prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule COc1ccc(-c2nc(CSc3nc4ccccc4[nH]3)n[nH]2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(-c2nc(CSc3nc4ccccc4[nH]3)n[nH]2)cc1 | COc1ccc(-c2nc(CSc3nc4ccccc4[nH]3)n[nH]2)cc1 | COCc1ccc(-c2nc(CSc3nc4ccccc4[nH]3)n[nH]2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(-c2nc(CSc3nc4ccccc4[nH]3)n[nH]2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(-c2nc(CSc3nc4ccccc4[nH]3)n[nH]2)cc1 | COc1ccc(-c2nc(CSc3nc4ccccc4[nH]3)n[nH]2)cc1 | COCSc1ccc(-c2nc(CSc3nc4ccccc4[nH]3)n[nH]2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(-c2nc(CSc3nc4ccccc4[nH]3)n[nH]2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(-c2nc(CSc3nc4ccccc4[nH]3)n[nH]2)cc1 | COc1ccc(-c2nc(CSc3nc4ccccc4[nH]3)n[nH]2)cc1 | CC(=O)Sc1ccc(-c2nc(CSc3nc4ccccc4[nH]3)n[nH]2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(-c2nc(CSc3nc4ccccc4[nH]3)n[nH]2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS)c1ccc(-c2nc(CSc3nc4ccccc4[nH]3)n[nH]2)cc1 | COc1ccc(-c2nc(CSc3nc4ccccc4[nH]3)n[nH]2)cc1 | O=C(CS)c1ccc(-c2nc(CSc3nc4ccccc4[nH]3)n[nH]2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(-c2nc(CSc3nc4ccccc4[nH]3)n[nH]2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CI)c1ccc(-c2nc(CSc3nc4ccccc4[nH]3)n[nH]2)cc1 | COc1ccc(-c2nc(CSc3nc4ccccc4[nH]3)n[nH]2)cc1 | O=C(CI)c1ccc(-c2nc(CSc3nc4ccccc4[nH]3)n[nH]2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(C(=O)COC(=O)c2cccc(S(C)(=O)=O)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)COSC(=O)Cc2cccc(S(C)(=O)=O)c2)cc1 | COc1ccc(C(=O)COC(=O)c2cccc(S(C)(=O)=O)c2)cc1 | COc1ccc(C(=O)COSC(=O)Cc2cccc(S(C)(=O)=O)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C37=O"
} |
Can you make molecule COc1ccc(C(=O)COC(=O)c2cccc(S(C)(=O)=O)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)COC(=O)CCCC(=O)c2cccc(S(C)(=O)=O)c2)cc1 | COc1ccc(C(=O)COC(=O)c2cccc(S(C)(=O)=O)c2)cc1 | COc1ccc(C(=O)COC(=O)CCCC(=O)c2cccc(S(C)(=O)=O)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C37=O"
} |
Can you make molecule COc1ccc(C(=O)COC(=O)c2cccc(S(C)(=O)=O)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)COC(=O)CC(C)(C)c2cccc(S(C)(=O)=O)c2)cc1 | COc1ccc(C(=O)COC(=O)c2cccc(S(C)(=O)=O)c2)cc1 | COc1ccc(C(=O)COC(=O)CC(C)(C)c2cccc(S(C)(=O)=O)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule COc1ccc(C(=O)COC(=O)c2cccc(S(C)(=O)=O)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)COC(=O)CCC(C)(C)c2cccc(S(C)(=O)=O)c2)cc1 | COc1ccc(C(=O)COC(=O)c2cccc(S(C)(=O)=O)c2)cc1 | COc1ccc(C(=O)COC(=O)CCC(C)(C)c2cccc(S(C)(=O)=O)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule COc1ccc(C(=O)COC(=O)c2cccc(S(C)(=O)=O)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)COSC(=O)[C@@H](C)c2cccc(S(C)(=O)=O)c2)cc1 | COc1ccc(C(=O)COC(=O)c2cccc(S(C)(=O)=O)c2)cc1 | COc1ccc(C(=O)COSC(=O)[C@@H](C)c2cccc(S(C)(=O)=O)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C37=O"
} |
Can you make molecule CCOC(=O)[C@H]1CCCC[NH+]1Cc1cc(=O)oc2cc(CC)c(Cl)cc12 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)[C@H]1CCCC[C@H](Cc2cc(=O)oc3cc(CC)c(Cl)cc23)C1 | CCOC(=O)[C@H]1CCCC[NH+]1Cc1cc(=O)oc2cc(CC)c(Cl)cc12 | CCOC(=O)[C@H]1CCCC[C@H](Cc2cc(=O)oc3cc(CC)c(Cl)cc23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@H]&C1",
"old_substring": "[C@H]16CCCC[NH+]15"
} |
Can you make molecule CCOC(=O)[C@H]1CCCC[NH+]1Cc1cc(=O)oc2cc(CC)c(Cl)cc12 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)[C@H]1CCC[C@H](Cc2cc(=O)oc3cc(CC)c(Cl)cc23)C1 | CCOC(=O)[C@H]1CCCC[NH+]1Cc1cc(=O)oc2cc(CC)c(Cl)cc12 | CCOC(=O)[C@H]1CCC[C@H](Cc2cc(=O)oc3cc(CC)c(Cl)cc23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]16CCCC[NH+]15"
} |
Can you make molecule CCOC(=O)[C@H]1CCCC[NH+]1Cc1cc(=O)oc2cc(CC)c(Cl)cc12 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)[C@H]1CCCCN(Cc2cc(=O)oc3cc(CC)c(Cl)cc23)C1 | CCOC(=O)[C@H]1CCCC[NH+]1Cc1cc(=O)oc2cc(CC)c(Cl)cc12 | CCOC(=O)[C@H]1CCCCN(Cc2cc(=O)oc3cc(CC)c(Cl)cc23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCCN&C1",
"old_substring": "[C@H]16CCCC[NH+]15"
} |
Can you make molecule CCOC(=O)[C@H]1CCCC[NH+]1Cc1cc(=O)oc2cc(CC)c(Cl)cc12 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)[C@H]1CCC[C@H](Cc2cc(=O)oc3cc(CC)c(Cl)cc23)CC1 | CCOC(=O)[C@H]1CCCC[NH+]1Cc1cc(=O)oc2cc(CC)c(Cl)cc12 | CCOC(=O)[C@H]1CCC[C@H](Cc2cc(=O)oc3cc(CC)c(Cl)cc23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&CC1",
"old_substring": "[C@H]16CCCC[NH+]15"
} |
Can you make molecule CCOC(=O)[C@H]1CCCC[NH+]1Cc1cc(=O)oc2cc(CC)c(Cl)cc12 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)[C@H]1CN(Cc2cc(=O)oc3cc(CC)c(Cl)cc23)C[C@@H]1C | CCOC(=O)[C@H]1CCCC[NH+]1Cc1cc(=O)oc2cc(CC)c(Cl)cc12 | CCOC(=O)[C@H]1CN(Cc2cc(=O)oc3cc(CC)c(Cl)cc23)C[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C[C@@H]1C",
"old_substring": "[C@H]16CCCC[NH+]15"
} |
Can you make molecule COC(=O)c1cccc(NS(=O)(=O)c2ccc(C)s2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSC(=O)c1cccc(NS(=O)(=O)c2ccc(C)s2)c1 | COC(=O)c1cccc(NS(=O)(=O)c2ccc(C)s2)c1 | COCSC(=O)c1cccc(NS(=O)(=O)c2ccc(C)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)c1cccc(NS(=O)(=O)c2ccc(C)s2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SC(=O)c1cccc(NS(=O)(=O)c2ccc(C)s2)c1 | COC(=O)c1cccc(NS(=O)(=O)c2ccc(C)s2)c1 | CC(=O)SC(=O)c1cccc(NS(=O)(=O)c2ccc(C)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)c1cccc(NS(=O)(=O)c2ccc(C)s2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CON(C)CCCC(=O)c1cccc(NS(=O)(=O)c2ccc(C)s2)c1 | COC(=O)c1cccc(NS(=O)(=O)c2ccc(C)s2)c1 | CON(C)CCCC(=O)c1cccc(NS(=O)(=O)c2ccc(C)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CON(C)CCC&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)c1cccc(NS(=O)(=O)c2ccc(C)s2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CCCC(=O)c1cccc(NS(=O)(=O)c2ccc(C)s2)c1 | COC(=O)c1cccc(NS(=O)(=O)c2ccc(C)s2)c1 | CC(=O)CCCC(=O)c1cccc(NS(=O)(=O)c2ccc(C)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)CCC&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)c1cccc(NS(=O)(=O)c2ccc(C)s2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)Nc2cccc(C(=O)C(=O)CCBr)c2)s1 | COC(=O)c1cccc(NS(=O)(=O)c2ccc(C)s2)c1 | Cc1ccc(S(=O)(=O)Nc2cccc(C(=O)C(=O)CCBr)c2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCBr",
"old_substring": "CO3"
} |
Can you make molecule O=C(COc1ccccc1C(=O)Nc1ccccc1)Nc1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SOc1ccccc1C(=O)Nc1ccccc1)Nc1ccc(Br)cc1 | O=C(COc1ccccc1C(=O)Nc1ccccc1)Nc1ccc(Br)cc1 | O=C(/C=C/SOc1ccccc1C(=O)Nc1ccccc1)Nc1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C2C4"
} |
Can you make molecule O=C(COc1ccccc1C(=O)Nc1ccccc1)Nc1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccccc1)c1ccccc1ON1CCC(=NONc2ccc(Br)cc2)CC1 | O=C(COc1ccccc1C(=O)Nc1ccccc1)Nc1ccc(Br)cc1 | O=C(Nc1ccccc1)c1ccccc1ON1CCC(=NONc2ccc(Br)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C2C4"
} |
Can you make molecule O=C(COc1ccccc1C(=O)Nc1ccccc1)Nc1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCN(Oc2ccccc2C(=O)Nc2ccccc2)CC1)Nc1ccc(Br)cc1 | O=C(COc1ccccc1C(=O)Nc1ccccc1)Nc1ccc(Br)cc1 | O=C(NN=C1CCN(Oc2ccccc2C(=O)Nc2ccccc2)CC1)Nc1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCN&CC1",
"old_substring": "O=C2C4"
} |
Can you make molecule O=C(COc1ccccc1C(=O)Nc1ccccc1)Nc1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(Oc2ccccc2C(=O)Nc2ccccc2)CC1)Nc1ccc(Br)cc1 | O=C(COc1ccccc1C(=O)Nc1ccccc1)Nc1ccc(Br)cc1 | O=C(NN=C1CCC(Oc2ccccc2C(=O)Nc2ccccc2)CC1)Nc1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C2C4"
} |
Can you make molecule O=C(COc1ccccc1C(=O)Nc1ccccc1)Nc1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ONc1ccc(Br)cc1)C(=O)SOc1ccccc1C(=O)Nc1ccccc1 | O=C(COc1ccccc1C(=O)Nc1ccccc1)Nc1ccc(Br)cc1 | C/C(=N\ONc1ccc(Br)cc1)C(=O)SOc1ccccc1C(=O)Nc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C2C4"
} |
Can you make molecule CC(C)[C@H]1CN(C(=O)CCC(N)=O)CCC[NH+]1Cc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)CCC(=O)N1CCC[NH+](Cc2ccc(F)cc2)[C@@H](CCCBr)C1 | CC(C)[C@H]1CN(C(=O)CCC(N)=O)CCC[NH+]1Cc1ccc(F)cc1 | NC(=O)CCC(=O)N1CCC[NH+](Cc2ccc(F)cc2)[C@@H](CCCBr)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)[C@H]1CN(C(=O)CCC(N)=O)CCC[NH+]1Cc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@H]1CN(C(=O)CCC(N)=O)CCC[NH+]1Cc1ccc(F)cc1 | CC(C)[C@H]1CN(C(=O)CCC(N)=O)CCC[NH+]1Cc1ccc(F)cc1 | CC(C)CC[C@H]1CN(C(=O)CCC(N)=O)CCC[NH+]1Cc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)[C@H]1CN(C(=O)CCC(N)=O)CCC[NH+]1Cc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)CCC(=O)N1CCC[NH+](Cc2ccc(F)cc2)[C@@H](CCCCBr)C1 | CC(C)[C@H]1CN(C(=O)CCC(N)=O)CCC[NH+]1Cc1ccc(F)cc1 | NC(=O)CCC(=O)N1CCC[NH+](Cc2ccc(F)cc2)[C@@H](CCCCBr)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)[C@H]1CN(C(=O)CCC(N)=O)CCC[NH+]1Cc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[C@H]1CN(C(=O)CCC(N)=O)CCC[NH+]1Cc1ccc(F)cc1 | CC(C)[C@H]1CN(C(=O)CCC(N)=O)CCC[NH+]1Cc1ccc(F)cc1 | C=CCCC[C@H]1CN(C(=O)CCC(N)=O)CCC[NH+]1Cc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)[C@H]1CN(C(=O)CCC(N)=O)CCC[NH+]1Cc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)CCC(=O)N1CCC[NH+](Cc2ccc(F)cc2)[C@@H](CCCCCl)C1 | CC(C)[C@H]1CN(C(=O)CCC(N)=O)CCC[NH+]1Cc1ccc(F)cc1 | NC(=O)CCC(=O)N1CCC[NH+](Cc2ccc(F)cc2)[C@@H](CCCCCl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CC4C"
} |
Can you make molecule Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)S(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)S(=O)(=O)C(C)C | Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)S(C)(=O)=O | Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)S(=O)(=O)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)S&(=O)=O",
"old_substring": "S6(C)(=O)=O"
} |
Can you make molecule Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)S(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)S(=O)(=O)CC(C)C | Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)S(C)(=O)=O | Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)S(=O)(=O)CC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CS&(=O)=O",
"old_substring": "S6(C)(=O)=O"
} |
Can you make molecule Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)S(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)CCCCS(C)(=O)=O | Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)S(C)(=O)=O | Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)CCCCS(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS(C)(=O)=O",
"old_substring": "S6(C)(=O)=O"
} |
Can you make molecule Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)S(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)C(=O)N=S(C)(C)=O | Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)S(C)(=O)=O | Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)C(=O)N=S(C)(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "CS(C)(=O)=NC&=O",
"old_substring": "S6(C)(=O)=O"
} |
Can you make molecule Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)S(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)CS(=O)(=O)C(C)C | Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)S(C)(=O)=O | Cc1ccc(S(=O)(=O)NCCC(=O)N2CCCC2)c(C)c1N(C)CS(=O)(=O)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)S(=O)(=O)C&",
"old_substring": "S6(C)(=O)=O"
} |
Can you make molecule O=C(NCCc1nccn1Cc1ccccc1)N[C@@H]1CCC[C@H]1CO less soluble in water? The output molecule should be similar to the input molecule. | O=C1C2=CC=CC2=C(NCCc2nccn2Cc2ccccc2)CCN1N[C@@H]1CCC[C@H]1CO | O=C(NCCc1nccn1Cc1ccccc1)N[C@@H]1CCC[C@H]1CO | O=C1C2=CC=CC2=C(NCCc2nccn2Cc2ccccc2)CCN1N[C@@H]1CCC[C@H]1CO | 102 | {
"fragment_index": 0,
"new_substring": "O=C1c2cccc&c2CCN1&",
"old_substring": "O=C23"
} |
Can you make molecule O=C(NCCc1nccn1Cc1ccccc1)N[C@@H]1CCC[C@H]1CO less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1c(NCCc2nccn2Cc2ccccc2)cc(N[C@@H]2CCC[C@H]2CO)ccc2oc1-2 | O=C(NCCc1nccn1Cc1ccccc1)N[C@@H]1CCC[C@H]1CO | O=Cc1c(NCCc2nccn2Cc2ccccc2)cc(N[C@@H]2CCC[C@H]2CO)ccc2oc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1c&oc2ccc&cc12",
"old_substring": "O=C23"
} |
Can you make molecule O=C(NCCc1nccn1Cc1ccccc1)N[C@@H]1CCC[C@H]1CO less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SN[C@@H]1CCC[C@H]1CO)NCCc1nccn1Cc1ccccc1 | O=C(NCCc1nccn1Cc1ccccc1)N[C@@H]1CCC[C@H]1CO | O=C(/C=C/SN[C@@H]1CCC[C@H]1CO)NCCc1nccn1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C23"
} |
Can you make molecule O=C(NCCc1nccn1Cc1ccccc1)N[C@@H]1CCC[C@H]1CO less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NCCc2nccn2Cc2ccccc2)nc1N[C@@H]1CCC[C@H]1CO | O=C(NCCc1nccn1Cc1ccccc1)N[C@@H]1CCC[C@H]1CO | O=Cc1sc(NCCc2nccn2Cc2ccccc2)nc1N[C@@H]1CCC[C@H]1CO | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C23"
} |
Can you make molecule O=C(NCCc1nccn1Cc1ccccc1)N[C@@H]1CCC[C@H]1CO less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NCCc2nccn2Cc2ccccc2)sc1N[C@@H]1CCC[C@H]1CO | O=C(NCCc1nccn1Cc1ccccc1)N[C@@H]1CCC[C@H]1CO | O=Cc1nc(NCCc2nccn2Cc2ccccc2)sc1N[C@@H]1CCC[C@H]1CO | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C23"
} |
Can you make molecule CC[NH+]1CC[C@@H](CNCc2ccc([O-])c[nH+]2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CC[C@@H](CCCNCc2ccc([O-])c[nH+]2)C1 | CC[NH+]1CC[C@@H](CNCc2ccc([O-])c[nH+]2)C1 | CC[NH+]1CC[C@@H](CCCNCc2ccc([O-])c[nH+]2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC&",
"old_substring": "C47"
} |
Can you make molecule CC[NH+]1CC[C@@H](CNCc2ccc([O-])c[nH+]2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CC[C@@H](CCCCNCc2ccc([O-])c[nH+]2)C1 | CC[NH+]1CC[C@@H](CNCc2ccc([O-])c[nH+]2)C1 | CC[NH+]1CC[C@@H](CCCCNCc2ccc([O-])c[nH+]2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C47"
} |
Can you make molecule CC[NH+]1CC[C@@H](CNCc2ccc([O-])c[nH+]2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CC[C@@H](CCC=NCc2ccc([O-])c[nH+]2)C1 | CC[NH+]1CC[C@@H](CNCc2ccc([O-])c[nH+]2)C1 | CC[NH+]1CC[C@@H](CCC=NCc2ccc([O-])c[nH+]2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C47"
} |
Can you make molecule CC[NH+]1CC[C@@H](CNCc2ccc([O-])c[nH+]2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CC[C@@H](CCCCCNCc2ccc([O-])c[nH+]2)C1 | CC[NH+]1CC[C@@H](CNCc2ccc([O-])c[nH+]2)C1 | CC[NH+]1CC[C@@H](CCCCCNCc2ccc([O-])c[nH+]2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C47"
} |
Can you make molecule CC[NH+]1CC[C@@H](CNCc2ccc([O-])c[nH+]2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CC[C@@H](C2CC(NCc3ccc([O-])c[nH+]3)C2)C1 | CC[NH+]1CC[C@@H](CNCc2ccc([O-])c[nH+]2)C1 | CC[NH+]1CC[C@@H](C2CC(NCc3ccc([O-])c[nH+]3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C47"
} |
Can you make molecule CC(C)[C@@H](NC(=O)[C@H]1CCCO1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NSC(=O)C[C@H]1CCCO1)C(=O)[O-] | CC(C)[C@@H](NC(=O)[C@H]1CCCO1)C(=O)[O-] | CC(C)[C@@H](NSC(=O)C[C@H]1CCCO1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule CC(C)[C@@H](NC(=O)[C@H]1CCCO1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NCC(=C=O)C[C@H]1CCCO1)C(=O)[O-] | CC(C)[C@@H](NC(=O)[C@H]1CCCO1)C(=O)[O-] | CC(C)[C@@H](NCC(=C=O)C[C@H]1CCCO1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule CC(C)[C@@H](NC(=O)[C@H]1CCCO1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NC(=O)CCCC(=O)[C@H]1CCCO1)C(=O)[O-] | CC(C)[C@@H](NC(=O)[C@H]1CCCO1)C(=O)[O-] | CC(C)[C@@H](NC(=O)CCCC(=O)[C@H]1CCCO1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C24=O"
} |
Can you make molecule CC(C)[C@@H](NC(=O)[C@H]1CCCO1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NC(=O)CC(C)(C)[C@H]1CCCO1)C(=O)[O-] | CC(C)[C@@H](NC(=O)[C@H]1CCCO1)C(=O)[O-] | CC(C)[C@@H](NC(=O)CC(C)(C)[C@H]1CCCO1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule CC(C)[C@@H](NC(=O)[C@H]1CCCO1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NC[S@+]([O-])CCC[C@H]1CCCO1)C(=O)[O-] | CC(C)[C@@H](NC(=O)[C@H]1CCCO1)C(=O)[O-] | CC(C)[C@@H](NC[S@+]([O-])CCC[C@H]1CCCO1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C24=O"
} |
Can you make molecule Cn1c(=O)c2ccccc2n2c(SCc3ncno3)nnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(=O)c2ccccc2n2c(SCSCc3ncno3)nnc12 | Cn1c(=O)c2ccccc2n2c(SCc3ncno3)nnc12 | Cn1c(=O)c2ccccc2n2c(SCSCc3ncno3)nnc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&CS&",
"old_substring": "S46"
} |
Can you make molecule Cn1c(=O)c2ccccc2n2c(SCc3ncno3)nnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(=O)c2ccccc2n2c(-c3ccc4c(c3)N(Cc3ncno3)CCS4)nnc12 | Cn1c(=O)c2ccccc2n2c(SCc3ncno3)nnc12 | Cn1c(=O)c2ccccc2n2c(-c3ccc4c(c3)N(Cc3ncno3)CCS4)nnc12 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "S46"
} |
Can you make molecule Cn1c(=O)c2ccccc2n2c(SCc3ncno3)nnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(=O)c2ccccc2n2c(N/C(C#N)=C(\Cl)SCc3ncno3)nnc12 | Cn1c(=O)c2ccccc2n2c(SCc3ncno3)nnc12 | Cn1c(=O)c2ccccc2n2c(N/C(C#N)=C(\Cl)SCc3ncno3)nnc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&/C(Cl)=C(\\C#N)N&",
"old_substring": "S46"
} |
Can you make molecule Cn1c(=O)c2ccccc2n2c(SCc3ncno3)nnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(=O)c2ccccc2n2c(-n3c(=S)n(Cc4ncno4)c4ccccc43)nnc12 | Cn1c(=O)c2ccccc2n2c(SCc3ncno3)nnc12 | Cn1c(=O)c2ccccc2n2c(-n3c(=S)n(Cc4ncno4)c4ccccc43)nnc12 | 102 | {
"fragment_index": 0,
"new_substring": "n1&c(=S)n&c2ccccc21",
"old_substring": "S46"
} |
Can you make molecule Cn1c(=O)c2ccccc2n2c(SCc3ncno3)nnc12 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1nnc2n(C)c(=O)c3ccccc3n12)[S@@+]([O-])CCCCc1ncno1 | Cn1c(=O)c2ccccc2n2c(SCc3ncno3)nnc12 | C[C@@H](c1nnc2n(C)c(=O)c3ccccc3n12)[S@@+]([O-])CCCCc1ncno1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC[S@](=O)[C@H]&C",
"old_substring": "S46"
} |
Can you make molecule C[C@H]1CCCCN1C(=O)CSc1ccc(N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCCN1SC(=O)CSc1ccc(N)cc1 | C[C@H]1CCCCN1C(=O)CSc1ccc(N)cc1 | C[C@H]1CCCCN1SC(=O)CSc1ccc(N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C2(=O)C3"
} |
Can you make molecule C[C@H]1CCCCN1C(=O)CSc1ccc(N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCCN1C(=O)CCCC(=O)Sc1ccc(N)cc1 | C[C@H]1CCCCN1C(=O)CSc1ccc(N)cc1 | C[C@H]1CCCCN1C(=O)CCCC(=O)Sc1ccc(N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C2(=O)C3"
} |
Can you make molecule C[C@H]1CCCCN1C(=O)CSc1ccc(N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCCN1C(=O)CC(C)(C)Sc1ccc(N)cc1 | C[C@H]1CCCCN1C(=O)CSc1ccc(N)cc1 | C[C@H]1CCCCN1C(=O)CC(C)(C)Sc1ccc(N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C2(=O)C3"
} |
Can you make molecule C[C@H]1CCCCN1C(=O)CSc1ccc(N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCCN1C[S@+]([O-])CCCSc1ccc(N)cc1 | C[C@H]1CCCCN1C(=O)CSc1ccc(N)cc1 | C[C@H]1CCCCN1C[S@+]([O-])CCCSc1ccc(N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C2(=O)C3"
} |
Can you make molecule C[C@H]1CCCCN1C(=O)CSc1ccc(N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCCN1C(=O)CCC(C)(C)Sc1ccc(N)cc1 | C[C@H]1CCCCN1C(=O)CSc1ccc(N)cc1 | C[C@H]1CCCCN1C(=O)CCC(C)(C)Sc1ccc(N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C2(=O)C3"
} |
Can you make molecule C[C@H]1CCCN(C(=O)Nc2ccc3ccccc3c2)[C@H]1CO less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(C(=O)N(C)C(=S)Sc2ccc3ccccc3c2)[C@H]1CO | C[C@H]1CCCN(C(=O)Nc2ccc3ccccc3c2)[C@H]1CO | C[C@H]1CCCN(C(=O)N(C)C(=S)Sc2ccc3ccccc3c2)[C@H]1CO | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N56"
} |
Can you make molecule C[C@H]1CCCN(C(=O)Nc2ccc3ccccc3c2)[C@H]1CO less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(C(=O)N2CCN=C2Sc2ccc3ccccc3c2)[C@H]1CO | C[C@H]1CCCN(C(=O)Nc2ccc3ccccc3c2)[C@H]1CO | C[C@H]1CCCN(C(=O)N2CCN=C2Sc2ccc3ccccc3c2)[C@H]1CO | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N56"
} |
Can you make molecule C[C@H]1CCCN(C(=O)Nc2ccc3ccccc3c2)[C@H]1CO less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(C(=O)CN2CCC(c3ccc4ccccc4c3)CC2)[C@H]1CO | C[C@H]1CCCN(C(=O)Nc2ccc3ccccc3c2)[C@H]1CO | C[C@H]1CCCN(C(=O)CN2CCC(c3ccc4ccccc4c3)CC2)[C@H]1CO | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N56"
} |
Can you make molecule C[C@H]1CCCN(C(=O)Nc2ccc3ccccc3c2)[C@H]1CO less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(C(=O)c2cc(C#N)c(-c3ccc4ccccc4c3)s2)[C@H]1CO | C[C@H]1CCCN(C(=O)Nc2ccc3ccccc3c2)[C@H]1CO | C[C@H]1CCCN(C(=O)c2cc(C#N)c(-c3ccc4ccccc4c3)s2)[C@H]1CO | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N56"
} |
Can you make molecule C[C@H]1CCCN(C(=O)Nc2ccc3ccccc3c2)[C@H]1CO less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(C(=O)c2ccc(-c3ccc4ccccc4c3)c(C#N)c2)[C@H]1CO | C[C@H]1CCCN(C(=O)Nc2ccc3ccccc3c2)[C@H]1CO | C[C@H]1CCCN(C(=O)c2ccc(-c3ccc4ccccc4c3)c(C#N)c2)[C@H]1CO | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N56"
} |
Can you make molecule CCCc1nnc(NC(=O)NNc2ccccc2Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC(c2nnc(NC(=O)NNc3ccccc3Cl)s2)C1 | CCCc1nnc(NC(=O)NNc2ccccc2Cl)s1 | CC1CC(c2nnc(NC(=O)NNc3ccccc3Cl)s2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1CC&C1",
"old_substring": "CCC5"
} |
Can you make molecule CCCc1nnc(NC(=O)NNc2ccccc2Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCc1nnc(NC(=O)NNc2ccccc2Cl)s1 | CCCc1nnc(NC(=O)NNc2ccccc2Cl)s1 | CC(C)CCc1nnc(NC(=O)NNc2ccccc2Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC5"
} |
Can you make molecule CCCc1nnc(NC(=O)NNc2ccccc2Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NNc1ccccc1Cl)Nc1nnc(CCCCBr)s1 | CCCc1nnc(NC(=O)NNc2ccccc2Cl)s1 | O=C(NNc1ccccc1Cl)Nc1nnc(CCCCBr)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC5"
} |
Can you make molecule CCCc1nnc(NC(=O)NNc2ccccc2Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCc1nnc(NC(=O)NNc2ccccc2Cl)s1 | CCCc1nnc(NC(=O)NNc2ccccc2Cl)s1 | C=CCCCc1nnc(NC(=O)NNc2ccccc2Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC5"
} |
Can you make molecule CCCc1nnc(NC(=O)NNc2ccccc2Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NNc1ccccc1Cl)Nc1nnc(CCCCCl)s1 | CCCc1nnc(NC(=O)NNc2ccccc2Cl)s1 | O=C(NNc1ccccc1Cl)Nc1nnc(CCCCCl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC5"
} |
Can you make molecule Cc1cc([C@H]2CCC[NH+]2CC(=O)NC(N)=O)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc([C@H]2CCC[NH+]2CC(=O)NCCCCC(N)=O)no1 | Cc1cc([C@H]2CCC[NH+]2CC(=O)NC(N)=O)no1 | Cc1cc([C@H]2CCC[NH+]2CC(=O)NCCCCC(N)=O)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C4(N)=O"
} |
Can you make molecule Cc1cc([C@H]2CCC[NH+]2CC(=O)NC(N)=O)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CNC(=O)C[NH+]1CCC[C@@H]1c1cc(C)on1 | Cc1cc([C@H]2CCC[NH+]2CC(=O)NC(N)=O)no1 | CC(=O)CNC(=O)C[NH+]1CCC[C@@H]1c1cc(C)on1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)=O",
"old_substring": "C4(N)=O"
} |
Can you make molecule Cc1cc([C@H]2CCC[NH+]2CC(=O)NC(N)=O)no1 less soluble in water? The output molecule should be similar to the input molecule. | CON(C)C(=O)NC(=O)C[NH+]1CCC[C@@H]1c1cc(C)on1 | Cc1cc([C@H]2CCC[NH+]2CC(=O)NC(N)=O)no1 | CON(C)C(=O)NC(=O)C[NH+]1CCC[C@@H]1c1cc(C)on1 | 102 | {
"fragment_index": 0,
"new_substring": "CON(C)C&=O",
"old_substring": "C4(N)=O"
} |
Can you make molecule Cc1cc([C@H]2CCC[NH+]2CC(=O)NC(N)=O)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc([C@H]2CCC[NH+]2CC(=O)NC(=O)C(C)C)no1 | Cc1cc([C@H]2CCC[NH+]2CC(=O)NC(N)=O)no1 | Cc1cc([C@H]2CCC[NH+]2CC(=O)NC(=O)C(C)C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&=O",
"old_substring": "C4(N)=O"
} |
Can you make molecule Cc1cc([C@H]2CCC[NH+]2CC(=O)NC(N)=O)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc([C@H]2CCC[NH+]2CC(=O)NC(=O)S)no1 | Cc1cc([C@H]2CCC[NH+]2CC(=O)NC(N)=O)no1 | Cc1cc([C@H]2CCC[NH+]2CC(=O)NC(=O)S)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)S",
"old_substring": "C4(N)=O"
} |
Can you make molecule CC[C@@H](C[NH3+])c1nc2cccc(C)c2o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc2nc([C@H](C[NH3+])CC(C)C)oc12 | CC[C@@H](C[NH3+])c1nc2cccc(C)c2o1 | Cc1cccc2nc([C@H](C[NH3+])CC(C)C)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C[C@H]3C[NH3+]",
"old_substring": "CC[C@H]3C[NH3+]"
} |
Can you make molecule CC[C@@H](C[NH3+])c1nc2cccc(C)c2o1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C[C@@H]([NH3+])c1nc2cccc(C)c2o1 | CC[C@@H](C[NH3+])c1nc2cccc(C)c2o1 | C=C(C)C[C@@H]([NH3+])c1nc2cccc(C)c2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)C[C@H]3[NH3+]",
"old_substring": "CC[C@H]3C[NH3+]"
} |
Can you make molecule CC[C@@H](C[NH3+])c1nc2cccc(C)c2o1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H]([NH3+])Cc1nc2cccc(C)c2o1 | CC[C@@H](C[NH3+])c1nc2cccc(C)c2o1 | CCCC[C@H]([NH3+])Cc1nc2cccc(C)c2o1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]([NH3+])C3",
"old_substring": "CC[C@H]3C[NH3+]"
} |
Can you make molecule CC[C@@H](C[NH3+])c1nc2cccc(C)c2o1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]([NH3+])CCc1nc2cccc(C)c2o1 | CC[C@@H](C[NH3+])c1nc2cccc(C)c2o1 | CCC[C@H]([NH3+])CCc1nc2cccc(C)c2o1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]([NH3+])CC3",
"old_substring": "CC[C@H]3C[NH3+]"
} |
Can you make molecule CC[C@@H](C[NH3+])c1nc2cccc(C)c2o1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C[NH3+])c1nc2cccc(C)c2o1 | CC[C@@H](C[NH3+])c1nc2cccc(C)c2o1 | CCC(CC)(C[NH3+])c1nc2cccc(C)c2o1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC3(CC)C[NH3+]",
"old_substring": "CC[C@H]3C[NH3+]"
} |
Can you make molecule CCNC(=O)c1ccc(Cl)cc1NC(=O)c1cc(C(C)C)nn1CC less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)c1ccc(Cl)cc1NSC(=O)Cc1cc(C(C)C)nn1CC | CCNC(=O)c1ccc(Cl)cc1NC(=O)c1cc(C(C)C)nn1CC | CCNC(=O)c1ccc(Cl)cc1NSC(=O)Cc1cc(C(C)C)nn1CC | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule CCNC(=O)c1ccc(Cl)cc1NC(=O)c1cc(C(C)C)nn1CC less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)c1ccc(Cl)cc1NC(=O)CCCC(=O)c1cc(C(C)C)nn1CC | CCNC(=O)c1ccc(Cl)cc1NC(=O)c1cc(C(C)C)nn1CC | CCNC(=O)c1ccc(Cl)cc1NC(=O)CCCC(=O)c1cc(C(C)C)nn1CC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule CCNC(=O)c1ccc(Cl)cc1NC(=O)c1cc(C(C)C)nn1CC less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)c1ccc(Cl)cc1NC(=O)CC(C)(C)c1cc(C(C)C)nn1CC | CCNC(=O)c1ccc(Cl)cc1NC(=O)c1cc(C(C)C)nn1CC | CCNC(=O)c1ccc(Cl)cc1NC(=O)CC(C)(C)c1cc(C(C)C)nn1CC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule CCNC(=O)c1ccc(Cl)cc1NC(=O)c1cc(C(C)C)nn1CC less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)c1ccc(Cl)cc1NC(=O)CCC(C)(C)c1cc(C(C)C)nn1CC | CCNC(=O)c1ccc(Cl)cc1NC(=O)c1cc(C(C)C)nn1CC | CCNC(=O)c1ccc(Cl)cc1NC(=O)CCC(C)(C)c1cc(C(C)C)nn1CC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule CCNC(=O)c1ccc(Cl)cc1NC(=O)c1cc(C(C)C)nn1CC less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)c1ccc(Cl)cc1NSC(=O)[C@@H](C)c1cc(C(C)C)nn1CC | CCNC(=O)c1ccc(Cl)cc1NC(=O)c1cc(C(C)C)nn1CC | CCNC(=O)c1ccc(Cl)cc1NSC(=O)[C@@H](C)c1cc(C(C)C)nn1CC | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule CCCCNC(=O)[C@@H](C)N1CCN(CC(=O)N2CCCC[C@@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)=NC(=O)[C@@H](C)N1CCN(CC(=O)N2CCCC[C@@H]2C)CC1 | CCCCNC(=O)[C@@H](C)N1CCN(CC(=O)N2CCCC[C@@H]2C)CC1 | CCCC(C)=NC(=O)[C@@H](C)N1CCN(CC(=O)N2CCCC[C@@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC=&C",
"old_substring": "CCCC5"
} |
Can you make molecule CCCCNC(=O)[C@@H](C)N1CCN(CC(=O)N2CCCC[C@@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)NC(=O)[C@@H](C)N1CCN(CC(=O)N2CCCC[C@@H]2C)CC1 | CCCCNC(=O)[C@@H](C)N1CCN(CC(=O)N2CCCC[C@@H]2C)CC1 | CCCC(C)(C)NC(=O)[C@@H](C)N1CCN(CC(=O)N2CCCC[C@@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "CCCC5"
} |
Can you make molecule CCCCNC(=O)[C@@H](C)N1CCN(CC(=O)N2CCCC[C@@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(CCC)=NC(=O)[C@@H](C)N1CCN(CC(=O)N2CCCC[C@@H]2C)CC1 | CCCCNC(=O)[C@@H](C)N1CCN(CC(=O)N2CCCC[C@@H]2C)CC1 | CCCC(CCC)=NC(=O)[C@@H](C)N1CCN(CC(=O)N2CCCC[C@@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC=&CCC",
"old_substring": "CCCC5"
} |
Can you make molecule CCCCNC(=O)[C@@H](C)N1CCN(CC(=O)N2CCCC[C@@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCC(C)=NC(=O)[C@@H](C)N1CCN(CC(=O)N2CCCC[C@@H]2C)CC1 | CCCCNC(=O)[C@@H](C)N1CCN(CC(=O)N2CCCC[C@@H]2C)CC1 | CCCCCC(C)=NC(=O)[C@@H](C)N1CCN(CC(=O)N2CCCC[C@@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCC=&C",
"old_substring": "CCCC5"
} |
Can you make molecule CCCCNC(=O)[C@@H](C)N1CCN(CC(=O)N2CCCC[C@@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCCC(=O)NC(=O)[C@@H](C)N1CCN(CC(=O)N2CCCC[C@@H]2C)CC1 | CCCCNC(=O)[C@@H](C)N1CCN(CC(=O)N2CCCC[C@@H]2C)CC1 | CCCCCCC(=O)NC(=O)[C@@H](C)N1CCN(CC(=O)N2CCCC[C@@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCCC&=O",
"old_substring": "CCCC5"
} |
Can you make molecule Cc1nc(C(=O)Nc2ccc(COC(C)(C)C)cc2)ccc1C#N less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C(=O)Nc2ccc(COC(C)(C)C)cc2I)ccc1C#N | Cc1nc(C(=O)Nc2ccc(COC(C)(C)C)cc2)ccc1C#N | Cc1nc(C(=O)Nc2ccc(COC(C)(C)C)cc2I)ccc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16ccc8cc1"
} |
Can you make molecule Cc1nc(C(=O)Nc2ccc(COC(C)(C)C)cc2)ccc1C#N less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C(=O)Nc2cc(COC(C)(C)C)ccc2Br)ccc1C#N | Cc1nc(C(=O)Nc2ccc(COC(C)(C)C)cc2)ccc1C#N | Cc1nc(C(=O)Nc2cc(COC(C)(C)C)ccc2Br)ccc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16ccc8cc1"
} |
Can you make molecule Cc1nc(C(=O)Nc2ccc(COC(C)(C)C)cc2)ccc1C#N less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C(=O)Nc2ccc(COC(C)(C)C)cc2Cl)ccc1C#N | Cc1nc(C(=O)Nc2ccc(COC(C)(C)C)cc2)ccc1C#N | Cc1nc(C(=O)Nc2ccc(COC(C)(C)C)cc2Cl)ccc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16ccc8cc1"
} |
Can you make molecule Cc1nc(C(=O)Nc2ccc(COC(C)(C)C)cc2)ccc1C#N less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C(=O)Nc2cccc(COC(C)(C)C)c2Br)ccc1C#N | Cc1nc(C(=O)Nc2ccc(COC(C)(C)C)cc2)ccc1C#N | Cc1nc(C(=O)Nc2cccc(COC(C)(C)C)c2Br)ccc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c16ccc8cc1"
} |
Can you make molecule Cc1nc(C(=O)Nc2ccc(COC(C)(C)C)cc2)ccc1C#N less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C(=O)Nc2cccc(COC(C)(C)C)c2Cl)ccc1C#N | Cc1nc(C(=O)Nc2ccc(COC(C)(C)C)cc2)ccc1C#N | Cc1nc(C(=O)Nc2cccc(COC(C)(C)C)c2Cl)ccc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c16ccc8cc1"
} |
Can you make molecule CCc1nc2n(n1)CCC[C@@H]2NS(=O)(=O)c1cc(F)c(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2c(c(S(=O)(=O)c3cc(F)c(F)cc3F)n1)CCCC2 | CCc1nc2n(n1)CCC[C@@H]2NS(=O)(=O)c1cc(F)c(F)cc1F | CCc1nc2c(c(S(=O)(=O)c3cc(F)c(F)cc3F)n1)CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&c2c(n1)CCCC2",
"old_substring": "c14nc2n(n1)CCC[C@@H]2N3"
} |
Can you make molecule CCc1nc2n(n1)CCC[C@@H]2NS(=O)(=O)c1cc(F)c(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2c(s1)CN(S(=O)(=O)c1cc(F)c(F)cc1F)CC2 | CCc1nc2n(n1)CCC[C@@H]2NS(=O)(=O)c1cc(F)c(F)cc1F | CCc1nc2c(s1)CN(S(=O)(=O)c1cc(F)c(F)cc1F)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2c(s1)CN&CC2",
"old_substring": "c14nc2n(n1)CCC[C@@H]2N3"
} |
Can you make molecule CCc1nc2n(n1)CCC[C@@H]2NS(=O)(=O)c1cc(F)c(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CCc1onc2c1C[C@H](S(=O)(=O)c1cc(F)c(F)cc1F)CC2 | CCc1nc2n(n1)CCC[C@@H]2NS(=O)(=O)c1cc(F)c(F)cc1F | CCc1onc2c1C[C@H](S(=O)(=O)c1cc(F)c(F)cc1F)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&onc2c1C[C@H]&CC2",
"old_substring": "c14nc2n(n1)CCC[C@@H]2N3"
} |
Can you make molecule CCc1nc2n(n1)CCC[C@@H]2NS(=O)(=O)c1cc(F)c(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(S(=O)(=O)c2cc(F)c(F)cc2F)c2c1CCCC2 | CCc1nc2n(n1)CCC[C@@H]2NS(=O)(=O)c1cc(F)c(F)cc1F | CCc1nn(S(=O)(=O)c2cc(F)c(F)cc2F)c2c1CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn&c2c1CCCC2",
"old_substring": "c14nc2n(n1)CCC[C@@H]2N3"
} |
Can you make molecule CCc1nc2n(n1)CCC[C@@H]2NS(=O)(=O)c1cc(F)c(F)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(S(=O)(=O)c2cc(F)c(F)cc2F)c2c1CCCCC2 | CCc1nc2n(n1)CCC[C@@H]2NS(=O)(=O)c1cc(F)c(F)cc1F | CCc1nn(S(=O)(=O)c2cc(F)c(F)cc2F)c2c1CCCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn&c2c1CCCCC2",
"old_substring": "c14nc2n(n1)CCC[C@@H]2N3"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.