prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(C)(CNC(=O)Cn1c(SC(F)F)nc2ccccc21)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CNSC(=O)Cn1c(SC(F)F)nc2ccccc21)c1ccncc1 | CC(C)(CNC(=O)Cn1c(SC(F)F)nc2ccccc21)c1ccncc1 | CC(C)(CNSC(=O)Cn1c(SC(F)F)nc2ccccc21)c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C5"
} |
Can you make molecule CC(C)(CNC(=O)Cn1c(SC(F)F)nc2ccccc21)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CNC(=O)CCCC(=O)n1c(SC(F)F)nc2ccccc21)c1ccncc1 | CC(C)(CNC(=O)Cn1c(SC(F)F)nc2ccccc21)c1ccncc1 | CC(C)(CNC(=O)CCCC(=O)n1c(SC(F)F)nc2ccccc21)c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C5"
} |
Can you make molecule CC(C)(CNC(=O)Cn1c(SC(F)F)nc2ccccc21)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CNC(=O)CC(C)(C)n1c(SC(F)F)nc2ccccc21)c1ccncc1 | CC(C)(CNC(=O)Cn1c(SC(F)F)nc2ccccc21)c1ccncc1 | CC(C)(CNC(=O)CC(C)(C)n1c(SC(F)F)nc2ccccc21)c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C5"
} |
Can you make molecule CC(C)(CNC(=O)Cn1c(SC(F)F)nc2ccccc21)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CNC[S@+]([O-])CCCn1c(SC(F)F)nc2ccccc21)c1ccncc1 | CC(C)(CNC(=O)Cn1c(SC(F)F)nc2ccccc21)c1ccncc1 | CC(C)(CNC[S@+]([O-])CCCn1c(SC(F)F)nc2ccccc21)c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C5"
} |
Can you make molecule CC(C)(CNC(=O)Cn1c(SC(F)F)nc2ccccc21)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CNC(=O)CCC(C)(C)n1c(SC(F)F)nc2ccccc21)c1ccncc1 | CC(C)(CNC(=O)Cn1c(SC(F)F)nc2ccccc21)c1ccncc1 | CC(C)(CNC(=O)CCC(C)(C)n1c(SC(F)F)nc2ccccc21)c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C5"
} |
Can you make molecule [NH3+][C@@H](CC(=O)[O-])c1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H](CO)c1cccc2ccccc12 | [NH3+][C@@H](CC(=O)[O-])c1cccc2ccccc12 | [NH3+][C@H](CO)c1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "[NH3+][C@@H]3CO",
"old_substring": "[NH3+][C@H]3CC(=O)[O-]"
} |
Can you make molecule [NH3+][C@@H](CC(=O)[O-])c1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]CCCCc1cccc2ccccc12 | [NH3+][C@@H](CC(=O)[O-])c1cccc2ccccc12 | [NH3+]CCCCc1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "[NH3+]CCCC3",
"old_substring": "[NH3+][C@H]3CC(=O)[O-]"
} |
Can you make molecule [NH3+][C@@H](CC(=O)[O-])c1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]CCCCCC(=O)c1cccc2ccccc12 | [NH3+][C@@H](CC(=O)[O-])c1cccc2ccccc12 | [NH3+]CCCCCC(=O)c1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "[NH3+]CCCCCC3=O",
"old_substring": "[NH3+][C@H]3CC(=O)[O-]"
} |
Can you make molecule [NH3+][C@@H](CC(=O)[O-])c1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H]([NH3+])Cc1cccc2ccccc12 | [NH3+][C@@H](CC(=O)[O-])c1cccc2ccccc12 | CCCC[C@H]([NH3+])Cc1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]([NH3+])C3",
"old_substring": "[NH3+][C@H]3CC(=O)[O-]"
} |
Can you make molecule [NH3+][C@@H](CC(=O)[O-])c1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]([NH3+])CCc1cccc2ccccc12 | [NH3+][C@@H](CC(=O)[O-])c1cccc2ccccc12 | CCC[C@H]([NH3+])CCc1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]([NH3+])CC3",
"old_substring": "[NH3+][C@H]3CC(=O)[O-]"
} |
Can you make molecule O=C(NC[C@H](c1ccco1)[NH+]1CCCCC1)C1CCN(C(=O)c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H](c1ccc(I)o1)[NH+]1CCCCC1)C1CCN(C(=O)c2ccc(F)cc2)CC1 | O=C(NC[C@H](c1ccco1)[NH+]1CCCCC1)C1CCN(C(=O)c2ccc(F)cc2)CC1 | O=C(NC[C@H](c1ccc(I)o1)[NH+]1CCCCC1)C1CCN(C(=O)c2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)o1",
"old_substring": "c19ccco1"
} |
Can you make molecule O=C(NC[C@H](c1ccco1)[NH+]1CCCCC1)C1CCN(C(=O)c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H](c1ccc(Br)o1)[NH+]1CCCCC1)C1CCN(C(=O)c2ccc(F)cc2)CC1 | O=C(NC[C@H](c1ccco1)[NH+]1CCCCC1)C1CCN(C(=O)c2ccc(F)cc2)CC1 | O=C(NC[C@H](c1ccc(Br)o1)[NH+]1CCCCC1)C1CCN(C(=O)c2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)o1",
"old_substring": "c19ccco1"
} |
Can you make molecule O=C(NC[C@H](c1ccco1)[NH+]1CCCCC1)C1CCN(C(=O)c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H](c1ccc(Cl)o1)[NH+]1CCCCC1)C1CCN(C(=O)c2ccc(F)cc2)CC1 | O=C(NC[C@H](c1ccco1)[NH+]1CCCCC1)C1CCN(C(=O)c2ccc(F)cc2)CC1 | O=C(NC[C@H](c1ccc(Cl)o1)[NH+]1CCCCC1)C1CCN(C(=O)c2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)o1",
"old_substring": "c19ccco1"
} |
Can you make molecule O=C(NC[C@H](c1ccco1)[NH+]1CCCCC1)C1CCN(C(=O)c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H](c1occc1Br)[NH+]1CCCCC1)C1CCN(C(=O)c2ccc(F)cc2)CC1 | O=C(NC[C@H](c1ccco1)[NH+]1CCCCC1)C1CCN(C(=O)c2ccc(F)cc2)CC1 | O=C(NC[C@H](c1occc1Br)[NH+]1CCCCC1)C1CCN(C(=O)c2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&occc1Br",
"old_substring": "c19ccco1"
} |
Can you make molecule O=C(NC[C@H](c1ccco1)[NH+]1CCCCC1)C1CCN(C(=O)c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1[C@@H](CNC(=O)C1CCN(C(=O)c2ccc(F)cc2)CC1)[NH+]1CCCCC1 | O=C(NC[C@H](c1ccco1)[NH+]1CCCCC1)C1CCN(C(=O)c2ccc(F)cc2)CC1 | Cc1ccsc1[C@@H](CNC(=O)C1CCN(C(=O)c2ccc(F)cc2)CC1)[NH+]1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c19ccco1"
} |
Can you make molecule C[C@@H]1CCCC[C@H]1NC(=O)Cn1cnc([N+](=O)[O-])n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[C@H]1NSC(=O)Cn1cnc([N+](=O)[O-])n1 | C[C@@H]1CCCC[C@H]1NC(=O)Cn1cnc([N+](=O)[O-])n1 | C[C@@H]1CCCC[C@H]1NSC(=O)Cn1cnc([N+](=O)[O-])n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C2(=O)C4"
} |
Can you make molecule C[C@@H]1CCCC[C@H]1NC(=O)Cn1cnc([N+](=O)[O-])n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[C@H]1NC(=O)CCCC(=O)n1cnc([N+](=O)[O-])n1 | C[C@@H]1CCCC[C@H]1NC(=O)Cn1cnc([N+](=O)[O-])n1 | C[C@@H]1CCCC[C@H]1NC(=O)CCCC(=O)n1cnc([N+](=O)[O-])n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C2(=O)C4"
} |
Can you make molecule C[C@@H]1CCCC[C@H]1NC(=O)Cn1cnc([N+](=O)[O-])n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[C@H]1NC(=O)CC(C)(C)n1cnc([N+](=O)[O-])n1 | C[C@@H]1CCCC[C@H]1NC(=O)Cn1cnc([N+](=O)[O-])n1 | C[C@@H]1CCCC[C@H]1NC(=O)CC(C)(C)n1cnc([N+](=O)[O-])n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C2(=O)C4"
} |
Can you make molecule C[C@@H]1CCCC[C@H]1NC(=O)Cn1cnc([N+](=O)[O-])n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[C@H]1NC[S@+]([O-])CCCn1cnc([N+](=O)[O-])n1 | C[C@@H]1CCCC[C@H]1NC(=O)Cn1cnc([N+](=O)[O-])n1 | C[C@@H]1CCCC[C@H]1NC[S@+]([O-])CCCn1cnc([N+](=O)[O-])n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C2(=O)C4"
} |
Can you make molecule C[C@@H]1CCCC[C@H]1NC(=O)Cn1cnc([N+](=O)[O-])n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[C@H]1NC(=O)CCC(C)(C)n1cnc([N+](=O)[O-])n1 | C[C@@H]1CCCC[C@H]1NC(=O)Cn1cnc([N+](=O)[O-])n1 | C[C@@H]1CCCC[C@H]1NC(=O)CCC(C)(C)n1cnc([N+](=O)[O-])n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C2(=O)C4"
} |
Can you make molecule Cc1nc(N2C[C@@H](C)[C@H](C)C2)sc1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C[C@@H](CS)C(C)C)sc1C[NH3+] | Cc1nc(N2C[C@@H](C)[C@H](C)C2)sc1C[NH3+] | Cc1nc(C[C@@H](CS)C(C)C)sc1C[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](CS)C(C)C",
"old_substring": "N13C[C@@H](C)[C@H](C)C1"
} |
Can you make molecule Cc1nc(N2C[C@@H](C)[C@H](C)C2)sc1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(N2CCCC(C)(C)C2)sc1C[NH3+] | Cc1nc(N2C[C@@H](C)[C@H](C)C2)sc1C[NH3+] | Cc1nc(N2CCCC(C)(C)C2)sc1C[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(C)(C)C1",
"old_substring": "N13C[C@@H](C)[C@H](C)C1"
} |
Can you make molecule Cc1nc(N2C[C@@H](C)[C@H](C)C2)sc1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(N2CCC[C@@H](C)CC2)sc1C[NH3+] | Cc1nc(N2C[C@@H](C)[C@H](C)C2)sc1C[NH3+] | Cc1nc(N2CCC[C@@H](C)CC2)sc1C[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@H](C)CC1",
"old_substring": "N13C[C@@H](C)[C@H](C)C1"
} |
Can you make molecule Cc1nc(N2C[C@@H](C)[C@H](C)C2)sc1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc([C@@H]2CCO[C@H](C)C2)sc1C[NH3+] | Cc1nc(N2C[C@@H](C)[C@H](C)C2)sc1C[NH3+] | Cc1nc([C@@H]2CCO[C@H](C)C2)sc1C[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1C[C@H]&CCO1",
"old_substring": "N13C[C@@H](C)[C@H](C)C1"
} |
Can you make molecule Cc1nc(N2C[C@@H](C)[C@H](C)C2)sc1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C[C@@H](C)C(C)(C)C)sc1C[NH3+] | Cc1nc(N2C[C@@H](C)[C@H](C)C2)sc1C[NH3+] | Cc1nc(C[C@@H](C)C(C)(C)C)sc1C[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](C)C(C)(C)C",
"old_substring": "N13C[C@@H](C)[C@H](C)C1"
} |
Can you make molecule CCOc1ccccc1NC(=O)Cn1nc(-c2cccc(Br)c2)ccc1=O less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(NC(=O)Cn2nc(-c3cccc(Br)c3)ccc2=O)cc1I | CCOc1ccccc1NC(=O)Cn1nc(-c2cccc(Br)c2)ccc1=O | CCOc1ccc(NC(=O)Cn2nc(-c3cccc(Br)c3)ccc2=O)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15ccccc16"
} |
Can you make molecule CCOc1ccccc1NC(=O)Cn1nc(-c2cccc(Br)c2)ccc1=O less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc(NC(=O)Cn2nc(-c3cccc(Br)c3)ccc2=O)ccc1Br | CCOc1ccccc1NC(=O)Cn1nc(-c2cccc(Br)c2)ccc1=O | CCOc1cc(NC(=O)Cn2nc(-c3cccc(Br)c3)ccc2=O)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15ccccc16"
} |
Can you make molecule CCOc1ccccc1NC(=O)Cn1nc(-c2cccc(Br)c2)ccc1=O less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(NC(=O)Cn2nc(-c3cccc(Br)c3)ccc2=O)cc1Cl | CCOc1ccccc1NC(=O)Cn1nc(-c2cccc(Br)c2)ccc1=O | CCOc1ccc(NC(=O)Cn2nc(-c3cccc(Br)c3)ccc2=O)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15ccccc16"
} |
Can you make molecule CCOc1ccccc1NC(=O)Cn1nc(-c2cccc(Br)c2)ccc1=O less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cccc(NC(=O)Cn2nc(-c3cccc(Br)c3)ccc2=O)c1Br | CCOc1ccccc1NC(=O)Cn1nc(-c2cccc(Br)c2)ccc1=O | CCOc1cccc(NC(=O)Cn2nc(-c3cccc(Br)c3)ccc2=O)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15ccccc16"
} |
Can you make molecule CCOc1ccccc1NC(=O)Cn1nc(-c2cccc(Br)c2)ccc1=O less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cccc(NC(=O)Cn2nc(-c3cccc(Br)c3)ccc2=O)c1Cl | CCOc1ccccc1NC(=O)Cn1nc(-c2cccc(Br)c2)ccc1=O | CCOc1cccc(NC(=O)Cn2nc(-c3cccc(Br)c3)ccc2=O)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15ccccc16"
} |
Can you make molecule C[C@H](Cc1ccc(C2CC2)cc1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCl)S(=O)(=O)c1ccc(C2CC2)cc1 | C[C@H](Cc1ccc(C2CC2)cc1)C(=O)[O-] | C[C@H](CCl)S(=O)(=O)c1ccc(C2CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CCl)S&(=O)=O",
"old_substring": "C[C@H](C3)C(=O)[O-]"
} |
Can you make molecule C[C@H](Cc1ccc(C2CC2)cc1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](O)CCC(=O)c1ccc(C2CC2)cc1 | C[C@H](Cc1ccc(C2CC2)cc1)C(=O)[O-] | C[C@H](O)CCC(=O)c1ccc(C2CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](O)CCC&=O",
"old_substring": "C[C@H](C3)C(=O)[O-]"
} |
Can you make molecule C[C@H](Cc1ccc(C2CC2)cc1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](O)C(=O)c1ccc(C2CC2)cc1 | C[C@H](Cc1ccc(C2CC2)cc1)C(=O)[O-] | C[C@H](O)C(=O)c1ccc(C2CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](O)C&=O",
"old_substring": "C[C@H](C3)C(=O)[O-]"
} |
Can you make molecule C[C@H](Cc1ccc(C2CC2)cc1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@](O)(CC=O)c1ccc(C2CC2)cc1 | C[C@H](Cc1ccc(C2CC2)cc1)C(=O)[O-] | C[C@](O)(CC=O)c1ccc(C2CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@]&(O)CC=O",
"old_substring": "C[C@H](C3)C(=O)[O-]"
} |
Can you make molecule C[C@H](Cc1ccc(C2CC2)cc1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CS(C)(=O)=O)c1ccc(C2CC2)cc1 | C[C@H](Cc1ccc(C2CC2)cc1)C(=O)[O-] | C[C@H](CS(C)(=O)=O)c1ccc(C2CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CS(C)(=O)=O",
"old_substring": "C[C@H](C3)C(=O)[O-]"
} |
Can you make molecule Cc1noc(C)c1[C@@H](C)NC(=O)NCC1(c2cccc(F)c2)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1c(C)noc1C)NC(=O)NCC1(c2cccc(F)c2)CCOCC1 | Cc1noc(C)c1[C@@H](C)NC(=O)NCC1(c2cccc(F)c2)CCOCC1 | CC[C@@H](CCc1c(C)noc1C)NC(=O)NCC1(c2cccc(F)c2)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]58C"
} |
Can you make molecule Cc1noc(C)c1[C@@H](C)NC(=O)NCC1(c2cccc(F)c2)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1CC[C@H](CBr)NC(=O)NCC1(c2cccc(F)c2)CCOCC1 | Cc1noc(C)c1[C@@H](C)NC(=O)NCC1(c2cccc(F)c2)CCOCC1 | Cc1noc(C)c1CC[C@H](CBr)NC(=O)NCC1(c2cccc(F)c2)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]58C"
} |
Can you make molecule Cc1noc(C)c1[C@@H](C)NC(=O)NCC1(c2cccc(F)c2)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1CCC[C@H](CBr)NC(=O)NCC1(c2cccc(F)c2)CCOCC1 | Cc1noc(C)c1[C@@H](C)NC(=O)NCC1(c2cccc(F)c2)CCOCC1 | Cc1noc(C)c1CCC[C@H](CBr)NC(=O)NCC1(c2cccc(F)c2)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]58C"
} |
Can you make molecule Cc1noc(C)c1[C@@H](C)NC(=O)NCC1(c2cccc(F)c2)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1CCC[C@@H](CCl)NC(=O)NCC1(c2cccc(F)c2)CCOCC1 | Cc1noc(C)c1[C@@H](C)NC(=O)NCC1(c2cccc(F)c2)CCOCC1 | Cc1noc(C)c1CCC[C@@H](CCl)NC(=O)NCC1(c2cccc(F)c2)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@H]58C"
} |
Can you make molecule Cc1noc(C)c1[C@@H](C)NC(=O)NCC1(c2cccc(F)c2)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1[C@H]1CCC[C@H](NC(=O)NCC2(c3cccc(F)c3)CCOCC2)C1 | Cc1noc(C)c1[C@@H](C)NC(=O)NCC1(c2cccc(F)c2)CCOCC1 | Cc1noc(C)c1[C@H]1CCC[C@H](NC(=O)NCC2(c3cccc(F)c3)CCOCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]58C"
} |
Can you make molecule O=C(NC[C@H](O)C1CCOCC1)c1cncn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H](CO)CC1CCOCC1)c1cncn1-c1ccccc1 | O=C(NC[C@H](O)C1CCOCC1)c1cncn1-c1ccccc1 | O=C(NC[C@H](CO)CC1CCOCC1)c1cncn1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](C&)CO",
"old_substring": "C3[C@@H]5O"
} |
Can you make molecule O=C(NC[C@H](O)C1CCOCC1)c1cncn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CNC(=O)c1cncn1-c1ccccc1)C(=O)C1CCOCC1 | O=C(NC[C@H](O)C1CCOCC1)c1cncn1-c1ccccc1 | C[C@H](CNC(=O)c1cncn1-c1ccccc1)C(=O)C1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](C)C&=O",
"old_substring": "C3[C@@H]5O"
} |
Can you make molecule O=C(NC[C@H](O)C1CCOCC1)c1cncn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNC(=O)c1cncn1-c1ccccc1)CC(=O)C1CCOCC1 | O=C(NC[C@H](O)C1CCOCC1)c1cncn1-c1ccccc1 | C[C@@H](CCNC(=O)c1cncn1-c1ccccc1)CC(=O)C1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C3[C@@H]5O"
} |
Can you make molecule O=C(NC[C@H](O)C1CCOCC1)c1cncn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C1CCOCC1)[C@H](O)CNC(=O)c1cncn1-c1ccccc1 | O=C(NC[C@H](O)C1CCOCC1)c1cncn1-c1ccccc1 | CC(C)(C1CCOCC1)[C@H](O)CNC(=O)c1cncn1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](O)C&(C)C",
"old_substring": "C3[C@@H]5O"
} |
Can you make molecule O=C(NC[C@H](O)C1CCOCC1)c1cncn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CC(=O)C1CCOCC1)NC(=O)c1cncn1-c1ccccc1 | O=C(NC[C@H](O)C1CCOCC1)c1cncn1-c1ccccc1 | CC[C@H](CC(=O)C1CCOCC1)NC(=O)c1cncn1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H]&CC&=O",
"old_substring": "C3[C@@H]5O"
} |
Can you make molecule O=C(NCCCSc1ccccc1)c1cc(Br)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C1C2=CC=CC2=C(NCCCSc2ccccc2)CCN1c1cc(Br)ccc1Cl | O=C(NCCCSc1ccccc1)c1cc(Br)ccc1Cl | O=C1C2=CC=CC2=C(NCCCSc2ccccc2)CCN1c1cc(Br)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "O=C1c2cccc&c2CCN1&",
"old_substring": "O=C25"
} |
Can you make molecule O=C(NCCCSc1ccccc1)c1cc(Br)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1c(NCCCSc2ccccc2)cc(-c2cc(Br)ccc2Cl)ccc2oc1-2 | O=C(NCCCSc1ccccc1)c1cc(Br)ccc1Cl | O=Cc1c(NCCCSc2ccccc2)cc(-c2cc(Br)ccc2Cl)ccc2oc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1c&oc2ccc&cc12",
"old_substring": "O=C25"
} |
Can you make molecule O=C(NCCCSc1ccccc1)c1cc(Br)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1cc(Br)ccc1Cl)NCCCSc1ccccc1 | O=C(NCCCSc1ccccc1)c1cc(Br)ccc1Cl | O=C(/C=C/Sc1cc(Br)ccc1Cl)NCCCSc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C25"
} |
Can you make molecule O=C(NCCCSc1ccccc1)c1cc(Br)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NCCCSc2ccccc2)nc1-c1cc(Br)ccc1Cl | O=C(NCCCSc1ccccc1)c1cc(Br)ccc1Cl | O=Cc1sc(NCCCSc2ccccc2)nc1-c1cc(Br)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C25"
} |
Can you make molecule O=C(NCCCSc1ccccc1)c1cc(Br)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NCCCSc2ccccc2)sc1-c1cc(Br)ccc1Cl | O=C(NCCCSc1ccccc1)c1cc(Br)ccc1Cl | O=Cc1nc(NCCCSc2ccccc2)sc1-c1cc(Br)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C25"
} |
Can you make molecule CCOC(=O)CN1C(=O)CS[C@@]12C(=O)Nc1ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | C=CSOC(=O)CN1C(=O)CS[C@@]12C(=O)Nc1ccccc12 | CCOC(=O)CN1C(=O)CS[C@@]12C(=O)Nc1ccccc12 | C=CSOC(=O)CN1C(=O)CS[C@@]12C(=O)Nc1ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)CN1C(=O)CS[C@@]12C(=O)Nc1ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOC(=O)CN1C(=O)CS[C@@]12C(=O)Nc1ccccc12 | CCOC(=O)CN1C(=O)CS[C@@]12C(=O)Nc1ccccc12 | C=CCCOC(=O)CN1C(=O)CS[C@@]12C(=O)Nc1ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)CN1C(=O)CS[C@@]12C(=O)Nc1ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CN1C(=O)CS[C@@]12C(=O)Nc1ccccc12)OCCCCl | CCOC(=O)CN1C(=O)CS[C@@]12C(=O)Nc1ccccc12 | O=C(CN1C(=O)CS[C@@]12C(=O)Nc1ccccc12)OCCCCl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)CN1C(=O)CS[C@@]12C(=O)Nc1ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CN1C(=O)CS[C@@]12C(=O)Nc1ccccc12)OCCCCS | CCOC(=O)CN1C(=O)CS[C@@]12C(=O)Nc1ccccc12 | O=C(CN1C(=O)CS[C@@]12C(=O)Nc1ccccc12)OCCCCS | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)CN1C(=O)CS[C@@]12C(=O)Nc1ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CN1C(=O)CS[C@@]12C(=O)Nc1ccccc12)OCCCBr | CCOC(=O)CN1C(=O)CS[C@@]12C(=O)Nc1ccccc12 | O=C(CN1C(=O)CS[C@@]12C(=O)Nc1ccccc12)OCCCBr | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4"
} |
Can you make molecule CC(C)(C)[NH2+]Cc1cccc(Oc2ncccn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C1(Cc2cccc(Oc3ncccn3)c2)CC[NH2+]C1 | CC(C)(C)[NH2+]Cc1cccc(Oc2ncccn2)c1 | CC(C)(C)C1(Cc2cccc(Oc3ncccn3)c2)CC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&&C1",
"old_substring": "[NH2+]56"
} |
Can you make molecule CC(C)(C)[NH2+]Cc1cccc(Oc2ncccn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)[C@]1(Cc2cccc(Oc3ncccn3)c2)CCC[NH2+]C1 | CC(C)(C)[NH2+]Cc1cccc(Oc2ncccn2)c1 | CC(C)(C)[C@]1(Cc2cccc(Oc3ncccn3)c2)CCC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH2+]56"
} |
Can you make molecule CC(C)(C)[NH2+]Cc1cccc(Oc2ncccn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)n1c[nH+]cc1Cc1cccc(Oc2ncccn2)c1 | CC(C)(C)[NH2+]Cc1cccc(Oc2ncccn2)c1 | CC(C)(C)n1c[nH+]cc1Cc1cccc(Oc2ncccn2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH2+]56"
} |
Can you make molecule CC(C)(C)[NH2+]Cc1cccc(Oc2ncccn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1cc(Cc2cccc(Oc3ncccn3)c2)[nH][nH+]1 | CC(C)(C)[NH2+]Cc1cccc(Oc2ncccn2)c1 | CC(C)(C)c1cc(Cc2cccc(Oc3ncccn3)c2)[nH][nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH2+]56"
} |
Can you make molecule CC(C)(C)[NH2+]Cc1cccc(Oc2ncccn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1[nH+]cc(Cc2cccc(Oc3ncccn3)c2)c1C(C)(C)C | CC(C)(C)[NH2+]Cc1cccc(Oc2ncccn2)c1 | Cn1[nH+]cc(Cc2cccc(Oc3ncccn3)c2)c1C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH2+]56"
} |
Can you make molecule C[NH2+]Cc1ccc(OC)c(C[NH+]2C[C@H](C)[C@@H](C)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]CCCCc1ccc(OC)c(C[NH+]2C[C@H](C)[C@@H](C)C2)c1 | C[NH2+]Cc1ccc(OC)c(C[NH+]2C[C@H](C)[C@@H](C)C2)c1 | C[NH2+]CCCCc1ccc(OC)c(C[NH+]2C[C@H](C)[C@@H](C)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C46"
} |
Can you make molecule C[NH2+]Cc1ccc(OC)c(C[NH+]2C[C@H](C)[C@@H](C)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]CCCCCc1ccc(OC)c(C[NH+]2C[C@H](C)[C@@H](C)C2)c1 | C[NH2+]Cc1ccc(OC)c(C[NH+]2C[C@H](C)[C@@H](C)C2)c1 | C[NH2+]CCCCCc1ccc(OC)c(C[NH+]2C[C@H](C)[C@@H](C)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C46"
} |
Can you make molecule C[NH2+]Cc1ccc(OC)c(C[NH+]2C[C@H](C)[C@@H](C)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]C1CC(c2ccc(OC)c(C[NH+]3C[C@H](C)[C@@H](C)C3)c2)C1 | C[NH2+]Cc1ccc(OC)c(C[NH+]2C[C@H](C)[C@@H](C)C2)c1 | C[NH2+]C1CC(c2ccc(OC)c(C[NH+]3C[C@H](C)[C@@H](C)C3)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C46"
} |
Can you make molecule C[NH2+]Cc1ccc(OC)c(C[NH+]2C[C@H](C)[C@@H](C)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]OC(=S)Sc1ccc(OC)c(C[NH+]2C[C@H](C)[C@@H](C)C2)c1 | C[NH2+]Cc1ccc(OC)c(C[NH+]2C[C@H](C)[C@@H](C)C2)c1 | C[NH2+]OC(=S)Sc1ccc(OC)c(C[NH+]2C[C@H](C)[C@@H](C)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C46"
} |
Can you make molecule C[NH2+]Cc1ccc(OC)c(C[NH+]2C[C@H](C)[C@@H](C)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]SC(=S)Nc1ccc(OC)c(C[NH+]2C[C@H](C)[C@@H](C)C2)c1 | C[NH2+]Cc1ccc(OC)c(C[NH+]2C[C@H](C)[C@@H](C)C2)c1 | C[NH2+]SC(=S)Nc1ccc(OC)c(C[NH+]2C[C@H](C)[C@@H](C)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C46"
} |
Can you make molecule CC(C)(O)CC[NH2+][C@H]1CCCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[NH2+][C@H]1CCCS(=O)(=O)C1 | CC(C)(O)CC[NH2+][C@H]1CCCS(=O)(=O)C1 | CC(C)CC[NH2+][C@H]1CCCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CC(C)(O)CC2"
} |
Can you make molecule CC(C)(O)CC[NH2+][C@H]1CCCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C(=O)CC[NH2+][C@H]1CCCS(=O)(=O)C1 | CC(C)(O)CC[NH2+][C@H]1CCCS(=O)(=O)C1 | CC(C)(C)C(=O)CC[NH2+][C@H]1CCCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)C(=O)CC&",
"old_substring": "CC(C)(O)CC2"
} |
Can you make molecule CC(C)(O)CC[NH2+][C@H]1CCCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C[NH2+][C@H]1CCCS(=O)(=O)C1)C(=O)Cl | CC(C)(O)CC[NH2+][C@H]1CCCS(=O)(=O)C1 | CC(C)(C[NH2+][C@H]1CCCS(=O)(=O)C1)C(=O)Cl | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)C(=O)Cl",
"old_substring": "CC(C)(O)CC2"
} |
Can you make molecule CC(C)(O)CC[NH2+][C@H]1CCCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCC(=O)C[NH2+][C@H]1CCCS(=O)(=O)C1 | CC(C)(O)CC[NH2+][C@H]1CCCS(=O)(=O)C1 | CC(C)CCC(=O)C[NH2+][C@H]1CCCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCC(=O)C&",
"old_substring": "CC(C)(O)CC2"
} |
Can you make molecule CC(C)(O)CC[NH2+][C@H]1CCCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C[NH2+][C@H]1CCCS(=O)(=O)C1 | CC(C)(O)CC[NH2+][C@H]1CCCS(=O)(=O)C1 | CC(C)(C)C[NH2+][C@H]1CCCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)(C)C",
"old_substring": "CC(C)(O)CC2"
} |
Can you make molecule CC1CC[NH+](CCCNC(=O)c2ccc(-n3cc[nH]c3=S)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC[NH+](CCCCCNC(=O)c2ccc(-n3cc[nH]c3=S)cc2)CC1 | CC1CC[NH+](CCCNC(=O)c2ccc(-n3cc[nH]c3=S)cc2)CC1 | CC1CC[NH+](CCCCCNC(=O)c2ccc(-n3cc[nH]c3=S)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C5CC6"
} |
Can you make molecule CC1CC[NH+](CCCNC(=O)c2ccc(-n3cc[nH]c3=S)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC[NH+](C2CCC(NC(=O)c3ccc(-n4cc[nH]c4=S)cc3)CC2)CC1 | CC1CC[NH+](CCCNC(=O)c2ccc(-n3cc[nH]c3=S)cc2)CC1 | CC1CC[NH+](C2CCC(NC(=O)c3ccc(-n4cc[nH]c4=S)cc3)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C5CC6"
} |
Can you make molecule CC1CC[NH+](CCCNC(=O)c2ccc(-n3cc[nH]c3=S)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC[NH+](CC(C)(C)CNC(=O)c2ccc(-n3cc[nH]c3=S)cc2)CC1 | CC1CC[NH+](CCCNC(=O)c2ccc(-n3cc[nH]c3=S)cc2)CC1 | CC1CC[NH+](CC(C)(C)CNC(=O)c2ccc(-n3cc[nH]c3=S)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)C&",
"old_substring": "C5CC6"
} |
Can you make molecule CC1CC[NH+](CCCNC(=O)c2ccc(-n3cc[nH]c3=S)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC[NH+](C2CCC(=NC(=O)c3ccc(-n4cc[nH]c4=S)cc3)CC2)CC1 | CC1CC[NH+](CCCNC(=O)c2ccc(-n3cc[nH]c3=S)cc2)CC1 | CC1CC[NH+](C2CCC(=NC(=O)c3ccc(-n4cc[nH]c4=S)cc3)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC=&CC1",
"old_substring": "C5CC6"
} |
Can you make molecule CC1CC[NH+](CCCNC(=O)c2ccc(-n3cc[nH]c3=S)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCNC(=O)c1ccc(-n2cc[nH]c2=S)cc1)[NH+]1CCC(C)CC1 | CC1CC[NH+](CCCNC(=O)c2ccc(-n3cc[nH]c3=S)cc2)CC1 | CCC[C@@H](CCNC(=O)c1ccc(-n2cc[nH]c2=S)cc1)[NH+]1CCC(C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C5CC6"
} |
Can you make molecule C=CCN(Cc1cccs1)C(=O)c1ccc(NC(=O)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCN(Cc1cccs1)C(=O)c1ccc(NC(=O)c2ccccc2)cc1 | C=CCN(Cc1cccs1)C(=O)c1ccc(NC(=O)c2ccccc2)cc1 | C=CCCCN(Cc1cccs1)C(=O)c1ccc(NC(=O)c2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "C=CC5"
} |
Can you make molecule C=CCN(Cc1cccs1)C(=O)c1ccc(NC(=O)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCN(Cc1cccs1)C(=O)c1ccc(NC(=O)c2ccccc2)cc1 | C=CCN(Cc1cccs1)C(=O)c1ccc(NC(=O)c2ccccc2)cc1 | C=CCCCCN(Cc1cccs1)C(=O)c1ccc(NC(=O)c2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "C=CC5"
} |
Can you make molecule C=CCN(Cc1cccs1)C(=O)c1ccc(NC(=O)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC(=O)N(Cc1cccs1)C(=O)c1ccc(NC(=O)c2ccccc2)cc1 | C=CCN(Cc1cccs1)C(=O)c1ccc(NC(=O)c2ccccc2)cc1 | C=CCCCC(=O)N(Cc1cccs1)C(=O)c1ccc(NC(=O)c2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&=O",
"old_substring": "C=CC5"
} |
Can you make molecule C=CCN(Cc1cccs1)C(=O)c1ccc(NC(=O)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC(CC=C)N(Cc1cccs1)C(=O)c1ccc(NC(=O)c2ccccc2)cc1 | C=CCN(Cc1cccs1)C(=O)c1ccc(NC(=O)c2ccccc2)cc1 | C=CCC(CC=C)N(Cc1cccs1)C(=O)c1ccc(NC(=O)c2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&CC=C",
"old_substring": "C=CC5"
} |
Can you make molecule C=CCN(Cc1cccs1)C(=O)c1ccc(NC(=O)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CC1CCN(N(Cc2cccs2)C(=O)c2ccc(NC(=O)c3ccccc3)cc2)CC1 | C=CCN(Cc1cccs1)C(=O)c1ccc(NC(=O)c2ccccc2)cc1 | C=CC1CCN(N(Cc2cccs2)C(=O)c2ccc(NC(=O)c3ccccc3)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CC1CCN&CC1",
"old_substring": "C=CC5"
} |
Can you make molecule CCCCn1nccc1NC(=O)c1ccn(-c2cccc(Cl)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)n1nccc1NC(=O)c1ccn(-c2cccc(Cl)c2)n1 | CCCCn1nccc1NC(=O)c1ccn(-c2cccc(Cl)c2)n1 | CCCC(C)(C)n1nccc1NC(=O)c1ccn(-c2cccc(Cl)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "CCCC6"
} |
Can you make molecule CCCCn1nccc1NC(=O)c1ccn(-c2cccc(Cl)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCCC(=O)n1nccc1NC(=O)c1ccn(-c2cccc(Cl)c2)n1 | CCCCn1nccc1NC(=O)c1ccn(-c2cccc(Cl)c2)n1 | CCCCCCC(=O)n1nccc1NC(=O)c1ccn(-c2cccc(Cl)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCCC&=O",
"old_substring": "CCCC6"
} |
Can you make molecule CCCCn1nccc1NC(=O)c1ccn(-c2cccc(Cl)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](C)n1nccc1NC(=O)c1ccn(-c2cccc(Cl)c2)n1 | CCCCn1nccc1NC(=O)c1ccn(-c2cccc(Cl)c2)n1 | CCCC[C@@H](C)n1nccc1NC(=O)c1ccn(-c2cccc(Cl)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&C",
"old_substring": "CCCC6"
} |
Can you make molecule CCCCn1nccc1NC(=O)c1ccn(-c2cccc(Cl)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC[C@@H](C)n1nccc1NC(=O)c1ccn(-c2cccc(Cl)c2)n1 | CCCCn1nccc1NC(=O)c1ccn(-c2cccc(Cl)c2)n1 | CCCCC[C@@H](C)n1nccc1NC(=O)c1ccn(-c2cccc(Cl)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC[C@H]&C",
"old_substring": "CCCC6"
} |
Can you make molecule CCCCn1nccc1NC(=O)c1ccn(-c2cccc(Cl)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(CC)n1nccc1NC(=O)c1ccn(-c2cccc(Cl)c2)n1 | CCCCn1nccc1NC(=O)c1ccn(-c2cccc(Cl)c2)n1 | CCC(C)(CC)n1nccc1NC(=O)c1ccn(-c2cccc(Cl)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "CCCC6"
} |
Can you make molecule CC[C@H](C)[NH+](C)CCNC(=O)c1ccc2c(c1)nc(C)n2C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[NH+](C)CCCCNC(=O)c1ccc2c(c1)nc(C)n2C | CC[C@H](C)[NH+](C)CCNC(=O)c1ccc2c(c1)nc(C)n2C | CC[C@H](C)[NH+](C)CCCCNC(=O)c1ccc2c(c1)nc(C)n2C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C5C6"
} |
Can you make molecule CC[C@H](C)[NH+](C)CCNC(=O)c1ccc2c(c1)nc(C)n2C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[NH+](C)CCCCCNC(=O)c1ccc2c(c1)nc(C)n2C | CC[C@H](C)[NH+](C)CCNC(=O)c1ccc2c(c1)nc(C)n2C | CC[C@H](C)[NH+](C)CCCCCNC(=O)c1ccc2c(c1)nc(C)n2C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C5C6"
} |
Can you make molecule CC[C@H](C)[NH+](C)CCNC(=O)c1ccc2c(c1)nc(C)n2C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[NH+](C)C1CC(NC(=O)c2ccc3c(c2)nc(C)n3C)C1 | CC[C@H](C)[NH+](C)CCNC(=O)c1ccc2c(c1)nc(C)n2C | CC[C@H](C)[NH+](C)C1CC(NC(=O)c2ccc3c(c2)nc(C)n3C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C5C6"
} |
Can you make molecule CC[C@H](C)[NH+](C)CCNC(=O)c1ccc2c(c1)nc(C)n2C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[NH+](C)[C@@H](C)CCNC(=O)c1ccc2c(c1)nc(C)n2C | CC[C@H](C)[NH+](C)CCNC(=O)c1ccc2c(c1)nc(C)n2C | CC[C@H](C)[NH+](C)[C@@H](C)CCNC(=O)c1ccc2c(c1)nc(C)n2C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C5C6"
} |
Can you make molecule CC[C@H](C)[NH+](C)CCNC(=O)c1ccc2c(c1)nc(C)n2C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[NH+](C)C1CCC(NC(=O)c2ccc3c(c2)nc(C)n3C)CC1 | CC[C@H](C)[NH+](C)CCNC(=O)c1ccc2c(c1)nc(C)n2C | CC[C@H](C)[NH+](C)C1CCC(NC(=O)c2ccc3c(c2)nc(C)n3C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C5C6"
} |
Can you make molecule Cc1cncc(NC(=O)N(C)Cc2cc(Br)ccc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cncc(NC(=O)c2cc(C#N)c(Cc3cc(Br)ccc3F)s2)c1 | Cc1cncc(NC(=O)N(C)Cc2cc(Br)ccc2F)c1 | Cc1cncc(NC(=O)c2cc(C#N)c(Cc3cc(Br)ccc3F)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N45C"
} |
Can you make molecule Cc1cncc(NC(=O)N(C)Cc2cc(Br)ccc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cncc(NC(=O)c2ccc(Cc3cc(Br)ccc3F)c(C#N)c2)c1 | Cc1cncc(NC(=O)N(C)Cc2cc(Br)ccc2F)c1 | Cc1cncc(NC(=O)c2ccc(Cc3cc(Br)ccc3F)c(C#N)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N45C"
} |
Can you make molecule Cc1cncc(NC(=O)N(C)Cc2cc(Br)ccc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cncc(NC(=O)ON=C2CCN(Cc3cc(Br)ccc3F)CC2)c1 | Cc1cncc(NC(=O)N(C)Cc2cc(Br)ccc2F)c1 | Cc1cncc(NC(=O)ON=C2CCN(Cc3cc(Br)ccc3F)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N45C"
} |
Can you make molecule Cc1cncc(NC(=O)N(C)Cc2cc(Br)ccc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cncc(NC(=O)N2CCC=C(CCc3cc(Br)ccc3F)C2)c1 | Cc1cncc(NC(=O)N(C)Cc2cc(Br)ccc2F)c1 | Cc1cncc(NC(=O)N2CCC=C(CCc3cc(Br)ccc3F)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "N45C"
} |
Can you make molecule Cc1cncc(NC(=O)N(C)Cc2cc(Br)ccc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cncc(NC(=O)N2Cc3nc(Cc4cc(Br)ccc4F)sc3C2)c1 | Cc1cncc(NC(=O)N(C)Cc2cc(Br)ccc2F)c1 | Cc1cncc(NC(=O)N2Cc3nc(Cc4cc(Br)ccc4F)sc3C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N45C"
} |
Can you make molecule C[C@H]1CN(S(=O)(=O)[C@@H](C)c2cnccn2)CC[NH2+]1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SN1CC[NH2+][C@@H](C)C1)c1cnccn1 | C[C@H]1CN(S(=O)(=O)[C@@H](C)c2cnccn2)CC[NH2+]1 | C[C@H](C(=O)SN1CC[NH2+][C@@H](C)C1)c1cnccn1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "S3(=O)(=O)[C@H]4C"
} |
Can you make molecule C[C@H]1CN(S(=O)(=O)[C@@H](C)c2cnccn2)CC[NH2+]1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(CC(C)(C)[C@@H](O)c2cnccn2)CC[NH2+]1 | C[C@H]1CN(S(=O)(=O)[C@@H](C)c2cnccn2)CC[NH2+]1 | C[C@H]1CN(CC(C)(C)[C@@H](O)c2cnccn2)CC[NH2+]1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)[C@H]&O",
"old_substring": "S3(=O)(=O)[C@H]4C"
} |
Can you make molecule C[C@H]1CN(S(=O)(=O)[C@@H](C)c2cnccn2)CC[NH2+]1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(C(=O)C[C@H](C)c2cnccn2)CC[NH2+]1 | C[C@H]1CN(S(=O)(=O)[C@@H](C)c2cnccn2)CC[NH2+]1 | C[C@H]1CN(C(=O)C[C@H](C)c2cnccn2)CC[NH2+]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@@H]&C",
"old_substring": "S3(=O)(=O)[C@H]4C"
} |
Can you make molecule C[C@H]1CN(S(=O)(=O)[C@@H](C)c2cnccn2)CC[NH2+]1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCc1cnccn1)C(=O)N1CC[NH2+][C@@H](C)C1 | C[C@H]1CN(S(=O)(=O)[C@@H](C)c2cnccn2)CC[NH2+]1 | C[C@H](CCc1cnccn1)C(=O)N1CC[NH2+][C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@H](C)CC&",
"old_substring": "S3(=O)(=O)[C@H]4C"
} |
Can you make molecule C[C@H]1CN(S(=O)(=O)[C@@H](C)c2cnccn2)CC[NH2+]1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(C(=O)[C@@H](C)CCc2cnccn2)CC[NH2+]1 | C[C@H]1CN(S(=O)(=O)[C@@H](C)c2cnccn2)CC[NH2+]1 | C[C@H]1CN(C(=O)[C@@H](C)CCc2cnccn2)CC[NH2+]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@@H](C)CC&",
"old_substring": "S3(=O)(=O)[C@H]4C"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.