prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule O=S(=O)(NC[C@H](O)c1ccc(C(F)(F)F)cc1)c1cc(F)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(NC[C@H](O)c1ccc(SC(F)(F)F)cc1)c1cc(F)ccc1F | O=S(=O)(NC[C@H](O)c1ccc(C(F)(F)F)cc1)c1cc(F)ccc1F | O=S(=O)(NC[C@H](O)c1ccc(SC(F)(F)F)cc1)c1cc(F)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C5(F)(F)F"
} |
Can you make molecule O=S(=O)(NC[C@H](O)c1ccc(C(F)(F)F)cc1)c1cc(F)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(NC[C@H](O)c1ccc(CCCC(F)(F)F)cc1)c1cc(F)ccc1F | O=S(=O)(NC[C@H](O)c1ccc(C(F)(F)F)cc1)c1cc(F)ccc1F | O=S(=O)(NC[C@H](O)c1ccc(CCCC(F)(F)F)cc1)c1cc(F)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C5(F)(F)F"
} |
Can you make molecule O=S(=O)(NC[C@H](O)c1ccc(C(F)(F)F)cc1)c1cc(F)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(NC[C@H](O)c1ccc(CCCCC(F)(F)F)cc1)c1cc(F)ccc1F | O=S(=O)(NC[C@H](O)c1ccc(C(F)(F)F)cc1)c1cc(F)ccc1F | O=S(=O)(NC[C@H](O)c1ccc(CCCCC(F)(F)F)cc1)c1cc(F)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C5(F)(F)F"
} |
Can you make molecule O=S(=O)(NC[C@H](O)c1ccc(C(F)(F)F)cc1)c1cc(F)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(NC[C@H](O)c1ccc(C(F)(F)C(F)(F)F)cc1)c1cc(F)ccc1F | O=S(=O)(NC[C@H](O)c1ccc(C(F)(F)F)cc1)c1cc(F)ccc1F | O=S(=O)(NC[C@H](O)c1ccc(C(F)(F)C(F)(F)F)cc1)c1cc(F)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C5(F)(F)F"
} |
Can you make molecule O=S(=O)(NC[C@H](O)c1ccc(C(F)(F)F)cc1)c1cc(F)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(NC[C@H](O)c1ccc(CC(F)(F)C(F)(F)F)cc1)c1cc(F)ccc1F | O=S(=O)(NC[C@H](O)c1ccc(C(F)(F)F)cc1)c1cc(F)ccc1F | O=S(=O)(NC[C@H](O)c1ccc(CC(F)(F)C(F)(F)F)cc1)c1cc(F)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C5(F)(F)F"
} |
Can you make molecule O=C(CSc1ccc2c(c1)OCCCO2)NC(=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1ccc2c(c1)OCCCO2)NSC(=O)Cc1cccs1 | O=C(CSc1ccc2c(c1)OCCCO2)NC(=O)c1cccs1 | O=C(CSc1ccc2c(c1)OCCCO2)NSC(=O)Cc1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule O=C(CSc1ccc2c(c1)OCCCO2)NC(=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCC(=O)c1cccs1)NC(=O)CSc1ccc2c(c1)OCCCO2 | O=C(CSc1ccc2c(c1)OCCCO2)NC(=O)c1cccs1 | O=C(CCCC(=O)c1cccs1)NC(=O)CSc1ccc2c(c1)OCCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule O=C(CSc1ccc2c(c1)OCCCO2)NC(=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)NC(=O)CSc1ccc2c(c1)OCCCO2)c1cccs1 | O=C(CSc1ccc2c(c1)OCCCO2)NC(=O)c1cccs1 | CC(C)(CC(=O)NC(=O)CSc1ccc2c(c1)OCCCO2)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule O=C(CSc1ccc2c(c1)OCCCO2)NC(=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)NC(=O)CSc1ccc2c(c1)OCCCO2)c1cccs1 | O=C(CSc1ccc2c(c1)OCCCO2)NC(=O)c1cccs1 | CC(C)(CCC(=O)NC(=O)CSc1ccc2c(c1)OCCCO2)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule O=C(CSc1ccc2c(c1)OCCCO2)NC(=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SNC(=O)CSc1ccc2c(c1)OCCCO2)c1cccs1 | O=C(CSc1ccc2c(c1)OCCCO2)NC(=O)c1cccs1 | C[C@H](C(=O)SNC(=O)CSc1ccc2c(c1)OCCCO2)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule C[NH+](C)CCSc1ccc(NC(=O)C2CC2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(=CCSc2ccc(NC(=O)C3CC3)nn2)CC1 | C[NH+](C)CCSc1ccc(NC(=O)C2CC2)nn1 | C[NH+]1CCC(=CCSc2ccc(NC(=O)C3CC3)nn2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[NH+]1CCC=&CC1",
"old_substring": "C[NH+]4C"
} |
Can you make molecule C[NH+](C)CCSc1ccc(NC(=O)C2CC2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(=NOCCSc2ccc(NC(=O)C3CC3)nn2)CC1 | C[NH+](C)CCSc1ccc(NC(=O)C2CC2)nn1 | C[NH+]1CCC(=NOCCSc2ccc(NC(=O)C3CC3)nn2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[NH+]1CCC(=NO&)CC1",
"old_substring": "C[NH+]4C"
} |
Can you make molecule C[NH+](C)CCSc1ccc(NC(=O)C2CC2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | C[N+](C)(C)CCSc1ccc(NC(=O)C2CC2)nn1 | C[NH+](C)CCSc1ccc(NC(=O)C2CC2)nn1 | C[N+](C)(C)CCSc1ccc(NC(=O)C2CC2)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]&(C)C",
"old_substring": "C[NH+]4C"
} |
Can you make molecule C[NH+](C)CCSc1ccc(NC(=O)C2CC2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(SCCC[NH+]2CCCSCC2)nn1)C1CC1 | C[NH+](C)CCSc1ccc(NC(=O)C2CC2)nn1 | O=C(Nc1ccc(SCCC[NH+]2CCCSCC2)nn1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCCSCC1",
"old_substring": "C[NH+]4C"
} |
Can you make molecule C[NH+](C)CCSc1ccc(NC(=O)C2CC2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | C[N+]1(C)CCC(CCSc2ccc(NC(=O)C3CC3)nn2)CC1 | C[NH+](C)CCSc1ccc(NC(=O)C2CC2)nn1 | C[N+]1(C)CCC(CCSc2ccc(NC(=O)C3CC3)nn2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]1(C)CCC&CC1",
"old_substring": "C[NH+]4C"
} |
Can you make molecule Cc1ccc(C)c(NC(=S)NCCc2cccs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(NC(=S)NCCc2ccc(Cl)s2)c1 | Cc1ccc(C)c(NC(=S)NCCc2cccs2)c1 | Cc1ccc(C)c(NC(=S)NCCc2ccc(Cl)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c15cccs1"
} |
Can you make molecule Cc1ccc(C)c(NC(=S)NCCc2cccs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(NC(=S)NCCc2ccc(Br)s2)c1 | Cc1ccc(C)c(NC(=S)NCCc2cccs2)c1 | Cc1ccc(C)c(NC(=S)NCCc2ccc(Br)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c15cccs1"
} |
Can you make molecule Cc1ccc(C)c(NC(=S)NCCc2cccs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(NC(=S)NCCc2sccc2Br)c1 | Cc1ccc(C)c(NC(=S)NCCc2cccs2)c1 | Cc1ccc(C)c(NC(=S)NCCc2sccc2Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c15cccs1"
} |
Can you make molecule Cc1ccc(C)c(NC(=S)NCCc2cccs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(NC(=S)NCCc2csc(I)c2)c1 | Cc1ccc(C)c(NC(=S)NCCc2cccs2)c1 | Cc1ccc(C)c(NC(=S)NCCc2csc(I)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(I)c1",
"old_substring": "c15cccs1"
} |
Can you make molecule Cc1ccc(C)c(NC(=S)NCCc2cccs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(NC(=S)NCCc2cc3c(s2)CSC3)c1 | Cc1ccc(C)c(NC(=S)NCCc2cccs2)c1 | Cc1ccc(C)c(NC(=S)NCCc2cc3c(s2)CSC3)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(s1)CSC2",
"old_substring": "c15cccs1"
} |
Can you make molecule CNc1ncc(F)c(-c2cccc(Cl)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CNc1ncc(F)c(-c2c(Cl)cccc2Cl)n1 | CNc1ncc(F)c(-c2cccc(Cl)c2)n1 | CNc1ncc(F)c(-c2c(Cl)cccc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1cccc(Cl)c1&",
"old_substring": "c14cccc(Cl)c1"
} |
Can you make molecule CNc1ncc(F)c(-c2cccc(Cl)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CNc1ncc(F)c(-c2ccc(Cl)cc2I)n1 | CNc1ncc(F)c(-c2cccc(Cl)c2)n1 | CNc1ncc(F)c(-c2ccc(Cl)cc2I)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c14cccc(Cl)c1"
} |
Can you make molecule CNc1ncc(F)c(-c2cccc(Cl)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CNc1ncc(F)c(-c2ccc(Cl)cc2Br)n1 | CNc1ncc(F)c(-c2cccc(Cl)c2)n1 | CNc1ncc(F)c(-c2ccc(Cl)cc2Br)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c14cccc(Cl)c1"
} |
Can you make molecule CNc1ncc(F)c(-c2cccc(Cl)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CNc1ncc(F)c(-c2ccc(Cl)c(I)c2)n1 | CNc1ncc(F)c(-c2cccc(Cl)c2)n1 | CNc1ncc(F)c(-c2ccc(Cl)c(I)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c14cccc(Cl)c1"
} |
Can you make molecule CNc1ncc(F)c(-c2cccc(Cl)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CNc1ncc(F)c(-c2ccc(Cl)c(Cl)c2)n1 | CNc1ncc(F)c(-c2cccc(Cl)c2)n1 | CNc1ncc(F)c(-c2ccc(Cl)c(Cl)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c14cccc(Cl)c1"
} |
Can you make molecule Cc1ccc(-c2nnc(SCC(=O)Nc3ccc(CC#N)cc3)n2N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nn(SCC(=O)Nc3ccc(CC#N)cc3)nc2C#N)cc1 | Cc1ccc(-c2nnc(SCC(=O)Nc3ccc(CC#N)cc3)n2N)cc1 | Cc1ccc(-c2nn(SCC(=O)Nc3ccc(CC#N)cc3)nc2C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn&nc1C#N",
"old_substring": "c19nnc8n1N"
} |
Can you make molecule Cc1ccc(-c2nnc(SCC(=O)Nc3ccc(CC#N)cc3)n2N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nnc3n2CCN(SCC(=O)Nc2ccc(CC#N)cc2)CC3)cc1 | Cc1ccc(-c2nnc(SCC(=O)Nc3ccc(CC#N)cc3)n2N)cc1 | Cc1ccc(-c2nnc3n2CCN(SCC(=O)Nc2ccc(CC#N)cc2)CC3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc2n1CCN&CC2",
"old_substring": "c19nnc8n1N"
} |
Can you make molecule Cc1ccc(-c2nnc(SCC(=O)Nc3ccc(CC#N)cc3)n2N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nnc(SCC(=O)Nc3ccc(CC#N)cc3)o2)cc1 | Cc1ccc(-c2nnc(SCC(=O)Nc3ccc(CC#N)cc3)n2N)cc1 | Cc1ccc(-c2nnc(SCC(=O)Nc3ccc(CC#N)cc3)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc&o1",
"old_substring": "c19nnc8n1N"
} |
Can you make molecule Cc1ccc(-c2nnc(SCC(=O)Nc3ccc(CC#N)cc3)n2N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nnc(SCC(=O)Nc3ccc(CC#N)cc3)s2)cc1 | Cc1ccc(-c2nnc(SCC(=O)Nc3ccc(CC#N)cc3)n2N)cc1 | Cc1ccc(-c2nnc(SCC(=O)Nc3ccc(CC#N)cc3)s2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc&s1",
"old_substring": "c19nnc8n1N"
} |
Can you make molecule Cc1ccc(-c2nnc(SCC(=O)Nc3ccc(CC#N)cc3)n2N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc(SCC(=O)Nc3ccc(CC#N)cc3)cn2N)cc1 | Cc1ccc(-c2nnc(SCC(=O)Nc3ccc(CC#N)cc3)n2N)cc1 | Cc1ccc(-c2nc(SCC(=O)Nc3ccc(CC#N)cc3)cn2N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&cn1N",
"old_substring": "c19nnc8n1N"
} |
Can you make molecule CCN(CC)C(=O)c1ccccc1OC(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CCC1(CC)CCN(C(=O)c2ccccc2OC(C)=O)C1 | CCN(CC)C(=O)c1ccccc1OC(C)=O | CCC1(CC)CCN(C(=O)c2ccccc2OC(C)=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N356"
} |
Can you make molecule CCN(CC)C(=O)c1ccccc1OC(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CCC1(CC)CCCN(C(=O)c2ccccc2OC(C)=O)C1 | CCN(CC)C(=O)c1ccccc1OC(C)=O | CCC1(CC)CCCN(C(=O)c2ccccc2OC(C)=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N356"
} |
Can you make molecule CCN(CC)C(=O)c1ccccc1OC(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CCc1oc(C(=O)c2ccccc2OC(C)=O)c(C#N)c1CC | CCN(CC)C(=O)c1ccccc1OC(C)=O | CCc1oc(C(=O)c2ccccc2OC(C)=O)c(C#N)c1CC | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N356"
} |
Can you make molecule CCN(CC)C(=O)c1ccccc1OC(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CCC1(CC)CCC(=O)N(C(=O)c2ccccc2OC(C)=O)C1 | CCN(CC)C(=O)c1ccccc1OC(C)=O | CCC1(CC)CCC(=O)N(C(=O)c2ccccc2OC(C)=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&&CCC1=O",
"old_substring": "N356"
} |
Can you make molecule CCN(CC)C(=O)c1ccccc1OC(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CCC1(CC)CCCN(C(=O)c2ccccc2OC(C)=O)C1 | CCN(CC)C(=O)c1ccccc1OC(C)=O | CCC1(CC)CCCN(C(=O)c2ccccc2OC(C)=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@]&&C1",
"old_substring": "N356"
} |
Can you make molecule Cc1ccc(-c2nc(-c3ccc(OCC(F)(F)F)nc3)no2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc(-c3ccc(OCCCC(F)(F)F)nc3)no2)cc1 | Cc1ccc(-c2nc(-c3ccc(OCC(F)(F)F)nc3)no2)cc1 | Cc1ccc(-c2nc(-c3ccc(OCCCC(F)(F)F)nc3)no2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C4C(F)(F)F"
} |
Can you make molecule Cc1ccc(-c2nc(-c3ccc(OCC(F)(F)F)nc3)no2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc(-c3ccc(OCCCCC(F)(F)F)nc3)no2)cc1 | Cc1ccc(-c2nc(-c3ccc(OCC(F)(F)F)nc3)no2)cc1 | Cc1ccc(-c2nc(-c3ccc(OCCCCC(F)(F)F)nc3)no2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C4C(F)(F)F"
} |
Can you make molecule Cc1ccc(-c2nc(-c3ccc(OCC(F)(F)F)nc3)no2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc(-c3ccc(OSC(F)(F)F)nc3)no2)cc1 | Cc1ccc(-c2nc(-c3ccc(OCC(F)(F)F)nc3)no2)cc1 | Cc1ccc(-c2nc(-c3ccc(OSC(F)(F)F)nc3)no2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C4C(F)(F)F"
} |
Can you make molecule Cc1ccc(-c2nc(-c3ccc(OCC(F)(F)F)nc3)no2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc(-c3ccc(OS/C=C/C(F)(F)F)nc3)no2)cc1 | Cc1ccc(-c2nc(-c3ccc(OCC(F)(F)F)nc3)no2)cc1 | Cc1ccc(-c2nc(-c3ccc(OS/C=C/C(F)(F)F)nc3)no2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&/C=C/C(F)(F)F",
"old_substring": "C4C(F)(F)F"
} |
Can you make molecule Cc1ccc(-c2nc(-c3ccc(OCC(F)(F)F)nc3)no2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc(-c3ccc(OCC(F)(F)C(F)(F)F)nc3)no2)cc1 | Cc1ccc(-c2nc(-c3ccc(OCC(F)(F)F)nc3)no2)cc1 | Cc1ccc(-c2nc(-c3ccc(OCC(F)(F)C(F)(F)F)nc3)no2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C4C(F)(F)F"
} |
Can you make molecule COc1ccc([C@@H](CNc2nc3ccccc3o2)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@]2(Nc3nc4ccccc4o3)CC[C@H](N3CCOCC3)C2)cc1 | COc1ccc([C@@H](CNc2nc3ccccc3o2)N2CCOCC2)cc1 | COc1ccc([C@]2(Nc3nc4ccccc4o3)CC[C@H](N3CCOCC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@]&&C1",
"old_substring": "[C@H]58C6"
} |
Can you make molecule COc1ccc([C@@H](CNc2nc3ccccc3o2)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@]2(Nc3nc4ccccc4o3)CC[C@H](N3CCOCC3)C2)cc1 | COc1ccc([C@@H](CNc2nc3ccccc3o2)N2CCOCC2)cc1 | COc1ccc([C@@]2(Nc3nc4ccccc4o3)CC[C@H](N3CCOCC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@@]&&C1",
"old_substring": "[C@H]58C6"
} |
Can you make molecule COc1ccc([C@@H](CNc2nc3ccccc3o2)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CCC[C@H](N2CCOCC2)C(C)(C)Nc2nc3ccccc3o2)cc1 | COc1ccc([C@@H](CNc2nc3ccccc3o2)N2CCOCC2)cc1 | COc1ccc(CCC[C@H](N2CCOCC2)C(C)(C)Nc2nc3ccccc3o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCC&)C&(C)C",
"old_substring": "[C@H]58C6"
} |
Can you make molecule COc1ccc([C@@H](CNc2nc3ccccc3o2)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@]2(Nc3nc4ccccc4o3)CCC[C@@H](N3CCOCC3)C2)cc1 | COc1ccc([C@@H](CNc2nc3ccccc3o2)N2CCOCC2)cc1 | COc1ccc([C@]2(Nc3nc4ccccc4o3)CCC[C@@H](N3CCOCC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCC[C@]&&C1",
"old_substring": "[C@H]58C6"
} |
Can you make molecule COc1ccc([C@@H](CNc2nc3ccccc3o2)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2CC(N3CCOCC3)C[C@@H](Nc3nc4ccccc4o3)C2)cc1 | COc1ccc([C@@H](CNc2nc3ccccc3o2)N2CCOCC2)cc1 | COc1ccc([C@H]2CC(N3CCOCC3)C[C@@H](Nc3nc4ccccc4o3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C[C@H]&C[C@H]&C1",
"old_substring": "[C@H]58C6"
} |
Can you make molecule CNC(=O)[C@H]1CCCC[C@H]1[NH2+][C@H](C)c1cc(C)cc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1cc(C)cc(C)c1)[NH2+][C@@H]1CCCC[C@@H]1C(=O)NC | CNC(=O)[C@H]1CCCC[C@H]1[NH2+][C@H](C)c1cc(C)cc(C)c1 | CC[C@@H](CCc1cc(C)cc(C)c1)[NH2+][C@@H]1CCCC[C@@H]1C(=O)NC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]36C"
} |
Can you make molecule CNC(=O)[C@H]1CCCC[C@H]1[NH2+][C@H](C)c1cc(C)cc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)[C@H]1CCCC[C@H]1[NH2+][C@@H](CBr)CCc1cc(C)cc(C)c1 | CNC(=O)[C@H]1CCCC[C@H]1[NH2+][C@H](C)c1cc(C)cc(C)c1 | CNC(=O)[C@H]1CCCC[C@H]1[NH2+][C@@H](CBr)CCc1cc(C)cc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]36C"
} |
Can you make molecule CNC(=O)[C@H]1CCCC[C@H]1[NH2+][C@H](C)c1cc(C)cc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)[C@H]1CCCC[C@H]1[NH2+][C@@H](CBr)CCCc1cc(C)cc(C)c1 | CNC(=O)[C@H]1CCCC[C@H]1[NH2+][C@H](C)c1cc(C)cc(C)c1 | CNC(=O)[C@H]1CCCC[C@H]1[NH2+][C@@H](CBr)CCCc1cc(C)cc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]36C"
} |
Can you make molecule CNC(=O)[C@H]1CCCC[C@H]1[NH2+][C@H](C)c1cc(C)cc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)[C@H]1CCCC[C@H]1[NH2+][C@H](CCl)CCCc1cc(C)cc(C)c1 | CNC(=O)[C@H]1CCCC[C@H]1[NH2+][C@H](C)c1cc(C)cc(C)c1 | CNC(=O)[C@H]1CCCC[C@H]1[NH2+][C@H](CCl)CCCc1cc(C)cc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@H]36C"
} |
Can you make molecule CNC(=O)[C@H]1CCCC[C@H]1[NH2+][C@H](C)c1cc(C)cc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)[C@H]1CCCC[C@H]1[NH2+][C@H]1CCC[C@H](c2cc(C)cc(C)c2)C1 | CNC(=O)[C@H]1CCCC[C@H]1[NH2+][C@H](C)c1cc(C)cc(C)c1 | CNC(=O)[C@H]1CCCC[C@H]1[NH2+][C@H]1CCC[C@H](c2cc(C)cc(C)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]36C"
} |
Can you make molecule CCN[C@H](c1cccnc1)C1([NH+]2CCCCC2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCN[C@H]1CC[C@@](c2cccnc2)(C2([NH+]3CCCCC3)CCCC2)C1 | CCN[C@H](c1cccnc1)C1([NH+]2CCCCC2)CCCC1 | CCN[C@H]1CC[C@@](c2cccnc2)(C2([NH+]3CCCCC3)CCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@]&&C1",
"old_substring": "[C@H]467"
} |
Can you make molecule CCN[C@H](c1cccnc1)C1([NH+]2CCCCC2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCN[C@H]1CC[C@](c2cccnc2)(C2([NH+]3CCCCC3)CCCC2)C1 | CCN[C@H](c1cccnc1)C1([NH+]2CCCCC2)CCCC1 | CCN[C@H]1CC[C@](c2cccnc2)(C2([NH+]3CCCCC3)CCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@@]&&C1",
"old_substring": "[C@H]467"
} |
Can you make molecule CCN[C@H](c1cccnc1)C1([NH+]2CCCCC2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCN[C@@H](CCCC1([NH+]2CCCCC2)CCCC1)C(C)(C)c1cccnc1 | CCN[C@H](c1cccnc1)C1([NH+]2CCCCC2)CCCC1 | CCN[C@@H](CCCC1([NH+]2CCCCC2)CCCC1)C(C)(C)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCC&)C&(C)C",
"old_substring": "[C@H]467"
} |
Can you make molecule CCN[C@H](c1cccnc1)C1([NH+]2CCCCC2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCN[C@@H]1CCC[C@@](c2cccnc2)(C2([NH+]3CCCCC3)CCCC2)C1 | CCN[C@H](c1cccnc1)C1([NH+]2CCCCC2)CCCC1 | CCN[C@@H]1CCC[C@@](c2cccnc2)(C2([NH+]3CCCCC3)CCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCC[C@]&&C1",
"old_substring": "[C@H]467"
} |
Can you make molecule CCN[C@H](c1cccnc1)C1([NH+]2CCCCC2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCNCC[C@H](CC1([NH+]2CCCCC2)CCCC1)C(=O)c1cccnc1 | CCN[C@H](c1cccnc1)C1([NH+]2CCCCC2)CCCC1 | CCNCC[C@H](CC1([NH+]2CCCCC2)CCCC1)C(=O)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@H](C&)C&=O",
"old_substring": "[C@H]467"
} |
Can you make molecule Cn1ncc2c(NCc3ccco3)nc(CCc3ccccc3)nc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncc2c(NCc3ccco3)nc(CCCCc3ccccc3)nc21 | Cn1ncc2c(NCc3ccco3)nc(CCc3ccccc3)nc21 | Cn1ncc2c(NCc3ccco3)nc(CCCCc3ccccc3)nc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C7C8"
} |
Can you make molecule Cn1ncc2c(NCc3ccco3)nc(CCc3ccccc3)nc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncc2c(NCc3ccco3)nc(CCCCCc3ccccc3)nc21 | Cn1ncc2c(NCc3ccco3)nc(CCc3ccccc3)nc21 | Cn1ncc2c(NCc3ccco3)nc(CCCCCc3ccccc3)nc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C7C8"
} |
Can you make molecule Cn1ncc2c(NCc3ccco3)nc(CCc3ccccc3)nc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncc2c(NCc3ccco3)nc(C3CC(c4ccccc4)C3)nc21 | Cn1ncc2c(NCc3ccco3)nc(CCc3ccccc3)nc21 | Cn1ncc2c(NCc3ccco3)nc(C3CC(c4ccccc4)C3)nc21 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C7C8"
} |
Can you make molecule Cn1ncc2c(NCc3ccco3)nc(CCc3ccccc3)nc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCc1ccccc1)c1nc(NCc2ccco2)c2cnn(C)c2n1 | Cn1ncc2c(NCc3ccco3)nc(CCc3ccccc3)nc21 | C[C@@H](CCc1ccccc1)c1nc(NCc2ccco2)c2cnn(C)c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C7C8"
} |
Can you make molecule Cn1ncc2c(NCc3ccco3)nc(CCc3ccccc3)nc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncc2c(NCc3ccco3)nc(C3CCC(c4ccccc4)CC3)nc21 | Cn1ncc2c(NCc3ccco3)nc(CCc3ccccc3)nc21 | Cn1ncc2c(NCc3ccco3)nc(C3CCC(c4ccccc4)CC3)nc21 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C7C8"
} |
Can you make molecule Cn1cc[nH+]c1C[C@H]1CCC[NH+](Cc2ncc(-c3ccccc3Cl)o2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc[nH+]c1C[C@H]1CCC[NH+](Cc2ccc(-c3ccccc3Cl)o2)C1 | Cn1cc[nH+]c1C[C@H]1CCC[NH+](Cc2ncc(-c3ccccc3Cl)o2)C1 | Cn1cc[nH+]c1C[C@H]1CCC[NH+](Cc2ccc(-c3ccccc3Cl)o2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&o1",
"old_substring": "c16ncc8o1"
} |
Can you make molecule Cn1cc[nH+]c1C[C@H]1CCC[NH+](Cc2ncc(-c3ccccc3Cl)o2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc(-c2ccccc2Cl)cc1C[NH+]1CCC[C@H](Cc2[nH+]ccn2C)C1 | Cn1cc[nH+]c1C[C@H]1CCC[NH+](Cc2ncc(-c3ccccc3Cl)o2)C1 | Cc1oc(-c2ccccc2Cl)cc1C[NH+]1CCC[C@H](Cc2[nH+]ccn2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&oc1C",
"old_substring": "c16ncc8o1"
} |
Can you make molecule Cn1cc[nH+]c1C[C@H]1CCC[NH+](Cc2ncc(-c3ccccc3Cl)o2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc[nH+]c1C[C@H]1CCC[NH+](Cc2nccc(-c3ccccc3Cl)c2I)C1 | Cn1cc[nH+]c1C[C@H]1CCC[NH+](Cc2ncc(-c3ccccc3Cl)o2)C1 | Cn1cc[nH+]c1C[C@H]1CCC[NH+](Cc2nccc(-c3ccccc3Cl)c2I)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nccc&c1I",
"old_substring": "c16ncc8o1"
} |
Can you make molecule Cn1cc[nH+]c1C[C@H]1CCC[NH+](Cc2ncc(-c3ccccc3Cl)o2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C[NH+]2CCC[C@H](Cc3[nH+]ccn3C)C2)sc1-c1ccccc1Cl | Cn1cc[nH+]c1C[C@H]1CCC[NH+](Cc2ncc(-c3ccccc3Cl)o2)C1 | Cc1nc(C[NH+]2CCC[C@H](Cc3[nH+]ccn3C)C2)sc1-c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc(C)c&s1",
"old_substring": "c16ncc8o1"
} |
Can you make molecule Cn1cc[nH+]c1C[C@H]1CCC[NH+](Cc2ncc(-c3ccccc3Cl)o2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc[nH+]c1C[C@H]1CCC[NH+](Cc2ncc(-c3ccccc3Cl)cc2Cl)C1 | Cn1cc[nH+]c1C[C@H]1CCC[NH+](Cc2ncc(-c3ccccc3Cl)o2)C1 | Cn1cc[nH+]c1C[C@H]1CCC[NH+](Cc2ncc(-c3ccccc3Cl)cc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc&cc1Cl",
"old_substring": "c16ncc8o1"
} |
Can you make molecule Cc1cc(N2CC[C@H](C)[C@H](O)C2)nc(C)[nH+]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2CC[C@H](C)C2)nc(C)[nH+]1 | Cc1cc(N2CC[C@H](C)[C@H](O)C2)nc(C)[nH+]1 | Cc1cc(N2CC[C@H](C)C2)nc(C)[nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC[C@H](C)C1",
"old_substring": "N13CC[C@H](C)[C@H](O)C1"
} |
Can you make molecule Cc1cc(N2CC[C@H](C)[C@H](O)C2)nc(C)[nH+]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2CC[C@H](Cl)C2)nc(C)[nH+]1 | Cc1cc(N2CC[C@H](C)[C@H](O)C2)nc(C)[nH+]1 | Cc1cc(N2CC[C@H](Cl)C2)nc(C)[nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC[C@H](Cl)C1",
"old_substring": "N13CC[C@H](C)[C@H](O)C1"
} |
Can you make molecule Cc1cc(N2CC[C@H](C)[C@H](O)C2)nc(C)[nH+]1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[C@@H](C=O)c1cc(C)[nH+]c(C)n1 | Cc1cc(N2CC[C@H](C)[C@H](O)C2)nc(C)[nH+]1 | CC[C@H](C)[C@@H](C=O)c1cc(C)[nH+]c(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C)[C@H]&C=O",
"old_substring": "N13CC[C@H](C)[C@H](O)C1"
} |
Can you make molecule Cc1cc(N2CC[C@H](C)[C@H](O)C2)nc(C)[nH+]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2CCC(C)(C)C2)nc(C)[nH+]1 | Cc1cc(N2CC[C@H](C)[C@H](O)C2)nc(C)[nH+]1 | Cc1cc(N2CCC(C)(C)C2)nc(C)[nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)(C)C1",
"old_substring": "N13CC[C@H](C)[C@H](O)C1"
} |
Can you make molecule Cc1cc(N2CC[C@H](C)[C@H](O)C2)nc(C)[nH+]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2CCSC(C)(C)C2)nc(C)[nH+]1 | Cc1cc(N2CC[C@H](C)[C@H](O)C2)nc(C)[nH+]1 | Cc1cc(N2CCSC(C)(C)C2)nc(C)[nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSC(C)(C)C1",
"old_substring": "N13CC[C@H](C)[C@H](O)C1"
} |
Can you make molecule Cc1nnc(CCC[NH+]2CCC(CC[NH+]3CCCC[C@@H]3C)CC2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(CCCCC[NH+]2CCC(CC[NH+]3CCCC[C@@H]3C)CC2)o1 | Cc1nnc(CCC[NH+]2CCC(CC[NH+]3CCCC[C@@H]3C)CC2)o1 | Cc1nnc(CCCCC[NH+]2CCC(CC[NH+]3CCCC[C@@H]3C)CC2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C6CC4"
} |
Can you make molecule Cc1nnc(CCC[NH+]2CCC(CC[NH+]3CCCC[C@@H]3C)CC2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc([C@@H](C)CC[NH+]2CCC(CC[NH+]3CCCC[C@@H]3C)CC2)o1 | Cc1nnc(CCC[NH+]2CCC(CC[NH+]3CCCC[C@@H]3C)CC2)o1 | Cc1nnc([C@@H](C)CC[NH+]2CCC(CC[NH+]3CCCC[C@@H]3C)CC2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C6CC4"
} |
Can you make molecule Cc1nnc(CCC[NH+]2CCC(CC[NH+]3CCCC[C@@H]3C)CC2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(C2CCC([NH+]3CCC(CC[NH+]4CCCC[C@@H]4C)CC3)CC2)o1 | Cc1nnc(CCC[NH+]2CCC(CC[NH+]3CCCC[C@@H]3C)CC2)o1 | Cc1nnc(C2CCC([NH+]3CCC(CC[NH+]4CCCC[C@@H]4C)CC3)CC2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C6CC4"
} |
Can you make molecule Cc1nnc(CCC[NH+]2CCC(CC[NH+]3CCCC[C@@H]3C)CC2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(CC(C)(C)C[NH+]2CCC(CC[NH+]3CCCC[C@@H]3C)CC2)o1 | Cc1nnc(CCC[NH+]2CCC(CC[NH+]3CCCC[C@@H]3C)CC2)o1 | Cc1nnc(CC(C)(C)C[NH+]2CCC(CC[NH+]3CCCC[C@@H]3C)CC2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)C&",
"old_substring": "C6CC4"
} |
Can you make molecule Cc1nnc(CCC[NH+]2CCC(CC[NH+]3CCCC[C@@H]3C)CC2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(C2CC(F)([NH+]3CCC(CC[NH+]4CCCC[C@@H]4C)CC3)C2)o1 | Cc1nnc(CCC[NH+]2CCC(CC[NH+]3CCCC[C@@H]3C)CC2)o1 | Cc1nnc(C2CC(F)([NH+]3CCC(CC[NH+]4CCCC[C@@H]4C)CC3)C2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&(F)C1",
"old_substring": "C6CC4"
} |
Can you make molecule CCc1nn(C)cc1CNC(=O)C1(CC)CCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1CNC(=O)C1CCC(CC)CC1 | CCc1nn(C)cc1CNC(=O)C1(CC)CCC1 | CCc1nn(C)cc1CNC(=O)C1CCC(CC)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C146CCC1"
} |
Can you make molecule CCc1nn(C)cc1CNC(=O)C1(CC)CCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC=C1CCC(C(=O)NCc2cn(C)nc2CC)CC1 | CCc1nn(C)cc1CNC(=O)C1(CC)CCC1 | CC=C1CCC(C(=O)NCc2cn(C)nc2CC)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC=&CC1",
"old_substring": "C146CCC1"
} |
Can you make molecule CCc1nn(C)cc1CNC(=O)C1(CC)CCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1CNC(=O)C1CCC(C)(CC)CC1 | CCc1nn(C)cc1CNC(=O)C1(CC)CCC1 | CCc1nn(C)cc1CNC(=O)C1CCC(C)(CC)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&(C)CC1",
"old_substring": "C146CCC1"
} |
Can you make molecule CCc1nn(C)cc1CNC(=O)C1(CC)CCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCCCC(=O)NCc1cn(C)nc1CC | CCc1nn(C)cc1CNC(=O)C1(CC)CCC1 | CCCCCCCC(=O)NCc1cn(C)nc1CC | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C146CCC1"
} |
Can you make molecule CCc1nn(C)cc1CNC(=O)C1(CC)CCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1CNC(=O)C1(C#N)CCC(CC)CC1 | CCc1nn(C)cc1CNC(=O)C1(CC)CCC1 | CCc1nn(C)cc1CNC(=O)C1(C#N)CCC(CC)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "C146CCC1"
} |
Can you make molecule COc1ccc(N2/C(=N/C(=O)CCCC(=O)[O-])S[C@@H]3CS(=O)(=O)C[C@H]32)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Br)cc(N2/C(=N/C(=O)CCCC(=O)[O-])S[C@@H]3CS(=O)(=O)C[C@H]32)c1Cl | COc1ccc(N2/C(=N/C(=O)CCCC(=O)[O-])S[C@@H]3CS(=O)(=O)C[C@H]32)cc1Cl | COc1cc(Br)cc(N2/C(=N/C(=O)CCCC(=O)[O-])S[C@@H]3CS(=O)(=O)C[C@H]32)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)cc&c1Cl",
"old_substring": "c14ccc5cc1Cl"
} |
Can you make molecule COc1ccc(N2/C(=N/C(=O)CCCC(=O)[O-])S[C@@H]3CS(=O)(=O)C[C@H]32)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1c(Cl)cc(N2/C(=N/C(=O)CCCC(=O)[O-])S[C@@H]3CS(=O)(=O)C[C@H]32)cc1Cl | COc1ccc(N2/C(=N/C(=O)CCCC(=O)[O-])S[C@@H]3CS(=O)(=O)C[C@H]32)cc1Cl | COc1c(Cl)cc(N2/C(=N/C(=O)CCCC(=O)[O-])S[C@@H]3CS(=O)(=O)C[C@H]32)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc&cc1Cl",
"old_substring": "c14ccc5cc1Cl"
} |
Can you make molecule COc1ccc(N2/C(=N/C(=O)CCCC(=O)[O-])S[C@@H]3CS(=O)(=O)C[C@H]32)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Cl)c(N2/C(=N/C(=O)CCCC(=O)[O-])S[C@@H]3CS(=O)(=O)C[C@H]32)cc1Cl | COc1ccc(N2/C(=N/C(=O)CCCC(=O)[O-])S[C@@H]3CS(=O)(=O)C[C@H]32)cc1Cl | COc1cc(Cl)c(N2/C(=N/C(=O)CCCC(=O)[O-])S[C@@H]3CS(=O)(=O)C[C@H]32)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)c&cc1Cl",
"old_substring": "c14ccc5cc1Cl"
} |
Can you make molecule COc1ccc(N2/C(=N/C(=O)CCCC(=O)[O-])S[C@@H]3CS(=O)(=O)C[C@H]32)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(N2/C(=N/C(=O)CCCC(=O)[O-])S[C@@H]3CS(=O)(=O)C[C@H]32)c(Cl)cc1Cl | COc1ccc(N2/C(=N/C(=O)CCCC(=O)[O-])S[C@@H]3CS(=O)(=O)C[C@H]32)cc1Cl | COc1cc(N2/C(=N/C(=O)CCCC(=O)[O-])S[C@@H]3CS(=O)(=O)C[C@H]32)c(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c(Cl)cc1Cl",
"old_substring": "c14ccc5cc1Cl"
} |
Can you make molecule COc1ccc(N2/C(=N/C(=O)CCCC(=O)[O-])S[C@@H]3CS(=O)(=O)C[C@H]32)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2/C(=N/C(=O)CCCC(=O)[O-])S[C@@H]3CS(=O)(=O)C[C@H]32)c(Cl)c1Cl | COc1ccc(N2/C(=N/C(=O)CCCC(=O)[O-])S[C@@H]3CS(=O)(=O)C[C@H]32)cc1Cl | COc1ccc(N2/C(=N/C(=O)CCCC(=O)[O-])S[C@@H]3CS(=O)(=O)C[C@H]32)c(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&c(Cl)c1Cl",
"old_substring": "c14ccc5cc1Cl"
} |
Can you make molecule CC(=O)C1=C([O-])C(=O)N(CCC2=c3ccccc3=[NH+][C@H]2C)[C@H]1c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[NH+]=c2ccccc2=C1CCCC(=O)NNC(=O)CCCc1ccccc1F | CC(=O)C1=C([O-])C(=O)N(CCC2=c3ccccc3=[NH+][C@H]2C)[C@H]1c1ccccc1F | C[C@@H]1[NH+]=c2ccccc2=C1CCCC(=O)NNC(=O)CCCc1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=O)NNC(=O)CCC&",
"old_substring": "CC(=O)C1=C([O-])C(=O)N4[C@H]15"
} |
Can you make molecule CC(=O)C1=C([O-])C(=O)N(CCC2=c3ccccc3=[NH+][C@H]2C)[C@H]1c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[NH+]=c2ccccc2=C1CCN1CC[C@H](C)[C@H](c2ccccc2F)C1 | CC(=O)C1=C([O-])C(=O)N(CCC2=c3ccccc3=[NH+][C@H]2C)[C@H]1c1ccccc1F | C[C@@H]1[NH+]=c2ccccc2=C1CCN1CC[C@H](C)[C@H](c2ccccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCN&C[C@H]1&",
"old_substring": "CC(=O)C1=C([O-])C(=O)N4[C@H]15"
} |
Can you make molecule CC(=O)C1=C([O-])C(=O)N(CCC2=c3ccccc3=[NH+][C@H]2C)[C@H]1c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[NH+]=c2ccccc2=C1CCN1C(=O)C[C@H](c2ccccc2F)C1=O | CC(=O)C1=C([O-])C(=O)N(CCC2=c3ccccc3=[NH+][C@H]2C)[C@H]1c1ccccc1F | C[C@@H]1[NH+]=c2ccccc2=C1CCN1C(=O)C[C@H](c2ccccc2F)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&C(=O)C[C@H]&C1=O",
"old_substring": "CC(=O)C1=C([O-])C(=O)N4[C@H]15"
} |
Can you make molecule CC(=O)C1=C([O-])C(=O)N(CCC2=c3ccccc3=[NH+][C@H]2C)[C@H]1c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[NH+]=c2ccccc2=C1CCC(=O)C1=CC(C(=O)c2ccccc2F)=NC1 | CC(=O)C1=C([O-])C(=O)N(CCC2=c3ccccc3=[NH+][C@H]2C)[C@H]1c1ccccc1F | C[C@@H]1[NH+]=c2ccccc2=C1CCC(=O)C1=CC(C(=O)c2ccccc2F)=NC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC(C&=O)=NC1",
"old_substring": "CC(=O)C1=C([O-])C(=O)N4[C@H]15"
} |
Can you make molecule CC(=O)C1=C([O-])C(=O)N(CCC2=c3ccccc3=[NH+][C@H]2C)[C@H]1c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[NH+]=c2ccccc2=C1CCC(=O)C1=NC=C(C(=O)c2ccccc2F)C1 | CC(=O)C1=C([O-])C(=O)N(CCC2=c3ccccc3=[NH+][C@H]2C)[C@H]1c1ccccc1F | C[C@@H]1[NH+]=c2ccccc2=C1CCC(=O)C1=NC=C(C(=O)c2ccccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=NC=C(C&=O)C1",
"old_substring": "CC(=O)C1=C([O-])C(=O)N4[C@H]15"
} |
Can you make molecule COc1cc(C)c(C(=O)N[C@H]2C[C@H](C)N(c3ccccc3)C2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C)c(C(=O)N[C@H]2C[C@@H](c3ccccc3)CCO2)cc1OC | COc1cc(C)c(C(=O)N[C@H]2C[C@H](C)N(c3ccccc3)C2)cc1OC | COc1cc(C)c(C(=O)N[C@H]2C[C@@H](c3ccccc3)CCO2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C[C@@H]&CCO1",
"old_substring": "[C@H]18C[C@H](C)N7C1"
} |
Can you make molecule COc1cc(C)c(C(=O)N[C@H]2C[C@H](C)N(c3ccccc3)C2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C)c(C(=O)N[C@H]2C[C@@H](c3ccccc3)N=N2)cc1OC | COc1cc(C)c(C(=O)N[C@H]2C[C@H](C)N(c3ccccc3)C2)cc1OC | COc1cc(C)c(C(=O)N[C@H]2C[C@@H](c3ccccc3)N=N2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C[C@@H]&N=N1",
"old_substring": "[C@H]18C[C@H](C)N7C1"
} |
Can you make molecule COc1cc(C)c(C(=O)N[C@H]2C[C@H](C)N(c3ccccc3)C2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C)c(C(=O)N[C@H]2C=C[C@H](c3ccccc3)C2)cc1OC | COc1cc(C)c(C(=O)N[C@H]2C[C@H](C)N(c3ccccc3)C2)cc1OC | COc1cc(C)c(C(=O)N[C@H]2C=C[C@H](c3ccccc3)C2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@H]&C1",
"old_substring": "[C@H]18C[C@H](C)N7C1"
} |
Can you make molecule COc1cc(C)c(C(=O)N[C@H]2C[C@H](C)N(c3ccccc3)C2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C)c(C(=O)N[C@H]2CCC[C@H](c3ccccc3)C2)cc1OC | COc1cc(C)c(C(=O)N[C@H]2C[C@H](C)N(c3ccccc3)C2)cc1OC | COc1cc(C)c(C(=O)N[C@H]2CCC[C@H](c3ccccc3)C2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]18C[C@H](C)N7C1"
} |
Can you make molecule COc1cc(C)c(C(=O)N[C@H]2C[C@H](C)N(c3ccccc3)C2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C)c(C(=O)N[C@H]2C=C(Cc3ccccc3)N=N2)cc1OC | COc1cc(C)c(C(=O)N[C@H]2C[C@H](C)N(c3ccccc3)C2)cc1OC | COc1cc(C)c(C(=O)N[C@H]2C=C(Cc3ccccc3)N=N2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C(C&)N=N1",
"old_substring": "[C@H]18C[C@H](C)N7C1"
} |
Can you make molecule Cc1ccc([C@H]2C[C@@H]2NC(=O)N2CCC(C(N)=O)CC2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H]2C[C@@H]2NC(=O)CC(C)(C)N2CCC(C(N)=O)CC2)cc1C | Cc1ccc([C@H]2C[C@@H]2NC(=O)N2CCC(C(N)=O)CC2)cc1C | Cc1ccc([C@H]2C[C@@H]2NC(=O)CC(C)(C)N2CCC(C(N)=O)CC2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ccc([C@H]2C[C@@H]2NC(=O)N2CCC(C(N)=O)CC2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H]2C[C@@H]2NC(=O)CCC(C)(C)N2CCC(C(N)=O)CC2)cc1C | Cc1ccc([C@H]2C[C@@H]2NC(=O)N2CCC(C(N)=O)CC2)cc1C | Cc1ccc([C@H]2C[C@@H]2NC(=O)CCC(C)(C)N2CCC(C(N)=O)CC2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ccc([C@H]2C[C@@H]2NC(=O)N2CCC(C(N)=O)CC2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H]2C[C@@H]2NC(=O)C[C@@H](Br)N2CCC(C(N)=O)CC2)cc1C | Cc1ccc([C@H]2C[C@@H]2NC(=O)N2CCC(C(N)=O)CC2)cc1C | Cc1ccc([C@H]2C[C@@H]2NC(=O)C[C@@H](Br)N2CCC(C(N)=O)CC2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ccc([C@H]2C[C@@H]2NC(=O)N2CCC(C(N)=O)CC2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H]2C[C@@H]2Nc2cc(C)n(N3CCC(C(N)=O)CC3)c(=O)c2)cc1C | Cc1ccc([C@H]2C[C@@H]2NC(=O)N2CCC(C(N)=O)CC2)cc1C | Cc1ccc([C@H]2C[C@@H]2Nc2cc(C)n(N3CCC(C(N)=O)CC3)c(=O)c2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ccc([C@H]2C[C@@H]2NC(=O)N2CCC(C(N)=O)CC2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H]2C[C@@H]2Nc2c(C)n(N3CCC(C(N)=O)CC3)ccc2=O)cc1C | Cc1ccc([C@H]2C[C@@H]2NC(=O)N2CCC(C(N)=O)CC2)cc1C | Cc1ccc([C@H]2C[C@@H]2Nc2c(C)n(N3CCC(C(N)=O)CC3)ccc2=O)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.