prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(=O)Nc1ccc2scc(C)c2c1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCC(CO)=Nc1ccc2scc(C)c2c1[N+](=O)[O-] | CC(=O)Nc1ccc2scc(C)c2c1[N+](=O)[O-] | CCC(CO)=Nc1ccc2scc(C)c2c1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&CO",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Nc1ccc2scc(C)c2c1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)Nc1ccc2scc(C)c2c1[N+](=O)[O-] | CC(=O)Nc1ccc2scc(C)c2c1[N+](=O)[O-] | CCCC(=O)Nc1ccc2scc(C)c2c1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Nc1ccc2scc(C)c2c1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SNc1ccc2scc(C)c2c1[N+](=O)[O-] | CC(=O)Nc1ccc2scc(C)c2c1[N+](=O)[O-] | CC(=O)SNc1ccc2scc(C)c2c1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Nc1ccc2scc(C)c2c1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Nc1ccc2scc(C)c2c1[N+](=O)[O-] | CC(=O)Nc1ccc2scc(C)c2c1[N+](=O)[O-] | CCCCC(=O)Nc1ccc2scc(C)c2c1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Nc1ccc2scc(C)c2c1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCC(C=O)=Nc1ccc2scc(C)c2c1[N+](=O)[O-] | CC(=O)Nc1ccc2scc(C)c2c1[N+](=O)[O-] | CCC(C=O)=Nc1ccc2scc(C)c2c1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&C=O",
"old_substring": "CC3=O"
} |
Can you make molecule CC(C)c1ccc([C@H]2C[C@H]2C(=O)N[C@@H](C)C(=O)NC(C)(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc([C@H]2C[C@H]2C(=O)N[C@@H](C)C(=O)NC(Cl)(Cl)Cl)cc1 | CC(C)c1ccc([C@H]2C[C@H]2C(=O)N[C@@H](C)C(=O)NC(C)(C)C)cc1 | CC(C)c1ccc([C@H]2C[C@H]2C(=O)N[C@@H](C)C(=O)NC(Cl)(Cl)Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule CC(C)c1ccc([C@H]2C[C@H]2C(=O)N[C@@H](C)C(=O)NC(C)(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc([C@H]2C[C@H]2C(=O)N[C@@H](C)C(=O)NC(C)(C)CC(C)(C)C)cc1 | CC(C)c1ccc([C@H]2C[C@H]2C(=O)N[C@@H](C)C(=O)NC(C)(C)C)cc1 | CC(C)c1ccc([C@H]2C[C@H]2C(=O)N[C@@H](C)C(=O)NC(C)(C)CC(C)(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)(C)CC(C)(C)C",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule CC(C)c1ccc([C@H]2C[C@H]2C(=O)N[C@@H](C)C(=O)NC(C)(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc([C@H]2C[C@H]2C(=O)N[C@@H](C)C(=O)NCCCC(C)(C)C)cc1 | CC(C)c1ccc([C@H]2C[C@H]2C(=O)N[C@@H](C)C(=O)NC(C)(C)C)cc1 | CC(C)c1ccc([C@H]2C[C@H]2C(=O)N[C@@H](C)C(=O)NCCCC(C)(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(C)(C)C",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule CC(C)c1ccc([C@H]2C[C@H]2C(=O)N[C@@H](C)C(=O)NC(C)(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc([C@H]2C[C@H]2C(=O)N[C@@H](C)C(=O)NCCCC(F)(F)F)cc1 | CC(C)c1ccc([C@H]2C[C@H]2C(=O)N[C@@H](C)C(=O)NC(C)(C)C)cc1 | CC(C)c1ccc([C@H]2C[C@H]2C(=O)N[C@@H](C)C(=O)NCCCC(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule CC(C)c1ccc([C@H]2C[C@H]2C(=O)N[C@@H](C)C(=O)NC(C)(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)C(C)=NC(=O)[C@H](C)NC(=O)[C@@H]1C[C@@H]1c1ccc(C(C)C)cc1 | CC(C)c1ccc([C@H]2C[C@H]2C(=O)N[C@@H](C)C(=O)NC(C)(C)C)cc1 | CCC(CC)C(C)=NC(=O)[C@H](C)NC(=O)[C@@H]1C[C@@H]1c1ccc(C(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)C(CC)CC",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule CCOC(=O)c1c(N/C=C2/C(=O)N(c3ccccc3)N=C2C)sc2c1CC[C@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | CCOSC(=O)Cc1c(N/C=C2/C(=O)N(c3ccccc3)N=C2C)sc2c1CC[C@H](C)C2 | CCOC(=O)c1c(N/C=C2/C(=O)N(c3ccccc3)N=C2C)sc2c1CC[C@H](C)C2 | CCOSC(=O)Cc1c(N/C=C2/C(=O)N(c3ccccc3)N=C2C)sc2c1CC[C@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule CCOC(=O)c1c(N/C=C2/C(=O)N(c3ccccc3)N=C2C)sc2c1CC[C@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCCC(=O)c1c(N/C=C2/C(=O)N(c3ccccc3)N=C2C)sc2c1CC[C@H](C)C2 | CCOC(=O)c1c(N/C=C2/C(=O)N(c3ccccc3)N=C2C)sc2c1CC[C@H](C)C2 | CCOC(=O)CCCC(=O)c1c(N/C=C2/C(=O)N(c3ccccc3)N=C2C)sc2c1CC[C@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule CCOC(=O)c1c(N/C=C2/C(=O)N(c3ccccc3)N=C2C)sc2c1CC[C@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CC(C)(C)c1c(N/C=C2/C(=O)N(c3ccccc3)N=C2C)sc2c1CC[C@H](C)C2 | CCOC(=O)c1c(N/C=C2/C(=O)N(c3ccccc3)N=C2C)sc2c1CC[C@H](C)C2 | CCOC(=O)CC(C)(C)c1c(N/C=C2/C(=O)N(c3ccccc3)N=C2C)sc2c1CC[C@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule CCOC(=O)c1c(N/C=C2/C(=O)N(c3ccccc3)N=C2C)sc2c1CC[C@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCC(C)(C)c1c(N/C=C2/C(=O)N(c3ccccc3)N=C2C)sc2c1CC[C@H](C)C2 | CCOC(=O)c1c(N/C=C2/C(=O)N(c3ccccc3)N=C2C)sc2c1CC[C@H](C)C2 | CCOC(=O)CCC(C)(C)c1c(N/C=C2/C(=O)N(c3ccccc3)N=C2C)sc2c1CC[C@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule CCOC(=O)c1c(N/C=C2/C(=O)N(c3ccccc3)N=C2C)sc2c1CC[C@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | CCOSC(=O)[C@@H](C)c1c(N/C=C2/C(=O)N(c3ccccc3)N=C2C)sc2c1CC[C@H](C)C2 | CCOC(=O)c1c(N/C=C2/C(=O)N(c3ccccc3)N=C2C)sc2c1CC[C@H](C)C2 | CCOSC(=O)[C@@H](C)c1c(N/C=C2/C(=O)N(c3ccccc3)N=C2C)sc2c1CC[C@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C47=O"
} |
Can you make molecule C=CCn1c(=O)c2c(nc3n2CC(C)=NN3Cc2cccc3ccccc23)n(C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCn1c(=O)c2c(nc3n2CC(C)=NN3Cc2ccc(Cl)c3ccccc23)n(C)c1=O | C=CCn1c(=O)c2c(nc3n2CC(C)=NN3Cc2cccc3ccccc23)n(C)c1=O | C=CCn1c(=O)c2c(nc3n2CC(C)=NN3Cc2ccc(Cl)c3ccccc23)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c2ccccc12",
"old_substring": "c15cccc2ccccc12"
} |
Can you make molecule C=CCn1c(=O)c2c(nc3n2CC(C)=NN3Cc2cccc3ccccc23)n(C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCn1c(=O)c2c(nc3n2CC(C)=NN3C=C(C)c2cccc3ccccc23)n(C)c1=O | C=CCn1c(=O)c2c(nc3n2CC(C)=NN3Cc2cccc3ccccc23)n(C)c1=O | C=CCn1c(=O)c2c(nc3n2CC(C)=NN3C=C(C)c2cccc3ccccc23)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC=&c1cccc2ccccc12",
"old_substring": "c15cccc2ccccc12"
} |
Can you make molecule C=CCn1c(=O)c2c(nc3n2CC(C)=NN3Cc2cccc3ccccc23)n(C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCn1c(=O)c2c(nc3n2CC(C)=NN3Cc2ccc3ccccc3c2Br)n(C)c1=O | C=CCn1c(=O)c2c(nc3n2CC(C)=NN3Cc2cccc3ccccc23)n(C)c1=O | C=CCn1c(=O)c2c(nc3n2CC(C)=NN3Cc2ccc3ccccc3c2Br)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2ccccc2c1Br",
"old_substring": "c15cccc2ccccc12"
} |
Can you make molecule C=CCn1c(=O)c2c(nc3n2CC(C)=NN3Cc2cccc3ccccc23)n(C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCn1c(=O)c2c(nc3n2CC(C)=NN3Cc2cc3sc4ccccc4c3s2)n(C)c1=O | C=CCn1c(=O)c2c(nc3n2CC(C)=NN3Cc2cccc3ccccc23)n(C)c1=O | C=CCn1c(=O)c2c(nc3n2CC(C)=NN3Cc2cc3sc4ccccc4c3s2)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sc3ccccc3c2s1",
"old_substring": "c15cccc2ccccc12"
} |
Can you make molecule C=CCn1c(=O)c2c(nc3n2CC(C)=NN3Cc2cccc3ccccc23)n(C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCn1c(=O)c2c(nc3n2CC(C)=NN3Cc2ccc3cc(Br)ccc3c2)n(C)c1=O | C=CCn1c(=O)c2c(nc3n2CC(C)=NN3Cc2cccc3ccccc23)n(C)c1=O | C=CCn1c(=O)c2c(nc3n2CC(C)=NN3Cc2ccc3cc(Br)ccc3c2)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "Brc1ccc2cc&ccc2c1",
"old_substring": "c15cccc2ccccc12"
} |
Can you make molecule Cc1ncsc1C(=O)Nc1ccccc1[C@H](C)NC(=O)c1scnc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncsc1CC(=O)SNc1ccccc1[C@H](C)NC(=O)c1scnc1C | Cc1ncsc1C(=O)Nc1ccccc1[C@H](C)NC(=O)c1scnc1C | Cc1ncsc1CC(=O)SNc1ccccc1[C@H](C)NC(=O)c1scnc1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C26=O"
} |
Can you make molecule Cc1ncsc1C(=O)Nc1ccccc1[C@H](C)NC(=O)c1scnc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncsc1C(=O)CCCC(=O)Nc1ccccc1[C@H](C)NC(=O)c1scnc1C | Cc1ncsc1C(=O)Nc1ccccc1[C@H](C)NC(=O)c1scnc1C | Cc1ncsc1C(=O)CCCC(=O)Nc1ccccc1[C@H](C)NC(=O)c1scnc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C26=O"
} |
Can you make molecule Cc1ncsc1C(=O)Nc1ccccc1[C@H](C)NC(=O)c1scnc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncsc1C(=O)N[C@@H](C)c1ccccc1NC(=O)CC(C)(C)c1scnc1C | Cc1ncsc1C(=O)Nc1ccccc1[C@H](C)NC(=O)c1scnc1C | Cc1ncsc1C(=O)N[C@@H](C)c1ccccc1NC(=O)CC(C)(C)c1scnc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C26=O"
} |
Can you make molecule Cc1ncsc1C(=O)Nc1ccccc1[C@H](C)NC(=O)c1scnc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncsc1C(=O)N[C@@H](C)c1ccccc1NC(=O)CCC(C)(C)c1scnc1C | Cc1ncsc1C(=O)Nc1ccccc1[C@H](C)NC(=O)c1scnc1C | Cc1ncsc1C(=O)N[C@@H](C)c1ccccc1NC(=O)CCC(C)(C)c1scnc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C26=O"
} |
Can you make molecule Cc1ncsc1C(=O)Nc1ccccc1[C@H](C)NC(=O)c1scnc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncsc1C(=O)N[C@@H](C)c1ccccc1NSC(=O)[C@@H](C)c1scnc1C | Cc1ncsc1C(=O)Nc1ccccc1[C@H](C)NC(=O)c1scnc1C | Cc1ncsc1C(=O)N[C@@H](C)c1ccccc1NSC(=O)[C@@H](C)c1scnc1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C26=O"
} |
Can you make molecule C[C@@H]1[C@@H](C(=O)[O-])CCN1C(=O)NC[C@@H]1COCCO1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[C@@H](C(=O)[O-])CCN1C(=O)CC(C)(C)NC[C@@H]1COCCO1 | C[C@@H]1[C@@H](C(=O)[O-])CCN1C(=O)NC[C@@H]1COCCO1 | C[C@@H]1[C@@H](C(=O)[O-])CCN1C(=O)CC(C)(C)NC[C@@H]1COCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule C[C@@H]1[C@@H](C(=O)[O-])CCN1C(=O)NC[C@@H]1COCCO1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[C@@H](C(=O)[O-])CCN1C(=O)CCC(C)(C)NC[C@@H]1COCCO1 | C[C@@H]1[C@@H](C(=O)[O-])CCN1C(=O)NC[C@@H]1COCCO1 | C[C@@H]1[C@@H](C(=O)[O-])CCN1C(=O)CCC(C)(C)NC[C@@H]1COCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule C[C@@H]1[C@@H](C(=O)[O-])CCN1C(=O)NC[C@@H]1COCCO1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[C@@H](C(=O)[O-])CCN1C(=O)C[C@@H](Br)NC[C@@H]1COCCO1 | C[C@@H]1[C@@H](C(=O)[O-])CCN1C(=O)NC[C@@H]1COCCO1 | C[C@@H]1[C@@H](C(=O)[O-])CCN1C(=O)C[C@@H](Br)NC[C@@H]1COCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule C[C@@H]1[C@@H](C(=O)[O-])CCN1C(=O)NC[C@@H]1COCCO1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2CC[C@H](C(=O)[O-])[C@H]2C)cc(=O)n1NC[C@@H]1COCCO1 | C[C@@H]1[C@@H](C(=O)[O-])CCN1C(=O)NC[C@@H]1COCCO1 | Cc1cc(N2CC[C@H](C(=O)[O-])[C@H]2C)cc(=O)n1NC[C@@H]1COCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C23=O"
} |
Can you make molecule C[C@@H]1[C@@H](C(=O)[O-])CCN1C(=O)NC[C@@H]1COCCO1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(N2CC[C@H](C(=O)[O-])[C@H]2C)c(=O)ccn1NC[C@@H]1COCCO1 | C[C@@H]1[C@@H](C(=O)[O-])CCN1C(=O)NC[C@@H]1COCCO1 | Cc1c(N2CC[C@H](C(=O)[O-])[C@H]2C)c(=O)ccn1NC[C@@H]1COCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C23=O"
} |
Can you make molecule COCCc1cc(NC[C@@H]2CCC[C@H](C)C2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | COCSCCc1cc(NC[C@@H]2CCC[C@H](C)C2)n(C)n1 | COCCc1cc(NC[C@@H]2CCC[C@H](C)C2)n(C)n1 | COCSCCc1cc(NC[C@@H]2CCC[C@H](C)C2)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COCCc1cc(NC[C@@H]2CCC[C@H](C)C2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SCCc1cc(NC[C@@H]2CCC[C@H](C)C2)n(C)n1 | COCCc1cc(NC[C@@H]2CCC[C@H](C)C2)n(C)n1 | CC(=O)SCCc1cc(NC[C@@H]2CCC[C@H](C)C2)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COCCc1cc(NC[C@@H]2CCC[C@H](C)C2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@@H](CNc2cc(CCC(=O)CI)nn2C)C1 | COCCc1cc(NC[C@@H]2CCC[C@H](C)C2)n(C)n1 | C[C@H]1CCC[C@@H](CNc2cc(CCC(=O)CI)nn2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule COCCc1cc(NC[C@@H]2CCC[C@H](C)C2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@@H](CNc2cc(CCC3OCCCO3)nn2C)C1 | COCCc1cc(NC[C@@H]2CCC[C@H](C)C2)n(C)n1 | C[C@H]1CCC[C@@H](CNc2cc(CCC3OCCCO3)nn2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCCCO1",
"old_substring": "CO3"
} |
Can you make molecule COCCc1cc(NC[C@@H]2CCC[C@H](C)C2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@@H](CNc2cc(CCC(=O)CCl)nn2C)C1 | COCCc1cc(NC[C@@H]2CCC[C@H](C)C2)n(C)n1 | C[C@H]1CCC[C@@H](CNc2cc(CCC(=O)CCl)nn2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCl",
"old_substring": "CO3"
} |
Can you make molecule O=c1c(-c2ccccc2F)coc2c(C[NH+]3CCCOC3)c(O)ccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=c1c(-c2ccccc2F)coc2c(C[NH+]3CCCCC3)c(O)ccc12 | O=c1c(-c2ccccc2F)coc2c(C[NH+]3CCCOC3)c(O)ccc12 | O=c1c(-c2ccccc2F)coc2c(C[NH+]3CCCCC3)c(O)ccc12 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCCC1",
"old_substring": "[NH+]14CCCOC1"
} |
Can you make molecule O=c1c(-c2ccccc2F)coc2c(C[NH+]3CCCOC3)c(O)ccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=c1c(-c2ccccc2F)coc2c(C[NH+]3CCCSCC3)c(O)ccc12 | O=c1c(-c2ccccc2F)coc2c(C[NH+]3CCCOC3)c(O)ccc12 | O=c1c(-c2ccccc2F)coc2c(C[NH+]3CCCSCC3)c(O)ccc12 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCSCC1",
"old_substring": "[NH+]14CCCOC1"
} |
Can you make molecule O=c1c(-c2ccccc2F)coc2c(C[NH+]3CCCOC3)c(O)ccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=c1c(-c2ccccc2F)coc2c(C[NH+]3CCCCCC3)c(O)ccc12 | O=c1c(-c2ccccc2F)coc2c(C[NH+]3CCCOC3)c(O)ccc12 | O=c1c(-c2ccccc2F)coc2c(C[NH+]3CCCCCC3)c(O)ccc12 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCCCC1",
"old_substring": "[NH+]14CCCOC1"
} |
Can you make molecule O=c1c(-c2ccccc2F)coc2c(C[NH+]3CCCOC3)c(O)ccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=c1c(-c2ccccc2F)coc2c(C[NH+]3CC=CCC3)c(O)ccc12 | O=c1c(-c2ccccc2F)coc2c(C[NH+]3CCCOC3)c(O)ccc12 | O=c1c(-c2ccccc2F)coc2c(C[NH+]3CC=CCC3)c(O)ccc12 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC=CCC1",
"old_substring": "[NH+]14CCCOC1"
} |
Can you make molecule O=c1c(-c2ccccc2F)coc2c(C[NH+]3CCCOC3)c(O)ccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=c1c(-c2ccccc2F)coc2c(C[NH+]3CCCCCCC3)c(O)ccc12 | O=c1c(-c2ccccc2F)coc2c(C[NH+]3CCCOC3)c(O)ccc12 | O=c1c(-c2ccccc2F)coc2c(C[NH+]3CCCCCCC3)c(O)ccc12 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCCCCC1",
"old_substring": "[NH+]14CCCOC1"
} |
Can you make molecule FC(F)(F)c1ccc(CNC2CC[NH+](Cc3cccnc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)c1ccc(CNC2CCN(Cc3cccnc3)CC2)cc1 | FC(F)(F)c1ccc(CNC2CC[NH+](Cc3cccnc3)CC2)cc1 | FC(F)(F)c1ccc(CNC2CCN(Cc3cccnc3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "C16CC[NH+]5CC1"
} |
Can you make molecule FC(F)(F)c1ccc(CNC2CC[NH+](Cc3cccnc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)c1ccc(CNC2CCC(Cc3cccnc3)CC2)cc1 | FC(F)(F)c1ccc(CNC2CC[NH+](Cc3cccnc3)CC2)cc1 | FC(F)(F)c1ccc(CNC2CCC(Cc3cccnc3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C16CC[NH+]5CC1"
} |
Can you make molecule FC(F)(F)c1ccc(CNC2CC[NH+](Cc3cccnc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)c1ccc(CNC2CC(Cc3cccnc3)C2)cc1 | FC(F)(F)c1ccc(CNC2CC[NH+](Cc3cccnc3)CC2)cc1 | FC(F)(F)c1ccc(CNC2CC(Cc3cccnc3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C16CC[NH+]5CC1"
} |
Can you make molecule FC(F)(F)c1ccc(CNC2CC[NH+](Cc3cccnc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN(NCc2ccc(C(F)(F)F)cc2)CCN1Cc1cccnc1 | FC(F)(F)c1ccc(CNC2CC[NH+](Cc3cccnc3)CC2)cc1 | C[C@@H]1CN(NCc2ccc(C(F)(F)F)cc2)CCN1Cc1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&[C@H](C)C1",
"old_substring": "C16CC[NH+]5CC1"
} |
Can you make molecule FC(F)(F)c1ccc(CNC2CC[NH+](Cc3cccnc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)c1ccc(CNCC2=CN=N[C@H]2Cc2cccnc2)cc1 | FC(F)(F)c1ccc(CNC2CC[NH+](Cc3cccnc3)CC2)cc1 | FC(F)(F)c1ccc(CNCC2=CN=N[C@H]2Cc2cccnc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(C&)[C@H]&N=N1",
"old_substring": "C16CC[NH+]5CC1"
} |
Can you make molecule CC[NH2+][C@@H](C)c1ccnc(Oc2ccccc2C(N)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH2+][C@@H](C)c1ccnc(Oc2ccc(C(N)=O)cc2I)c1 | CC[NH2+][C@@H](C)c1ccnc(Oc2ccccc2C(N)=O)c1 | CC[NH2+][C@@H](C)c1ccnc(Oc2ccc(C(N)=O)cc2I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c14ccccc17"
} |
Can you make molecule CC[NH2+][C@@H](C)c1ccnc(Oc2ccccc2C(N)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH2+][C@@H](C)c1ccnc(Oc2cc(C(N)=O)ccc2Br)c1 | CC[NH2+][C@@H](C)c1ccnc(Oc2ccccc2C(N)=O)c1 | CC[NH2+][C@@H](C)c1ccnc(Oc2cc(C(N)=O)ccc2Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c14ccccc17"
} |
Can you make molecule CC[NH2+][C@@H](C)c1ccnc(Oc2ccccc2C(N)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH2+][C@@H](C)c1ccnc(Oc2ccc(C(N)=O)cc2Cl)c1 | CC[NH2+][C@@H](C)c1ccnc(Oc2ccccc2C(N)=O)c1 | CC[NH2+][C@@H](C)c1ccnc(Oc2ccc(C(N)=O)cc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c14ccccc17"
} |
Can you make molecule CC[NH2+][C@@H](C)c1ccnc(Oc2ccccc2C(N)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH2+][C@@H](C)c1ccnc(Oc2cccc(C(N)=O)c2Br)c1 | CC[NH2+][C@@H](C)c1ccnc(Oc2ccccc2C(N)=O)c1 | CC[NH2+][C@@H](C)c1ccnc(Oc2cccc(C(N)=O)c2Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c14ccccc17"
} |
Can you make molecule CC[NH2+][C@@H](C)c1ccnc(Oc2ccccc2C(N)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH2+][C@@H](C)c1ccnc(Oc2cccc(C(N)=O)c2Cl)c1 | CC[NH2+][C@@H](C)c1ccnc(Oc2ccccc2C(N)=O)c1 | CC[NH2+][C@@H](C)c1ccnc(Oc2cccc(C(N)=O)c2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c14ccccc17"
} |
Can you make molecule Cc1ccccc1S(=O)(=O)Nc1cccc(CCc2nc3ccccc3n2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1S(=O)(=O)Nc1cccc(CCCCc2nc3ccccc3n2C)c1 | Cc1ccccc1S(=O)(=O)Nc1cccc(CCc2nc3ccccc3n2C)c1 | Cc1ccccc1S(=O)(=O)Nc1cccc(CCCCc2nc3ccccc3n2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C7C6"
} |
Can you make molecule Cc1ccccc1S(=O)(=O)Nc1cccc(CCc2nc3ccccc3n2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1S(=O)(=O)Nc1cccc(CCCCCc2nc3ccccc3n2C)c1 | Cc1ccccc1S(=O)(=O)Nc1cccc(CCc2nc3ccccc3n2C)c1 | Cc1ccccc1S(=O)(=O)Nc1cccc(CCCCCc2nc3ccccc3n2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C7C6"
} |
Can you make molecule Cc1ccccc1S(=O)(=O)Nc1cccc(CCc2nc3ccccc3n2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1S(=O)(=O)Nc1cccc(C2CC(c3nc4ccccc4n3C)C2)c1 | Cc1ccccc1S(=O)(=O)Nc1cccc(CCc2nc3ccccc3n2C)c1 | Cc1ccccc1S(=O)(=O)Nc1cccc(C2CC(c3nc4ccccc4n3C)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C7C6"
} |
Can you make molecule Cc1ccccc1S(=O)(=O)Nc1cccc(CCc2nc3ccccc3n2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1S(=O)(=O)Nc1cccc([C@@H](C)CCc2nc3ccccc3n2C)c1 | Cc1ccccc1S(=O)(=O)Nc1cccc(CCc2nc3ccccc3n2C)c1 | Cc1ccccc1S(=O)(=O)Nc1cccc([C@@H](C)CCc2nc3ccccc3n2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C7C6"
} |
Can you make molecule Cc1ccccc1S(=O)(=O)Nc1cccc(CCc2nc3ccccc3n2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1S(=O)(=O)Nc1cccc(C2CCC(c3nc4ccccc4n3C)CC2)c1 | Cc1ccccc1S(=O)(=O)Nc1cccc(CCc2nc3ccccc3n2C)c1 | Cc1ccccc1S(=O)(=O)Nc1cccc(C2CCC(c3nc4ccccc4n3C)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C7C6"
} |
Can you make molecule O=C1C[C@@H](C(=O)N2CCOc3ccc(Cl)cc3C2)c2cc(F)ccc2N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@@H](C(=O)N2CCSc3ccc(Cl)cc32)c2cc(F)ccc2N1 | O=C1C[C@@H](C(=O)N2CCOc3ccc(Cl)cc3C2)c2cc(F)ccc2N1 | O=C1C[C@@H](C(=O)N2CCSc3ccc(Cl)cc32)c2cc(F)ccc2N1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc(Cl)cc21",
"old_substring": "N14CCOc2ccc(Cl)cc2C1"
} |
Can you make molecule O=C1C[C@@H](C(=O)N2CCOc3ccc(Cl)cc3C2)c2cc(F)ccc2N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@@H](C(=O)N2CCCc3cc(Cl)ccc32)c2cc(F)ccc2N1 | O=C1C[C@@H](C(=O)N2CCOc3ccc(Cl)cc3C2)c2cc(F)ccc2N1 | O=C1C[C@@H](C(=O)N2CCCc3cc(Cl)ccc32)c2cc(F)ccc2N1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2cc(Cl)ccc21",
"old_substring": "N14CCOc2ccc(Cl)cc2C1"
} |
Can you make molecule O=C1C[C@@H](C(=O)N2CCOc3ccc(Cl)cc3C2)c2cc(F)ccc2N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@@H](C(=O)N2CCCc3cccc(Cl)c32)c2cc(F)ccc2N1 | O=C1C[C@@H](C(=O)N2CCOc3ccc(Cl)cc3C2)c2cc(F)ccc2N1 | O=C1C[C@@H](C(=O)N2CCCc3cccc(Cl)c32)c2cc(F)ccc2N1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2cccc(Cl)c21",
"old_substring": "N14CCOc2ccc(Cl)cc2C1"
} |
Can you make molecule O=C1C[C@@H](C(=O)N2CCOc3ccc(Cl)cc3C2)c2cc(F)ccc2N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@@H](C(=O)N2CCCc3cc(Br)ccc32)c2cc(F)ccc2N1 | O=C1C[C@@H](C(=O)N2CCOc3ccc(Cl)cc3C2)c2cc(F)ccc2N1 | O=C1C[C@@H](C(=O)N2CCCc3cc(Br)ccc32)c2cc(F)ccc2N1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2cc(Br)ccc21",
"old_substring": "N14CCOc2ccc(Cl)cc2C1"
} |
Can you make molecule O=C1C[C@@H](C(=O)N2CCOc3ccc(Cl)cc3C2)c2cc(F)ccc2N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@@H](C(=O)N2CCc3c(Br)cccc3C2)c2cc(F)ccc2N1 | O=C1C[C@@H](C(=O)N2CCOc3ccc(Cl)cc3C2)c2cc(F)ccc2N1 | O=C1C[C@@H](C(=O)N2CCc3c(Br)cccc3C2)c2cc(F)ccc2N1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c(Br)cccc2C1",
"old_substring": "N14CCOc2ccc(Cl)cc2C1"
} |
Can you make molecule COc1ccc(CCNC(=O)c2nn([C@@H]3CCS(=O)(=O)C3)c3c2CCCC3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CCNC(=O)c2nn([C@@H]3CCS(=O)(=O)C3)c3c2CCCC3)cc1I | COc1ccc(CCNC(=O)c2nn([C@@H]3CCS(=O)(=O)C3)c3c2CCCC3)cc1 | COc1ccc(CCNC(=O)c2nn([C@@H]3CCS(=O)(=O)C3)c3c2CCCC3)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule COc1ccc(CCNC(=O)c2nn([C@@H]3CCS(=O)(=O)C3)c3c2CCCC3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(CCNC(=O)c2nn([C@@H]3CCS(=O)(=O)C3)c3c2CCCC3)ccc1Br | COc1ccc(CCNC(=O)c2nn([C@@H]3CCS(=O)(=O)C3)c3c2CCCC3)cc1 | COc1cc(CCNC(=O)c2nn([C@@H]3CCS(=O)(=O)C3)c3c2CCCC3)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule COc1ccc(CCNC(=O)c2nn([C@@H]3CCS(=O)(=O)C3)c3c2CCCC3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CCNC(=O)c2nn([C@@H]3CCS(=O)(=O)C3)c3c2CCCC3)cc1Cl | COc1ccc(CCNC(=O)c2nn([C@@H]3CCS(=O)(=O)C3)c3c2CCCC3)cc1 | COc1ccc(CCNC(=O)c2nn([C@@H]3CCS(=O)(=O)C3)c3c2CCCC3)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule COc1ccc(CCNC(=O)c2nn([C@@H]3CCS(=O)(=O)C3)c3c2CCCC3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CCNC(=O)c2nn([C@@H]3CCS(=O)(=O)C3)c3c2CCCC3)c1Br | COc1ccc(CCNC(=O)c2nn([C@@H]3CCS(=O)(=O)C3)c3c2CCCC3)cc1 | COc1cccc(CCNC(=O)c2nn([C@@H]3CCS(=O)(=O)C3)c3c2CCCC3)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule COc1ccc(CCNC(=O)c2nn([C@@H]3CCS(=O)(=O)C3)c3c2CCCC3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CCNC(=O)c2nn([C@@H]3CCS(=O)(=O)C3)c3c2CCCC3)c1Cl | COc1ccc(CCNC(=O)c2nn([C@@H]3CCS(=O)(=O)C3)c3c2CCCC3)cc1 | COc1cccc(CCNC(=O)c2nn([C@@H]3CCS(=O)(=O)C3)c3c2CCCC3)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule CCOc1ncccc1C(=O)Nc1ccc(C(=O)NC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ncccc1C(=O)Nc1ccc(CC(=O)SNC)cc1 | CCOc1ncccc1C(=O)Nc1ccc(C(=O)NC)cc1 | CCOc1ncccc1C(=O)Nc1ccc(CC(=O)SNC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C38=O"
} |
Can you make molecule CCOc1ncccc1C(=O)Nc1ccc(C(=O)NC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ncccc1C(=O)Nc1ccc(C(=O)CCCC(=O)NC)cc1 | CCOc1ncccc1C(=O)Nc1ccc(C(=O)NC)cc1 | CCOc1ncccc1C(=O)Nc1ccc(C(=O)CCCC(=O)NC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C38=O"
} |
Can you make molecule CCOc1ncccc1C(=O)Nc1ccc(C(=O)NC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ncccc1C(=O)Nc1ccc(C(C)(C)CC(=O)NC)cc1 | CCOc1ncccc1C(=O)Nc1ccc(C(=O)NC)cc1 | CCOc1ncccc1C(=O)Nc1ccc(C(C)(C)CC(=O)NC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C38=O"
} |
Can you make molecule CCOc1ncccc1C(=O)Nc1ccc(C(=O)NC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ncccc1C(=O)Nc1ccc(C(C)(C)CCC(=O)NC)cc1 | CCOc1ncccc1C(=O)Nc1ccc(C(=O)NC)cc1 | CCOc1ncccc1C(=O)Nc1ccc(C(C)(C)CCC(=O)NC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C38=O"
} |
Can you make molecule CCOc1ncccc1C(=O)Nc1ccc(C(=O)NC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ncccc1C(=O)Nc1ccc([C@H](C)C(=O)SNC)cc1 | CCOc1ncccc1C(=O)Nc1ccc(C(=O)NC)cc1 | CCOc1ncccc1C(=O)Nc1ccc([C@H](C)C(=O)SNC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C38=O"
} |
Can you make molecule Cn1nccc1C(=O)Nc1sccc1-c1nc2ccccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nccc1CC(=O)SNc1sccc1-c1nc2ccccc2s1 | Cn1nccc1C(=O)Nc1sccc1-c1nc2ccccc2s1 | Cn1nccc1CC(=O)SNc1sccc1-c1nc2ccccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cn1nccc1C(=O)Nc1sccc1-c1nc2ccccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nccc1C(=O)CCCC(=O)Nc1sccc1-c1nc2ccccc2s1 | Cn1nccc1C(=O)Nc1sccc1-c1nc2ccccc2s1 | Cn1nccc1C(=O)CCCC(=O)Nc1sccc1-c1nc2ccccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule Cn1nccc1C(=O)Nc1sccc1-c1nc2ccccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nccc1C(C)(C)CC(=O)Nc1sccc1-c1nc2ccccc2s1 | Cn1nccc1C(=O)Nc1sccc1-c1nc2ccccc2s1 | Cn1nccc1C(C)(C)CC(=O)Nc1sccc1-c1nc2ccccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cn1nccc1C(=O)Nc1sccc1-c1nc2ccccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nccc1C(C)(C)CCC(=O)Nc1sccc1-c1nc2ccccc2s1 | Cn1nccc1C(=O)Nc1sccc1-c1nc2ccccc2s1 | Cn1nccc1C(C)(C)CCC(=O)Nc1sccc1-c1nc2ccccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cn1nccc1C(=O)Nc1sccc1-c1nc2ccccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SNc1sccc1-c1nc2ccccc2s1)c1ccnn1C | Cn1nccc1C(=O)Nc1sccc1-c1nc2ccccc2s1 | C[C@H](C(=O)SNc1sccc1-c1nc2ccccc2s1)c1ccnn1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule C[C@H](OC(=O)C1CCN(C(=O)C(C)(C)C)CC1)C(=O)Nc1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=O)C1CCC(C(=O)C(C)(C)C)CC1)C(=O)Nc1ccc2c(c1)OCO2 | C[C@H](OC(=O)C1CCN(C(=O)C(C)(C)C)CC1)C(=O)Nc1ccc2c(c1)OCO2 | C[C@H](OC(=O)C1CCC(C(=O)C(C)(C)C)CC1)C(=O)Nc1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C18CCN4CC1"
} |
Can you make molecule C[C@H](OC(=O)C1CCN(C(=O)C(C)(C)C)CC1)C(=O)Nc1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=O)C1CCC(C)(C(=O)C(C)(C)C)CC1)C(=O)Nc1ccc2c(c1)OCO2 | C[C@H](OC(=O)C1CCN(C(=O)C(C)(C)C)CC1)C(=O)Nc1ccc2c(c1)OCO2 | C[C@H](OC(=O)C1CCC(C)(C(=O)C(C)(C)C)CC1)C(=O)Nc1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&(C)CC1",
"old_substring": "C18CCN4CC1"
} |
Can you make molecule C[C@H](OC(=O)C1CCN(C(=O)C(C)(C)C)CC1)C(=O)Nc1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=O)C1(C#N)CCC(C(=O)C(C)(C)C)CC1)C(=O)Nc1ccc2c(c1)OCO2 | C[C@H](OC(=O)C1CCN(C(=O)C(C)(C)C)CC1)C(=O)Nc1ccc2c(c1)OCO2 | C[C@H](OC(=O)C1(C#N)CCC(C(=O)C(C)(C)C)CC1)C(=O)Nc1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "C18CCN4CC1"
} |
Can you make molecule C[C@H](OC(=O)C1CCN(C(=O)C(C)(C)C)CC1)C(=O)Nc1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=O)CCCCCC(=O)C(C)(C)C)C(=O)Nc1ccc2c(c1)OCO2 | C[C@H](OC(=O)C1CCN(C(=O)C(C)(C)C)CC1)C(=O)Nc1ccc2c(c1)OCO2 | C[C@H](OC(=O)CCCCCC(=O)C(C)(C)C)C(=O)Nc1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C18CCN4CC1"
} |
Can you make molecule C[C@H](OC(=O)C1CCN(C(=O)C(C)(C)C)CC1)C(=O)Nc1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=O)N1CCC=C(CC(=O)C(C)(C)C)C1)C(=O)Nc1ccc2c(c1)OCO2 | C[C@H](OC(=O)C1CCN(C(=O)C(C)(C)C)CC1)C(=O)Nc1ccc2c(c1)OCO2 | C[C@H](OC(=O)N1CCC=C(CC(=O)C(C)(C)C)C1)C(=O)Nc1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "C18CCN4CC1"
} |
Can you make molecule Cc1onc(-c2ccccc2Cl)c1C(=O)N1CCCSC[C@H]1CN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1onc(-c2ccccc2Cl)c1C(=O)N1CCCSC[C@H]1CN1CCCC1 | Cc1onc(-c2ccccc2Cl)c1C(=O)N1CCCSC[C@H]1CN1CCOCC1 | Cc1onc(-c2ccccc2Cl)c1C(=O)N1CCCSC[C@H]1CN1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC1",
"old_substring": "N14CCOCC1"
} |
Can you make molecule Cc1onc(-c2ccccc2Cl)c1C(=O)N1CCCSC[C@H]1CN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1onc(-c2ccccc2Cl)c1C(=O)N1CCCSC[C@H]1CN1CCCCC1 | Cc1onc(-c2ccccc2Cl)c1C(=O)N1CCCSC[C@H]1CN1CCOCC1 | Cc1onc(-c2ccccc2Cl)c1C(=O)N1CCCSC[C@H]1CN1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "N14CCOCC1"
} |
Can you make molecule Cc1onc(-c2ccccc2Cl)c1C(=O)N1CCCSC[C@H]1CN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1onc(-c2ccccc2Cl)c1C(=O)N1CCCSC[C@H]1CN1CCSCC1 | Cc1onc(-c2ccccc2Cl)c1C(=O)N1CCCSC[C@H]1CN1CCOCC1 | Cc1onc(-c2ccccc2Cl)c1C(=O)N1CCCSC[C@H]1CN1CCSCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSCC1",
"old_substring": "N14CCOCC1"
} |
Can you make molecule Cc1onc(-c2ccccc2Cl)c1C(=O)N1CCCSC[C@H]1CN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1onc(-c2ccccc2Cl)c1C(=O)N1CCCSC[C@H]1CN1CC=CC1 | Cc1onc(-c2ccccc2Cl)c1C(=O)N1CCCSC[C@H]1CN1CCOCC1 | Cc1onc(-c2ccccc2Cl)c1C(=O)N1CCCSC[C@H]1CN1CC=CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=CC1",
"old_substring": "N14CCOCC1"
} |
Can you make molecule Cc1onc(-c2ccccc2Cl)c1C(=O)N1CCCSC[C@H]1CN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1onc(-c2ccccc2Cl)c1C(=O)N1CCCSC[C@H]1CSSN1CCOCC1 | Cc1onc(-c2ccccc2Cl)c1C(=O)N1CCCSC[C@H]1CN1CCOCC1 | Cc1onc(-c2ccccc2Cl)c1C(=O)N1CCCSC[C@H]1CSSN1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SN1CCOCC1",
"old_substring": "N14CCOCC1"
} |
Can you make molecule CC[C@@H](C)n1ncc(C(=O)N2CCC(n3cc[nH+]c3)CC2)c1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCCl)Cn1ncc(C(=O)N2CCC(n3cc[nH+]c3)CC2)c1C1CC1 | CC[C@@H](C)n1ncc(C(=O)N2CCC(n3cc[nH+]c3)CC2)c1C1CC1 | CC[C@@H](CCCl)Cn1ncc(C(=O)N2CCC(n3cc[nH+]c3)CC2)c1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&)CCCl",
"old_substring": "CC[C@H]6C"
} |
Can you make molecule CC[C@@H](C)n1ncc(C(=O)N2CCC(n3cc[nH+]c3)CC2)c1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CCCl)Cn1ncc(C(=O)N2CCC(n3cc[nH+]c3)CC2)c1C1CC1 | CC[C@@H](C)n1ncc(C(=O)N2CCC(n3cc[nH+]c3)CC2)c1C1CC1 | CC[C@H](CCCl)Cn1ncc(C(=O)N2CCC(n3cc[nH+]c3)CC2)c1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](C&)CCCl",
"old_substring": "CC[C@H]6C"
} |
Can you make molecule CC[C@@H](C)n1ncc(C(=O)N2CCC(n3cc[nH+]c3)CC2)c1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](Cl)CCCn1ncc(C(=O)N2CCC(n3cc[nH+]c3)CC2)c1C1CC1 | CC[C@@H](C)n1ncc(C(=O)N2CCC(n3cc[nH+]c3)CC2)c1C1CC1 | CC[C@@H](Cl)CCCn1ncc(C(=O)N2CCC(n3cc[nH+]c3)CC2)c1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](Cl)CCC&",
"old_substring": "CC[C@H]6C"
} |
Can you make molecule CC[C@@H](C)n1ncc(C(=O)N2CCC(n3cc[nH+]c3)CC2)c1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C[C@H](CC)n1ncc(C(=O)N2CCC(n3cc[nH+]c3)CC2)c1C1CC1 | CC[C@@H](C)n1ncc(C(=O)N2CCC(n3cc[nH+]c3)CC2)c1C1CC1 | CC[C@@H](C)C[C@H](CC)n1ncc(C(=O)N2CCC(n3cc[nH+]c3)CC2)c1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&C[C@H](C)CC",
"old_substring": "CC[C@H]6C"
} |
Can you make molecule CC[C@@H](C)n1ncc(C(=O)N2CCC(n3cc[nH+]c3)CC2)c1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](Cl)[C@@H](C)n1ncc(C(=O)N2CCC(n3cc[nH+]c3)CC2)c1C1CC1 | CC[C@@H](C)n1ncc(C(=O)N2CCC(n3cc[nH+]c3)CC2)c1C1CC1 | CC[C@@H](Cl)[C@@H](C)n1ncc(C(=O)N2CCC(n3cc[nH+]c3)CC2)c1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](Cl)[C@H]&C",
"old_substring": "CC[C@H]6C"
} |
Can you make molecule CCOC(=O)c1c(NC(=O)c2ccc(F)c(F)c2)sc(C)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1c(NC(=O)c2ccc(F)c(Cl)c2)sc(C)c1C | CCOC(=O)c1c(NC(=O)c2ccc(F)c(F)c2)sc(C)c1C | CCOC(=O)c1c(NC(=O)c2ccc(F)c(Cl)c2)sc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)c(Cl)c1",
"old_substring": "c18ccc(F)c(F)c1"
} |
Can you make molecule CCOC(=O)c1c(NC(=O)c2ccc(F)c(F)c2)sc(C)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1c(NC(=O)c2ccc(F)c(Cl)c2F)sc(C)c1C | CCOC(=O)c1c(NC(=O)c2ccc(F)c(F)c2)sc(C)c1C | CCOC(=O)c1c(NC(=O)c2ccc(F)c(Cl)c2F)sc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)c(Cl)c1F",
"old_substring": "c18ccc(F)c(F)c1"
} |
Can you make molecule CCOC(=O)c1c(NC(=O)c2ccc(F)c(F)c2)sc(C)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1c(NC(=O)c2ccc(Cl)c(I)c2)sc(C)c1C | CCOC(=O)c1c(NC(=O)c2ccc(F)c(F)c2)sc(C)c1C | CCOC(=O)c1c(NC(=O)c2ccc(Cl)c(I)c2)sc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c18ccc(F)c(F)c1"
} |
Can you make molecule CCOC(=O)c1c(NC(=O)c2ccc(F)c(F)c2)sc(C)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1c(NC(=O)c2ccc(I)c(C)c2C)sc(C)c1C | CCOC(=O)c1c(NC(=O)c2ccc(F)c(F)c2)sc(C)c1C | CCOC(=O)c1c(NC(=O)c2ccc(I)c(C)c2C)sc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)c(C)c1C",
"old_substring": "c18ccc(F)c(F)c1"
} |
Can you make molecule CCOC(=O)c1c(NC(=O)c2ccc(F)c(F)c2)sc(C)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1c(NC(=O)c2ccc(F)cc2Cl)sc(C)c1C | CCOC(=O)c1c(NC(=O)c2ccc(F)c(F)c2)sc(C)c1C | CCOC(=O)c1c(NC(=O)c2ccc(F)cc2Cl)sc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c18ccc(F)c(F)c1"
} |
Can you make molecule CC(C)[NH+]1CCN(CC(=O)NCCc2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[NH+]1CCN(CC(=O)NCCc2ccc(F)cc2)CC1 | CC(C)[NH+]1CCN(CC(=O)NCCc2ccc(F)cc2)CC1 | CC(C)CC[NH+]1CCN(CC(=O)NCCc2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)[NH+]1CCN(CC(=O)NCCc2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CN1CC[NH+](CCCCBr)CC1)NCCc1ccc(F)cc1 | CC(C)[NH+]1CCN(CC(=O)NCCc2ccc(F)cc2)CC1 | O=C(CN1CC[NH+](CCCCBr)CC1)NCCc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)[NH+]1CCN(CC(=O)NCCc2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[NH+]1CCN(CC(=O)NCCc2ccc(F)cc2)CC1 | CC(C)[NH+]1CCN(CC(=O)NCCc2ccc(F)cc2)CC1 | C=CCCC[NH+]1CCN(CC(=O)NCCc2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)[NH+]1CCN(CC(=O)NCCc2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CN1CC[NH+](CCCCCl)CC1)NCCc1ccc(F)cc1 | CC(C)[NH+]1CCN(CC(=O)NCCc2ccc(F)cc2)CC1 | O=C(CN1CC[NH+](CCCCCl)CC1)NCCc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)[NH+]1CCN(CC(=O)NCCc2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC[NH+]1CCN(CC(=O)NCCc2ccc(F)cc2)CC1 | CC(C)[NH+]1CCN(CC(=O)NCCc2ccc(F)cc2)CC1 | C=CCCCC[NH+]1CCN(CC(=O)NCCc2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CC4C"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.