prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule C/[NH+]=C(/NC[C@@H]1CC[NH+](C2CC2)C1)N1C[C@H](C)C[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C/[NH+]=C(/NC[C@@H]1CC[NH+](C2SCCS2)C1)N1C[C@H](C)C[C@@H](C)C1 | C/[NH+]=C(/NC[C@@H]1CC[NH+](C2CC2)C1)N1C[C@H](C)C[C@@H](C)C1 | C/[NH+]=C(/NC[C@@H]1CC[NH+](C2SCCS2)C1)N1C[C@H](C)C[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C14CC1"
} |
Can you make molecule C/[NH+]=C(/NC[C@@H]1CC[NH+](C2CC2)C1)N1C[C@H](C)C[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C/[NH+]=C(/NC[C@@H]1CC[NH+](C2CCCCC2)C1)N1C[C@H](C)C[C@@H](C)C1 | C/[NH+]=C(/NC[C@@H]1CC[NH+](C2CC2)C1)N1C[C@H](C)C[C@@H](C)C1 | C/[NH+]=C(/NC[C@@H]1CC[NH+](C2CCCCC2)C1)N1C[C@H](C)C[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C14CC1"
} |
Can you make molecule C/[NH+]=C(/NC[C@@H]1CC[NH+](C2CC2)C1)N1C[C@H](C)C[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C/[NH+]=C(/NC[C@@H]1CC[NH+](C2SCCCS2)C1)N1C[C@H](C)C[C@@H](C)C1 | C/[NH+]=C(/NC[C@@H]1CC[NH+](C2CC2)C1)N1C[C@H](C)C[C@@H](C)C1 | C/[NH+]=C(/NC[C@@H]1CC[NH+](C2SCCCS2)C1)N1C[C@H](C)C[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C14CC1"
} |
Can you make molecule C/[NH+]=C(/NC[C@@H]1CC[NH+](C2CC2)C1)N1C[C@H](C)C[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C/[NH+]=C(/NC[C@@H]1CC[NH+](C2SCSCS2)C1)N1C[C@H](C)C[C@@H](C)C1 | C/[NH+]=C(/NC[C@@H]1CC[NH+](C2CC2)C1)N1C[C@H](C)C[C@@H](C)C1 | C/[NH+]=C(/NC[C@@H]1CC[NH+](C2SCSCS2)C1)N1C[C@H](C)C[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C14CC1"
} |
Can you make molecule C/[NH+]=C(/NC[C@@H]1CC[NH+](C2CC2)C1)N1C[C@H](C)C[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C/[NH+]=C(/NC[C@@H]1CC[NH+](C2CCCCCC2)C1)N1C[C@H](C)C[C@@H](C)C1 | C/[NH+]=C(/NC[C@@H]1CC[NH+](C2CC2)C1)N1C[C@H](C)C[C@@H](C)C1 | C/[NH+]=C(/NC[C@@H]1CC[NH+](C2CCCCCC2)C1)N1C[C@H](C)C[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C14CC1"
} |
Can you make molecule C[C@H](OCc1ccccc1)C(=O)Nc1sc2c(c1C(=O)NC1CC1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OCc1ccccc1)C(=O)Nc1sc2c(c1CC(=O)SNC1CC1)CCC2 | C[C@H](OCc1ccccc1)C(=O)Nc1sc2c(c1C(=O)NC1CC1)CCC2 | C[C@H](OCc1ccccc1)C(=O)Nc1sc2c(c1CC(=O)SNC1CC1)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C49=O"
} |
Can you make molecule C[C@H](OCc1ccccc1)C(=O)Nc1sc2c(c1C(=O)NC1CC1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OCc1ccccc1)C(=O)Nc1sc2c(c1C(=O)CCCC(=O)NC1CC1)CCC2 | C[C@H](OCc1ccccc1)C(=O)Nc1sc2c(c1C(=O)NC1CC1)CCC2 | C[C@H](OCc1ccccc1)C(=O)Nc1sc2c(c1C(=O)CCCC(=O)NC1CC1)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C49=O"
} |
Can you make molecule C[C@H](OCc1ccccc1)C(=O)Nc1sc2c(c1C(=O)NC1CC1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OCc1ccccc1)C(=O)Nc1sc2c(c1C(C)(C)CC(=O)NC1CC1)CCC2 | C[C@H](OCc1ccccc1)C(=O)Nc1sc2c(c1C(=O)NC1CC1)CCC2 | C[C@H](OCc1ccccc1)C(=O)Nc1sc2c(c1C(C)(C)CC(=O)NC1CC1)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C49=O"
} |
Can you make molecule C[C@H](OCc1ccccc1)C(=O)Nc1sc2c(c1C(=O)NC1CC1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OCc1ccccc1)C(=O)Nc1sc2c(c1C(C)(C)CCC(=O)NC1CC1)CCC2 | C[C@H](OCc1ccccc1)C(=O)Nc1sc2c(c1C(=O)NC1CC1)CCC2 | C[C@H](OCc1ccccc1)C(=O)Nc1sc2c(c1C(C)(C)CCC(=O)NC1CC1)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C49=O"
} |
Can you make molecule C[C@H](OCc1ccccc1)C(=O)Nc1sc2c(c1C(=O)NC1CC1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OCc1ccccc1)C(=O)Nc1sc2c(c1[C@H](C)C(=O)SNC1CC1)CCC2 | C[C@H](OCc1ccccc1)C(=O)Nc1sc2c(c1C(=O)NC1CC1)CCC2 | C[C@H](OCc1ccccc1)C(=O)Nc1sc2c(c1[C@H](C)C(=O)SNC1CC1)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C49=O"
} |
Can you make molecule CCc1ccsc1CNC(=O)C(=O)Nc1cc(F)cc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(CNC(=O)C(=O)Nc2cc(F)cc(F)c2)sc1Br | CCc1ccsc1CNC(=O)C(=O)Nc1cc(F)cc(F)c1 | CCc1cc(CNC(=O)C(=O)Nc2cc(F)cc(F)c2)sc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&sc1Br",
"old_substring": "c17ccsc16"
} |
Can you make molecule CCc1ccsc1CNC(=O)C(=O)Nc1cc(F)cc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1sc(CNC(=O)C(=O)Nc2cc(F)cc(F)c2)cc1Br | CCc1ccsc1CNC(=O)C(=O)Nc1cc(F)cc(F)c1 | CCc1sc(CNC(=O)C(=O)Nc2cc(F)cc(F)c2)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc&cc1Br",
"old_substring": "c17ccsc16"
} |
Can you make molecule CCc1ccsc1CNC(=O)C(=O)Nc1cc(F)cc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(CNC(=O)C(=O)Nc2cc(F)cc(F)c2)cc1I | CCc1ccsc1CNC(=O)C(=O)Nc1cc(F)cc(F)c1 | CCc1ccc(CNC(=O)C(=O)Nc2cc(F)cc(F)c2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c17ccsc16"
} |
Can you make molecule CCc1ccsc1CNC(=O)C(=O)Nc1cc(F)cc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(CNC(=O)C(=O)Nc2cc(F)cc(F)c2)ccc1Br | CCc1ccsc1CNC(=O)C(=O)Nc1cc(F)cc(F)c1 | CCc1cc(CNC(=O)C(=O)Nc2cc(F)cc(F)c2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c17ccsc16"
} |
Can you make molecule CCc1ccsc1CNC(=O)C(=O)Nc1cc(F)cc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(CNC(=O)C(=O)Nc2cc(F)cc(F)c2)cc1Cl | CCc1ccsc1CNC(=O)C(=O)Nc1cc(F)cc(F)c1 | CCc1ccc(CNC(=O)C(=O)Nc2cc(F)cc(F)c2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c17ccsc16"
} |
Can you make molecule COc1ccccc1OCC(=O)N1CCc2c(cnc(C)c2CNC(=O)c2cncs2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1OC/C(C)=N\ON1CCc2c(cnc(C)c2CNC(=O)c2cncs2)C1 | COc1ccccc1OCC(=O)N1CCc2c(cnc(C)c2CNC(=O)c2cncs2)C1 | COc1ccccc1OC/C(C)=N\ON1CCc2c(cnc(C)c2CNC(=O)c2cncs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C5C3=O"
} |
Can you make molecule COc1ccccc1OCC(=O)N1CCc2c(cnc(C)c2CNC(=O)c2cncs2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Oc1ccccc1OC)C(=O)CN1CCc2c(cnc(C)c2CNC(=O)c2cncs2)C1 | COc1ccccc1OCC(=O)N1CCc2c(cnc(C)c2CNC(=O)c2cncs2)C1 | CCC(CC)(Oc1ccccc1OC)C(=O)CN1CCc2c(cnc(C)c2CNC(=O)c2cncs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C5C3=O"
} |
Can you make molecule COc1ccccc1OCC(=O)N1CCc2c(cnc(C)c2CNC(=O)c2cncs2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1OSSC(=O)N1CCc2c(cnc(C)c2CNC(=O)c2cncs2)C1 | COc1ccccc1OCC(=O)N1CCc2c(cnc(C)c2CNC(=O)c2cncs2)C1 | COc1ccccc1OSSC(=O)N1CCc2c(cnc(C)c2CNC(=O)c2cncs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C5C3=O"
} |
Can you make molecule COc1ccccc1OCC(=O)N1CCc2c(cnc(C)c2CNC(=O)c2cncs2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Oc1ccccc1OC)C(=O)CCN1CCc2c(cnc(C)c2CNC(=O)c2cncs2)C1 | COc1ccccc1OCC(=O)N1CCc2c(cnc(C)c2CNC(=O)c2cncs2)C1 | CCC(CC)(Oc1ccccc1OC)C(=O)CCN1CCc2c(cnc(C)c2CNC(=O)c2cncs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C5C3=O"
} |
Can you make molecule COc1ccccc1OCC(=O)N1CCc2c(cnc(C)c2CNC(=O)c2cncs2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)Oc1ccccc1OC)C(=O)N1CCc2c(cnc(C)c2CNC(=O)c2cncs2)C1 | COc1ccccc1OCC(=O)N1CCc2c(cnc(C)c2CNC(=O)c2cncs2)C1 | CC[C@H](C(=O)Oc1ccccc1OC)C(=O)N1CCc2c(cnc(C)c2CNC(=O)c2cncs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C5C3=O"
} |
Can you make molecule C[NH2+][C@@H](C)c1cc(F)c(C)cc1Sc1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(CC)C[NH3+].CCc1cc(F)c(C)cc1Sc1nccs1 | C[NH2+][C@@H](C)c1cc(F)c(C)cc1Sc1nccs1 | C=C(CC)C[NH3+].CCc1cc(F)c(C)cc1Sc1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=3C[NH3+]",
"old_substring": "C[NH2+]2"
} |
Can you make molecule C[NH2+][C@@H](C)c1cc(F)c(C)cc1Sc1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | CCC([NH3+])CC.CCc1cc(F)c(C)cc1Sc1nccs1 | C[NH2+][C@@H](C)c1cc(F)c(C)cc1Sc1nccs1 | CCC([NH3+])CC.CCc1cc(F)c(C)cc1Sc1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC3([NH3+])CC",
"old_substring": "C[NH2+]2"
} |
Can you make molecule C[NH2+][C@@H](C)c1cc(F)c(C)cc1Sc1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)[NH3+].CCc1cc(F)c(C)cc1Sc1nccs1 | C[NH2+][C@@H](C)c1cc(F)c(C)cc1Sc1nccs1 | CC(C)(C)[NH3+].CCc1cc(F)c(C)cc1Sc1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)([NH3+])C3",
"old_substring": "C[NH2+]2"
} |
Can you make molecule C[NH2+][C@@H](C)c1cc(F)c(C)cc1Sc1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C[NH3+])CCC.CCc1cc(F)c(C)cc1Sc1nccs1 | C[NH2+][C@@H](C)c1cc(F)c(C)cc1Sc1nccs1 | CCCC(C[NH3+])CCC.CCc1cc(F)c(C)cc1Sc1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC3(C[NH3+])CCC",
"old_substring": "C[NH2+]2"
} |
Can you make molecule C[NH2+][C@@H](C)c1cc(F)c(C)cc1Sc1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(C)C[NH3+].CCc1cc(F)c(C)cc1Sc1nccs1 | C[NH2+][C@@H](C)c1cc(F)c(C)cc1Sc1nccs1 | CCC(C)(C)C[NH3+].CCc1cc(F)c(C)cc1Sc1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C[NH3+])CC3",
"old_substring": "C[NH2+]2"
} |
Can you make molecule COc1ccccc1NC(=O)c1ccc(NC(=O)CCC(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)c2ccc(NC(=O)CCC(F)(F)F)cc2)cc1I | COc1ccccc1NC(=O)c1ccc(NC(=O)CCC(F)(F)F)cc1 | COc1ccc(NC(=O)c2ccc(NC(=O)CCC(F)(F)F)cc2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c14ccccc15"
} |
Can you make molecule COc1ccccc1NC(=O)c1ccc(NC(=O)CCC(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)c2ccc(NC(=O)CCC(F)(F)F)cc2)ccc1Br | COc1ccccc1NC(=O)c1ccc(NC(=O)CCC(F)(F)F)cc1 | COc1cc(NC(=O)c2ccc(NC(=O)CCC(F)(F)F)cc2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c14ccccc15"
} |
Can you make molecule COc1ccccc1NC(=O)c1ccc(NC(=O)CCC(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)c2ccc(NC(=O)CCC(F)(F)F)cc2)cc1Cl | COc1ccccc1NC(=O)c1ccc(NC(=O)CCC(F)(F)F)cc1 | COc1ccc(NC(=O)c2ccc(NC(=O)CCC(F)(F)F)cc2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c14ccccc15"
} |
Can you make molecule COc1ccccc1NC(=O)c1ccc(NC(=O)CCC(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(NC(=O)c2ccc(NC(=O)CCC(F)(F)F)cc2)c1Br | COc1ccccc1NC(=O)c1ccc(NC(=O)CCC(F)(F)F)cc1 | COc1cccc(NC(=O)c2ccc(NC(=O)CCC(F)(F)F)cc2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c14ccccc15"
} |
Can you make molecule COc1ccccc1NC(=O)c1ccc(NC(=O)CCC(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(NC(=O)c2ccc(NC(=O)CCC(F)(F)F)cc2)c1Cl | COc1ccccc1NC(=O)c1ccc(NC(=O)CCC(F)(F)F)cc1 | COc1cccc(NC(=O)c2ccc(NC(=O)CCC(F)(F)F)cc2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c14ccccc15"
} |
Can you make molecule CN(CCOc1cccc(Cl)c1)C(=O)c1ccc2ncsc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(CCCCOc1cccc(Cl)c1)C(=O)c1ccc2ncsc2c1 | CN(CCOc1cccc(Cl)c1)C(=O)c1ccc2ncsc2c1 | CN(CCCCOc1cccc(Cl)c1)C(=O)c1ccc2ncsc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C6C4"
} |
Can you make molecule CN(CCOc1cccc(Cl)c1)C(=O)c1ccc2ncsc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(CCCCCOc1cccc(Cl)c1)C(=O)c1ccc2ncsc2c1 | CN(CCOc1cccc(Cl)c1)C(=O)c1ccc2ncsc2c1 | CN(CCCCCOc1cccc(Cl)c1)C(=O)c1ccc2ncsc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C6C4"
} |
Can you make molecule CN(CCOc1cccc(Cl)c1)C(=O)c1ccc2ncsc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)c1ccc2ncsc2c1)C1CC(Oc2cccc(Cl)c2)C1 | CN(CCOc1cccc(Cl)c1)C(=O)c1ccc2ncsc2c1 | CN(C(=O)c1ccc2ncsc2c1)C1CC(Oc2cccc(Cl)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C6C4"
} |
Can you make molecule CN(CCOc1cccc(Cl)c1)C(=O)c1ccc2ncsc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCOc1cccc(Cl)c1)N(C)C(=O)c1ccc2ncsc2c1 | CN(CCOc1cccc(Cl)c1)C(=O)c1ccc2ncsc2c1 | C[C@@H](CCOc1cccc(Cl)c1)N(C)C(=O)c1ccc2ncsc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C6C4"
} |
Can you make molecule CN(CCOc1cccc(Cl)c1)C(=O)c1ccc2ncsc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)c1ccc2ncsc2c1)C1CCC(Oc2cccc(Cl)c2)CC1 | CN(CCOc1cccc(Cl)c1)C(=O)c1ccc2ncsc2c1 | CN(C(=O)c1ccc2ncsc2c1)C1CCC(Oc2cccc(Cl)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C6C4"
} |
Can you make molecule COCCC(=O)NC[C@@H]1CC[C@@H](C(=O)[O-])O1 less soluble in water? The output molecule should be similar to the input molecule. | COCSCCC(=O)NC[C@@H]1CC[C@@H](C(=O)[O-])O1 | COCCC(=O)NC[C@@H]1CC[C@@H](C(=O)[O-])O1 | COCSCCC(=O)NC[C@@H]1CC[C@@H](C(=O)[O-])O1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COCCC(=O)NC[C@@H]1CC[C@@H](C(=O)[O-])O1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SCCC(=O)NC[C@@H]1CC[C@@H](C(=O)[O-])O1 | COCCC(=O)NC[C@@H]1CC[C@@H](C(=O)[O-])O1 | CC(=O)SCCC(=O)NC[C@@H]1CC[C@@H](C(=O)[O-])O1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COCCC(=O)NC[C@@H]1CC[C@@H](C(=O)[O-])O1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CI)CCC(=O)NC[C@@H]1CC[C@@H](C(=O)[O-])O1 | COCCC(=O)NC[C@@H]1CC[C@@H](C(=O)[O-])O1 | O=C(CI)CCC(=O)NC[C@@H]1CC[C@@H](C(=O)[O-])O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule COCCC(=O)NC[C@@H]1CC[C@@H](C(=O)[O-])O1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC1OCCCO1)NC[C@@H]1CC[C@@H](C(=O)[O-])O1 | COCCC(=O)NC[C@@H]1CC[C@@H](C(=O)[O-])O1 | O=C(CCC1OCCCO1)NC[C@@H]1CC[C@@H](C(=O)[O-])O1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCCCO1",
"old_substring": "CO3"
} |
Can you make molecule COCCC(=O)NC[C@@H]1CC[C@@H](C(=O)[O-])O1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCl)CCC(=O)NC[C@@H]1CC[C@@H](C(=O)[O-])O1 | COCCC(=O)NC[C@@H]1CC[C@@H](C(=O)[O-])O1 | O=C(CCl)CCC(=O)NC[C@@H]1CC[C@@H](C(=O)[O-])O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCl",
"old_substring": "CO3"
} |
Can you make molecule Cc1cc(C(=O)N(Cc2cccnc2)Cc2ccccc2C)c2ccccc2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)N(Cc2cccnc2)Cc2ccc(C)c(Cl)c2)c2ccccc2n1 | Cc1cc(C(=O)N(Cc2cccnc2)Cc2ccccc2C)c2ccccc2n1 | Cc1cc(C(=O)N(Cc2cccnc2)Cc2ccc(C)c(Cl)c2)c2ccccc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1Cl",
"old_substring": "c18ccccc1C"
} |
Can you make molecule Cc1cc(C(=O)N(Cc2cccnc2)Cc2ccccc2C)c2ccccc2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)N(Cc2cccnc2)Cc2ccc(Br)cc2C)c2ccccc2n1 | Cc1cc(C(=O)N(Cc2cccnc2)Cc2ccccc2C)c2ccccc2n1 | Cc1cc(C(=O)N(Cc2cccnc2)Cc2ccc(Br)cc2C)c2ccccc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1C",
"old_substring": "c18ccccc1C"
} |
Can you make molecule Cc1cc(C(=O)N(Cc2cccnc2)Cc2ccccc2C)c2ccccc2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)N(Cc2cccnc2)Cc2cccc(Br)c2C)c2ccccc2n1 | Cc1cc(C(=O)N(Cc2cccnc2)Cc2ccccc2C)c2ccccc2n1 | Cc1cc(C(=O)N(Cc2cccnc2)Cc2cccc(Br)c2C)c2ccccc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Br)c1C",
"old_substring": "c18ccccc1C"
} |
Can you make molecule Cc1cc(C(=O)N(Cc2cccnc2)Cc2ccccc2C)c2ccccc2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)N(Cc2cccnc2)Cc2ccc(F)cc2Cl)c2ccccc2n1 | Cc1cc(C(=O)N(Cc2cccnc2)Cc2ccccc2C)c2ccccc2n1 | Cc1cc(C(=O)N(Cc2cccnc2)Cc2ccc(F)cc2Cl)c2ccccc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c18ccccc1C"
} |
Can you make molecule Cc1cc(C(=O)N(Cc2cccnc2)Cc2ccccc2C)c2ccccc2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)N(Cc2cccnc2)Cc2cc(F)ccc2Cl)c2ccccc2n1 | Cc1cc(C(=O)N(Cc2cccnc2)Cc2ccccc2C)c2ccccc2n1 | Cc1cc(C(=O)N(Cc2cccnc2)Cc2cc(F)ccc2Cl)c2ccccc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Cl",
"old_substring": "c18ccccc1C"
} |
Can you make molecule O=C(NCCNc1ncccn1)Nc1ccc2c(c1)Cc1ccccc1-2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCNc1ncncc1I)Nc1ccc2c(c1)Cc1ccccc1-2 | O=C(NCCNc1ncccn1)Nc1ccc2c(c1)Cc1ccccc1-2 | O=C(NCCNc1ncncc1I)Nc1ccc2c(c1)Cc1ccccc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncncc1I",
"old_substring": "c17ncccn1"
} |
Can you make molecule O=C(NCCNc1ncccn1)Nc1ccc2c(c1)Cc1ccccc1-2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCNc1ccnc(Br)n1)Nc1ccc2c(c1)Cc1ccccc1-2 | O=C(NCCNc1ncccn1)Nc1ccc2c(c1)Cc1ccccc1-2 | O=C(NCCNc1ccnc(Br)n1)Nc1ccc2c(c1)Cc1ccccc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1nccc&n1",
"old_substring": "c17ncccn1"
} |
Can you make molecule O=C(NCCNc1ncccn1)Nc1ccc2c(c1)Cc1ccccc1-2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCNc1ncc(Br)cn1)Nc1ccc2c(c1)Cc1ccccc1-2 | O=C(NCCNc1ncccn1)Nc1ccc2c(c1)Cc1ccccc1-2 | O=C(NCCNc1ncc(Br)cn1)Nc1ccc2c(c1)Cc1ccccc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc(Br)cn1",
"old_substring": "c17ncccn1"
} |
Can you make molecule O=C(NCCNc1ncccn1)Nc1ccc2c(c1)Cc1ccccc1-2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCNc1ncncc1Cl)Nc1ccc2c(c1)Cc1ccccc1-2 | O=C(NCCNc1ncccn1)Nc1ccc2c(c1)Cc1ccccc1-2 | O=C(NCCNc1ncncc1Cl)Nc1ccc2c(c1)Cc1ccccc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncncc1Cl",
"old_substring": "c17ncccn1"
} |
Can you make molecule O=C(NCCNc1ncccn1)Nc1ccc2c(c1)Cc1ccccc1-2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCNc1ncc2ccccn12)Nc1ccc2c(c1)Cc1ccccc1-2 | O=C(NCCNc1ncccn1)Nc1ccc2c(c1)Cc1ccccc1-2 | O=C(NCCNc1ncc2ccccn12)Nc1ccc2c(c1)Cc1ccccc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc2ccccn12",
"old_substring": "c17ncccn1"
} |
Can you make molecule N#CCN1CCN(CC(=O)NC(=O)NC2CCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCN1CCN(CC(=O)NC(=O)N=C2CCCCC2)CC1 | N#CCN1CCN(CC(=O)NC(=O)NC2CCCC2)CC1 | N#CCN1CCN(CC(=O)NC(=O)N=C2CCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCCC1",
"old_substring": "C18CCCC1"
} |
Can you make molecule N#CCN1CCN(CC(=O)NC(=O)NC2CCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCN1CCN(CC(=O)NC(=O)NC2CCCCCC2)CC1 | N#CCN1CCN(CC(=O)NC(=O)NC2CCCC2)CC1 | N#CCN1CCN(CC(=O)NC(=O)NC2CCCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C18CCCC1"
} |
Can you make molecule N#CCN1CCN(CC(=O)NC(=O)NC2CCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCN1CCN(CC(=O)NC(=O)NC2CCCCCCC2)CC1 | N#CCN1CCN(CC(=O)NC(=O)NC2CCCC2)CC1 | N#CCN1CCN(CC(=O)NC(=O)NC2CCCCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C18CCCC1"
} |
Can you make molecule N#CCN1CCN(CC(=O)NC(=O)NC2CCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCN1CCN(CC(=O)NC(=O)NSC2=CCCCCC2)CC1 | N#CCN1CCN(CC(=O)NC(=O)NC2CCCC2)CC1 | N#CCN1CCN(CC(=O)NC(=O)NSC2=CCCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C18CCCC1"
} |
Can you make molecule N#CCN1CCN(CC(=O)NC(=O)NC2CCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCN1CCN(CC(=O)NC(=O)N=CC2CCCC2)CC1 | N#CCN1CCN(CC(=O)NC(=O)NC2CCCC2)CC1 | N#CCN1CCN(CC(=O)NC(=O)N=CC2CCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&C1CCCC1",
"old_substring": "C18CCCC1"
} |
Can you make molecule C[C@H](OC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1)c1cccc(C#N)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1cccc(C#N)c1)OC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1 | C[C@H](OC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1)c1cccc(C#N)c1 | C[C@H](CC(C)(C)c1cccc(C#N)c1)OC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@H]59"
} |
Can you make molecule C[C@H](OC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1)c1cccc(C#N)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCOC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1)CC(=O)c1cccc(C#N)c1 | C[C@H](OC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1)c1cccc(C#N)c1 | C[C@H](CCOC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1)CC(=O)c1cccc(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@H]59"
} |
Can you make molecule C[C@H](OC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1)c1cccc(C#N)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1cccc(C#N)c1)[C@H](C)OC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1 | C[C@H](OC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1)c1cccc(C#N)c1 | C[C@H](Cc1cccc(C#N)c1)[C@H](C)OC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "C[C@H]59"
} |
Can you make molecule C[C@H](OC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1)c1cccc(C#N)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCOC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1)CC(=O)c1cccc(C#N)c1 | C[C@H](OC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1)c1cccc(C#N)c1 | C[C@@H](CCOC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1)CC(=O)c1cccc(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@H]59"
} |
Can you make molecule C[C@H](OC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1)c1cccc(C#N)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1cccc(C#N)c1)OC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1 | C[C@H](OC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1)c1cccc(C#N)c1 | CCC[C@@H](CCc1cccc(C#N)c1)OC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C[C@H]59"
} |
Can you make molecule CCn1c(SCC(=O)Nc2cccc(Cl)c2C)nnc1-c1ccc(O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cn(SCC(=O)Nc2cccc(Cl)c2C)nc1-c1ccc(O)cc1 | CCn1c(SCC(=O)Nc2cccc(Cl)c2C)nnc1-c1ccc(O)cc1 | CCc1cn(SCC(=O)Nc2cccc(Cl)c2C)nc1-c1ccc(O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cn&nc1&",
"old_substring": "n16c7nnc18"
} |
Can you make molecule CCn1c(SCC(=O)Nc2cccc(Cl)c2C)nnc1-c1ccc(O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(SCC(=O)Nc2cccc(Cl)c2C)nc2c(-c3ccc(O)cc3)ncn12 | CCn1c(SCC(=O)Nc2cccc(Cl)c2C)nnc1-c1ccc(O)cc1 | CCc1cc(SCC(=O)Nc2cccc(Cl)c2C)nc2c(-c3ccc(O)cc3)ncn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&nc2c&ncn12",
"old_substring": "n16c7nnc18"
} |
Can you make molecule CCn1c(SCC(=O)Nc2cccc(Cl)c2C)nnc1-c1ccc(O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(SCC(=O)Nc2cccc(Cl)c2C)c2c(-c3ccc(O)cc3)ncnc21 | CCn1c(SCC(=O)Nc2cccc(Cl)c2C)nnc1-c1ccc(O)cc1 | CCn1cc(SCC(=O)Nc2cccc(Cl)c2C)c2c(-c3ccc(O)cc3)ncnc21 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc&c2c&ncnc21",
"old_substring": "n16c7nnc18"
} |
Can you make molecule CCn1c(SCC(=O)Nc2cccc(Cl)c2C)nnc1-c1ccc(O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1ccc2nc(SCC(=O)Nc3cccc(Cl)c3C)nc(-c3ccc(O)cc3)c21 | CCn1c(SCC(=O)Nc2cccc(Cl)c2C)nnc1-c1ccc(O)cc1 | CCn1ccc2nc(SCC(=O)Nc3cccc(Cl)c3C)nc(-c3ccc(O)cc3)c21 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccc2nc&nc&c21",
"old_substring": "n16c7nnc18"
} |
Can you make molecule CCn1c(SCC(=O)Nc2cccc(Cl)c2C)nnc1-c1ccc(O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cnc2c(SCC(=O)Nc3cccc(Cl)c3C)cn(-c3ccc(O)cc3)c2c1=O | CCn1c(SCC(=O)Nc2cccc(Cl)c2C)nnc1-c1ccc(O)cc1 | CCn1cnc2c(SCC(=O)Nc3cccc(Cl)c3C)cn(-c3ccc(O)cc3)c2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "n1&cnc2c&cn&c2c1=O",
"old_substring": "n16c7nnc18"
} |
Can you make molecule Cc1c(C(=O)C=Cc2cnn(C)c2)nnn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C(=O)C=Cc2cnn(C)c2)nnn1-c1ccccc1Cl | Cc1c(C(=O)C=Cc2cnn(C)c2)nnn1-c1ccccc1 | Cc1c(C(=O)C=Cc2cnn(C)c2)nnn1-c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c15ccccc1"
} |
Can you make molecule Cc1c(C(=O)C=Cc2cnn(C)c2)nnn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C(=O)C=Cc2cnn(C)c2)nnn1-c1ccc(I)cc1 | Cc1c(C(=O)C=Cc2cnn(C)c2)nnn1-c1ccccc1 | Cc1c(C(=O)C=Cc2cnn(C)c2)nnn1-c1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c15ccccc1"
} |
Can you make molecule Cc1c(C(=O)C=Cc2cnn(C)c2)nnn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2nnc(C(=O)C=Cc3cnn(C)c3)c2C)cc1I | Cc1c(C(=O)C=Cc2cnn(C)c2)nnn1-c1ccccc1 | Cc1ccc(-n2nnc(C(=O)C=Cc3cnn(C)c3)c2C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c15ccccc1"
} |
Can you make molecule Cc1c(C(=O)C=Cc2cnn(C)c2)nnn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C(=O)C=Cc2cnn(C)c2)nnn1-c1cccc(Br)c1 | Cc1c(C(=O)C=Cc2cnn(C)c2)nnn1-c1ccccc1 | Cc1c(C(=O)C=Cc2cnn(C)c2)nnn1-c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c15ccccc1"
} |
Can you make molecule Cc1c(C(=O)C=Cc2cnn(C)c2)nnn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-n2nnc(C(=O)C=Cc3cnn(C)c3)c2C)c1C | Cc1c(C(=O)C=Cc2cnn(C)c2)nnn1-c1ccccc1 | Cc1cccc(-n2nnc(C(=O)C=Cc3cnn(C)c3)c2C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c15ccccc1"
} |
Can you make molecule O=C(CSc1ccc(Cl)cc1)N1CCC(C(F)(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1ccc(Cl)cc1)N1CCC(CCCC(F)(F)F)CC1 | O=C(CSc1ccc(Cl)cc1)N1CCC(C(F)(F)F)CC1 | O=C(CSc1ccc(Cl)cc1)N1CCC(CCCC(F)(F)F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule O=C(CSc1ccc(Cl)cc1)N1CCC(C(F)(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1ccc(Cl)cc1)N1CCC(CCCCC(F)(F)F)CC1 | O=C(CSc1ccc(Cl)cc1)N1CCC(C(F)(F)F)CC1 | O=C(CSc1ccc(Cl)cc1)N1CCC(CCCCC(F)(F)F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule O=C(CSc1ccc(Cl)cc1)N1CCC(C(F)(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1ccc(Cl)cc1)N1CCC(CC(F)(F)C(F)F)CC1 | O=C(CSc1ccc(Cl)cc1)N1CCC(C(F)(F)F)CC1 | O=C(CSc1ccc(Cl)cc1)N1CCC(CC(F)(F)C(F)F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule O=C(CSc1ccc(Cl)cc1)N1CCC(C(F)(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1ccc(Cl)cc1)N1CCC(=C(F)C(F)(F)F)CC1 | O=C(CSc1ccc(Cl)cc1)N1CCC(C(F)(F)F)CC1 | O=C(CSc1ccc(Cl)cc1)N1CCC(=C(F)C(F)(F)F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(F)C(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule O=C(CSc1ccc(Cl)cc1)N1CCC(C(F)(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1ccc(Cl)cc1)N1CCC(C(F)(F)C(F)(F)F)CC1 | O=C(CSc1ccc(Cl)cc1)N1CCC(C(F)(F)F)CC1 | O=C(CSc1ccc(Cl)cc1)N1CCC(C(F)(F)C(F)(F)F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule CCc1nnc2sc(-c3ccc(OC)c(NC(=O)COc4ccc(C)cc4)c3)nn12 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc2sc(-c3ccc(OC)c(NSC(=O)COc4ccc(C)cc4)c3)nn12 | CCc1nnc2sc(-c3ccc(OC)c(NC(=O)COc4ccc(C)cc4)c3)nn12 | CCc1nnc2sc(-c3ccc(OC)c(NSC(=O)COc4ccc(C)cc4)c3)nn12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C5(=O)C6"
} |
Can you make molecule CCc1nnc2sc(-c3ccc(OC)c(NC(=O)COc4ccc(C)cc4)c3)nn12 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc2sc(-c3ccc(OC)c(NC(=O)CCCC(=O)Oc4ccc(C)cc4)c3)nn12 | CCc1nnc2sc(-c3ccc(OC)c(NC(=O)COc4ccc(C)cc4)c3)nn12 | CCc1nnc2sc(-c3ccc(OC)c(NC(=O)CCCC(=O)Oc4ccc(C)cc4)c3)nn12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C5(=O)C6"
} |
Can you make molecule CCc1nnc2sc(-c3ccc(OC)c(NC(=O)COc4ccc(C)cc4)c3)nn12 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc2sc(-c3ccc(OC)c(NC(=O)CC(C)(C)Oc4ccc(C)cc4)c3)nn12 | CCc1nnc2sc(-c3ccc(OC)c(NC(=O)COc4ccc(C)cc4)c3)nn12 | CCc1nnc2sc(-c3ccc(OC)c(NC(=O)CC(C)(C)Oc4ccc(C)cc4)c3)nn12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C5(=O)C6"
} |
Can you make molecule CCc1nnc2sc(-c3ccc(OC)c(NC(=O)COc4ccc(C)cc4)c3)nn12 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc2sc(-c3ccc(OC)c(NC[S@+]([O-])CCCOc4ccc(C)cc4)c3)nn12 | CCc1nnc2sc(-c3ccc(OC)c(NC(=O)COc4ccc(C)cc4)c3)nn12 | CCc1nnc2sc(-c3ccc(OC)c(NC[S@+]([O-])CCCOc4ccc(C)cc4)c3)nn12 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C5(=O)C6"
} |
Can you make molecule CCc1nnc2sc(-c3ccc(OC)c(NC(=O)COc4ccc(C)cc4)c3)nn12 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc2sc(-c3ccc(OC)c(NC(=O)CCC(C)(C)Oc4ccc(C)cc4)c3)nn12 | CCc1nnc2sc(-c3ccc(OC)c(NC(=O)COc4ccc(C)cc4)c3)nn12 | CCc1nnc2sc(-c3ccc(OC)c(NC(=O)CCC(C)(C)Oc4ccc(C)cc4)c3)nn12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C5(=O)C6"
} |
Can you make molecule O=C1C(=Cc2ccc(Cl)cc2Cl)SC(=S)N1C[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=Cc2ccc(Cl)cc2Cl)SC(=S)N1C[C@H]1CCCOCC1 | O=C1C(=Cc2ccc(Cl)cc2Cl)SC(=S)N1C[C@H]1CCCO1 | O=C1C(=Cc2ccc(Cl)cc2Cl)SC(=S)N1C[C@H]1CCCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCOCC1",
"old_substring": "[C@H]15CCCO1"
} |
Can you make molecule O=C1C(=Cc2ccc(Cl)cc2Cl)SC(=S)N1C[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=Cc2ccc(Cl)cc2Cl)SC(=S)N1C[C@H]1CSCCS1 | O=C1C(=Cc2ccc(Cl)cc2Cl)SC(=S)N1C[C@H]1CCCO1 | O=C1C(=Cc2ccc(Cl)cc2Cl)SC(=S)N1C[C@H]1CSCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CSCCS1",
"old_substring": "[C@H]15CCCO1"
} |
Can you make molecule O=C1C(=Cc2ccc(Cl)cc2Cl)SC(=S)N1C[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=Cc2ccc(Cl)cc2Cl)SC(=S)N1C[C@H]1CC=CS1 | O=C1C(=Cc2ccc(Cl)cc2Cl)SC(=S)N1C[C@H]1CCCO1 | O=C1C(=Cc2ccc(Cl)cc2Cl)SC(=S)N1C[C@H]1CC=CS1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC=CS1",
"old_substring": "[C@H]15CCCO1"
} |
Can you make molecule O=C1C(=Cc2ccc(Cl)cc2Cl)SC(=S)N1C[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=Cc2ccc(Cl)cc2Cl)SC(=S)N1C[C@@H]1CCSC1 | O=C1C(=Cc2ccc(Cl)cc2Cl)SC(=S)N1C[C@H]1CCCO1 | O=C1C(=Cc2ccc(Cl)cc2Cl)SC(=S)N1C[C@@H]1CCSC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCSC1",
"old_substring": "[C@H]15CCCO1"
} |
Can you make molecule O=C1C(=Cc2ccc(Cl)cc2Cl)SC(=S)N1C[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=Cc2ccc(Cl)cc2Cl)SC(=S)N1C[C@H]1CC12CCOCC2 | O=C1C(=Cc2ccc(Cl)cc2Cl)SC(=S)N1C[C@H]1CCCO1 | O=C1C(=Cc2ccc(Cl)cc2Cl)SC(=S)N1C[C@H]1CC12CCOCC2 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC12CCOCC2",
"old_substring": "[C@H]15CCCO1"
} |
Can you make molecule COC(=O)c1c(NC(=O)c2cccc(F)c2)sc(C(=O)NC(C)C)c1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1c(NSC2=NC(=O)C=[SH]2)sc(C(=O)NC(C)C)c1C.Fc1ccccc1 | COC(=O)c1c(NC(=O)c2cccc(F)c2)sc(C(=O)NC(C)C)c1C | COC(=O)c1c(NSC2=NC(=O)C=[SH]2)sc(C(=O)NC(C)C)c1C.Fc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C1=NC(=O)C=&S1",
"old_substring": "C4%10=O"
} |
Can you make molecule COC(=O)c1c(NC(=O)c2cccc(F)c2)sc(C(=O)NC(C)C)c1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1c(Nn2nc(C)c(C)cc2=O)sc(C(=O)NC(C)C)c1C.Fc1ccccc1 | COC(=O)c1c(NC(=O)c2cccc(F)c2)sc(C(=O)NC(C)C)c1C | COC(=O)c1c(Nn2nc(C)c(C)cc2=O)sc(C(=O)NC(C)C)c1C.Fc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nn&c(=O)c&c1C",
"old_substring": "C4%10=O"
} |
Can you make molecule COC(=O)c1c(NC(=O)c2cccc(F)c2)sc(C(=O)NC(C)C)c1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1c(NC(=O)n2cc(C#N)cn2)sc(C(=O)NC(C)C)c1C.Fc1ccccc1 | COC(=O)c1c(NC(=O)c2cccc(F)c2)sc(C(=O)NC(C)C)c1C | COC(=O)c1c(NC(=O)n2cc(C#N)cn2)sc(C(=O)NC(C)C)c1C.Fc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cn(C&=O)nc1&",
"old_substring": "C4%10=O"
} |
Can you make molecule COC(=O)c1c(NC(=O)c2cccc(F)c2)sc(C(=O)NC(C)C)c1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1c(NCCC=CO)sc(C(=O)NC(C)C)c1C.Fc1ccccc1 | COC(=O)c1c(NC(=O)c2cccc(F)c2)sc(C(=O)NC(C)C)c1C | COC(=O)c1c(NCCC=CO)sc(C(=O)NC(C)C)c1C.Fc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C4%10=O"
} |
Can you make molecule COC(=O)c1c(NC(=O)c2cccc(F)c2)sc(C(=O)NC(C)C)c1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1c(Nc2c[nH]c(=O)cc2C)sc(C(=O)NC(C)C)c1C.Fc1ccccc1 | COC(=O)c1c(NC(=O)c2cccc(F)c2)sc(C(=O)NC(C)C)c1C | COC(=O)c1c(Nc2c[nH]c(=O)cc2C)sc(C(=O)NC(C)C)c1C.Fc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c[nH]c(=O)c1&",
"old_substring": "C4%10=O"
} |
Can you make molecule C[C@H]1CC[C@@H]([NH2+]Cc2ccc([N+](=O)[O-])c(F)c2)[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@@H](C2(Cc3ccc([N+](=O)[O-])c(F)c3)CC[NH2+]C2)[C@H](C)C1 | C[C@H]1CC[C@@H]([NH2+]Cc2ccc([N+](=O)[O-])c(F)c2)[C@H](C)C1 | C[C@H]1CC[C@@H](C2(Cc3ccc([N+](=O)[O-])c(F)c3)CC[NH2+]C2)[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&&C1",
"old_substring": "[NH2+]34"
} |
Can you make molecule C[C@H]1CC[C@@H]([NH2+]Cc2ccc([N+](=O)[O-])c(F)c2)[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@@H]([C@@]2(Cc3ccc([N+](=O)[O-])c(F)c3)CCC[NH2+]C2)[C@H](C)C1 | C[C@H]1CC[C@@H]([NH2+]Cc2ccc([N+](=O)[O-])c(F)c2)[C@H](C)C1 | C[C@H]1CC[C@@H]([C@@]2(Cc3ccc([N+](=O)[O-])c(F)c3)CCC[NH2+]C2)[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH2+]34"
} |
Can you make molecule C[C@H]1CC[C@@H]([NH2+]Cc2ccc([N+](=O)[O-])c(F)c2)[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@@H](c2c[nH+]cn2Cc2ccc([N+](=O)[O-])c(F)c2)[C@H](C)C1 | C[C@H]1CC[C@@H]([NH2+]Cc2ccc([N+](=O)[O-])c(F)c2)[C@H](C)C1 | C[C@H]1CC[C@@H](c2c[nH+]cn2Cc2ccc([N+](=O)[O-])c(F)c2)[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule C[C@H]1CC[C@@H]([NH2+]Cc2ccc([N+](=O)[O-])c(F)c2)[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@@H](c2cc(Cc3ccc([N+](=O)[O-])c(F)c3)[nH+][nH]2)[C@H](C)C1 | C[C@H]1CC[C@@H]([NH2+]Cc2ccc([N+](=O)[O-])c(F)c2)[C@H](C)C1 | C[C@H]1CC[C@@H](c2cc(Cc3ccc([N+](=O)[O-])c(F)c3)[nH+][nH]2)[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule C[C@H]1CC[C@@H]([NH2+]Cc2ccc([N+](=O)[O-])c(F)c2)[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@@H](c2c[nH+]n(C)c2Cc2ccc([N+](=O)[O-])c(F)c2)[C@H](C)C1 | C[C@H]1CC[C@@H]([NH2+]Cc2ccc([N+](=O)[O-])c(F)c2)[C@H](C)C1 | C[C@H]1CC[C@@H](c2c[nH+]n(C)c2Cc2ccc([N+](=O)[O-])c(F)c2)[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule C[C@H]([C@@H](C)O)S(=O)(=O)CCC(=O)N[C@H](C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1ccccc1)NC(=O)CCS(=O)(=O)[C@H](C)[C@@H](C)O | C[C@H]([C@@H](C)O)S(=O)(=O)CCC(=O)N[C@H](C)c1ccccc1 | C[C@H](CC(C)(C)c1ccccc1)NC(=O)CCS(=O)(=O)[C@H](C)[C@@H](C)O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@@H]34"
} |
Can you make molecule C[C@H]([C@@H](C)O)S(=O)(=O)CCC(=O)N[C@H](C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNC(=O)CCS(=O)(=O)[C@H](C)[C@@H](C)O)CC(=O)c1ccccc1 | C[C@H]([C@@H](C)O)S(=O)(=O)CCC(=O)N[C@H](C)c1ccccc1 | C[C@@H](CCNC(=O)CCS(=O)(=O)[C@H](C)[C@@H](C)O)CC(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@@H]34"
} |
Can you make molecule C[C@H]([C@@H](C)O)S(=O)(=O)CCC(=O)N[C@H](C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([C@@H](C)O)S(=O)(=O)CCC(=O)NCC[C@H](Cl)c1ccccc1 | C[C@H]([C@@H](C)O)S(=O)(=O)CCC(=O)N[C@H](C)c1ccccc1 | C[C@H]([C@@H](C)O)S(=O)(=O)CCC(=O)NCC[C@H](Cl)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "C[C@@H]34"
} |
Can you make molecule C[C@H]([C@@H](C)O)S(=O)(=O)CCC(=O)N[C@H](C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](CC(=O)c1ccccc1)NC(=O)CCS(=O)(=O)[C@H](C)[C@@H](C)O | C[C@H]([C@@H](C)O)S(=O)(=O)CCC(=O)N[C@H](C)c1ccccc1 | CCC[C@H](CC(=O)c1ccccc1)NC(=O)CCS(=O)(=O)[C@H](C)[C@@H](C)O | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@@H]&CC&=O",
"old_substring": "C[C@@H]34"
} |
Can you make molecule C[C@H]([C@@H](C)O)S(=O)(=O)CCC(=O)N[C@H](C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CCc1ccccc1)NC(=O)CCS(=O)(=O)[C@H](C)[C@@H](C)O | C[C@H]([C@@H](C)O)S(=O)(=O)CCC(=O)N[C@H](C)c1ccccc1 | CC(C)[C@H](CCc1ccccc1)NC(=O)CCS(=O)(=O)[C@H](C)[C@@H](C)O | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "C[C@@H]34"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.