the input molecule. | CSc1cccc2sc(N3CCN(C(=O)CC(C)(C)c4ccn(C(C)C)n4)CC3)nc12 | CSc1cccc2sc(N3CCN(C(=O)c4ccn(C(C)C)n4)CC3)nc12 | CSc1cccc2sc(N3CCN(C(=O)CC(C)(C)c4ccn(C(C)C)n4)CC3)nc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C57=O"
} |
Can you make molecule CSc1cccc2sc(N3CCN(C(=O)c4ccn(C(C)C)n4)CC3)nc12 less soluble in water? The output molecule should be similar to the input molecule. | CSc1cccc2sc(N3CCN(C(=O)CCC(C)(C)c4ccn(C(C)C)n4)CC3)nc12 | CSc1cccc2sc(N3CCN(C(=O)c4ccn(C(C)C)n4)CC3)nc12 | CSc1cccc2sc(N3CCN(C(=O)CCC(C)(C)c4ccn(C(C)C)n4)CC3)nc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C57=O"
} |
Can you make molecule CSc1cccc2sc(N3CCN(C(=O)c4ccn(C(C)C)n4)CC3)nc12 less soluble in water? The output molecule should be similar to the input molecule. | CSc1cccc2sc(N3CCN(SC(=O)[C@@H](C)c4ccn(C(C)C)n4)CC3)nc12 | CSc1cccc2sc(N3CCN(C(=O)c4ccn(C(C)C)n4)CC3)nc12 | CSc1cccc2sc(N3CCN(SC(=O)[C@@H](C)c4ccn(C(C)C)n4)CC3)nc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C57=O"
} |
Can you make molecule Cc1ccc(C)c2nc3sc(C(=O)Nc4ccc5c(c4)OCO5)c(N)c3cc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c2nc3sc(CC(=O)SNc4ccc5c(c4)OCO5)c(N)c3cc12 | Cc1ccc(C)c2nc3sc(C(=O)Nc4ccc5c(c4)OCO5)c(N)c3cc12 | Cc1ccc(C)c2nc3sc(CC(=O)SNc4ccc5c(c4)OCO5)c(N)c3cc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C68=O"
} |
Can you make molecule Cc1ccc(C)c2nc3sc(C(=O)Nc4ccc5c(c4)OCO5)c(N)c3cc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c2nc3sc(C(=O)CCCC(=O)Nc4ccc5c(c4)OCO5)c(N)c3cc12 | Cc1ccc(C)c2nc3sc(C(=O)Nc4ccc5c(c4)OCO5)c(N)c3cc12 | Cc1ccc(C)c2nc3sc(C(=O)CCCC(=O)Nc4ccc5c(c4)OCO5)c(N)c3cc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C68=O"
} |
Can you make molecule Cc1ccc(C)c2nc3sc(C(=O)Nc4ccc5c(c4)OCO5)c(N)c3cc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c2nc3sc(C(C)(C)CC(=O)Nc4ccc5c(c4)OCO5)c(N)c3cc12 | Cc1ccc(C)c2nc3sc(C(=O)Nc4ccc5c(c4)OCO5)c(N)c3cc12 | Cc1ccc(C)c2nc3sc(C(C)(C)CC(=O)Nc4ccc5c(c4)OCO5)c(N)c3cc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C68=O"
} |
Can you make molecule Cc1ccc(C)c2nc3sc(C(=O)Nc4ccc5c(c4)OCO5)c(N)c3cc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c2nc3sc(C(C)(C)CCC(=O)Nc4ccc5c(c4)OCO5)c(N)c3cc12 | Cc1ccc(C)c2nc3sc(C(=O)Nc4ccc5c(c4)OCO5)c(N)c3cc12 | Cc1ccc(C)c2nc3sc(C(C)(C)CCC(=O)Nc4ccc5c(c4)OCO5)c(N)c3cc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C68=O"
} |
Can you make molecule Cc1ccc(C)c2nc3sc(C(=O)Nc4ccc5c(c4)OCO5)c(N)c3cc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c2nc3sc([C@H](C)C(=O)SNc4ccc5c(c4)OCO5)c(N)c3cc12 | Cc1ccc(C)c2nc3sc(C(=O)Nc4ccc5c(c4)OCO5)c(N)c3cc12 | Cc1ccc(C)c2nc3sc([C@H](C)C(=O)SNc4ccc5c(c4)OCO5)c(N)c3cc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C68=O"
} |
Can you make molecule COC(=O)CCN(Cc1cnc2ncccn12)C1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCN1CCC(Cc2cnc3ncccn23)(C2CCOCC2)C1 | COC(=O)CCN(Cc1cnc2ncccn12)C1CCOCC1 | COC(=O)CCN1CCC(Cc2cnc3ncccn23)(C2CCOCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N456"
} |
Can you make molecule COC(=O)CCN(Cc1cnc2ncccn12)C1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCN1CCCC(Cc2cnc3ncccn23)(C2CCOCC2)C1 | COC(=O)CCN(Cc1cnc2ncccn12)C1CCOCC1 | COC(=O)CCN1CCCC(Cc2cnc3ncccn23)(C2CCOCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N456"
} |
Can you make molecule COC(=O)CCN(Cc1cnc2ncccn12)C1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCc1oc(Cc2cnc3ncccn23)c(C2CCOCC2)c1C#N | COC(=O)CCN(Cc1cnc2ncccn12)C1CCOCC1 | COC(=O)CCc1oc(Cc2cnc3ncccn23)c(C2CCOCC2)c1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N456"
} |
Can you make molecule COC(=O)CCN(Cc1cnc2ncccn12)C1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCN1CC(Cc2cnc3ncccn23)(C2CCOCC2)CCC1=O | COC(=O)CCN(Cc1cnc2ncccn12)C1CCOCC1 | COC(=O)CCN1CC(Cc2cnc3ncccn23)(C2CCOCC2)CCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&&CCC1=O",
"old_substring": "N456"
} |
Can you make molecule COC(=O)CCN(Cc1cnc2ncccn12)C1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCN1CCC[C@@](Cc2cnc3ncccn23)(C2CCOCC2)C1 | COC(=O)CCN(Cc1cnc2ncccn12)C1CCOCC1 | COC(=O)CCN1CCC[C@@](Cc2cnc3ncccn23)(C2CCOCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@]&&C1",
"old_substring": "N456"
} |
Can you make molecule O=C(c1c[nH]c2ccc(F)cc12)N(CC1CC1)CC(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1c[nH]c2ccc(F)cc12)N1CCC(CC2CC2)(CC(F)(F)F)C1 | O=C(c1c[nH]c2ccc(F)cc12)N(CC1CC1)CC(F)(F)F | O=C(c1c[nH]c2ccc(F)cc12)N1CCC(CC2CC2)(CC(F)(F)F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N345"
} |
Can you make molecule O=C(c1c[nH]c2ccc(F)cc12)N(CC1CC1)CC(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1c[nH]c2ccc(F)cc12)N1CCCC(CC2CC2)(CC(F)(F)F)C1 | O=C(c1c[nH]c2ccc(F)cc12)N(CC1CC1)CC(F)(F)F | O=C(c1c[nH]c2ccc(F)cc12)N1CCCC(CC2CC2)(CC(F)(F)F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N345"
} |
Can you make molecule O=C(c1c[nH]c2ccc(F)cc12)N(CC1CC1)CC(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1c(C(=O)c2c[nH]c3ccc(F)cc23)oc(CC2CC2)c1CC(F)(F)F | O=C(c1c[nH]c2ccc(F)cc12)N(CC1CC1)CC(F)(F)F | N#Cc1c(C(=O)c2c[nH]c3ccc(F)cc23)oc(CC2CC2)c1CC(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N345"
} |
Can you make molecule O=C(c1c[nH]c2ccc(F)cc12)N(CC1CC1)CC(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C1CCC(CC2CC2)(CC(F)(F)F)CN1C(=O)c1c[nH]c2ccc(F)cc12 | O=C(c1c[nH]c2ccc(F)cc12)N(CC1CC1)CC(F)(F)F | O=C1CCC(CC2CC2)(CC(F)(F)F)CN1C(=O)c1c[nH]c2ccc(F)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&&CCC1=O",
"old_substring": "N345"
} |
Can you make molecule O=C(c1c[nH]c2ccc(F)cc12)N(CC1CC1)CC(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1c[nH]c2ccc(F)cc12)N1CCC[C@@](CC2CC2)(CC(F)(F)F)C1 | O=C(c1c[nH]c2ccc(F)cc12)N(CC1CC1)CC(F)(F)F | O=C(c1c[nH]c2ccc(F)cc12)N1CCC[C@@](CC2CC2)(CC(F)(F)F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@]&&C1",
"old_substring": "N345"
} |
Can you make molecule O=C(Cc1ccc(Cl)cc1)/N=C1/S[C@@H]2CS(=O)(=O)C[C@H]2N1c1cc(Cl)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1ccc(Cl)cc1)/N=C1/S[C@@H]2CS(=O)(=O)C[C@H]2N1c1c(Cl)cc(Br)cc1Cl | O=C(Cc1ccc(Cl)cc1)/N=C1/S[C@@H]2CS(=O)(=O)C[C@H]2N1c1cc(Cl)ccc1Cl | O=C(Cc1ccc(Cl)cc1)/N=C1/S[C@@H]2CS(=O)(=O)C[C@H]2N1c1c(Cl)cc(Br)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc(Br)cc1Cl",
"old_substring": "c13cc(Cl)ccc1Cl"
} |
Can you make molecule O=C(Cc1ccc(Cl)cc1)/N=C1/S[C@@H]2CS(=O)(=O)C[C@H]2N1c1cc(Cl)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1ccc(Cl)cc1)/N=C1/S[C@@H]2CS(=O)(=O)C[C@H]2N1c1cc(Cl)cc(Cl)c1Br | O=C(Cc1ccc(Cl)cc1)/N=C1/S[C@@H]2CS(=O)(=O)C[C@H]2N1c1cc(Cl)ccc1Cl | O=C(Cc1ccc(Cl)cc1)/N=C1/S[C@@H]2CS(=O)(=O)C[C@H]2N1c1cc(Cl)cc(Cl)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)cc(Cl)c1Br",
"old_substring": "c13cc(Cl)ccc1Cl"
} |
Can you make molecule O=C(Cc1ccc(Cl)cc1)/N=C1/S[C@@H]2CS(=O)(=O)C[C@H]2N1c1cc(Cl)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1ccc(Cl)cc1)/N=C1/S[C@@H]2CS(=O)(=O)C[C@H]2N1c1cc(Br)cc(Br)c1Cl | O=C(Cc1ccc(Cl)cc1)/N=C1/S[C@@H]2CS(=O)(=O)C[C@H]2N1c1cc(Cl)ccc1Cl | O=C(Cc1ccc(Cl)cc1)/N=C1/S[C@@H]2CS(=O)(=O)C[C@H]2N1c1cc(Br)cc(Br)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)cc(Br)c1Cl",
"old_substring": "c13cc(Cl)ccc1Cl"
} |
Can you make molecule O=C(Cc1ccc(Cl)cc1)/N=C1/S[C@@H]2CS(=O)(=O)C[C@H]2N1c1cc(Cl)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1ccc(Cl)cc1)/N=C1/S[C@@H]2CS(=O)(=O)C[C@H]2N1c1c(Cl)ccc(Cl)c1Cl | O=C(Cc1ccc(Cl)cc1)/N=C1/S[C@@H]2CS(=O)(=O)C[C@H]2N1c1cc(Cl)ccc1Cl | O=C(Cc1ccc(Cl)cc1)/N=C1/S[C@@H]2CS(=O)(=O)C[C@H]2N1c1c(Cl)ccc(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)ccc(Cl)c1Cl",
"old_substring": "c13cc(Cl)ccc1Cl"
} |
Can you make molecule O=C(Cc1ccc(Cl)cc1)/N=C1/S[C@@H]2CS(=O)(=O)C[C@H]2N1c1cc(Cl)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1ccc(Cl)cc1)/N=C1/S[C@@H]2CS(=O)(=O)C[C@H]2N1c1ccc(Cl)c(Cl)c1Cl | O=C(Cc1ccc(Cl)cc1)/N=C1/S[C@@H]2CS(=O)(=O)C[C@H]2N1c1cc(Cl)ccc1Cl | O=C(Cc1ccc(Cl)cc1)/N=C1/S[C@@H]2CS(=O)(=O)C[C@H]2N1c1ccc(Cl)c(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1Cl",
"old_substring": "c13cc(Cl)ccc1Cl"
} |
Can you make molecule Cc1cccc(C)c1NC(=O)C[NH+]1CCC(OCc2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1NC(=O)C[NH+]1CC=C(CCOCc2ccc(F)cc2)CC1 | Cc1cccc(C)c1NC(=O)C[NH+]1CCC(OCc2ccc(F)cc2)CC1 | Cc1cccc(C)c1NC(=O)C[NH+]1CC=C(CCOCc2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC=C(CC&)CC1",
"old_substring": "[NH+]16CCC5CC1"
} |
Can you make molecule Cc1cccc(C)c1NC(=O)C[NH+]1CCC(OCc2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1NC(=O)C[C@H]1CN(OCc2ccc(F)cc2)C(C)(C)C1 | Cc1cccc(C)c1NC(=O)C[NH+]1CCC(OCc2ccc(F)cc2)CC1 | Cc1cccc(C)c1NC(=O)C[C@H]1CN(OCc2ccc(F)cc2)C(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C(C)(C)C1",
"old_substring": "[NH+]16CCC5CC1"
} |
Can you make molecule Cc1cccc(C)c1NC(=O)C[NH+]1CCC(OCc2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1NC(=O)CN1CCCN(OCc2ccc(F)cc2)CC1 | Cc1cccc(C)c1NC(=O)C[NH+]1CCC(OCc2ccc(F)cc2)CC1 | Cc1cccc(C)c1NC(=O)CN1CCCN(OCc2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&CC1",
"old_substring": "[NH+]16CCC5CC1"
} |
Can you make molecule Cc1cccc(C)c1NC(=O)C[NH+]1CCC(OCc2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1NC(=O)CCN1CCC(OCc2ccc(F)cc2)CC1 | Cc1cccc(C)c1NC(=O)C[NH+]1CCC(OCc2ccc(F)cc2)CC1 | Cc1cccc(C)c1NC(=O)CCN1CCC(OCc2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "[NH+]16CCC5CC1"
} |
Can you make molecule Cc1cccc(C)c1NC(=O)C[NH+]1CCC(OCc2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1NC(=O)C[C@@H]1N=NC=C1CCOCc1ccc(F)cc1 | Cc1cccc(C)c1NC(=O)C[NH+]1CCC(OCc2ccc(F)cc2)CC1 | Cc1cccc(C)c1NC(=O)C[C@@H]1N=NC=C1CCOCc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=NC=C1CC&",
"old_substring": "[NH+]16CCC5CC1"
} |
Can you make molecule C[C@@H]1CCC[C@H](C)N1C(=O)[C@@H]1COCCO1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[C@H](C)N1C(=O)[C@@H]1CCSC1 | C[C@@H]1CCC[C@H](C)N1C(=O)[C@@H]1COCCO1 | C[C@@H]1CCC[C@H](C)N1C(=O)[C@@H]1CCSC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCSC1",
"old_substring": "[C@@H]13COCCO1"
} |
Can you make molecule C[C@@H]1CCC[C@H](C)N1C(=O)[C@@H]1COCCO1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[C@H](C)N1C(=O)[C@@H]1CCCCO1 | C[C@@H]1CCC[C@H](C)N1C(=O)[C@@H]1COCCO1 | C[C@@H]1CCC[C@H](C)N1C(=O)[C@@H]1CCCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCCO1",
"old_substring": "[C@@H]13COCCO1"
} |
Can you make molecule C[C@@H]1CCC[C@H](C)N1C(=O)[C@@H]1COCCO1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[C@H](C)N1C(=O)[C@@H]1CC=CO1 | C[C@@H]1CCC[C@H](C)N1C(=O)[C@@H]1COCCO1 | C[C@@H]1CCC[C@H](C)N1C(=O)[C@@H]1CC=CO1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC=CO1",
"old_substring": "[C@@H]13COCCO1"
} |
Can you make molecule C[C@@H]1CCC[C@H](C)N1C(=O)[C@@H]1COCCO1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[C@H](C)N1C(=O)[C@@H]1CCCC1=O | C[C@@H]1CCC[C@H](C)N1C(=O)[C@@H]1COCCO1 | C[C@@H]1CCC[C@H](C)N1C(=O)[C@@H]1CCCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCC1=O",
"old_substring": "[C@@H]13COCCO1"
} |
Can you make molecule C[C@@H]1CCC[C@H](C)N1C(=O)[C@@H]1COCCO1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[C@H](C)N1C(=O)[C@@H]1C=CCC1 | C[C@@H]1CCC[C@H](C)N1C(=O)[C@@H]1COCCO1 | C[C@@H]1CCC[C@H](C)N1C(=O)[C@@H]1C=CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=CCC1",
"old_substring": "[C@@H]13COCCO1"
} |
Can you make molecule CC(C)[C@@H](C)CC(=O)NNC(=S)NC1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](C)CC(=O)NNC(=S)NC1CCCCCCC1 | CC(C)[C@@H](C)CC(=O)NNC(=S)NC1CCCCC1 | CC(C)[C@@H](C)CC(=O)NNC(=S)NC1CCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C12CCCCC1"
} |
Can you make molecule CC(C)[C@@H](C)CC(=O)NNC(=S)NC1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](C)CC(=O)NNC(=S)NSC1=CCCCCC1 | CC(C)[C@@H](C)CC(=O)NNC(=S)NC1CCCCC1 | CC(C)[C@@H](C)CC(=O)NNC(=S)NSC1=CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C12CCCCC1"
} |
Can you make molecule CC(C)[C@@H](C)CC(=O)NNC(=S)NC1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](C)CC(=O)NNC(=S)N=CC1CCCCC1 | CC(C)[C@@H](C)CC(=O)NNC(=S)NC1CCCCC1 | CC(C)[C@@H](C)CC(=O)NNC(=S)N=CC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&C1CCCCC1",
"old_substring": "C12CCCCC1"
} |
Can you make molecule CC(C)[C@@H](C)CC(=O)NNC(=S)NC1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](C)CC(=O)NNC(=S)NC1CCCCCCCCCCC1 | CC(C)[C@@H](C)CC(=O)NNC(=S)NC1CCCCC1 | CC(C)[C@@H](C)CC(=O)NNC(=S)NC1CCCCCCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCCCCCC1",
"old_substring": "C12CCCCC1"
} |
Can you make molecule CC(C)[C@@H](C)CC(=O)NNC(=S)NC1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](C)CC(=O)NNC(=S)NC1(C#N)CCCCCCC1 | CC(C)[C@@H](C)CC(=O)NNC(=S)NC1CCCCC1 | CC(C)[C@@H](C)CC(=O)NNC(=S)NC1(C#N)CCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCCCCCC1",
"old_substring": "C12CCCCC1"
} |
Can you make molecule Cc1cccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(Cc4ccco4)C3=O)c3ccccc32)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(Cc4ccc(I)o4)C3=O)c3ccccc32)c1 | Cc1cccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(Cc4ccco4)C3=O)c3ccccc32)c1 | Cc1cccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(Cc4ccc(I)o4)C3=O)c3ccccc32)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)o1",
"old_substring": "c19ccco1"
} |
Can you make molecule Cc1cccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(Cc4ccco4)C3=O)c3ccccc32)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(Cc4ccc(Br)o4)C3=O)c3ccccc32)c1 | Cc1cccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(Cc4ccco4)C3=O)c3ccccc32)c1 | Cc1cccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(Cc4ccc(Br)o4)C3=O)c3ccccc32)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)o1",
"old_substring": "c19ccco1"
} |
Can you make molecule Cc1cccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(Cc4ccco4)C3=O)c3ccccc32)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(Cc4ccc(Cl)o4)C3=O)c3ccccc32)c1 | Cc1cccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(Cc4ccco4)C3=O)c3ccccc32)c1 | Cc1cccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(Cc4ccc(Cl)o4)C3=O)c3ccccc32)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)o1",
"old_substring": "c19ccco1"
} |
Can you make molecule Cc1cccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(Cc4ccco4)C3=O)c3ccccc32)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(Cc4occc4Br)C3=O)c3ccccc32)c1 | Cc1cccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(Cc4ccco4)C3=O)c3ccccc32)c1 | Cc1cccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(Cc4occc4Br)C3=O)c3ccccc32)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&occc1Br",
"old_substring": "c19ccco1"
} |
Can you make molecule Cc1cccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(Cc4ccco4)C3=O)c3ccccc32)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(Cc4sccc4C)C3=O)c3ccccc32)c1 | Cc1cccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(Cc4ccco4)C3=O)c3ccccc32)c1 | Cc1cccc(NC(=O)CN2C(=O)C(=C3SC(=S)N(Cc4sccc4C)C3=O)c3ccccc32)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c19ccco1"
} |
Can you make molecule CC(=O)N[C@@H]1C(=O)C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CO)=N[C@@H]1C(=O)C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C | CC(=O)N[C@@H]1C(=O)C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C | CCC(CO)=N[C@@H]1C(=O)C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&CO",
"old_substring": "CC5=O"
} |
Can you make molecule CC(=O)N[C@@H]1C(=O)C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)N[C@@H]1C(=O)C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C | CC(=O)N[C@@H]1C(=O)C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C | CCCC(=O)N[C@@H]1C(=O)C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC5=O"
} |
Can you make molecule CC(=O)N[C@@H]1C(=O)C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SN[C@@H]1C(=O)C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C | CC(=O)N[C@@H]1C(=O)C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C | CC(=O)SN[C@@H]1C(=O)C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CC5=O"
} |
Can you make molecule CC(=O)N[C@@H]1C(=O)C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)N[C@@H]1C(=O)C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C | CC(=O)N[C@@H]1C(=O)C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C | CCCCC(=O)N[C@@H]1C(=O)C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC5=O"
} |
Can you make molecule CC(=O)N[C@@H]1C(=O)C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C less soluble in water? The output molecule should be similar to the input molecule. | CCC(C=O)=N[C@@H]1C(=O)C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C | CC(=O)N[C@@H]1C(=O)C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C | CCC(C=O)=N[C@@H]1C(=O)C[C@@H]2[C@H]3CCC4=CC(=O)CC[C@@]4(C)[C@@H]3CC[C@]12C | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&C=O",
"old_substring": "CC5=O"
} |
Can you make molecule CCCNC(=O)[C@H]1CS[C@H](c2ccccc2O)N1C(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CCCNSC(=O)C[C@H]1CS[C@H](c2ccccc2O)N1C(C)=O | CCCNC(=O)[C@H]1CS[C@H](c2ccccc2O)N1C(C)=O | CCCNSC(=O)C[C@H]1CS[C@H](c2ccccc2O)N1C(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule CCCNC(=O)[C@H]1CS[C@H](c2ccccc2O)N1C(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CCCNCC(=C=O)C[C@H]1CS[C@H](c2ccccc2O)N1C(C)=O | CCCNC(=O)[C@H]1CS[C@H](c2ccccc2O)N1C(C)=O | CCCNCC(=C=O)C[C@H]1CS[C@H](c2ccccc2O)N1C(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule CCCNC(=O)[C@H]1CS[C@H](c2ccccc2O)N1C(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CCCNC(=O)CCCC(=O)[C@H]1CS[C@H](c2ccccc2O)N1C(C)=O | CCCNC(=O)[C@H]1CS[C@H](c2ccccc2O)N1C(C)=O | CCCNC(=O)CCCC(=O)[C@H]1CS[C@H](c2ccccc2O)N1C(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule CCCNC(=O)[C@H]1CS[C@H](c2ccccc2O)N1C(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CCCNC(=O)CC(C)(C)[C@H]1CS[C@H](c2ccccc2O)N1C(C)=O | CCCNC(=O)[C@H]1CS[C@H](c2ccccc2O)N1C(C)=O | CCCNC(=O)CC(C)(C)[C@H]1CS[C@H](c2ccccc2O)N1C(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule CCCNC(=O)[C@H]1CS[C@H](c2ccccc2O)N1C(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CCCNC[S@+]([O-])CCC[C@H]1CS[C@H](c2ccccc2O)N1C(C)=O | CCCNC(=O)[C@H]1CS[C@H](c2ccccc2O)N1C(C)=O | CCCNC[S@+]([O-])CCC[C@H]1CS[C@H](c2ccccc2O)N1C(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C36=O"
} |
Can you make molecule Cc1ccc(N2CC[C@H](C(=O)NC[C@@H](CC(C)C)N3CCOCC3)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2CC[C@H](C(=O)NC[C@@H](CC(C)C)N3CCCC3)C2=O)cc1 | Cc1ccc(N2CC[C@H](C(=O)NC[C@@H](CC(C)C)N3CCOCC3)C2=O)cc1 | Cc1ccc(N2CC[C@H](C(=O)NC[C@@H](CC(C)C)N3CCCC3)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC1",
"old_substring": "N16CCOCC1"
} |
Can you make molecule Cc1ccc(N2CC[C@H](C(=O)NC[C@@H](CC(C)C)N3CCOCC3)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2CC[C@H](C(=O)NC[C@@H](CC(C)C)N3CCCCC3)C2=O)cc1 | Cc1ccc(N2CC[C@H](C(=O)NC[C@@H](CC(C)C)N3CCOCC3)C2=O)cc1 | Cc1ccc(N2CC[C@H](C(=O)NC[C@@H](CC(C)C)N3CCCCC3)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "N16CCOCC1"
} |
Can you make molecule Cc1ccc(N2CC[C@H](C(=O)NC[C@@H](CC(C)C)N3CCOCC3)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2CC[C@H](C(=O)NC[C@@H](CC(C)C)N3CCSCC3)C2=O)cc1 | Cc1ccc(N2CC[C@H](C(=O)NC[C@@H](CC(C)C)N3CCOCC3)C2=O)cc1 | Cc1ccc(N2CC[C@H](C(=O)NC[C@@H](CC(C)C)N3CCSCC3)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSCC1",
"old_substring": "N16CCOCC1"
} |
Can you make molecule Cc1ccc(N2CC[C@H](C(=O)NC[C@@H](CC(C)C)N3CCOCC3)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2CC[C@H](C(=O)NC[C@@H](CC(C)C)N3CC=CC3)C2=O)cc1 | Cc1ccc(N2CC[C@H](C(=O)NC[C@@H](CC(C)C)N3CCOCC3)C2=O)cc1 | Cc1ccc(N2CC[C@H](C(=O)NC[C@@H](CC(C)C)N3CC=CC3)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=CC1",
"old_substring": "N16CCOCC1"
} |
Can you make molecule Cc1ccc(N2CC[C@H](C(=O)NC[C@@H](CC(C)C)N3CCOCC3)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2CC[C@H](C(=O)NC[C@@H](CC(C)C)SSN3CCOCC3)C2=O)cc1 | Cc1ccc(N2CC[C@H](C(=O)NC[C@@H](CC(C)C)N3CCOCC3)C2=O)cc1 | Cc1ccc(N2CC[C@H](C(=O)NC[C@@H](CC(C)C)SSN3CCOCC3)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SN1CCOCC1",
"old_substring": "N16CCOCC1"
} |
Can you make molecule COc1ccc(NC(=O)CCc2ccc3c(c2)OCCO3)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(NC(=O)CCc2ccc3c(c2)OCCO3)cc1OC | COc1ccc(NC(=O)CCc2ccc3c(c2)OCCO3)cc1OC | COCc1ccc(NC(=O)CCc2ccc3c(c2)OCCO3)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(NC(=O)CCc2ccc3c(c2)OCCO3)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(NC(=O)CCc2ccc3c(c2)OCCO3)cc1OC | COc1ccc(NC(=O)CCc2ccc3c(c2)OCCO3)cc1OC | COCSc1ccc(NC(=O)CCc2ccc3c(c2)OCCO3)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(NC(=O)CCc2ccc3c(c2)OCCO3)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)CCc2ccc3c(c2)OCCO3)ccc1SC(C)=O | COc1ccc(NC(=O)CCc2ccc3c(c2)OCCO3)cc1OC | COc1cc(NC(=O)CCc2ccc3c(c2)OCCO3)ccc1SC(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(NC(=O)CCc2ccc3c(c2)OCCO3)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)CCc2ccc3c(c2)OCCO3)ccc1C(=O)CS | COc1ccc(NC(=O)CCc2ccc3c(c2)OCCO3)cc1OC | COc1cc(NC(=O)CCc2ccc3c(c2)OCCO3)ccc1C(=O)CS | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(NC(=O)CCc2ccc3c(c2)OCCO3)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)CCc2ccc3c(c2)OCCO3)ccc1C(=O)CI | COc1ccc(NC(=O)CCc2ccc3c(c2)OCCO3)cc1OC | COc1cc(NC(=O)CCc2ccc3c(c2)OCCO3)ccc1C(=O)CI | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule Cc1ccc(C(F)(F)F)cc1C=CC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(SC(F)(F)F)cc1C=CC(=O)[O-] | Cc1ccc(C(F)(F)F)cc1C=CC(=O)[O-] | Cc1ccc(SC(F)(F)F)cc1C=CC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C3(F)(F)F"
} |
Can you make molecule Cc1ccc(C(F)(F)F)cc1C=CC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CCCC(F)(F)F)cc1C=CC(=O)[O-] | Cc1ccc(C(F)(F)F)cc1C=CC(=O)[O-] | Cc1ccc(CCCC(F)(F)F)cc1C=CC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C3(F)(F)F"
} |
Can you make molecule Cc1ccc(C(F)(F)F)cc1C=CC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CCCCC(F)(F)F)cc1C=CC(=O)[O-] | Cc1ccc(C(F)(F)F)cc1C=CC(=O)[O-] | Cc1ccc(CCCCC(F)(F)F)cc1C=CC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C3(F)(F)F"
} |
Can you make molecule Cc1ccc(C(F)(F)F)cc1C=CC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(F)(F)C(F)(F)F)cc1C=CC(=O)[O-] | Cc1ccc(C(F)(F)F)cc1C=CC(=O)[O-] | Cc1ccc(C(F)(F)C(F)(F)F)cc1C=CC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C3(F)(F)F"
} |
Can you make molecule Cc1ccc(C(F)(F)F)cc1C=CC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CC(F)(F)C(F)(F)F)cc1C=CC(=O)[O-] | Cc1ccc(C(F)(F)F)cc1C=CC(=O)[O-] | Cc1ccc(CC(F)(F)C(F)(F)F)cc1C=CC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C3(F)(F)F"
} |
Can you make molecule Cc1ccccc1C(=O)Nc1ccc(N2CC[NH+](Cc3ccccc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C(=O)Nc1ccc(N2CC[NH+](Cc3ccccc3)CC2)cc1I | Cc1ccccc1C(=O)Nc1ccc(N2CC[NH+](Cc3ccccc3)CC2)cc1 | Cc1ccccc1C(=O)Nc1ccc(N2CC[NH+](Cc3ccccc3)CC2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16ccc7cc1"
} |
Can you make molecule Cc1ccccc1C(=O)Nc1ccc(N2CC[NH+](Cc3ccccc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C(=O)Nc1cc(N2CC[NH+](Cc3ccccc3)CC2)ccc1Br | Cc1ccccc1C(=O)Nc1ccc(N2CC[NH+](Cc3ccccc3)CC2)cc1 | Cc1ccccc1C(=O)Nc1cc(N2CC[NH+](Cc3ccccc3)CC2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16ccc7cc1"
} |
Can you make molecule Cc1ccccc1C(=O)Nc1ccc(N2CC[NH+](Cc3ccccc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C(=O)Nc1ccc(N2CC[NH+](Cc3ccccc3)CC2)cc1Cl | Cc1ccccc1C(=O)Nc1ccc(N2CC[NH+](Cc3ccccc3)CC2)cc1 | Cc1ccccc1C(=O)Nc1ccc(N2CC[NH+](Cc3ccccc3)CC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16ccc7cc1"
} |
Can you make molecule Cc1ccccc1C(=O)Nc1ccc(N2CC[NH+](Cc3ccccc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C(=O)Nc1cccc(N2CC[NH+](Cc3ccccc3)CC2)c1Br | Cc1ccccc1C(=O)Nc1ccc(N2CC[NH+](Cc3ccccc3)CC2)cc1 | Cc1ccccc1C(=O)Nc1cccc(N2CC[NH+](Cc3ccccc3)CC2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c16ccc7cc1"
} |
Can you make molecule Cc1ccccc1C(=O)Nc1ccc(N2CC[NH+](Cc3ccccc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C(=O)Nc1cccc(N2CC[NH+](Cc3ccccc3)CC2)c1Cl | Cc1ccccc1C(=O)Nc1ccc(N2CC[NH+](Cc3ccccc3)CC2)cc1 | Cc1ccccc1C(=O)Nc1cccc(N2CC[NH+](Cc3ccccc3)CC2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c16ccc7cc1"
} |
Can you make molecule c1cc(C[NH2+]Cc2ccco2)cc(OC2CCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Ic1ccc(C[NH2+]Cc2cccc(OC3CCCC3)c2)o1 | c1cc(C[NH2+]Cc2ccco2)cc(OC2CCCC2)c1 | Ic1ccc(C[NH2+]Cc2cccc(OC3CCCC3)c2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule c1cc(C[NH2+]Cc2ccco2)cc(OC2CCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Brc1ccc(C[NH2+]Cc2cccc(OC3CCCC3)c2)o1 | c1cc(C[NH2+]Cc2ccco2)cc(OC2CCCC2)c1 | Brc1ccc(C[NH2+]Cc2cccc(OC3CCCC3)c2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule c1cc(C[NH2+]Cc2ccco2)cc(OC2CCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc(C[NH2+]Cc2cccc(OC3CCCC3)c2)o1 | c1cc(C[NH2+]Cc2ccco2)cc(OC2CCCC2)c1 | Clc1ccc(C[NH2+]Cc2cccc(OC3CCCC3)c2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule c1cc(C[NH2+]Cc2ccco2)cc(OC2CCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Brc1ccoc1C[NH2+]Cc1cccc(OC2CCCC2)c1 | c1cc(C[NH2+]Cc2ccco2)cc(OC2CCCC2)c1 | Brc1ccoc1C[NH2+]Cc1cccc(OC2CCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&occc1Br",
"old_substring": "c17ccco1"
} |
Can you make molecule c1cc(C[NH2+]Cc2ccco2)cc(OC2CCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1C[NH2+]Cc1cccc(OC2CCCC2)c1 | c1cc(C[NH2+]Cc2ccco2)cc(OC2CCCC2)c1 | Cc1ccsc1C[NH2+]Cc1cccc(OC2CCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c17ccco1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.