prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(C)c1ccccc1NC(=O)C(=O)NCCc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccccc1NC(=O)C(=O)NCCc1cc2cc(F)ccc2s1 | CC(C)c1ccccc1NC(=O)C(=O)NCCc1cccc(F)c1 | CC(C)c1ccccc1NC(=O)C(=O)NCCc1cc2cc(F)ccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc(F)ccc2s1",
"old_substring": "c17cccc(F)c1"
} |
Can you make molecule CC(C)c1ccccc1NC(=O)C(=O)NCCc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccccc1NC(=O)C(=O)NCC=Cc1cccc(F)c1F | CC(C)c1ccccc1NC(=O)C(=O)NCCc1cccc(F)c1 | CC(C)c1ccccc1NC(=O)C(=O)NCC=Cc1cccc(F)c1F | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1cccc(F)c1F",
"old_substring": "c17cccc(F)c1"
} |
Can you make molecule CC(C)c1ccccc1NC(=O)C(=O)NCCc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Br)cccc1CCNC(=O)C(=O)Nc1ccccc1C(C)C | CC(C)c1ccccc1NC(=O)C(=O)NCCc1cccc(F)c1 | Cc1c(Br)cccc1CCNC(=O)C(=O)Nc1ccccc1C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Br)c1C",
"old_substring": "c17cccc(F)c1"
} |
Can you make molecule CC(C)c1ccccc1NC(=O)C(=O)NCCc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(CCNC(=O)C(=O)Nc2ccccc2C(C)C)oc2ccc(F)cc12 | CC(C)c1ccccc1NC(=O)C(=O)NCCc1cccc(F)c1 | Cc1c(CCNC(=O)C(=O)Nc2ccccc2C(C)C)oc2ccc(F)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&oc2ccc(F)cc2c1C",
"old_substring": "c17cccc(F)c1"
} |
Can you make molecule CC(C)c1ccccc1NC(=O)C(=O)NCCc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccccc1NC(=O)C(=O)NCCc1cc(F)ccc1Br | CC(C)c1ccccc1NC(=O)C(=O)NCCc1cccc(F)c1 | CC(C)c1ccccc1NC(=O)C(=O)NCCc1cc(F)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c17cccc(F)c1"
} |
Can you make molecule CC[C@H](C)n1nccc1NC(=O)Cn1cnc2c(cnn2C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)n1nccc1NSC(=O)Cn1cnc2c(cnn2C)c1=O | CC[C@H](C)n1nccc1NC(=O)Cn1cnc2c(cnn2C)c1=O | CC[C@H](C)n1nccc1NSC(=O)Cn1cnc2c(cnn2C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C6"
} |
Can you make molecule CC[C@H](C)n1nccc1NC(=O)Cn1cnc2c(cnn2C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)n1nccc1NC(=O)CCCC(=O)n1cnc2c(cnn2C)c1=O | CC[C@H](C)n1nccc1NC(=O)Cn1cnc2c(cnn2C)c1=O | CC[C@H](C)n1nccc1NC(=O)CCCC(=O)n1cnc2c(cnn2C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C6"
} |
Can you make molecule CC[C@H](C)n1nccc1NC(=O)Cn1cnc2c(cnn2C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)n1nccc1NC(=O)CC(C)(C)n1cnc2c(cnn2C)c1=O | CC[C@H](C)n1nccc1NC(=O)Cn1cnc2c(cnn2C)c1=O | CC[C@H](C)n1nccc1NC(=O)CC(C)(C)n1cnc2c(cnn2C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C6"
} |
Can you make molecule CC[C@H](C)n1nccc1NC(=O)Cn1cnc2c(cnn2C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)n1nccc1NC[S@+]([O-])CCCn1cnc2c(cnn2C)c1=O | CC[C@H](C)n1nccc1NC(=O)Cn1cnc2c(cnn2C)c1=O | CC[C@H](C)n1nccc1NC[S@+]([O-])CCCn1cnc2c(cnn2C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C6"
} |
Can you make molecule CC[C@H](C)n1nccc1NC(=O)Cn1cnc2c(cnn2C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)n1nccc1NC(=O)CCC(C)(C)n1cnc2c(cnn2C)c1=O | CC[C@H](C)n1nccc1NC(=O)Cn1cnc2c(cnn2C)c1=O | CC[C@H](C)n1nccc1NC(=O)CCC(C)(C)n1cnc2c(cnn2C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C6"
} |
Can you make molecule CCc1ccc(N([C@H](C)C(=O)NCc2cccnc2)S(C)(=O)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(N([C@H](C)C(=O)NCc2cccnc2)S(=O)(=O)C(C)C)cc1 | CCc1ccc(N([C@H](C)C(=O)NCc2cccnc2)S(C)(=O)=O)cc1 | CCc1ccc(N([C@H](C)C(=O)NCc2cccnc2)S(=O)(=O)C(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)S&(=O)=O",
"old_substring": "S6(C)(=O)=O"
} |
Can you make molecule CCc1ccc(N([C@H](C)C(=O)NCc2cccnc2)S(C)(=O)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(N([C@H](C)C(=O)NCc2cccnc2)S(=O)(=O)CC(C)C)cc1 | CCc1ccc(N([C@H](C)C(=O)NCc2cccnc2)S(C)(=O)=O)cc1 | CCc1ccc(N([C@H](C)C(=O)NCc2cccnc2)S(=O)(=O)CC(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CS&(=O)=O",
"old_substring": "S6(C)(=O)=O"
} |
Can you make molecule CCc1ccc(N([C@H](C)C(=O)NCc2cccnc2)S(C)(=O)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(N(CCCCS(C)(=O)=O)[C@H](C)C(=O)NCc2cccnc2)cc1 | CCc1ccc(N([C@H](C)C(=O)NCc2cccnc2)S(C)(=O)=O)cc1 | CCc1ccc(N(CCCCS(C)(=O)=O)[C@H](C)C(=O)NCc2cccnc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS(C)(=O)=O",
"old_substring": "S6(C)(=O)=O"
} |
Can you make molecule CCc1ccc(N([C@H](C)C(=O)NCc2cccnc2)S(C)(=O)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(N(C(=O)N=S(C)(C)=O)[C@H](C)C(=O)NCc2cccnc2)cc1 | CCc1ccc(N([C@H](C)C(=O)NCc2cccnc2)S(C)(=O)=O)cc1 | CCc1ccc(N(C(=O)N=S(C)(C)=O)[C@H](C)C(=O)NCc2cccnc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CS(C)(=O)=NC&=O",
"old_substring": "S6(C)(=O)=O"
} |
Can you make molecule CCc1ccc(N([C@H](C)C(=O)NCc2cccnc2)S(C)(=O)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(N(CS(=O)(=O)C(C)C)[C@H](C)C(=O)NCc2cccnc2)cc1 | CCc1ccc(N([C@H](C)C(=O)NCc2cccnc2)S(C)(=O)=O)cc1 | CCc1ccc(N(CS(=O)(=O)C(C)C)[C@H](C)C(=O)NCc2cccnc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)S(=O)(=O)C&",
"old_substring": "S6(C)(=O)=O"
} |
Can you make molecule CC[NH2+][C@]1(CO)CC[C@H]([NH+](CC)CC(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH2+][C@]1(CO)CC[C@H]([NH+](CC)C(C)(C)CCBr)C1 | CC[NH2+][C@]1(CO)CC[C@H]([NH+](CC)CC(C)C)C1 | CC[NH2+][C@]1(CO)CC[C@H]([NH+](CC)C(C)(C)CCBr)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC&(C)CCBr",
"old_substring": "C5C(C)C"
} |
Can you make molecule CC[NH2+][C@]1(CO)CC[C@H]([NH+](CC)CC(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)[NH+](CC)[C@H]1CC[C@@](CO)([NH2+]CC)C1 | CC[NH2+][C@]1(CO)CC[C@H]([NH+](CC)CC(C)C)C1 | CCCC(C)(C)[NH+](CC)[C@H]1CC[C@@](CO)([NH2+]CC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "C5C(C)C"
} |
Can you make molecule CC[NH2+][C@]1(CO)CC[C@H]([NH+](CC)CC(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH2+][C@]1(CO)CC[C@H]([NH+](CC)CC(C)(C)CBr)C1 | CC[NH2+][C@]1(CO)CC[C@H]([NH+](CC)CC(C)C)C1 | CC[NH2+][C@]1(CO)CC[C@H]([NH+](CC)CC(C)(C)CBr)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)(C)CBr",
"old_substring": "C5C(C)C"
} |
Can you make molecule CC[NH2+][C@]1(CO)CC[C@H]([NH+](CC)CC(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH2+][C@]1(CO)CC[C@H]([NH+](CC)C(C(C)C)C(C)C)C1 | CC[NH2+][C@]1(CO)CC[C@H]([NH+](CC)CC(C)C)C1 | CC[NH2+][C@]1(CO)CC[C@H]([NH+](CC)C(C(C)C)C(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&C(C)C",
"old_substring": "C5C(C)C"
} |
Can you make molecule CC[NH2+][C@]1(CO)CC[C@H]([NH+](CC)CC(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH2+][C@]1(CO)CC[C@H]([NH+](CC)C(=O)CCCC(C)C)C1 | CC[NH2+][C@]1(CO)CC[C@H]([NH+](CC)CC(C)C)C1 | CC[NH2+][C@]1(CO)CC[C@H]([NH+](CC)C(=O)CCCC(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCCC&=O",
"old_substring": "C5C(C)C"
} |
Can you make molecule COc1ccc([C@H](C)[NH2+]Cc2ccccn2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc([C@H](C)[NH2+]Cc2ccccn2)cc1F | COc1ccc([C@H](C)[NH2+]Cc2ccccn2)cc1F | COCc1ccc([C@H](C)[NH2+]Cc2ccccn2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc([C@H](C)[NH2+]Cc2ccccn2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc([C@H](C)[NH2+]Cc2ccccn2)cc1F | COc1ccc([C@H](C)[NH2+]Cc2ccccn2)cc1F | COCSc1ccc([C@H](C)[NH2+]Cc2ccccn2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc([C@H](C)[NH2+]Cc2ccccn2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc([C@H](C)[NH2+]Cc2ccccn2)cc1F | COc1ccc([C@H](C)[NH2+]Cc2ccccn2)cc1F | CC(=O)Sc1ccc([C@H](C)[NH2+]Cc2ccccn2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc([C@H](C)[NH2+]Cc2ccccn2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH2+]Cc1ccccn1)c1ccc(C(=O)CS)c(F)c1 | COc1ccc([C@H](C)[NH2+]Cc2ccccn2)cc1F | C[C@H]([NH2+]Cc1ccccn1)c1ccc(C(=O)CS)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc([C@H](C)[NH2+]Cc2ccccn2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH2+]Cc1ccccn1)c1ccc(C(=O)CI)c(F)c1 | COc1ccc([C@H](C)[NH2+]Cc2ccccn2)cc1F | C[C@H]([NH2+]Cc1ccccn1)c1ccc(C(=O)CI)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(OC)c([C@H]2CC[NH+](c3c([O-])c(=[OH+])c3=O)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(OC)c([C@H]2CC[NH+](c3c([O-])c(=[OH+])c3=O)C2)c1 | COc1ccc(OC)c([C@H]2CC[NH+](c3c([O-])c(=[OH+])c3=O)C2)c1 | COCc1ccc(OC)c([C@H]2CC[NH+](c3c([O-])c(=[OH+])c3=O)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(OC)c([C@H]2CC[NH+](c3c([O-])c(=[OH+])c3=O)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(OC)c([C@H]2CC[NH+](c3c([O-])c(=[OH+])c3=O)C2)c1 | COc1ccc(OC)c([C@H]2CC[NH+](c3c([O-])c(=[OH+])c3=O)C2)c1 | COCSc1ccc(OC)c([C@H]2CC[NH+](c3c([O-])c(=[OH+])c3=O)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(OC)c([C@H]2CC[NH+](c3c([O-])c(=[OH+])c3=O)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(SC(C)=O)cc1[C@H]1CC[NH+](c2c([O-])c(=[OH+])c2=O)C1 | COc1ccc(OC)c([C@H]2CC[NH+](c3c([O-])c(=[OH+])c3=O)C2)c1 | COc1ccc(SC(C)=O)cc1[C@H]1CC[NH+](c2c([O-])c(=[OH+])c2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(OC)c([C@H]2CC[NH+](c3c([O-])c(=[OH+])c3=O)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)CS)cc1[C@H]1CC[NH+](c2c([O-])c(=[OH+])c2=O)C1 | COc1ccc(OC)c([C@H]2CC[NH+](c3c([O-])c(=[OH+])c3=O)C2)c1 | COc1ccc(C(=O)CS)cc1[C@H]1CC[NH+](c2c([O-])c(=[OH+])c2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(OC)c([C@H]2CC[NH+](c3c([O-])c(=[OH+])c3=O)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)CI)cc1[C@H]1CC[NH+](c2c([O-])c(=[OH+])c2=O)C1 | COc1ccc(OC)c([C@H]2CC[NH+](c3c([O-])c(=[OH+])c3=O)C2)c1 | COc1ccc(C(=O)CI)cc1[C@H]1CC[NH+](c2c([O-])c(=[OH+])c2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule CC(C)c1[nH+]ccn1CCCNC(=O)c1ccc(N2CCCC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1[nH+]ccc2ccn(CCCNC(=O)c3ccc(N4CCCC4)nc3)c12 | CC(C)c1[nH+]ccn1CCCNC(=O)c1ccc(N2CCCC2)nc1 | CC(C)c1[nH+]ccc2ccn(CCCNC(=O)c3ccc(N4CCCC4)nc3)c12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]ccc2ccn&c12",
"old_substring": "c18[nH+]ccn17"
} |
Can you make molecule CC(C)c1[nH+]ccn1CCCNC(=O)c1ccc(N2CCCC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1[nH+]cc(CCCNC(=O)c2ccc(N3CCCC3)nc2)cc1Cl | CC(C)c1[nH+]ccn1CCCNC(=O)c1ccc(N2CCCC2)nc1 | CC(C)c1[nH+]cc(CCCNC(=O)c2ccc(N3CCCC3)nc2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cc&cc1Cl",
"old_substring": "c18[nH+]ccn17"
} |
Can you make molecule CC(C)c1[nH+]ccn1CCCNC(=O)c1ccc(N2CCCC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1[nH]nc(CCCNC(=O)c2ccc(N3CCCC3)nc2)c1Cl | CC(C)c1[nH+]ccn1CCCNC(=O)c1ccc(N2CCCC2)nc1 | CC(C)c1[nH]nc(CCCNC(=O)c2ccc(N3CCCC3)nc2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH]nc&c1Cl",
"old_substring": "c18[nH+]ccn17"
} |
Can you make molecule CC(C)c1[nH+]ccn1CCCNC(=O)c1ccc(N2CCCC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(CCCNC(=O)c2ccc(N3CCCC3)nc2)c(C)c(C(C)C)[nH+]1 | CC(C)c1[nH+]ccn1CCCNC(=O)c1ccc(N2CCCC2)nc1 | Cc1nc(CCCNC(=O)c2ccc(N3CCCC3)nc2)c(C)c(C(C)C)[nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]c(C)nc&c1C",
"old_substring": "c18[nH+]ccn17"
} |
Can you make molecule CC(C)c1[nH+]ccn1CCCNC(=O)c1ccc(N2CCCC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH+]c(C(C)C)nc(CCCNC(=O)c2ccc(N3CCCC3)nc2)c1C | CC(C)c1[nH+]ccn1CCCNC(=O)c1ccc(N2CCCC2)nc1 | Cc1[nH+]c(C(C)C)nc(CCCNC(=O)c2ccc(N3CCCC3)nc2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1[nH+]c&nc&c1C",
"old_substring": "c18[nH+]ccn17"
} |
Can you make molecule CCC(CC)(Nc1ccc(OC)cc1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)[O-])N(C)C(=S)Sc1ccc(OC)cc1 | CCC(CC)(Nc1ccc(OC)cc1)C(=O)[O-] | CCC(CC)(C(=O)[O-])N(C)C(=S)Sc1ccc(OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N34"
} |
Can you make molecule CCC(CC)(Nc1ccc(OC)cc1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)[O-])N1CCN=C1Sc1ccc(OC)cc1 | CCC(CC)(Nc1ccc(OC)cc1)C(=O)[O-] | CCC(CC)(C(=O)[O-])N1CCN=C1Sc1ccc(OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N34"
} |
Can you make molecule CCC(CC)(Nc1ccc(OC)cc1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(CN1CCC(c2ccc(OC)cc2)CC1)C(=O)[O-] | CCC(CC)(Nc1ccc(OC)cc1)C(=O)[O-] | CCC(CC)(CN1CCC(c2ccc(OC)cc2)CC1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N34"
} |
Can you make molecule CCC(CC)(Nc1ccc(OC)cc1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)[O-])c1cccc(-c2ccc(OC)cc2)c1N | CCC(CC)(Nc1ccc(OC)cc1)C(=O)[O-] | CCC(CC)(C(=O)[O-])c1cccc(-c2ccc(OC)cc2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&cccc1&",
"old_substring": "N34"
} |
Can you make molecule CCC(CC)(Nc1ccc(OC)cc1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)[O-])c1cc(N)cc(-c2ccc(OC)cc2)c1 | CCC(CC)(Nc1ccc(OC)cc1)C(=O)[O-] | CCC(CC)(C(=O)[O-])c1cc(N)cc(-c2ccc(OC)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1cc&cc&c1",
"old_substring": "N34"
} |
Can you make molecule COC(=O)c1cc(NC(=O)[C@H]2CC[NH2+][C@H]2C)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(NSC(=O)C[C@H]2CC[NH2+][C@H]2C)ccc1F | COC(=O)c1cc(NC(=O)[C@H]2CC[NH2+][C@H]2C)ccc1F | COC(=O)c1cc(NSC(=O)C[C@H]2CC[NH2+][C@H]2C)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule COC(=O)c1cc(NC(=O)[C@H]2CC[NH2+][C@H]2C)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(NCC(=C=O)C[C@H]2CC[NH2+][C@H]2C)ccc1F | COC(=O)c1cc(NC(=O)[C@H]2CC[NH2+][C@H]2C)ccc1F | COC(=O)c1cc(NCC(=C=O)C[C@H]2CC[NH2+][C@H]2C)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule COC(=O)c1cc(NC(=O)[C@H]2CC[NH2+][C@H]2C)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(NC(=O)CCCC(=O)[C@H]2CC[NH2+][C@H]2C)ccc1F | COC(=O)c1cc(NC(=O)[C@H]2CC[NH2+][C@H]2C)ccc1F | COC(=O)c1cc(NC(=O)CCCC(=O)[C@H]2CC[NH2+][C@H]2C)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule COC(=O)c1cc(NC(=O)[C@H]2CC[NH2+][C@H]2C)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(NC(=O)CC(C)(C)[C@H]2CC[NH2+][C@H]2C)ccc1F | COC(=O)c1cc(NC(=O)[C@H]2CC[NH2+][C@H]2C)ccc1F | COC(=O)c1cc(NC(=O)CC(C)(C)[C@H]2CC[NH2+][C@H]2C)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule COC(=O)c1cc(NC(=O)[C@H]2CC[NH2+][C@H]2C)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(NC[S@+]([O-])CCC[C@H]2CC[NH2+][C@H]2C)ccc1F | COC(=O)c1cc(NC(=O)[C@H]2CC[NH2+][C@H]2C)ccc1F | COC(=O)c1cc(NC[S@+]([O-])CCC[C@H]2CC[NH2+][C@H]2C)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C46=O"
} |
Can you make molecule COc1ccc(C(=O)N(C[C@H]2CCC(=O)N2)C(C)C)o1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N(C[C@H]2CSC(=O)C2)C(C)C)o1 | COc1ccc(C(=O)N(C[C@H]2CCC(=O)N2)C(C)C)o1 | COc1ccc(C(=O)N(C[C@H]2CSC(=O)C2)C(C)C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CSC(=O)C1",
"old_substring": "[C@H]18CCC(=O)N1"
} |
Can you make molecule COc1ccc(C(=O)N(C[C@H]2CCC(=O)N2)C(C)C)o1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N(C[C@H]2N=C(C)CS2)C(C)C)o1 | COc1ccc(C(=O)N(C[C@H]2CCC(=O)N2)C(C)C)o1 | COc1ccc(C(=O)N(C[C@H]2N=C(C)CS2)C(C)C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&N=C(C)CS1",
"old_substring": "[C@H]18CCC(=O)N1"
} |
Can you make molecule COc1ccc(C(=O)N(C[C@H]2CCC(=O)N2)C(C)C)o1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N(C[C@H]2OC2(C)C)C(C)C)o1 | COc1ccc(C(=O)N(C[C@H]2CCC(=O)N2)C(C)C)o1 | COc1ccc(C(=O)N(C[C@H]2OC2(C)C)C(C)C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&OC1(C)C",
"old_substring": "[C@H]18CCC(=O)N1"
} |
Can you make molecule COc1ccc(C(=O)N(C[C@H]2CCC(=O)N2)C(C)C)o1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N(C[C@H]2C=CC(=N)S2)C(C)C)o1 | COc1ccc(C(=O)N(C[C@H]2CCC(=O)N2)C(C)C)o1 | COc1ccc(C(=O)N(C[C@H]2C=CC(=N)S2)C(C)C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=CC(=N)S1",
"old_substring": "[C@H]18CCC(=O)N1"
} |
Can you make molecule COc1ccc(C(=O)N(C[C@H]2CCC(=O)N2)C(C)C)o1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N(C[C@H]2CSCCO2)C(C)C)o1 | COc1ccc(C(=O)N(C[C@H]2CCC(=O)N2)C(C)C)o1 | COc1ccc(C(=O)N(C[C@H]2CSCCO2)C(C)C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CSCCO1",
"old_substring": "[C@H]18CCC(=O)N1"
} |
Can you make molecule C[NH2+][C@@H](Cc1csc(C)n1)C(OC)OC less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@@H](Cc1csc(C)n1)C(OC)[C@@H](C)[PH2]=O | C[NH2+][C@@H](Cc1csc(C)n1)C(OC)OC | C[NH2+][C@@H](Cc1csc(C)n1)C(OC)[C@@H](C)[PH2]=O | 102 | {
"fragment_index": 0,
"new_substring": "O=[PH2][C@@H]2C&",
"old_substring": "O2C"
} |
Can you make molecule C[NH2+][C@@H](Cc1csc(C)n1)C(OC)OC less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@@H](Cc1csc(C)n1)C(OC)SCOC | C[NH2+][C@@H](Cc1csc(C)n1)C(OC)OC | C[NH2+][C@@H](Cc1csc(C)n1)C(OC)SCOC | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "O2C"
} |
Can you make molecule C[NH2+][C@@H](Cc1csc(C)n1)C(OC)OC less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@@H](Cc1csc(C)n1)C(OC)OCCl | C[NH2+][C@@H](Cc1csc(C)n1)C(OC)OC | C[NH2+][C@@H](Cc1csc(C)n1)C(OC)OCCl | 102 | {
"fragment_index": 0,
"new_substring": "O&CCl",
"old_substring": "O2C"
} |
Can you make molecule C[NH2+][C@@H](Cc1csc(C)n1)C(OC)OC less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@@H](Cc1csc(C)n1)C(OC)=C(Br)C=O | C[NH2+][C@@H](Cc1csc(C)n1)C(OC)OC | C[NH2+][C@@H](Cc1csc(C)n1)C(OC)=C(Br)C=O | 102 | {
"fragment_index": 0,
"new_substring": "O=CC=&Br",
"old_substring": "O2C"
} |
Can you make molecule C[NH2+][C@@H](Cc1csc(C)n1)C(OC)OC less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@@H](Cc1csc(C)n1)C(OC)C(=O)CCCl | C[NH2+][C@@H](Cc1csc(C)n1)C(OC)OC | C[NH2+][C@@H](Cc1csc(C)n1)C(OC)C(=O)CCCl | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCCl",
"old_substring": "O2C"
} |
Can you make molecule CCn1nc(C)cc1C(=O)N1C[C@@H](C)CC[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(C)cc1CC(=O)SN1C[C@@H](C)CC[C@H]1C | CCn1nc(C)cc1C(=O)N1C[C@@H](C)CC[C@H]1C | CCn1nc(C)cc1CC(=O)SN1C[C@@H](C)CC[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C23=O"
} |
Can you make molecule CCn1nc(C)cc1C(=O)N1C[C@@H](C)CC[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(C)cc1C(=O)CCCC(=O)N1C[C@@H](C)CC[C@H]1C | CCn1nc(C)cc1C(=O)N1C[C@@H](C)CC[C@H]1C | CCn1nc(C)cc1C(=O)CCCC(=O)N1C[C@@H](C)CC[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C23=O"
} |
Can you make molecule CCn1nc(C)cc1C(=O)N1C[C@@H](C)CC[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(C)cc1C(C)(C)CC(=O)N1C[C@@H](C)CC[C@H]1C | CCn1nc(C)cc1C(=O)N1C[C@@H](C)CC[C@H]1C | CCn1nc(C)cc1C(C)(C)CC(=O)N1C[C@@H](C)CC[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CCn1nc(C)cc1C(=O)N1C[C@@H](C)CC[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(C)cc1C(C)(C)CCC(=O)N1C[C@@H](C)CC[C@H]1C | CCn1nc(C)cc1C(=O)N1C[C@@H](C)CC[C@H]1C | CCn1nc(C)cc1C(C)(C)CCC(=O)N1C[C@@H](C)CC[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CCn1nc(C)cc1C(=O)N1C[C@@H](C)CC[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(C)cc1[C@H](C)C(=O)SN1C[C@@H](C)CC[C@H]1C | CCn1nc(C)cc1C(=O)N1C[C@@H](C)CC[C@H]1C | CCn1nc(C)cc1[C@H](C)C(=O)SN1C[C@@H](C)CC[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C23=O"
} |
Can you make molecule CCN[C@@H]1c2cc(OC)ccc2C[C@H]1[NH+](C)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)[C@@H](N=C(C)C)[C@H]([NH+](C)C(C)C)C2 | CCN[C@@H]1c2cc(OC)ccc2C[C@H]1[NH+](C)C(C)C | COc1ccc2c(c1)[C@@H](N=C(C)C)[C@H]([NH+](C)C(C)C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&C",
"old_substring": "CC4"
} |
Can you make molecule CCN[C@@H]1c2cc(OC)ccc2C[C@H]1[NH+](C)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | C=CSN[C@@H]1c2cc(OC)ccc2C[C@H]1[NH+](C)C(C)C | CCN[C@@H]1c2cc(OC)ccc2C[C@H]1[NH+](C)C(C)C | C=CSN[C@@H]1c2cc(OC)ccc2C[C@H]1[NH+](C)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCN[C@@H]1c2cc(OC)ccc2C[C@H]1[NH+](C)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)[C@@H](N=C(C)I)[C@H]([NH+](C)C(C)C)C2 | CCN[C@@H]1c2cc(OC)ccc2C[C@H]1[NH+](C)C(C)C | COc1ccc2c(c1)[C@@H](N=C(C)I)[C@H]([NH+](C)C(C)C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&I",
"old_substring": "CC4"
} |
Can you make molecule CCN[C@@H]1c2cc(OC)ccc2C[C@H]1[NH+](C)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | C=CCCN[C@@H]1c2cc(OC)ccc2C[C@H]1[NH+](C)C(C)C | CCN[C@@H]1c2cc(OC)ccc2C[C@H]1[NH+](C)C(C)C | C=CCCN[C@@H]1c2cc(OC)ccc2C[C@H]1[NH+](C)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCN[C@@H]1c2cc(OC)ccc2C[C@H]1[NH+](C)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)[C@@H](N=CCCl)[C@H]([NH+](C)C(C)C)C2 | CCN[C@@H]1c2cc(OC)ccc2C[C@H]1[NH+](C)C(C)C | COc1ccc2c(c1)[C@@H](N=CCCl)[C@H]([NH+](C)C(C)C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CCl",
"old_substring": "CC4"
} |
Can you make molecule C[C@@H]1C[C@H](C)C[NH+](C[C@@H](O)CO[C@@H]2CCC[C@H]2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@H](C)C[NH+](C[C@@H](O)C(C)(C)O[C@@H]2CCC[C@H]2C)C1 | C[C@@H]1C[C@H](C)C[NH+](C[C@@H](O)CO[C@@H]2CCC[C@H]2C)C1 | C[C@@H]1C[C@H](C)C[NH+](C[C@@H](O)C(C)(C)O[C@@H]2CCC[C@H]2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](O)C&(C)C",
"old_substring": "C5[C@@H](O)C3"
} |
Can you make molecule C[C@@H]1C[C@H](C)C[NH+](C[C@@H](O)CO[C@@H]2CCC[C@H]2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@H](C)C[NH+](C[C@@H](C)C(=O)O[C@@H]2CCC[C@H]2C)C1 | C[C@@H]1C[C@H](C)C[NH+](C[C@@H](O)CO[C@@H]2CCC[C@H]2C)C1 | C[C@@H]1C[C@H](C)C[NH+](C[C@@H](C)C(=O)O[C@@H]2CCC[C@H]2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](C)C&=O",
"old_substring": "C5[C@@H](O)C3"
} |
Can you make molecule C[C@@H]1C[C@H](C)C[NH+](C[C@@H](O)CO[C@@H]2CCC[C@H]2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@H](C)C[NH+](C[C@H](S)CO[C@@H]2CCC[C@H]2C)C1 | C[C@@H]1C[C@H](C)C[NH+](C[C@@H](O)CO[C@@H]2CCC[C@H]2C)C1 | C[C@@H]1C[C@H](C)C[NH+](C[C@H](S)CO[C@@H]2CCC[C@H]2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@H](S)C&",
"old_substring": "C5[C@@H](O)C3"
} |
Can you make molecule C[C@@H]1C[C@H](C)C[NH+](C[C@@H](O)CO[C@@H]2CCC[C@H]2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@H](C)C[NH+](CC[C@H](C)CC(=O)O[C@@H]2CCC[C@H]2C)C1 | C[C@@H]1C[C@H](C)C[NH+](C[C@@H](O)CO[C@@H]2CCC[C@H]2C)C1 | C[C@@H]1C[C@H](C)C[NH+](CC[C@H](C)CC(=O)O[C@@H]2CCC[C@H]2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C5[C@@H](O)C3"
} |
Can you make molecule C[C@@H]1C[C@H](C)C[NH+](C[C@@H](O)CO[C@@H]2CCC[C@H]2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@H](C)C[NH+](C(=O)C[C@H](C)C(=O)O[C@@H]2CCC[C@H]2C)C1 | C[C@@H]1C[C@H](C)C[NH+](C[C@@H](O)CO[C@@H]2CCC[C@H]2C)C1 | C[C@@H]1C[C@H](C)C[NH+](C(=O)C[C@H](C)C(=O)O[C@@H]2CCC[C@H]2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&=O)C&=O",
"old_substring": "C5[C@@H](O)C3"
} |
Can you make molecule COc1ccc(F)cc1C(=O)Nc1cc(F)ccc1OCC(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1C(=O)Nc1cc(Br)c(OCC(F)(F)F)cc1C | COc1ccc(F)cc1C(=O)Nc1cc(F)ccc1OCC(F)(F)F | COc1ccc(F)cc1C(=O)Nc1cc(Br)c(OCC(F)(F)F)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c&cc1C",
"old_substring": "c16cc(F)ccc15"
} |
Can you make molecule COc1ccc(F)cc1C(=O)Nc1cc(F)ccc1OCC(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1C(=O)Nc1c(F)cc(OCC(F)(F)F)cc1Cl | COc1ccc(F)cc1C(=O)Nc1cc(F)ccc1OCC(F)(F)F | COc1ccc(F)cc1C(=O)Nc1c(F)cc(OCC(F)(F)F)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(F)cc&cc1Cl",
"old_substring": "c16cc(F)ccc15"
} |
Can you make molecule COc1ccc(F)cc1C(=O)Nc1cc(F)ccc1OCC(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1C(=O)Nc1cc(OCC(F)(F)F)c(F)cc1Cl | COc1ccc(F)cc1C(=O)Nc1cc(F)ccc1OCC(F)(F)F | COc1ccc(F)cc1C(=O)Nc1cc(OCC(F)(F)F)c(F)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c(F)cc1Cl",
"old_substring": "c16cc(F)ccc15"
} |
Can you make molecule COc1ccc(F)cc1C(=O)Nc1cc(F)ccc1OCC(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1C(=O)Nc1cc(Cl)c(OCC(F)(F)F)cc1Cl | COc1ccc(F)cc1C(=O)Nc1cc(F)ccc1OCC(F)(F)F | COc1ccc(F)cc1C(=O)Nc1cc(Cl)c(OCC(F)(F)F)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)c&cc1Cl",
"old_substring": "c16cc(F)ccc15"
} |
Can you make molecule COc1ccc(F)cc1C(=O)Nc1cc(F)ccc1OCC(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1C(=O)Nc1cc(Br)c(OCC(F)(F)F)cc1Br | COc1ccc(F)cc1C(=O)Nc1cc(F)ccc1OCC(F)(F)F | COc1ccc(F)cc1C(=O)Nc1cc(Br)c(OCC(F)(F)F)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c&cc1Br",
"old_substring": "c16cc(F)ccc15"
} |
Can you make molecule CC(=O)N1CCc2nc3ccncc3cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)N1CCc2nc3ccncc3cc2C1 | CC(=O)N1CCc2nc3ccncc3cc2C1 | CCCC(=O)N1CCc2nc3ccncc3cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)N1CCc2nc3ccncc3cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SN1CCc2nc3ccncc3cc2C1 | CC(=O)N1CCc2nc3ccncc3cc2C1 | CC(=O)SN1CCc2nc3ccncc3cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)N1CCc2nc3ccncc3cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)N1CCc2nc3ccncc3cc2C1 | CC(=O)N1CCc2nc3ccncc3cc2C1 | CCCCC(=O)N1CCc2nc3ccncc3cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)N1CCc2nc3ccncc3cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CCCN1CCc2nc3ccncc3cc2C1 | CC(=O)N1CCc2nc3ccncc3cc2C1 | CC(=O)CCCN1CCc2nc3ccncc3cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)CCC&",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)N1CCc2nc3ccncc3cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)CCCN1CCc2nc3ccncc3cc2C1 | CC(=O)N1CCc2nc3ccncc3cc2C1 | CCC(=O)CCCN1CCc2nc3ccncc3cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC(=O)CCC&",
"old_substring": "CC4=O"
} |
Can you make molecule CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C[NH+]2CCCCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)CN2CCCCCC2)c1 | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C[NH+]2CCCCCC2)c1 | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)CN2CCCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCC1",
"old_substring": "[NH+]16CCCCCC1"
} |
Can you make molecule CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C[NH+]2CCCCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)CC[NH+]2CCCCCCC2)c1 | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C[NH+]2CCCCCC2)c1 | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)CC[NH+]2CCCCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCCCCCC1",
"old_substring": "[NH+]16CCCCCC1"
} |
Can you make molecule CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C[NH+]2CCCCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)CC[N+]2=CCCC2)c1 | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C[NH+]2CCCCCC2)c1 | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)CC[N+]2=CCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[N+]1=CCCC1",
"old_substring": "[NH+]16CCCCCC1"
} |
Can you make molecule CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C[NH+]2CCCCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)CN2CCCCCCC2)c1 | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C[NH+]2CCCCCC2)c1 | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)CN2CCCCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1",
"old_substring": "[NH+]16CCCCCC1"
} |
Can you make molecule CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C[NH+]2CCCCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)CN2CCCCC2)c1 | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C[NH+]2CCCCCC2)c1 | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)CN2CCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "[NH+]16CCCCCC1"
} |
Can you make molecule CCC[C@@](O)(c1ccccc1)[C@H](C)C#N less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@](O)(c1ccccc1Cl)[C@H](C)C#N | CCC[C@@](O)(c1ccccc1)[C@H](C)C#N | CCC[C@@](O)(c1ccccc1Cl)[C@H](C)C#N | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c12ccccc1"
} |
Can you make molecule CCC[C@@](O)(c1ccccc1)[C@H](C)C#N less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@](O)(c1cc2sccc2s1)[C@H](C)C#N | CCC[C@@](O)(c1ccccc1)[C@H](C)C#N | CCC[C@@](O)(c1cc2sccc2s1)[C@H](C)C#N | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sccc2s1",
"old_substring": "c12ccccc1"
} |
Can you make molecule CCC[C@@](O)(c1ccccc1)[C@H](C)C#N less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@](O)(c1ccc(I)cc1)[C@H](C)C#N | CCC[C@@](O)(c1ccccc1)[C@H](C)C#N | CCC[C@@](O)(c1ccc(I)cc1)[C@H](C)C#N | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c12ccccc1"
} |
Can you make molecule CCC[C@@](O)(c1ccccc1)[C@H](C)C#N less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@](O)(c1csc2ccccc12)[C@H](C)C#N | CCC[C@@](O)(c1ccccc1)[C@H](C)C#N | CCC[C@@](O)(c1csc2ccccc12)[C@H](C)C#N | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc2ccccc12",
"old_substring": "c12ccccc1"
} |
Can you make molecule CCC[C@@](O)(c1ccccc1)[C@H](C)C#N less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@](O)(c1ccc(C)c(I)c1)[C@H](C)C#N | CCC[C@@](O)(c1ccccc1)[C@H](C)C#N | CCC[C@@](O)(c1ccc(C)c(I)c1)[C@H](C)C#N | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c12ccccc1"
} |
Can you make molecule CC(C)N(CC(C)(C)O)C(=O)N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(CC(C)(C)O)C(=O)N[C@@H]1CC[C@@H](c2ccc(Cl)c(F)c2)C1 | CC(C)N(CC(C)(C)O)C(=O)N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1 | CC(C)N(CC(C)(C)O)C(=O)N[C@@H]1CC[C@@H](c2ccc(Cl)c(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]16CCO[C@@H]17"
} |
Can you make molecule CC(C)N(CC(C)(C)O)C(=O)N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(CC(C)(C)O)C(=O)N[C@H]1C=C[C@@H](c2ccc(Cl)c(F)c2)C1 | CC(C)N(CC(C)(C)O)C(=O)N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1 | CC(C)N(CC(C)(C)O)C(=O)N[C@H]1C=C[C@@H](c2ccc(Cl)c(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@@H]&C1",
"old_substring": "[C@@H]16CCO[C@@H]17"
} |
Can you make molecule CC(C)N(CC(C)(C)O)C(=O)N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(CC(C)(C)O)C(=O)N[C@H]1C=C[C@H](c2ccc(Cl)c(F)c2)C1 | CC(C)N(CC(C)(C)O)C(=O)N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1 | CC(C)N(CC(C)(C)O)C(=O)N[C@H]1C=C[C@H](c2ccc(Cl)c(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@H]&C1",
"old_substring": "[C@@H]16CCO[C@@H]17"
} |
Can you make molecule CC(C)N(CC(C)(C)O)C(=O)N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(CC(C)(C)O)C(=O)N[C@H]1CCC[C@H](c2ccc(Cl)c(F)c2)C1 | CC(C)N(CC(C)(C)O)C(=O)N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1 | CC(C)N(CC(C)(C)O)C(=O)N[C@H]1CCC[C@H](c2ccc(Cl)c(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@@H]16CCO[C@@H]17"
} |
Can you make molecule CC(C)N(CC(C)(C)O)C(=O)N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(CC(C)(C)O)C(=O)N[C@H]1CCCC[C@H](c2ccc(Cl)c(F)c2)C1 | CC(C)N(CC(C)(C)O)C(=O)N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1 | CC(C)N(CC(C)(C)O)C(=O)N[C@H]1CCCC[C@H](c2ccc(Cl)c(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@H]&C1",
"old_substring": "[C@@H]16CCO[C@@H]17"
} |
Can you make molecule CCc1cccc(C)c1NC(=O)CN1C(=O)C(C)=C(c2ccc(F)cc2)S1(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1cccc(C)c1NC(=O)CN1C(=O)C(C)=C(c2ccc(F)cc2)S1(=O)=O | CCc1cccc(C)c1NC(=O)CN1C(=O)C(C)=C(c2ccc(F)cc2)S1(=O)=O | C=CSc1cccc(C)c1NC(=O)CN1C(=O)C(C)=C(c2ccc(F)cc2)S1(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC6"
} |
Can you make molecule CCc1cccc(C)c1NC(=O)CN1C(=O)C(C)=C(c2ccc(F)cc2)S1(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(c2ccc(F)cc2)S(=O)(=O)N(CC(=O)Nc2c(C)cccc2C(C)C)C1=O | CCc1cccc(C)c1NC(=O)CN1C(=O)C(C)=C(c2ccc(F)cc2)S1(=O)=O | CC1=C(c2ccc(F)cc2)S(=O)(=O)N(CC(=O)Nc2c(C)cccc2C(C)C)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC6"
} |
Can you make molecule CCc1cccc(C)c1NC(=O)CN1C(=O)C(C)=C(c2ccc(F)cc2)S1(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1cccc(C)c1NC(=O)CN1C(=O)C(C)=C(c2ccc(F)cc2)S1(=O)=O | CCc1cccc(C)c1NC(=O)CN1C(=O)C(C)=C(c2ccc(F)cc2)S1(=O)=O | C=CCCc1cccc(C)c1NC(=O)CN1C(=O)C(C)=C(c2ccc(F)cc2)S1(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC6"
} |
Can you make molecule CCc1cccc(C)c1NC(=O)CN1C(=O)C(C)=C(c2ccc(F)cc2)S1(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(c2ccc(F)cc2)S(=O)(=O)N(CC(=O)Nc2c(C)cccc2CCCCl)C1=O | CCc1cccc(C)c1NC(=O)CN1C(=O)C(C)=C(c2ccc(F)cc2)S1(=O)=O | CC1=C(c2ccc(F)cc2)S(=O)(=O)N(CC(=O)Nc2c(C)cccc2CCCCl)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC6"
} |
Can you make molecule CCc1cccc(C)c1NC(=O)CN1C(=O)C(C)=C(c2ccc(F)cc2)S1(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(c2ccc(F)cc2)S(=O)(=O)N(CC(=O)Nc2c(C)cccc2CCCCS)C1=O | CCc1cccc(C)c1NC(=O)CN1C(=O)C(C)=C(c2ccc(F)cc2)S1(=O)=O | CC1=C(c2ccc(F)cc2)S(=O)(=O)N(CC(=O)Nc2c(C)cccc2CCCCS)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC6"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.