prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCC[NH2+][C@@H]1CCC[C@H]1CC[NH+]1CCCC(C)(C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@@H]1CCC[C@H]1CCCC[NH+]1CCCC(C)(C)CC1 | CCC[NH2+][C@@H]1CCC[C@H]1CC[NH+]1CCCC(C)(C)CC1 | CCC[NH2+][C@@H]1CCC[C@H]1CCCC[NH+]1CCCC(C)(C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C5C3"
} |
Can you make molecule CCC[NH2+][C@@H]1CCC[C@H]1CC[NH+]1CCCC(C)(C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@@H]1CCC[C@H]1CCCCC[NH+]1CCCC(C)(C)CC1 | CCC[NH2+][C@@H]1CCC[C@H]1CC[NH+]1CCCC(C)(C)CC1 | CCC[NH2+][C@@H]1CCC[C@H]1CCCCC[NH+]1CCCC(C)(C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C5C3"
} |
Can you make molecule CCC[NH2+][C@@H]1CCC[C@H]1CC[NH+]1CCCC(C)(C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@@H]1CCC[C@H]1[C@@H](C)CC[NH+]1CCCC(C)(C)CC1 | CCC[NH2+][C@@H]1CCC[C@H]1CC[NH+]1CCCC(C)(C)CC1 | CCC[NH2+][C@@H]1CCC[C@H]1[C@@H](C)CC[NH+]1CCCC(C)(C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C5C3"
} |
Can you make molecule CCC[NH2+][C@@H]1CCC[C@H]1CC[NH+]1CCCC(C)(C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@@H]1CCC[C@H]1C1CCC([NH+]2CCCC(C)(C)CC2)CC1 | CCC[NH2+][C@@H]1CCC[C@H]1CC[NH+]1CCCC(C)(C)CC1 | CCC[NH2+][C@@H]1CCC[C@H]1C1CCC([NH+]2CCCC(C)(C)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C5C3"
} |
Can you make molecule CCC[NH2+][C@@H]1CCC[C@H]1CC[NH+]1CCCC(C)(C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@@H]1CCC[C@H]1CC(C)(C)C[NH+]1CCCC(C)(C)CC1 | CCC[NH2+][C@@H]1CCC[C@H]1CC[NH+]1CCCC(C)(C)CC1 | CCC[NH2+][C@@H]1CCC[C@H]1CC(C)(C)C[NH+]1CCCC(C)(C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)C&",
"old_substring": "C5C3"
} |
Can you make molecule C[C@]1(C(N)=O)Oc2ccc(Cl)cc2NC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)[C@@]1(C)Oc2ccc(Cl)cc2NC1=O | C[C@]1(C(N)=O)Oc2ccc(Cl)cc2NC1=O | CC(=O)[C@@]1(C)Oc2ccc(Cl)cc2NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)=O",
"old_substring": "C3(N)=O"
} |
Can you make molecule C[C@]1(C(N)=O)Oc2ccc(Cl)cc2NC1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@]1(CCCCC(N)=O)Oc2ccc(Cl)cc2NC1=O | C[C@]1(C(N)=O)Oc2ccc(Cl)cc2NC1=O | C[C@]1(CCCCC(N)=O)Oc2ccc(Cl)cc2NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C3(N)=O"
} |
Can you make molecule C[C@]1(C(N)=O)Oc2ccc(Cl)cc2NC1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@]1(C/C(N)=N\O)Oc2ccc(Cl)cc2NC1=O | C[C@]1(C(N)=O)Oc2ccc(Cl)cc2NC1=O | C[C@]1(C/C(N)=N\O)Oc2ccc(Cl)cc2NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&/C(N)=N\\O",
"old_substring": "C3(N)=O"
} |
Can you make molecule C[C@]1(C(N)=O)Oc2ccc(Cl)cc2NC1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@]1(CC/C(N)=N/O)Oc2ccc(Cl)cc2NC1=O | C[C@]1(C(N)=O)Oc2ccc(Cl)cc2NC1=O | C[C@]1(CC/C(N)=N/O)Oc2ccc(Cl)cc2NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N/O",
"old_substring": "C3(N)=O"
} |
Can you make molecule C[C@]1(C(N)=O)Oc2ccc(Cl)cc2NC1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@]1(CC/C(N)=N\O)Oc2ccc(Cl)cc2NC1=O | C[C@]1(C(N)=O)Oc2ccc(Cl)cc2NC1=O | C[C@]1(CC/C(N)=N\O)Oc2ccc(Cl)cc2NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N\\O",
"old_substring": "C3(N)=O"
} |
Can you make molecule CC(C)(NC(=O)c1ccc(-n2cccn2)cc1)c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | CC(CCc1ccc2c(c1)OCO2)=NC(=O)c1ccc(-n2cccn2)cc1 | CC(C)(NC(=O)c1ccc(-n2cccn2)cc1)c1ccc2c(c1)OCO2 | CC(CCc1ccc2c(c1)OCO2)=NC(=O)c1ccc(-n2cccn2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "CC46C"
} |
Can you make molecule CC(C)(NC(=O)c1ccc(-n2cccn2)cc1)c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC1CCC(c2ccc3c(c2)OCO3)CC1)c1ccc(-n2cccn2)cc1 | CC(C)(NC(=O)c1ccc(-n2cccn2)cc1)c1ccc2c(c1)OCO2 | O=C(NC1CCC(c2ccc3c(c2)OCO3)CC1)c1ccc(-n2cccn2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "CC46C"
} |
Can you make molecule CC(C)(NC(=O)c1ccc(-n2cccn2)cc1)c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1ccc2c(c1)OCO2)NC(=O)c1ccc(-n2cccn2)cc1 | CC(C)(NC(=O)c1ccc(-n2cccn2)cc1)c1ccc2c(c1)OCO2 | CCC[C@@H](CCc1ccc2c(c1)OCO2)NC(=O)c1ccc(-n2cccn2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "CC46C"
} |
Can you make molecule CC(C)(NC(=O)c1ccc(-n2cccn2)cc1)c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | CC1(c2ccc3c(c2)OCO3)CCC(NC(=O)c2ccc(-n3cccn3)cc2)CC1 | CC(C)(NC(=O)c1ccc(-n2cccn2)cc1)c1ccc2c(c1)OCO2 | CC1(c2ccc3c(c2)OCO3)CCC(NC(=O)c2ccc(-n3cccn3)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&(C)CC1",
"old_substring": "CC46C"
} |
Can you make molecule CC(C)(NC(=O)c1ccc(-n2cccn2)cc1)c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@](C)(CCc1ccc2c(c1)OCO2)NC(=O)c1ccc(-n2cccn2)cc1 | CC(C)(NC(=O)c1ccc(-n2cccn2)cc1)c1ccc2c(c1)OCO2 | CC[C@](C)(CCc1ccc2c(c1)OCO2)NC(=O)c1ccc(-n2cccn2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@]&(C)CC&",
"old_substring": "CC46C"
} |
Can you make molecule CCc1ccc(CN(C)C(=O)c2cc3ccccc3[nH]2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(CN(C)SC(=O)Cc2cc3ccccc3[nH]2)cc1 | CCc1ccc(CN(C)C(=O)c2cc3ccccc3[nH]2)cc1 | CCc1ccc(CN(C)SC(=O)Cc2cc3ccccc3[nH]2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule CCc1ccc(CN(C)C(=O)c2cc3ccccc3[nH]2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(CN(C)C(=O)CCCC(=O)c2cc3ccccc3[nH]2)cc1 | CCc1ccc(CN(C)C(=O)c2cc3ccccc3[nH]2)cc1 | CCc1ccc(CN(C)C(=O)CCCC(=O)c2cc3ccccc3[nH]2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule CCc1ccc(CN(C)C(=O)c2cc3ccccc3[nH]2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(CN(C)C(=O)CC(C)(C)c2cc3ccccc3[nH]2)cc1 | CCc1ccc(CN(C)C(=O)c2cc3ccccc3[nH]2)cc1 | CCc1ccc(CN(C)C(=O)CC(C)(C)c2cc3ccccc3[nH]2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CCc1ccc(CN(C)C(=O)c2cc3ccccc3[nH]2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(CN(C)C(=O)CCC(C)(C)c2cc3ccccc3[nH]2)cc1 | CCc1ccc(CN(C)C(=O)c2cc3ccccc3[nH]2)cc1 | CCc1ccc(CN(C)C(=O)CCC(C)(C)c2cc3ccccc3[nH]2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CCc1ccc(CN(C)C(=O)c2cc3ccccc3[nH]2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(CN(C)SC(=O)[C@@H](C)c2cc3ccccc3[nH]2)cc1 | CCc1ccc(CN(C)C(=O)c2cc3ccccc3[nH]2)cc1 | CCc1ccc(CN(C)SC(=O)[C@@H](C)c2cc3ccccc3[nH]2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule CC(C)Sc1nnc(NC(=O)C(F)(F)F)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)SCSc1nnc(NC(=O)C(F)(F)F)s1 | CC(C)Sc1nnc(NC(=O)C(F)(F)F)s1 | CC(C)SCSc1nnc(NC(=O)C(F)(F)F)s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&CS&",
"old_substring": "S35"
} |
Can you make molecule CC(C)Sc1nnc(NC(=O)C(F)(F)F)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N1CCSC(C(=O)C(F)(F)F)=CC=C2C=C1Nc1nnc2s1 | CC(C)Sc1nnc(NC(=O)C(F)(F)F)s1 | CC(C)N1CCSC(C(=O)C(F)(F)F)=CC=C2C=C1Nc1nnc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "S35"
} |
Can you make molecule CC(C)Sc1nnc(NC(=O)C(F)(F)F)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[S@@+]([O-])C(Cl)(Cl)c1nnc(NC(=O)C(F)(F)F)s1 | CC(C)Sc1nnc(NC(=O)C(F)(F)F)s1 | CC(C)C[S@@+]([O-])C(Cl)(Cl)c1nnc(NC(=O)C(F)(F)F)s1 | 102 | {
"fragment_index": 0,
"new_substring": "O=[S@](C&)C&(Cl)Cl",
"old_substring": "S35"
} |
Can you make molecule CC(C)Sc1nnc(NC(=O)C(F)(F)F)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)S/C(Cl)=C(\C#N)Nc1nnc(NC(=O)C(F)(F)F)s1 | CC(C)Sc1nnc(NC(=O)C(F)(F)F)s1 | CC(C)S/C(Cl)=C(\C#N)Nc1nnc(NC(=O)C(F)(F)F)s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&/C(Cl)=C(\\C#N)N&",
"old_substring": "S35"
} |
Can you make molecule CC(C)Sc1nnc(NC(=O)C(F)(F)F)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)n1c2ccccc(C(=O)C(F)(F)F)n(c1=S)-c1nnc(s1)N2 | CC(C)Sc1nnc(NC(=O)C(F)(F)F)s1 | CC(C)n1c2ccccc(C(=O)C(F)(F)F)n(c1=S)-c1nnc(s1)N2 | 102 | {
"fragment_index": 0,
"new_substring": "n1&c(=S)n&c2ccccc21",
"old_substring": "S35"
} |
Can you make molecule CC(C)(C)c1n[nH]c(C(=O)N2CCO[C@H]3CCC[C@H]32)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCBr)c1n[nH]c(C(=O)N2CCO[C@H]3CCC[C@H]32)n1 | CC(C)(C)c1n[nH]c(C(=O)N2CCO[C@H]3CCC[C@H]32)n1 | CC(C)(CCBr)c1n[nH]c(C(=O)N2CCO[C@H]3CCC[C@H]32)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC&(C)CCBr",
"old_substring": "CC6(C)C"
} |
Can you make molecule CC(C)(C)c1n[nH]c(C(=O)N2CCO[C@H]3CCC[C@H]32)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)c1n[nH]c(C(=O)N2CCO[C@H]3CCC[C@H]32)n1 | CC(C)(C)c1n[nH]c(C(=O)N2CCO[C@H]3CCC[C@H]32)n1 | CCCC(C)(C)c1n[nH]c(C(=O)N2CCO[C@H]3CCC[C@H]32)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "CC6(C)C"
} |
Can you make molecule CC(C)(C)c1n[nH]c(C(=O)N2CCO[C@H]3CCC[C@H]32)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(c1n[nH]c(C(=O)N2CCO[C@H]3CCC[C@H]32)n1)C(C)C | CC(C)(C)c1n[nH]c(C(=O)N2CCO[C@H]3CCC[C@H]32)n1 | CC(C)C(c1n[nH]c(C(=O)N2CCO[C@H]3CCC[C@H]32)n1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&C(C)C",
"old_substring": "CC6(C)C"
} |
Can you make molecule CC(C)(C)c1n[nH]c(C(=O)N2CCO[C@H]3CCC[C@H]32)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCCC(=O)c1n[nH]c(C(=O)N2CCO[C@H]3CCC[C@H]32)n1 | CC(C)(C)c1n[nH]c(C(=O)N2CCO[C@H]3CCC[C@H]32)n1 | CC(C)CCCC(=O)c1n[nH]c(C(=O)N2CCO[C@H]3CCC[C@H]32)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCCC&=O",
"old_substring": "CC6(C)C"
} |
Can you make molecule CC(C)(C)c1n[nH]c(C(=O)N2CCO[C@H]3CCC[C@H]32)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC(c2n[nH]c(C(=O)N3CCO[C@H]4CCC[C@H]43)n2)CC1 | CC(C)(C)c1n[nH]c(C(=O)N2CCO[C@H]3CCC[C@H]32)n1 | CC1(C)CCC(c2n[nH]c(C(=O)N3CCO[C@H]4CCC[C@H]43)n2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCC&CC1",
"old_substring": "CC6(C)C"
} |
Can you make molecule CCOc1cc(NC(=O)[C@@H]2C=C[C@H]([NH3+])C2)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc(N)ccc1OC.O=C1[C@@H]2CC[C@@H]1C2 | CCOc1cc(NC(=O)[C@@H]2C=C[C@H]([NH3+])C2)ccc1OC | CCOc1cc(N)ccc1OC.O=C1[C@@H]2CC[C@@H]1C2 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]18C=C[C@H]([NH3+])C1"
} |
Can you make molecule CCOc1cc(NC(=O)[C@@H]2C=C[C@H]([NH3+])C2)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc(N)ccc1OC.O=C1[C@@H]2CC[C@H]1O2 | CCOc1cc(NC(=O)[C@@H]2C=C[C@H]([NH3+])C2)ccc1OC | CCOc1cc(N)ccc1OC.O=C1[C@@H]2CC[C@H]1O2 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@H]&O1",
"old_substring": "[C@@H]18C=C[C@H]([NH3+])C1"
} |
Can you make molecule CCOc1cc(NC(=O)[C@@H]2C=C[C@H]([NH3+])C2)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc(N)ccc1OC.O=C1[C@@H]2CC[C@@H]1O2 | CCOc1cc(NC(=O)[C@@H]2C=C[C@H]([NH3+])C2)ccc1OC | CCOc1cc(N)ccc1OC.O=C1[C@@H]2CC[C@@H]1O2 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&O1",
"old_substring": "[C@@H]18C=C[C@H]([NH3+])C1"
} |
Can you make molecule CCOc1cc(NC(=O)[C@@H]2C=C[C@H]([NH3+])C2)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc(N)ccc1OC.C[C@@H]1CN2C[C@H]1C2=O | CCOc1cc(NC(=O)[C@@H]2C=C[C@H]([NH3+])C2)ccc1OC | CCOc1cc(N)ccc1OC.C[C@@H]1CN2C[C@H]1C2=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CN&C[C@H]1C",
"old_substring": "[C@@H]18C=C[C@H]([NH3+])C1"
} |
Can you make molecule CCOc1cc(NC(=O)[C@@H]2C=C[C@H]([NH3+])C2)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc(N)ccc1OC.O=C1[C@@H]2CCCN1CC2 | CCOc1cc(NC(=O)[C@@H]2C=C[C@H]([NH3+])C2)ccc1OC | CCOc1cc(N)ccc1OC.O=C1[C@@H]2CCCN1CC2 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCN&CC1",
"old_substring": "[C@@H]18C=C[C@H]([NH3+])C1"
} |
Can you make molecule OCc1ccc(CN2CCCC[C@@H]([NH+]3CCCC3)C2)o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(F)c1ccc(CN2CCCC[C@@H]([NH+]3CCCC3)C2)o1 | OCc1ccc(CN2CCCC[C@@H]([NH+]3CCCC3)C2)o1 | O=C(F)c1ccc(CN2CCCC[C@@H]([NH+]3CCCC3)C2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&F",
"old_substring": "OC6"
} |
Can you make molecule OCc1ccc(CN2CCCC[C@@H]([NH+]3CCCC3)C2)o1 less soluble in water? The output molecule should be similar to the input molecule. | ClCOc1ccc(CN2CCCC[C@@H]([NH+]3CCCC3)C2)o1 | OCc1ccc(CN2CCCC[C@@H]([NH+]3CCCC3)C2)o1 | ClCOc1ccc(CN2CCCC[C@@H]([NH+]3CCCC3)C2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O&CCl",
"old_substring": "OC6"
} |
Can you make molecule OCc1ccc(CN2CCCC[C@@H]([NH+]3CCCC3)C2)o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cl)c1ccc(CN2CCCC[C@@H]([NH+]3CCCC3)C2)o1 | OCc1ccc(CN2CCCC[C@@H]([NH+]3CCCC3)C2)o1 | O=C(Cl)c1ccc(CN2CCCC[C@@H]([NH+]3CCCC3)C2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&Cl",
"old_substring": "OC6"
} |
Can you make molecule OCc1ccc(CN2CCCC[C@@H]([NH+]3CCCC3)C2)o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CF)c1ccc(CN2CCCC[C@@H]([NH+]3CCCC3)C2)o1 | OCc1ccc(CN2CCCC[C@@H]([NH+]3CCCC3)C2)o1 | O=C(CF)c1ccc(CN2CCCC[C@@H]([NH+]3CCCC3)C2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CF",
"old_substring": "OC6"
} |
Can you make molecule OCc1ccc(CN2CCCC[C@@H]([NH+]3CCCC3)C2)o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCl)c1ccc(CN2CCCC[C@@H]([NH+]3CCCC3)C2)o1 | OCc1ccc(CN2CCCC[C@@H]([NH+]3CCCC3)C2)o1 | O=C(CCCl)c1ccc(CN2CCCC[C@@H]([NH+]3CCCC3)C2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCCl",
"old_substring": "OC6"
} |
Can you make molecule CC[C@H]1CCCN(C(=O)c2cc(C)n(-c3nccs3)c2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CCCN(SC(=O)Cc2cc(C)n(-c3nccs3)c2C)C1 | CC[C@H]1CCCN(C(=O)c2cc(C)n(-c3nccs3)c2C)C1 | CC[C@H]1CCCN(SC(=O)Cc2cc(C)n(-c3nccs3)c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C45=O"
} |
Can you make molecule CC[C@H]1CCCN(C(=O)c2cc(C)n(-c3nccs3)c2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CCCN(C(=O)CCCC(=O)c2cc(C)n(-c3nccs3)c2C)C1 | CC[C@H]1CCCN(C(=O)c2cc(C)n(-c3nccs3)c2C)C1 | CC[C@H]1CCCN(C(=O)CCCC(=O)c2cc(C)n(-c3nccs3)c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C45=O"
} |
Can you make molecule CC[C@H]1CCCN(C(=O)c2cc(C)n(-c3nccs3)c2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CCCN(C(=O)CC(C)(C)c2cc(C)n(-c3nccs3)c2C)C1 | CC[C@H]1CCCN(C(=O)c2cc(C)n(-c3nccs3)c2C)C1 | CC[C@H]1CCCN(C(=O)CC(C)(C)c2cc(C)n(-c3nccs3)c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule CC[C@H]1CCCN(C(=O)c2cc(C)n(-c3nccs3)c2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CCCN(C(=O)CCC(C)(C)c2cc(C)n(-c3nccs3)c2C)C1 | CC[C@H]1CCCN(C(=O)c2cc(C)n(-c3nccs3)c2C)C1 | CC[C@H]1CCCN(C(=O)CCC(C)(C)c2cc(C)n(-c3nccs3)c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule CC[C@H]1CCCN(C(=O)c2cc(C)n(-c3nccs3)c2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CCCN(SC(=O)[C@@H](C)c2cc(C)n(-c3nccs3)c2C)C1 | CC[C@H]1CCCN(C(=O)c2cc(C)n(-c3nccs3)c2C)C1 | CC[C@H]1CCCN(SC(=O)[C@@H](C)c2cc(C)n(-c3nccs3)c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C45=O"
} |
Can you make molecule Brc1cc(CSc2nnc(-c3ccccc3)o2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Brc1cc(CCCCSc2nnc(-c3ccccc3)o2)cs1 | Brc1cc(CSc2nnc(-c3ccccc3)o2)cs1 | Brc1cc(CCCCSc2nnc(-c3ccccc3)o2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C45"
} |
Can you make molecule Brc1cc(CSc2nnc(-c3ccccc3)o2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Brc1cc(CCCCCSc2nnc(-c3ccccc3)o2)cs1 | Brc1cc(CSc2nnc(-c3ccccc3)o2)cs1 | Brc1cc(CCCCCSc2nnc(-c3ccccc3)o2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C45"
} |
Can you make molecule Brc1cc(CSc2nnc(-c3ccccc3)o2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Brc1cc(C2CC(Sc3nnc(-c4ccccc4)o3)C2)cs1 | Brc1cc(CSc2nnc(-c3ccccc3)o2)cs1 | Brc1cc(C2CC(Sc3nnc(-c4ccccc4)o3)C2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C45"
} |
Can you make molecule Brc1cc(CSc2nnc(-c3ccccc3)o2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | S=C(OSc1nnc(-c2ccccc2)o1)Sc1csc(Br)c1 | Brc1cc(CSc2nnc(-c3ccccc3)o2)cs1 | S=C(OSc1nnc(-c2ccccc2)o1)Sc1csc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C45"
} |
Can you make molecule Brc1cc(CSc2nnc(-c3ccccc3)o2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | S=C(Nc1csc(Br)c1)SSc1nnc(-c2ccccc2)o1 | Brc1cc(CSc2nnc(-c3ccccc3)o2)cs1 | S=C(Nc1csc(Br)c1)SSc1nnc(-c2ccccc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C45"
} |
Can you make molecule O=C(Cn1cc(C=C2C(=O)Nc3cc(Cl)ccc32)c2ccccc21)NC[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sn1cc(C=C2C(=O)Nc3cc(Cl)ccc32)c2ccccc21)NC[C@H]1CCCO1 | O=C(Cn1cc(C=C2C(=O)Nc3cc(Cl)ccc32)c2ccccc21)NC[C@H]1CCCO1 | O=C(/C=C/Sn1cc(C=C2C(=O)Nc3cc(Cl)ccc32)c2ccccc21)NC[C@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C4C7"
} |
Can you make molecule O=C(Cn1cc(C=C2C(=O)Nc3cc(Cl)ccc32)c2ccccc21)NC[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1CCCO1)NN=C1CCC(n2cc(C=C3C(=O)Nc4cc(Cl)ccc43)c3ccccc32)CC1 | O=C(Cn1cc(C=C2C(=O)Nc3cc(Cl)ccc32)c2ccccc21)NC[C@H]1CCCO1 | O=C(NC[C@H]1CCCO1)NN=C1CCC(n2cc(C=C3C(=O)Nc4cc(Cl)ccc43)c3ccccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C4C7"
} |
Can you make molecule O=C(Cn1cc(C=C2C(=O)Nc3cc(Cl)ccc32)c2ccccc21)NC[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ONC[C@H]1CCCO1)C(=O)Sn1cc(C=C2C(=O)Nc3cc(Cl)ccc32)c2ccccc21 | O=C(Cn1cc(C=C2C(=O)Nc3cc(Cl)ccc32)c2ccccc21)NC[C@H]1CCCO1 | C/C(=N\ONC[C@H]1CCCO1)C(=O)Sn1cc(C=C2C(=O)Nc3cc(Cl)ccc32)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C4C7"
} |
Can you make molecule O=C(Cn1cc(C=C2C(=O)Nc3cc(Cl)ccc32)c2ccccc21)NC[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1CCCO1)C1=CC[C@H](n2cc(C=C3C(=O)Nc4cc(Cl)ccc43)c3ccccc32)S1 | O=C(Cn1cc(C=C2C(=O)Nc3cc(Cl)ccc32)c2ccccc21)NC[C@H]1CCCO1 | O=C(NC[C@H]1CCCO1)C1=CC[C@H](n2cc(C=C3C(=O)Nc4cc(Cl)ccc43)c3ccccc32)S1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C4C7"
} |
Can you make molecule O=C(Cn1cc(C=C2C(=O)Nc3cc(Cl)ccc32)c2ccccc21)NC[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1CCCO1)NN=Cc1ccc(-n2cc(C=C3C(=O)Nc4cc(Cl)ccc43)c3ccccc32)cc1 | O=C(Cn1cc(C=C2C(=O)Nc3cc(Cl)ccc32)c2ccccc21)NC[C@H]1CCCO1 | O=C(NC[C@H]1CCCO1)NN=Cc1ccc(-n2cc(C=C3C(=O)Nc4cc(Cl)ccc43)c3ccccc32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=Cc1ccc&cc1",
"old_substring": "O=C4C7"
} |
Can you make molecule COc1ccccc1N1CCN(C(=O)[C@@H](C)n2ccc(C(F)(F)F)n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1CCN(SC(=O)[C@@H](C)n2ccc(C(F)(F)F)n2)CC1 | COc1ccccc1N1CCN(C(=O)[C@@H](C)n2ccc(C(F)(F)F)n2)CC1 | COc1ccccc1N1CCN(SC(=O)[C@@H](C)n2ccc(C(F)(F)F)n2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C3(=O)[C@H]6C"
} |
Can you make molecule COc1ccccc1N1CCN(C(=O)[C@@H](C)n2ccc(C(F)(F)F)n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1CCN(C(=O)C[C@@H](Br)n2ccc(C(F)(F)F)n2)CC1 | COc1ccccc1N1CCN(C(=O)[C@@H](C)n2ccc(C(F)(F)F)n2)CC1 | COc1ccccc1N1CCN(C(=O)C[C@@H](Br)n2ccc(C(F)(F)F)n2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C3(=O)[C@H]6C"
} |
Can you make molecule COc1ccccc1N1CCN(C(=O)[C@@H](C)n2ccc(C(F)(F)F)n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1CCN([C@@H](C)CCn2ccc(C(F)(F)F)n2)CC1 | COc1ccccc1N1CCN(C(=O)[C@@H](C)n2ccc(C(F)(F)F)n2)CC1 | COc1ccccc1N1CCN([C@@H](C)CCn2ccc(C(F)(F)F)n2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C3(=O)[C@H]6C"
} |
Can you make molecule COc1ccccc1N1CCN(C(=O)[C@@H](C)n2ccc(C(F)(F)F)n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1CCN(C(=O)C[C@@H](C(C)C)n2ccc(C(F)(F)F)n2)CC1 | COc1ccccc1N1CCN(C(=O)[C@@H](C)n2ccc(C(F)(F)F)n2)CC1 | COc1ccccc1N1CCN(C(=O)C[C@@H](C(C)C)n2ccc(C(F)(F)F)n2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&C(C)C",
"old_substring": "C3(=O)[C@H]6C"
} |
Can you make molecule COc1ccccc1N1CCN(C(=O)[C@@H](C)n2ccc(C(F)(F)F)n2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CC(=O)n1ccc(C(F)(F)F)n1)N1CCN(c2ccccc2OC)CC1 | COc1ccccc1N1CCN(C(=O)[C@@H](C)n2ccc(C(F)(F)F)n2)CC1 | CC[C@@H](CC(=O)n1ccc(C(F)(F)F)n1)N1CCN(c2ccccc2OC)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&CC&=O",
"old_substring": "C3(=O)[C@H]6C"
} |
Can you make molecule CC[C@@H](C)CN(C)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CCCl)CN(C)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1 | CC[C@@H](C)CN(C)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1 | CC[C@H](CCCl)CN(C)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](C&)CCCl",
"old_substring": "CC[C@@H](C)C4"
} |
Can you make molecule CC[C@@H](C)CN(C)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](Cl)CCCN(C)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1 | CC[C@@H](C)CN(C)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1 | CC[C@@H](Cl)CCCN(C)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](Cl)CCC&",
"old_substring": "CC[C@@H](C)C4"
} |
Can you make molecule CC[C@@H](C)CN(C)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCCl)CN(C)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1 | CC[C@@H](C)CN(C)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1 | CC[C@@H](CCCl)CN(C)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&)CCCl",
"old_substring": "CC[C@@H](C)C4"
} |
Can you make molecule CC[C@@H](C)CN(C)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CC(=O)N(C)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1)C(C)C | CC[C@@H](C)CN(C)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1 | CC[C@H](CC(=O)N(C)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](CC&=O)C(C)C",
"old_substring": "CC[C@@H](C)C4"
} |
Can you make molecule CC[C@@H](C)CN(C)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C[C@H](CC)N(C)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1 | CC[C@@H](C)CN(C)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1 | CC[C@@H](C)C[C@H](CC)N(C)C(=O)N[C@@H](c1ccc(Cl)cc1)c1ncon1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&C[C@H](C)CC",
"old_substring": "CC[C@@H](C)C4"
} |
Can you make molecule COCCNC(=S)N1c2ccccc2C[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | COCCCCNC(=S)N1c2ccccc2C[C@H]1C | COCCNC(=S)N1c2ccccc2C[C@H]1C | COCCCCNC(=S)N1c2ccccc2C[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C3C4"
} |
Can you make molecule COCCNC(=S)N1c2ccccc2C[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | COCCCCCNC(=S)N1c2ccccc2C[C@H]1C | COCCNC(=S)N1c2ccccc2C[C@H]1C | COCCCCCNC(=S)N1c2ccccc2C[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C3C4"
} |
Can you make molecule COCCNC(=S)N1c2ccccc2C[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | COC1CC(NC(=S)N2c3ccccc3C[C@H]2C)C1 | COCCNC(=S)N1c2ccccc2C[C@H]1C | COC1CC(NC(=S)N2c3ccccc3C[C@H]2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C3C4"
} |
Can you make molecule COCCNC(=S)N1c2ccccc2C[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CO[C@@H](C)CCNC(=S)N1c2ccccc2C[C@H]1C | COCCNC(=S)N1c2ccccc2C[C@H]1C | CO[C@@H](C)CCNC(=S)N1c2ccccc2C[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C3C4"
} |
Can you make molecule COCCNC(=S)N1c2ccccc2C[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | COC1CCC(NC(=S)N2c3ccccc3C[C@H]2C)CC1 | COCCNC(=S)N1c2ccccc2C[C@H]1C | COC1CCC(NC(=S)N2c3ccccc3C[C@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C3C4"
} |
Can you make molecule Cc1ccc(-c2nc(C)c(C(=O)N(C)Cc3ncnn3C)s2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc(C)c(CC(=O)SN(C)Cc3ncnn3C)s2)c(C)c1 | Cc1ccc(-c2nc(C)c(C(=O)N(C)Cc3ncnn3C)s2)c(C)c1 | Cc1ccc(-c2nc(C)c(CC(=O)SN(C)Cc3ncnn3C)s2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccc(-c2nc(C)c(C(=O)N(C)Cc3ncnn3C)s2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc(C)c(C(=O)CCCC(=O)N(C)Cc3ncnn3C)s2)c(C)c1 | Cc1ccc(-c2nc(C)c(C(=O)N(C)Cc3ncnn3C)s2)c(C)c1 | Cc1ccc(-c2nc(C)c(C(=O)CCCC(=O)N(C)Cc3ncnn3C)s2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccc(-c2nc(C)c(C(=O)N(C)Cc3ncnn3C)s2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc(C)c(C(C)(C)CC(=O)N(C)Cc3ncnn3C)s2)c(C)c1 | Cc1ccc(-c2nc(C)c(C(=O)N(C)Cc3ncnn3C)s2)c(C)c1 | Cc1ccc(-c2nc(C)c(C(C)(C)CC(=O)N(C)Cc3ncnn3C)s2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccc(-c2nc(C)c(C(=O)N(C)Cc3ncnn3C)s2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc(C)c(C(C)(C)CCC(=O)N(C)Cc3ncnn3C)s2)c(C)c1 | Cc1ccc(-c2nc(C)c(C(=O)N(C)Cc3ncnn3C)s2)c(C)c1 | Cc1ccc(-c2nc(C)c(C(C)(C)CCC(=O)N(C)Cc3ncnn3C)s2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccc(-c2nc(C)c(C(=O)N(C)Cc3ncnn3C)s2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc(C)c([C@H](C)C(=O)SN(C)Cc3ncnn3C)s2)c(C)c1 | Cc1ccc(-c2nc(C)c(C(=O)N(C)Cc3ncnn3C)s2)c(C)c1 | Cc1ccc(-c2nc(C)c([C@H](C)C(=O)SN(C)Cc3ncnn3C)s2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule C[C@@H]([NH2+]C[C@]1(C)CCCO1)c1ccc2c(c1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](c1ccc2c(c1)CCC2)C1(C[C@]2(C)CCCO2)CC[NH2+]C1 | C[C@@H]([NH2+]C[C@]1(C)CCCO1)c1ccc2c(c1)CCC2 | C[C@H](c1ccc2c(c1)CCC2)C1(C[C@]2(C)CCCO2)CC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&&C1",
"old_substring": "[NH2+]34"
} |
Can you make molecule C[C@@H]([NH2+]C[C@]1(C)CCCO1)c1ccc2c(c1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](c1ccc2c(c1)CCC2)[C@]1(C[C@]2(C)CCCO2)CCC[NH2+]C1 | C[C@@H]([NH2+]C[C@]1(C)CCCO1)c1ccc2c(c1)CCC2 | C[C@H](c1ccc2c(c1)CCC2)[C@]1(C[C@]2(C)CCCO2)CCC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH2+]34"
} |
Can you make molecule C[C@@H]([NH2+]C[C@]1(C)CCCO1)c1ccc2c(c1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](c1ccc2c(c1)CCC2)n1c[nH+]cc1C[C@]1(C)CCCO1 | C[C@@H]([NH2+]C[C@]1(C)CCCO1)c1ccc2c(c1)CCC2 | C[C@H](c1ccc2c(c1)CCC2)n1c[nH+]cc1C[C@]1(C)CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule C[C@@H]([NH2+]C[C@]1(C)CCCO1)c1ccc2c(c1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](c1ccc2c(c1)CCC2)c1cc(C[C@]2(C)CCCO2)[nH][nH+]1 | C[C@@H]([NH2+]C[C@]1(C)CCCO1)c1ccc2c(c1)CCC2 | C[C@H](c1ccc2c(c1)CCC2)c1cc(C[C@]2(C)CCCO2)[nH][nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule C[C@@H]([NH2+]C[C@]1(C)CCCO1)c1ccc2c(c1)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](c1ccc2c(c1)CCC2)c1c(C[C@]2(C)CCCO2)c[nH+]n1C | C[C@@H]([NH2+]C[C@]1(C)CCCO1)c1ccc2c(c1)CCC2 | C[C@H](c1ccc2c(c1)CCC2)c1c(C[C@]2(C)CCCO2)c[nH+]n1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule COc1ccc([C@H](O)CN[C@@H](C)c2ccc(F)cc2Cl)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H](O)CN[C@@H](C)c2sc3cc(F)ccc3c2Cl)cc1OC | COc1ccc([C@H](O)CN[C@@H](C)c2ccc(F)cc2Cl)cc1OC | COc1ccc([C@H](O)CN[C@@H](C)c2sc3cc(F)ccc3c2Cl)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2cc(F)ccc2c1Cl",
"old_substring": "c18ccc(F)cc1Cl"
} |
Can you make molecule COc1ccc([C@H](O)CN[C@@H](C)c2ccc(F)cc2Cl)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H](O)CN[C@@H](C)c2cc(Br)ccc2Cl)cc1OC | COc1ccc([C@H](O)CN[C@@H](C)c2ccc(F)cc2Cl)cc1OC | COc1ccc([C@H](O)CN[C@@H](C)c2cc(Br)ccc2Cl)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Cl",
"old_substring": "c18ccc(F)cc1Cl"
} |
Can you make molecule COc1ccc([C@H](O)CN[C@@H](C)c2ccc(F)cc2Cl)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H](O)CN[C@@H](C)c2cc(Br)c(F)cc2Cl)cc1OC | COc1ccc([C@H](O)CN[C@@H](C)c2ccc(F)cc2Cl)cc1OC | COc1ccc([C@H](O)CN[C@@H](C)c2cc(Br)c(F)cc2Cl)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c(F)cc1Cl",
"old_substring": "c18ccc(F)cc1Cl"
} |
Can you make molecule COc1ccc([C@H](O)CN[C@@H](C)c2ccc(F)cc2Cl)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H](O)CN[C@@H](C)c2sc3cccc(F)c3c2Cl)cc1OC | COc1ccc([C@H](O)CN[C@@H](C)c2ccc(F)cc2Cl)cc1OC | COc1ccc([C@H](O)CN[C@@H](C)c2sc3cccc(F)c3c2Cl)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2cccc(F)c2c1Cl",
"old_substring": "c18ccc(F)cc1Cl"
} |
Can you make molecule COc1ccc([C@H](O)CN[C@@H](C)c2ccc(F)cc2Cl)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H](O)CN[C@@H](C)c2ccc(Br)cc2I)cc1OC | COc1ccc([C@H](O)CN[C@@H](C)c2ccc(F)cc2Cl)cc1OC | COc1ccc([C@H](O)CN[C@@H](C)c2ccc(Br)cc2I)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1I",
"old_substring": "c18ccc(F)cc1Cl"
} |
Can you make molecule Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2SCCS2)c1 | Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2CC2)c1 | Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2SCCS2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C15CC1"
} |
Can you make molecule Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2CCCCC2)c1 | Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2CC2)c1 | Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2CCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C15CC1"
} |
Can you make molecule Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2SCCCS2)c1 | Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2CC2)c1 | Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2SCCCS2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C15CC1"
} |
Can you make molecule Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2SCSCS2)c1 | Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2CC2)c1 | Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2SCSCS2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C15CC1"
} |
Can you make molecule Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2CCCCCC2)c1 | Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2CC2)c1 | Cc1ccc(C)c(S(=O)(=O)N(Cc2ccc(F)cc2)C2CCCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C15CC1"
} |
Can you make molecule O=C(Nc1ccccc1C(F)(F)F)c1c[nH]c2c(F)cccc2c1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1c[nH]c2c(F)cccc2c1=O)Nc1ccccc1C(F)(F)F | O=C(Nc1ccccc1C(F)(F)F)c1c[nH]c2c(F)cccc2c1=O | O=C(/C=C/Sc1c[nH]c2c(F)cccc2c1=O)Nc1ccccc1C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1ccccc1C(F)(F)F)c1c[nH]c2c(F)cccc2c1=O less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(Nc2ccccc2C(F)(F)F)nc1-c1c[nH]c2c(F)cccc2c1=O | O=C(Nc1ccccc1C(F)(F)F)c1c[nH]c2c(F)cccc2c1=O | O=Cc1sc(Nc2ccccc2C(F)(F)F)nc1-c1c[nH]c2c(F)cccc2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1ccccc1C(F)(F)F)c1c[nH]c2c(F)cccc2c1=O less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(Nc2ccccc2C(F)(F)F)sc1-c1c[nH]c2c(F)cccc2c1=O | O=C(Nc1ccccc1C(F)(F)F)c1c[nH]c2c(F)cccc2c1=O | O=Cc1nc(Nc2ccccc2C(F)(F)F)sc1-c1c[nH]c2c(F)cccc2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1ccccc1C(F)(F)F)c1c[nH]c2c(F)cccc2c1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccccc1C(F)(F)F)n1nc(-c2c[nH]c3c(F)cccc3c2=O)oc1=S | O=C(Nc1ccccc1C(F)(F)F)c1c[nH]c2c(F)cccc2c1=O | O=C(Nc1ccccc1C(F)(F)F)n1nc(-c2c[nH]c3c(F)cccc3c2=O)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1ccccc1C(F)(F)F)c1c[nH]c2c(F)cccc2c1=O less soluble in water? The output molecule should be similar to the input molecule. | O=c1c(-c2ccc(/C=N/ONc3ccccc3C(F)(F)F)o2)c[nH]c2c(F)cccc12 | O=C(Nc1ccccc1C(F)(F)F)c1c[nH]c2c(F)cccc2c1=O | O=c1c(-c2ccc(/C=N/ONc3ccccc3C(F)(F)F)o2)c[nH]c2c(F)cccc12 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C35"
} |
Can you make molecule COc1ccccc1N1C[C@@H](C(=O)N[C@H](c2ccccc2)c2ccccn2)CC1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1C[C@@H](C(=O)NC(c2ccccc2)c2ccccc2)CC1=O | COc1ccccc1N1C[C@@H](C(=O)N[C@H](c2ccccc2)c2ccccn2)CC1=O | COc1ccccc1N1C[C@@H](C(=O)NC(c2ccccc2)c2ccccc2)CC1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c17ccccn1"
} |
Can you make molecule COc1ccccc1N1C[C@@H](C(=O)N[C@H](c2ccccc2)c2ccccn2)CC1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1C[C@@H](C(=O)N[C@H](c2ccccc2)c2ccc(I)cn2)CC1=O | COc1ccccc1N1C[C@@H](C(=O)N[C@H](c2ccccc2)c2ccccn2)CC1=O | COc1ccccc1N1C[C@@H](C(=O)N[C@H](c2ccccc2)c2ccc(I)cn2)CC1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cn1",
"old_substring": "c17ccccn1"
} |
Can you make molecule COc1ccccc1N1C[C@@H](C(=O)N[C@H](c2ccccc2)c2ccccn2)CC1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1C[C@@H](C(=O)N[C@H](c2ccccc2)c2cccc(Cl)n2)CC1=O | COc1ccccc1N1C[C@@H](C(=O)N[C@H](c2ccccc2)c2ccccn2)CC1=O | COc1ccccc1N1C[C@@H](C(=O)N[C@H](c2ccccc2)c2cccc(Cl)n2)CC1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Cl)n1",
"old_substring": "c17ccccn1"
} |
Can you make molecule COc1ccccc1N1C[C@@H](C(=O)N[C@H](c2ccccc2)c2ccccn2)CC1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1C[C@@H](C(=O)N[C@H](c2ccccc2)c2cc(Br)ccn2)CC1=O | COc1ccccc1N1C[C@@H](C(=O)N[C@H](c2ccccc2)c2ccccn2)CC1=O | COc1ccccc1N1C[C@@H](C(=O)N[C@H](c2ccccc2)c2cc(Br)ccn2)CC1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccn1",
"old_substring": "c17ccccn1"
} |
Can you make molecule COc1ccccc1N1C[C@@H](C(=O)N[C@H](c2ccccc2)c2ccccn2)CC1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1N1C[C@@H](C(=O)N[C@H](c2ccccc2)c2cc3sccn3c2)CC1=O | COc1ccccc1N1C[C@@H](C(=O)N[C@H](c2ccccc2)c2ccccn2)CC1=O | COc1ccccc1N1C[C@@H](C(=O)N[C@H](c2ccccc2)c2cc3sccn3c2)CC1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sccn2c1",
"old_substring": "c17ccccn1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.