prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule O=C(C(=O)N1CCN(C(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)CC1)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)N1CCN(C(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)CC1)N1CCCC1 | O=C(C(=O)N1CCN(C(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)CC1)N1CCCC1 | O=C(CCC(=O)N1CCN(C(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)CC1)N1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O=C4C5=O"
} |
Can you make molecule O=C(C(=O)N1CCN(C(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)CC1)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CC[S@+]([O-])CN1CCN(C(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)CC1)N1CCCC1 | O=C(C(=O)N1CCN(C(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)CC1)N1CCCC1 | O=C(CC[S@+]([O-])CN1CCN(C(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)CC1)N1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CC[S@](=O)C&",
"old_substring": "O=C4C5=O"
} |
Can you make molecule O=C(C(=O)N1CCN(C(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)CC1)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C1=NO[C@H](N2CCN(C(=O)c3cc(-c4ccc(F)cc4)nc4ccccc34)CC2)C1)N1CCCC1 | O=C(C(=O)N1CCN(C(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)CC1)N1CCCC1 | O=C(C1=NO[C@H](N2CCN(C(=O)c3cc(-c4ccc(F)cc4)nc4ccccc34)CC2)C1)N1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=NO[C@H]&C1",
"old_substring": "O=C4C5=O"
} |
Can you make molecule O=C(C(=O)N1CCN(C(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)CC1)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ON1CCCC1)C(=O)SN1CCN(C(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)CC1 | O=C(C(=O)N1CCN(C(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)CC1)N1CCCC1 | C/C(=N\ON1CCCC1)C(=O)SN1CCN(C(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C4C5=O"
} |
Can you make molecule O=C(C(=O)N1CCN(C(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)CC1)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCS(=O)(=O)CN1CCN(C(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)CC1)N1CCCC1 | O=C(C(=O)N1CCN(C(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)CC1)N1CCCC1 | O=C(CCCS(=O)(=O)CN1CCN(C(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)CC1)N1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCCS(=O)(=O)C&",
"old_substring": "O=C4C5=O"
} |
Can you make molecule COc1ccc([C@H]2CCCN2C(=O)C=Cc2ccc(Cl)c([N+](=O)[O-])c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2CCCN2SC(=O)C=Cc2ccc(Cl)c([N+](=O)[O-])c2)cc1 | COc1ccc([C@H]2CCCN2C(=O)C=Cc2ccc(Cl)c([N+](=O)[O-])c2)cc1 | COc1ccc([C@H]2CCCN2SC(=O)C=Cc2ccc(Cl)c([N+](=O)[O-])c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C=5"
} |
Can you make molecule COc1ccc([C@H]2CCCN2C(=O)C=Cc2ccc(Cl)c([N+](=O)[O-])c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2CCCN2C(=O)C2=C(N=Cc3ccc(Cl)c([N+](=O)[O-])c3)CCS2)cc1 | COc1ccc([C@H]2CCCN2C(=O)C=Cc2ccc(Cl)c([N+](=O)[O-])c2)cc1 | COc1ccc([C@H]2CCCN2C(=O)C2=C(N=Cc3ccc(Cl)c([N+](=O)[O-])c3)CCS2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=C(N&)CCS1",
"old_substring": "C3(=O)C=5"
} |
Can you make molecule COc1ccc([C@H]2CCCN2C(=O)C=Cc2ccc(Cl)c([N+](=O)[O-])c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2CCCN2C(=O)C(N=Cc2ccc(Cl)c([N+](=O)[O-])c2)=C(Cl)Cl)cc1 | COc1ccc([C@H]2CCCN2C(=O)C=Cc2ccc(Cl)c([N+](=O)[O-])c2)cc1 | COc1ccc([C@H]2CCCN2C(=O)C(N=Cc2ccc(Cl)c([N+](=O)[O-])c2)=C(Cl)Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(N&)=C(Cl)Cl",
"old_substring": "C3(=O)C=5"
} |
Can you make molecule COc1ccc([C@H]2CCCN2C(=O)C=Cc2ccc(Cl)c([N+](=O)[O-])c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2CCCN2C(=O)C(C=Cc2ccc(Cl)c([N+](=O)[O-])c2)=C(Cl)Cl)cc1 | COc1ccc([C@H]2CCCN2C(=O)C=Cc2ccc(Cl)c([N+](=O)[O-])c2)cc1 | COc1ccc([C@H]2CCCN2C(=O)C(C=Cc2ccc(Cl)c([N+](=O)[O-])c2)=C(Cl)Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C&)=C(Cl)Cl",
"old_substring": "C3(=O)C=5"
} |
Can you make molecule COc1ccc([C@H]2CCCN2C(=O)C=Cc2ccc(Cl)c([N+](=O)[O-])c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2CCCN2C[S@+]([O-])CCC=Cc2ccc(Cl)c([N+](=O)[O-])c2)cc1 | COc1ccc([C@H]2CCCN2C(=O)C=Cc2ccc(Cl)c([N+](=O)[O-])c2)cc1 | COc1ccc([C@H]2CCCN2C[S@+]([O-])CCC=Cc2ccc(Cl)c([N+](=O)[O-])c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C=5"
} |
Can you make molecule COc1ccc(C(=O)OCC(=O)N[C@@H](C)C(C)C)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)OCC(=O)N[C@@H](C)CCC(C)(C)C)c(F)c1 | COc1ccc(C(=O)OCC(=O)N[C@@H](C)C(C)C)c(F)c1 | COc1ccc(C(=O)OCC(=O)N[C@@H](C)CCC(C)(C)C)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)CCC(C)(C)C",
"old_substring": "[C@H]6(C)C(C)C"
} |
Can you make molecule COc1ccc(C(=O)OCC(=O)N[C@@H](C)C(C)C)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)OCC(=O)N[C@H]2CCCC2(C)C)c(F)c1 | COc1ccc(C(=O)OCC(=O)N[C@@H](C)C(C)C)c(F)c1 | COc1ccc(C(=O)OCC(=O)N[C@H]2CCCC2(C)C)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC1(C)C",
"old_substring": "[C@H]6(C)C(C)C"
} |
Can you make molecule COc1ccc(C(=O)OCC(=O)N[C@@H](C)C(C)C)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)OCC(=O)N[C@H]2CCC=CCCC2)c(F)c1 | COc1ccc(C(=O)OCC(=O)N[C@@H](C)C(C)C)c(F)c1 | COc1ccc(C(=O)OCC(=O)N[C@H]2CCC=CCCC2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC=CCCC1",
"old_substring": "[C@H]6(C)C(C)C"
} |
Can you make molecule COc1ccc(C(=O)OCC(=O)N[C@@H](C)C(C)C)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)OCC(=O)N[C@@]2(C)CC2(Br)Br)c(F)c1 | COc1ccc(C(=O)OCC(=O)N[C@@H](C)C(C)C)c(F)c1 | COc1ccc(C(=O)OCC(=O)N[C@@]2(C)CC2(Br)Br)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@]1&(C)CC1(Br)Br",
"old_substring": "[C@H]6(C)C(C)C"
} |
Can you make molecule COc1ccc(C(=O)OCC(=O)N[C@@H](C)C(C)C)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)OCC(=O)N[C@H]2CC23CCCCC3)c(F)c1 | COc1ccc(C(=O)OCC(=O)N[C@@H](C)C(C)C)c(F)c1 | COc1ccc(C(=O)OCC(=O)N[C@H]2CC23CCCCC3)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC12CCCCC2",
"old_substring": "[C@H]6(C)C(C)C"
} |
Can you make molecule Cc1nc(C[C@@H]([NH3+])[C@@H]2CN(C(C)C)CCO2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCC.Cc1nc(C2O[C@@H]3[C@@H]4CN(CCO4)[C@H]3O2)cs1 | Cc1nc(C[C@@H]([NH3+])[C@@H]2CN(C(C)C)CCO2)cs1 | CCC.Cc1nc(C2O[C@@H]3[C@@H]4CN(CCO4)[C@H]3O2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&O[C@H]&[C@@H]&O1",
"old_substring": "C5[C@H]4[NH3+]"
} |
Can you make molecule Cc1nc(C[C@@H]([NH3+])[C@@H]2CN(C(C)C)CCO2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCC.Cc1nc(C2C[C@H]3C[C@@H](C2)N2CCO[C@H]3C2)cs1 | Cc1nc(C[C@@H]([NH3+])[C@@H]2CN(C(C)C)CCO2)cs1 | CCC.Cc1nc(C2C[C@H]3C[C@@H](C2)N2CCO[C@H]3C2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C[C@H]&C[C@H]&C1",
"old_substring": "C5[C@H]4[NH3+]"
} |
Can you make molecule Cc1nc(C[C@@H]([NH3+])[C@@H]2CN(C(C)C)CCO2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCC.Cc1nc([C@H]2NN[C@@H]3[C@@H]4CN(CCO4)N23)cs1 | Cc1nc(C[C@@H]([NH3+])[C@@H]2CN(C(C)C)CCO2)cs1 | CCC.Cc1nc([C@H]2NN[C@@H]3[C@@H]4CN(CCO4)N23)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&NN[C@H]&N1&",
"old_substring": "C5[C@H]4[NH3+]"
} |
Can you make molecule Cc1nc(C[C@@H]([NH3+])[C@@H]2CN(C(C)C)CCO2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCC.Cc1nc(N2CN[C@@H]3[C@@H]4CN(CCO4)[C@H]32)cs1 | Cc1nc(C[C@@H]([NH3+])[C@@H]2CN(C(C)C)CCO2)cs1 | CCC.Cc1nc(N2CN[C@@H]3[C@@H]4CN(CCO4)[C@H]32)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CN[C@H]&[C@H]1&",
"old_substring": "C5[C@H]4[NH3+]"
} |
Can you make molecule Cc1nc(C[C@@H]([NH3+])[C@@H]2CN(C(C)C)CCO2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCC.Cc1nc(N2CN[C@H]3[C@@H]4CN(CCO4)[C@H]32)cs1 | Cc1nc(C[C@@H]([NH3+])[C@@H]2CN(C(C)C)CCO2)cs1 | CCC.Cc1nc(N2CN[C@H]3[C@@H]4CN(CCO4)[C@H]32)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CN[C@@H]&[C@H]1&",
"old_substring": "C5[C@H]4[NH3+]"
} |
Can you make molecule c1cncc(-c2ncc(C[NH+]3C[C@H]4CCCC[C@@H]4C3)s2)c1 less soluble in water? The output molecule should be similar to the input molecule. | c1cncc(-c2ccc(C[NH+]3C[C@H]4CCCC[C@@H]4C3)s2)c1 | c1cncc(-c2ncc(C[NH+]3C[C@H]4CCCC[C@@H]4C3)s2)c1 | c1cncc(-c2ccc(C[NH+]3C[C@H]4CCCC[C@@H]4C3)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&s1",
"old_substring": "c17ncc6s1"
} |
Can you make molecule c1cncc(-c2ncc(C[NH+]3C[C@H]4CCCC[C@@H]4C3)s2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1nc(C[NH+]2C[C@H]3CCCC[C@@H]3C2)sc1-c1cccnc1 | c1cncc(-c2ncc(C[NH+]3C[C@H]4CCCC[C@@H]4C3)s2)c1 | Clc1nc(C[NH+]2C[C@H]3CCCC[C@@H]3C2)sc1-c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc&nc1Cl",
"old_substring": "c17ncc6s1"
} |
Can you make molecule c1cncc(-c2ncc(C[NH+]3C[C@H]4CCCC[C@@H]4C3)s2)c1 less soluble in water? The output molecule should be similar to the input molecule. | c1cncc(-c2nc3c(C[NH+]4C[C@H]5CCCC[C@@H]5C4)cccc3s2)c1 | c1cncc(-c2ncc(C[NH+]3C[C@H]4CCCC[C@@H]4C3)s2)c1 | c1cncc(-c2nc3c(C[NH+]4C[C@H]5CCCC[C@@H]5C4)cccc3s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2c&cccc2s1",
"old_substring": "c17ncc6s1"
} |
Can you make molecule c1cncc(-c2ncc(C[NH+]3C[C@H]4CCCC[C@@H]4C3)s2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Ic1c(C[NH+]2C[C@H]3CCCC[C@@H]3C2)ccnc1-c1cccnc1 | c1cncc(-c2ncc(C[NH+]3C[C@H]4CCCC[C@@H]4C3)s2)c1 | Ic1c(C[NH+]2C[C@H]3CCCC[C@@H]3C2)ccnc1-c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nccc&c1I",
"old_substring": "c17ncc6s1"
} |
Can you make molecule c1cncc(-c2ncc(C[NH+]3C[C@H]4CCCC[C@@H]4C3)s2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Brc1sc(C[NH+]2C[C@H]3CCCC[C@@H]3C2)cc1-c1cccnc1 | c1cncc(-c2ncc(C[NH+]3C[C@H]4CCCC[C@@H]4C3)s2)c1 | Brc1sc(C[NH+]2C[C@H]3CCCC[C@@H]3C2)cc1-c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&sc1Br",
"old_substring": "c17ncc6s1"
} |
Can you make molecule CCS[C@@H]1CC[C@H](NC(=O)NCc2cn(C)nc2CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSS[C@@H]1CC[C@H](NC(=O)NCc2cn(C)nc2CC)C1 | CCS[C@@H]1CC[C@H](NC(=O)NCc2cn(C)nc2CC)C1 | C=CSS[C@@H]1CC[C@H](NC(=O)NCc2cn(C)nc2CC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC6"
} |
Can you make molecule CCS[C@@H]1CC[C@H](NC(=O)NCc2cn(C)nc2CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCS[C@@H]1CC[C@H](NC(=O)NCc2cn(C)nc2CC)C1 | CCS[C@@H]1CC[C@H](NC(=O)NCc2cn(C)nc2CC)C1 | C=CCCS[C@@H]1CC[C@H](NC(=O)NCc2cn(C)nc2CC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC6"
} |
Can you make molecule CCS[C@@H]1CC[C@H](NC(=O)NCc2cn(C)nc2CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1CNC(=O)N[C@H]1CC[C@@H](SCCCCl)C1 | CCS[C@@H]1CC[C@H](NC(=O)NCc2cn(C)nc2CC)C1 | CCc1nn(C)cc1CNC(=O)N[C@H]1CC[C@@H](SCCCCl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC6"
} |
Can you make molecule CCS[C@@H]1CC[C@H](NC(=O)NCc2cn(C)nc2CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1CNC(=O)N[C@H]1CC[C@@H](SCCCCS)C1 | CCS[C@@H]1CC[C@H](NC(=O)NCc2cn(C)nc2CC)C1 | CCc1nn(C)cc1CNC(=O)N[C@H]1CC[C@@H](SCCCCS)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC6"
} |
Can you make molecule CCS[C@@H]1CC[C@H](NC(=O)NCc2cn(C)nc2CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1CNC(=O)N[C@H]1CC[C@@H](SCCCBr)C1 | CCS[C@@H]1CC[C@H](NC(=O)NCc2cn(C)nc2CC)C1 | CCc1nn(C)cc1CNC(=O)N[C@H]1CC[C@@H](SCCCBr)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC6"
} |
Can you make molecule CCc1cc(OS(=O)(=O)c2ccc3c(c2)C(=O)NCC3)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(Br)cc(OS(=O)(=O)c2ccc3c(c2)C(=O)NCC3)c1Cl | CCc1cc(OS(=O)(=O)c2ccc3c(c2)C(=O)NCC3)ccc1Cl | CCc1cc(Br)cc(OS(=O)(=O)c2ccc3c(c2)C(=O)NCC3)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)cc&c1Cl",
"old_substring": "c15cc4ccc1Cl"
} |
Can you make molecule CCc1cc(OS(=O)(=O)c2ccc3c(c2)C(=O)NCC3)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCc1c(Cl)cc(OS(=O)(=O)c2ccc3c(c2)C(=O)NCC3)cc1Cl | CCc1cc(OS(=O)(=O)c2ccc3c(c2)C(=O)NCC3)ccc1Cl | CCc1c(Cl)cc(OS(=O)(=O)c2ccc3c(c2)C(=O)NCC3)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc&cc1Cl",
"old_substring": "c15cc4ccc1Cl"
} |
Can you make molecule CCc1cc(OS(=O)(=O)c2ccc3c(c2)C(=O)NCC3)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(Cl)c(OS(=O)(=O)c2ccc3c(c2)C(=O)NCC3)cc1Cl | CCc1cc(OS(=O)(=O)c2ccc3c(c2)C(=O)NCC3)ccc1Cl | CCc1cc(Cl)c(OS(=O)(=O)c2ccc3c(c2)C(=O)NCC3)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)c&cc1Cl",
"old_substring": "c15cc4ccc1Cl"
} |
Can you make molecule CCc1cc(OS(=O)(=O)c2ccc3c(c2)C(=O)NCC3)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(OS(=O)(=O)c2ccc3c(c2)C(=O)NCC3)c(Cl)cc1Cl | CCc1cc(OS(=O)(=O)c2ccc3c(c2)C(=O)NCC3)ccc1Cl | CCc1cc(OS(=O)(=O)c2ccc3c(c2)C(=O)NCC3)c(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c(Cl)cc1Cl",
"old_substring": "c15cc4ccc1Cl"
} |
Can you make molecule CCc1cc(OS(=O)(=O)c2ccc3c(c2)C(=O)NCC3)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(OS(=O)(=O)c2ccc3c(c2)C(=O)NCC3)c(Cl)c1Cl | CCc1cc(OS(=O)(=O)c2ccc3c(c2)C(=O)NCC3)ccc1Cl | CCc1ccc(OS(=O)(=O)c2ccc3c(c2)C(=O)NCC3)c(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&c(Cl)c1Cl",
"old_substring": "c15cc4ccc1Cl"
} |
Can you make molecule CC[C@@H](C[NH2+][C@@H](C)CC)Oc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CC2([C@@H](C)CC)CC[NH+]1C2.Oc1ccccc1 | CC[C@@H](C[NH2+][C@@H](C)CC)Oc1ccccc1 | CC[C@H]1CC2([C@@H](C)CC)CC[NH+]1C2.Oc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&&C1",
"old_substring": "[NH2+]45"
} |
Can you make molecule CC[C@@H](C[NH2+][C@@H](C)CC)Oc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1C[C@@]2([C@@H](C)CC)CCC[NH+]1C2.Oc1ccccc1 | CC[C@@H](C[NH2+][C@@H](C)CC)Oc1ccccc1 | CC[C@H]1C[C@@]2([C@@H](C)CC)CCC[NH+]1C2.Oc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH2+]45"
} |
Can you make molecule CC[C@@H](C[NH2+][C@@H](C)CC)Oc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1Cc2c1[nH+]cn2[C@@H](C)CC.Oc1ccccc1 | CC[C@@H](C[NH2+][C@@H](C)CC)Oc1ccccc1 | CC[C@H]1Cc2c1[nH+]cn2[C@@H](C)CC.Oc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH2+]45"
} |
Can you make molecule CC[C@@H](C[NH2+][C@@H](C)CC)Oc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1Cc2cc([C@@H](C)CC)[nH+]n21.Oc1ccccc1 | CC[C@@H](C[NH2+][C@@H](C)CC)Oc1ccccc1 | CC[C@H]1Cc2cc([C@@H](C)CC)[nH+]n21.Oc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH2+]45"
} |
Can you make molecule CC[C@@H](C[NH2+][C@@H](C)CC)Oc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1Cc2c1[nH+]n(C)c2[C@@H](C)CC.Oc1ccccc1 | CC[C@@H](C[NH2+][C@@H](C)CC)Oc1ccccc1 | CC[C@H]1Cc2c1[nH+]n(C)c2[C@@H](C)CC.Oc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH2+]45"
} |
Can you make molecule CCc1nn(C)cc1C(=O)N(C)CC(=O)Nc1cccc(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1C(=O)N(C)CC(=O)Nc1cccc(C)c1C | CCc1nn(C)cc1C(=O)N(C)CC(=O)Nc1cccc(C)n1 | CCc1nn(C)cc1C(=O)N(C)CC(=O)Nc1cccc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c15cccc(C)n1"
} |
Can you make molecule CCc1nn(C)cc1C(=O)N(C)CC(=O)Nc1cccc(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1C(=O)N(C)CC(=O)Nc1ccc(C)s1 | CCc1nn(C)cc1C(=O)N(C)CC(=O)Nc1cccc(C)n1 | CCc1nn(C)cc1C(=O)N(C)CC(=O)Nc1ccc(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)s1",
"old_substring": "c15cccc(C)n1"
} |
Can you make molecule CCc1nn(C)cc1C(=O)N(C)CC(=O)Nc1cccc(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1C(=O)N(C)CC(=O)Nn1c(Cl)cccc1=O | CCc1nn(C)cc1C(=O)N(C)CC(=O)Nc1cccc(C)n1 | CCc1nn(C)cc1C(=O)N(C)CC(=O)Nn1c(Cl)cccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1cccc(Cl)n1&",
"old_substring": "c15cccc(C)n1"
} |
Can you make molecule CCc1nn(C)cc1C(=O)N(C)CC(=O)Nc1cccc(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1C(=O)N(C)CC(=O)Nc1cc2cc(C)ccc2n1C | CCc1nn(C)cc1C(=O)N(C)CC(=O)Nc1cccc(C)n1 | CCc1nn(C)cc1C(=O)N(C)CC(=O)Nc1cc2cc(C)ccc2n1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc(C)ccc2n1C",
"old_substring": "c15cccc(C)n1"
} |
Can you make molecule CCc1nn(C)cc1C(=O)N(C)CC(=O)Nc1cccc(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1C(=O)N(C)CC(=O)Nc1cccc2ccc(C)nc12 | CCc1nn(C)cc1C(=O)N(C)CC(=O)Nc1cccc(C)n1 | CCc1nn(C)cc1C(=O)N(C)CC(=O)Nc1cccc2ccc(C)nc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc2ccc(C)nc12",
"old_substring": "c15cccc(C)n1"
} |
Can you make molecule FC(F)(F)[C@@H](Br)c1ccccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)CC[C@@H](CBr)c1ccccc1Cl | FC(F)(F)[C@@H](Br)c1ccccc1Cl | CC(C)(C)CC[C@@H](CBr)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)CC[C@H]&CBr",
"old_substring": "FC(F)(F)[C@H]2Br"
} |
Can you make molecule FC(F)(F)[C@@H](Br)c1ccccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@H](C)c1ccccc1Cl | FC(F)(F)[C@@H](Br)c1ccccc1Cl | CC(C)CC[C@H](C)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC[C@@H]&C",
"old_substring": "FC(F)(F)[C@H]2Br"
} |
Can you make molecule FC(F)(F)[C@@H](Br)c1ccccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCC[C@H](C)c1ccccc1Cl | FC(F)(F)[C@@H](Br)c1ccccc1Cl | CC(C)CCC[C@H](C)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCC[C@@H]&C",
"old_substring": "FC(F)(F)[C@H]2Br"
} |
Can you make molecule FC(F)(F)[C@@H](Br)c1ccccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)[C@@H](C)c1ccccc1Cl | FC(F)(F)[C@@H](Br)c1ccccc1Cl | CCC(CC)[C@@H](C)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CCC(CC)[C@H]&C",
"old_substring": "FC(F)(F)[C@H]2Br"
} |
Can you make molecule FC(F)(F)[C@@H](Br)c1ccccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCC(C)(C)C)c1ccccc1Cl | FC(F)(F)[C@@H](Br)c1ccccc1Cl | C[C@@H](CCC(C)(C)C)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)CCC(C)(C)C",
"old_substring": "FC(F)(F)[C@H]2Br"
} |
Can you make molecule COC(=O)[C@H](C#N)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@@H](C(=O)C(=O)C1=CCC1)C(F)(F)F | COC(=O)[C@H](C#N)C(F)(F)F | N#C[C@@H](C(=O)C(=O)C1=CCC1)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=CCC1",
"old_substring": "CO1"
} |
Can you make molecule COC(=O)[C@H](C#N)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@@H](C(=O)C(=O)C1=CSCCO1)C(F)(F)F | COC(=O)[C@H](C#N)C(F)(F)F | N#C[C@@H](C(=O)C(=O)C1=CSCCO1)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=CSCCO1",
"old_substring": "CO1"
} |
Can you make molecule COC(=O)[C@H](C#N)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@@H](C(=O)C(=O)C1=COCCC1)C(F)(F)F | COC(=O)[C@H](C#N)C(F)(F)F | N#C[C@@H](C(=O)C(=O)C1=COCCC1)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=COCCC1",
"old_substring": "CO1"
} |
Can you make molecule COC(=O)[C@H](C#N)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@@H](C(=O)C(=O)C1=CCCCC1)C(F)(F)F | COC(=O)[C@H](C#N)C(F)(F)F | N#C[C@@H](C(=O)C(=O)C1=CCCCC1)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=CCCCC1",
"old_substring": "CO1"
} |
Can you make molecule COC(=O)[C@H](C#N)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@@H](C(=O)C(=O)CC1=CCCCC1)C(F)(F)F | COC(=O)[C@H](C#N)C(F)(F)F | N#C[C@@H](C(=O)C(=O)CC1=CCCCC1)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC1=CCCCC1",
"old_substring": "CO1"
} |
Can you make molecule CCOc1ccc(C(=O)CSc2nnc3c(=O)n(-c4cc(C)cc(C)c4)ccn23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(C(=O)CSc2nnc3c(=O)n(-c4cc(Cl)cc(Cl)c4Br)ccn23)cc1 | CCOc1ccc(C(=O)CSc2nnc3c(=O)n(-c4cc(C)cc(C)c4)ccn23)cc1 | CCOc1ccc(C(=O)CSc2nnc3c(=O)n(-c4cc(Cl)cc(Cl)c4Br)ccn23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)cc(Cl)c1Br",
"old_substring": "c19cc(C)cc(C)c1"
} |
Can you make molecule CCOc1ccc(C(=O)CSc2nnc3c(=O)n(-c4cc(C)cc(C)c4)ccn23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(C(=O)CSc2nnc3c(=O)n(-c4ccc(Cl)c(Cl)c4)ccn23)cc1 | CCOc1ccc(C(=O)CSc2nnc3c(=O)n(-c4cc(C)cc(C)c4)ccn23)cc1 | CCOc1ccc(C(=O)CSc2nnc3c(=O)n(-c4ccc(Cl)c(Cl)c4)ccn23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c19cc(C)cc(C)c1"
} |
Can you make molecule CCOc1ccc(C(=O)CSc2nnc3c(=O)n(-c4cc(C)cc(C)c4)ccn23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(C(=O)CSc2nnc3c(=O)n(-c4cc(C)c(C)cc4Br)ccn23)cc1 | CCOc1ccc(C(=O)CSc2nnc3c(=O)n(-c4cc(C)cc(C)c4)ccn23)cc1 | CCOc1ccc(C(=O)CSc2nnc3c(=O)n(-c4cc(C)c(C)cc4Br)ccn23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(C)c(C)cc1Br",
"old_substring": "c19cc(C)cc(C)c1"
} |
Can you make molecule CCOc1ccc(C(=O)CSc2nnc3c(=O)n(-c4cc(C)cc(C)c4)ccn23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(C(=O)CSc2nnc3c(=O)n(-c4c(C)cc(I)cc4C)ccn23)cc1 | CCOc1ccc(C(=O)CSc2nnc3c(=O)n(-c4cc(C)cc(C)c4)ccn23)cc1 | CCOc1ccc(C(=O)CSc2nnc3c(=O)n(-c4c(C)cc(I)cc4C)ccn23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(I)cc(C)c1&",
"old_substring": "c19cc(C)cc(C)c1"
} |
Can you make molecule CCOc1ccc(C(=O)CSc2nnc3c(=O)n(-c4cc(C)cc(C)c4)ccn23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(C(=O)CSc2nnc3c(=O)n(-c4c(Cl)ccc(C)c4Cl)ccn23)cc1 | CCOc1ccc(C(=O)CSc2nnc3c(=O)n(-c4cc(C)cc(C)c4)ccn23)cc1 | CCOc1ccc(C(=O)CSc2nnc3c(=O)n(-c4c(Cl)ccc(C)c4Cl)ccn23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)ccc(C)c1Cl",
"old_substring": "c19cc(C)cc(C)c1"
} |
Can you make molecule Cn1ncc2c1CCC[C@H]2[NH2+][C@H]1CCN(c2ccc(Cl)cc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncc2c1CCC[C@H]2[NH2+][C@H]1CCCCN(c2ccc(Cl)cc2)C1=O | Cn1ncc2c1CCC[C@H]2[NH2+][C@H]1CCN(c2ccc(Cl)cc2)C1=O | Cn1ncc2c1CCC[C@H]2[NH2+][C@H]1CCCCN(c2ccc(Cl)cc2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCCN&C1=O",
"old_substring": "[C@H]13CCN4C1=O"
} |
Can you make molecule Cn1ncc2c1CCC[C@H]2[NH2+][C@H]1CCN(c2ccc(Cl)cc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncc2c1CCC[C@H]2[NH2+][C@H]1CC(Cc2ccc(Cl)cc2)=NO1 | Cn1ncc2c1CCC[C@H]2[NH2+][C@H]1CCN(c2ccc(Cl)cc2)C1=O | Cn1ncc2c1CCC[C@H]2[NH2+][C@H]1CC(Cc2ccc(Cl)cc2)=NO1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC(C&)=NO1",
"old_substring": "[C@H]13CCN4C1=O"
} |
Can you make molecule Cn1ncc2c1CCC[C@H]2[NH2+][C@H]1CCN(c2ccc(Cl)cc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncc2c1CCC[C@H]2[NH2+][C@H]1C=C(Cc2ccc(Cl)cc2)ON1 | Cn1ncc2c1CCC[C@H]2[NH2+][C@H]1CCN(c2ccc(Cl)cc2)C1=O | Cn1ncc2c1CCC[C@H]2[NH2+][C@H]1C=C(Cc2ccc(Cl)cc2)ON1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C(C&)ON1",
"old_substring": "[C@H]13CCN4C1=O"
} |
Can you make molecule Cn1ncc2c1CCC[C@H]2[NH2+][C@H]1CCN(c2ccc(Cl)cc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncc2c1CCC[C@H]2[NH2+][C@@H]1CCCCN(c2ccc(Cl)cc2)C1=O | Cn1ncc2c1CCC[C@H]2[NH2+][C@H]1CCN(c2ccc(Cl)cc2)C1=O | Cn1ncc2c1CCC[C@H]2[NH2+][C@@H]1CCCCN(c2ccc(Cl)cc2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCCN&C1=O",
"old_substring": "[C@H]13CCN4C1=O"
} |
Can you make molecule Cn1ncc2c1CCC[C@H]2[NH2+][C@H]1CCN(c2ccc(Cl)cc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncc2c1CCC[C@H]2[NH2+][C@H]1CCCCN(c2ccc(Cl)cc2)C1 | Cn1ncc2c1CCC[C@H]2[NH2+][C@H]1CCN(c2ccc(Cl)cc2)C1=O | Cn1ncc2c1CCC[C@H]2[NH2+][C@H]1CCCCN(c2ccc(Cl)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCCN&C1",
"old_substring": "[C@H]13CCN4C1=O"
} |
Can you make molecule COc1cc(NC(=O)C[C@@H]2C[NH2+]CCO2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(NC(=O)C[C@@H]2C[NH2+]CCO2)cc(OC)c1 | COc1cc(NC(=O)C[C@@H]2C[NH2+]CCO2)cc(OC)c1 | COCc1cc(NC(=O)C[C@@H]2C[NH2+]CCO2)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(NC(=O)C[C@@H]2C[NH2+]CCO2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc(NC(=O)C[C@@H]2C[NH2+]CCO2)cc(OC)c1 | COc1cc(NC(=O)C[C@@H]2C[NH2+]CCO2)cc(OC)c1 | COCSc1cc(NC(=O)C[C@@H]2C[NH2+]CCO2)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(NC(=O)C[C@@H]2C[NH2+]CCO2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)C[C@@H]2C[NH2+]CCO2)cc(SC(C)=O)c1 | COc1cc(NC(=O)C[C@@H]2C[NH2+]CCO2)cc(OC)c1 | COc1cc(NC(=O)C[C@@H]2C[NH2+]CCO2)cc(SC(C)=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(NC(=O)C[C@@H]2C[NH2+]CCO2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)C[C@@H]2C[NH2+]CCO2)cc(C(=O)CS)c1 | COc1cc(NC(=O)C[C@@H]2C[NH2+]CCO2)cc(OC)c1 | COc1cc(NC(=O)C[C@@H]2C[NH2+]CCO2)cc(C(=O)CS)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(NC(=O)C[C@@H]2C[NH2+]CCO2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)C[C@@H]2C[NH2+]CCO2)cc(C(=O)CI)c1 | COc1cc(NC(=O)C[C@@H]2C[NH2+]CCO2)cc(OC)c1 | COc1cc(NC(=O)C[C@@H]2C[NH2+]CCO2)cc(C(=O)CI)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule COC(=O)c1c(CBr)nc2n(Cc3ccccc3)c3ccccc3n12 less soluble in water? The output molecule should be similar to the input molecule. | COCSC(=O)c1c(CBr)nc2n(Cc3ccccc3)c3ccccc3n12 | COC(=O)c1c(CBr)nc2n(Cc3ccccc3)c3ccccc3n12 | COCSC(=O)c1c(CBr)nc2n(Cc3ccccc3)c3ccccc3n12 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COC(=O)c1c(CBr)nc2n(Cc3ccccc3)c3ccccc3n12 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SC(=O)c1c(CBr)nc2n(Cc3ccccc3)c3ccccc3n12 | COC(=O)c1c(CBr)nc2n(Cc3ccccc3)c3ccccc3n12 | CC(=O)SC(=O)c1c(CBr)nc2n(Cc3ccccc3)c3ccccc3n12 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COC(=O)c1c(CBr)nc2n(Cc3ccccc3)c3ccccc3n12 less soluble in water? The output molecule should be similar to the input molecule. | CON(C)CCCC(=O)c1c(CBr)nc2n(Cc3ccccc3)c3ccccc3n12 | COC(=O)c1c(CBr)nc2n(Cc3ccccc3)c3ccccc3n12 | CON(C)CCCC(=O)c1c(CBr)nc2n(Cc3ccccc3)c3ccccc3n12 | 102 | {
"fragment_index": 0,
"new_substring": "CON(C)CCC&",
"old_substring": "CO4"
} |
Can you make molecule COC(=O)c1c(CBr)nc2n(Cc3ccccc3)c3ccccc3n12 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CCCC(=O)c1c(CBr)nc2n(Cc3ccccc3)c3ccccc3n12 | COC(=O)c1c(CBr)nc2n(Cc3ccccc3)c3ccccc3n12 | CC(=O)CCCC(=O)c1c(CBr)nc2n(Cc3ccccc3)c3ccccc3n12 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)CCC&",
"old_substring": "CO4"
} |
Can you make molecule COC(=O)c1c(CBr)nc2n(Cc3ccccc3)c3ccccc3n12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCBr)C(=O)c1c(CBr)nc2n(Cc3ccccc3)c3ccccc3n12 | COC(=O)c1c(CBr)nc2n(Cc3ccccc3)c3ccccc3n12 | O=C(CCBr)C(=O)c1c(CBr)nc2n(Cc3ccccc3)c3ccccc3n12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCBr",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(NC(=O)N[C@@H](C)c2ccc(C)o2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)N[C@@H](C)c2ccc(Br)o2)cn1 | COc1ccc(NC(=O)N[C@@H](C)c2ccc(C)o2)cn1 | COc1ccc(NC(=O)N[C@@H](C)c2ccc(Br)o2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)o1",
"old_substring": "c18ccc(C)o1"
} |
Can you make molecule COc1ccc(NC(=O)N[C@@H](C)c2ccc(C)o2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)N[C@@H](C)c2ccc(Cl)s2)cn1 | COc1ccc(NC(=O)N[C@@H](C)c2ccc(C)o2)cn1 | COc1ccc(NC(=O)N[C@@H](C)c2ccc(Cl)s2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c18ccc(C)o1"
} |
Can you make molecule COc1ccc(NC(=O)N[C@@H](C)c2ccc(C)o2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)N[C@@H](C)c2cccc(C)c2C)cn1 | COc1ccc(NC(=O)N[C@@H](C)c2ccc(C)o2)cn1 | COc1ccc(NC(=O)N[C@@H](C)c2cccc(C)c2C)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c18ccc(C)o1"
} |
Can you make molecule COc1ccc(NC(=O)N[C@@H](C)c2ccc(C)o2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)N[C@@H](C)c2cc3cc(C)ccc3o2)cn1 | COc1ccc(NC(=O)N[C@@H](C)c2ccc(C)o2)cn1 | COc1ccc(NC(=O)N[C@@H](C)c2cc3cc(C)ccc3o2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc(C)ccc2o1",
"old_substring": "c18ccc(C)o1"
} |
Can you make molecule COc1ccc(NC(=O)N[C@@H](C)c2ccc(C)o2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)N[C@@H](C)c2cc3cc(Cl)ccc3o2)cn1 | COc1ccc(NC(=O)N[C@@H](C)c2ccc(C)o2)cn1 | COc1ccc(NC(=O)N[C@@H](C)c2cc3cc(Cl)ccc3o2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc(Cl)ccc2o1",
"old_substring": "c18ccc(C)o1"
} |
Can you make molecule Cc1ccc(NS(=O)(=O)c2ccc(Cl)cc2[N+](=O)[O-])c2c1CC(C)(C)O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(cc1NS(=O)(=O)c1ccc(Cl)cc1[N+](=O)[O-])CCCC2 | Cc1ccc(NS(=O)(=O)c2ccc(Cl)cc2[N+](=O)[O-])c2c1CC(C)(C)O2 | Cc1cc2c(cc1NS(=O)(=O)c1ccc(Cl)cc1[N+](=O)[O-])CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc2c(cc1&)CCCC2",
"old_substring": "Cc1ccc4c2c1CC(C)(C)O2"
} |
Can you make molecule Cc1ccc(NS(=O)(=O)c2ccc(Cl)cc2[N+](=O)[O-])c2c1CC(C)(C)O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c(C=NS(=O)(=O)c2ccc(Cl)cc2[N+](=O)[O-])cc1C | Cc1ccc(NS(=O)(=O)c2ccc(Cl)cc2[N+](=O)[O-])c2c1CC(C)(C)O2 | Cc1cc(C)c(C=NS(=O)(=O)c2ccc(Cl)cc2[N+](=O)[O-])cc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(C)c(C=&)cc1C",
"old_substring": "Cc1ccc4c2c1CC(C)(C)O2"
} |
Can you make molecule Cc1ccc(NS(=O)(=O)c2ccc(Cl)cc2[N+](=O)[O-])c2c1CC(C)(C)O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c(NS(=O)(=O)c2ccc(Cl)cc2[N+](=O)[O-])c(Cl)c1 | Cc1ccc(NS(=O)(=O)c2ccc(Cl)cc2[N+](=O)[O-])c2c1CC(C)(C)O2 | Cc1cc(C)c(NS(=O)(=O)c2ccc(Cl)cc2[N+](=O)[O-])c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(C)c&c(Cl)c1",
"old_substring": "Cc1ccc4c2c1CC(C)(C)O2"
} |
Can you make molecule Cc1ccc(NS(=O)(=O)c2ccc(Cl)cc2[N+](=O)[O-])c2c1CC(C)(C)O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(I)cc(C)c1NS(=O)(=O)c1ccc(Cl)cc1[N+](=O)[O-] | Cc1ccc(NS(=O)(=O)c2ccc(Cl)cc2[N+](=O)[O-])c2c1CC(C)(C)O2 | Cc1cc(I)cc(C)c1NS(=O)(=O)c1ccc(Cl)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(I)cc(C)c1&",
"old_substring": "Cc1ccc4c2c1CC(C)(C)O2"
} |
Can you make molecule Cc1ccc(NS(=O)(=O)c2ccc(Cl)cc2[N+](=O)[O-])c2c1CC(C)(C)O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C=NS(=O)(=O)c2ccc(Cl)cc2[N+](=O)[O-])cc(C)c1Cl | Cc1ccc(NS(=O)(=O)c2ccc(Cl)cc2[N+](=O)[O-])c2c1CC(C)(C)O2 | Cc1cc(C=NS(=O)(=O)c2ccc(Cl)cc2[N+](=O)[O-])cc(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(C=&)cc(C)c1Cl",
"old_substring": "Cc1ccc4c2c1CC(C)(C)O2"
} |
Can you make molecule O=C(N/N=C\c1ccoc1)c1ccccc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C\c1ccoc1)c1ccc2ccc(=O)oc2c1 | O=C(N/N=C\c1ccoc1)c1ccccc1[N+](=O)[O-] | O=C(N/N=C\c1ccoc1)c1ccc2ccc(=O)oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2ccc(=O)oc2c1",
"old_substring": "c12ccccc1[N+](=O)[O-]"
} |
Can you make molecule O=C(N/N=C\c1ccoc1)c1ccccc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C\c1ccoc1)c1cc2ccccc2c(=O)s1 | O=C(N/N=C\c1ccoc1)c1ccccc1[N+](=O)[O-] | O=C(N/N=C\c1ccoc1)c1cc2ccccc2c(=O)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2ccccc2c(=O)s1",
"old_substring": "c12ccccc1[N+](=O)[O-]"
} |
Can you make molecule O=C(N/N=C\c1ccoc1)c1ccccc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C\c1ccoc1)c1nc2ccsc2c(=O)s1 | O=C(N/N=C\c1ccoc1)c1ccccc1[N+](=O)[O-] | O=C(N/N=C\c1ccoc1)c1nc2ccsc2c(=O)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2ccsc2c(=O)s1",
"old_substring": "c12ccccc1[N+](=O)[O-]"
} |
Can you make molecule O=C(N/N=C\c1ccoc1)c1ccccc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C\c1ccoc1)c1ccc(I)cc1 | O=C(N/N=C\c1ccoc1)c1ccccc1[N+](=O)[O-] | O=C(N/N=C\c1ccoc1)c1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c12ccccc1[N+](=O)[O-]"
} |
Can you make molecule O=C(N/N=C\c1ccoc1)c1ccccc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C\c1ccoc1)c1ccccc1Cl | O=C(N/N=C\c1ccoc1)c1ccccc1[N+](=O)[O-] | O=C(N/N=C\c1ccoc1)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c12ccccc1[N+](=O)[O-]"
} |
Can you make molecule C[C@H](Oc1ccccc1N)C(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCOc1ccccc1N)CC(=O)c1ccc(Cl)cc1 | C[C@H](Oc1ccccc1N)C(=O)c1ccc(Cl)cc1 | C[C@H](CCOc1ccccc1N)CC(=O)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@H]2C4=O"
} |
Can you make molecule C[C@H](Oc1ccccc1N)C(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCOc1ccccc1N)CC(=O)c1ccc(Cl)cc1 | C[C@H](Oc1ccccc1N)C(=O)c1ccc(Cl)cc1 | C[C@@H](CCOc1ccccc1N)CC(=O)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@H]2C4=O"
} |
Can you make molecule C[C@H](Oc1ccccc1N)C(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCc1ccc(Cl)cc1)Oc1ccccc1N | C[C@H](Oc1ccccc1N)C(=O)c1ccc(Cl)cc1 | C[C@@H](CCc1ccc(Cl)cc1)Oc1ccccc1N | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C[C@H]2C4=O"
} |
Can you make molecule C[C@H](Oc1ccccc1N)C(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@](CO)(CCCc1ccc(Cl)cc1)Oc1ccccc1N | C[C@H](Oc1ccccc1N)C(=O)c1ccc(Cl)cc1 | C[C@](CO)(CCCc1ccc(Cl)cc1)Oc1ccccc1N | 102 | {
"fragment_index": 0,
"new_substring": "C[C@]&(CO)CCC&",
"old_substring": "C[C@H]2C4=O"
} |
Can you make molecule C[C@H](Oc1ccccc1N)C(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1ccc(Cl)cc1)Oc1ccccc1N | C[C@H](Oc1ccccc1N)C(=O)c1ccc(Cl)cc1 | C[C@H](CC(C)(C)c1ccc(Cl)cc1)Oc1ccccc1N | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@H]2C4=O"
} |
Can you make molecule Cc1cc(=O)[nH]c(N2CCN(C(=O)c3cc(F)cc(F)c3)CC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)[nH]c(SN2CCN(C(=O)c3cc(F)cc(F)c3)CC2)n1 | Cc1cc(=O)[nH]c(N2CCN(C(=O)c3cc(F)cc(F)c3)CC2)n1 | Cc1cc(=O)[nH]c(SN2CCN(C(=O)c3cc(F)cc(F)c3)CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N15CCN4CC1"
} |
Can you make molecule Cc1cc(=O)[nH]c(N2CCN(C(=O)c3cc(F)cc(F)c3)CC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)[nH]c(N2CCN=C2CC(=O)c2cc(F)cc(F)c2)n1 | Cc1cc(=O)[nH]c(N2CCN(C(=O)c3cc(F)cc(F)c3)CC2)n1 | Cc1cc(=O)[nH]c(N2CCN=C2CC(=O)c2cc(F)cc(F)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1C&",
"old_substring": "N15CCN4CC1"
} |
Can you make molecule Cc1cc(=O)[nH]c(N2CCN(C(=O)c3cc(F)cc(F)c3)CC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)[nH]c(N2CCCN(C(=O)c3cc(F)cc(F)c3)C2=O)n1 | Cc1cc(=O)[nH]c(N2CCN(C(=O)c3cc(F)cc(F)c3)CC2)n1 | Cc1cc(=O)[nH]c(N2CCCN(C(=O)c3cc(F)cc(F)c3)C2=O)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&C1=O",
"old_substring": "N15CCN4CC1"
} |
Can you make molecule Cc1cc(=O)[nH]c(N2CCN(C(=O)c3cc(F)cc(F)c3)CC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)[nH]c(N2CCN=C2SC(=O)c2cc(F)cc(F)c2)n1 | Cc1cc(=O)[nH]c(N2CCN(C(=O)c3cc(F)cc(F)c3)CC2)n1 | Cc1cc(=O)[nH]c(N2CCN=C2SC(=O)c2cc(F)cc(F)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N15CCN4CC1"
} |
Can you make molecule Cc1cc(=O)[nH]c(N2CCN(C(=O)c3cc(F)cc(F)c3)CC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)[nH]c(N2CCN(C(=O)c3cc(F)cc(F)c3)C(C)(C)C2)n1 | Cc1cc(=O)[nH]c(N2CCN(C(=O)c3cc(F)cc(F)c3)CC2)n1 | Cc1cc(=O)[nH]c(N2CCN(C(=O)c3cc(F)cc(F)c3)C(C)(C)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&C(C)(C)C1",
"old_substring": "N15CCN4CC1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.