prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CN(Cc1ccccc1)C(=O)CCNC(=O)N1CCOC[C@@H]1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCNC(=O)N1CCOC[C@@H]1C1CC1)C1CCN(Cc2ccccc2)CC1 | CN(Cc1ccccc1)C(=O)CCNC(=O)N1CCOC[C@@H]1C1CC1 | O=C(CCNC(=O)N1CCOC[C@@H]1C1CC1)C1CCN(Cc2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "CN25"
} |
Can you make molecule CN(Cc1ccccc1)C(=O)CCNC(=O)N1CCOC[C@@H]1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)CCNC(=O)N1CCOC[C@@H]1C1CC1)C(=S)SCc1ccccc1 | CN(Cc1ccccc1)C(=O)CCNC(=O)N1CCOC[C@@H]1C1CC1 | CN(C(=O)CCNC(=O)N1CCOC[C@@H]1C1CC1)C(=S)SCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "CN25"
} |
Can you make molecule CN(Cc1ccccc1)C(=O)CCNC(=O)N1CCOC[C@@H]1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCNC(=O)N1CCOC[C@@H]1C1CC1)CN1CCC(Cc2ccccc2)CC1 | CN(Cc1ccccc1)C(=O)CCNC(=O)N1CCOC[C@@H]1C1CC1 | O=C(CCNC(=O)N1CCOC[C@@H]1C1CC1)CN1CCC(Cc2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "CN25"
} |
Can you make molecule CN(Cc1ccccc1)C(=O)CCNC(=O)N1CCOC[C@@H]1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCNC(=O)N1CCOC[C@@H]1C1CC1)N1CSC(=S)N(Cc2ccccc2)C1 | CN(Cc1ccccc1)C(=O)CCNC(=O)N1CCOC[C@@H]1C1CC1 | O=C(CCNC(=O)N1CCOC[C@@H]1C1CC1)N1CSC(=S)N(Cc2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S=C1SCN&CN1&",
"old_substring": "CN25"
} |
Can you make molecule CN(Cc1ccccc1)C(=O)CCNC(=O)N1CCOC[C@@H]1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(C(=O)CCNC(=O)N2CCOC[C@@H]2C2CC2)CCC(Cc2ccccc2)CC1 | CN(Cc1ccccc1)C(=O)CCNC(=O)N1CCOC[C@@H]1C1CC1 | N#CC1(C(=O)CCNC(=O)N2CCOC[C@@H]2C2CC2)CCC(Cc2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "CN25"
} |
Can you make molecule CC1(C)CC(=O)C(C(=S)Nc2ccccc2)/C(=N/C2CC(C)(C)[NH2+]C(C)(C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CC(=O)C(C(=S)Nc2ccccc2Cl)/C(=N/C2CC(C)(C)[NH2+]C(C)(C)C2)C1 | CC1(C)CC(=O)C(C(=S)Nc2ccccc2)/C(=N/C2CC(C)(C)[NH2+]C(C)(C)C2)C1 | CC1(C)CC(=O)C(C(=S)Nc2ccccc2Cl)/C(=N/C2CC(C)(C)[NH2+]C(C)(C)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c13ccccc1"
} |
Can you make molecule CC1(C)CC(=O)C(C(=S)Nc2ccccc2)/C(=N/C2CC(C)(C)[NH2+]C(C)(C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CC(=O)C(C(=S)Nc2ccc(I)cc2)/C(=N/C2CC(C)(C)[NH2+]C(C)(C)C2)C1 | CC1(C)CC(=O)C(C(=S)Nc2ccccc2)/C(=N/C2CC(C)(C)[NH2+]C(C)(C)C2)C1 | CC1(C)CC(=O)C(C(=S)Nc2ccc(I)cc2)/C(=N/C2CC(C)(C)[NH2+]C(C)(C)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c13ccccc1"
} |
Can you make molecule CC1(C)CC(=O)C(C(=S)Nc2ccccc2)/C(=N/C2CC(C)(C)[NH2+]C(C)(C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=S)C2C(=O)CC(C)(C)C/C2=N\C2CC(C)(C)[NH2+]C(C)(C)C2)cc1I | CC1(C)CC(=O)C(C(=S)Nc2ccccc2)/C(=N/C2CC(C)(C)[NH2+]C(C)(C)C2)C1 | Cc1ccc(NC(=S)C2C(=O)CC(C)(C)C/C2=N\C2CC(C)(C)[NH2+]C(C)(C)C2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c13ccccc1"
} |
Can you make molecule CC1(C)CC(=O)C(C(=S)Nc2ccccc2)/C(=N/C2CC(C)(C)[NH2+]C(C)(C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CC(=O)C(C(=S)Nc2cccc(Br)c2)/C(=N/C2CC(C)(C)[NH2+]C(C)(C)C2)C1 | CC1(C)CC(=O)C(C(=S)Nc2ccccc2)/C(=N/C2CC(C)(C)[NH2+]C(C)(C)C2)C1 | CC1(C)CC(=O)C(C(=S)Nc2cccc(Br)c2)/C(=N/C2CC(C)(C)[NH2+]C(C)(C)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c13ccccc1"
} |
Can you make molecule CC1(C)CC(=O)C(C(=S)Nc2ccccc2)/C(=N/C2CC(C)(C)[NH2+]C(C)(C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=S)C2C(=O)CC(C)(C)C/C2=N\C2CC(C)(C)[NH2+]C(C)(C)C2)c1C | CC1(C)CC(=O)C(C(=S)Nc2ccccc2)/C(=N/C2CC(C)(C)[NH2+]C(C)(C)C2)C1 | Cc1cccc(NC(=S)C2C(=O)CC(C)(C)C/C2=N\C2CC(C)(C)[NH2+]C(C)(C)C2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c13ccccc1"
} |
Can you make molecule CCn1ccc(C(=O)N2CCC[C@H](c3nnc(Cn4cccn4)n3C)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1ccc(C(=O)N2CCCCC2)n1.Cn1cccn1.Cn1cnncc1=O | CCn1ccc(C(=O)N2CCC[C@H](c3nnc(Cn4cccn4)n3C)C2)n1 | CCn1ccc(C(=O)N2CCCCC2)n1.Cn1cccn1.Cn1cnncc1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc&c(=O)n1C",
"old_substring": "c1%10nnc9n1C"
} |
Can you make molecule CCn1ccc(C(=O)N2CCC[C@H](c3nnc(Cn4cccn4)n3C)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1ccc(C(=O)N2CCCCC2)n1.Cc1cnnc2ccnn12.Cn1cccn1 | CCn1ccc(C(=O)N2CCC[C@H](c3nnc(Cn4cccn4)n3C)C2)n1 | CCn1ccc(C(=O)N2CCCCC2)n1.Cc1cnnc2ccnn12.Cn1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc2c&cnn2c1C",
"old_substring": "c1%10nnc9n1C"
} |
Can you make molecule CCn1ccc(C(=O)N2CCC[C@H](c3nnc(Cn4cccn4)n3C)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1ccc(C(=O)N2CCCCC2)n1.Cc1cncnn1.Cn1cccn1 | CCn1ccc(C(=O)N2CCC[C@H](c3nnc(Cn4cccn4)n3C)C2)n1 | CCn1ccc(C(=O)N2CCCCC2)n1.Cc1cncnn1.Cn1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc(C)c&n1",
"old_substring": "c1%10nnc9n1C"
} |
Can you make molecule CCn1ccc(C(=O)N2CCC[C@H](c3nnc(Cn4cccn4)n3C)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1ccc(C(=O)N2CCCCC2)n1.Cn1cccn1.Cn1ccnc1 | CCn1ccc(C(=O)N2CCC[C@H](c3nnc(Cn4cccn4)n3C)C2)n1 | CCn1ccc(C(=O)N2CCCCC2)n1.Cn1cccn1.Cn1ccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc&n1C",
"old_substring": "c1%10nnc9n1C"
} |
Can you make molecule CCn1ccc(C(=O)N2CCC[C@H](c3nnc(Cn4cccn4)n3C)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1ccc(C(=O)N2CCCCC2)n1.Cn1cccn1.Cn1cccn1 | CCn1ccc(C(=O)N2CCC[C@H](c3nnc(Cn4cccn4)n3C)C2)n1 | CCn1ccc(C(=O)N2CCCCC2)n1.Cn1cccn1.Cn1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&nn1C",
"old_substring": "c1%10nnc9n1C"
} |
Can you make molecule O[C@H](C1CC[NH+](Cc2c(Cl)nc3ccccn23)CC1)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O[C@@H](CCC(F)(F)F)C1CC[NH+](Cc2c(Cl)nc3ccccn23)CC1 | O[C@H](C1CC[NH+](Cc2c(Cl)nc3ccccn23)CC1)C(F)(F)F | O[C@@H](CCC(F)(F)F)C1CC[NH+](Cc2c(Cl)nc3ccccn23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@H]&CCC(F)(F)F",
"old_substring": "O[C@H]6C(F)(F)F"
} |
Can you make molecule O[C@H](C1CC[NH+](Cc2c(Cl)nc3ccccn23)CC1)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)CC1CC[NH+](Cc2c(Cl)nc3ccccn23)CC1 | O[C@H](C1CC[NH+](Cc2c(Cl)nc3ccccn23)CC1)C(F)(F)F | FC(F)(F)CC1CC[NH+](Cc2c(Cl)nc3ccccn23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)F",
"old_substring": "O[C@H]6C(F)(F)F"
} |
Can you make molecule O[C@H](C1CC[NH+](Cc2c(Cl)nc3ccccn23)CC1)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)C=C1CC[NH+](Cc2c(Cl)nc3ccccn23)CC1 | O[C@H](C1CC[NH+](Cc2c(Cl)nc3ccccn23)CC1)C(F)(F)F | FC(F)(F)C=C1CC[NH+](Cc2c(Cl)nc3ccccn23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&C(F)(F)F",
"old_substring": "O[C@H]6C(F)(F)F"
} |
Can you make molecule O[C@H](C1CC[NH+](Cc2c(Cl)nc3ccccn23)CC1)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C1CC[NH+](Cc2c(Cl)nc3ccccn23)CC1)C(F)(F)F | O[C@H](C1CC[NH+](Cc2c(Cl)nc3ccccn23)CC1)C(F)(F)F | C[C@H](C1CC[NH+](Cc2c(Cl)nc3ccccn23)CC1)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)C(F)(F)F",
"old_substring": "O[C@H]6C(F)(F)F"
} |
Can you make molecule O[C@H](C1CC[NH+](Cc2c(Cl)nc3ccccn23)CC1)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@H](C1CC[NH+](Cc2c(Cl)nc3ccccn23)CC1)C(F)(F)F | O[C@H](C1CC[NH+](Cc2c(Cl)nc3ccccn23)CC1)C(F)(F)F | N#C[C@H](C1CC[NH+](Cc2c(Cl)nc3ccccn23)CC1)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "N#C[C@H]&C(F)(F)F",
"old_substring": "O[C@H]6C(F)(F)F"
} |
Can you make molecule Cc1cnc(S(=O)(=O)CCc2scnc2C)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(S(=O)(=O)CCc2sccc2C)nc1 | Cc1cnc(S(=O)(=O)CCc2scnc2C)nc1 | Cc1cnc(S(=O)(=O)CCc2sccc2C)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c13scnc1C"
} |
Can you make molecule Cc1cnc(S(=O)(=O)CCc2scnc2C)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(S(=O)(=O)CCc2nc(C)c(Cl)s2)nc1 | Cc1cnc(S(=O)(=O)CCc2scnc2C)nc1 | Cc1cnc(S(=O)(=O)CCc2nc(C)c(Cl)s2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc&sc1Cl",
"old_substring": "c13scnc1C"
} |
Can you make molecule Cc1cnc(S(=O)(=O)CCc2scnc2C)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(S(=O)(=O)CCc2scc3c2CCCC3)nc1 | Cc1cnc(S(=O)(=O)CCc2scnc2C)nc1 | Cc1cnc(S(=O)(=O)CCc2scc3c2CCCC3)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&scc2c1CCCC2",
"old_substring": "c13scnc1C"
} |
Can you make molecule Cc1cnc(S(=O)(=O)CCc2scnc2C)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(S(=O)(=O)CCc2sccc2Br)nc1 | Cc1cnc(S(=O)(=O)CCc2scnc2C)nc1 | Cc1cnc(S(=O)(=O)CCc2sccc2Br)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c13scnc1C"
} |
Can you make molecule Cc1cnc(S(=O)(=O)CCc2scnc2C)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(S(=O)(=O)CCc2nc3c(s2)CCCC3)nc1 | Cc1cnc(S(=O)(=O)CCc2scnc2C)nc1 | Cc1cnc(S(=O)(=O)CCc2nc3c(s2)CCCC3)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2c(s1)CCCC2",
"old_substring": "c13scnc1C"
} |
Can you make molecule CC[NH+](CC)CC(=O)N(C)[C@@H]1CC[NH+](C)C[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)CC(=O)n1cc(C#N)c([C@@H]2CC[NH+](C)C[C@@H]2C)n1 | CC[NH+](CC)CC(=O)N(C)[C@@H]1CC[NH+](C)C[C@@H]1C | CC[NH+](CC)CC(=O)n1cc(C#N)c([C@@H]2CC[NH+](C)C[C@@H]2C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cn&nc1&",
"old_substring": "N26C"
} |
Can you make molecule CC[NH+](CC)CC(=O)N(C)[C@@H]1CC[NH+](C)C[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)CC(=O)c1nc(C#N)c([C@@H]2CC[NH+](C)C[C@@H]2C)o1 | CC[NH+](CC)CC(=O)N(C)[C@@H]1CC[NH+](C)C[C@@H]1C | CC[NH+](CC)CC(=O)c1nc(C#N)c([C@@H]2CC[NH+](C)C[C@@H]2C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1nc&oc1&",
"old_substring": "N26C"
} |
Can you make molecule CC[NH+](CC)CC(=O)N(C)[C@@H]1CC[NH+](C)C[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)CC(=O)c1cc(C#N)c([C@@H]2CC[NH+](C)C[C@@H]2C)s1 | CC[NH+](CC)CC(=O)N(C)[C@@H]1CC[NH+](C)C[C@@H]1C | CC[NH+](CC)CC(=O)c1cc(C#N)c([C@@H]2CC[NH+](C)C[C@@H]2C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N26C"
} |
Can you make molecule CC[NH+](CC)CC(=O)N(C)[C@@H]1CC[NH+](C)C[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)CC(=O)c1ccc([C@@H]2CC[NH+](C)C[C@@H]2C)c(C#N)c1 | CC[NH+](CC)CC(=O)N(C)[C@@H]1CC[NH+](C)C[C@@H]1C | CC[NH+](CC)CC(=O)c1ccc([C@@H]2CC[NH+](C)C[C@@H]2C)c(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N26C"
} |
Can you make molecule CC[NH+](CC)CC(=O)N(C)[C@@H]1CC[NH+](C)C[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)CC(=O)ON=C1CCN([C@@H]2CC[NH+](C)C[C@@H]2C)CC1 | CC[NH+](CC)CC(=O)N(C)[C@@H]1CC[NH+](C)C[C@@H]1C | CC[NH+](CC)CC(=O)ON=C1CCN([C@@H]2CC[NH+](C)C[C@@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N26C"
} |
Can you make molecule Nc1ccc(-c2nnc(SCC(=O)c3ccc([C@H]4CC4(Cl)Cl)cc3)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(-c2nnc(SCC(=O)c3ccc([C@@H]4CC=C(Cl)S4)cc3)o2)cc1 | Nc1ccc(-c2nnc(SCC(=O)c3ccc([C@H]4CC4(Cl)Cl)cc3)o2)cc1 | Nc1ccc(-c2nnc(SCC(=O)c3ccc([C@@H]4CC=C(Cl)S4)cc3)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC=C(Cl)S1",
"old_substring": "[C@H]19CC1(Cl)Cl"
} |
Can you make molecule Nc1ccc(-c2nnc(SCC(=O)c3ccc([C@H]4CC4(Cl)Cl)cc3)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC[C@@H]1c1ccc(C(=O)CSc2nnc(-c3ccc(N)cc3)o2)cc1 | Nc1ccc(-c2nnc(SCC(=O)c3ccc([C@H]4CC4(Cl)Cl)cc3)o2)cc1 | CC1(C)CCC[C@@H]1c1ccc(C(=O)CSc2nnc(-c3ccc(N)cc3)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC1(C)C",
"old_substring": "[C@H]19CC1(Cl)Cl"
} |
Can you make molecule Nc1ccc(-c2nnc(SCC(=O)c3ccc([C@H]4CC4(Cl)Cl)cc3)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(-c2nnc(SCC(=O)c3ccc([C@H]4CC=CC=C4Cl)cc3)o2)cc1 | Nc1ccc(-c2nnc(SCC(=O)c3ccc([C@H]4CC4(Cl)Cl)cc3)o2)cc1 | Nc1ccc(-c2nnc(SCC(=O)c3ccc([C@H]4CC=CC=C4Cl)cc3)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC=CC=C1Cl",
"old_substring": "[C@H]19CC1(Cl)Cl"
} |
Can you make molecule Nc1ccc(-c2nnc(SCC(=O)c3ccc([C@H]4CC4(Cl)Cl)cc3)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(-c2nnc(SCC(=O)c3ccc([C@H]4CC45CCCCC5)cc3)o2)cc1 | Nc1ccc(-c2nnc(SCC(=O)c3ccc([C@H]4CC4(Cl)Cl)cc3)o2)cc1 | Nc1ccc(-c2nnc(SCC(=O)c3ccc([C@H]4CC45CCCCC5)cc3)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC12CCCCC2",
"old_substring": "[C@H]19CC1(Cl)Cl"
} |
Can you make molecule Nc1ccc(-c2nnc(SCC(=O)c3ccc([C@H]4CC4(Cl)Cl)cc3)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(-c2nnc(SCC(=O)c3ccc([C@H]4CCC=CCCC4)cc3)o2)cc1 | Nc1ccc(-c2nnc(SCC(=O)c3ccc([C@H]4CC4(Cl)Cl)cc3)o2)cc1 | Nc1ccc(-c2nnc(SCC(=O)c3ccc([C@H]4CCC=CCCC4)cc3)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC=CCCC1",
"old_substring": "[C@H]19CC1(Cl)Cl"
} |
Can you make molecule CCNS(=O)(=O)[C@H]1CCN(C(=O)c2cnn(-c3ccccc3C)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCNS(=O)(=O)[C@H]1CCN(SC(=O)Cc2cnn(-c3ccccc3C)c2)C1 | CCNS(=O)(=O)[C@H]1CCN(C(=O)c2cnn(-c3ccccc3C)c2)C1 | CCNS(=O)(=O)[C@H]1CCN(SC(=O)Cc2cnn(-c3ccccc3C)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule CCNS(=O)(=O)[C@H]1CCN(C(=O)c2cnn(-c3ccccc3C)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCNS(=O)(=O)[C@H]1CCN(C(=O)CCCC(=O)c2cnn(-c3ccccc3C)c2)C1 | CCNS(=O)(=O)[C@H]1CCN(C(=O)c2cnn(-c3ccccc3C)c2)C1 | CCNS(=O)(=O)[C@H]1CCN(C(=O)CCCC(=O)c2cnn(-c3ccccc3C)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule CCNS(=O)(=O)[C@H]1CCN(C(=O)c2cnn(-c3ccccc3C)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCNS(=O)(=O)[C@H]1CCN(C(=O)CC(C)(C)c2cnn(-c3ccccc3C)c2)C1 | CCNS(=O)(=O)[C@H]1CCN(C(=O)c2cnn(-c3ccccc3C)c2)C1 | CCNS(=O)(=O)[C@H]1CCN(C(=O)CC(C)(C)c2cnn(-c3ccccc3C)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule CCNS(=O)(=O)[C@H]1CCN(C(=O)c2cnn(-c3ccccc3C)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCNS(=O)(=O)[C@H]1CCN(C(=O)CCC(C)(C)c2cnn(-c3ccccc3C)c2)C1 | CCNS(=O)(=O)[C@H]1CCN(C(=O)c2cnn(-c3ccccc3C)c2)C1 | CCNS(=O)(=O)[C@H]1CCN(C(=O)CCC(C)(C)c2cnn(-c3ccccc3C)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule CCNS(=O)(=O)[C@H]1CCN(C(=O)c2cnn(-c3ccccc3C)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCNS(=O)(=O)[C@H]1CCN(SC(=O)[C@@H](C)c2cnn(-c3ccccc3C)c2)C1 | CCNS(=O)(=O)[C@H]1CCN(C(=O)c2cnn(-c3ccccc3C)c2)C1 | CCNS(=O)(=O)[C@H]1CCN(SC(=O)[C@@H](C)c2cnn(-c3ccccc3C)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C47=O"
} |
Can you make molecule COc1ccc(CC(=O)Nc2nnc(-c3ccccc3OC)o2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2nnc(NC(=O)Cc3ccc(OC)c(C)c3)o2)c(I)c1 | COc1ccc(CC(=O)Nc2nnc(-c3ccccc3OC)o2)cc1C | COc1ccc(-c2nnc(NC(=O)Cc3ccc(OC)c(C)c3)o2)c(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c19ccccc16"
} |
Can you make molecule COc1ccc(CC(=O)Nc2nnc(-c3ccccc3OC)o2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Br)c(-c2nnc(NC(=O)Cc3ccc(OC)c(C)c3)o2)c1 | COc1ccc(CC(=O)Nc2nnc(-c3ccccc3OC)o2)cc1C | COc1ccc(Br)c(-c2nnc(NC(=O)Cc3ccc(OC)c(C)c3)o2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c19ccccc16"
} |
Can you make molecule COc1ccc(CC(=O)Nc2nnc(-c3ccccc3OC)o2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2nnc(NC(=O)Cc3ccc(OC)c(C)c3)o2)c(Cl)c1 | COc1ccc(CC(=O)Nc2nnc(-c3ccccc3OC)o2)cc1C | COc1ccc(-c2nnc(NC(=O)Cc3ccc(OC)c(C)c3)o2)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c19ccccc16"
} |
Can you make molecule COc1ccc(CC(=O)Nc2nnc(-c3ccccc3OC)o2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CC(=O)Nc2nnc(-c3cccc(OC)c3Br)o2)cc1C | COc1ccc(CC(=O)Nc2nnc(-c3ccccc3OC)o2)cc1C | COc1ccc(CC(=O)Nc2nnc(-c3cccc(OC)c3Br)o2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c19ccccc16"
} |
Can you make molecule COc1ccc(CC(=O)Nc2nnc(-c3ccccc3OC)o2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CC(=O)Nc2nnc(-c3cccc(OC)c3Cl)o2)cc1C | COc1ccc(CC(=O)Nc2nnc(-c3ccccc3OC)o2)cc1C | COc1ccc(CC(=O)Nc2nnc(-c3cccc(OC)c3Cl)o2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c19ccccc16"
} |
Can you make molecule Cc1ccc(CN(C(=O)N[C@H](C)c2nnc3ccccn23)C2CC2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CN(C(=O)CC(C)(C)N[C@H](C)c2nnc3ccccn23)C2CC2)cc1C | Cc1ccc(CN(C(=O)N[C@H](C)c2nnc3ccccn23)C2CC2)cc1C | Cc1ccc(CN(C(=O)CC(C)(C)N[C@H](C)c2nnc3ccccn23)C2CC2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1ccc(CN(C(=O)N[C@H](C)c2nnc3ccccn23)C2CC2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CN(C(=O)CCC(C)(C)N[C@H](C)c2nnc3ccccn23)C2CC2)cc1C | Cc1ccc(CN(C(=O)N[C@H](C)c2nnc3ccccn23)C2CC2)cc1C | Cc1ccc(CN(C(=O)CCC(C)(C)N[C@H](C)c2nnc3ccccn23)C2CC2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1ccc(CN(C(=O)N[C@H](C)c2nnc3ccccn23)C2CC2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CN(C(=O)C[C@@H](Br)N[C@H](C)c2nnc3ccccn23)C2CC2)cc1C | Cc1ccc(CN(C(=O)N[C@H](C)c2nnc3ccccn23)C2CC2)cc1C | Cc1ccc(CN(C(=O)C[C@@H](Br)N[C@H](C)c2nnc3ccccn23)C2CC2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C45=O"
} |
Can you make molecule Cc1ccc(CN(C(=O)N[C@H](C)c2nnc3ccccn23)C2CC2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CN(c2cc(C)n(N[C@H](C)c3nnc4ccccn34)c(=O)c2)C2CC2)cc1C | Cc1ccc(CN(C(=O)N[C@H](C)c2nnc3ccccn23)C2CC2)cc1C | Cc1ccc(CN(c2cc(C)n(N[C@H](C)c3nnc4ccccn34)c(=O)c2)C2CC2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C45=O"
} |
Can you make molecule Cc1ccc(CN(C(=O)N[C@H](C)c2nnc3ccccn23)C2CC2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CN(c2c(C)n(N[C@H](C)c3nnc4ccccn34)ccc2=O)C2CC2)cc1C | Cc1ccc(CN(C(=O)N[C@H](C)c2nnc3ccccn23)C2CC2)cc1C | Cc1ccc(CN(c2c(C)n(N[C@H](C)c3nnc4ccccn34)ccc2=O)C2CC2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C45=O"
} |
Can you make molecule CC[C@H](NC(=O)NCCNC(C)=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)NCCCCNC(C)=O)c1cccs1 | CC[C@H](NC(=O)NCCNC(C)=O)c1cccs1 | CC[C@H](NC(=O)NCCCCNC(C)=O)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C6C7"
} |
Can you make molecule CC[C@H](NC(=O)NCCNC(C)=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)N=CCCNC(C)=O)c1cccs1 | CC[C@H](NC(=O)NCCNC(C)=O)c1cccs1 | CC[C@H](NC(=O)N=CCCNC(C)=O)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C6C7"
} |
Can you make molecule CC[C@H](NC(=O)NCCNC(C)=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)NCCCCCNC(C)=O)c1cccs1 | CC[C@H](NC(=O)NCCNC(C)=O)c1cccs1 | CC[C@H](NC(=O)NCCCCCNC(C)=O)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C6C7"
} |
Can you make molecule CC[C@H](NC(=O)NCCNC(C)=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)NC1CC(NC(C)=O)C1)c1cccs1 | CC[C@H](NC(=O)NCCNC(C)=O)c1cccs1 | CC[C@H](NC(=O)NC1CC(NC(C)=O)C1)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C6C7"
} |
Can you make molecule CC[C@H](NC(=O)NCCNC(C)=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)N=C(C)CCNC(C)=O)c1cccs1 | CC[C@H](NC(=O)NCCNC(C)=O)c1cccs1 | CC[C@H](NC(=O)N=C(C)CCNC(C)=O)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C6C7"
} |
Can you make molecule COc1ccc2c(c1)c(CC(=O)Nc1ccccn1)c(C)n2C(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)c(CCC(CO)=Nc1ccccn1)c(C)n2C(=O)c1ccc(Cl)cc1 | COc1ccc2c(c1)c(CC(=O)Nc1ccccn1)c(C)n2C(=O)c1ccc(Cl)cc1 | COc1ccc2c(c1)c(CCC(CO)=Nc1ccccn1)c(C)n2C(=O)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C7C3=O"
} |
Can you make molecule COc1ccc2c(c1)c(CC(=O)Nc1ccccn1)c(C)n2C(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)c(C/C(C)=N\ONc1ccccn1)c(C)n2C(=O)c1ccc(Cl)cc1 | COc1ccc2c(c1)c(CC(=O)Nc1ccccn1)c(C)n2C(=O)c1ccc(Cl)cc1 | COc1ccc2c(c1)c(C/C(C)=N\ONc1ccccn1)c(C)n2C(=O)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C7C3=O"
} |
Can you make molecule COc1ccc2c(c1)c(CC(=O)Nc1ccccn1)c(C)n2C(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CNc1ccccn1)c1c(C)n(C(=O)c2ccc(Cl)cc2)c2ccc(OC)cc12 | COc1ccc2c(c1)c(CC(=O)Nc1ccccn1)c(C)n2C(=O)c1ccc(Cl)cc1 | CCC(CC)(C(=O)CNc1ccccn1)c1c(C)n(C(=O)c2ccc(Cl)cc2)c2ccc(OC)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C7C3=O"
} |
Can you make molecule COc1ccc2c(c1)c(CC(=O)Nc1ccccn1)c(C)n2C(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)c(SSC(=O)Nc1ccccn1)c(C)n2C(=O)c1ccc(Cl)cc1 | COc1ccc2c(c1)c(CC(=O)Nc1ccccn1)c(C)n2C(=O)c1ccc(Cl)cc1 | COc1ccc2c(c1)c(SSC(=O)Nc1ccccn1)c(C)n2C(=O)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C7C3=O"
} |
Can you make molecule COc1ccc2c(c1)c(CC(=O)Nc1ccccn1)c(C)n2C(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCNc1ccccn1)c1c(C)n(C(=O)c2ccc(Cl)cc2)c2ccc(OC)cc12 | COc1ccc2c(c1)c(CC(=O)Nc1ccccn1)c(C)n2C(=O)c1ccc(Cl)cc1 | CCC(CC)(C(=O)CCNc1ccccn1)c1c(C)n(C(=O)c2ccc(Cl)cc2)c2ccc(OC)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C7C3=O"
} |
Can you make molecule CCNc1ccc(S(N)(=O)=O)c(N)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC12CC(Nc3ccc(S(N)(=O)=O)c(N)c3)=CC=CC=C1C2 | CCNc1ccc(S(N)(=O)=O)c(N)c1 | CC12CC(Nc3ccc(S(N)(=O)=O)c(N)c3)=CC=CC=C1C2 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&Cc2ccccc2C1",
"old_substring": "CC2"
} |
Can you make molecule CCNc1ccc(S(N)(=O)=O)c(N)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCCC2=C(N=C1Nc1ccc(S(N)(=O)=O)c(N)c1)S2 | CCNc1ccc(S(N)(=O)=O)c(N)c1 | CC1(C)CCCC2=C(N=C1Nc1ccc(S(N)(=O)=O)c(N)c1)S2 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCCc2sc&nc21",
"old_substring": "CC2"
} |
Can you make molecule CCNc1ccc(S(N)(=O)=O)c(N)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CC2=CC2=CC=C(Nc2ccc(S(N)(=O)=O)c(N)c2)O1 | CCNc1ccc(S(N)(=O)=O)c(N)c1 | CC1(C)CC2=CC2=CC=C(Nc2ccc(S(N)(=O)=O)c(N)c2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)Cc2cc&ccc2O1",
"old_substring": "CC2"
} |
Can you make molecule CCNc1ccc(S(N)(=O)=O)c(N)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC2=CC2=CC=C1Nc1ccc(S(N)(=O)=O)c(N)c1 | CCNc1ccc(S(N)(=O)=O)c(N)c1 | CN1CCC2=CC2=CC=C1Nc1ccc(S(N)(=O)=O)c(N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CN1CCc2cc&ccc21",
"old_substring": "CC2"
} |
Can you make molecule CCNc1ccc(S(N)(=O)=O)c(N)c1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1cc(NCCCCC23CC2C3)ccc1S(N)(=O)=O | CCNc1ccc(S(N)(=O)=O)c(N)c1 | Nc1cc(NCCCCC23CC2C3)ccc1S(N)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC2(CCCC2)C1",
"old_substring": "CC2"
} |
Can you make molecule CN(C)C(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@]1(C)CC1(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@]1(C(=O)N[C@H](Cc2ccccc2)C(=O)CN=C=S)CC1(Cl)Cl | CN(C)C(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@]1(C)CC1(Cl)Cl | C[C@]1(C(=O)N[C@H](Cc2ccccc2)C(=O)CN=C=S)CC1(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&N=C=S",
"old_substring": "CN2C"
} |
Can you make molecule CN(C)C(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@]1(C)CC1(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@]1(C(=O)N[C@H](Cc2ccccc2)C(=O)CN2CCSCC2)CC1(Cl)Cl | CN(C)C(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@]1(C)CC1(Cl)Cl | C[C@]1(C(=O)N[C@H](Cc2ccccc2)C(=O)CN2CCSCC2)CC1(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCSCC1",
"old_substring": "CN2C"
} |
Can you make molecule CN(C)C(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@]1(C)CC1(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | CON(C)CCCC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@]1(C)CC1(Cl)Cl | CN(C)C(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@]1(C)CC1(Cl)Cl | CON(C)CCCC(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@]1(C)CC1(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "CON(C)CCC&",
"old_substring": "CN2C"
} |
Can you make molecule CN(C)C(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@]1(C)CC1(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@]1(C(=O)N[C@H](Cc2ccccc2)C(=O)CN2CCCCC2)CC1(Cl)Cl | CN(C)C(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@]1(C)CC1(Cl)Cl | C[C@]1(C(=O)N[C@H](Cc2ccccc2)C(=O)CN2CCCCC2)CC1(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCCCC1",
"old_substring": "CN2C"
} |
Can you make molecule CN(C)C(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@]1(C)CC1(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@]1(C(=O)N[C@H](Cc2ccccc2)C(=O)SC2=NCCS2)CC1(Cl)Cl | CN(C)C(=O)[C@@H](Cc1ccccc1)NC(=O)[C@@]1(C)CC1(Cl)Cl | C[C@]1(C(=O)N[C@H](Cc2ccccc2)C(=O)SC2=NCCS2)CC1(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&C1=NCCS1",
"old_substring": "CN2C"
} |
Can you make molecule CCS(=O)(=O)CCNC(=O)N[C@H](c1ccccc1)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)CCNC(=O)N[C@@H](c1ccccn1)c1ccccc1Cl | CCS(=O)(=O)CCNC(=O)N[C@H](c1ccccc1)c1ccccn1 | CCS(=O)(=O)CCNC(=O)N[C@@H](c1ccccn1)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c17ccccc1"
} |
Can you make molecule CCS(=O)(=O)CCNC(=O)N[C@H](c1ccccc1)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)CCNC(=O)N[C@H](c1ccc(I)cc1)c1ccccn1 | CCS(=O)(=O)CCNC(=O)N[C@H](c1ccccc1)c1ccccn1 | CCS(=O)(=O)CCNC(=O)N[C@H](c1ccc(I)cc1)c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c17ccccc1"
} |
Can you make molecule CCS(=O)(=O)CCNC(=O)N[C@H](c1ccccc1)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)CCNC(=O)N[C@H](c1ccc(C)c(I)c1)c1ccccn1 | CCS(=O)(=O)CCNC(=O)N[C@H](c1ccccc1)c1ccccn1 | CCS(=O)(=O)CCNC(=O)N[C@H](c1ccc(C)c(I)c1)c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c17ccccc1"
} |
Can you make molecule CCS(=O)(=O)CCNC(=O)N[C@H](c1ccccc1)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)CCNC(=O)N[C@H](c1cccc(Br)c1)c1ccccn1 | CCS(=O)(=O)CCNC(=O)N[C@H](c1ccccc1)c1ccccn1 | CCS(=O)(=O)CCNC(=O)N[C@H](c1cccc(Br)c1)c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c17ccccc1"
} |
Can you make molecule CCS(=O)(=O)CCNC(=O)N[C@H](c1ccccc1)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)CCNC(=O)N[C@@H](c1ccccn1)c1cccc(C)c1C | CCS(=O)(=O)CCNC(=O)N[C@H](c1ccccc1)c1ccccn1 | CCS(=O)(=O)CCNC(=O)N[C@@H](c1ccccn1)c1cccc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c17ccccc1"
} |
Can you make molecule CSc1ccc(CNS(=O)(=O)c2cccc(C#N)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1ccc(CCCCNS(=O)(=O)c2cccc(C#N)c2)cc1 | CSc1ccc(CNS(=O)(=O)c2cccc(C#N)c2)cc1 | CSc1ccc(CCCCNS(=O)(=O)c2cccc(C#N)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C35"
} |
Can you make molecule CSc1ccc(CNS(=O)(=O)c2cccc(C#N)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1ccc(CCC=NS(=O)(=O)c2cccc(C#N)c2)cc1 | CSc1ccc(CNS(=O)(=O)c2cccc(C#N)c2)cc1 | CSc1ccc(CCC=NS(=O)(=O)c2cccc(C#N)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C35"
} |
Can you make molecule CSc1ccc(CNS(=O)(=O)c2cccc(C#N)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1ccc(CCCCCNS(=O)(=O)c2cccc(C#N)c2)cc1 | CSc1ccc(CNS(=O)(=O)c2cccc(C#N)c2)cc1 | CSc1ccc(CCCCCNS(=O)(=O)c2cccc(C#N)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C35"
} |
Can you make molecule CSc1ccc(CNS(=O)(=O)c2cccc(C#N)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1ccc(C2CC(NS(=O)(=O)c3cccc(C#N)c3)C2)cc1 | CSc1ccc(CNS(=O)(=O)c2cccc(C#N)c2)cc1 | CSc1ccc(C2CC(NS(=O)(=O)c3cccc(C#N)c3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C35"
} |
Can you make molecule CSc1ccc(CNS(=O)(=O)c2cccc(C#N)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1ccc(SC(=S)ONS(=O)(=O)c2cccc(C#N)c2)cc1 | CSc1ccc(CNS(=O)(=O)c2cccc(C#N)c2)cc1 | CSc1ccc(SC(=S)ONS(=O)(=O)c2cccc(C#N)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C35"
} |
Can you make molecule C[C@@H](c1ccco1)N(C)C(=O)c1cn(CC2CCCCC2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccco1)N(C)C(=O)c1cn(CC2CCCCCCC2)nn1 | C[C@@H](c1ccco1)N(C)C(=O)c1cn(CC2CCCCC2)nn1 | C[C@@H](c1ccco1)N(C)C(=O)c1cn(CC2CCCCCCC2)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C18CCCCC1"
} |
Can you make molecule C[C@@H](c1ccco1)N(C)C(=O)c1cn(CC2CCCCC2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccco1)N(C)C(=O)c1cn(CSC2=CCCCCC2)nn1 | C[C@@H](c1ccco1)N(C)C(=O)c1cn(CC2CCCCC2)nn1 | C[C@@H](c1ccco1)N(C)C(=O)c1cn(CSC2=CCCCCC2)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C18CCCCC1"
} |
Can you make molecule C[C@@H](c1ccco1)N(C)C(=O)c1cn(CC2CCCCC2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccco1)N(C)C(=O)c1cn(CC2CCCCCCCCCCC2)nn1 | C[C@@H](c1ccco1)N(C)C(=O)c1cn(CC2CCCCC2)nn1 | C[C@@H](c1ccco1)N(C)C(=O)c1cn(CC2CCCCCCCCCCC2)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCCCCCC1",
"old_substring": "C18CCCCC1"
} |
Can you make molecule C[C@@H](c1ccco1)N(C)C(=O)c1cn(CC2CCCCC2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccco1)N(C)C(=O)c1cn(CC2(C#N)CCCCCCC2)nn1 | C[C@@H](c1ccco1)N(C)C(=O)c1cn(CC2CCCCC2)nn1 | C[C@@H](c1ccco1)N(C)C(=O)c1cn(CC2(C#N)CCCCCCC2)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCCCCCC1",
"old_substring": "C18CCCCC1"
} |
Can you make molecule C[C@@H](c1ccco1)N(C)C(=O)c1cn(CC2CCCCC2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccco1)N(C)C(=O)c1cn(C=CC2CCCCCC2)nn1 | C[C@@H](c1ccco1)N(C)C(=O)c1cn(CC2CCCCC2)nn1 | C[C@@H](c1ccco1)N(C)C(=O)c1cn(C=CC2CCCCCC2)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&C1CCCCCC1",
"old_substring": "C18CCCCC1"
} |
Can you make molecule CCC[C@H](C)N(C)S(=O)(=O)c1ccc(CC(=O)[O-])s1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](C)N(C)S(=O)(=O)c1ccc(CCS(=O)(=O)[O-])s1 | CCC[C@H](C)N(C)S(=O)(=O)c1ccc(CC(=O)[O-])s1 | CCC[C@H](C)N(C)S(=O)(=O)c1ccc(CCS(=O)(=O)[O-])s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CS(=O)(=O)[O-]",
"old_substring": "C4C(=O)[O-]"
} |
Can you make molecule CCC[C@H](C)N(C)S(=O)(=O)c1ccc(CC(=O)[O-])s1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](C)N(C)S(=O)(=O)c1ccc(ONC(C)=O)s1 | CCC[C@H](C)N(C)S(=O)(=O)c1ccc(CC(=O)[O-])s1 | CCC[C@H](C)N(C)S(=O)(=O)c1ccc(ONC(C)=O)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)NO&",
"old_substring": "C4C(=O)[O-]"
} |
Can you make molecule CCC[C@H](C)N(C)S(=O)(=O)c1ccc(CC(=O)[O-])s1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](C)N(C)S(=O)(=O)c1ccc(CCC(=O)O)s1 | CCC[C@H](C)N(C)S(=O)(=O)c1ccc(CC(=O)[O-])s1 | CCC[C@H](C)N(C)S(=O)(=O)c1ccc(CCC(=O)O)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC(=O)O",
"old_substring": "C4C(=O)[O-]"
} |
Can you make molecule CCC[C@H](C)N(C)S(=O)(=O)c1ccc(CC(=O)[O-])s1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](C)N(C)S(=O)(=O)c1ccc(C(CC)(CC)C(=O)[O-])s1 | CCC[C@H](C)N(C)S(=O)(=O)c1ccc(CC(=O)[O-])s1 | CCC[C@H](C)N(C)S(=O)(=O)c1ccc(C(CC)(CC)C(=O)[O-])s1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)[O-]",
"old_substring": "C4C(=O)[O-]"
} |
Can you make molecule CCC[C@H](C)N(C)S(=O)(=O)c1ccc(CC(=O)[O-])s1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](C)N(C)S(=O)(=O)c1ccc(CCCS(=O)(=O)[O-])s1 | CCC[C@H](C)N(C)S(=O)(=O)c1ccc(CC(=O)[O-])s1 | CCC[C@H](C)N(C)S(=O)(=O)c1ccc(CCCS(=O)(=O)[O-])s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCS(=O)(=O)[O-]",
"old_substring": "C4C(=O)[O-]"
} |
Can you make molecule COC(=O)c1ccc(NC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COSC(=O)Cc1ccc(NC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 | COC(=O)c1ccc(NC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 | COSC(=O)Cc1ccc(NC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule COC(=O)c1ccc(NC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCCC(=O)c1ccc(NC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 | COC(=O)c1ccc(NC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 | COC(=O)CCCC(=O)c1ccc(NC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule COC(=O)c1ccc(NC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CC(C)(C)c1ccc(NC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 | COC(=O)c1ccc(NC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 | COC(=O)CC(C)(C)c1ccc(NC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule COC(=O)c1ccc(NC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCC(C)(C)c1ccc(NC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 | COC(=O)c1ccc(NC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 | COC(=O)CCC(C)(C)c1ccc(NC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule COC(=O)c1ccc(NC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COSC(=O)[C@@H](C)c1ccc(NC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 | COC(=O)c1ccc(NC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 | COSC(=O)[C@@H](C)c1ccc(NC(=S)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cccc(CN(C)c2ccc(Cl)c(CCl)n2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CCCCN(C)c2ccc(Cl)c(CCl)n2)n1 | Cc1cccc(CN(C)c2ccc(Cl)c(CCl)n2)n1 | Cc1cccc(CCCCN(C)c2ccc(Cl)c(CCl)n2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C35"
} |
Can you make molecule Cc1cccc(CN(C)c2ccc(Cl)c(CCl)n2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CCCCCN(C)c2ccc(Cl)c(CCl)n2)n1 | Cc1cccc(CN(C)c2ccc(Cl)c(CCl)n2)n1 | Cc1cccc(CCCCCN(C)c2ccc(Cl)c(CCl)n2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C35"
} |
Can you make molecule Cc1cccc(CN(C)c2ccc(Cl)c(CCl)n2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C2CC(N(C)c3ccc(Cl)c(CCl)n3)C2)n1 | Cc1cccc(CN(C)c2ccc(Cl)c(CCl)n2)n1 | Cc1cccc(C2CC(N(C)c3ccc(Cl)c(CCl)n3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C35"
} |
Can you make molecule Cc1cccc(CN(C)c2ccc(Cl)c(CCl)n2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(SC(=S)ON(C)c2ccc(Cl)c(CCl)n2)n1 | Cc1cccc(CN(C)c2ccc(Cl)c(CCl)n2)n1 | Cc1cccc(SC(=S)ON(C)c2ccc(Cl)c(CCl)n2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C35"
} |
Can you make molecule Cc1cccc(CN(C)c2ccc(Cl)c(CCl)n2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=S)SN(C)c2ccc(Cl)c(CCl)n2)n1 | Cc1cccc(CN(C)c2ccc(Cl)c(CCl)n2)n1 | Cc1cccc(NC(=S)SN(C)c2ccc(Cl)c(CCl)n2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C35"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.