prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCCC[C@@H](CC)C(=O)NCc1nc[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CC)C(=O)N1Cc2nc(Cc3nc[nH]n3)sc2C1 | CCCC[C@@H](CC)C(=O)NCc1nc[nH]n1 | CCCC[C@@H](CC)C(=O)N1Cc2nc(Cc3nc[nH]n3)sc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N23"
} |
Can you make molecule CCCC[C@@H](CC)C(=O)NCc1nc[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CC)C(=O)N1CCc2noc(Cc3nc[nH]n3)c2C1 | CCCC[C@@H](CC)C(=O)NCc1nc[nH]n1 | CCCC[C@@H](CC)C(=O)N1CCc2noc(Cc3nc[nH]n3)c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N23"
} |
Can you make molecule CCCC[C@@H](CC)C(=O)NCc1nc[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CC)C(=O)N1CCc2cc(Cc3nc[nH]n3)ccc21 | CCCC[C@@H](CC)C(=O)NCc1nc[nH]n1 | CCCC[C@@H](CC)C(=O)N1CCc2cc(Cc3nc[nH]n3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N23"
} |
Can you make molecule CCCC[C@@H](CC)C(=O)NCc1nc[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CC)C(=O)c1sc2nsc(Cc3nc[nH]n3)c2c1N | CCCC[C@@H](CC)C(=O)NCc1nc[nH]n1 | CCCC[C@@H](CC)C(=O)c1sc2nsc(Cc3nc[nH]n3)c2c1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&sc2nsc&c12",
"old_substring": "N23"
} |
Can you make molecule CCCC[C@@H](CC)C(=O)NCc1nc[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CC)C(=O)N1CCc2nc(Cc3nc[nH]n3)oc2C1 | CCCC[C@@H](CC)C(=O)NCc1nc[nH]n1 | CCCC[C@@H](CC)C(=O)N1CCc2nc(Cc3nc[nH]n3)oc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2nc&oc2C1",
"old_substring": "N23"
} |
Can you make molecule O[C@@H]1C[C@H](C2CCCCC2)[NH+](Cc2cccc3[nH]ccc23)C1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@@H]1C[C@H](C2CCCCCCC2)[NH+](Cc2cccc3[nH]ccc23)C1 | O[C@@H]1C[C@H](C2CCCCC2)[NH+](Cc2cccc3[nH]ccc23)C1 | O[C@@H]1C[C@H](C2CCCCCCC2)[NH+](Cc2cccc3[nH]ccc23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C16CCCCC1"
} |
Can you make molecule O[C@@H]1C[C@H](C2CCCCC2)[NH+](Cc2cccc3[nH]ccc23)C1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@@H]1C[C@H](SC2=CCCCCC2)[NH+](Cc2cccc3[nH]ccc23)C1 | O[C@@H]1C[C@H](C2CCCCC2)[NH+](Cc2cccc3[nH]ccc23)C1 | O[C@@H]1C[C@H](SC2=CCCCCC2)[NH+](Cc2cccc3[nH]ccc23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C16CCCCC1"
} |
Can you make molecule O[C@@H]1C[C@H](C2CCCCC2)[NH+](Cc2cccc3[nH]ccc23)C1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@@H]1C[C@H](C2CCCCCCCCCCC2)[NH+](Cc2cccc3[nH]ccc23)C1 | O[C@@H]1C[C@H](C2CCCCC2)[NH+](Cc2cccc3[nH]ccc23)C1 | O[C@@H]1C[C@H](C2CCCCCCCCCCC2)[NH+](Cc2cccc3[nH]ccc23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCCCCCC1",
"old_substring": "C16CCCCC1"
} |
Can you make molecule O[C@@H]1C[C@H](C2CCCCC2)[NH+](Cc2cccc3[nH]ccc23)C1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1([C@H]2C[C@@H](O)C[NH+]2Cc2cccc3[nH]ccc23)CCCCCCC1 | O[C@@H]1C[C@H](C2CCCCC2)[NH+](Cc2cccc3[nH]ccc23)C1 | N#CC1([C@H]2C[C@@H](O)C[NH+]2Cc2cccc3[nH]ccc23)CCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCCCCCC1",
"old_substring": "C16CCCCC1"
} |
Can you make molecule O[C@@H]1C[C@H](C2CCCCC2)[NH+](Cc2cccc3[nH]ccc23)C1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@@H]1C[C@H](C2C3=CC=CC=C2CCCC3)[NH+](Cc2cccc3[nH]ccc23)C1 | O[C@@H]1C[C@H](C2CCCCC2)[NH+](Cc2cccc3[nH]ccc23)C1 | O[C@@H]1C[C@H](C2C3=CC=CC=C2CCCC3)[NH+](Cc2cccc3[nH]ccc23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C2=CC=CC=C1CCCC2",
"old_substring": "C16CCCCC1"
} |
Can you make molecule Cc1ccc(-c2cnc(CCC(=O)O[C@H](C)c3nc4sc(C)c(C)c4c(=O)[nH]3)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CO[C@H](C)c1nc2sc(C)c(C)c2c(=O)[nH]1)c1ncc(-c2ccc(C)cc2)o1 | Cc1ccc(-c2cnc(CCC(=O)O[C@H](C)c3nc4sc(C)c(C)c4c(=O)[nH]3)o2)cc1 | CCC(CC)(C(=O)CO[C@H](C)c1nc2sc(C)c(C)c2c(=O)[nH]1)c1ncc(-c2ccc(C)cc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C7CC5=O"
} |
Can you make molecule Cc1ccc(-c2cnc(CCC(=O)O[C@H](C)c3nc4sc(C)c(C)c4c(=O)[nH]3)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCO[C@H](C)c1nc2sc(C)c(C)c2c(=O)[nH]1)c1ncc(-c2ccc(C)cc2)o1 | Cc1ccc(-c2cnc(CCC(=O)O[C@H](C)c3nc4sc(C)c(C)c4c(=O)[nH]3)o2)cc1 | CCC(CC)(C(=O)CCO[C@H](C)c1nc2sc(C)c(C)c2c(=O)[nH]1)c1ncc(-c2ccc(C)cc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C7CC5=O"
} |
Can you make molecule Cc1ccc(-c2cnc(CCC(=O)O[C@H](C)c3nc4sc(C)c(C)c4c(=O)[nH]3)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](c1ncc(-c2ccc(C)cc2)o1)[S@+]([O-])CO[C@H](C)c1nc2sc(C)c(C)c2c(=O)[nH]1 | Cc1ccc(-c2cnc(CCC(=O)O[C@H](C)c3nc4sc(C)c(C)c4c(=O)[nH]3)o2)cc1 | CC[C@H](c1ncc(-c2ccc(C)cc2)o1)[S@+]([O-])CO[C@H](C)c1nc2sc(C)c(C)c2c(=O)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&[S@](=O)C&",
"old_substring": "C7CC5=O"
} |
Can you make molecule Cc1ccc(-c2cnc(CCC(=O)O[C@H](C)c3nc4sc(C)c(C)c4c(=O)[nH]3)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](C(=O)O[C@H](C)c1nc2sc(C)c(C)c2c(=O)[nH]1)C(=O)c1ncc(-c2ccc(C)cc2)o1 | Cc1ccc(-c2cnc(CCC(=O)O[C@H](C)c3nc4sc(C)c(C)c4c(=O)[nH]3)o2)cc1 | CCCC[C@@H](C(=O)O[C@H](C)c1nc2sc(C)c(C)c2c(=O)[nH]1)C(=O)c1ncc(-c2ccc(C)cc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H](C&=O)C&=O",
"old_substring": "C7CC5=O"
} |
Can you make molecule Cc1ccc(-c2cnc(CCC(=O)O[C@H](C)c3nc4sc(C)c(C)c4c(=O)[nH]3)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2cnc(CCC[S@+]([O-])[C@@H](C)O[C@H](C)c3nc4sc(C)c(C)c4c(=O)[nH]3)o2)cc1 | Cc1ccc(-c2cnc(CCC(=O)O[C@H](C)c3nc4sc(C)c(C)c4c(=O)[nH]3)o2)cc1 | Cc1ccc(-c2cnc(CCC[S@+]([O-])[C@@H](C)O[C@H](C)c3nc4sc(C)c(C)c4c(=O)[nH]3)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC[S@](=O)[C@H]&C",
"old_substring": "C7CC5=O"
} |
Can you make molecule CCNC(=O)c1cccc(NC(=O)C[NH+](C)CC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)c1cccc(NC(=O)C[NH+]2CCC(CC)CC2)c1 | CCNC(=O)c1cccc(NC(=O)C[NH+](C)CC)c1 | CCNC(=O)c1cccc(NC(=O)C[NH+]2CCC(CC)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&CC1",
"old_substring": "[NH+]56C"
} |
Can you make molecule CCNC(=O)c1cccc(NC(=O)C[NH+](C)CC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH+](C)CCC(=O)Nc1cccc(C(=O)NCC)c1 | CCNC(=O)c1cccc(NC(=O)C[NH+](C)CC)c1 | CCC[NH+](C)CCC(=O)Nc1cccc(C(=O)NCC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[NH+](C&)C&",
"old_substring": "[NH+]56C"
} |
Can you make molecule CCNC(=O)c1cccc(NC(=O)C[NH+](C)CC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)c1cccc(NC(=O)CC[NH+]2CCC(CC)CC2)c1 | CCNC(=O)c1cccc(NC(=O)C[NH+](C)CC)c1 | CCNC(=O)c1cccc(NC(=O)CC[NH+]2CCC(CC)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&CC1",
"old_substring": "[NH+]56C"
} |
Can you make molecule CCNC(=O)c1cccc(NC(=O)C[NH+](C)CC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC1=CC[NH+](CC(=O)Nc2cccc(C(=O)NCC)c2)CC1 | CCNC(=O)c1cccc(NC(=O)C[NH+](C)CC)c1 | CCCC1=CC[NH+](CC(=O)Nc2cccc(C(=O)NCC)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC=C(C&)CC1",
"old_substring": "[NH+]56C"
} |
Can you make molecule CCNC(=O)c1cccc(NC(=O)C[NH+](C)CC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)c1cccc(NC(=O)C[NH+]2CCC[C@H](CC)CC2)c1 | CCNC(=O)c1cccc(NC(=O)C[NH+](C)CC)c1 | CCNC(=O)c1cccc(NC(=O)C[NH+]2CCC[C@H](CC)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@H]&CC1",
"old_substring": "[NH+]56C"
} |
Can you make molecule CCNS(=O)(=O)c1ccc(Cl)c(N)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC12CC(NS(=O)(=O)c3ccc(Cl)c(N)c3)=CC=CC=C1C2 | CCNS(=O)(=O)c1ccc(Cl)c(N)c1 | CC12CC(NS(=O)(=O)c3ccc(Cl)c(N)c3)=CC=CC=C1C2 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&Cc2ccccc2C1",
"old_substring": "CC2"
} |
Can you make molecule CCNS(=O)(=O)c1ccc(Cl)c(N)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCCC2=C(N=C1NS(=O)(=O)c1ccc(Cl)c(N)c1)S2 | CCNS(=O)(=O)c1ccc(Cl)c(N)c1 | CC1(C)CCCC2=C(N=C1NS(=O)(=O)c1ccc(Cl)c(N)c1)S2 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCCc2sc&nc21",
"old_substring": "CC2"
} |
Can you make molecule CCNS(=O)(=O)c1ccc(Cl)c(N)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CC2=CC2=CC=C(NS(=O)(=O)c2ccc(Cl)c(N)c2)O1 | CCNS(=O)(=O)c1ccc(Cl)c(N)c1 | CC1(C)CC2=CC2=CC=C(NS(=O)(=O)c2ccc(Cl)c(N)c2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)Cc2cc&ccc2O1",
"old_substring": "CC2"
} |
Can you make molecule CCNS(=O)(=O)c1ccc(Cl)c(N)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC2=CC2=CC=C1NS(=O)(=O)c1ccc(Cl)c(N)c1 | CCNS(=O)(=O)c1ccc(Cl)c(N)c1 | CN1CCC2=CC2=CC=C1NS(=O)(=O)c1ccc(Cl)c(N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CN1CCc2cc&ccc21",
"old_substring": "CC2"
} |
Can you make molecule CCNS(=O)(=O)c1ccc(Cl)c(N)c1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1cc(S(=O)(=O)NCCCCC23CC2C3)ccc1Cl | CCNS(=O)(=O)c1ccc(Cl)c(N)c1 | Nc1cc(S(=O)(=O)NCCCCC23CC2C3)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC2(CCCC2)C1",
"old_substring": "CC2"
} |
Can you make molecule COCCn1c2ccccc2n2c(=O)n(CC(=O)N(C)C)nc12 less soluble in water? The output molecule should be similar to the input molecule. | COCCn1c2ccccc2n2c(=O)n(CC(=O)C(C)C)nc12 | COCCn1c2ccccc2n2c(=O)n(CC(=O)N(C)C)nc12 | COCCn1c2ccccc2n2c(=O)n(CC(=O)C(C)C)nc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "N3(C)C"
} |
Can you make molecule COCCn1c2ccccc2n2c(=O)n(CC(=O)N(C)C)nc12 less soluble in water? The output molecule should be similar to the input molecule. | COCCn1c2ccccc2n2c(=O)n(CC(=O)CC(=N)S)nc12 | COCCn1c2ccccc2n2c(=O)n(CC(=O)N(C)C)nc12 | COCCn1c2ccccc2n2c(=O)n(CC(=O)CC(=N)S)nc12 | 102 | {
"fragment_index": 0,
"new_substring": "N=C(S)C&",
"old_substring": "N3(C)C"
} |
Can you make molecule COCCn1c2ccccc2n2c(=O)n(CC(=O)N(C)C)nc12 less soluble in water? The output molecule should be similar to the input molecule. | COCCn1c2ccccc2n2c(=O)n(CC(=O)N(C)C3=CCCC3)nc12 | COCCn1c2ccccc2n2c(=O)n(CC(=O)N(C)C)nc12 | COCCn1c2ccccc2n2c(=O)n(CC(=O)N(C)C3=CCCC3)nc12 | 102 | {
"fragment_index": 0,
"new_substring": "N&(C)C1=CCCC1",
"old_substring": "N3(C)C"
} |
Can you make molecule COCCn1c2ccccc2n2c(=O)n(CC(=O)N(C)C)nc12 less soluble in water? The output molecule should be similar to the input molecule. | COCCn1c2ccccc2n2c(=O)n(CC(=O)C(F)(F)C#N)nc12 | COCCn1c2ccccc2n2c(=O)n(CC(=O)N(C)C)nc12 | COCCn1c2ccccc2n2c(=O)n(CC(=O)C(F)(F)C#N)nc12 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC&(F)F",
"old_substring": "N3(C)C"
} |
Can you make molecule COCCn1c2ccccc2n2c(=O)n(CC(=O)N(C)C)nc12 less soluble in water? The output molecule should be similar to the input molecule. | COCCn1c2ccccc2n2c(=O)n(CC(=O)N3CCC(C)CC3)nc12 | COCCn1c2ccccc2n2c(=O)n(CC(=O)N(C)C)nc12 | COCCn1c2ccccc2n2c(=O)n(CC(=O)N3CCC(C)CC3)nc12 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)CC1",
"old_substring": "N3(C)C"
} |
Can you make molecule Cc1cscc1C[NH2+][C@H](C)CS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cscc1C1=CC=C([NH2+][C@H](C)CS(C)(=O)=O)N2CCC2=C1 | Cc1cscc1C[NH2+][C@H](C)CS(C)(=O)=O | Cc1cscc1C1=CC=C([NH2+][C@H](C)CS(C)(=O)=O)N2CCC2=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "C24"
} |
Can you make molecule Cc1cscc1C[NH2+][C@H](C)CS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cscc1-c1ncnc2sc-2c(C)c1[NH2+][C@H](C)CS(C)(=O)=O | Cc1cscc1C[NH2+][C@H](C)CS(C)(=O)=O | Cc1cscc1-c1ncnc2sc-2c(C)c1[NH2+][C@H](C)CS(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&sc2ncnc&c12",
"old_substring": "C24"
} |
Can you make molecule Cc1cscc1C[NH2+][C@H](C)CS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cscc1C1=CC=C2SCCN2C([NH2+][C@H](C)CS(C)(=O)=O)=C1 | Cc1cscc1C[NH2+][C@H](C)CS(C)(=O)=O | Cc1cscc1C1=CC=C2SCCN2C([NH2+][C@H](C)CS(C)(=O)=O)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "C24"
} |
Can you make molecule Cc1cscc1C[NH2+][C@H](C)CS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cscc1C1=C2CCN2CC([NH2+][C@H](C)CS(C)(=O)=O)=CC=C1 | Cc1cscc1C[NH2+][C@H](C)CS(C)(=O)=O | Cc1cscc1C1=C2CCN2CC([NH2+][C@H](C)CS(C)(=O)=O)=CC=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c&cccc2C1",
"old_substring": "C24"
} |
Can you make molecule Cc1cscc1C[NH2+][C@H](C)CS(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cscc1-c1ccc([NH2+][C@H](C)CS(C)(=O)=O)c(C)c2sc-2n1 | Cc1cscc1C[NH2+][C@H](C)CS(C)(=O)=O | Cc1cscc1-c1ccc([NH2+][C@H](C)CS(C)(=O)=O)c(C)c2sc-2n1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&sc2nc&ccc12",
"old_substring": "C24"
} |
Can you make molecule C[C@@H](OC(=O)c1cnc(-c2ccccc2)nc1)c1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1nccs1)OC(=O)c1cnc(-c2ccccc2)nc1 | C[C@@H](OC(=O)c1cnc(-c2ccccc2)nc1)c1nccs1 | C[C@H](CC(C)(C)c1nccs1)OC(=O)c1cnc(-c2ccccc2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@@H]46"
} |
Can you make molecule C[C@@H](OC(=O)c1cnc(-c2ccccc2)nc1)c1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCOC(=O)c1cnc(-c2ccccc2)nc1)CC(=O)c1nccs1 | C[C@@H](OC(=O)c1cnc(-c2ccccc2)nc1)c1nccs1 | C[C@@H](CCOC(=O)c1cnc(-c2ccccc2)nc1)CC(=O)c1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@@H]46"
} |
Can you make molecule C[C@@H](OC(=O)c1cnc(-c2ccccc2)nc1)c1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(OCC[C@H](Cl)c1nccs1)c1cnc(-c2ccccc2)nc1 | C[C@@H](OC(=O)c1cnc(-c2ccccc2)nc1)c1nccs1 | O=C(OCC[C@H](Cl)c1nccs1)c1cnc(-c2ccccc2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "C[C@@H]46"
} |
Can you make molecule C[C@@H](OC(=O)c1cnc(-c2ccccc2)nc1)c1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](CC(=O)c1nccs1)OC(=O)c1cnc(-c2ccccc2)nc1 | C[C@@H](OC(=O)c1cnc(-c2ccccc2)nc1)c1nccs1 | CCC[C@H](CC(=O)c1nccs1)OC(=O)c1cnc(-c2ccccc2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@@H]&CC&=O",
"old_substring": "C[C@@H]46"
} |
Can you make molecule C[C@@H](OC(=O)c1cnc(-c2ccccc2)nc1)c1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CCc1nccs1)OC(=O)c1cnc(-c2ccccc2)nc1 | C[C@@H](OC(=O)c1cnc(-c2ccccc2)nc1)c1nccs1 | CC(C)[C@H](CCc1nccs1)OC(=O)c1cnc(-c2ccccc2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "C[C@@H]46"
} |
Can you make molecule Cn1nc(C(C)(C)C)cc1C(=O)NCCc1nc(-c2ccc(Cl)cc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nc(C(C)(C)C)cc1C(=O)NCCc1nc(-c2ccc(Cl)cc2I)no1 | Cn1nc(C(C)(C)C)cc1C(=O)NCCc1nc(-c2ccc(Cl)cc2)no1 | Cn1nc(C(C)(C)C)cc1C(=O)NCCc1nc(-c2ccc(Cl)cc2I)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c18ccc(Cl)cc1"
} |
Can you make molecule Cn1nc(C(C)(C)C)cc1C(=O)NCCc1nc(-c2ccc(Cl)cc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nc(C(C)(C)C)cc1C(=O)NCCc1nc(-c2ccc(Cl)cc2Br)no1 | Cn1nc(C(C)(C)C)cc1C(=O)NCCc1nc(-c2ccc(Cl)cc2)no1 | Cn1nc(C(C)(C)C)cc1C(=O)NCCc1nc(-c2ccc(Cl)cc2Br)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c18ccc(Cl)cc1"
} |
Can you make molecule Cn1nc(C(C)(C)C)cc1C(=O)NCCc1nc(-c2ccc(Cl)cc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nc(C(C)(C)C)cc1C(=O)NCCc1nc(-c2ccc(Cl)c(I)c2)no1 | Cn1nc(C(C)(C)C)cc1C(=O)NCCc1nc(-c2ccc(Cl)cc2)no1 | Cn1nc(C(C)(C)C)cc1C(=O)NCCc1nc(-c2ccc(Cl)c(I)c2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c18ccc(Cl)cc1"
} |
Can you make molecule Cn1nc(C(C)(C)C)cc1C(=O)NCCc1nc(-c2ccc(Cl)cc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nc(C(C)(C)C)cc1C(=O)NCCc1nc(-c2cc(Cl)ccc2Cl)no1 | Cn1nc(C(C)(C)C)cc1C(=O)NCCc1nc(-c2ccc(Cl)cc2)no1 | Cn1nc(C(C)(C)C)cc1C(=O)NCCc1nc(-c2cc(Cl)ccc2Cl)no1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1ccc(Cl)c&c1",
"old_substring": "c18ccc(Cl)cc1"
} |
Can you make molecule Cn1nc(C(C)(C)C)cc1C(=O)NCCc1nc(-c2ccc(Cl)cc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nc(C(C)(C)C)cc1C(=O)NCCc1nc(-c2ccc(Cl)c(Cl)c2)no1 | Cn1nc(C(C)(C)C)cc1C(=O)NCCc1nc(-c2ccc(Cl)cc2)no1 | Cn1nc(C(C)(C)C)cc1C(=O)NCCc1nc(-c2ccc(Cl)c(Cl)c2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c18ccc(Cl)cc1"
} |
Can you make molecule COC(=O)C=Cc1ccc[n+]([O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | COSC(=O)C=Cc1ccc[n+]([O-])c1 | COC(=O)C=Cc1ccc[n+]([O-])c1 | COSC(=O)C=Cc1ccc[n+]([O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C2(=O)C=3"
} |
Can you make molecule COC(=O)C=Cc1ccc[n+]([O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)C1=C(N=Cc2ccc[n+]([O-])c2)CCS1 | COC(=O)C=Cc1ccc[n+]([O-])c1 | COC(=O)C1=C(N=Cc2ccc[n+]([O-])c2)CCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=C(N&)CCS1",
"old_substring": "C2(=O)C=3"
} |
Can you make molecule COC(=O)C=Cc1ccc[n+]([O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)C(N=Cc1ccc[n+]([O-])c1)=C(Cl)Cl | COC(=O)C=Cc1ccc[n+]([O-])c1 | COC(=O)C(N=Cc1ccc[n+]([O-])c1)=C(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(N&)=C(Cl)Cl",
"old_substring": "C2(=O)C=3"
} |
Can you make molecule COC(=O)C=Cc1ccc[n+]([O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)C(C=Cc1ccc[n+]([O-])c1)=C(Cl)Cl | COC(=O)C=Cc1ccc[n+]([O-])c1 | COC(=O)C(C=Cc1ccc[n+]([O-])c1)=C(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C&)=C(Cl)Cl",
"old_substring": "C2(=O)C=3"
} |
Can you make molecule COC(=O)C=Cc1ccc[n+]([O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | COC[S@+]([O-])CCC=Cc1ccc[n+]([O-])c1 | COC(=O)C=Cc1ccc[n+]([O-])c1 | COC[S@+]([O-])CCC=Cc1ccc[n+]([O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C2(=O)C=3"
} |
Can you make molecule C[C@H]1CCCC[C@@H]1OCCNC(=O)Cn1cnc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCC[C@@H]1OCCCCNC(=O)Cn1cnc([N+](=O)[O-])c1 | C[C@H]1CCCC[C@@H]1OCCNC(=O)Cn1cnc([N+](=O)[O-])c1 | C[C@H]1CCCC[C@@H]1OCCCCNC(=O)Cn1cnc([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C3C5"
} |
Can you make molecule C[C@H]1CCCC[C@@H]1OCCNC(=O)Cn1cnc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCC[C@@H]1OCCCCCNC(=O)Cn1cnc([N+](=O)[O-])c1 | C[C@H]1CCCC[C@@H]1OCCNC(=O)Cn1cnc([N+](=O)[O-])c1 | C[C@H]1CCCC[C@@H]1OCCCCCNC(=O)Cn1cnc([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C3C5"
} |
Can you make molecule C[C@H]1CCCC[C@@H]1OCCNC(=O)Cn1cnc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCC[C@@H]1OC1CC(NC(=O)Cn2cnc([N+](=O)[O-])c2)C1 | C[C@H]1CCCC[C@@H]1OCCNC(=O)Cn1cnc([N+](=O)[O-])c1 | C[C@H]1CCCC[C@@H]1OC1CC(NC(=O)Cn2cnc([N+](=O)[O-])c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C3C5"
} |
Can you make molecule C[C@H]1CCCC[C@@H]1OCCNC(=O)Cn1cnc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNC(=O)Cn1cnc([N+](=O)[O-])c1)O[C@H]1CCCC[C@@H]1C | C[C@H]1CCCC[C@@H]1OCCNC(=O)Cn1cnc([N+](=O)[O-])c1 | C[C@@H](CCNC(=O)Cn1cnc([N+](=O)[O-])c1)O[C@H]1CCCC[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C3C5"
} |
Can you make molecule C[C@H]1CCCC[C@@H]1OCCNC(=O)Cn1cnc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCC[C@@H]1OC1CCC(NC(=O)Cn2cnc([N+](=O)[O-])c2)CC1 | C[C@H]1CCCC[C@@H]1OCCNC(=O)Cn1cnc([N+](=O)[O-])c1 | C[C@H]1CCCC[C@@H]1OC1CCC(NC(=O)Cn2cnc([N+](=O)[O-])c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C3C5"
} |
Can you make molecule CCn1c(CN2CCN([C@H](C)C(=O)N3CCCC3)CC2)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCn1c(CN2CCN([C@H](C)C(=O)N3CCCCCC3)CC2)nc2ccccc21 | CCn1c(CN2CCN([C@H](C)C(=O)N3CCCC3)CC2)nc2ccccc21 | CCn1c(CN2CCN([C@H](C)C(=O)N3CCCCCC3)CC2)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCC1",
"old_substring": "N14CCCC1"
} |
Can you make molecule CCn1c(CN2CCN([C@H](C)C(=O)N3CCCC3)CC2)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCn1c(CN2CCN([C@H](C)C(=O)N3CCCCCCC3)CC2)nc2ccccc21 | CCn1c(CN2CCN([C@H](C)C(=O)N3CCCC3)CC2)nc2ccccc21 | CCn1c(CN2CCN([C@H](C)C(=O)N3CCCCCCC3)CC2)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1",
"old_substring": "N14CCCC1"
} |
Can you make molecule CCn1c(CN2CCN([C@H](C)C(=O)N3CCCC3)CC2)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCn1c(CN2CCN([C@H](C)C(=O)N3CCC(C)CC3)CC2)nc2ccccc21 | CCn1c(CN2CCN([C@H](C)C(=O)N3CCCC3)CC2)nc2ccccc21 | CCn1c(CN2CCN([C@H](C)C(=O)N3CCC(C)CC3)CC2)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)CC1",
"old_substring": "N14CCCC1"
} |
Can you make molecule CCn1c(CN2CCN([C@H](C)C(=O)N3CCCC3)CC2)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCn1c(CN2CCN([C@H](C)C(=O)N3CCCCCCCC3)CC2)nc2ccccc21 | CCn1c(CN2CCN([C@H](C)C(=O)N3CCCC3)CC2)nc2ccccc21 | CCn1c(CN2CCN([C@H](C)C(=O)N3CCCCCCCC3)CC2)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCCC1",
"old_substring": "N14CCCC1"
} |
Can you make molecule CCn1c(CN2CCN([C@H](C)C(=O)N3CCCC3)CC2)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCn1c(CN2CCN([C@H](C)C(=O)N3CCCCCCC3=O)CC2)nc2ccccc21 | CCn1c(CN2CCN([C@H](C)C(=O)N3CCCC3)CC2)nc2ccccc21 | CCn1c(CN2CCN([C@H](C)C(=O)N3CCCCCCC3=O)CC2)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1=O",
"old_substring": "N14CCCC1"
} |
Can you make molecule C[C@@H](NC(=O)C[C@@H]1CCCO1)c1ccc(NC(=O)c2ccncc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NSC(=O)C[C@@H]1CCCO1)c1ccc(NC(=O)c2ccncc2)cc1 | C[C@@H](NC(=O)C[C@@H]1CCCO1)c1ccc(NC(=O)c2ccncc2)cc1 | C[C@@H](NSC(=O)C[C@@H]1CCCO1)c1ccc(NC(=O)c2ccncc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C8"
} |
Can you make molecule C[C@@H](NC(=O)C[C@@H]1CCCO1)c1ccc(NC(=O)c2ccncc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)CC(C)(C)[C@@H]1CCCO1)c1ccc(NC(=O)c2ccncc2)cc1 | C[C@@H](NC(=O)C[C@@H]1CCCO1)c1ccc(NC(=O)c2ccncc2)cc1 | C[C@@H](NC(=O)CC(C)(C)[C@@H]1CCCO1)c1ccc(NC(=O)c2ccncc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C8"
} |
Can you make molecule C[C@@H](NC(=O)C[C@@H]1CCCO1)c1ccc(NC(=O)c2ccncc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC[S@+]([O-])CCC[C@@H]1CCCO1)c1ccc(NC(=O)c2ccncc2)cc1 | C[C@@H](NC(=O)C[C@@H]1CCCO1)c1ccc(NC(=O)c2ccncc2)cc1 | C[C@@H](NC[S@+]([O-])CCC[C@@H]1CCCO1)c1ccc(NC(=O)c2ccncc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C8"
} |
Can you make molecule C[C@@H](NC(=O)C[C@@H]1CCCO1)c1ccc(NC(=O)c2ccncc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)CCC(C)(C)[C@@H]1CCCO1)c1ccc(NC(=O)c2ccncc2)cc1 | C[C@@H](NC(=O)C[C@@H]1CCCO1)c1ccc(NC(=O)c2ccncc2)cc1 | C[C@@H](NC(=O)CCC(C)(C)[C@@H]1CCCO1)c1ccc(NC(=O)c2ccncc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C8"
} |
Can you make molecule C[C@@H](NC(=O)C[C@@H]1CCCO1)c1ccc(NC(=O)c2ccncc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)C[C@H](C)[C@@H]1CCCO1)c1ccc(NC(=O)c2ccncc2)cc1 | C[C@@H](NC(=O)C[C@@H]1CCCO1)c1ccc(NC(=O)c2ccncc2)cc1 | C[C@@H](NC(=O)C[C@H](C)[C@@H]1CCCO1)c1ccc(NC(=O)c2ccncc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@@H]&C",
"old_substring": "C3(=O)C8"
} |
Can you make molecule CC(C)[NH+]1CCCN(C(=O)C(C)(C)c2cccc(C#N)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[NH+]1CCCN(C(=O)CCC(C)(C)c2cccc(C#N)c2)CC1 | CC(C)[NH+]1CCCN(C(=O)C(C)(C)c2cccc(C#N)c2)CC1 | CC(C)[NH+]1CCCN(C(=O)CCC(C)(C)c2cccc(C#N)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C5(C)C"
} |
Can you make molecule CC(C)[NH+]1CCCN(C(=O)C(C)(C)c2cccc(C#N)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[NH+]1CCCN(C(=O)C(C)(C)CCCc2cccc(C#N)c2)CC1 | CC(C)[NH+]1CCCN(C(=O)C(C)(C)c2cccc(C#N)c2)CC1 | CC(C)[NH+]1CCCN(C(=O)C(C)(C)CCCc2cccc(C#N)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(C)CCC&",
"old_substring": "C3(=O)C5(C)C"
} |
Can you make molecule CC(C)[NH+]1CCCN(C(=O)C(C)(C)c2cccc(C#N)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[NH+]1CCCN(C(=O)C(C)(C)C(C)(C)c2cccc(C#N)c2)CC1 | CC(C)[NH+]1CCCN(C(=O)C(C)(C)c2cccc(C#N)c2)CC1 | CC(C)[NH+]1CCCN(C(=O)C(C)(C)C(C)(C)c2cccc(C#N)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(C)C&(C)C",
"old_substring": "C3(=O)C5(C)C"
} |
Can you make molecule CC(C)[NH+]1CCCN(C(=O)C(C)(C)c2cccc(C#N)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[NH+]1CCCN(C(=O)C(Cc2cccc(C#N)c2)=C(Cl)Cl)CC1 | CC(C)[NH+]1CCCN(C(=O)C(C)(C)c2cccc(C#N)c2)CC1 | CC(C)[NH+]1CCCN(C(=O)C(Cc2cccc(C#N)c2)=C(Cl)Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C&)=C(Cl)Cl",
"old_substring": "C3(=O)C5(C)C"
} |
Can you make molecule CC(C)[NH+]1CCCN(C(=O)C(C)(C)c2cccc(C#N)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CC(=O)N1CCC[NH+](C(C)C)CC1)c1cccc(C#N)c1 | CC(C)[NH+]1CCCN(C(=O)C(C)(C)c2cccc(C#N)c2)CC1 | CC(C)[C@H](CC(=O)N1CCC[NH+](C(C)C)CC1)c1cccc(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&C(C)C",
"old_substring": "C3(=O)C5(C)C"
} |
Can you make molecule COc1cccc(C=C2C(=O)NC(=S)N(c3cccc(Br)c3)C2=O)c1OC(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C=C2C(=O)NC(=S)N(c3cccc(Br)c3)C2=O)c1OC1(C)CCCC1 | COc1cccc(C=C2C(=O)NC(=S)N(c3cccc(Br)c3)C2=O)c1OC(C)C | COc1cccc(C=C2C(=O)NC(=S)N(c3cccc(Br)c3)C2=O)c1OC1(C)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C4(C)C"
} |
Can you make molecule COc1cccc(C=C2C(=O)NC(=S)N(c3cccc(Br)c3)C2=O)c1OC(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C=C2C(=O)NC(=S)N(c3cccc(Br)c3)C2=O)c1OC(Cl)(Cl)Cl | COc1cccc(C=C2C(=O)NC(=S)N(c3cccc(Br)c3)C2=O)c1OC(C)C | COc1cccc(C=C2C(=O)NC(=S)N(c3cccc(Br)c3)C2=O)c1OC(Cl)(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C4(C)C"
} |
Can you make molecule COc1cccc(C=C2C(=O)NC(=S)N(c3cccc(Br)c3)C2=O)c1OC(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)Oc1c(C=C2C(=O)NC(=S)N(c3cccc(Br)c3)C2=O)cccc1OC | COc1cccc(C=C2C(=O)NC(=S)N(c3cccc(Br)c3)C2=O)c1OC(C)C | CCCC(C)(C)Oc1c(C=C2C(=O)NC(=S)N(c3cccc(Br)c3)C2=O)cccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "C4(C)C"
} |
Can you make molecule COc1cccc(C=C2C(=O)NC(=S)N(c3cccc(Br)c3)C2=O)c1OC(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(CC)Oc1c(C=C2C(=O)NC(=S)N(c3cccc(Br)c3)C2=O)cccc1OC | COc1cccc(C=C2C(=O)NC(=S)N(c3cccc(Br)c3)C2=O)c1OC(C)C | CCC(C)(CC)Oc1c(C=C2C(=O)NC(=S)N(c3cccc(Br)c3)C2=O)cccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "C4(C)C"
} |
Can you make molecule COc1cccc(C=C2C(=O)NC(=S)N(c3cccc(Br)c3)C2=O)c1OC(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C=C2C(=O)NC(=S)N(c3cccc(Br)c3)C2=O)c1OC1(C=O)CCCCCC1 | COc1cccc(C=C2C(=O)NC(=S)N(c3cccc(Br)c3)C2=O)c1OC(C)C | COc1cccc(C=C2C(=O)NC(=S)N(c3cccc(Br)c3)C2=O)c1OC1(C=O)CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C=O)CCCCCC1",
"old_substring": "C4(C)C"
} |
Can you make molecule CCOC(C(=O)NN1CCCCC1)(c1ccccc1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC12CC(OC(C(=O)NN3CCCCC3)(c3ccccc3)c3ccccc3)=CC=CC=C1C2 | CCOC(C(=O)NN1CCCCC1)(c1ccccc1)c1ccccc1 | CC12CC(OC(C(=O)NN3CCCCC3)(c3ccccc3)c3ccccc3)=CC=CC=C1C2 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&Cc2ccccc2C1",
"old_substring": "CC2"
} |
Can you make molecule CCOC(C(=O)NN1CCCCC1)(c1ccccc1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCCC2=C(N=C1OC(C(=O)NN1CCCCC1)(c1ccccc1)c1ccccc1)S2 | CCOC(C(=O)NN1CCCCC1)(c1ccccc1)c1ccccc1 | CC1(C)CCCC2=C(N=C1OC(C(=O)NN1CCCCC1)(c1ccccc1)c1ccccc1)S2 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCCc2sc&nc21",
"old_substring": "CC2"
} |
Can you make molecule CCOC(C(=O)NN1CCCCC1)(c1ccccc1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CC2=CC2=CC=C(OC(C(=O)NN2CCCCC2)(c2ccccc2)c2ccccc2)O1 | CCOC(C(=O)NN1CCCCC1)(c1ccccc1)c1ccccc1 | CC1(C)CC2=CC2=CC=C(OC(C(=O)NN2CCCCC2)(c2ccccc2)c2ccccc2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)Cc2cc&ccc2O1",
"old_substring": "CC2"
} |
Can you make molecule CCOC(C(=O)NN1CCCCC1)(c1ccccc1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC2=CC2=CC=C1OC(C(=O)NN1CCCCC1)(c1ccccc1)c1ccccc1 | CCOC(C(=O)NN1CCCCC1)(c1ccccc1)c1ccccc1 | CN1CCC2=CC2=CC=C1OC(C(=O)NN1CCCCC1)(c1ccccc1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CN1CCc2cc&ccc21",
"old_substring": "CC2"
} |
Can you make molecule CCOC(C(=O)NN1CCCCC1)(c1ccccc1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN1CCCCC1)C(OCCCCC12CC1C2)(c1ccccc1)c1ccccc1 | CCOC(C(=O)NN1CCCCC1)(c1ccccc1)c1ccccc1 | O=C(NN1CCCCC1)C(OCCCCC12CC1C2)(c1ccccc1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC2(CCCC2)C1",
"old_substring": "CC2"
} |
Can you make molecule CC(=O)Nc1cccc(CNC(=O)N[C@H](C)C(=O)NCc2ccco2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cccc(CSCNC(=O)N[C@H](C)C(=O)NCc2ccco2)c1 | CC(=O)Nc1cccc(CNC(=O)N[C@H](C)C(=O)NCc2ccco2)c1 | CC(=O)Nc1cccc(CSCNC(=O)N[C@H](C)C(=O)NCc2ccco2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N58"
} |
Can you make molecule CC(=O)Nc1cccc(CNC(=O)N[C@H](C)C(=O)NCc2ccco2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cccc(CSC(=N)NC(=O)N[C@H](C)C(=O)NCc2ccco2)c1 | CC(=O)Nc1cccc(CNC(=O)N[C@H](C)C(=O)NCc2ccco2)c1 | CC(=O)Nc1cccc(CSC(=N)NC(=O)N[C@H](C)C(=O)NCc2ccco2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N58"
} |
Can you make molecule CC(=O)Nc1cccc(CNC(=O)N[C@H](C)C(=O)NCc2ccco2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cccc(CSC(=S)N(C)C(=O)N[C@H](C)C(=O)NCc2ccco2)c1 | CC(=O)Nc1cccc(CNC(=O)N[C@H](C)C(=O)NCc2ccco2)c1 | CC(=O)Nc1cccc(CSC(=S)N(C)C(=O)N[C@H](C)C(=O)NCc2ccco2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N58"
} |
Can you make molecule CC(=O)Nc1cccc(CNC(=O)N[C@H](C)C(=O)NCc2ccco2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cccc(CSC2=NCCN2C(=O)N[C@H](C)C(=O)NCc2ccco2)c1 | CC(=O)Nc1cccc(CNC(=O)N[C@H](C)C(=O)NCc2ccco2)c1 | CC(=O)Nc1cccc(CSC2=NCCN2C(=O)N[C@H](C)C(=O)NCc2ccco2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N58"
} |
Can you make molecule CC(=O)Nc1cccc(CNC(=O)N[C@H](C)C(=O)NCc2ccco2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cccc(CC2CCN(CC(=O)N[C@H](C)C(=O)NCc3ccco3)CC2)c1 | CC(=O)Nc1cccc(CNC(=O)N[C@H](C)C(=O)NCc2ccco2)c1 | CC(=O)Nc1cccc(CC2CCN(CC(=O)N[C@H](C)C(=O)NCc3ccco3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N58"
} |
Can you make molecule CC(C)OCC[C@H]1CCCCN1C(=O)NC1CCC([NH+]2CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCOCC[C@H]1CCCCN1C(=O)NC1CCC([NH+]2CCCCC2)CC1 | CC(C)OCC[C@H]1CCCCN1C(=O)NC1CCC([NH+]2CCCCC2)CC1 | CC(C)CCOCC[C@H]1CCCCN1C(=O)NC1CCC([NH+]2CCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)OCC[C@H]1CCCCN1C(=O)NC1CCC([NH+]2CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC1CCC([NH+]2CCCCC2)CC1)N1CCCC[C@@H]1CCOCCCCBr | CC(C)OCC[C@H]1CCCCN1C(=O)NC1CCC([NH+]2CCCCC2)CC1 | O=C(NC1CCC([NH+]2CCCCC2)CC1)N1CCCC[C@@H]1CCOCCCCBr | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)OCC[C@H]1CCCCN1C(=O)NC1CCC([NH+]2CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCOCC[C@H]1CCCCN1C(=O)NC1CCC([NH+]2CCCCC2)CC1 | CC(C)OCC[C@H]1CCCCN1C(=O)NC1CCC([NH+]2CCCCC2)CC1 | C=CCCCOCC[C@H]1CCCCN1C(=O)NC1CCC([NH+]2CCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)OCC[C@H]1CCCCN1C(=O)NC1CCC([NH+]2CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC1CCC([NH+]2CCCCC2)CC1)N1CCCC[C@@H]1CCOCCCCCl | CC(C)OCC[C@H]1CCCCN1C(=O)NC1CCC([NH+]2CCCCC2)CC1 | O=C(NC1CCC([NH+]2CCCCC2)CC1)N1CCCC[C@@H]1CCOCCCCCl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)OCC[C@H]1CCCCN1C(=O)NC1CCC([NH+]2CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCOCC[C@H]1CCCCN1C(=O)NC1CCC([NH+]2CCCCC2)CC1 | CC(C)OCC[C@H]1CCCCN1C(=O)NC1CCC([NH+]2CCCCC2)CC1 | C=CCCCCOCC[C@H]1CCCCN1C(=O)NC1CCC([NH+]2CCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)[C@H](NC(=O)Cc1ccccc1)C(=O)Nc1nc(-c2cccnc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](NC(=O)Cc1ccccc1Cl)C(=O)Nc1nc(-c2cccnc2)cs1 | CC(C)[C@H](NC(=O)Cc1ccccc1)C(=O)Nc1nc(-c2cccnc2)cs1 | CC(C)[C@H](NC(=O)Cc1ccccc1Cl)C(=O)Nc1nc(-c2cccnc2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c17ccccc1"
} |
Can you make molecule CC(C)[C@H](NC(=O)Cc1ccccc1)C(=O)Nc1nc(-c2cccnc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](NC(=O)Cc1ccc(I)cc1)C(=O)Nc1nc(-c2cccnc2)cs1 | CC(C)[C@H](NC(=O)Cc1ccccc1)C(=O)Nc1nc(-c2cccnc2)cs1 | CC(C)[C@H](NC(=O)Cc1ccc(I)cc1)C(=O)Nc1nc(-c2cccnc2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c17ccccc1"
} |
Can you make molecule CC(C)[C@H](NC(=O)Cc1ccccc1)C(=O)Nc1nc(-c2cccnc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CC(=O)N[C@H](C(=O)Nc2nc(-c3cccnc3)cs2)C(C)C)cc1I | CC(C)[C@H](NC(=O)Cc1ccccc1)C(=O)Nc1nc(-c2cccnc2)cs1 | Cc1ccc(CC(=O)N[C@H](C(=O)Nc2nc(-c3cccnc3)cs2)C(C)C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c17ccccc1"
} |
Can you make molecule CC(C)[C@H](NC(=O)Cc1ccccc1)C(=O)Nc1nc(-c2cccnc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](NC(=O)Cc1cccc(Br)c1)C(=O)Nc1nc(-c2cccnc2)cs1 | CC(C)[C@H](NC(=O)Cc1ccccc1)C(=O)Nc1nc(-c2cccnc2)cs1 | CC(C)[C@H](NC(=O)Cc1cccc(Br)c1)C(=O)Nc1nc(-c2cccnc2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c17ccccc1"
} |
Can you make molecule CC(C)[C@H](NC(=O)Cc1ccccc1)C(=O)Nc1nc(-c2cccnc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CC(=O)N[C@H](C(=O)Nc2nc(-c3cccnc3)cs2)C(C)C)c1C | CC(C)[C@H](NC(=O)Cc1ccccc1)C(=O)Nc1nc(-c2cccnc2)cs1 | Cc1cccc(CC(=O)N[C@H](C(=O)Nc2nc(-c3cccnc3)cs2)C(C)C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c17ccccc1"
} |
Can you make molecule Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCN1CCOCC1)C3=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCN1CCCC1)C3=O | Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCN1CCOCC1)C3=O | Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCN1CCCC1)C3=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC1",
"old_substring": "N14CCOCC1"
} |
Can you make molecule Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCN1CCOCC1)C3=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCN1CCCCC1)C3=O | Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCN1CCOCC1)C3=O | Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCN1CCCCC1)C3=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "N14CCOCC1"
} |
Can you make molecule Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCN1CCOCC1)C3=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCN1CCSCC1)C3=O | Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCN1CCOCC1)C3=O | Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCN1CCSCC1)C3=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSCC1",
"old_substring": "N14CCOCC1"
} |
Can you make molecule Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCN1CCOCC1)C3=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCN1CC=CC1)C3=O | Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCN1CCOCC1)C3=O | Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCN1CC=CC1)C3=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=CC1",
"old_substring": "N14CCOCC1"
} |
Can you make molecule Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCN1CCOCC1)C3=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCSSN1CCOCC1)C3=O | Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCN1CCOCC1)C3=O | Cc1cc2oc3c(c(=O)c2cc1Cl)[C@H](c1cccnc1)N(CCCSSN1CCOCC1)C3=O | 102 | {
"fragment_index": 0,
"new_substring": "S&SN1CCOCC1",
"old_substring": "N14CCOCC1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.