prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(=O)Nc1cccc(CN[C@H]2CC[NH+]([C@@H](C)c3ccccc3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CO)=Nc1cccc(CN[C@H]2CC[NH+]([C@@H](C)c3ccccc3)C2)c1 | CC(=O)Nc1cccc(CN[C@H]2CC[NH+]([C@@H](C)c3ccccc3)C2)c1 | CCC(CO)=Nc1cccc(CN[C@H]2CC[NH+]([C@@H](C)c3ccccc3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&CO",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)Nc1cccc(CN[C@H]2CC[NH+]([C@@H](C)c3ccccc3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)Nc1cccc(CN[C@H]2CC[NH+]([C@@H](C)c3ccccc3)C2)c1 | CC(=O)Nc1cccc(CN[C@H]2CC[NH+]([C@@H](C)c3ccccc3)C2)c1 | CCCC(=O)Nc1cccc(CN[C@H]2CC[NH+]([C@@H](C)c3ccccc3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)Nc1cccc(CN[C@H]2CC[NH+]([C@@H](C)c3ccccc3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SNc1cccc(CN[C@H]2CC[NH+]([C@@H](C)c3ccccc3)C2)c1 | CC(=O)Nc1cccc(CN[C@H]2CC[NH+]([C@@H](C)c3ccccc3)C2)c1 | CC(=O)SNc1cccc(CN[C@H]2CC[NH+]([C@@H](C)c3ccccc3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)Nc1cccc(CN[C@H]2CC[NH+]([C@@H](C)c3ccccc3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Nc1cccc(CN[C@H]2CC[NH+]([C@@H](C)c3ccccc3)C2)c1 | CC(=O)Nc1cccc(CN[C@H]2CC[NH+]([C@@H](C)c3ccccc3)C2)c1 | CCCCC(=O)Nc1cccc(CN[C@H]2CC[NH+]([C@@H](C)c3ccccc3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)Nc1cccc(CN[C@H]2CC[NH+]([C@@H](C)c3ccccc3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C=O)=Nc1cccc(CN[C@H]2CC[NH+]([C@@H](C)c3ccccc3)C2)c1 | CC(=O)Nc1cccc(CN[C@H]2CC[NH+]([C@@H](C)c3ccccc3)C2)c1 | CCC(C=O)=Nc1cccc(CN[C@H]2CC[NH+]([C@@H](C)c3ccccc3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&C=O",
"old_substring": "CC4=O"
} |
Can you make molecule C[NH+](Cc1cnc(C2CCC2)s1)C(C1CC1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](Cc1cnc(C2CCCCC2)s1)C(C1CC1)C1CC1 | C[NH+](Cc1cnc(C2CCC2)s1)C(C1CC1)C1CC1 | C[NH+](Cc1cnc(C2CCCCC2)s1)C(C1CC1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C18CCC1"
} |
Can you make molecule C[NH+](Cc1cnc(C2CCC2)s1)C(C1CC1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](Cc1cnc(C2SCCCS2)s1)C(C1CC1)C1CC1 | C[NH+](Cc1cnc(C2CCC2)s1)C(C1CC1)C1CC1 | C[NH+](Cc1cnc(C2SCCCS2)s1)C(C1CC1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C18CCC1"
} |
Can you make molecule C[NH+](Cc1cnc(C2CCC2)s1)C(C1CC1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](Cc1cnc(C2CCCCCC2)s1)C(C1CC1)C1CC1 | C[NH+](Cc1cnc(C2CCC2)s1)C(C1CC1)C1CC1 | C[NH+](Cc1cnc(C2CCCCCC2)s1)C(C1CC1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C18CCC1"
} |
Can you make molecule C[NH+](Cc1cnc(C2CCC2)s1)C(C1CC1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](Cc1cnc(C2(C)CCCC2)s1)C(C1CC1)C1CC1 | C[NH+](Cc1cnc(C2CCC2)s1)C(C1CC1)C1CC1 | C[NH+](Cc1cnc(C2(C)CCCC2)s1)C(C1CC1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C18CCC1"
} |
Can you make molecule C[NH+](Cc1cnc(C2CCC2)s1)C(C1CC1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](Cc1cnc(C2CCCCCCC2)s1)C(C1CC1)C1CC1 | C[NH+](Cc1cnc(C2CCC2)s1)C(C1CC1)C1CC1 | C[NH+](Cc1cnc(C2CCCCCCC2)s1)C(C1CC1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C18CCC1"
} |
Can you make molecule Cc1ncccc1NC(=O)C(=O)N1CCn2c(nnc2C(F)(F)F)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncccc1NC(=O)C(=O)N1CCn2c(nnc2SC(F)(F)F)C1 | Cc1ncccc1NC(=O)C(=O)N1CCn2c(nnc2C(F)(F)F)C1 | Cc1ncccc1NC(=O)C(=O)N1CCn2c(nnc2SC(F)(F)F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule Cc1ncccc1NC(=O)C(=O)N1CCn2c(nnc2C(F)(F)F)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncccc1NC(=O)C(=O)N1CCn2c(CCCC(F)(F)F)nnc2C1 | Cc1ncccc1NC(=O)C(=O)N1CCn2c(nnc2C(F)(F)F)C1 | Cc1ncccc1NC(=O)C(=O)N1CCn2c(CCCC(F)(F)F)nnc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule Cc1ncccc1NC(=O)C(=O)N1CCn2c(nnc2C(F)(F)F)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncccc1NC(=O)C(=O)N1CCn2c(CCCCC(F)(F)F)nnc2C1 | Cc1ncccc1NC(=O)C(=O)N1CCn2c(nnc2C(F)(F)F)C1 | Cc1ncccc1NC(=O)C(=O)N1CCn2c(CCCCC(F)(F)F)nnc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule Cc1ncccc1NC(=O)C(=O)N1CCn2c(nnc2C(F)(F)F)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncccc1NC(=O)C(=O)N1CCn2c(nnc2C(F)(F)C(F)(F)F)C1 | Cc1ncccc1NC(=O)C(=O)N1CCn2c(nnc2C(F)(F)F)C1 | Cc1ncccc1NC(=O)C(=O)N1CCn2c(nnc2C(F)(F)C(F)(F)F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule Cc1ncccc1NC(=O)C(=O)N1CCn2c(nnc2C(F)(F)F)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncccc1NC(=O)C(=O)N1CCn2c(nnc2CC(F)(F)C(F)(F)F)C1 | Cc1ncccc1NC(=O)C(=O)N1CCn2c(nnc2C(F)(F)F)C1 | Cc1ncccc1NC(=O)C(=O)N1CCn2c(nnc2CC(F)(F)C(F)(F)F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule COc1ccccc1CN1C[C@@H](C(=O)NCc2noc(-c3ccccc3)n2)CCC1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CN1C[C@@H](C(=O)NCc2ncon2)CCC1=O.Fc1ccccc1 | COc1ccccc1CN1C[C@@H](C(=O)NCc2noc(-c3ccccc3)n2)CCC1=O | COc1ccccc1CN1C[C@@H](C(=O)NCc2ncon2)CCC1=O.Fc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Fc1cccc&c1",
"old_substring": "c1%11ccccc1"
} |
Can you make molecule COc1ccccc1CN1C[C@@H](C(=O)NCc2noc(-c3ccccc3)n2)CCC1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CN1C[C@@H](C(=O)NCc2ncon2)CCC1=O.Cc1ccccc1 | COc1ccccc1CN1C[C@@H](C(=O)NCc2noc(-c3ccccc3)n2)CCC1=O | COc1ccccc1CN1C[C@@H](C(=O)NCc2ncon2)CCC1=O.Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cccc&c1",
"old_substring": "c1%11ccccc1"
} |
Can you make molecule COc1ccccc1CN1C[C@@H](C(=O)NCc2noc(-c3ccccc3)n2)CCC1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CN1C[C@@H](C(=O)NCc2ncon2)CCC1=O.Ic1ccccc1 | COc1ccccc1CN1C[C@@H](C(=O)NCc2noc(-c3ccccc3)n2)CCC1=O | COc1ccccc1CN1C[C@@H](C(=O)NCc2ncon2)CCC1=O.Ic1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c1%11ccccc1"
} |
Can you make molecule COc1ccccc1CN1C[C@@H](C(=O)NCc2noc(-c3ccccc3)n2)CCC1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CN1C[C@@H](C(=O)NCc2ncon2)CCC1=O.Fc1ccc(F)cc1 | COc1ccccc1CN1C[C@@H](C(=O)NCc2noc(-c3ccccc3)n2)CCC1=O | COc1ccccc1CN1C[C@@H](C(=O)NCc2ncon2)CCC1=O.Fc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1F",
"old_substring": "c1%11ccccc1"
} |
Can you make molecule COc1ccccc1CN1C[C@@H](C(=O)NCc2noc(-c3ccccc3)n2)CCC1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CN1C[C@@H](C(=O)NCc2ncon2)CCC1=O.Cc1ccccc1C | COc1ccccc1CN1C[C@@H](C(=O)NCc2noc(-c3ccccc3)n2)CCC1=O | COc1ccccc1CN1C[C@@H](C(=O)NCc2ncon2)CCC1=O.Cc1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c1%11ccccc1"
} |
Can you make molecule Cc1cccc(S(=O)(=O)Nc2ccc(CC(=O)NC3CC3)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(S(=O)(=O)Nc2ccc(CC(=O)NC3SCCS3)cc2)c1 | Cc1cccc(S(=O)(=O)Nc2ccc(CC(=O)NC3CC3)cc2)c1 | Cc1cccc(S(=O)(=O)Nc2ccc(CC(=O)NC3SCCS3)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C17CC1"
} |
Can you make molecule Cc1cccc(S(=O)(=O)Nc2ccc(CC(=O)NC3CC3)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(S(=O)(=O)Nc2ccc(CC(=O)N=C3CCC3)cc2)c1 | Cc1cccc(S(=O)(=O)Nc2ccc(CC(=O)NC3CC3)cc2)c1 | Cc1cccc(S(=O)(=O)Nc2ccc(CC(=O)N=C3CCC3)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCC1",
"old_substring": "C17CC1"
} |
Can you make molecule Cc1cccc(S(=O)(=O)Nc2ccc(CC(=O)NC3CC3)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(S(=O)(=O)Nc2ccc(CC(=O)NC3CCCCC3)cc2)c1 | Cc1cccc(S(=O)(=O)Nc2ccc(CC(=O)NC3CC3)cc2)c1 | Cc1cccc(S(=O)(=O)Nc2ccc(CC(=O)NC3CCCCC3)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule Cc1cccc(S(=O)(=O)Nc2ccc(CC(=O)NC3CC3)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(S(=O)(=O)Nc2ccc(CC(=O)N=C3CCCC3)cc2)c1 | Cc1cccc(S(=O)(=O)Nc2ccc(CC(=O)NC3CC3)cc2)c1 | Cc1cccc(S(=O)(=O)Nc2ccc(CC(=O)N=C3CCCC3)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule Cc1cccc(S(=O)(=O)Nc2ccc(CC(=O)NC3CC3)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(S(=O)(=O)Nc2ccc(CC(=O)NC3SCCCS3)cc2)c1 | Cc1cccc(S(=O)(=O)Nc2ccc(CC(=O)NC3CC3)cc2)c1 | Cc1cccc(S(=O)(=O)Nc2ccc(CC(=O)NC3SCCCS3)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C17CC1"
} |
Can you make molecule Cc1cccc(NC(=O)CN2C(=O)[C@@H]3CCCN3C(=O)c3ccccc32)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Br)ccc(NC(=O)CN2C(=O)[C@@H]3CCCN3C(=O)c3ccccc32)c1C | Cc1cccc(NC(=O)CN2C(=O)[C@@H]3CCCN3C(=O)c3ccccc32)c1C | Cc1c(Br)ccc(NC(=O)CN2C(=O)[C@@H]3CCCN3C(=O)c3ccccc32)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c(Br)ccc&c1C",
"old_substring": "Cc1cccc5c1C"
} |
Can you make molecule Cc1cccc(NC(=O)CN2C(=O)[C@@H]3CCCN3C(=O)c3ccccc32)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(F)c(NC(=O)CN2C(=O)[C@@H]3CCCN3C(=O)c3ccccc32)c1Cl | Cc1cccc(NC(=O)CN2C(=O)[C@@H]3CCCN3C(=O)c3ccccc32)c1C | Cc1ccc(F)c(NC(=O)CN2C(=O)[C@@H]3CCCN3C(=O)c3ccccc32)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(F)c&c1Cl",
"old_substring": "Cc1cccc5c1C"
} |
Can you make molecule Cc1cccc(NC(=O)CN2C(=O)[C@@H]3CCCN3C(=O)c3ccccc32)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)CN2C(=O)[C@@H]3CCCN3C(=O)c3ccccc32)c(C)cc1I | Cc1cccc(NC(=O)CN2C(=O)[C@@H]3CCCN3C(=O)c3ccccc32)c1C | Cc1cc(NC(=O)CN2C(=O)[C@@H]3CCCN3C(=O)c3ccccc32)c(C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1I",
"old_substring": "Cc1cccc5c1C"
} |
Can you make molecule Cc1cccc(NC(=O)CN2C(=O)[C@@H]3CCCN3C(=O)c3ccccc32)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2occ(NC(=O)CN3C(=O)[C@@H]4CCCN4C(=O)c4ccccc43)c2cc1Cl | Cc1cccc(NC(=O)CN2C(=O)[C@@H]3CCCN3C(=O)c3ccccc32)c1C | Cc1cc2occ(NC(=O)CN3C(=O)[C@@H]4CCCN4C(=O)c4ccccc43)c2cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc2occ&c2cc1Cl",
"old_substring": "Cc1cccc5c1C"
} |
Can you make molecule Cc1cccc(NC(=O)CN2C(=O)[C@@H]3CCCN3C(=O)c3ccccc32)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)CN2C(=O)[C@@H]3CCCN3C(=O)c3ccccc32)c(C)cc1Br | Cc1cccc(NC(=O)CN2C(=O)[C@@H]3CCCN3C(=O)c3ccccc32)c1C | Cc1cc(NC(=O)CN2C(=O)[C@@H]3CCCN3C(=O)c3ccccc32)c(C)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1Br",
"old_substring": "Cc1cccc5c1C"
} |
Can you make molecule Cc1oc(-c2cccs2)nc1C[S@@+]([O-])CCO less soluble in water? The output molecule should be similar to the input molecule. | CC[S@@+]([O-])CC(=O)c1nc(-c2cccs2)oc1C | Cc1oc(-c2cccs2)nc1C[S@@+]([O-])CCO | CC[S@@+]([O-])CC(=O)c1nc(-c2cccs2)oc1C | 102 | {
"fragment_index": 0,
"new_substring": "CC[S@@](=O)CC&=O",
"old_substring": "C3[S@@](=O)CCO"
} |
Can you make molecule Cc1oc(-c2cccs2)nc1C[S@@+]([O-])CCO less soluble in water? The output molecule should be similar to the input molecule. | CC[S@@+]([O-])CCc1nc(-c2cccs2)oc1C | Cc1oc(-c2cccs2)nc1C[S@@+]([O-])CCO | CC[S@@+]([O-])CCc1nc(-c2cccs2)oc1C | 102 | {
"fragment_index": 0,
"new_substring": "CC[S@@](=O)CC&",
"old_substring": "C3[S@@](=O)CCO"
} |
Can you make molecule Cc1oc(-c2cccs2)nc1C[S@@+]([O-])CCO less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc(-c2cccs2)nc1CC[S@+](C)[O-] | Cc1oc(-c2cccs2)nc1C[S@@+]([O-])CCO | Cc1oc(-c2cccs2)nc1CC[S@+](C)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C[S@](=O)CC&",
"old_substring": "C3[S@@](=O)CCO"
} |
Can you make molecule Cc1oc(-c2cccs2)nc1C[S@@+]([O-])CCO less soluble in water? The output molecule should be similar to the input molecule. | CC[S@@+]([O-])CCC(=O)c1nc(-c2cccs2)oc1C | Cc1oc(-c2cccs2)nc1C[S@@+]([O-])CCO | CC[S@@+]([O-])CCC(=O)c1nc(-c2cccs2)oc1C | 102 | {
"fragment_index": 0,
"new_substring": "CC[S@@](=O)CCC&=O",
"old_substring": "C3[S@@](=O)CCO"
} |
Can you make molecule Cc1oc(-c2cccs2)nc1C[S@@+]([O-])CCO less soluble in water? The output molecule should be similar to the input molecule. | CC[S@+]([O-])CC(=O)c1nc(-c2cccs2)oc1C | Cc1oc(-c2cccs2)nc1C[S@@+]([O-])CCO | CC[S@+]([O-])CC(=O)c1nc(-c2cccs2)oc1C | 102 | {
"fragment_index": 0,
"new_substring": "CC[S@](=O)CC&=O",
"old_substring": "C3[S@@](=O)CCO"
} |
Can you make molecule C[C@H](c1ccco1)[NH+](C)CC(=O)Nc1ccc(N2CCCCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](c1ccco1)[NH+](C)CC(=O)Nc1ccc(N2CCCCCCCC2)cc1 | C[C@H](c1ccco1)[NH+](C)CC(=O)Nc1ccc(N2CCCCCC2)cc1 | C[C@H](c1ccco1)[NH+](C)CC(=O)Nc1ccc(N2CCCCCCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCCC1",
"old_substring": "N17CCCCCC1"
} |
Can you make molecule C[C@H](c1ccco1)[NH+](C)CC(=O)Nc1ccc(N2CCCCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](c1ccco1)[NH+](C)CC(=O)Nc1ccc(C2(C#N)CCCCC2)cc1 | C[C@H](c1ccco1)[NH+](C)CC(=O)Nc1ccc(N2CCCCCC2)cc1 | C[C@H](c1ccco1)[NH+](C)CC(=O)Nc1ccc(C2(C#N)CCCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC1&CCCCC1",
"old_substring": "N17CCCCCC1"
} |
Can you make molecule C[C@H](c1ccco1)[NH+](C)CC(=O)Nc1ccc(N2CCCCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](c1ccco1)[NH+](C)CC(=O)Nc1ccc(N2CCCC(C)(C)CC2)cc1 | C[C@H](c1ccco1)[NH+](C)CC(=O)Nc1ccc(N2CCCCCC2)cc1 | C[C@H](c1ccco1)[NH+](C)CC(=O)Nc1ccc(N2CCCC(C)(C)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(C)(C)CC1",
"old_substring": "N17CCCCCC1"
} |
Can you make molecule C[C@H](c1ccco1)[NH+](C)CC(=O)Nc1ccc(N2CCCCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](c1ccco1)[NH+](C)CC(=O)Nc1ccc(C2CCCCC2)cc1 | C[C@H](c1ccco1)[NH+](C)CC(=O)Nc1ccc(N2CCCCCC2)cc1 | C[C@H](c1ccco1)[NH+](C)CC(=O)Nc1ccc(C2CCCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "N17CCCCCC1"
} |
Can you make molecule C[C@H](c1ccco1)[NH+](C)CC(=O)Nc1ccc(N2CCCCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](c1ccco1)[NH+](C)CC(=O)Nc1ccc(N2CCC3(CCCCC3)C2)cc1 | C[C@H](c1ccco1)[NH+](C)CC(=O)Nc1ccc(N2CCCCCC2)cc1 | C[C@H](c1ccco1)[NH+](C)CC(=O)Nc1ccc(N2CCC3(CCCCC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC2(CCCCC2)C1",
"old_substring": "N17CCCCCC1"
} |
Can you make molecule CC[C@@H]([NH3+])[C@@H](c1cccc(Cl)c1)N1C[C@@H](C)[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]([NH3+])[C@H](C[C@@H](CS)C(C)C)c1cccc(Cl)c1 | CC[C@@H]([NH3+])[C@@H](c1cccc(Cl)c1)N1C[C@@H](C)[C@@H](C)C1 | CC[C@@H]([NH3+])[C@H](C[C@@H](CS)C(C)C)c1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](CS)C(C)C",
"old_substring": "N12C[C@@H](C)[C@@H](C)C1"
} |
Can you make molecule CC[C@@H]([NH3+])[C@@H](c1cccc(Cl)c1)N1C[C@@H](C)[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]([NH3+])[C@@H](c1cccc(Cl)c1)N1CCCC(C)(C)C1 | CC[C@@H]([NH3+])[C@@H](c1cccc(Cl)c1)N1C[C@@H](C)[C@@H](C)C1 | CC[C@@H]([NH3+])[C@@H](c1cccc(Cl)c1)N1CCCC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(C)(C)C1",
"old_substring": "N12C[C@@H](C)[C@@H](C)C1"
} |
Can you make molecule CC[C@@H]([NH3+])[C@@H](c1cccc(Cl)c1)N1C[C@@H](C)[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]([NH3+])[C@@H](c1cccc(Cl)c1)N1CCC[C@@H](C)CC1 | CC[C@@H]([NH3+])[C@@H](c1cccc(Cl)c1)N1C[C@@H](C)[C@@H](C)C1 | CC[C@@H]([NH3+])[C@@H](c1cccc(Cl)c1)N1CCC[C@@H](C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@H](C)CC1",
"old_substring": "N12C[C@@H](C)[C@@H](C)C1"
} |
Can you make molecule CC[C@@H]([NH3+])[C@@H](c1cccc(Cl)c1)N1C[C@@H](C)[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]([NH3+])[C@@H](c1cccc(Cl)c1)N1CCCC(C)(C)CC1 | CC[C@@H]([NH3+])[C@@H](c1cccc(Cl)c1)N1C[C@@H](C)[C@@H](C)C1 | CC[C@@H]([NH3+])[C@@H](c1cccc(Cl)c1)N1CCCC(C)(C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(C)(C)CC1",
"old_substring": "N12C[C@@H](C)[C@@H](C)C1"
} |
Can you make molecule CC[C@@H]([NH3+])[C@@H](c1cccc(Cl)c1)N1C[C@@H](C)[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]([NH3+])[C@H](C[C@@H](C)C(C)(C)C)c1cccc(Cl)c1 | CC[C@@H]([NH3+])[C@@H](c1cccc(Cl)c1)N1C[C@@H](C)[C@@H](C)C1 | CC[C@@H]([NH3+])[C@H](C[C@@H](C)C(C)(C)C)c1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](C)C(C)(C)C",
"old_substring": "N12C[C@@H](C)[C@@H](C)C1"
} |
Can you make molecule CCC[C@H]1CN(C(=O)c2cccc(-c3nnc(C)o3)c2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(-c2cccc(C(=O)N3CCO[C@@H](CCC(C)C)C3)c2)o1 | CCC[C@H]1CN(C(=O)c2cccc(-c3nnc(C)o3)c2)CCO1 | Cc1nnc(-c2cccc(C(=O)N3CCO[C@@H](CCC(C)C)C3)c2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC6"
} |
Can you make molecule CCC[C@H]1CN(C(=O)c2cccc(-c3nnc(C)o3)c2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(-c2cccc(C(=O)N3CCO[C@@H](CCCCBr)C3)c2)o1 | CCC[C@H]1CN(C(=O)c2cccc(-c3nnc(C)o3)c2)CCO1 | Cc1nnc(-c2cccc(C(=O)N3CCO[C@@H](CCCCBr)C3)c2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC6"
} |
Can you make molecule CCC[C@H]1CN(C(=O)c2cccc(-c3nnc(C)o3)c2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[C@H]1CN(C(=O)c2cccc(-c3nnc(C)o3)c2)CCO1 | CCC[C@H]1CN(C(=O)c2cccc(-c3nnc(C)o3)c2)CCO1 | C=CCCC[C@H]1CN(C(=O)c2cccc(-c3nnc(C)o3)c2)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC6"
} |
Can you make molecule CCC[C@H]1CN(C(=O)c2cccc(-c3nnc(C)o3)c2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(-c2cccc(C(=O)N3CCO[C@@H](CCCCCl)C3)c2)o1 | CCC[C@H]1CN(C(=O)c2cccc(-c3nnc(C)o3)c2)CCO1 | Cc1nnc(-c2cccc(C(=O)N3CCO[C@@H](CCCCCl)C3)c2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC6"
} |
Can you make molecule CCC[C@H]1CN(C(=O)c2cccc(-c3nnc(C)o3)c2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC[C@H]1CN(C(=O)c2cccc(-c3nnc(C)o3)c2)CCO1 | CCC[C@H]1CN(C(=O)c2cccc(-c3nnc(C)o3)c2)CCO1 | C=CCCCC[C@H]1CN(C(=O)c2cccc(-c3nnc(C)o3)c2)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CCC6"
} |
Can you make molecule COc1cccc(-c2c[nH]c([C@@H]3CCCN3C(=O)Cc3cn4ccsc4n3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(-c2c[nH]c([C@@H]3C=C(CC(=O)Cc4cn5ccsc5n4)N=N3)n2)c1 | COc1cccc(-c2c[nH]c([C@@H]3CCCN3C(=O)Cc3cn4ccsc4n3)n2)c1 | COc1cccc(-c2c[nH]c([C@@H]3C=C(CC(=O)Cc4cn5ccsc5n4)N=N3)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=C(C&)N=N1",
"old_substring": "[C@@H]18CCCN15"
} |
Can you make molecule COc1cccc(-c2c[nH]c([C@@H]3CCCN3C(=O)Cc3cn4ccsc4n3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(-c2c[nH]c([C@@H]3N=NC=C3CCC(=O)Cc3cn4ccsc4n3)n2)c1 | COc1cccc(-c2c[nH]c([C@@H]3CCCN3C(=O)Cc3cn4ccsc4n3)n2)c1 | COc1cccc(-c2c[nH]c([C@@H]3N=NC=C3CCC(=O)Cc3cn4ccsc4n3)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=NC=C1CC&",
"old_substring": "[C@@H]18CCCN15"
} |
Can you make molecule COc1cccc(-c2c[nH]c([C@@H]3CCCN3C(=O)Cc3cn4ccsc4n3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(-c2c[nH]c([C@@H]3CC[C@@H](C(=O)Cc4cn5ccsc5n4)C3)n2)c1 | COc1cccc(-c2c[nH]c([C@@H]3CCCN3C(=O)Cc3cn4ccsc4n3)n2)c1 | COc1cccc(-c2c[nH]c([C@@H]3CC[C@@H](C(=O)Cc4cn5ccsc5n4)C3)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]18CCCN15"
} |
Can you make molecule COc1cccc(-c2c[nH]c([C@@H]3CCCN3C(=O)Cc3cn4ccsc4n3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(-c2c[nH]c([C@H]3C=C(CC(=O)Cc4cn5ccsc5n4)N=N3)n2)c1 | COc1cccc(-c2c[nH]c([C@@H]3CCCN3C(=O)Cc3cn4ccsc4n3)n2)c1 | COc1cccc(-c2c[nH]c([C@H]3C=C(CC(=O)Cc4cn5ccsc5n4)N=N3)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C(C&)N=N1",
"old_substring": "[C@@H]18CCCN15"
} |
Can you make molecule COc1cccc(-c2c[nH]c([C@@H]3CCCN3C(=O)Cc3cn4ccsc4n3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(-c2c[nH]c([C@H]3C(CC(=O)Cc4cn5ccsc5n4)=CN=C3C)n2)c1 | COc1cccc(-c2c[nH]c([C@@H]3CCCN3C(=O)Cc3cn4ccsc4n3)n2)c1 | COc1cccc(-c2c[nH]c([C@H]3C(CC(=O)Cc4cn5ccsc5n4)=CN=C3C)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C(C&)=CN=C1C",
"old_substring": "[C@@H]18CCCN15"
} |
Can you make molecule COC(=O)Cn1c(=O)oc(=O)c2cc(C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | COSC(=O)Cn1c(=O)oc(=O)c2cc(C)ccc21 | COC(=O)Cn1c(=O)oc(=O)c2cc(C)ccc21 | COSC(=O)Cn1c(=O)oc(=O)c2cc(C)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C4"
} |
Can you make molecule COC(=O)Cn1c(=O)oc(=O)c2cc(C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCCC(=O)n1c(=O)oc(=O)c2cc(C)ccc21 | COC(=O)Cn1c(=O)oc(=O)c2cc(C)ccc21 | COC(=O)CCCC(=O)n1c(=O)oc(=O)c2cc(C)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C4"
} |
Can you make molecule COC(=O)Cn1c(=O)oc(=O)c2cc(C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CC(C)(C)n1c(=O)oc(=O)c2cc(C)ccc21 | COC(=O)Cn1c(=O)oc(=O)c2cc(C)ccc21 | COC(=O)CC(C)(C)n1c(=O)oc(=O)c2cc(C)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C4"
} |
Can you make molecule COC(=O)Cn1c(=O)oc(=O)c2cc(C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | COC[S@+]([O-])CCCn1c(=O)oc(=O)c2cc(C)ccc21 | COC(=O)Cn1c(=O)oc(=O)c2cc(C)ccc21 | COC[S@+]([O-])CCCn1c(=O)oc(=O)c2cc(C)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C4"
} |
Can you make molecule COC(=O)Cn1c(=O)oc(=O)c2cc(C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCC(C)(C)n1c(=O)oc(=O)c2cc(C)ccc21 | COC(=O)Cn1c(=O)oc(=O)c2cc(C)ccc21 | COC(=O)CCC(C)(C)n1c(=O)oc(=O)c2cc(C)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C4"
} |
Can you make molecule Cc1cccc(OCCNc2ccc(C#N)c(N)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(SC(=S)OCCNc2ccc(C#N)c(N)c2)c1 | Cc1cccc(OCCNc2ccc(C#N)c(N)c2)c1 | Cc1cccc(SC(=S)OCCNc2ccc(C#N)c(N)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O34"
} |
Can you make molecule Cc1cccc(OCCNc2ccc(C#N)c(N)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CC(=N)OCCNc2ccc(C#N)c(N)c2)c1 | Cc1cccc(OCCNc2ccc(C#N)c(N)c2)c1 | Cc1cccc(CC(=N)OCCNc2ccc(C#N)c(N)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O34"
} |
Can you make molecule Cc1cccc(OCCNc2ccc(C#N)c(N)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C(=O)CCC(=O)CCNc2ccc(C#N)c(N)c2)c1 | Cc1cccc(OCCNc2ccc(C#N)c(N)c2)c1 | Cc1cccc(C(=O)CCC(=O)CCNc2ccc(C#N)c(N)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O34"
} |
Can you make molecule Cc1cccc(OCCNc2ccc(C#N)c(N)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CC[C@@H](O)CCNc2ccc(C#N)c(N)c2)c1 | Cc1cccc(OCCNc2ccc(C#N)c(N)c2)c1 | Cc1cccc(CC[C@@H](O)CCNc2ccc(C#N)c(N)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O34"
} |
Can you make molecule Cc1cccc(OCCNc2ccc(C#N)c(N)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(S/C=C/C(=O)CCNc2ccc(C#N)c(N)c2)c1 | Cc1cccc(OCCNc2ccc(C#N)c(N)c2)c1 | Cc1cccc(S/C=C/C(=O)CCNc2ccc(C#N)c(N)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O34"
} |
Can you make molecule C[C@@H](C(=O)N(C)C)[NH+](CC(=O)[O-])C(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(C(=O)[C@H](C)[NH+](CC(=O)[O-])C(C)(C)C)CC1 | C[C@@H](C(=O)N(C)C)[NH+](CC(=O)[O-])C(C)(C)C | CC1CCN(C(=O)[C@H](C)[NH+](CC(=O)[O-])C(C)(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)CC1",
"old_substring": "N1(C)C"
} |
Can you make molecule C[C@@H](C(=O)N(C)C)[NH+](CC(=O)[O-])C(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)N1CCC(F)CC1)[NH+](CC(=O)[O-])C(C)(C)C | C[C@@H](C(=O)N(C)C)[NH+](CC(=O)[O-])C(C)(C)C | C[C@@H](C(=O)N1CCC(F)CC1)[NH+](CC(=O)[O-])C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(F)CC1",
"old_substring": "N1(C)C"
} |
Can you make molecule C[C@@H](C(=O)N(C)C)[NH+](CC(=O)[O-])C(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)N1CCC(C)(C)C1)[NH+](CC(=O)[O-])C(C)(C)C | C[C@@H](C(=O)N(C)C)[NH+](CC(=O)[O-])C(C)(C)C | C[C@@H](C(=O)N1CCC(C)(C)C1)[NH+](CC(=O)[O-])C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)(C)C1",
"old_substring": "N1(C)C"
} |
Can you make molecule C[C@@H](C(=O)N(C)C)[NH+](CC(=O)[O-])C(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)N1CCC(C#N)CC1)[NH+](CC(=O)[O-])C(C)(C)C | C[C@@H](C(=O)N(C)C)[NH+](CC(=O)[O-])C(C)(C)C | C[C@@H](C(=O)N1CCC(C#N)CC1)[NH+](CC(=O)[O-])C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C#N)CC1",
"old_substring": "N1(C)C"
} |
Can you make molecule C[C@@H](C(=O)N(C)C)[NH+](CC(=O)[O-])C(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)N1CCOC(C)(C)C1)[NH+](CC(=O)[O-])C(C)(C)C | C[C@@H](C(=O)N(C)C)[NH+](CC(=O)[O-])C(C)(C)C | C[C@@H](C(=O)N1CCOC(C)(C)C1)[NH+](CC(=O)[O-])C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOC(C)(C)C1",
"old_substring": "N1(C)C"
} |
Can you make molecule CC1(CNC(=O)Cc2cccc(F)c2F)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(CCCNC(=O)Cc2cccc(F)c2F)CCCC1 | CC1(CNC(=O)Cc2cccc(F)c2F)CCCC1 | CC1(CCCNC(=O)Cc2cccc(F)c2F)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC&",
"old_substring": "C45"
} |
Can you make molecule CC1(CNC(=O)Cc2cccc(F)c2F)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(CCCCNC(=O)Cc2cccc(F)c2F)CCCC1 | CC1(CNC(=O)Cc2cccc(F)c2F)CCCC1 | CC1(CCCCNC(=O)Cc2cccc(F)c2F)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C45"
} |
Can you make molecule CC1(CNC(=O)Cc2cccc(F)c2F)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(CCC=NC(=O)Cc2cccc(F)c2F)CCCC1 | CC1(CNC(=O)Cc2cccc(F)c2F)CCCC1 | CC1(CCC=NC(=O)Cc2cccc(F)c2F)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C45"
} |
Can you make molecule CC1(CNC(=O)Cc2cccc(F)c2F)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(CCCCCNC(=O)Cc2cccc(F)c2F)CCCC1 | CC1(CNC(=O)Cc2cccc(F)c2F)CCCC1 | CC1(CCCCCNC(=O)Cc2cccc(F)c2F)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C45"
} |
Can you make molecule CC1(CNC(=O)Cc2cccc(F)c2F)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C2CC(NC(=O)Cc3cccc(F)c3F)C2)CCCC1 | CC1(CNC(=O)Cc2cccc(F)c2F)CCCC1 | CC1(C2CC(NC(=O)Cc3cccc(F)c3F)C2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C45"
} |
Can you make molecule CCCc1cc(NC(=O)[C@@H](C)Oc2cccc(C#N)c2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC(c2cc(NC(=O)[C@@H](C)Oc3cccc(C#N)c3)n(C)n2)C1 | CCCc1cc(NC(=O)[C@@H](C)Oc2cccc(C#N)c2)n(C)n1 | CC1CC(c2cc(NC(=O)[C@@H](C)Oc3cccc(C#N)c3)n(C)n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1CC&C1",
"old_substring": "CCC7"
} |
Can you make molecule CCCc1cc(NC(=O)[C@@H](C)Oc2cccc(C#N)c2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCc1cc(NC(=O)[C@@H](C)Oc2cccc(C#N)c2)n(C)n1 | CCCc1cc(NC(=O)[C@@H](C)Oc2cccc(C#N)c2)n(C)n1 | CC(C)CCc1cc(NC(=O)[C@@H](C)Oc2cccc(C#N)c2)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC7"
} |
Can you make molecule CCCc1cc(NC(=O)[C@@H](C)Oc2cccc(C#N)c2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Oc1cccc(C#N)c1)C(=O)Nc1cc(CCCCBr)nn1C | CCCc1cc(NC(=O)[C@@H](C)Oc2cccc(C#N)c2)n(C)n1 | C[C@@H](Oc1cccc(C#N)c1)C(=O)Nc1cc(CCCCBr)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC7"
} |
Can you make molecule CCCc1cc(NC(=O)[C@@H](C)Oc2cccc(C#N)c2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCc1cc(NC(=O)[C@@H](C)Oc2cccc(C#N)c2)n(C)n1 | CCCc1cc(NC(=O)[C@@H](C)Oc2cccc(C#N)c2)n(C)n1 | C=CCCCc1cc(NC(=O)[C@@H](C)Oc2cccc(C#N)c2)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC7"
} |
Can you make molecule CCCc1cc(NC(=O)[C@@H](C)Oc2cccc(C#N)c2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Oc1cccc(C#N)c1)C(=O)Nc1cc(CCCCCl)nn1C | CCCc1cc(NC(=O)[C@@H](C)Oc2cccc(C#N)c2)n(C)n1 | C[C@@H](Oc1cccc(C#N)c1)C(=O)Nc1cc(CCCCCl)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC7"
} |
Can you make molecule CCOC(=O)[C@@H]1CC[C@@H](NC(=O)OC(C)(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)[C@@H]1CC[C@@H](NC(C)(C)CC(=O)OC(C)(C)C)C1 | CCOC(=O)[C@@H]1CC[C@@H](NC(=O)OC(C)(C)C)C1 | CCOC(=O)[C@@H]1CC[C@@H](NC(C)(C)CC(=O)OC(C)(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCOC(=O)[C@@H]1CC[C@@H](NC(=O)OC(C)(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)[C@@H]1CC[C@@H](NC(C)(C)CCC(=O)OC(C)(C)C)C1 | CCOC(=O)[C@@H]1CC[C@@H](NC(=O)OC(C)(C)C)C1 | CCOC(=O)[C@@H]1CC[C@@H](NC(C)(C)CCC(=O)OC(C)(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCOC(=O)[C@@H]1CC[C@@H](NC(=O)OC(C)(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)[C@@H]1CC[C@@H](N[C@H](Br)CC(=O)OC(C)(C)C)C1 | CCOC(=O)[C@@H]1CC[C@@H](NC(=O)OC(C)(C)C)C1 | CCOC(=O)[C@@H]1CC[C@@H](N[C@H](Br)CC(=O)OC(C)(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule CCOC(=O)[C@@H]1CC[C@@H](NC(=O)OC(C)(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)[C@@H]1CC[C@@H](Nn2c(C)cc(OC(C)(C)C)cc2=O)C1 | CCOC(=O)[C@@H]1CC[C@@H](NC(=O)OC(C)(C)C)C1 | CCOC(=O)[C@@H]1CC[C@@H](Nn2c(C)cc(OC(C)(C)C)cc2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule CCOC(=O)[C@@H]1CC[C@@H](NC(=O)OC(C)(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)[C@@H]1CC[C@@H](Nn2ccc(=O)c(OC(C)(C)C)c2C)C1 | CCOC(=O)[C@@H]1CC[C@@H](NC(=O)OC(C)(C)C)C1 | CCOC(=O)[C@@H]1CC[C@@H](Nn2ccc(=O)c(OC(C)(C)C)c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule Cc1cc(C)cc(N(CCC#N)C(=O)[C@H](C)Sc2ncnc3c2cnn3C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C#N)(CC)N(C(=O)[C@H](C)Sc1ncnc2c1cnn2C)c1cc(C)cc(C)c1 | Cc1cc(C)cc(N(CCC#N)C(=O)[C@H](C)Sc2ncnc3c2cnn3C)c1 | CCC(C#N)(CC)N(C(=O)[C@H](C)Sc1ncnc2c1cnn2C)c1cc(C)cc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C#N)CC",
"old_substring": "C5CC#N"
} |
Can you make molecule Cc1cc(C)cc(N(CCC#N)C(=O)[C@H](C)Sc2ncnc3c2cnn3C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C#N)(CCC)N(C(=O)[C@H](C)Sc1ncnc2c1cnn2C)c1cc(C)cc(C)c1 | Cc1cc(C)cc(N(CCC#N)C(=O)[C@H](C)Sc2ncnc3c2cnn3C)c1 | CCCC(C#N)(CCC)N(C(=O)[C@H](C)Sc1ncnc2c1cnn2C)c1cc(C)cc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C#N)CCC",
"old_substring": "C5CC#N"
} |
Can you make molecule Cc1cc(C)cc(N(CCC#N)C(=O)[C@H](C)Sc2ncnc3c2cnn3C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(N(CCC(C)(C)C#N)C(=O)[C@H](C)Sc2ncnc3c2cnn3C)c1 | Cc1cc(C)cc(N(CCC#N)C(=O)[C@H](C)Sc2ncnc3c2cnn3C)c1 | Cc1cc(C)cc(N(CCC(C)(C)C#N)C(=O)[C@H](C)Sc2ncnc3c2cnn3C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C#N)CC&",
"old_substring": "C5CC#N"
} |
Can you make molecule Cc1cc(C)cc(N(CCC#N)C(=O)[C@H](C)Sc2ncnc3c2cnn3C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C#N)(CC)C(=O)N(C(=O)[C@H](C)Sc1ncnc2c1cnn2C)c1cc(C)cc(C)c1 | Cc1cc(C)cc(N(CCC#N)C(=O)[C@H](C)Sc2ncnc3c2cnn3C)c1 | CCC(C#N)(CC)C(=O)N(C(=O)[C@H](C)Sc1ncnc2c1cnn2C)c1cc(C)cc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC(C#N)(CC)C&=O",
"old_substring": "C5CC#N"
} |
Can you make molecule Cc1cc(C)cc(N(CCC#N)C(=O)[C@H](C)Sc2ncnc3c2cnn3C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](C#N)C(=O)N(C(=O)[C@H](C)Sc1ncnc2c1cnn2C)c1cc(C)cc(C)c1 | Cc1cc(C)cc(N(CCC#N)C(=O)[C@H](C)Sc2ncnc3c2cnn3C)c1 | CCC[C@H](C#N)C(=O)N(C(=O)[C@H](C)Sc1ncnc2c1cnn2C)c1cc(C)cc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H](C#N)C&=O",
"old_substring": "C5CC#N"
} |
Can you make molecule CCc1cc(C(=O)NCc2cc3n(n2)CCCN(S(C)(=O)=O)C3)on1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccn(C(=O)NCc2cc3n(n2)CCCN(S(C)(=O)=O)C3)c1 | CCc1cc(C(=O)NCc2cc3n(n2)CCCN(S(C)(=O)=O)C3)on1 | CCc1ccn(C(=O)NCc2cc3n(n2)CCCN(S(C)(=O)=O)C3)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccn&c1",
"old_substring": "c18cc7on1"
} |
Can you make molecule CCc1cc(C(=O)NCc2cc3n(n2)CCCN(S(C)(=O)=O)C3)on1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(C(=O)NCc2cc3n(n2)CCCN(S(C)(=O)=O)C3)o1 | CCc1cc(C(=O)NCc2cc3n(n2)CCCN(S(C)(=O)=O)C3)on1 | CCc1ccc(C(=O)NCc2cc3n(n2)CCCN(S(C)(=O)=O)C3)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&o1",
"old_substring": "c18cc7on1"
} |
Can you make molecule CCc1cc(C(=O)NCc2cc3n(n2)CCCN(S(C)(=O)=O)C3)on1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(C(=O)NCc2cc3n(n2)CCCN(S(C)(=O)=O)C3)oc1C | CCc1cc(C(=O)NCc2cc3n(n2)CCCN(S(C)(=O)=O)C3)on1 | CCc1cc(C(=O)NCc2cc3n(n2)CCCN(S(C)(=O)=O)C3)oc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&oc1C",
"old_substring": "c18cc7on1"
} |
Can you make molecule CCc1cc(C(=O)NCc2cc3n(n2)CCCN(S(C)(=O)=O)C3)on1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc2oc(C(=O)NCc3cc4n(n3)CCCN(S(C)(=O)=O)C4)nc2c1 | CCc1cc(C(=O)NCc2cc3n(n2)CCCN(S(C)(=O)=O)C3)on1 | CCc1ccc2oc(C(=O)NCc3cc4n(n3)CCCN(S(C)(=O)=O)C4)nc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2oc&nc2c1",
"old_substring": "c18cc7on1"
} |
Can you make molecule CCc1cc(C(=O)NCc2cc3n(n2)CCCN(S(C)(=O)=O)C3)on1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc2occc2c(C(=O)NCc2cc3n(n2)CCCN(S(C)(=O)=O)C3)n1 | CCc1cc(C(=O)NCc2cc3n(n2)CCCN(S(C)(=O)=O)C3)on1 | CCc1cc2occc2c(C(=O)NCc2cc3n(n2)CCCN(S(C)(=O)=O)C3)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2occc2c&n1",
"old_substring": "c18cc7on1"
} |
Can you make molecule COc1ccc([C@@H](C[NH3+])OC(C)C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc([C@@H](C[NH3+])OC(C)C)cc1F | COc1ccc([C@@H](C[NH3+])OC(C)C)cc1F | COCc1ccc([C@@H](C[NH3+])OC(C)C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc([C@@H](C[NH3+])OC(C)C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc([C@@H](C[NH3+])OC(C)C)cc1F | COc1ccc([C@@H](C[NH3+])OC(C)C)cc1F | COCSc1ccc([C@@H](C[NH3+])OC(C)C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc([C@@H](C[NH3+])OC(C)C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc([C@@H](C[NH3+])OC(C)C)cc1F | COc1ccc([C@@H](C[NH3+])OC(C)C)cc1F | CC(=O)Sc1ccc([C@@H](C[NH3+])OC(C)C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc([C@@H](C[NH3+])OC(C)C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)O[C@H](C[NH3+])c1ccc(C(=O)CS)c(F)c1 | COc1ccc([C@@H](C[NH3+])OC(C)C)cc1F | CC(C)O[C@H](C[NH3+])c1ccc(C(=O)CS)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc([C@@H](C[NH3+])OC(C)C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)O[C@H](C[NH3+])c1ccc(C(=O)CI)c(F)c1 | COc1ccc([C@@H](C[NH3+])OC(C)C)cc1F | CC(C)O[C@H](C[NH3+])c1ccc(C(=O)CI)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.