prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule N#CCOc1cccc(CC(=O)N2CCO[C@@H](c3nccs3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(Cc1cccc(OCC#N)c1)=N/ON1CCO[C@@H](c2nccs2)C1 | N#CCOc1cccc(CC(=O)N2CCO[C@@H](c3nccs3)C2)c1 | C/C(Cc1cccc(OCC#N)c1)=N/ON1CCO[C@@H](c2nccs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C7C4=O"
} |
Can you make molecule N#CCOc1cccc(CC(=O)N2CCO[C@@H](c3nccs3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CN1CCO[C@@H](c2nccs2)C1)c1cccc(OCC#N)c1 | N#CCOc1cccc(CC(=O)N2CCO[C@@H](c3nccs3)C2)c1 | CCC(CC)(C(=O)CN1CCO[C@@H](c2nccs2)C1)c1cccc(OCC#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C7C4=O"
} |
Can you make molecule N#CCOc1cccc(CC(=O)N2CCO[C@@H](c3nccs3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCOc1cccc(SSC(=O)N2CCO[C@@H](c3nccs3)C2)c1 | N#CCOc1cccc(CC(=O)N2CCO[C@@H](c3nccs3)C2)c1 | N#CCOc1cccc(SSC(=O)N2CCO[C@@H](c3nccs3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C7C4=O"
} |
Can you make molecule N#CCOc1cccc(CC(=O)N2CCO[C@@H](c3nccs3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCN1CCO[C@@H](c2nccs2)C1)c1cccc(OCC#N)c1 | N#CCOc1cccc(CC(=O)N2CCO[C@@H](c3nccs3)C2)c1 | CCC(CC)(C(=O)CCN1CCO[C@@H](c2nccs2)C1)c1cccc(OCC#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C7C4=O"
} |
Can you make molecule N#CCOc1cccc(CC(=O)N2CCO[C@@H](c3nccs3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)c1cccc(OCC#N)c1)C(=O)N1CCO[C@@H](c2nccs2)C1 | N#CCOc1cccc(CC(=O)N2CCO[C@@H](c3nccs3)C2)c1 | CC[C@H](C(=O)c1cccc(OCC#N)c1)C(=O)N1CCO[C@@H](c2nccs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C7C4=O"
} |
Can you make molecule O=C(NCCNc1ncccn1)[C@@H]1COc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCCCNc1ncccn1)[C@@H]1COc2ccccc2O1 | O=C(NCCNc1ncccn1)[C@@H]1COc2ccccc2O1 | O=C(NCCCCNc1ncccn1)[C@@H]1COc2ccccc2O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C4C5"
} |
Can you make molecule O=C(NCCNc1ncccn1)[C@@H]1COc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N=CCCNc1ncccn1)[C@@H]1COc2ccccc2O1 | O=C(NCCNc1ncccn1)[C@@H]1COc2ccccc2O1 | O=C(N=CCCNc1ncccn1)[C@@H]1COc2ccccc2O1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C4C5"
} |
Can you make molecule O=C(NCCNc1ncccn1)[C@@H]1COc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCCCCNc1ncccn1)[C@@H]1COc2ccccc2O1 | O=C(NCCNc1ncccn1)[C@@H]1COc2ccccc2O1 | O=C(NCCCCCNc1ncccn1)[C@@H]1COc2ccccc2O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4C5"
} |
Can you make molecule O=C(NCCNc1ncccn1)[C@@H]1COc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC1CC(Nc2ncccn2)C1)[C@@H]1COc2ccccc2O1 | O=C(NCCNc1ncccn1)[C@@H]1COc2ccccc2O1 | O=C(NC1CC(Nc2ncccn2)C1)[C@@H]1COc2ccccc2O1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C4C5"
} |
Can you make molecule O=C(NCCNc1ncccn1)[C@@H]1COc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | CC(CCNc1ncccn1)=NC(=O)[C@@H]1COc2ccccc2O1 | O=C(NCCNc1ncccn1)[C@@H]1COc2ccccc2O1 | CC(CCNc1ncccn1)=NC(=O)[C@@H]1COc2ccccc2O1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C4C5"
} |
Can you make molecule COCc1cccc(O[C@@H]2CC[C@](C#N)(NC(C)C)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(O[C@@H]2CC[C@](C#N)(NC(C)C)C2)cc1I | COCc1cccc(O[C@@H]2CC[C@](C#N)(NC(C)C)C2)c1 | COCc1ccc(O[C@@H]2CC[C@](C#N)(NC(C)C)C2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c18cccc5c1"
} |
Can you make molecule COCc1cccc(O[C@@H]2CC[C@](C#N)(NC(C)C)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(O[C@@H]2CC[C@](C#N)(NC(C)C)C2)ccc1Br | COCc1cccc(O[C@@H]2CC[C@](C#N)(NC(C)C)C2)c1 | COCc1cc(O[C@@H]2CC[C@](C#N)(NC(C)C)C2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c18cccc5c1"
} |
Can you make molecule COCc1cccc(O[C@@H]2CC[C@](C#N)(NC(C)C)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(O[C@@H]2CC[C@](C#N)(NC(C)C)C2)cc1Cl | COCc1cccc(O[C@@H]2CC[C@](C#N)(NC(C)C)C2)c1 | COCc1ccc(O[C@@H]2CC[C@](C#N)(NC(C)C)C2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c18cccc5c1"
} |
Can you make molecule COCc1cccc(O[C@@H]2CC[C@](C#N)(NC(C)C)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cccc(O[C@@H]2CC[C@](C#N)(NC(C)C)C2)c1Br | COCc1cccc(O[C@@H]2CC[C@](C#N)(NC(C)C)C2)c1 | COCc1cccc(O[C@@H]2CC[C@](C#N)(NC(C)C)C2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c18cccc5c1"
} |
Can you make molecule COCc1cccc(O[C@@H]2CC[C@](C#N)(NC(C)C)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cccc(O[C@@H]2CC[C@](C#N)(NC(C)C)C2)c1Cl | COCc1cccc(O[C@@H]2CC[C@](C#N)(NC(C)C)C2)c1 | COCc1cccc(O[C@@H]2CC[C@](C#N)(NC(C)C)C2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c18cccc5c1"
} |
Can you make molecule CC1(C)CN(CC(=O)N2CCCC2)c2ccc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)cc21 less soluble in water? The output molecule should be similar to the input molecule. | C/C(CN1CC(C)(C)c2cc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)ccc21)=N/ON1CCCC1 | CC1(C)CN(CC(=O)N2CCCC2)c2ccc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)cc21 | C/C(CN1CC(C)(C)c2cc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)ccc21)=N/ON1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C6C5=O"
} |
Can you make molecule CC1(C)CN(CC(=O)N2CCCC2)c2ccc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)cc21 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CN1CCCC1)N1CC(C)(C)c2cc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)ccc21 | CC1(C)CN(CC(=O)N2CCCC2)c2ccc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)cc21 | CCC(CC)(C(=O)CN1CCCC1)N1CC(C)(C)c2cc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C6C5=O"
} |
Can you make molecule CC1(C)CN(CC(=O)N2CCCC2)c2ccc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)cc21 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CN(SSC(=O)N2CCCC2)c2ccc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)cc21 | CC1(C)CN(CC(=O)N2CCCC2)c2ccc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)cc21 | CC1(C)CN(SSC(=O)N2CCCC2)c2ccc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C6C5=O"
} |
Can you make molecule CC1(C)CN(CC(=O)N2CCCC2)c2ccc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)cc21 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCN1CCCC1)N1CC(C)(C)c2cc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)ccc21 | CC1(C)CN(CC(=O)N2CCCC2)c2ccc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)cc21 | CCC(CC)(C(=O)CCN1CCCC1)N1CC(C)(C)c2cc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C6C5=O"
} |
Can you make molecule CC1(C)CN(CC(=O)N2CCCC2)c2ccc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)cc21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C(=O)N1CCCC1)C(=O)N1CC(C)(C)c2cc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)ccc21 | CC1(C)CN(CC(=O)N2CCCC2)c2ccc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)cc21 | CC[C@@H](C(=O)N1CCCC1)C(=O)N1CC(C)(C)c2cc(S(=O)(=O)Nc3ccc4c(c3)OCCO4)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C6C5=O"
} |
Can you make molecule CCCSc1ncc(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCCSc1nc(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)ncc1I | CCCSc1ncc(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)cn1 | CCCSc1nc(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)ncc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1I",
"old_substring": "c18ncc7cn1"
} |
Can you make molecule CCCSc1ncc(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCCSc1ncc(Cl)c(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)n1 | CCCSc1ncc(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)cn1 | CCCSc1ncc(Cl)c(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc(Cl)c&n1",
"old_substring": "c18ncc7cn1"
} |
Can you make molecule CCCSc1ncc(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCCSc1ncc(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)c(Cl)n1 | CCCSc1ncc(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)cn1 | CCCSc1ncc(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)c(Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc&c(Cl)n1",
"old_substring": "c18ncc7cn1"
} |
Can you make molecule CCCSc1ncc(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCCSc1nc(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)c2sccn12 | CCCSc1ncc(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)cn1 | CCCSc1nc(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)c2sccn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&c2sccn12",
"old_substring": "c18ncc7cn1"
} |
Can you make molecule CCCSc1ncc(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCCSc1nccc(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)c1I | CCCSc1ncc(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)cn1 | CCCSc1nccc(C[NH+]2CCC(c3cc(=O)[nH]c(-c4ccccn4)n3)CC2)c1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&nccc&c1I",
"old_substring": "c18ncc7cn1"
} |
Can you make molecule CCCn1c(C[C@@]2(O)CCC[NH2+]C2)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC(n2c(C[C@@]3(O)CCC[NH2+]C3)nc3ccccc32)C1 | CCCn1c(C[C@@]2(O)CCC[NH2+]C2)nc2ccccc21 | CC1CC(n2c(C[C@@]3(O)CCC[NH2+]C3)nc3ccccc32)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1CC&C1",
"old_substring": "CCC3"
} |
Can you make molecule CCCn1c(C[C@@]2(O)CCC[NH2+]C2)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCn1c(C[C@@]2(O)CCC[NH2+]C2)nc2ccccc21 | CCCn1c(C[C@@]2(O)CCC[NH2+]C2)nc2ccccc21 | CC(C)CCn1c(C[C@@]2(O)CCC[NH2+]C2)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC3"
} |
Can you make molecule CCCn1c(C[C@@]2(O)CCC[NH2+]C2)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O[C@]1(Cc2nc3ccccc3n2CCCCBr)CCC[NH2+]C1 | CCCn1c(C[C@@]2(O)CCC[NH2+]C2)nc2ccccc21 | O[C@]1(Cc2nc3ccccc3n2CCCCBr)CCC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC3"
} |
Can you make molecule CCCn1c(C[C@@]2(O)CCC[NH2+]C2)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCn1c(C[C@@]2(O)CCC[NH2+]C2)nc2ccccc21 | CCCn1c(C[C@@]2(O)CCC[NH2+]C2)nc2ccccc21 | C=CCCCn1c(C[C@@]2(O)CCC[NH2+]C2)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC3"
} |
Can you make molecule CCCn1c(C[C@@]2(O)CCC[NH2+]C2)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O[C@]1(Cc2nc3ccccc3n2CCCCCl)CCC[NH2+]C1 | CCCn1c(C[C@@]2(O)CCC[NH2+]C2)nc2ccccc21 | O[C@]1(Cc2nc3ccccc3n2CCCCCl)CCC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC3"
} |
Can you make molecule COc1cc(C[NH+]2CC[C@@H](NCc3scnc3C)C2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(C[NH+]2CC[C@@H](NCc3scnc3C)C2)cc(OC)c1 | COc1cc(C[NH+]2CC[C@@H](NCc3scnc3C)C2)cc(OC)c1 | COCc1cc(C[NH+]2CC[C@@H](NCc3scnc3C)C2)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C[NH+]2CC[C@@H](NCc3scnc3C)C2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc(C[NH+]2CC[C@@H](NCc3scnc3C)C2)cc(OC)c1 | COc1cc(C[NH+]2CC[C@@H](NCc3scnc3C)C2)cc(OC)c1 | COCSc1cc(C[NH+]2CC[C@@H](NCc3scnc3C)C2)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C[NH+]2CC[C@@H](NCc3scnc3C)C2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C[NH+]2CC[C@@H](NCc3scnc3C)C2)cc(SC(C)=O)c1 | COc1cc(C[NH+]2CC[C@@H](NCc3scnc3C)C2)cc(OC)c1 | COc1cc(C[NH+]2CC[C@@H](NCc3scnc3C)C2)cc(SC(C)=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C[NH+]2CC[C@@H](NCc3scnc3C)C2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C[NH+]2CC[C@@H](NCc3scnc3C)C2)cc(C(=O)CS)c1 | COc1cc(C[NH+]2CC[C@@H](NCc3scnc3C)C2)cc(OC)c1 | COc1cc(C[NH+]2CC[C@@H](NCc3scnc3C)C2)cc(C(=O)CS)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C[NH+]2CC[C@@H](NCc3scnc3C)C2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C[NH+]2CC[C@@H](NCc3scnc3C)C2)cc(C(=O)CI)c1 | COc1cc(C[NH+]2CC[C@@H](NCc3scnc3C)C2)cc(OC)c1 | COc1cc(C[NH+]2CC[C@@H](NCc3scnc3C)C2)cc(C(=O)CI)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule NS(=O)(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(-n4cccn4)cc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NS(=O)(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(-n4cc(I)cn4)cc3)CC2)cc1 | NS(=O)(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(-n4cccn4)cc3)CC2)cc1 | NS(=O)(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(-n4cc(I)cn4)cc3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc(I)cn1",
"old_substring": "n18cccn1"
} |
Can you make molecule NS(=O)(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(-n4cccn4)cc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=Cn1cc(-c2ccc(C(=O)N3CCN(S(=O)(=O)c4ccc(S(N)(=O)=O)cc4)CC3)cc2)cn1 | NS(=O)(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(-n4cccn4)cc3)CC2)cc1 | C=Cn1cc(-c2ccc(C(=O)N3CCN(S(=O)(=O)c4ccc(S(N)(=O)=O)cc4)CC3)cc2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C=Cn1cc&cn1",
"old_substring": "n18cccn1"
} |
Can you make molecule NS(=O)(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(-n4cccn4)cc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cn(-c2ccc(C(=O)N3CCN(S(=O)(=O)c4ccc(S(N)(=O)=O)cc4)CC3)cc2)nc1I | NS(=O)(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(-n4cccn4)cc3)CC2)cc1 | Cc1cn(-c2ccc(C(=O)N3CCN(S(=O)(=O)c4ccc(S(N)(=O)=O)cc4)CC3)cc2)nc1I | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc(C)c(I)n1",
"old_substring": "n18cccn1"
} |
Can you make molecule NS(=O)(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(-n4cccn4)cc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NS(=O)(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(-n4ccsc4=O)cc3)CC2)cc1 | NS(=O)(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(-n4cccn4)cc3)CC2)cc1 | NS(=O)(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(-n4ccsc4=O)cc3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccsc1=O",
"old_substring": "n18cccn1"
} |
Can you make molecule NS(=O)(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(-n4cccn4)cc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n(-c2ccc(C(=O)N3CCN(S(=O)(=O)c4ccc(S(N)(=O)=O)cc4)CC3)cc2)n1 | NS(=O)(=O)c1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(-n4cccn4)cc3)CC2)cc1 | Cc1cc(C)n(-c2ccc(C(=O)N3CCN(S(=O)(=O)c4ccc(S(N)(=O)=O)cc4)CC3)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&nc(C)cc1C",
"old_substring": "n18cccn1"
} |
Can you make molecule COc1ccc(S(=O)(=O)NCC[NH2+][C@H]2CCOC3(CCOCC3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(S(=O)(=O)NCC[NH2+][C@H]2CCOC3(CCOCC3)C2)cc1 | COc1ccc(S(=O)(=O)NCC[NH2+][C@H]2CCOC3(CCOCC3)C2)cc1 | COCc1ccc(S(=O)(=O)NCC[NH2+][C@H]2CCOC3(CCOCC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(S(=O)(=O)NCC[NH2+][C@H]2CCOC3(CCOCC3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(S(=O)(=O)NCC[NH2+][C@H]2CCOC3(CCOCC3)C2)cc1 | COc1ccc(S(=O)(=O)NCC[NH2+][C@H]2CCOC3(CCOCC3)C2)cc1 | COCSc1ccc(S(=O)(=O)NCC[NH2+][C@H]2CCOC3(CCOCC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(S(=O)(=O)NCC[NH2+][C@H]2CCOC3(CCOCC3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(S(=O)(=O)NCC[NH2+][C@H]2CCOC3(CCOCC3)C2)cc1 | COc1ccc(S(=O)(=O)NCC[NH2+][C@H]2CCOC3(CCOCC3)C2)cc1 | CC(=O)Sc1ccc(S(=O)(=O)NCC[NH2+][C@H]2CCOC3(CCOCC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(S(=O)(=O)NCC[NH2+][C@H]2CCOC3(CCOCC3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS)c1ccc(S(=O)(=O)NCC[NH2+][C@H]2CCOC3(CCOCC3)C2)cc1 | COc1ccc(S(=O)(=O)NCC[NH2+][C@H]2CCOC3(CCOCC3)C2)cc1 | O=C(CS)c1ccc(S(=O)(=O)NCC[NH2+][C@H]2CCOC3(CCOCC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(S(=O)(=O)NCC[NH2+][C@H]2CCOC3(CCOCC3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CI)c1ccc(S(=O)(=O)NCC[NH2+][C@H]2CCOC3(CCOCC3)C2)cc1 | COc1ccc(S(=O)(=O)NCC[NH2+][C@H]2CCOC3(CCOCC3)C2)cc1 | O=C(CI)c1ccc(S(=O)(=O)NCC[NH2+][C@H]2CCOC3(CCOCC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule CC(=O)c1cc(CC(=O)N2CCN3CCNC(=O)[C@H]3C2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)c1cc(C/C(C)=N\ON2CCN3CCNC(=O)[C@H]3C2)cs1 | CC(=O)c1cc(CC(=O)N2CCN3CCNC(=O)[C@H]3C2)cs1 | CC(=O)c1cc(C/C(C)=N\ON2CCN3CCNC(=O)[C@H]3C2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C6C4=O"
} |
Can you make molecule CC(=O)c1cc(CC(=O)N2CCN3CCNC(=O)[C@H]3C2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CN1CCN2CCNC(=O)[C@H]2C1)c1csc(C(C)=O)c1 | CC(=O)c1cc(CC(=O)N2CCN3CCNC(=O)[C@H]3C2)cs1 | CCC(CC)(C(=O)CN1CCN2CCNC(=O)[C@H]2C1)c1csc(C(C)=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C6C4=O"
} |
Can you make molecule CC(=O)c1cc(CC(=O)N2CCN3CCNC(=O)[C@H]3C2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)c1cc(SSC(=O)N2CCN3CCNC(=O)[C@H]3C2)cs1 | CC(=O)c1cc(CC(=O)N2CCN3CCNC(=O)[C@H]3C2)cs1 | CC(=O)c1cc(SSC(=O)N2CCN3CCNC(=O)[C@H]3C2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C6C4=O"
} |
Can you make molecule CC(=O)c1cc(CC(=O)N2CCN3CCNC(=O)[C@H]3C2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCN1CCN2CCNC(=O)[C@H]2C1)c1csc(C(C)=O)c1 | CC(=O)c1cc(CC(=O)N2CCN3CCNC(=O)[C@H]3C2)cs1 | CCC(CC)(C(=O)CCN1CCN2CCNC(=O)[C@H]2C1)c1csc(C(C)=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C6C4=O"
} |
Can you make molecule CC(=O)c1cc(CC(=O)N2CCN3CCNC(=O)[C@H]3C2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)c1csc(C(C)=O)c1)C(=O)N1CCN2CCNC(=O)[C@H]2C1 | CC(=O)c1cc(CC(=O)N2CCN3CCNC(=O)[C@H]3C2)cs1 | CC[C@H](C(=O)c1csc(C(C)=O)c1)C(=O)N1CCN2CCNC(=O)[C@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C6C4=O"
} |
Can you make molecule Cc1ccc([C@H]2CN(C(=O)c3ccc(Cl)cc3)CCO2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H]2CN(C(=O)c3ccc(Cl)cc3I)CCO2)nc1 | Cc1ccc([C@H]2CN(C(=O)c3ccc(Cl)cc3)CCO2)nc1 | Cc1ccc([C@H]2CN(C(=O)c3ccc(Cl)cc3I)CCO2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c15ccc(Cl)cc1"
} |
Can you make molecule Cc1ccc([C@H]2CN(C(=O)c3ccc(Cl)cc3)CCO2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H]2CN(C(=O)c3ccc(Cl)cc3Br)CCO2)nc1 | Cc1ccc([C@H]2CN(C(=O)c3ccc(Cl)cc3)CCO2)nc1 | Cc1ccc([C@H]2CN(C(=O)c3ccc(Cl)cc3Br)CCO2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c15ccc(Cl)cc1"
} |
Can you make molecule Cc1ccc([C@H]2CN(C(=O)c3ccc(Cl)cc3)CCO2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H]2CN(C(=O)c3ccc(Cl)c(I)c3)CCO2)nc1 | Cc1ccc([C@H]2CN(C(=O)c3ccc(Cl)cc3)CCO2)nc1 | Cc1ccc([C@H]2CN(C(=O)c3ccc(Cl)c(I)c3)CCO2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c15ccc(Cl)cc1"
} |
Can you make molecule Cc1ccc([C@H]2CN(C(=O)c3ccc(Cl)cc3)CCO2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H]2CN(C(=O)c3cc(Cl)ccc3Cl)CCO2)nc1 | Cc1ccc([C@H]2CN(C(=O)c3ccc(Cl)cc3)CCO2)nc1 | Cc1ccc([C@H]2CN(C(=O)c3cc(Cl)ccc3Cl)CCO2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1ccc(Cl)c&c1",
"old_substring": "c15ccc(Cl)cc1"
} |
Can you make molecule Cc1ccc([C@H]2CN(C(=O)c3ccc(Cl)cc3)CCO2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H]2CN(C(=O)c3ccc(Cl)c(Cl)c3)CCO2)nc1 | Cc1ccc([C@H]2CN(C(=O)c3ccc(Cl)cc3)CCO2)nc1 | Cc1ccc([C@H]2CN(C(=O)c3ccc(Cl)c(Cl)c3)CCO2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c15ccc(Cl)cc1"
} |
Can you make molecule CCn1cnnc1CNC(=O)C=Cc1ccc(C(C)(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cnn(CNC(=O)C=Cc2ccc(C(C)(C)C)cc2)c1=S | CCn1cnnc1CNC(=O)C=Cc1ccc(C(C)(C)C)cc1 | CCn1cnn(CNC(=O)C=Cc2ccc(C(C)(C)C)cc2)c1=S | 102 | {
"fragment_index": 0,
"new_substring": "n1&cnn&c1=S",
"old_substring": "n15cnnc16"
} |
Can you make molecule CCn1cnnc1CNC(=O)C=Cc1ccc(C(C)(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cnc(CNC(=O)C=Cc2ccc(C(C)(C)C)cc2)c1 | CCn1cnnc1CNC(=O)C=Cc1ccc(C(C)(C)C)cc1 | CCn1cnc(CNC(=O)C=Cc2ccc(C(C)(C)C)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cnc&c1",
"old_substring": "n15cnnc16"
} |
Can you make molecule CCn1cnnc1CNC(=O)C=Cc1ccc(C(C)(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(CNC(=O)C=Cc2ccc(C(C)(C)C)cc2)nc1Cl | CCn1cnnc1CNC(=O)C=Cc1ccc(C(C)(C)C)cc1 | CCn1nc(CNC(=O)C=Cc2ccc(C(C)(C)C)cc2)nc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "n1&nc&nc1Cl",
"old_substring": "n15cnnc16"
} |
Can you make molecule CCn1cnnc1CNC(=O)C=Cc1ccc(C(C)(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cnc(CNC(=O)C=Cc2ccc(C(C)(C)C)cc2)cc1=O | CCn1cnnc1CNC(=O)C=Cc1ccc(C(C)(C)C)cc1 | CCn1cnc(CNC(=O)C=Cc2ccc(C(C)(C)C)cc2)cc1=O | 102 | {
"fragment_index": 0,
"new_substring": "n1&cnc&cc1=O",
"old_substring": "n15cnnc16"
} |
Can you make molecule CCn1cnnc1CNC(=O)C=Cc1ccc(C(C)(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cncc(CNC(=O)C=Cc2ccc(C(C)(C)C)cc2)c1=O | CCn1cnnc1CNC(=O)C=Cc1ccc(C(C)(C)C)cc1 | CCn1cncc(CNC(=O)C=Cc2ccc(C(C)(C)C)cc2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "n1&cncc&c1=O",
"old_substring": "n15cnnc16"
} |
Can you make molecule CN(C[C@@H]1CC[NH+](C)C1)C(=O)N[C@@H](Cc1ccccc1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)N[C@@H](Cc1ccccc1)C1CC1)C(=S)SC[C@@H]1CC[NH+](C)C1 | CN(C[C@@H]1CC[NH+](C)C1)C(=O)N[C@@H](Cc1ccccc1)C1CC1 | CN(C(=O)N[C@@H](Cc1ccccc1)C1CC1)C(=S)SC[C@@H]1CC[NH+](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "CN24"
} |
Can you make molecule CN(C[C@@H]1CC[NH+](C)C1)C(=O)N[C@@H](Cc1ccccc1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CC[C@@H](CC2CCN(CC(=O)N[C@@H](Cc3ccccc3)C3CC3)CC2)C1 | CN(C[C@@H]1CC[NH+](C)C1)C(=O)N[C@@H](Cc1ccccc1)C1CC1 | C[NH+]1CC[C@@H](CC2CCN(CC(=O)N[C@@H](Cc3ccccc3)C3CC3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "CN24"
} |
Can you make molecule CN(C[C@@H]1CC[NH+](C)C1)C(=O)N[C@@H](Cc1ccccc1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CC[C@@H](CN2CN(C(=O)N[C@@H](Cc3ccccc3)C3CC3)CSC2=S)C1 | CN(C[C@@H]1CC[NH+](C)C1)C(=O)N[C@@H](Cc1ccccc1)C1CC1 | C[NH+]1CC[C@@H](CN2CN(C(=O)N[C@@H](Cc3ccccc3)C3CC3)CSC2=S)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S=C1SCN&CN1&",
"old_substring": "CN24"
} |
Can you make molecule CN(C[C@@H]1CC[NH+](C)C1)C(=O)N[C@@H](Cc1ccccc1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CC[C@@H](CC2CCC(C#N)(C(=O)N[C@@H](Cc3ccccc3)C3CC3)CC2)C1 | CN(C[C@@H]1CC[NH+](C)C1)C(=O)N[C@@H](Cc1ccccc1)C1CC1 | C[NH+]1CC[C@@H](CC2CCC(C#N)(C(=O)N[C@@H](Cc3ccccc3)C3CC3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "CN24"
} |
Can you make molecule CN(C[C@@H]1CC[NH+](C)C1)C(=O)N[C@@H](Cc1ccccc1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CC[C@@H](Cc2snc3sc-3c(N)c2C(=O)N[C@@H](Cc2ccccc2)C2CC2)C1 | CN(C[C@@H]1CC[NH+](C)C1)C(=O)N[C@@H](Cc1ccccc1)C1CC1 | C[NH+]1CC[C@@H](Cc2snc3sc-3c(N)c2C(=O)N[C@@H](Cc2ccccc2)C2CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&sc2nsc&c12",
"old_substring": "CN24"
} |
Can you make molecule C[C@@H]1CCc2c(sc3ncn(CC(=O)N[C@H](C)c4ccco4)c(=O)c23)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1ccco1)NC(=O)Cn1cnc2sc3c(c2c1=O)CC[C@@H](C)C3 | C[C@@H]1CCc2c(sc3ncn(CC(=O)N[C@H](C)c4ccco4)c(=O)c23)C1 | CC[C@@H](CCc1ccco1)NC(=O)Cn1cnc2sc3c(c2c1=O)CC[C@@H](C)C3 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]68C"
} |
Can you make molecule C[C@@H]1CCc2c(sc3ncn(CC(=O)N[C@H](C)c4ccco4)c(=O)c23)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCc2c(sc3ncn(CC(=O)N[C@@H](CBr)CCc4ccco4)c(=O)c23)C1 | C[C@@H]1CCc2c(sc3ncn(CC(=O)N[C@H](C)c4ccco4)c(=O)c23)C1 | C[C@@H]1CCc2c(sc3ncn(CC(=O)N[C@@H](CBr)CCc4ccco4)c(=O)c23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]68C"
} |
Can you make molecule C[C@@H]1CCc2c(sc3ncn(CC(=O)N[C@H](C)c4ccco4)c(=O)c23)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCc2c(sc3ncn(CC(=O)N[C@@H](CBr)CCCc4ccco4)c(=O)c23)C1 | C[C@@H]1CCc2c(sc3ncn(CC(=O)N[C@H](C)c4ccco4)c(=O)c23)C1 | C[C@@H]1CCc2c(sc3ncn(CC(=O)N[C@@H](CBr)CCCc4ccco4)c(=O)c23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]68C"
} |
Can you make molecule C[C@@H]1CCc2c(sc3ncn(CC(=O)N[C@H](C)c4ccco4)c(=O)c23)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCc2c(sc3ncn(CC(=O)N[C@H](CCl)CCCc4ccco4)c(=O)c23)C1 | C[C@@H]1CCc2c(sc3ncn(CC(=O)N[C@H](C)c4ccco4)c(=O)c23)C1 | C[C@@H]1CCc2c(sc3ncn(CC(=O)N[C@H](CCl)CCCc4ccco4)c(=O)c23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@H]68C"
} |
Can you make molecule C[C@@H]1CCc2c(sc3ncn(CC(=O)N[C@H](C)c4ccco4)c(=O)c23)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCc2c(sc3ncn(CC(=O)N[C@H]4CCC[C@H](c5ccco5)C4)c(=O)c23)C1 | C[C@@H]1CCc2c(sc3ncn(CC(=O)N[C@H](C)c4ccco4)c(=O)c23)C1 | C[C@@H]1CCc2c(sc3ncn(CC(=O)N[C@H]4CCC[C@H](c5ccco5)C4)c(=O)c23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]68C"
} |
Can you make molecule C=CCc1cc(CNC(=O)c2ccco2)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | C=CCc1cc(CNSC(=O)Cc2ccco2)cc(OC)c1OC | C=CCc1cc(CNC(=O)c2ccco2)cc(OC)c1OC | C=CCc1cc(CNSC(=O)Cc2ccco2)cc(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C37=O"
} |
Can you make molecule C=CCc1cc(CNC(=O)c2ccco2)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | C=CCc1cc(CNC(=O)CCCC(=O)c2ccco2)cc(OC)c1OC | C=CCc1cc(CNC(=O)c2ccco2)cc(OC)c1OC | C=CCc1cc(CNC(=O)CCCC(=O)c2ccco2)cc(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C37=O"
} |
Can you make molecule C=CCc1cc(CNC(=O)c2ccco2)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | C=CCc1cc(CNC(=O)CC(C)(C)c2ccco2)cc(OC)c1OC | C=CCc1cc(CNC(=O)c2ccco2)cc(OC)c1OC | C=CCc1cc(CNC(=O)CC(C)(C)c2ccco2)cc(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule C=CCc1cc(CNC(=O)c2ccco2)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | C=CCc1cc(CNC(=O)CCC(C)(C)c2ccco2)cc(OC)c1OC | C=CCc1cc(CNC(=O)c2ccco2)cc(OC)c1OC | C=CCc1cc(CNC(=O)CCC(C)(C)c2ccco2)cc(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule C=CCc1cc(CNC(=O)c2ccco2)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | C=CCc1cc(CNSC(=O)[C@@H](C)c2ccco2)cc(OC)c1OC | C=CCc1cc(CNC(=O)c2ccco2)cc(OC)c1OC | C=CCc1cc(CNSC(=O)[C@@H](C)c2ccco2)cc(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C37=O"
} |
Can you make molecule COc1ccccc1CNC(=O)C1(Cc2cc(-c3ccccc3C)no2)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CNC(=O)C1(Cc2ccc3ncoc3c2)CCOCC1.Cc1ccccc1 | COc1ccccc1CNC(=O)C1(Cc2cc(-c3ccccc3C)no2)CCOCC1 | COc1ccccc1CNC(=O)C1(Cc2ccc3ncoc3c2)CCOCC1.Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2nc&oc2c1",
"old_substring": "c18cc%11no1"
} |
Can you make molecule COc1ccccc1CNC(=O)C1(Cc2cc(-c3ccccc3C)no2)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CNC(=O)C1(Cc2ccc3nocc3c2)CCOCC1.Cc1ccccc1 | COc1ccccc1CNC(=O)C1(Cc2cc(-c3ccccc3C)no2)CCOCC1 | COc1ccccc1CNC(=O)C1(Cc2ccc3nocc3c2)CCOCC1.Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2noc&c2c1",
"old_substring": "c18cc%11no1"
} |
Can you make molecule COc1ccccc1CNC(=O)C1(Cc2cc(-c3ccccc3C)no2)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CNC(=O)C1(Cc2cc(C)nc3oncc23)CCOCC1.Cc1ccccc1 | COc1ccccc1CNC(=O)C1(Cc2cc(-c3ccccc3C)no2)CCOCC1 | COc1ccccc1CNC(=O)C1(Cc2cc(C)nc3oncc23)CCOCC1.Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c2c&noc2n1",
"old_substring": "c18cc%11no1"
} |
Can you make molecule COc1ccccc1CNC(=O)C1(Cc2cc(-c3ccccc3C)no2)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CNC(=O)C1(Cc2nocc2C)CCOCC1.Cc1ccccc1 | COc1ccccc1CNC(=O)C1(Cc2cc(-c3ccccc3C)no2)CCOCC1 | COc1ccccc1CNC(=O)C1(Cc2nocc2C)CCOCC1.Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&noc1&",
"old_substring": "c18cc%11no1"
} |
Can you make molecule COc1ccccc1CNC(=O)C1(Cc2cc(-c3ccccc3C)no2)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CNC(=O)C1(Cc2ccco2)CCOCC1.Cc1ccccc1 | COc1ccccc1CNC(=O)C1(Cc2cc(-c3ccccc3C)no2)CCOCC1 | COc1ccccc1CNC(=O)C1(Cc2ccco2)CCOCC1.Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&o1",
"old_substring": "c18cc%11no1"
} |
Can you make molecule Cc1ccc([C@H](NC(=O)NC[C@H]2CC[NH+](C3CC3)C2)C2CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H](NC(=O)CC(C)(C)NC[C@H]2CC[NH+](C3CC3)C2)C2CC2)cc1 | Cc1ccc([C@H](NC(=O)NC[C@H]2CC[NH+](C3CC3)C2)C2CC2)cc1 | Cc1ccc([C@H](NC(=O)CC(C)(C)NC[C@H]2CC[NH+](C3CC3)C2)C2CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1ccc([C@H](NC(=O)NC[C@H]2CC[NH+](C3CC3)C2)C2CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H](NC(=O)CCC(C)(C)NC[C@H]2CC[NH+](C3CC3)C2)C2CC2)cc1 | Cc1ccc([C@H](NC(=O)NC[C@H]2CC[NH+](C3CC3)C2)C2CC2)cc1 | Cc1ccc([C@H](NC(=O)CCC(C)(C)NC[C@H]2CC[NH+](C3CC3)C2)C2CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1ccc([C@H](NC(=O)NC[C@H]2CC[NH+](C3CC3)C2)C2CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H](Nc2c(C)n(C)n(NC[C@H]3CC[NH+](C4CC4)C3)c2=O)C2CC2)cc1 | Cc1ccc([C@H](NC(=O)NC[C@H]2CC[NH+](C3CC3)C2)C2CC2)cc1 | Cc1ccc([C@H](Nc2c(C)n(C)n(NC[C@H]3CC[NH+](C4CC4)C3)c2=O)C2CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)n&n1C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1ccc([C@H](NC(=O)NC[C@H]2CC[NH+](C3CC3)C2)C2CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H](Nc2nn(NC[C@H]3CC[NH+](C4CC4)C3)c(C)cc2=O)C2CC2)cc1 | Cc1ccc([C@H](NC(=O)NC[C@H]2CC[NH+](C3CC3)C2)C2CC2)cc1 | Cc1ccc([C@H](Nc2nn(NC[C@H]3CC[NH+](C4CC4)C3)c(C)cc2=O)C2CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(=O)c&nn1&",
"old_substring": "C45=O"
} |
Can you make molecule Cc1ccc([C@H](NC(=O)NC[C@H]2CC[NH+](C3CC3)C2)C2CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H](NC(=O)C[C@@H](Br)NC[C@H]2CC[NH+](C3CC3)C2)C2CC2)cc1 | Cc1ccc([C@H](NC(=O)NC[C@H]2CC[NH+](C3CC3)C2)C2CC2)cc1 | Cc1ccc([C@H](NC(=O)C[C@@H](Br)NC[C@H]2CC[NH+](C3CC3)C2)C2CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C45=O"
} |
Can you make molecule CC1=C(C(=O)OC(C)C)[C@H](c2cccc(NC(=O)Cc3ccc(F)cc3)c2)NC(=O)N1C less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)OC(C)C)[C@H](c2ccc(NC(=O)Cc3ccc(F)cc3)cc2I)NC(=O)N1C | CC1=C(C(=O)OC(C)C)[C@H](c2cccc(NC(=O)Cc3ccc(F)cc3)c2)NC(=O)N1C | CC1=C(C(=O)OC(C)C)[C@H](c2ccc(NC(=O)Cc3ccc(F)cc3)cc2I)NC(=O)N1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c19cccc7c1"
} |
Can you make molecule CC1=C(C(=O)OC(C)C)[C@H](c2cccc(NC(=O)Cc3ccc(F)cc3)c2)NC(=O)N1C less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)OC(C)C)[C@H](c2cc(NC(=O)Cc3ccc(F)cc3)ccc2Br)NC(=O)N1C | CC1=C(C(=O)OC(C)C)[C@H](c2cccc(NC(=O)Cc3ccc(F)cc3)c2)NC(=O)N1C | CC1=C(C(=O)OC(C)C)[C@H](c2cc(NC(=O)Cc3ccc(F)cc3)ccc2Br)NC(=O)N1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c19cccc7c1"
} |
Can you make molecule CC1=C(C(=O)OC(C)C)[C@H](c2cccc(NC(=O)Cc3ccc(F)cc3)c2)NC(=O)N1C less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)OC(C)C)[C@H](c2ccc(NC(=O)Cc3ccc(F)cc3)cc2Cl)NC(=O)N1C | CC1=C(C(=O)OC(C)C)[C@H](c2cccc(NC(=O)Cc3ccc(F)cc3)c2)NC(=O)N1C | CC1=C(C(=O)OC(C)C)[C@H](c2ccc(NC(=O)Cc3ccc(F)cc3)cc2Cl)NC(=O)N1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c19cccc7c1"
} |
Can you make molecule CC1=C(C(=O)OC(C)C)[C@H](c2cccc(NC(=O)Cc3ccc(F)cc3)c2)NC(=O)N1C less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)OC(C)C)[C@H](c2cccc(NC(=O)Cc3ccc(F)cc3)c2Br)NC(=O)N1C | CC1=C(C(=O)OC(C)C)[C@H](c2cccc(NC(=O)Cc3ccc(F)cc3)c2)NC(=O)N1C | CC1=C(C(=O)OC(C)C)[C@H](c2cccc(NC(=O)Cc3ccc(F)cc3)c2Br)NC(=O)N1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c19cccc7c1"
} |
Can you make molecule CC1=C(C(=O)OC(C)C)[C@H](c2cccc(NC(=O)Cc3ccc(F)cc3)c2)NC(=O)N1C less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)OC(C)C)[C@H](c2cccc(NC(=O)Cc3ccc(F)cc3)c2Cl)NC(=O)N1C | CC1=C(C(=O)OC(C)C)[C@H](c2cccc(NC(=O)Cc3ccc(F)cc3)c2)NC(=O)N1C | CC1=C(C(=O)OC(C)C)[C@H](c2cccc(NC(=O)Cc3ccc(F)cc3)c2Cl)NC(=O)N1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c19cccc7c1"
} |
Can you make molecule CN1CC[C@H](NC(=O)c2cnc([C@H]3CCCO3)s2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1CC[C@H](NSC(=O)Cc2cnc([C@H]3CCCO3)s2)C1=O | CN1CC[C@H](NC(=O)c2cnc([C@H]3CCCO3)s2)C1=O | CN1CC[C@H](NSC(=O)Cc2cnc([C@H]3CCCO3)s2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule CN1CC[C@H](NC(=O)c2cnc([C@H]3CCCO3)s2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1CC[C@H](NC(=O)CCCC(=O)c2cnc([C@H]3CCCO3)s2)C1=O | CN1CC[C@H](NC(=O)c2cnc([C@H]3CCCO3)s2)C1=O | CN1CC[C@H](NC(=O)CCCC(=O)c2cnc([C@H]3CCCO3)s2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule CN1CC[C@H](NC(=O)c2cnc([C@H]3CCCO3)s2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1CC[C@H](NC(=O)CC(C)(C)c2cnc([C@H]3CCCO3)s2)C1=O | CN1CC[C@H](NC(=O)c2cnc([C@H]3CCCO3)s2)C1=O | CN1CC[C@H](NC(=O)CC(C)(C)c2cnc([C@H]3CCCO3)s2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CN1CC[C@H](NC(=O)c2cnc([C@H]3CCCO3)s2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1CC[C@H](NC(=O)CCC(C)(C)c2cnc([C@H]3CCCO3)s2)C1=O | CN1CC[C@H](NC(=O)c2cnc([C@H]3CCCO3)s2)C1=O | CN1CC[C@H](NC(=O)CCC(C)(C)c2cnc([C@H]3CCCO3)s2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CN1CC[C@H](NC(=O)c2cnc([C@H]3CCCO3)s2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SN[C@H]1CCN(C)C1=O)c1cnc([C@H]2CCCO2)s1 | CN1CC[C@H](NC(=O)c2cnc([C@H]3CCCO3)s2)C1=O | C[C@H](C(=O)SN[C@H]1CCN(C)C1=O)c1cnc([C@H]2CCCO2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule C[C@H]1[NH2+]CC[C@@H]1c1nncn1C1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[NH2+]CC[C@@H]1c1nnc2scc-2n1C1CCCCC1 | C[C@H]1[NH2+]CC[C@@H]1c1nncn1C1CCCCC1 | C[C@H]1[NH2+]CC[C@@H]1c1nnc2scc-2n1C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc2scc&n12",
"old_substring": "c13nncn12"
} |
Can you make molecule C[C@H]1[NH2+]CC[C@@H]1c1nncn1C1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[NH2+]CC[C@@H]1c1nnc2sc-2cn1C1CCCCC1 | C[C@H]1[NH2+]CC[C@@H]1c1nncn1C1CCCCC1 | C[C@H]1[NH2+]CC[C@@H]1c1nnc2sc-2cn1C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc2sc&cn12",
"old_substring": "c13nncn12"
} |
Can you make molecule C[C@H]1[NH2+]CC[C@@H]1c1nncn1C1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[NH2+]CC[C@@H]1c1nnc(C2CCCCC2)s1 | C[C@H]1[NH2+]CC[C@@H]1c1nncn1C1CCCCC1 | C[C@H]1[NH2+]CC[C@@H]1c1nnc(C2CCCCC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc&s1",
"old_substring": "c13nncn12"
} |
Can you make molecule C[C@H]1[NH2+]CC[C@@H]1c1nncn1C1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[NH2+]CC[C@@H]1c1nnc2ccc-2cn1C1CCCCC1 | C[C@H]1[NH2+]CC[C@@H]1c1nncn1C1CCCCC1 | C[C@H]1[NH2+]CC[C@@H]1c1nnc2ccc-2cn1C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc2ccc&cn12",
"old_substring": "c13nncn12"
} |
Can you make molecule C[C@H]1[NH2+]CC[C@@H]1c1nncn1C1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[NH2+]CC[C@@H]1c1nn(C2CCCCC2)c(=S)n1C | C[C@H]1[NH2+]CC[C@@H]1c1nncn1C1CCCCC1 | C[C@H]1[NH2+]CC[C@@H]1c1nn(C2CCCCC2)c(=S)n1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn&c(=S)n1C",
"old_substring": "c13nncn12"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.