prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(=C1SC(=O)N(c2ccc(Cl)cc2)C1=O)c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=CC1=CN=N[C@H]1c1ccc(Cl)cc1)c1ccc(Br)cc1 | CC(=C1SC(=O)N(c2ccc(Cl)cc2)C1=O)c1ccc(Br)cc1 | CC(=CC1=CN=N[C@H]1c1ccc(Cl)cc1)c1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(C&)[C@H]&N=N1",
"old_substring": "C1=3SC(=O)N4C1=O"
} |
Can you make molecule CC(=C1SC(=O)N(c2ccc(Cl)cc2)C1=O)c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=C1CC(F)(c2ccc(Cl)cc2)C1)c1ccc(Br)cc1 | CC(=C1SC(=O)N(c2ccc(Cl)cc2)C1=O)c1ccc(Br)cc1 | CC(=C1CC(F)(c2ccc(Cl)cc2)C1)c1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&(F)C1",
"old_substring": "C1=3SC(=O)N4C1=O"
} |
Can you make molecule CC(=C1SC(=O)N(c2ccc(Cl)cc2)C1=O)c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=NC(=S)N1CCC(c2ccc(Cl)cc2)CC1)c1ccc(Br)cc1 | CC(=C1SC(=O)N(c2ccc(Cl)cc2)C1=O)c1ccc(Br)cc1 | CC(=NC(=S)N1CCC(c2ccc(Cl)cc2)CC1)c1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=S)N1CCC&CC1",
"old_substring": "C1=3SC(=O)N4C1=O"
} |
Can you make molecule CC(=C1SC(=O)N(c2ccc(Cl)cc2)C1=O)c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=C1CC(C#N)(c2ccc(Cl)cc2)C1)c1ccc(Br)cc1 | CC(=C1SC(=O)N(c2ccc(Cl)cc2)C1=O)c1ccc(Br)cc1 | CC(=C1CC(C#N)(c2ccc(Cl)cc2)C1)c1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&(C#N)C1",
"old_substring": "C1=3SC(=O)N4C1=O"
} |
Can you make molecule CC(=C1SC(=O)N(c2ccc(Cl)cc2)C1=O)c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C=C(C)c1ccc(Br)cc1)C(=O)c1ccc(Cl)cc1 | CC(=C1SC(=O)N(c2ccc(Cl)cc2)C1=O)c1ccc(Br)cc1 | C=C(C=C(C)c1ccc(Br)cc1)C(=O)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C&)C&=O",
"old_substring": "C1=3SC(=O)N4C1=O"
} |
Can you make molecule Cc1ccc(NC(=O)C[C@H]2SC([N-]c3ccc(N(C)C)cc3)=NC2=O)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NSC(=O)C[C@H]2SC([N-]c3ccc(N(C)C)cc3)=NC2=O)c(C)c1 | Cc1ccc(NC(=O)C[C@H]2SC([N-]c3ccc(N(C)C)cc3)=NC2=O)c(C)c1 | Cc1ccc(NSC(=O)C[C@H]2SC([N-]c3ccc(N(C)C)cc3)=NC2=O)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C4(=O)C8"
} |
Can you make molecule Cc1ccc(NC(=O)C[C@H]2SC([N-]c3ccc(N(C)C)cc3)=NC2=O)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CC(C)(C)[C@H]2SC([N-]c3ccc(N(C)C)cc3)=NC2=O)c(C)c1 | Cc1ccc(NC(=O)C[C@H]2SC([N-]c3ccc(N(C)C)cc3)=NC2=O)c(C)c1 | Cc1ccc(NC(=O)CC(C)(C)[C@H]2SC([N-]c3ccc(N(C)C)cc3)=NC2=O)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)C8"
} |
Can you make molecule Cc1ccc(NC(=O)C[C@H]2SC([N-]c3ccc(N(C)C)cc3)=NC2=O)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC[S@+]([O-])CCC[C@H]2SC([N-]c3ccc(N(C)C)cc3)=NC2=O)c(C)c1 | Cc1ccc(NC(=O)C[C@H]2SC([N-]c3ccc(N(C)C)cc3)=NC2=O)c(C)c1 | Cc1ccc(NC[S@+]([O-])CCC[C@H]2SC([N-]c3ccc(N(C)C)cc3)=NC2=O)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C4(=O)C8"
} |
Can you make molecule Cc1ccc(NC(=O)C[C@H]2SC([N-]c3ccc(N(C)C)cc3)=NC2=O)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CCC(C)(C)[C@H]2SC([N-]c3ccc(N(C)C)cc3)=NC2=O)c(C)c1 | Cc1ccc(NC(=O)C[C@H]2SC([N-]c3ccc(N(C)C)cc3)=NC2=O)c(C)c1 | Cc1ccc(NC(=O)CCC(C)(C)[C@H]2SC([N-]c3ccc(N(C)C)cc3)=NC2=O)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C4(=O)C8"
} |
Can you make molecule Cc1ccc(NC(=O)C[C@H]2SC([N-]c3ccc(N(C)C)cc3)=NC2=O)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C[C@H](C)[C@H]2SC([N-]c3ccc(N(C)C)cc3)=NC2=O)c(C)c1 | Cc1ccc(NC(=O)C[C@H]2SC([N-]c3ccc(N(C)C)cc3)=NC2=O)c(C)c1 | Cc1ccc(NC(=O)C[C@H](C)[C@H]2SC([N-]c3ccc(N(C)C)cc3)=NC2=O)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@@H]&C",
"old_substring": "C4(=O)C8"
} |
Can you make molecule CO[C@H]1CCCC[C@H]1NC(=O)NC[C@H](c1cccc(F)c1)[NH+](C)C less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H]1CCCC[C@H]1NC(=O)CC(C)(C)NC[C@H](c1cccc(F)c1)[NH+](C)C | CO[C@H]1CCCC[C@H]1NC(=O)NC[C@H](c1cccc(F)c1)[NH+](C)C | CO[C@H]1CCCC[C@H]1NC(=O)CC(C)(C)NC[C@H](c1cccc(F)c1)[NH+](C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CO[C@H]1CCCC[C@H]1NC(=O)NC[C@H](c1cccc(F)c1)[NH+](C)C less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H]1CCCC[C@H]1NC(=O)CCC(C)(C)NC[C@H](c1cccc(F)c1)[NH+](C)C | CO[C@H]1CCCC[C@H]1NC(=O)NC[C@H](c1cccc(F)c1)[NH+](C)C | CO[C@H]1CCCC[C@H]1NC(=O)CCC(C)(C)NC[C@H](c1cccc(F)c1)[NH+](C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CO[C@H]1CCCC[C@H]1NC(=O)NC[C@H](c1cccc(F)c1)[NH+](C)C less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H]1CCCC[C@H]1Nc1c(C)n(C)n(NC[C@H](c2cccc(F)c2)[NH+](C)C)c1=O | CO[C@H]1CCCC[C@H]1NC(=O)NC[C@H](c1cccc(F)c1)[NH+](C)C | CO[C@H]1CCCC[C@H]1Nc1c(C)n(C)n(NC[C@H](c2cccc(F)c2)[NH+](C)C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)n&n1C",
"old_substring": "C23=O"
} |
Can you make molecule CO[C@H]1CCCC[C@H]1NC(=O)NC[C@H](c1cccc(F)c1)[NH+](C)C less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H]1CCCC[C@H]1Nc1nn(NC[C@H](c2cccc(F)c2)[NH+](C)C)c(C)cc1=O | CO[C@H]1CCCC[C@H]1NC(=O)NC[C@H](c1cccc(F)c1)[NH+](C)C | CO[C@H]1CCCC[C@H]1Nc1nn(NC[C@H](c2cccc(F)c2)[NH+](C)C)c(C)cc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(=O)c&nn1&",
"old_substring": "C23=O"
} |
Can you make molecule CO[C@H]1CCCC[C@H]1NC(=O)NC[C@H](c1cccc(F)c1)[NH+](C)C less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H]1CCCC[C@H]1NC(=O)C[C@@H](Br)NC[C@H](c1cccc(F)c1)[NH+](C)C | CO[C@H]1CCCC[C@H]1NC(=O)NC[C@H](c1cccc(F)c1)[NH+](C)C | CO[C@H]1CCCC[C@H]1NC(=O)C[C@@H](Br)NC[C@H](c1cccc(F)c1)[NH+](C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule Cc1nn(C)c(C)c1CN[C@H]1CCC[NH2+]C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)c(C)c1C1=CC=C(N[C@H]2CCC[NH2+]C2)N2CCC2=C1 | Cc1nn(C)c(C)c1CN[C@H]1CCC[NH2+]C1 | Cc1nn(C)c(C)c1C1=CC=C(N[C@H]2CCC[NH2+]C2)N2CCC2=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "C24"
} |
Can you make molecule Cc1nn(C)c(C)c1CN[C@H]1CCC[NH2+]C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc2nc-2cc(-c2c(C)nn(C)c2C)c1N[C@H]1CCC[NH2+]C1 | Cc1nn(C)c(C)c1CN[C@H]1CCC[NH2+]C1 | Cc1noc2nc-2cc(-c2c(C)nn(C)c2C)c1N[C@H]1CCC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1noc2nc&cc&c12",
"old_substring": "C24"
} |
Can you make molecule Cc1nn(C)c(C)c1CN[C@H]1CCC[NH2+]C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)c(C)c1-c1ncnc2sc-2c(C)c1N[C@H]1CCC[NH2+]C1 | Cc1nn(C)c(C)c1CN[C@H]1CCC[NH2+]C1 | Cc1nn(C)c(C)c1-c1ncnc2sc-2c(C)c1N[C@H]1CCC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&sc2ncnc&c12",
"old_substring": "C24"
} |
Can you make molecule Cc1nn(C)c(C)c1CN[C@H]1CCC[NH2+]C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)c(C)c1C1=CC=C2SCCN2C(N[C@H]2CCC[NH2+]C2)=C1 | Cc1nn(C)c(C)c1CN[C@H]1CCC[NH2+]C1 | Cc1nn(C)c(C)c1C1=CC=C2SCCN2C(N[C@H]2CCC[NH2+]C2)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "C24"
} |
Can you make molecule Cc1nn(C)c(C)c1CN[C@H]1CCC[NH2+]C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)c(C)c1-c1c(C)oc2ncnc-2c1N[C@H]1CCC[NH2+]C1 | Cc1nn(C)c(C)c1CN[C@H]1CCC[NH2+]C1 | Cc1nn(C)c(C)c1-c1c(C)oc2ncnc-2c1N[C@H]1CCC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1oc2ncnc&c2c1&",
"old_substring": "C24"
} |
Can you make molecule Cc1cc(=O)[nH]c(SCC(=O)N2C[C@]3(C)C[C@H]2CC(C)(C)C3)n1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(CSc1nc(C)cc(=O)[nH]1)=N/ON1C[C@]2(C)C[C@H]1CC(C)(C)C2 | Cc1cc(=O)[nH]c(SCC(=O)N2C[C@]3(C)C[C@H]2CC(C)(C)C3)n1 | C/C(CSc1nc(C)cc(=O)[nH]1)=N/ON1C[C@]2(C)C[C@H]1CC(C)(C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C5C4=O"
} |
Can you make molecule Cc1cc(=O)[nH]c(SCC(=O)N2C[C@]3(C)C[C@H]2CC(C)(C)C3)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Sc1nc(C)cc(=O)[nH]1)C(=O)CN1C[C@]2(C)C[C@H]1CC(C)(C)C2 | Cc1cc(=O)[nH]c(SCC(=O)N2C[C@]3(C)C[C@H]2CC(C)(C)C3)n1 | CCC(CC)(Sc1nc(C)cc(=O)[nH]1)C(=O)CN1C[C@]2(C)C[C@H]1CC(C)(C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C5C4=O"
} |
Can you make molecule Cc1cc(=O)[nH]c(SCC(=O)N2C[C@]3(C)C[C@H]2CC(C)(C)C3)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)[nH]c(SSSC(=O)N2C[C@]3(C)C[C@H]2CC(C)(C)C3)n1 | Cc1cc(=O)[nH]c(SCC(=O)N2C[C@]3(C)C[C@H]2CC(C)(C)C3)n1 | Cc1cc(=O)[nH]c(SSSC(=O)N2C[C@]3(C)C[C@H]2CC(C)(C)C3)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C5C4=O"
} |
Can you make molecule Cc1cc(=O)[nH]c(SCC(=O)N2C[C@]3(C)C[C@H]2CC(C)(C)C3)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Sc1nc(C)cc(=O)[nH]1)C(=O)CCN1C[C@]2(C)C[C@H]1CC(C)(C)C2 | Cc1cc(=O)[nH]c(SCC(=O)N2C[C@]3(C)C[C@H]2CC(C)(C)C3)n1 | CCC(CC)(Sc1nc(C)cc(=O)[nH]1)C(=O)CCN1C[C@]2(C)C[C@H]1CC(C)(C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C5C4=O"
} |
Can you make molecule Cc1cc(=O)[nH]c(SCC(=O)N2C[C@]3(C)C[C@H]2CC(C)(C)C3)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)Sc1nc(C)cc(=O)[nH]1)C(=O)N1C[C@]2(C)C[C@H]1CC(C)(C)C2 | Cc1cc(=O)[nH]c(SCC(=O)N2C[C@]3(C)C[C@H]2CC(C)(C)C3)n1 | CC[C@H](C(=O)Sc1nc(C)cc(=O)[nH]1)C(=O)N1C[C@]2(C)C[C@H]1CC(C)(C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C5C4=O"
} |
Can you make molecule COC1CC[NH+](Cn2nc(-c3ccc(C)cc3)n(C)c2=S)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC1CC[NH+](Cn2nc(-c3ccc(C)cc3Cl)n(C)c2=S)CC1 | COC1CC[NH+](Cn2nc(-c3ccc(C)cc3)n(C)c2=S)CC1 | COC1CC[NH+](Cn2nc(-c3ccc(C)cc3Cl)n(C)c2=S)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)cc1Cl",
"old_substring": "c16ccc(C)cc1"
} |
Can you make molecule COC1CC[NH+](Cn2nc(-c3ccc(C)cc3)n(C)c2=S)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC1CC[NH+](Cn2nc(-c3ccc(Cl)cc3I)n(C)c2=S)CC1 | COC1CC[NH+](Cn2nc(-c3ccc(C)cc3)n(C)c2=S)CC1 | COC1CC[NH+](Cn2nc(-c3ccc(Cl)cc3I)n(C)c2=S)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c16ccc(C)cc1"
} |
Can you make molecule COC1CC[NH+](Cn2nc(-c3ccc(C)cc3)n(C)c2=S)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC1CC[NH+](Cn2nc(-c3ccc(Cl)cc3Br)n(C)c2=S)CC1 | COC1CC[NH+](Cn2nc(-c3ccc(C)cc3)n(C)c2=S)CC1 | COC1CC[NH+](Cn2nc(-c3ccc(Cl)cc3Br)n(C)c2=S)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c16ccc(C)cc1"
} |
Can you make molecule COC1CC[NH+](Cn2nc(-c3ccc(C)cc3)n(C)c2=S)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC1CC[NH+](Cn2nc(-c3cc(C)c(I)cc3C)n(C)c2=S)CC1 | COC1CC[NH+](Cn2nc(-c3ccc(C)cc3)n(C)c2=S)CC1 | COC1CC[NH+](Cn2nc(-c3cc(C)c(I)cc3C)n(C)c2=S)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1I",
"old_substring": "c16ccc(C)cc1"
} |
Can you make molecule COC1CC[NH+](Cn2nc(-c3ccc(C)cc3)n(C)c2=S)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC1CC[NH+](Cn2nc(-c3ccc(Cl)c(I)c3)n(C)c2=S)CC1 | COC1CC[NH+](Cn2nc(-c3ccc(C)cc3)n(C)c2=S)CC1 | COC1CC[NH+](Cn2nc(-c3ccc(Cl)c(I)c3)n(C)c2=S)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c16ccc(C)cc1"
} |
Can you make molecule C[NH2+][C@]1(C(=O)[O-])CCC[C@@H](OCC2CCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC([C@]2(C(=O)[O-])CCC[C@@H](OCC3CCCCC3)C2)CC1 | C[NH2+][C@]1(C(=O)[O-])CCC[C@@H](OCC2CCCCC2)C1 | C[NH+]1CCC([C@]2(C(=O)[O-])CCC[C@@H](OCC3CCCCC3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&CC1",
"old_substring": "C[NH2+]5"
} |
Can you make molecule C[NH2+][C@]1(C(=O)[O-])CCC[C@@H](OCC2CCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=CCC[NH+]([C@]2(C(=O)[O-])CCC[C@@H](OCC3CCCCC3)C2)C1 | C[NH2+][C@]1(C(=O)[O-])CCC[C@@H](OCC2CCCCC2)C1 | CC1=CCC[NH+]([C@]2(C(=O)[O-])CCC[C@@H](OCC3CCCCC3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C1=CCC[NH+]&C1",
"old_substring": "C[NH2+]5"
} |
Can you make molecule C[NH2+][C@]1(C(=O)[O-])CCC[C@@H](OCC2CCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC[NH+]([C@]2(C(=O)[O-])CCC[C@@H](OCC3CCCCC3)C2)CC1 | C[NH2+][C@]1(C(=O)[O-])CCC[C@@H](OCC2CCCCC2)C1 | CC1CC[NH+]([C@]2(C(=O)[O-])CCC[C@@H](OCC3CCCCC3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CC[NH+]&CC1",
"old_substring": "C[NH2+]5"
} |
Can you make molecule C[NH2+][C@]1(C(=O)[O-])CCC[C@@H](OCC2CCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(C)([C@]2(C(=O)[O-])CCC[C@@H](OCC3CCCCC3)C2)CC1 | C[NH2+][C@]1(C(=O)[O-])CCC[C@@H](OCC2CCCCC2)C1 | C[NH+]1CCC(C)([C@]2(C(=O)[O-])CCC[C@@H](OCC3CCCCC3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&(C)CC1",
"old_substring": "C[NH2+]5"
} |
Can you make molecule C[NH2+][C@]1(C(=O)[O-])CCC[C@@H](OCC2CCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CC[C@@H]([C@]2(C(=O)[O-])CCC[C@@H](OCC3CCCCC3)C2)C1 | C[NH2+][C@]1(C(=O)[O-])CCC[C@@H](OCC2CCCCC2)C1 | C[NH+]1CC[C@@H]([C@]2(C(=O)[O-])CCC[C@@H](OCC3CCCCC3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CC[C@@H]&C1",
"old_substring": "C[NH2+]5"
} |
Can you make molecule Cc1nnc(SCC(=O)c2cc(C)n(CC(F)(F)F)c2C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Sc1nnc(C)s1)C(=O)Cc1cc(C)n(CC(F)(F)F)c1C | Cc1nnc(SCC(=O)c2cc(C)n(CC(F)(F)F)c2C)s1 | CCC(CC)(Sc1nnc(C)s1)C(=O)Cc1cc(C)n(CC(F)(F)F)c1C | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C3C4=O"
} |
Can you make molecule Cc1nnc(SCC(=O)c2cc(C)n(CC(F)(F)F)c2C)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(SSSC(=O)c2cc(C)n(CC(F)(F)F)c2C)s1 | Cc1nnc(SCC(=O)c2cc(C)n(CC(F)(F)F)c2C)s1 | Cc1nnc(SSSC(=O)c2cc(C)n(CC(F)(F)F)c2C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C3C4=O"
} |
Can you make molecule Cc1nnc(SCC(=O)c2cc(C)n(CC(F)(F)F)c2C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Sc1nnc(C)s1)C(=O)CCc1cc(C)n(CC(F)(F)F)c1C | Cc1nnc(SCC(=O)c2cc(C)n(CC(F)(F)F)c2C)s1 | CCC(CC)(Sc1nnc(C)s1)C(=O)CCc1cc(C)n(CC(F)(F)F)c1C | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C3C4=O"
} |
Can you make molecule Cc1nnc(SCC(=O)c2cc(C)n(CC(F)(F)F)c2C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)Sc1nnc(C)s1)C(=O)c1cc(C)n(CC(F)(F)F)c1C | Cc1nnc(SCC(=O)c2cc(C)n(CC(F)(F)F)c2C)s1 | CC[C@H](C(=O)Sc1nnc(C)s1)C(=O)c1cc(C)n(CC(F)(F)F)c1C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C3C4=O"
} |
Can you make molecule Cc1nnc(SCC(=O)c2cc(C)n(CC(F)(F)F)c2C)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(SC(=O)C[C@H](C)C(=O)c2cc(C)n(CC(F)(F)F)c2C)s1 | Cc1nnc(SCC(=O)c2cc(C)n(CC(F)(F)F)c2C)s1 | Cc1nnc(SC(=O)C[C@H](C)C(=O)c2cc(C)n(CC(F)(F)F)c2C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&=O)C&=O",
"old_substring": "C3C4=O"
} |
Can you make molecule CC(C)CN(CCC#N)C(=O)NC[C@@H]1CC[C@H](C(=O)[O-])O1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC1=C2CCN2CC(C(=O)NC[C@@H]2CC[C@H](C(=O)[O-])O2)=NC(CCC#N)=N1 | CC(C)CN(CCC#N)C(=O)NC[C@@H]1CC[C@H](C(=O)[O-])O1 | CC(C)CC1=C2CCN2CC(C(=O)NC[C@@H]2CC[C@H](C(=O)[O-])O2)=NC(CCC#N)=N1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c&nc&nc2C1",
"old_substring": "N245"
} |
Can you make molecule CC(C)CN(CCC#N)C(=O)NC[C@@H]1CC[C@H](C(=O)[O-])O1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC1=C2OCCN2CC(C(=O)NC[C@@H]2CC[C@H](C(=O)[O-])O2)=CC(CCC#N)=C1 | CC(C)CN(CCC#N)C(=O)NC[C@@H]1CC[C@H](C(=O)[O-])O1 | CC(C)CC1=C2OCCN2CC(C(=O)NC[C@@H]2CC[C@H](C(=O)[O-])O2)=CC(CCC#N)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2c&cc&cc2C1",
"old_substring": "N245"
} |
Can you make molecule CC(C)CN(CCC#N)C(=O)NC[C@@H]1CC[C@H](C(=O)[O-])O1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC1(CCC#N)CCN(C(=O)NC[C@@H]2CC[C@H](C(=O)[O-])O2)C1 | CC(C)CN(CCC#N)C(=O)NC[C@@H]1CC[C@H](C(=O)[O-])O1 | CC(C)CC1(CCC#N)CCN(C(=O)NC[C@@H]2CC[C@H](C(=O)[O-])O2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N245"
} |
Can you make molecule CC(C)CN(CCC#N)C(=O)NC[C@@H]1CC[C@H](C(=O)[O-])O1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC1(CCC#N)CCCN(C(=O)NC[C@@H]2CC[C@H](C(=O)[O-])O2)C1 | CC(C)CN(CCC#N)C(=O)NC[C@@H]1CC[C@H](C(=O)[O-])O1 | CC(C)CC1(CCC#N)CCCN(C(=O)NC[C@@H]2CC[C@H](C(=O)[O-])O2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N245"
} |
Can you make molecule CC(C)CN(CCC#N)C(=O)NC[C@@H]1CC[C@H](C(=O)[O-])O1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Cc1oc(C(=O)NC[C@@H]2CC[C@H](C(=O)[O-])O2)c(C#N)c1CCC#N | CC(C)CN(CCC#N)C(=O)NC[C@@H]1CC[C@H](C(=O)[O-])O1 | CC(C)Cc1oc(C(=O)NC[C@@H]2CC[C@H](C(=O)[O-])O2)c(C#N)c1CCC#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N245"
} |
Can you make molecule Cc1cc(CN2CCN3C(=O)NC[C@@H]3C2)cc(C)c1OC(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CN2CCN3C(=O)NC[C@@H]3C2)cc(C)c1OC(F)(F)Cl | Cc1cc(CN2CCN3C(=O)NC[C@@H]3C2)cc(C)c1OC(F)F | Cc1cc(CN2CCN3C(=O)NC[C@@H]3C2)cc(C)c1OC(F)(F)Cl | 102 | {
"fragment_index": 0,
"new_substring": "O&C(F)(F)Cl",
"old_substring": "O4C(F)F"
} |
Can you make molecule Cc1cc(CN2CCN3C(=O)NC[C@@H]3C2)cc(C)c1OC(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CN2CCN3C(=O)NC[C@@H]3C2)cc(C)c1C(F)(F)F | Cc1cc(CN2CCN3C(=O)NC[C@@H]3C2)cc(C)c1OC(F)F | Cc1cc(CN2CCN3C(=O)NC[C@@H]3C2)cc(C)c1C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "FC&(F)F",
"old_substring": "O4C(F)F"
} |
Can you make molecule Cc1cc(CN2CCN3C(=O)NC[C@@H]3C2)cc(C)c1OC(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CN2CCN3C(=O)NC[C@@H]3C2)cc(C)c1SC(F)F | Cc1cc(CN2CCN3C(=O)NC[C@@H]3C2)cc(C)c1OC(F)F | Cc1cc(CN2CCN3C(=O)NC[C@@H]3C2)cc(C)c1SC(F)F | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)F",
"old_substring": "O4C(F)F"
} |
Can you make molecule Cc1cc(CN2CCN3C(=O)NC[C@@H]3C2)cc(C)c1OC(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CN2CCN3C(=O)NC[C@@H]3C2)cc(C)c1[C@@H](O)CC(F)(F)F | Cc1cc(CN2CCN3C(=O)NC[C@@H]3C2)cc(C)c1OC(F)F | Cc1cc(CN2CCN3C(=O)NC[C@@H]3C2)cc(C)c1[C@@H](O)CC(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "O[C@H]&CC(F)(F)F",
"old_substring": "O4C(F)F"
} |
Can you make molecule Cc1cc(CN2CCN3C(=O)NC[C@@H]3C2)cc(C)c1OC(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CN2CCN3C(=O)NC[C@@H]3C2)cc(C)c1-c1c(F)cc(C=O)cc1F | Cc1cc(CN2CCN3C(=O)NC[C@@H]3C2)cc(C)c1OC(F)F | Cc1cc(CN2CCN3C(=O)NC[C@@H]3C2)cc(C)c1-c1c(F)cc(C=O)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1cc(F)c&c(F)c1",
"old_substring": "O4C(F)F"
} |
Can you make molecule CCNC(=O)c1cccc(NC(=O)NCCCSC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)c1cccc(NC(=O)CC(C)(C)NCCCSC)c1 | CCNC(=O)c1cccc(NC(=O)NCCCSC)c1 | CCNC(=O)c1cccc(NC(=O)CC(C)(C)NCCCSC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCNC(=O)c1cccc(NC(=O)NCCCSC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)c1cccc(NC(=O)CCC(C)(C)NCCCSC)c1 | CCNC(=O)c1cccc(NC(=O)NCCCSC)c1 | CCNC(=O)c1cccc(NC(=O)CCC(C)(C)NCCCSC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCNC(=O)c1cccc(NC(=O)NCCCSC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)c1cccc(NC(=O)C[C@@H](Br)NCCCSC)c1 | CCNC(=O)c1cccc(NC(=O)NCCCSC)c1 | CCNC(=O)c1cccc(NC(=O)C[C@@H](Br)NCCCSC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule CCNC(=O)c1cccc(NC(=O)NCCCSC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)c1cccc(Nc2cc(C)n(NCCCSC)c(=O)c2)c1 | CCNC(=O)c1cccc(NC(=O)NCCCSC)c1 | CCNC(=O)c1cccc(Nc2cc(C)n(NCCCSC)c(=O)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule CCNC(=O)c1cccc(NC(=O)NCCCSC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)c1cccc(Nc2c(C)n(NCCCSC)ccc2=O)c1 | CCNC(=O)c1cccc(NC(=O)NCCCSC)c1 | CCNC(=O)c1cccc(Nc2c(C)n(NCCCSC)ccc2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule Cn1c(-c2cccc3ccccc23)nn(CN2CCOCC2)c1=S less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(-c2cccc3ccccc23)nc2sc(CN3CCOCC3)cc2c1=O | Cn1c(-c2cccc3ccccc23)nn(CN2CCOCC2)c1=S | Cn1c(-c2cccc3ccccc23)nc2sc(CN3CCOCC3)cc2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cn1c&nc2sc&cc2c1=O",
"old_substring": "Cn1c5nn4c1=S"
} |
Can you make molecule Cn1c(-c2cccc3ccccc23)nn(CN2CCOCC2)c1=S less soluble in water? The output molecule should be similar to the input molecule. | S=c1n(CN2CCOCC2)ccn1-c1cccc2ccccc12 | Cn1c(-c2cccc3ccccc23)nn(CN2CCOCC2)c1=S | S=c1n(CN2CCOCC2)ccn1-c1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccn&c1=S",
"old_substring": "Cn1c5nn4c1=S"
} |
Can you make molecule Cn1c(-c2cccc3ccccc23)nn(CN2CCOCC2)c1=S less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(CN2CCOCC2)cn(-c2cccc3ccccc23)c1=S | Cn1c(-c2cccc3ccccc23)nn(CN2CCOCC2)c1=S | Cn1c(CN2CCOCC2)cn(-c2cccc3ccccc23)c1=S | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc&n(C)c1=S",
"old_substring": "Cn1c5nn4c1=S"
} |
Can you make molecule Cn1c(-c2cccc3ccccc23)nn(CN2CCOCC2)c1=S less soluble in water? The output molecule should be similar to the input molecule. | S=c1n(-c2cccc3ccccc23)nc2ccc(CN3CCOCC3)cn12 | Cn1c(-c2cccc3ccccc23)nn(CN2CCOCC2)c1=S | S=c1n(-c2cccc3ccccc23)nc2ccc(CN3CCOCC3)cn12 | 102 | {
"fragment_index": 0,
"new_substring": "n1&nc2ccc&cn2c1=S",
"old_substring": "Cn1c5nn4c1=S"
} |
Can you make molecule Cn1c(-c2cccc3ccccc23)nn(CN2CCOCC2)c1=S less soluble in water? The output molecule should be similar to the input molecule. | S=c1sc(-c2cccc3ccccc23)nn1CN1CCOCC1 | Cn1c(-c2cccc3ccccc23)nn(CN2CCOCC2)c1=S | S=c1sc(-c2cccc3ccccc23)nn1CN1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn&c(=S)s1",
"old_substring": "Cn1c5nn4c1=S"
} |
Can you make molecule CCCCCN1C(=O)C(=Cc2ccc(O)c(OCC)c2)SC1=S less soluble in water? The output molecule should be similar to the input molecule. | CCCCCN1C(=O)C(=Cc2ccc(O)c(SC(=S)OCC)c2)SC1=S | CCCCCN1C(=O)C(=Cc2ccc(O)c(OCC)c2)SC1=S | CCCCCN1C(=O)C(=Cc2ccc(O)c(SC(=S)OCC)c2)SC1=S | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O34"
} |
Can you make molecule CCCCCN1C(=O)C(=Cc2ccc(O)c(OCC)c2)SC1=S less soluble in water? The output molecule should be similar to the input molecule. | CCCCCN1C(=O)C(=Cc2ccc(O)c(CC(=N)OCC)c2)SC1=S | CCCCCN1C(=O)C(=Cc2ccc(O)c(OCC)c2)SC1=S | CCCCCN1C(=O)C(=Cc2ccc(O)c(CC(=N)OCC)c2)SC1=S | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O34"
} |
Can you make molecule CCCCCN1C(=O)C(=Cc2ccc(O)c(OCC)c2)SC1=S less soluble in water? The output molecule should be similar to the input molecule. | CCCCCN1C(=O)C(=Cc2ccc(O)c(C(=O)CCC(=O)CC)c2)SC1=S | CCCCCN1C(=O)C(=Cc2ccc(O)c(OCC)c2)SC1=S | CCCCCN1C(=O)C(=Cc2ccc(O)c(C(=O)CCC(=O)CC)c2)SC1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O34"
} |
Can you make molecule CCCCCN1C(=O)C(=Cc2ccc(O)c(OCC)c2)SC1=S less soluble in water? The output molecule should be similar to the input molecule. | CCCCCN1C(=O)C(=Cc2ccc(O)c(CC[C@@H](O)CC)c2)SC1=S | CCCCCN1C(=O)C(=Cc2ccc(O)c(OCC)c2)SC1=S | CCCCCN1C(=O)C(=Cc2ccc(O)c(CC[C@@H](O)CC)c2)SC1=S | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O34"
} |
Can you make molecule CCCCCN1C(=O)C(=Cc2ccc(O)c(OCC)c2)SC1=S less soluble in water? The output molecule should be similar to the input molecule. | CCCCCN1C(=O)C(=Cc2ccc(O)c(S/C=C/C(=O)CC)c2)SC1=S | CCCCCN1C(=O)C(=Cc2ccc(O)c(OCC)c2)SC1=S | CCCCCN1C(=O)C(=Cc2ccc(O)c(S/C=C/C(=O)CC)c2)SC1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O34"
} |
Can you make molecule N#CCCN(Cc1ccccc1)C(=S)NC(=O)c1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(N(Cc2ccccc2)C(=S)NC(=O)c2cccc(Cl)c2)CCCCC1 | N#CCCN(Cc1ccccc1)C(=S)NC(=O)c1cccc(Cl)c1 | N#CC1(N(Cc2ccccc2)C(=S)NC(=O)c2cccc(Cl)c2)CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC1&CCCCC1",
"old_substring": "N#CCC3"
} |
Can you make molecule N#CCCN(Cc1ccccc1)C(=S)NC(=O)c1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1=C(NN(Cc2ccccc2)C(=S)NC(=O)c2cccc(Cl)c2)CCC1 | N#CCCN(Cc1ccccc1)C(=S)NC(=O)c1cccc(Cl)c1 | N#CC1=C(NN(Cc2ccccc2)C(=S)NC(=O)c2cccc(Cl)c2)CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC1=C(N&)CCC1",
"old_substring": "N#CCC3"
} |
Can you make molecule N#CCCN(Cc1ccccc1)C(=S)NC(=O)c1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC12CC(=CC=CC=C(C(=O)c3cccc(Cl)c3)C1)NC(=S)N2Cc1ccccc1 | N#CCCN(Cc1ccccc1)C(=S)NC(=O)c1cccc(Cl)c1 | N#CC12CC(=CC=CC=C(C(=O)c3cccc(Cl)c3)C1)NC(=S)N2Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC1&Cc2ccccc2C1",
"old_substring": "N#CCC3"
} |
Can you make molecule N#CCCN(Cc1ccccc1)C(=S)NC(=O)c1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCC[C@H](C#N)CN(Cc1ccccc1)C(=S)NC(=O)c1cccc(Cl)c1 | N#CCCN(Cc1ccccc1)C(=S)NC(=O)c1cccc(Cl)c1 | N#CCC[C@H](C#N)CN(Cc1ccccc1)C(=S)NC(=O)c1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CCC[C@H](C#N)C&",
"old_substring": "N#CCC3"
} |
Can you make molecule N#CCCN(Cc1ccccc1)C(=S)NC(=O)c1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCC[C@@H](C#N)CN(Cc1ccccc1)C(=S)NC(=O)c1cccc(Cl)c1 | N#CCCN(Cc1ccccc1)C(=S)NC(=O)c1cccc(Cl)c1 | N#CCC[C@@H](C#N)CN(Cc1ccccc1)C(=S)NC(=O)c1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CCC[C@@H](C#N)C&",
"old_substring": "N#CCC3"
} |
Can you make molecule CCCS(=O)(=O)c1ccccc1C(=O)Nc1nnc(CC)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCS(=O)(=O)c1ccccc1C(=O)N1Cc2nc(-c3nnc(CC)s3)sc2C1 | CCCS(=O)(=O)c1ccccc1C(=O)Nc1nnc(CC)s1 | CCCS(=O)(=O)c1ccccc1C(=O)N1Cc2nc(-c3nnc(CC)s3)sc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N23"
} |
Can you make molecule CCCS(=O)(=O)c1ccccc1C(=O)Nc1nnc(CC)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCS(=O)(=O)c1ccccc1C(=O)N1CCc2cc(-c3nnc(CC)s3)ccc21 | CCCS(=O)(=O)c1ccccc1C(=O)Nc1nnc(CC)s1 | CCCS(=O)(=O)c1ccccc1C(=O)N1CCc2cc(-c3nnc(CC)s3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N23"
} |
Can you make molecule CCCS(=O)(=O)c1ccccc1C(=O)Nc1nnc(CC)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCS(=O)(=O)c1ccccc1C(=O)c1sc2nsc(-c3nnc(CC)s3)c2c1N | CCCS(=O)(=O)c1ccccc1C(=O)Nc1nnc(CC)s1 | CCCS(=O)(=O)c1ccccc1C(=O)c1sc2nsc(-c3nnc(CC)s3)c2c1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&sc2nsc&c12",
"old_substring": "N23"
} |
Can you make molecule CCCS(=O)(=O)c1ccccc1C(=O)Nc1nnc(CC)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCS(=O)(=O)c1ccccc1C(=O)N1CCSc2ccc(-c3nnc(CC)s3)cc21 | CCCS(=O)(=O)c1ccccc1C(=O)Nc1nnc(CC)s1 | CCCS(=O)(=O)c1ccccc1C(=O)N1CCSc2ccc(-c3nnc(CC)s3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "N23"
} |
Can you make molecule CCCS(=O)(=O)c1ccccc1C(=O)Nc1nnc(CC)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCS(=O)(=O)c1ccccc1C(=O)N1CCCn2nc(-c3nnc(CC)s3)cc2C1 | CCCS(=O)(=O)c1ccccc1C(=O)Nc1nnc(CC)s1 | CCCS(=O)(=O)c1ccccc1C(=O)N1CCCn2nc(-c3nnc(CC)s3)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc2C1",
"old_substring": "N23"
} |
Can you make molecule CNC(=O)[C@H](C)CN(C)Cc1cc(=O)n2cccc(C)c2[nH+]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccn2c(=O)cc(CN(C)C[C@@H](C)C(=O)CN=C=S)[nH+]c12 | CNC(=O)[C@H](C)CN(C)Cc1cc(=O)n2cccc(C)c2[nH+]1 | Cc1cccn2c(=O)cc(CN(C)C[C@@H](C)C(=O)CN=C=S)[nH+]c12 | 102 | {
"fragment_index": 0,
"new_substring": "C&N=C=S",
"old_substring": "CN3"
} |
Can you make molecule CNC(=O)[C@H](C)CN(C)Cc1cc(=O)n2cccc(C)c2[nH+]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccn2c(=O)cc(CN(C)C[C@@H](C)C(=O)C3N=N3)[nH+]c12 | CNC(=O)[C@H](C)CN(C)Cc1cc(=O)n2cccc(C)c2[nH+]1 | Cc1cccn2c(=O)cc(CN(C)C[C@@H](C)C(=O)C3N=N3)[nH+]c12 | 102 | {
"fragment_index": 0,
"new_substring": "C1&N=N1",
"old_substring": "CN3"
} |
Can you make molecule CNC(=O)[C@H](C)CN(C)Cc1cc(=O)n2cccc(C)c2[nH+]1 less soluble in water? The output molecule should be similar to the input molecule. | C/C=N/OC(=O)[C@H](C)CN(C)Cc1cc(=O)n2cccc(C)c2[nH+]1 | CNC(=O)[C@H](C)CN(C)Cc1cc(=O)n2cccc(C)c2[nH+]1 | C/C=N/OC(=O)[C@H](C)CN(C)Cc1cc(=O)n2cccc(C)c2[nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C=N/O&",
"old_substring": "CN3"
} |
Can you make molecule CNC(=O)[C@H](C)CN(C)Cc1cc(=O)n2cccc(C)c2[nH+]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccn2c(=O)cc(CN(C)C[C@@H](C)C(=O)CCCN=C=S)[nH+]c12 | CNC(=O)[C@H](C)CN(C)Cc1cc(=O)n2cccc(C)c2[nH+]1 | Cc1cccn2c(=O)cc(CN(C)C[C@@H](C)C(=O)CCCN=C=S)[nH+]c12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCN=C=S",
"old_substring": "CN3"
} |
Can you make molecule CNC(=O)[C@H](C)CN(C)Cc1cc(=O)n2cccc(C)c2[nH+]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccn2c(=O)cc(CN(C)C[C@@H](C)C(=O)CN3CCSCC3)[nH+]c12 | CNC(=O)[C@H](C)CN(C)Cc1cc(=O)n2cccc(C)c2[nH+]1 | Cc1cccn2c(=O)cc(CN(C)C[C@@H](C)C(=O)CN3CCSCC3)[nH+]c12 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCSCC1",
"old_substring": "CN3"
} |
Can you make molecule COCCNC(=O)C(C#N)=Cc1cccc(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSCCNC(=O)C(C#N)=Cc1cccc(O)c1 | COCCNC(=O)C(C#N)=Cc1cccc(O)c1 | COCSCCNC(=O)C(C#N)=Cc1cccc(O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COCCNC(=O)C(C#N)=Cc1cccc(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SCCNC(=O)C(C#N)=Cc1cccc(O)c1 | COCCNC(=O)C(C#N)=Cc1cccc(O)c1 | CC(=O)SCCNC(=O)C(C#N)=Cc1cccc(O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COCCNC(=O)C(C#N)=Cc1cccc(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC(=Cc1cccc(O)c1)C(=O)NCCC(=O)CI | COCCNC(=O)C(C#N)=Cc1cccc(O)c1 | N#CC(=Cc1cccc(O)c1)C(=O)NCCC(=O)CI | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule COCCNC(=O)C(C#N)=Cc1cccc(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC(=Cc1cccc(O)c1)C(=O)NCCC1OCCCO1 | COCCNC(=O)C(C#N)=Cc1cccc(O)c1 | N#CC(=Cc1cccc(O)c1)C(=O)NCCC1OCCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCCCO1",
"old_substring": "CO3"
} |
Can you make molecule COCCNC(=O)C(C#N)=Cc1cccc(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC(=Cc1cccc(O)c1)C(=O)NCCC(=O)CCl | COCCNC(=O)C(C#N)=Cc1cccc(O)c1 | N#CC(=Cc1cccc(O)c1)C(=O)NCCC(=O)CCl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCl",
"old_substring": "CO3"
} |
Can you make molecule CNC(=O)CN1c2ccccc2C(=O)N(C)[C@H]1c1ccccc1O less soluble in water? The output molecule should be similar to the input molecule. | CNSC(=O)CN1c2ccccc2C(=O)N(C)[C@H]1c1ccccc1O | CNC(=O)CN1c2ccccc2C(=O)N(C)[C@H]1c1ccccc1O | CNSC(=O)CN1c2ccccc2C(=O)N(C)[C@H]1c1ccccc1O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C4"
} |
Can you make molecule CNC(=O)CN1c2ccccc2C(=O)N(C)[C@H]1c1ccccc1O less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CCCC(=O)N1c2ccccc2C(=O)N(C)[C@H]1c1ccccc1O | CNC(=O)CN1c2ccccc2C(=O)N(C)[C@H]1c1ccccc1O | CNC(=O)CCCC(=O)N1c2ccccc2C(=O)N(C)[C@H]1c1ccccc1O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C4"
} |
Can you make molecule CNC(=O)CN1c2ccccc2C(=O)N(C)[C@H]1c1ccccc1O less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CC(C)(C)N1c2ccccc2C(=O)N(C)[C@H]1c1ccccc1O | CNC(=O)CN1c2ccccc2C(=O)N(C)[C@H]1c1ccccc1O | CNC(=O)CC(C)(C)N1c2ccccc2C(=O)N(C)[C@H]1c1ccccc1O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C4"
} |
Can you make molecule CNC(=O)CN1c2ccccc2C(=O)N(C)[C@H]1c1ccccc1O less soluble in water? The output molecule should be similar to the input molecule. | CNC[S@+]([O-])CCCN1c2ccccc2C(=O)N(C)[C@H]1c1ccccc1O | CNC(=O)CN1c2ccccc2C(=O)N(C)[C@H]1c1ccccc1O | CNC[S@+]([O-])CCCN1c2ccccc2C(=O)N(C)[C@H]1c1ccccc1O | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C4"
} |
Can you make molecule CNC(=O)CN1c2ccccc2C(=O)N(C)[C@H]1c1ccccc1O less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CCC(C)(C)N1c2ccccc2C(=O)N(C)[C@H]1c1ccccc1O | CNC(=O)CN1c2ccccc2C(=O)N(C)[C@H]1c1ccccc1O | CNC(=O)CCC(C)(C)N1c2ccccc2C(=O)N(C)[C@H]1c1ccccc1O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C4"
} |
Can you make molecule CC(=O)N[C@H](C)C(=O)Nc1ccc(Sc2nncs2)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@H](C)C(C)(C)CNc1ccc(Sc2nncs2)c(Cl)c1 | CC(=O)N[C@H](C)C(=O)Nc1ccc(Sc2nncs2)c(Cl)c1 | CC(=O)N[C@H](C)C(C)(C)CNc1ccc(Sc2nncs2)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "[C@@H]5(C)C4=O"
} |
Can you make molecule CC(=O)N[C@H](C)C(=O)Nc1ccc(Sc2nncs2)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@H](CCl)CCCNc1ccc(Sc2nncs2)c(Cl)c1 | CC(=O)N[C@H](C)C(=O)Nc1ccc(Sc2nncs2)c(Cl)c1 | CC(=O)N[C@H](CCl)CCCNc1ccc(Sc2nncs2)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]5(C)C4=O"
} |
Can you make molecule CC(=O)N[C@H](C)C(=O)Nc1ccc(Sc2nncs2)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@@H]1C=C(CNc2ccc(Sc3nncs3)c(Cl)c2)N=N1 | CC(=O)N[C@H](C)C(=O)Nc1ccc(Sc2nncs2)c(Cl)c1 | CC(=O)N[C@@H]1C=C(CNc2ccc(Sc3nncs3)c(Cl)c2)N=N1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=C(C&)N=N1",
"old_substring": "[C@@H]5(C)C4=O"
} |
Can you make molecule CC(=O)N[C@H](C)C(=O)Nc1ccc(Sc2nncs2)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@]1(C)CCCN(Nc2ccc(Sc3nncs3)c(Cl)c2)C1 | CC(=O)N[C@H](C)C(=O)Nc1ccc(Sc2nncs2)c(Cl)c1 | CC(=O)N[C@]1(C)CCCN(Nc2ccc(Sc3nncs3)c(Cl)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@]1&(C)CCCN&C1",
"old_substring": "[C@@H]5(C)C4=O"
} |
Can you make molecule CC(=O)N[C@H](C)C(=O)Nc1ccc(Sc2nncs2)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@@H](CBr)CCNc1ccc(Sc2nncs2)c(Cl)c1 | CC(=O)N[C@H](C)C(=O)Nc1ccc(Sc2nncs2)c(Cl)c1 | CC(=O)N[C@@H](CBr)CCNc1ccc(Sc2nncs2)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@@H]5(C)C4=O"
} |
Can you make molecule CC[n+]1c(N)n(CCOc2ccc(Cl)cc2Cl)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC[n+]1c(N)n(CCCCOc2ccc(Cl)cc2Cl)c2ccccc21 | CC[n+]1c(N)n(CCOc2ccc(Cl)cc2Cl)c2ccccc21 | CC[n+]1c(N)n(CCCCOc2ccc(Cl)cc2Cl)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C5C3"
} |
Can you make molecule CC[n+]1c(N)n(CCOc2ccc(Cl)cc2Cl)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC[n+]1c(N)n(CCCCCOc2ccc(Cl)cc2Cl)c2ccccc21 | CC[n+]1c(N)n(CCOc2ccc(Cl)cc2Cl)c2ccccc21 | CC[n+]1c(N)n(CCCCCOc2ccc(Cl)cc2Cl)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C5C3"
} |
Can you make molecule CC[n+]1c(N)n(CCOc2ccc(Cl)cc2Cl)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC[n+]1c(N)n(C2CC(Oc3ccc(Cl)cc3Cl)C2)c2ccccc21 | CC[n+]1c(N)n(CCOc2ccc(Cl)cc2Cl)c2ccccc21 | CC[n+]1c(N)n(C2CC(Oc3ccc(Cl)cc3Cl)C2)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C5C3"
} |
Can you make molecule CC[n+]1c(N)n(CCOc2ccc(Cl)cc2Cl)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC[n+]1c(N)n(C2CCN(Oc3ccc(Cl)cc3Cl)CC2)c2ccccc21 | CC[n+]1c(N)n(CCOc2ccc(Cl)cc2Cl)c2ccccc21 | CC[n+]1c(N)n(C2CCN(Oc3ccc(Cl)cc3Cl)CC2)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "C5C3"
} |
Can you make molecule CC[n+]1c(N)n(CCOc2ccc(Cl)cc2Cl)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC[n+]1c(N)n([C@@H](C)CCOc2ccc(Cl)cc2Cl)c2ccccc21 | CC[n+]1c(N)n(CCOc2ccc(Cl)cc2Cl)c2ccccc21 | CC[n+]1c(N)n([C@@H](C)CCOc2ccc(Cl)cc2Cl)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C5C3"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.