prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1cc(CSc2nnc(N3CCOCC3)n2C[C@@H]2CCCO2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccoc1CSc1nnc(N2CCOCC2)n1C[C@@H]1CCCO1 | Cc1cc(CSc2nnc(N3CCOCC3)n2C[C@@H]2CCCO2)no1 | Cc1ccoc1CSc1nnc(N2CCOCC2)n1C[C@@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccoc1&",
"old_substring": "Cc1cc8no1"
} |
Can you make molecule Cc1cc(CSc2nnc(N3CCOCC3)n2C[C@@H]2CCCO2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(CSc3nnc(N4CCOCC4)n3C[C@@H]3CCCO3)oc2c1 | Cc1cc(CSc2nnc(N3CCOCC3)n2C[C@@H]2CCCO2)no1 | Cc1ccc2nc(CSc3nnc(N4CCOCC4)n3C[C@@H]3CCCO3)oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc2nc&oc2c1",
"old_substring": "Cc1cc8no1"
} |
Can you make molecule Cc1cc(CSc2nnc(N3CCOCC3)n2C[C@@H]2CCCO2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CSc2nnc(N3CCOCC3)n2C[C@@H]2CCCO2)ncc1Br | Cc1cc(CSc2nnc(N3CCOCC3)n2C[C@@H]2CCCO2)no1 | Cc1cc(CSc2nnc(N3CCOCC3)n2C[C@@H]2CCCO2)ncc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&ncc1Br",
"old_substring": "Cc1cc8no1"
} |
Can you make molecule Cc1cc(CSc2nnc(N3CCOCC3)n2C[C@@H]2CCCO2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)n1CSc1nnc(N2CCOCC2)n1C[C@@H]1CCCO1 | Cc1cc(CSc2nnc(N3CCOCC3)n2C[C@@H]2CCCO2)no1 | Cc1ccc(C)n1CSc1nnc(N2CCOCC2)n1C[C@@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(C)n1&",
"old_substring": "Cc1cc8no1"
} |
Can you make molecule Cc1cc(CSc2nnc(N3CCOCC3)n2C[C@@H]2CCCO2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CSc2nnc(N3CCOCC3)n2C[C@@H]2CCCO2)cnc1Cl | Cc1cc(CSc2nnc(N3CCOCC3)n2C[C@@H]2CCCO2)no1 | Cc1cc(CSc2nnc(N3CCOCC3)n2C[C@@H]2CCCO2)cnc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cnc1Cl",
"old_substring": "Cc1cc8no1"
} |
Can you make molecule COc1ccc(CC[C@@H](C)[NH2+][C@@H](C)C(=O)N2CCCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CC[C@@H](C)[NH2+][C@@H](CBr)CCN2CCCCC2)cc1 | COc1ccc(CC[C@@H](C)[NH2+][C@@H](C)C(=O)N2CCCCC2)cc1 | COc1ccc(CC[C@@H](C)[NH2+][C@@H](CBr)CCN2CCCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]6(C)C3=O"
} |
Can you make molecule COc1ccc(CC[C@@H](C)[NH2+][C@@H](C)C(=O)N2CCCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CC[C@@H](C)[NH2+][C@@H](CBr)CCCN2CCCCC2)cc1 | COc1ccc(CC[C@@H](C)[NH2+][C@@H](C)C(=O)N2CCCCC2)cc1 | COc1ccc(CC[C@@H](C)[NH2+][C@@H](CBr)CCCN2CCCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]6(C)C3=O"
} |
Can you make molecule COc1ccc(CC[C@@H](C)[NH2+][C@@H](C)C(=O)N2CCCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCN1CCCCC1)[NH2+][C@H](C)CCc1ccc(OC)cc1 | COc1ccc(CC[C@@H](C)[NH2+][C@@H](C)C(=O)N2CCCCC2)cc1 | CC[C@@H](CCN1CCCCC1)[NH2+][C@H](C)CCc1ccc(OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]6(C)C3=O"
} |
Can you make molecule COc1ccc(CC[C@@H](C)[NH2+][C@@H](C)C(=O)N2CCCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CC[C@@H](C)[NH2+][C@@H](CCl)CCN2CCCCC2)cc1 | COc1ccc(CC[C@@H](C)[NH2+][C@@H](C)C(=O)N2CCCCC2)cc1 | COc1ccc(CC[C@@H](C)[NH2+][C@@H](CCl)CCN2CCCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCl)CC&",
"old_substring": "[C@H]6(C)C3=O"
} |
Can you make molecule COc1ccc(CC[C@@H](C)[NH2+][C@@H](C)C(=O)N2CCCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CC[C@@H](C)[NH2+][C@@H](C)CC(C)(C)CN2CCCCC2)cc1 | COc1ccc(CC[C@@H](C)[NH2+][C@@H](C)C(=O)N2CCCCC2)cc1 | COc1ccc(CC[C@@H](C)[NH2+][C@@H](C)CC(C)(C)CN2CCCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)CC(C)(C)C&",
"old_substring": "[C@H]6(C)C3=O"
} |
Can you make molecule N#CC(=Cc1ccc(O)c(Cl)c1)C(=O)Nc1cc(Cl)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C=C(C=Cc1ccc(O)c(Cl)c1)C(=O)Nc1cc(Cl)ccc1Cl | N#CC(=Cc1ccc(O)c(Cl)c1)C(=O)Nc1cc(Cl)ccc1Cl | C=C(C=Cc1ccc(O)c(Cl)c1)C(=O)Nc1cc(Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C&)C&=O",
"old_substring": "N#CC=4C2=O"
} |
Can you make molecule N#CC(=Cc1ccc(O)c(Cl)c1)C(=O)Nc1cc(Cl)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Oc1ccc(C=CC2=CC3=CC=CC3=C(Nc3cc(Cl)ccc3Cl)OC2)cc1Cl | N#CC(=Cc1ccc(O)c(Cl)c1)C(=O)Nc1cc(Cl)ccc1Cl | Oc1ccc(C=CC2=CC3=CC=CC3=C(Nc3cc(Cl)ccc3Cl)OC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&C1=Cc2cccc&c2OC1",
"old_substring": "N#CC=4C2=O"
} |
Can you make molecule N#CC(=Cc1ccc(O)c(Cl)c1)C(=O)Nc1cc(Cl)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | OCC(CC=Cc1ccc(O)c(Cl)c1)=Nc1cc(Cl)ccc1Cl | N#CC(=Cc1ccc(O)c(Cl)c1)C(=O)Nc1cc(Cl)ccc1Cl | OCC(CC=Cc1ccc(O)c(Cl)c1)=Nc1cc(Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "N#CC=4C2=O"
} |
Can you make molecule N#CC(=Cc1ccc(O)c(Cl)c1)C(=O)Nc1cc(Cl)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Oc1ccc(C=CCCNc2cc(Cl)ccc2Cl)cc1Cl | N#CC(=Cc1ccc(O)c(Cl)c1)C(=O)Nc1cc(Cl)ccc1Cl | Oc1ccc(C=CCCNc2cc(Cl)ccc2Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&CC&",
"old_substring": "N#CC=4C2=O"
} |
Can you make molecule N#CC(=Cc1ccc(O)c(Cl)c1)C(=O)Nc1cc(Cl)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=Cc2ccc(O)c(Cl)c2)CCCC1=Nc1cc(Cl)ccc1Cl | N#CC(=Cc1ccc(O)c(Cl)c1)C(=O)Nc1cc(Cl)ccc1Cl | O=C1C(=Cc2ccc(O)c(Cl)c2)CCCC1=Nc1cc(Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCC=&C1=O",
"old_substring": "N#CC=4C2=O"
} |
Can you make molecule COC(=O)c1cc(Br)ccc1NC(=O)c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(Br)ccc1NSC(=O)Cc1ccc(Br)cc1 | COC(=O)c1cc(Br)ccc1NC(=O)c1ccc(Br)cc1 | COC(=O)c1cc(Br)ccc1NSC(=O)Cc1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule COC(=O)c1cc(Br)ccc1NC(=O)c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(Br)ccc1NC(=O)CCCC(=O)c1ccc(Br)cc1 | COC(=O)c1cc(Br)ccc1NC(=O)c1ccc(Br)cc1 | COC(=O)c1cc(Br)ccc1NC(=O)CCCC(=O)c1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule COC(=O)c1cc(Br)ccc1NC(=O)c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(Br)ccc1NC(=O)CC(C)(C)c1ccc(Br)cc1 | COC(=O)c1cc(Br)ccc1NC(=O)c1ccc(Br)cc1 | COC(=O)c1cc(Br)ccc1NC(=O)CC(C)(C)c1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule COC(=O)c1cc(Br)ccc1NC(=O)c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(Br)ccc1NC(=O)CCC(C)(C)c1ccc(Br)cc1 | COC(=O)c1cc(Br)ccc1NC(=O)c1ccc(Br)cc1 | COC(=O)c1cc(Br)ccc1NC(=O)CCC(C)(C)c1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule COC(=O)c1cc(Br)ccc1NC(=O)c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(Br)ccc1NSC(=O)[C@@H](C)c1ccc(Br)cc1 | COC(=O)c1cc(Br)ccc1NC(=O)c1ccc(Br)cc1 | COC(=O)c1cc(Br)ccc1NSC(=O)[C@@H](C)c1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule C[C@H](c1ccc(F)c(F)c1)N(C)C(=O)C=Cc1ccc(OCC#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](c1ccc(F)c(F)c1)N(C)C(=O)C=C1CCC(C)(OCC#N)CC1 | C[C@H](c1ccc(F)c(F)c1)N(C)C(=O)C=Cc1ccc(OCC#N)cc1 | C[C@H](c1ccc(F)c(F)c1)N(C)C(=O)C=C1CCC(C)(OCC#N)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&(C)CC1",
"old_substring": "C=6c1ccc4cc1"
} |
Can you make molecule C[C@H](c1ccc(F)c(F)c1)N(C)C(=O)C=Cc1ccc(OCC#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@](C)(C=CC(=O)N(C)[C@H](C)c1ccc(F)c(F)c1)COCC#N | C[C@H](c1ccc(F)c(F)c1)N(C)C(=O)C=Cc1ccc(OCC#N)cc1 | CCC[C@](C)(C=CC(=O)N(C)[C@H](C)c1ccc(F)c(F)c1)COCC#N | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@](C)(C&)C&",
"old_substring": "C=6c1ccc4cc1"
} |
Can you make molecule C[C@H](c1ccc(F)c(F)c1)N(C)C(=O)C=Cc1ccc(OCC#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1ccc(F)c(F)c1)N(C)C(=O)C=Cc1ccc(OCC#N)cc1 | C[C@H](c1ccc(F)c(F)c1)N(C)C(=O)C=Cc1ccc(OCC#N)cc1 | C[C@H](CC(C)(C)c1ccc(F)c(F)c1)N(C)C(=O)C=Cc1ccc(OCC#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@@H]57"
} |
Can you make molecule C[C@H](c1ccc(F)c(F)c1)N(C)C(=O)C=Cc1ccc(OCC#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCN(C)C(=O)C=Cc1ccc(OCC#N)cc1)CC(=O)c1ccc(F)c(F)c1 | C[C@H](c1ccc(F)c(F)c1)N(C)C(=O)C=Cc1ccc(OCC#N)cc1 | C[C@@H](CCN(C)C(=O)C=Cc1ccc(OCC#N)cc1)CC(=O)c1ccc(F)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@@H]57"
} |
Can you make molecule C[C@H](c1ccc(F)c(F)c1)N(C)C(=O)C=Cc1ccc(OCC#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(CC[C@H](Cl)c1ccc(F)c(F)c1)C(=O)C=Cc1ccc(OCC#N)cc1 | C[C@H](c1ccc(F)c(F)c1)N(C)C(=O)C=Cc1ccc(OCC#N)cc1 | CN(CC[C@H](Cl)c1ccc(F)c(F)c1)C(=O)C=Cc1ccc(OCC#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "C[C@@H]57"
} |
Can you make molecule C[C@@H](Cc1cccs1)[NH+](C)Cc1ccc(Br)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Cc1cccs1)[NH+]1CCC(Cc2ccc(Br)s2)CC1 | C[C@@H](Cc1cccs1)[NH+](C)Cc1ccc(Br)s1 | C[C@@H](Cc1cccs1)[NH+]1CCC(Cc2ccc(Br)s2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&CC1",
"old_substring": "[NH+]23C"
} |
Can you make molecule C[C@@H](Cc1cccs1)[NH+](C)Cc1ccc(Br)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Cc1cccs1)[NH+]1Cc2cc(Cc3ccc(Br)s3)sc2C1 | C[C@@H](Cc1cccs1)[NH+](C)Cc1ccc(Br)s1 | C[C@@H](Cc1cccs1)[NH+]1Cc2cc(Cc3ccc(Br)s3)sc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&Cc2cc&sc2C1",
"old_substring": "[NH+]23C"
} |
Can you make molecule C[C@@H](Cc1cccs1)[NH+](C)Cc1ccc(Br)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Cc1cccs1)[NH+]1CCc2nc(Cc3ccc(Br)s3)sc2C1 | C[C@@H](Cc1cccs1)[NH+](C)Cc1ccc(Br)s1 | C[C@@H](Cc1cccs1)[NH+]1CCc2nc(Cc3ccc(Br)s3)sc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCc2nc&sc2C1",
"old_substring": "[NH+]23C"
} |
Can you make molecule C[C@@H](Cc1cccs1)[NH+](C)Cc1ccc(Br)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Cc1cccs1)[NH+]1CCc2sc(Cc3ccc(Br)s3)cc2C1 | C[C@@H](Cc1cccs1)[NH+](C)Cc1ccc(Br)s1 | C[C@@H](Cc1cccs1)[NH+]1CCc2sc(Cc3ccc(Br)s3)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCc2sc&cc2C1",
"old_substring": "[NH+]23C"
} |
Can you make molecule C[C@@H](Cc1cccs1)[NH+](C)Cc1ccc(Br)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Cc1cccs1)C[NH+]1CCC(Cc2ccc(Br)s2)CC1 | C[C@@H](Cc1cccs1)[NH+](C)Cc1ccc(Br)s1 | C[C@@H](Cc1cccs1)C[NH+]1CCC(Cc2ccc(Br)s2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&CC1",
"old_substring": "[NH+]23C"
} |
Can you make molecule Cc1ncc(CO)c2cc(C(N)=O)/c(=N/c3ccc(OC(F)(F)F)cc3)oc12 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)c1cc2c(CO)cnc(C)c2o/c1=N\c1ccc(OC(F)(F)F)cc1 | Cc1ncc(CO)c2cc(C(N)=O)/c(=N/c3ccc(OC(F)(F)F)cc3)oc12 | CC(=O)c1cc2c(CO)cnc(C)c2o/c1=N\c1ccc(OC(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)=O",
"old_substring": "C5(N)=O"
} |
Can you make molecule Cc1ncc(CO)c2cc(C(N)=O)/c(=N/c3ccc(OC(F)(F)F)cc3)oc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncc(CO)c2cc(CCCCC(N)=O)/c(=N/c3ccc(OC(F)(F)F)cc3)oc12 | Cc1ncc(CO)c2cc(C(N)=O)/c(=N/c3ccc(OC(F)(F)F)cc3)oc12 | Cc1ncc(CO)c2cc(CCCCC(N)=O)/c(=N/c3ccc(OC(F)(F)F)cc3)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C5(N)=O"
} |
Can you make molecule Cc1ncc(CO)c2cc(C(N)=O)/c(=N/c3ccc(OC(F)(F)F)cc3)oc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncc(CO)c2cc(CC/C(N)=N/O)/c(=N/c3ccc(OC(F)(F)F)cc3)oc12 | Cc1ncc(CO)c2cc(C(N)=O)/c(=N/c3ccc(OC(F)(F)F)cc3)oc12 | Cc1ncc(CO)c2cc(CC/C(N)=N/O)/c(=N/c3ccc(OC(F)(F)F)cc3)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N/O",
"old_substring": "C5(N)=O"
} |
Can you make molecule Cc1ncc(CO)c2cc(C(N)=O)/c(=N/c3ccc(OC(F)(F)F)cc3)oc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncc(CO)c2cc(CC/C(N)=N\O)/c(=N/c3ccc(OC(F)(F)F)cc3)oc12 | Cc1ncc(CO)c2cc(C(N)=O)/c(=N/c3ccc(OC(F)(F)F)cc3)oc12 | Cc1ncc(CO)c2cc(CC/C(N)=N\O)/c(=N/c3ccc(OC(F)(F)F)cc3)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N\\O",
"old_substring": "C5(N)=O"
} |
Can you make molecule Cc1ncc(CO)c2cc(C(N)=O)/c(=N/c3ccc(OC(F)(F)F)cc3)oc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncc(CO)c2cc(CC(N)=S)/c(=N/c3ccc(OC(F)(F)F)cc3)oc12 | Cc1ncc(CO)c2cc(C(N)=O)/c(=N/c3ccc(OC(F)(F)F)cc3)oc12 | Cc1ncc(CO)c2cc(CC(N)=S)/c(=N/c3ccc(OC(F)(F)F)cc3)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(N)=S",
"old_substring": "C5(N)=O"
} |
Can you make molecule C[C@H]([NH3+])[C@H]1CCCC(C)(C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1NCC[C@H]1[C@H]1CCCC(C)(C)CC1 | C[C@H]([NH3+])[C@H]1CCCC(C)(C)CC1 | C[C@H]1NCC[C@H]1[C@H]1CCCC(C)(C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1[C@H]&CCN1&",
"old_substring": "C[C@@H]2[NH3+]"
} |
Can you make molecule C[C@H]([NH3+])[C@H]1CCCC(C)(C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC[C@H]([C@]2(C)CCC[NH2+]C2)CC1 | C[C@H]([NH3+])[C@H]1CCCC(C)(C)CC1 | CC1(C)CCC[C@H]([C@]2(C)CCC[NH2+]C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@]1&CCC[NH+]&C1",
"old_substring": "C[C@@H]2[NH3+]"
} |
Can you make molecule C[C@H]([NH3+])[C@H]1CCCC(C)(C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCO)[C@H]1CCCC(C)(C)CC1 | C[C@H]([NH3+])[C@H]1CCCC(C)(C)CC1 | C[C@@H](CCO)[C@H]1CCCC(C)(C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&C[C@H]&O",
"old_substring": "C[C@@H]2[NH3+]"
} |
Can you make molecule C[C@H]([NH3+])[C@H]1CCCC(C)(C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN([C@H]2CCCC(C)(C)CC2)CC1 | C[C@H]([NH3+])[C@H]1CCCC(C)(C)CC1 | CC1CCN([C@H]2CCCC(C)(C)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCN&C[C@H]1&",
"old_substring": "C[C@@H]2[NH3+]"
} |
Can you make molecule C[C@H]([NH3+])[C@H]1CCCC(C)(C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](C)[C@H]1CCCC(C)(C)CC1 | C[C@H]([NH3+])[C@H]1CCCC(C)(C)CC1 | CC(C)[C@H](C)[C@H]1CCCC(C)(C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "C[C@@H]2[NH3+]"
} |
Can you make molecule CS(=O)(=O)c1ccc(Cl)c(NC(=O)C=Cc2cccc(F)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc(Cl)c(NSC(=O)C=Cc2cccc(F)c2)c1 | CS(=O)(=O)c1ccc(Cl)c(NC(=O)C=Cc2cccc(F)c2)c1 | CS(=O)(=O)c1ccc(Cl)c(NSC(=O)C=Cc2cccc(F)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C=5"
} |
Can you make molecule CS(=O)(=O)c1ccc(Cl)c(NC(=O)C=Cc2cccc(F)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc(Cl)c(NC(=O)C2=C(N=Cc3cccc(F)c3)CCS2)c1 | CS(=O)(=O)c1ccc(Cl)c(NC(=O)C=Cc2cccc(F)c2)c1 | CS(=O)(=O)c1ccc(Cl)c(NC(=O)C2=C(N=Cc3cccc(F)c3)CCS2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=C(N&)CCS1",
"old_substring": "C3(=O)C=5"
} |
Can you make molecule CS(=O)(=O)c1ccc(Cl)c(NC(=O)C=Cc2cccc(F)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc(Cl)c(NC(=O)C(N=Cc2cccc(F)c2)=C(Cl)Cl)c1 | CS(=O)(=O)c1ccc(Cl)c(NC(=O)C=Cc2cccc(F)c2)c1 | CS(=O)(=O)c1ccc(Cl)c(NC(=O)C(N=Cc2cccc(F)c2)=C(Cl)Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(N&)=C(Cl)Cl",
"old_substring": "C3(=O)C=5"
} |
Can you make molecule CS(=O)(=O)c1ccc(Cl)c(NC(=O)C=Cc2cccc(F)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc(Cl)c(NC(=O)C(C=Cc2cccc(F)c2)=C(Cl)Cl)c1 | CS(=O)(=O)c1ccc(Cl)c(NC(=O)C=Cc2cccc(F)c2)c1 | CS(=O)(=O)c1ccc(Cl)c(NC(=O)C(C=Cc2cccc(F)c2)=C(Cl)Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C&)=C(Cl)Cl",
"old_substring": "C3(=O)C=5"
} |
Can you make molecule CS(=O)(=O)c1ccc(Cl)c(NC(=O)C=Cc2cccc(F)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc(Cl)c(NC[S@+]([O-])CCC=Cc2cccc(F)c2)c1 | CS(=O)(=O)c1ccc(Cl)c(NC(=O)C=Cc2cccc(F)c2)c1 | CS(=O)(=O)c1ccc(Cl)c(NC[S@+]([O-])CCC=Cc2cccc(F)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C=5"
} |
Can you make molecule CCCn1ncc(C(=O)N[C@H](c2ccc(C)cc2)c2cccnc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCCn1ncc(C(=O)N[C@@H](c2cccnc2)c2ccc(C)cc2Cl)c1C | CCCn1ncc(C(=O)N[C@H](c2ccc(C)cc2)c2cccnc2)c1C | CCCn1ncc(C(=O)N[C@@H](c2cccnc2)c2ccc(C)cc2Cl)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)cc1Cl",
"old_substring": "c17ccc(C)cc1"
} |
Can you make molecule CCCn1ncc(C(=O)N[C@H](c2ccc(C)cc2)c2cccnc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCCn1ncc(C(=O)N[C@@H](c2cccnc2)c2ccc(Cl)cc2I)c1C | CCCn1ncc(C(=O)N[C@H](c2ccc(C)cc2)c2cccnc2)c1C | CCCn1ncc(C(=O)N[C@@H](c2cccnc2)c2ccc(Cl)cc2I)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c17ccc(C)cc1"
} |
Can you make molecule CCCn1ncc(C(=O)N[C@H](c2ccc(C)cc2)c2cccnc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCCn1ncc(C(=O)N[C@@H](c2cccnc2)c2ccc(Cl)cc2Br)c1C | CCCn1ncc(C(=O)N[C@H](c2ccc(C)cc2)c2cccnc2)c1C | CCCn1ncc(C(=O)N[C@@H](c2cccnc2)c2ccc(Cl)cc2Br)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c17ccc(C)cc1"
} |
Can you make molecule CCCn1ncc(C(=O)N[C@H](c2ccc(C)cc2)c2cccnc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCCn1ncc(C(=O)N[C@@H](c2cccnc2)c2cc(C)c(I)cc2C)c1C | CCCn1ncc(C(=O)N[C@H](c2ccc(C)cc2)c2cccnc2)c1C | CCCn1ncc(C(=O)N[C@@H](c2cccnc2)c2cc(C)c(I)cc2C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1I",
"old_substring": "c17ccc(C)cc1"
} |
Can you make molecule CCCn1ncc(C(=O)N[C@H](c2ccc(C)cc2)c2cccnc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCCn1ncc(C(=O)N[C@@H](c2cccnc2)c2ccc(Cl)c(I)c2)c1C | CCCn1ncc(C(=O)N[C@H](c2ccc(C)cc2)c2cccnc2)c1C | CCCn1ncc(C(=O)N[C@@H](c2cccnc2)c2ccc(Cl)c(I)c2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c17ccc(C)cc1"
} |
Can you make molecule CC(C)n1cnnc1[C@H]1CCC[NH+](CC2CCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | BrCCCCn1cnnc1[C@H]1CCC[NH+](CC2CCC2)C1 | CC(C)n1cnnc1[C@H]1CCC[NH+](CC2CCC2)C1 | BrCCCCn1cnnc1[C@H]1CCC[NH+](CC2CCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)n1cnnc1[C@H]1CCC[NH+](CC2CCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCn1cnnc1[C@H]1CCC[NH+](CC2CCC2)C1 | CC(C)n1cnnc1[C@H]1CCC[NH+](CC2CCC2)C1 | C=CCCCCn1cnnc1[C@H]1CCC[NH+](CC2CCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)n1cnnc1[C@H]1CCC[NH+](CC2CCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | BrCCCCCn1cnnc1[C@H]1CCC[NH+](CC2CCC2)C1 | CC(C)n1cnnc1[C@H]1CCC[NH+](CC2CCC2)C1 | BrCCCCCn1cnnc1[C@H]1CCC[NH+](CC2CCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCBr",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)n1cnnc1[C@H]1CCC[NH+](CC2CCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | SCCCCCn1cnnc1[C@H]1CCC[NH+](CC2CCC2)C1 | CC(C)n1cnnc1[C@H]1CCC[NH+](CC2CCC2)C1 | SCCCCCn1cnnc1[C@H]1CCC[NH+](CC2CCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCC&",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)n1cnnc1[C@H]1CCC[NH+](CC2CCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | SCCCCCCn1cnnc1[C@H]1CCC[NH+](CC2CCC2)C1 | CC(C)n1cnnc1[C@H]1CCC[NH+](CC2CCC2)C1 | SCCCCCCn1cnnc1[C@H]1CCC[NH+](CC2CCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCCC&",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)OC(=O)[C@H](C)CNC(=O)N1C[C@H](C)O[C@@H](c2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)OC(=O)C[C@H](NC(=O)N1C[C@H](C)O[C@@H](c2ccccc2)C1)C(C)C | CC(C)OC(=O)[C@H](C)CNC(=O)N1C[C@H](C)O[C@@H](c2ccccc2)C1 | CC(C)OC(=O)C[C@H](NC(=O)N1C[C@H](C)O[C@@H](c2ccccc2)C1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&C(C)C",
"old_substring": "C3(=O)[C@H](C)C7"
} |
Can you make molecule CC(C)OC(=O)[C@H](C)CNC(=O)N1C[C@H](C)O[C@@H](c2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)O[C@@H](C)CCNC(=O)N1C[C@H](C)O[C@@H](c2ccccc2)C1 | CC(C)OC(=O)[C@H](C)CNC(=O)N1C[C@H](C)O[C@@H](c2ccccc2)C1 | CC(C)O[C@@H](C)CCNC(=O)N1C[C@H](C)O[C@@H](c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C3(=O)[C@H](C)C7"
} |
Can you make molecule CC(C)OC(=O)[C@H](C)CNC(=O)N1C[C@H](C)O[C@@H](c2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)OC(=O)CCC(C)(C)NC(=O)N1C[C@H](C)O[C@@H](c2ccccc2)C1 | CC(C)OC(=O)[C@H](C)CNC(=O)N1C[C@H](C)O[C@@H](c2ccccc2)C1 | CC(C)OC(=O)CCC(C)(C)NC(=O)N1C[C@H](C)O[C@@H](c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)[C@H](C)C7"
} |
Can you make molecule CC(C)OC(=O)[C@H](C)CNC(=O)N1C[C@H](C)O[C@@H](c2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)OC(=O)C(C)(C)CCCNC(=O)N1C[C@H](C)O[C@@H](c2ccccc2)C1 | CC(C)OC(=O)[C@H](C)CNC(=O)N1C[C@H](C)O[C@@H](c2ccccc2)C1 | CC(C)OC(=O)C(C)(C)CCCNC(=O)N1C[C@H](C)O[C@@H](c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(C)CCC&",
"old_substring": "C3(=O)[C@H](C)C7"
} |
Can you make molecule CC(C)OC(=O)[C@H](C)CNC(=O)N1C[C@H](C)O[C@@H](c2ccccc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)OC(=O)CC(C)(C)NC(=O)N1C[C@H](C)O[C@@H](c2ccccc2)C1 | CC(C)OC(=O)[C@H](C)CNC(=O)N1C[C@H](C)O[C@@H](c2ccccc2)C1 | CC(C)OC(=O)CC(C)(C)NC(=O)N1C[C@H](C)O[C@@H](c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)[C@H](C)C7"
} |
Can you make molecule O=C(NC1CCCCC1)c1c(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CC[C@@H]3O2)sc2c1CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1c(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CC[C@@H]3O2)sc2c1CCCC2)NC1CCCCC1 | O=C(NC1CCCCC1)c1c(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CC[C@@H]3O2)sc2c1CCCC2 | O=C(/C=C/Sc1c(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CC[C@@H]3O2)sc2c1CCCC2)NC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C57"
} |
Can you make molecule O=C(NC1CCCCC1)c1c(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CC[C@@H]3O2)sc2c1CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NC2CCCCC2)nc1-c1c(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CC[C@@H]3O2)sc2c1CCCC2 | O=C(NC1CCCCC1)c1c(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CC[C@@H]3O2)sc2c1CCCC2 | O=Cc1sc(NC2CCCCC2)nc1-c1c(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CC[C@@H]3O2)sc2c1CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C57"
} |
Can you make molecule O=C(NC1CCCCC1)c1c(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CC[C@@H]3O2)sc2c1CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NC2CCCCC2)sc1-c1c(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CC[C@@H]3O2)sc2c1CCCC2 | O=C(NC1CCCCC1)c1c(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CC[C@@H]3O2)sc2c1CCCC2 | O=Cc1nc(NC2CCCCC2)sc1-c1c(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CC[C@@H]3O2)sc2c1CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C57"
} |
Can you make molecule O=C(NC1CCCCC1)c1c(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CC[C@@H]3O2)sc2c1CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C1[C@@H]2[C@H](C(=O)N1c1sc3c(c1-c1nn(C(=O)NC4CCCCC4)c(=S)o1)CCCC3)[C@H]1CC[C@@H]2O1 | O=C(NC1CCCCC1)c1c(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CC[C@@H]3O2)sc2c1CCCC2 | O=C1[C@@H]2[C@H](C(=O)N1c1sc3c(c1-c1nn(C(=O)NC4CCCCC4)c(=S)o1)CCCC3)[C@H]1CC[C@@H]2O1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C57"
} |
Can you make molecule O=C(NC1CCCCC1)c1c(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CC[C@@H]3O2)sc2c1CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C1[C@@H]2[C@H](C(=O)N1c1sc3c(c1-c1ccc(/C=N/ONC4CCCCC4)o1)CCCC3)[C@H]1CC[C@@H]2O1 | O=C(NC1CCCCC1)c1c(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CC[C@@H]3O2)sc2c1CCCC2 | O=C1[C@@H]2[C@H](C(=O)N1c1sc3c(c1-c1ccc(/C=N/ONC4CCCCC4)o1)CCCC3)[C@H]1CC[C@@H]2O1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C57"
} |
Can you make molecule COC(=O)C(CC[C@]1(C)[C@H](O)C=CC[C@@H]1C)C(=O)OC less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)C(CC[C@]1(C)[C@H](O)C=CC[C@@H]1C)C(=O)C1OCc2ccccc2CO1 | COC(=O)C(CC[C@]1(C)[C@H](O)C=CC[C@@H]1C)C(=O)OC | COC(=O)C(CC[C@]1(C)[C@H](O)C=CC[C@@H]1C)C(=O)C1OCc2ccccc2CO1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCc2ccccc2CO1",
"old_substring": "CO2"
} |
Can you make molecule COC(=O)C(CC[C@]1(C)[C@H](O)C=CC[C@@H]1C)C(=O)OC less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)C(CC[C@]1(C)[C@H](O)C=CC[C@@H]1C)C(=O)C1(O)Cc2ccccc2C1 | COC(=O)C(CC[C@]1(C)[C@H](O)C=CC[C@@H]1C)C(=O)OC | COC(=O)C(CC[C@]1(C)[C@H](O)C=CC[C@@H]1C)C(=O)C1(O)Cc2ccccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(O)Cc2ccccc2C1",
"old_substring": "CO2"
} |
Can you make molecule COC(=O)C(CC[C@]1(C)[C@H](O)C=CC[C@@H]1C)C(=O)OC less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)C(CC[C@]1(C)[C@H](O)C=CC[C@@H]1C)C(=O)C1=CC2=NN2C[C@@H](C)CO1 | COC(=O)C(CC[C@]1(C)[C@H](O)C=CC[C@@H]1C)C(=O)OC | COC(=O)C(CC[C@]1(C)[C@H](O)C=CC[C@@H]1C)C(=O)C1=CC2=NN2C[C@@H](C)CO1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1COc2cc&nn2C1",
"old_substring": "CO2"
} |
Can you make molecule COC(=O)C(CC[C@]1(C)[C@H](O)C=CC[C@@H]1C)C(=O)OC less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)C(CC[C@]1(C)[C@H](O)C=CC[C@@H]1C)C(=O)N1CCOC12CCCCC2 | COC(=O)C(CC[C@]1(C)[C@H](O)C=CC[C@@H]1C)C(=O)OC | COC(=O)C(CC[C@]1(C)[C@H](O)C=CC[C@@H]1C)C(=O)N1CCOC12CCCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOC12CCCCC2",
"old_substring": "CO2"
} |
Can you make molecule COC(=O)C(CC[C@]1(C)[C@H](O)C=CC[C@@H]1C)C(=O)OC less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)C(CC[C@]1(C)[C@H](O)C=CC[C@@H]1C)C(=O)N1CCOC2(CCC2)C1 | COC(=O)C(CC[C@]1(C)[C@H](O)C=CC[C@@H]1C)C(=O)OC | COC(=O)C(CC[C@]1(C)[C@H](O)C=CC[C@@H]1C)C(=O)N1CCOC2(CCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOC2(CCC2)C1",
"old_substring": "CO2"
} |
Can you make molecule CNC(=O)/C(C#N)=C1/S[C@H](Cc2cccc([N+](=O)[O-])c2)C(=O)N1c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | N#C/C(C(=O)CN=C=S)=C1\S[C@H](Cc2cccc([N+](=O)[O-])c2)C(=O)N1c1ccccc1 | CNC(=O)/C(C#N)=C1/S[C@H](Cc2cccc([N+](=O)[O-])c2)C(=O)N1c1ccccc1 | N#C/C(C(=O)CN=C=S)=C1\S[C@H](Cc2cccc([N+](=O)[O-])c2)C(=O)N1c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N=C=S",
"old_substring": "CN3"
} |
Can you make molecule CNC(=O)/C(C#N)=C1/S[C@H](Cc2cccc([N+](=O)[O-])c2)C(=O)N1c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | N#C/C(C(=O)C1N=N1)=C1\S[C@H](Cc2cccc([N+](=O)[O-])c2)C(=O)N1c1ccccc1 | CNC(=O)/C(C#N)=C1/S[C@H](Cc2cccc([N+](=O)[O-])c2)C(=O)N1c1ccccc1 | N#C/C(C(=O)C1N=N1)=C1\S[C@H](Cc2cccc([N+](=O)[O-])c2)C(=O)N1c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&N=N1",
"old_substring": "CN3"
} |
Can you make molecule CNC(=O)/C(C#N)=C1/S[C@H](Cc2cccc([N+](=O)[O-])c2)C(=O)N1c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C/C=N/OC(=O)/C(C#N)=C1/S[C@H](Cc2cccc([N+](=O)[O-])c2)C(=O)N1c1ccccc1 | CNC(=O)/C(C#N)=C1/S[C@H](Cc2cccc([N+](=O)[O-])c2)C(=O)N1c1ccccc1 | C/C=N/OC(=O)/C(C#N)=C1/S[C@H](Cc2cccc([N+](=O)[O-])c2)C(=O)N1c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C=N/O&",
"old_substring": "CN3"
} |
Can you make molecule CNC(=O)/C(C#N)=C1/S[C@H](Cc2cccc([N+](=O)[O-])c2)C(=O)N1c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | N#C/C(C(=O)CCCN=C=S)=C1\S[C@H](Cc2cccc([N+](=O)[O-])c2)C(=O)N1c1ccccc1 | CNC(=O)/C(C#N)=C1/S[C@H](Cc2cccc([N+](=O)[O-])c2)C(=O)N1c1ccccc1 | N#C/C(C(=O)CCCN=C=S)=C1\S[C@H](Cc2cccc([N+](=O)[O-])c2)C(=O)N1c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCN=C=S",
"old_substring": "CN3"
} |
Can you make molecule CNC(=O)/C(C#N)=C1/S[C@H](Cc2cccc([N+](=O)[O-])c2)C(=O)N1c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | N#C/C(C(=O)CN1CCSCC1)=C1\S[C@H](Cc2cccc([N+](=O)[O-])c2)C(=O)N1c1ccccc1 | CNC(=O)/C(C#N)=C1/S[C@H](Cc2cccc([N+](=O)[O-])c2)C(=O)N1c1ccccc1 | N#C/C(C(=O)CN1CCSCC1)=C1\S[C@H](Cc2cccc([N+](=O)[O-])c2)C(=O)N1c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCSCC1",
"old_substring": "CN3"
} |
Can you make molecule Cc1cccc2c(=O)cc(C(=O)Nc3ccc(Cl)c(Cl)c3)oc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc2c(=O)cc(CC(=O)SNc3ccc(Cl)c(Cl)c3)oc12 | Cc1cccc2c(=O)cc(C(=O)Nc3ccc(Cl)c(Cl)c3)oc12 | Cc1cccc2c(=O)cc(CC(=O)SNc3ccc(Cl)c(Cl)c3)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cccc2c(=O)cc(C(=O)Nc3ccc(Cl)c(Cl)c3)oc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc2c(=O)cc(C(=O)CCCC(=O)Nc3ccc(Cl)c(Cl)c3)oc12 | Cc1cccc2c(=O)cc(C(=O)Nc3ccc(Cl)c(Cl)c3)oc12 | Cc1cccc2c(=O)cc(C(=O)CCCC(=O)Nc3ccc(Cl)c(Cl)c3)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cccc2c(=O)cc(C(=O)Nc3ccc(Cl)c(Cl)c3)oc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc2c(=O)cc(C(C)(C)CC(=O)Nc3ccc(Cl)c(Cl)c3)oc12 | Cc1cccc2c(=O)cc(C(=O)Nc3ccc(Cl)c(Cl)c3)oc12 | Cc1cccc2c(=O)cc(C(C)(C)CC(=O)Nc3ccc(Cl)c(Cl)c3)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cccc2c(=O)cc(C(=O)Nc3ccc(Cl)c(Cl)c3)oc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc2c(=O)cc(C(C)(C)CCC(=O)Nc3ccc(Cl)c(Cl)c3)oc12 | Cc1cccc2c(=O)cc(C(=O)Nc3ccc(Cl)c(Cl)c3)oc12 | Cc1cccc2c(=O)cc(C(C)(C)CCC(=O)Nc3ccc(Cl)c(Cl)c3)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cccc2c(=O)cc(C(=O)Nc3ccc(Cl)c(Cl)c3)oc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc2c(=O)cc([C@H](C)C(=O)SNc3ccc(Cl)c(Cl)c3)oc12 | Cc1cccc2c(=O)cc(C(=O)Nc3ccc(Cl)c(Cl)c3)oc12 | Cc1cccc2c(=O)cc([C@H](C)C(=O)SNc3ccc(Cl)c(Cl)c3)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule C[C@H]1CCc2sc(C(=O)OC[C@H]3CC(=O)N(C4CC4)C3)cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCc2sc(C(=O)OC[C@H]3CC(=O)N(C4SCCS4)C3)cc2C1 | C[C@H]1CCc2sc(C(=O)OC[C@H]3CC(=O)N(C4CC4)C3)cc2C1 | C[C@H]1CCc2sc(C(=O)OC[C@H]3CC(=O)N(C4SCCS4)C3)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C19CC1"
} |
Can you make molecule C[C@H]1CCc2sc(C(=O)OC[C@H]3CC(=O)N(C4CC4)C3)cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCc2sc(C(=O)OC[C@H]3CC(=O)N(C4CCCCC4)C3)cc2C1 | C[C@H]1CCc2sc(C(=O)OC[C@H]3CC(=O)N(C4CC4)C3)cc2C1 | C[C@H]1CCc2sc(C(=O)OC[C@H]3CC(=O)N(C4CCCCC4)C3)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C19CC1"
} |
Can you make molecule C[C@H]1CCc2sc(C(=O)OC[C@H]3CC(=O)N(C4CC4)C3)cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCc2sc(C(=O)OC[C@H]3CC(=O)N(C4SCCCS4)C3)cc2C1 | C[C@H]1CCc2sc(C(=O)OC[C@H]3CC(=O)N(C4CC4)C3)cc2C1 | C[C@H]1CCc2sc(C(=O)OC[C@H]3CC(=O)N(C4SCCCS4)C3)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C19CC1"
} |
Can you make molecule C[C@H]1CCc2sc(C(=O)OC[C@H]3CC(=O)N(C4CC4)C3)cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCc2sc(C(=O)OC[C@H]3CC(=O)N(C4SCSCS4)C3)cc2C1 | C[C@H]1CCc2sc(C(=O)OC[C@H]3CC(=O)N(C4CC4)C3)cc2C1 | C[C@H]1CCc2sc(C(=O)OC[C@H]3CC(=O)N(C4SCSCS4)C3)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C19CC1"
} |
Can you make molecule C[C@H]1CCc2sc(C(=O)OC[C@H]3CC(=O)N(C4CC4)C3)cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCc2sc(C(=O)OC[C@H]3CC(=O)N(C4CCCCCC4)C3)cc2C1 | C[C@H]1CCc2sc(C(=O)OC[C@H]3CC(=O)N(C4CC4)C3)cc2C1 | C[C@H]1CCc2sc(C(=O)OC[C@H]3CC(=O)N(C4CCCCCC4)C3)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C19CC1"
} |
Can you make molecule Cn1cc(CCC[NH+]2CCC(c3ccc(F)cc3)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | C=Cn1cc(CCC[NH+]2CCC(c3ccc(F)cc3)CC2)cn1 | Cn1cc(CCC[NH+]2CCC(c3ccc(F)cc3)CC2)cn1 | C=Cn1cc(CCC[NH+]2CCC(c3ccc(F)cc3)CC2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C=Cn1cc&cn1",
"old_substring": "Cn1cc5cn1"
} |
Can you make molecule Cn1cc(CCC[NH+]2CCC(c3ccc(F)cc3)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc2cc(CCC[NH+]3CCC(c4ccc(F)cc4)CC3)ccc2n1 | Cn1cc(CCC[NH+]2CCC(c3ccc(F)cc3)CC2)cn1 | Cn1cc2cc(CCC[NH+]3CCC(c4ccc(F)cc4)CC3)ccc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "Cn1cc2cc&ccc2n1",
"old_substring": "Cn1cc5cn1"
} |
Can you make molecule Cn1cc(CCC[NH+]2CCC(c3ccc(F)cc3)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncc(CCC[NH+]2CCC(c3ccc(F)cc3)CC2)c1Cl | Cn1cc(CCC[NH+]2CCC(c3ccc(F)cc3)CC2)cn1 | Cn1ncc(CCC[NH+]2CCC(c3ccc(F)cc3)CC2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cn1ncc&c1Cl",
"old_substring": "Cn1cc5cn1"
} |
Can you make molecule Cn1cc(CCC[NH+]2CCC(c3ccc(F)cc3)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(Cl)cnc1CCC[NH+]1CCC(c2ccc(F)cc2)CC1 | Cn1cc(CCC[NH+]2CCC(c3ccc(F)cc3)CC2)cn1 | Cn1c(Cl)cnc1CCC[NH+]1CCC(c2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cn1c(Cl)cnc1&",
"old_substring": "Cn1cc5cn1"
} |
Can you make molecule Cn1cc(CCC[NH+]2CCC(c3ccc(F)cc3)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(CCC[NH+]2CCC(c3ccc(F)cc3)CC2)ccc1=O | Cn1cc(CCC[NH+]2CCC(c3ccc(F)cc3)CC2)cn1 | Cn1cc(CCC[NH+]2CCC(c3ccc(F)cc3)CC2)ccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cn1cc&ccc1=O",
"old_substring": "Cn1cc5cn1"
} |
Can you make molecule COC(=O)[C@H](C)NC(=O)c1nc(-c2ccccc2)n2c1CCCCC2 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H](C)NSC(=O)Cc1nc(-c2ccccc2)n2c1CCCCC2 | COC(=O)[C@H](C)NC(=O)c1nc(-c2ccccc2)n2c1CCCCC2 | COC(=O)[C@H](C)NSC(=O)Cc1nc(-c2ccccc2)n2c1CCCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule COC(=O)[C@H](C)NC(=O)c1nc(-c2ccccc2)n2c1CCCCC2 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H](C)NC(=O)CCCC(=O)c1nc(-c2ccccc2)n2c1CCCCC2 | COC(=O)[C@H](C)NC(=O)c1nc(-c2ccccc2)n2c1CCCCC2 | COC(=O)[C@H](C)NC(=O)CCCC(=O)c1nc(-c2ccccc2)n2c1CCCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule COC(=O)[C@H](C)NC(=O)c1nc(-c2ccccc2)n2c1CCCCC2 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H](C)NC(=O)CC(C)(C)c1nc(-c2ccccc2)n2c1CCCCC2 | COC(=O)[C@H](C)NC(=O)c1nc(-c2ccccc2)n2c1CCCCC2 | COC(=O)[C@H](C)NC(=O)CC(C)(C)c1nc(-c2ccccc2)n2c1CCCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule COC(=O)[C@H](C)NC(=O)c1nc(-c2ccccc2)n2c1CCCCC2 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H](C)NC(=O)CCC(C)(C)c1nc(-c2ccccc2)n2c1CCCCC2 | COC(=O)[C@H](C)NC(=O)c1nc(-c2ccccc2)n2c1CCCCC2 | COC(=O)[C@H](C)NC(=O)CCC(C)(C)c1nc(-c2ccccc2)n2c1CCCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule COC(=O)[C@H](C)NC(=O)c1nc(-c2ccccc2)n2c1CCCCC2 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H](C)NSC(=O)[C@@H](C)c1nc(-c2ccccc2)n2c1CCCCC2 | COC(=O)[C@H](C)NC(=O)c1nc(-c2ccccc2)n2c1CCCCC2 | COC(=O)[C@H](C)NSC(=O)[C@@H](C)c1nc(-c2ccccc2)n2c1CCCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule CC(=O)N[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O less soluble in water? The output molecule should be similar to the input molecule. | CCC(CO)=N[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O | CC(=O)N[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O | CCC(CO)=N[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&CO",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)N[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)N[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O | CC(=O)N[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O | CCCC(=O)N[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)N[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SN[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O | CC(=O)N[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O | CC(=O)SN[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)N[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)N[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O | CC(=O)N[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O | CCCCC(=O)N[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)N[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O less soluble in water? The output molecule should be similar to the input molecule. | CCC(C=O)=N[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O | CC(=O)N[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O | CCC(C=O)=N[C@H]1C(=O)N=C(SCC(=O)Nc2cccc3ccccc23)NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&C=O",
"old_substring": "CC4=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.