prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule COC(=O)CCCc1nnc(NC(=O)N2CCC[C@@H]3CCC[C@@H]32)s1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCCc1nnc(NC(=O)CC(C)(C)N2CCC[C@@H]3CCC[C@@H]32)s1 | COC(=O)CCCc1nnc(NC(=O)N2CCC[C@@H]3CCC[C@@H]32)s1 | COC(=O)CCCc1nnc(NC(=O)CC(C)(C)N2CCC[C@@H]3CCC[C@@H]32)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C56=O"
} |
Can you make molecule COC(=O)CCCc1nnc(NC(=O)N2CCC[C@@H]3CCC[C@@H]32)s1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCCc1nnc(NC(=O)CCC(C)(C)N2CCC[C@@H]3CCC[C@@H]32)s1 | COC(=O)CCCc1nnc(NC(=O)N2CCC[C@@H]3CCC[C@@H]32)s1 | COC(=O)CCCc1nnc(NC(=O)CCC(C)(C)N2CCC[C@@H]3CCC[C@@H]32)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C56=O"
} |
Can you make molecule COC(=O)CCCc1nnc(NC(=O)N2CCC[C@@H]3CCC[C@@H]32)s1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCCc1nnc(NC(=O)C[C@@H](Br)N2CCC[C@@H]3CCC[C@@H]32)s1 | COC(=O)CCCc1nnc(NC(=O)N2CCC[C@@H]3CCC[C@@H]32)s1 | COC(=O)CCCc1nnc(NC(=O)C[C@@H](Br)N2CCC[C@@H]3CCC[C@@H]32)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C56=O"
} |
Can you make molecule COC(=O)CCCc1nnc(NC(=O)N2CCC[C@@H]3CCC[C@@H]32)s1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCCc1nnc(Nc2cc(C)n(N3CCC[C@@H]4CCC[C@@H]43)c(=O)c2)s1 | COC(=O)CCCc1nnc(NC(=O)N2CCC[C@@H]3CCC[C@@H]32)s1 | COC(=O)CCCc1nnc(Nc2cc(C)n(N3CCC[C@@H]4CCC[C@@H]43)c(=O)c2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C56=O"
} |
Can you make molecule COC(=O)CCCc1nnc(NC(=O)N2CCC[C@@H]3CCC[C@@H]32)s1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCCc1nnc(Nc2c(C)n(N3CCC[C@@H]4CCC[C@@H]43)ccc2=O)s1 | COC(=O)CCCc1nnc(NC(=O)N2CCC[C@@H]3CCC[C@@H]32)s1 | COC(=O)CCCc1nnc(Nc2c(C)n(N3CCC[C@@H]4CCC[C@@H]43)ccc2=O)s1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C56=O"
} |
Can you make molecule O=C(N[C@H]1CCCC[C@H]1OC1CCCC1)c1ccc([N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C2=CC=CC2=C(N[C@H]2CCCC[C@H]2OC2CCCC2)CCN1c1ccc([N+](=O)[O-])cc1 | O=C(N[C@H]1CCCC[C@H]1OC1CCCC1)c1ccc([N+](=O)[O-])cc1 | O=C1C2=CC=CC2=C(N[C@H]2CCCC[C@H]2OC2CCCC2)CCN1c1ccc([N+](=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1c2cccc&c2CCN1&",
"old_substring": "O=C26"
} |
Can you make molecule O=C(N[C@H]1CCCC[C@H]1OC1CCCC1)c1ccc([N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1c(N[C@H]2CCCC[C@H]2OC2CCCC2)cc(-c2ccc([N+](=O)[O-])cc2)ccc2oc1-2 | O=C(N[C@H]1CCCC[C@H]1OC1CCCC1)c1ccc([N+](=O)[O-])cc1 | O=Cc1c(N[C@H]2CCCC[C@H]2OC2CCCC2)cc(-c2ccc([N+](=O)[O-])cc2)ccc2oc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1c&oc2ccc&cc12",
"old_substring": "O=C26"
} |
Can you make molecule O=C(N[C@H]1CCCC[C@H]1OC1CCCC1)c1ccc([N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccc([N+](=O)[O-])cc1)N[C@H]1CCCC[C@H]1OC1CCCC1 | O=C(N[C@H]1CCCC[C@H]1OC1CCCC1)c1ccc([N+](=O)[O-])cc1 | O=C(/C=C/Sc1ccc([N+](=O)[O-])cc1)N[C@H]1CCCC[C@H]1OC1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C26"
} |
Can you make molecule O=C(N[C@H]1CCCC[C@H]1OC1CCCC1)c1ccc([N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(N[C@H]2CCCC[C@H]2OC2CCCC2)nc1-c1ccc([N+](=O)[O-])cc1 | O=C(N[C@H]1CCCC[C@H]1OC1CCCC1)c1ccc([N+](=O)[O-])cc1 | O=Cc1sc(N[C@H]2CCCC[C@H]2OC2CCCC2)nc1-c1ccc([N+](=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C26"
} |
Can you make molecule O=C(N[C@H]1CCCC[C@H]1OC1CCCC1)c1ccc([N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(N[C@H]2CCCC[C@H]2OC2CCCC2)sc1-c1ccc([N+](=O)[O-])cc1 | O=C(N[C@H]1CCCC[C@H]1OC1CCCC1)c1ccc([N+](=O)[O-])cc1 | O=Cc1nc(N[C@H]2CCCC[C@H]2OC2CCCC2)sc1-c1ccc([N+](=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C26"
} |
Can you make molecule O=C(CCOc1ccccc1)NNC(=O)CC1(O)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(CC(=O)NNC(=O)CCOc2ccccc2)CCCC1 | O=C(CCOc1ccccc1)NNC(=O)CC1(O)CCCC1 | CC1(CC(=O)NNC(=O)CCOc2ccccc2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C14(O)CCCC1"
} |
Can you make molecule O=C(CCOc1ccccc1)NNC(=O)CC1(O)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=CC1(CC(=O)NNC(=O)CCOc2ccccc2)CCCCCC1 | O=C(CCOc1ccccc1)NNC(=O)CC1(O)CCCC1 | O=CC1(CC(=O)NNC(=O)CCOc2ccccc2)CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C=O)CCCCCC1",
"old_substring": "C14(O)CCCC1"
} |
Can you make molecule O=C(CCOc1ccccc1)NNC(=O)CC1(O)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCOc1ccccc1)NNC(=O)CC1(O)CCC(F)(F)CC1 | O=C(CCOc1ccccc1)NNC(=O)CC1(O)CCCC1 | O=C(CCOc1ccccc1)NNC(=O)CC1(O)CCC(F)(F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(O)CCC(F)(F)CC1",
"old_substring": "C14(O)CCCC1"
} |
Can you make molecule O=C(CCOc1ccccc1)NNC(=O)CC1(O)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(O)C1(CC(=O)NNC(=O)CCOc2ccccc2)CCCCC1 | O=C(CCOc1ccccc1)NNC(=O)CC1(O)CCCC1 | CN(O)C1(CC(=O)NNC(=O)CCOc2ccccc2)CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(N(C)O)CCCCC1",
"old_substring": "C14(O)CCCC1"
} |
Can you make molecule O=C(CCOc1ccccc1)NNC(=O)CC1(O)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCOc1ccccc1)NNC(=O)CC1CCCCC1 | O=C(CCOc1ccccc1)NNC(=O)CC1(O)CCCC1 | O=C(CCOc1ccccc1)NNC(=O)CC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C14(O)CCCC1"
} |
Can you make molecule C=CCN(CC(=O)[O-])C(=O)[C@@H](C[NH3+])C(C)C less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCN(CC(=O)[O-])C(=O)[C@@H](C[NH3+])C(C)C | C=CCN(CC(=O)[O-])C(=O)[C@@H](C[NH3+])C(C)C | C=CCCCN(CC(=O)[O-])C(=O)[C@@H](C[NH3+])C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "C=CC2"
} |
Can you make molecule C=CCN(CC(=O)[O-])C(=O)[C@@H](C[NH3+])C(C)C less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCN(CC(=O)[O-])C(=O)[C@@H](C[NH3+])C(C)C | C=CCN(CC(=O)[O-])C(=O)[C@@H](C[NH3+])C(C)C | C=CCCCCN(CC(=O)[O-])C(=O)[C@@H](C[NH3+])C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "C=CC2"
} |
Can you make molecule C=CCN(CC(=O)[O-])C(=O)[C@@H](C[NH3+])C(C)C less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC(=O)N(CC(=O)[O-])C(=O)[C@@H](C[NH3+])C(C)C | C=CCN(CC(=O)[O-])C(=O)[C@@H](C[NH3+])C(C)C | C=CCCCC(=O)N(CC(=O)[O-])C(=O)[C@@H](C[NH3+])C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&=O",
"old_substring": "C=CC2"
} |
Can you make molecule C=CCN(CC(=O)[O-])C(=O)[C@@H](C[NH3+])C(C)C less soluble in water? The output molecule should be similar to the input molecule. | C=CCC(CC=C)N(CC(=O)[O-])C(=O)[C@@H](C[NH3+])C(C)C | C=CCN(CC(=O)[O-])C(=O)[C@@H](C[NH3+])C(C)C | C=CCC(CC=C)N(CC(=O)[O-])C(=O)[C@@H](C[NH3+])C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&CC=C",
"old_substring": "C=CC2"
} |
Can you make molecule C=CCN(CC(=O)[O-])C(=O)[C@@H](C[NH3+])C(C)C less soluble in water? The output molecule should be similar to the input molecule. | C=C(Cl)CN(CC(=O)[O-])C(=O)[C@@H](C[NH3+])C(C)C | C=CCN(CC(=O)[O-])C(=O)[C@@H](C[NH3+])C(C)C | C=C(Cl)CN(CC(=O)[O-])C(=O)[C@@H](C[NH3+])C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C=C(Cl)C&",
"old_substring": "C=CC2"
} |
Can you make molecule O=C(CCn1ccccc1=O)NCC1(c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCn1ccccc1=O)NCC1CCC(c2ccccc2)CC1 | O=C(CCn1ccccc1=O)NCC1(c2ccccc2)CC1 | O=C(CCn1ccccc1=O)NCC1CCC(c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C167CC1"
} |
Can you make molecule O=C(CCn1ccccc1=O)NCC1(c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCn1ccccc1=O)NCC1CC(F)(c2ccccc2)C1 | O=C(CCn1ccccc1=O)NCC1(c2ccccc2)CC1 | O=C(CCn1ccccc1=O)NCC1CC(F)(c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&(F)C1",
"old_substring": "C167CC1"
} |
Can you make molecule O=C(CCn1ccccc1=O)NCC1(c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCn1ccccc1=O)NC[C@@H]1N=NC=C1CCc1ccccc1 | O=C(CCn1ccccc1=O)NCC1(c2ccccc2)CC1 | O=C(CCn1ccccc1=O)NC[C@@H]1N=NC=C1CCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=NC=C1CC&",
"old_substring": "C167CC1"
} |
Can you make molecule O=C(CCn1ccccc1=O)NCC1(c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCn1ccccc1=O)NCCCCCc1ccccc1 | O=C(CCn1ccccc1=O)NCC1(c2ccccc2)CC1 | O=C(CCn1ccccc1=O)NCCCCCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C167CC1"
} |
Can you make molecule O=C(CCn1ccccc1=O)NCC1(c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CNC(=O)CCn2ccccc2=O)c(C)n1-c1ccccc1 | O=C(CCn1ccccc1=O)NCC1(c2ccccc2)CC1 | Cc1cc(CNC(=O)CCn2ccccc2=O)c(C)n1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)n1&",
"old_substring": "C167CC1"
} |
Can you make molecule COc1cc(C)c([C@@H](C)NC(=O)CSC2CCCC2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1cc(OC)c(OC)cc1C)NC(=O)CSC1CCCC1 | COc1cc(C)c([C@@H](C)NC(=O)CSC2CCCC2)cc1OC | CC[C@@H](CCc1cc(OC)c(OC)cc1C)NC(=O)CSC1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]68C"
} |
Can you make molecule COc1cc(C)c([C@@H](C)NC(=O)CSC2CCCC2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C)c(CC[C@H](CBr)NC(=O)CSC2CCCC2)cc1OC | COc1cc(C)c([C@@H](C)NC(=O)CSC2CCCC2)cc1OC | COc1cc(C)c(CC[C@H](CBr)NC(=O)CSC2CCCC2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]68C"
} |
Can you make molecule COc1cc(C)c([C@@H](C)NC(=O)CSC2CCCC2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C)c(CCC[C@H](CBr)NC(=O)CSC2CCCC2)cc1OC | COc1cc(C)c([C@@H](C)NC(=O)CSC2CCCC2)cc1OC | COc1cc(C)c(CCC[C@H](CBr)NC(=O)CSC2CCCC2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]68C"
} |
Can you make molecule COc1cc(C)c([C@@H](C)NC(=O)CSC2CCCC2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C)c(CCC[C@@H](CCl)NC(=O)CSC2CCCC2)cc1OC | COc1cc(C)c([C@@H](C)NC(=O)CSC2CCCC2)cc1OC | COc1cc(C)c(CCC[C@@H](CCl)NC(=O)CSC2CCCC2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@H]68C"
} |
Can you make molecule COc1cc(C)c([C@@H](C)NC(=O)CSC2CCCC2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C)c([C@H]2CCC[C@H](NC(=O)CSC3CCCC3)C2)cc1OC | COc1cc(C)c([C@@H](C)NC(=O)CSC2CCCC2)cc1OC | COc1cc(C)c([C@H]2CCC[C@H](NC(=O)CSC3CCCC3)C2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]68C"
} |
Can you make molecule C=CCNC(=O)Nc1ccc(F)c(NC(=O)OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCNC(=O)Nc1ccc(F)c(NC(C)(C)CC(=O)OC)c1 | C=CCNC(=O)Nc1ccc(F)c(NC(=O)OC)c1 | C=CCNC(=O)Nc1ccc(F)c(NC(C)(C)CC(=O)OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule C=CCNC(=O)Nc1ccc(F)c(NC(=O)OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCNC(=O)Nc1ccc(F)c(NC(C)(C)CCC(=O)OC)c1 | C=CCNC(=O)Nc1ccc(F)c(NC(=O)OC)c1 | C=CCNC(=O)Nc1ccc(F)c(NC(C)(C)CCC(=O)OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule C=CCNC(=O)Nc1ccc(F)c(NC(=O)OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCNC(=O)Nc1ccc(F)c(N[C@H](Br)CC(=O)OC)c1 | C=CCNC(=O)Nc1ccc(F)c(NC(=O)OC)c1 | C=CCNC(=O)Nc1ccc(F)c(N[C@H](Br)CC(=O)OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C25=O"
} |
Can you make molecule C=CCNC(=O)Nc1ccc(F)c(NC(=O)OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCNC(=O)Nc1ccc(F)c(Nn2c(C)cc(OC)cc2=O)c1 | C=CCNC(=O)Nc1ccc(F)c(NC(=O)OC)c1 | C=CCNC(=O)Nc1ccc(F)c(Nn2c(C)cc(OC)cc2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C25=O"
} |
Can you make molecule C=CCNC(=O)Nc1ccc(F)c(NC(=O)OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCNC(=O)Nc1ccc(F)c(Nn2ccc(=O)c(OC)c2C)c1 | C=CCNC(=O)Nc1ccc(F)c(NC(=O)OC)c1 | C=CCNC(=O)Nc1ccc(F)c(Nn2ccc(=O)c(OC)c2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C25=O"
} |
Can you make molecule Cn1cccc1Cc1nnc(SCC(=O)Nc2ccc3c(c2)OCCO3)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cn1cccc1Cc1nn(SCC(=O)Nc2ccc3c(c2)OCCO3)c(=S)n1C | Cn1cccc1Cc1nnc(SCC(=O)Nc2ccc3c(c2)OCCO3)n1C | Cn1cccc1Cc1nn(SCC(=O)Nc2ccc3c(c2)OCCO3)c(=S)n1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn&c(=S)n1C",
"old_substring": "c18nnc9n1C"
} |
Can you make molecule Cn1cccc1Cc1nnc(SCC(=O)Nc2ccc3c(c2)OCCO3)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cn1cccc1Cc1nnc(SCC(=O)Nc2ccc3c(c2)OCCO3)s1 | Cn1cccc1Cc1nnc(SCC(=O)Nc2ccc3c(c2)OCCO3)n1C | Cn1cccc1Cc1nnc(SCC(=O)Nc2ccc3c(c2)OCCO3)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc&s1",
"old_substring": "c18nnc9n1C"
} |
Can you make molecule Cn1cccc1Cc1nnc(SCC(=O)Nc2ccc3c(c2)OCCO3)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cn1cccc1Cc1ncc(SCC(=O)Nc2ccc3c(c2)OCCO3)n1C | Cn1cccc1Cc1nnc(SCC(=O)Nc2ccc3c(c2)OCCO3)n1C | Cn1cccc1Cc1ncc(SCC(=O)Nc2ccc3c(c2)OCCO3)n1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc&n1C",
"old_substring": "c18nnc9n1C"
} |
Can you make molecule Cn1cccc1Cc1nnc(SCC(=O)Nc2ccc3c(c2)OCCO3)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cn1cccc1Cc1cc(SCC(=O)Nc2ccc3c(c2)OCCO3)nn1C | Cn1cccc1Cc1nnc(SCC(=O)Nc2ccc3c(c2)OCCO3)n1C | Cn1cccc1Cc1cc(SCC(=O)Nc2ccc3c(c2)OCCO3)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&nn1C",
"old_substring": "c18nnc9n1C"
} |
Can you make molecule Cn1cccc1Cc1nnc(SCC(=O)Nc2ccc3c(c2)OCCO3)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Cc2cccn2C)sc2nc(SCC(=O)Nc3ccc4c(c3)OCCO4)nn12 | Cn1cccc1Cc1nnc(SCC(=O)Nc2ccc3c(c2)OCCO3)n1C | Cc1c(Cc2cccn2C)sc2nc(SCC(=O)Nc3ccc4c(c3)OCCO4)nn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2nc&nn2c1C",
"old_substring": "c18nnc9n1C"
} |
Can you make molecule C[C@@H](C#N)CNC(=O)c1cccc(Oc2cccc(C(F)(F)F)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C#N)CNC(=O)c1cccc(Oc2ccc(C(F)(F)F)cc2I)c1 | C[C@@H](C#N)CNC(=O)c1cccc(Oc2cccc(C(F)(F)F)c2)c1 | C[C@@H](C#N)CNC(=O)c1cccc(Oc2ccc(C(F)(F)F)cc2I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15cccc8c1"
} |
Can you make molecule C[C@@H](C#N)CNC(=O)c1cccc(Oc2cccc(C(F)(F)F)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C#N)CNC(=O)c1cccc(Oc2cc(C(F)(F)F)ccc2Br)c1 | C[C@@H](C#N)CNC(=O)c1cccc(Oc2cccc(C(F)(F)F)c2)c1 | C[C@@H](C#N)CNC(=O)c1cccc(Oc2cc(C(F)(F)F)ccc2Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15cccc8c1"
} |
Can you make molecule C[C@@H](C#N)CNC(=O)c1cccc(Oc2cccc(C(F)(F)F)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C#N)CNC(=O)c1cccc(Oc2ccc(C(F)(F)F)cc2Cl)c1 | C[C@@H](C#N)CNC(=O)c1cccc(Oc2cccc(C(F)(F)F)c2)c1 | C[C@@H](C#N)CNC(=O)c1cccc(Oc2ccc(C(F)(F)F)cc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15cccc8c1"
} |
Can you make molecule C[C@@H](C#N)CNC(=O)c1cccc(Oc2cccc(C(F)(F)F)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C#N)CNC(=O)c1cccc(Oc2cccc(C(F)(F)F)c2Br)c1 | C[C@@H](C#N)CNC(=O)c1cccc(Oc2cccc(C(F)(F)F)c2)c1 | C[C@@H](C#N)CNC(=O)c1cccc(Oc2cccc(C(F)(F)F)c2Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15cccc8c1"
} |
Can you make molecule C[C@@H](C#N)CNC(=O)c1cccc(Oc2cccc(C(F)(F)F)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C#N)CNC(=O)c1cccc(Oc2cccc(C(F)(F)F)c2Cl)c1 | C[C@@H](C#N)CNC(=O)c1cccc(Oc2cccc(C(F)(F)F)c2)c1 | C[C@@H](C#N)CNC(=O)c1cccc(Oc2cccc(C(F)(F)F)c2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15cccc8c1"
} |
Can you make molecule Cc1oc(-c2ccccc2)nc1CCNC(=O)c1ccc([S@@+](C)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc(-c2ccccc2)nc1CCCCNC(=O)c1ccc([S@@+](C)[O-])cc1 | Cc1oc(-c2ccccc2)nc1CCNC(=O)c1ccc([S@@+](C)[O-])cc1 | Cc1oc(-c2ccccc2)nc1CCCCNC(=O)c1ccc([S@@+](C)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C6C4"
} |
Can you make molecule Cc1oc(-c2ccccc2)nc1CCNC(=O)c1ccc([S@@+](C)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc(-c2ccccc2)nc1CCCCCNC(=O)c1ccc([S@@+](C)[O-])cc1 | Cc1oc(-c2ccccc2)nc1CCNC(=O)c1ccc([S@@+](C)[O-])cc1 | Cc1oc(-c2ccccc2)nc1CCCCCNC(=O)c1ccc([S@@+](C)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C6C4"
} |
Can you make molecule Cc1oc(-c2ccccc2)nc1CCNC(=O)c1ccc([S@@+](C)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc(-c2ccccc2)nc1C1CC(NC(=O)c2ccc([S@@+](C)[O-])cc2)C1 | Cc1oc(-c2ccccc2)nc1CCNC(=O)c1ccc([S@@+](C)[O-])cc1 | Cc1oc(-c2ccccc2)nc1C1CC(NC(=O)c2ccc([S@@+](C)[O-])cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C6C4"
} |
Can you make molecule Cc1oc(-c2ccccc2)nc1CCNC(=O)c1ccc([S@@+](C)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc(-c2ccccc2)nc1C1CCN(NC(=O)c2ccc([S@@+](C)[O-])cc2)CC1 | Cc1oc(-c2ccccc2)nc1CCNC(=O)c1ccc([S@@+](C)[O-])cc1 | Cc1oc(-c2ccccc2)nc1C1CCN(NC(=O)c2ccc([S@@+](C)[O-])cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "C6C4"
} |
Can you make molecule Cc1oc(-c2ccccc2)nc1CCNC(=O)c1ccc([S@@+](C)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc(-c2ccccc2)nc1[C@@H](C)CCNC(=O)c1ccc([S@@+](C)[O-])cc1 | Cc1oc(-c2ccccc2)nc1CCNC(=O)c1ccc([S@@+](C)[O-])cc1 | Cc1oc(-c2ccccc2)nc1[C@@H](C)CCNC(=O)c1ccc([S@@+](C)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C6C4"
} |
Can you make molecule CCc1noc(C)c1C[NH+](C[C@@H]1CCCCO1)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCc1noc(C)c1C[NH+](C[C@@H]1CCCSC1)C(C)C | CCc1noc(C)c1C[NH+](C[C@@H]1CCCCO1)C(C)C | CCc1noc(C)c1C[NH+](C[C@@H]1CCCSC1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCSC1",
"old_substring": "[C@@H]15CCCCO1"
} |
Can you make molecule CCc1noc(C)c1C[NH+](C[C@@H]1CCCCO1)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCc1noc(C)c1C[NH+](C[C@@H]1CC=C(Cl)S1)C(C)C | CCc1noc(C)c1C[NH+](C[C@@H]1CCCCO1)C(C)C | CCc1noc(C)c1C[NH+](C[C@@H]1CC=C(Cl)S1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC=C(Cl)S1",
"old_substring": "[C@@H]15CCCCO1"
} |
Can you make molecule CCc1noc(C)c1C[NH+](C[C@@H]1CCCCO1)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCc1noc(C)c1C[NH+](C[C@@H]1CC12CCC2)C(C)C | CCc1noc(C)c1C[NH+](C[C@@H]1CCCCO1)C(C)C | CCc1noc(C)c1C[NH+](C[C@@H]1CC12CCC2)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC12CCC2",
"old_substring": "[C@@H]15CCCCO1"
} |
Can you make molecule CCc1noc(C)c1C[NH+](C[C@@H]1CCCCO1)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCc1noc(C)c1C[NH+](C[C@@H]1CCCS[C@H]1C)C(C)C | CCc1noc(C)c1C[NH+](C[C@@H]1CCCCO1)C(C)C | CCc1noc(C)c1C[NH+](C[C@@H]1CCCS[C@H]1C)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCS[C@H]1C",
"old_substring": "[C@@H]15CCCCO1"
} |
Can you make molecule CCc1noc(C)c1C[NH+](C[C@@H]1CCCCO1)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCc1noc(C)c1C[NH+](C[C@@H]1CCSS1)C(C)C | CCc1noc(C)c1C[NH+](C[C@@H]1CCCCO1)C(C)C | CCc1noc(C)c1C[NH+](C[C@@H]1CCSS1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCSS1",
"old_substring": "[C@@H]15CCCCO1"
} |
Can you make molecule Cc1ccccc1Oc1cc(Br)ccc1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1-c1ccc(O)c(-c2cc(Br)ccc2C[NH3+])c2onc1-2 | Cc1ccccc1Oc1cc(Br)ccc1C[NH3+] | Cc1ccccc1-c1ccc(O)c(-c2cc(Br)ccc2C[NH3+])c2onc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "Oc1ccc2c&noc2c1&",
"old_substring": "O23"
} |
Can you make molecule Cc1ccccc1Oc1cc(Br)ccc1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1N1CCOc2ccc(-c3cc(Br)ccc3C[NH3+])cc2C1 | Cc1ccccc1Oc1cc(Br)ccc1C[NH3+] | Cc1ccccc1N1CCOc2ccc(-c3cc(Br)ccc3C[NH3+])cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccc&cc2C1",
"old_substring": "O23"
} |
Can you make molecule Cc1ccccc1Oc1cc(Br)ccc1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1-c1cc2ccc-2ncn(-c2cc(Br)ccc2C[NH3+])c1=O | Cc1ccccc1Oc1cc(Br)ccc1C[NH3+] | Cc1ccccc1-c1cc2ccc-2ncn(-c2cc(Br)ccc2C[NH3+])c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cc&ccc2ncn1&",
"old_substring": "O23"
} |
Can you make molecule Cc1ccccc1Oc1cc(Br)ccc1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1-c1ccc2nc-2ccn(-c2cc(Br)ccc2C[NH3+])c1=O | Cc1ccccc1Oc1cc(Br)ccc1C[NH3+] | Cc1ccccc1-c1ccc2nc-2ccn(-c2cc(Br)ccc2C[NH3+])c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2ccc&nc2ccn1&",
"old_substring": "O23"
} |
Can you make molecule Cc1ccccc1Oc1cc(Br)ccc1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1-c1cnc2nc-2ccn(-c2cc(Br)ccc2C[NH3+])c1=O | Cc1ccccc1Oc1cc(Br)ccc1C[NH3+] | Cc1ccccc1-c1cnc2nc-2ccn(-c2cc(Br)ccc2C[NH3+])c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cnc&nc2ccn1&",
"old_substring": "O23"
} |
Can you make molecule CCc1cccc(CC)c1NC(=O)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cccc(CC)c1NC(=O)CC(C)(C)NC1CC1 | CCc1cccc(CC)c1NC(=O)NC1CC1 | CCc1cccc(CC)c1NC(=O)CC(C)(C)NC1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CCc1cccc(CC)c1NC(=O)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cccc(CC)c1NC(=O)CCC(C)(C)NC1CC1 | CCc1cccc(CC)c1NC(=O)NC1CC1 | CCc1cccc(CC)c1NC(=O)CCC(C)(C)NC1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CCc1cccc(CC)c1NC(=O)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cccc(CC)c1NC(=O)C[C@@H](Br)NC1CC1 | CCc1cccc(CC)c1NC(=O)NC1CC1 | CCc1cccc(CC)c1NC(=O)C[C@@H](Br)NC1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule CCc1cccc(CC)c1NC(=O)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cccc(CC)c1Nc1cc(C)n(NC2CC2)c(=O)c1 | CCc1cccc(CC)c1NC(=O)NC1CC1 | CCc1cccc(CC)c1Nc1cc(C)n(NC2CC2)c(=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C23=O"
} |
Can you make molecule CCc1cccc(CC)c1NC(=O)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cccc(CC)c1Nc1c(C)n(NC2CC2)ccc1=O | CCc1cccc(CC)c1NC(=O)NC1CC1 | CCc1cccc(CC)c1Nc1c(C)n(NC2CC2)ccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C23=O"
} |
Can you make molecule CC[NH+]1CCN(C2(CNC(=O)c3ccccc3Br)CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CCCNC(=O)c1ccccc1Br)N1CC[NH+](CC)CC1 | CC[NH+]1CCN(C2(CNC(=O)c3ccccc3Br)CCCCC2)CC1 | CCCC[C@@H](CCCNC(=O)c1ccccc1Br)N1CC[NH+](CC)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&CC&",
"old_substring": "C169CCCCC1"
} |
Can you make molecule CC[NH+]1CCN(C2(CNC(=O)c3ccccc3Br)CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CCN(c2c(C)c(C)c(CNC(=O)c3ccccc3Br)c(C)c2C)CC1 | CC[NH+]1CCN(C2(CNC(=O)c3ccccc3Br)CCCCC2)CC1 | CC[NH+]1CCN(c2c(C)c(C)c(CNC(=O)c3ccccc3Br)c(C)c2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(C)c(C)c&c1C",
"old_substring": "C169CCCCC1"
} |
Can you make molecule CC[NH+]1CCN(C2(CNC(=O)c3ccccc3Br)CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CCN(c2cc(CNC(=O)c3ccccc3Br)cc3c2CCC3(C)C)CC1 | CC[NH+]1CCN(C2(CNC(=O)c3ccccc3Br)CCCCC2)CC1 | CC[NH+]1CCN(c2cc(CNC(=O)c3ccccc3Br)cc3c2CCC3(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc2c1CCC2(C)C",
"old_substring": "C169CCCCC1"
} |
Can you make molecule CC[NH+]1CCN(C2(CNC(=O)c3ccccc3Br)CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CCN(c2ccc3sc(CNC(=O)c4ccccc4Br)c(C)c3c2)CC1 | CC[NH+]1CCN(C2(CNC(=O)c3ccccc3Br)CCCCC2)CC1 | CC[NH+]1CCN(c2ccc3sc(CNC(=O)c4ccccc4Br)c(C)c3c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2sc&c(C)c2c1",
"old_substring": "C169CCCCC1"
} |
Can you make molecule CC[NH+]1CCN(C2(CNC(=O)c3ccccc3Br)CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CCN(c2cc(CNC(=O)c3ccccc3Br)c(Cl)cc2Cl)CC1 | CC[NH+]1CCN(C2(CNC(=O)c3ccccc3Br)CCCCC2)CC1 | CC[NH+]1CCN(c2cc(CNC(=O)c3ccccc3Br)c(Cl)cc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c(Cl)cc1Cl",
"old_substring": "C169CCCCC1"
} |
Can you make molecule CCCCn1nc(C)c(C[NH2+]C[C@@H](C)O)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCCCn1nc(C)c(C2=CC=C([NH2+]C[C@@H](C)O)N3CCC3=C2)c1Cl | CCCCn1nc(C)c(C[NH2+]C[C@@H](C)O)c1Cl | CCCCn1nc(C)c(C2=CC=C([NH2+]C[C@@H](C)O)N3CCC3=C2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "C25"
} |
Can you make molecule CCCCn1nc(C)c(C[NH2+]C[C@@H](C)O)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCCCn1nc(C)c(-c2ncnc3sc-3c(C)c2[NH2+]C[C@@H](C)O)c1Cl | CCCCn1nc(C)c(C[NH2+]C[C@@H](C)O)c1Cl | CCCCn1nc(C)c(-c2ncnc3sc-3c(C)c2[NH2+]C[C@@H](C)O)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&sc2ncnc&c12",
"old_substring": "C25"
} |
Can you make molecule CCCCn1nc(C)c(C[NH2+]C[C@@H](C)O)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCCCn1nc(C)c(C2=CC=C3SCCN3C([NH2+]C[C@@H](C)O)=C2)c1Cl | CCCCn1nc(C)c(C[NH2+]C[C@@H](C)O)c1Cl | CCCCn1nc(C)c(C2=CC=C3SCCN3C([NH2+]C[C@@H](C)O)=C2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "C25"
} |
Can you make molecule CCCCn1nc(C)c(C[NH2+]C[C@@H](C)O)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCCCn1nc(C)c(C2=C3CCN3CC([NH2+]C[C@@H](C)O)=CC=C2)c1Cl | CCCCn1nc(C)c(C[NH2+]C[C@@H](C)O)c1Cl | CCCCn1nc(C)c(C2=C3CCN3CC([NH2+]C[C@@H](C)O)=CC=C2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c&cccc2C1",
"old_substring": "C25"
} |
Can you make molecule CCCCn1nc(C)c(C[NH2+]C[C@@H](C)O)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCCCn1nc(C)c(-c2ccc([NH2+]C[C@@H](C)O)c(C)c3sc-3n2)c1Cl | CCCCn1nc(C)c(C[NH2+]C[C@@H](C)O)c1Cl | CCCCn1nc(C)c(-c2ccc([NH2+]C[C@@H](C)O)c(C)c3sc-3n2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&sc2nc&ccc12",
"old_substring": "C25"
} |
Can you make molecule CC=CC=CC(=O)N1C[C@H](C)[C@H](C(=O)OC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC=CC=CC(=O)N1C[C@@H](CC(=O)SOC)[C@@H](C)C1 | CC=CC=CC(=O)N1C[C@H](C)[C@H](C(=O)OC)C1 | CC=CC=CC(=O)N1C[C@@H](CC(=O)SOC)[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule CC=CC=CC(=O)N1C[C@H](C)[C@H](C(=O)OC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC=CC=CC(=O)N1C[C@@H](CC(=C=O)COC)[C@@H](C)C1 | CC=CC=CC(=O)N1C[C@H](C)[C@H](C(=O)OC)C1 | CC=CC=CC(=O)N1C[C@@H](CC(=C=O)COC)[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule CC=CC=CC(=O)N1C[C@H](C)[C@H](C(=O)OC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC=CC=CC(=O)N1C[C@H](C)[C@H](C(=O)CCCC(=O)OC)C1 | CC=CC=CC(=O)N1C[C@H](C)[C@H](C(=O)OC)C1 | CC=CC=CC(=O)N1C[C@H](C)[C@H](C(=O)CCCC(=O)OC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C24=O"
} |
Can you make molecule CC=CC=CC(=O)N1C[C@H](C)[C@H](C(=O)OC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC=CC=CC(=O)N1C[C@@H](C(C)(C)CC(=O)OC)[C@@H](C)C1 | CC=CC=CC(=O)N1C[C@H](C)[C@H](C(=O)OC)C1 | CC=CC=CC(=O)N1C[C@@H](C(C)(C)CC(=O)OC)[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule CC=CC=CC(=O)N1C[C@H](C)[C@H](C(=O)OC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC=CC=CC(=O)N1C[C@@H](CCC[S@@+]([O-])COC)[C@@H](C)C1 | CC=CC=CC(=O)N1C[C@H](C)[C@H](C(=O)OC)C1 | CC=CC=CC(=O)N1C[C@@H](CCC[S@@+]([O-])COC)[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C24=O"
} |
Can you make molecule COc1cccc(OC)c1OC1CC[NH+](Cc2ccc([C@H]3C[C@@H]3C)o2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(OC)c1OC1CC[NH+](Cc2ccco2)CC1.I[C@@H]1[CH]CCCC1 | COc1cccc(OC)c1OC1CC[NH+](Cc2ccc([C@H]3C[C@@H]3C)o2)CC1 | COc1cccc(OC)c1OC1CC[NH+](Cc2ccco2)CC1.I[C@@H]1[CH]CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@@H]1I",
"old_substring": "[C@H]1%10C[C@@H]1C"
} |
Can you make molecule COc1cccc(OC)c1OC1CC[NH+](Cc2ccc([C@H]3C[C@@H]3C)o2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(OC)c1OC1CC[NH+](Cc2ccco2)CC1.[CH]1CSCCS1 | COc1cccc(OC)c1OC1CC[NH+](Cc2ccc([C@H]3C[C@@H]3C)o2)CC1 | COc1cccc(OC)c1OC1CC[NH+](Cc2ccco2)CC1.[CH]1CSCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CSCCS1",
"old_substring": "[C@H]1%10C[C@@H]1C"
} |
Can you make molecule COc1cccc(OC)c1OC1CC[NH+](Cc2ccc([C@H]3C[C@@H]3C)o2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(OC)c1OC1CC[NH+](Cc2ccco2)CC1.[CH]1CC=CS1 | COc1cccc(OC)c1OC1CC[NH+](Cc2ccc([C@H]3C[C@@H]3C)o2)CC1 | COc1cccc(OC)c1OC1CC[NH+](Cc2ccco2)CC1.[CH]1CC=CS1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC=CS1",
"old_substring": "[C@H]1%10C[C@@H]1C"
} |
Can you make molecule COc1cccc(OC)c1OC1CC[NH+](Cc2ccc([C@H]3C[C@@H]3C)o2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(OC)c1OC1CC[NH+](Cc2ccco2)CC1.C[C@H]1[CH]CCCS1 | COc1cccc(OC)c1OC1CC[NH+](Cc2ccc([C@H]3C[C@@H]3C)o2)CC1 | COc1cccc(OC)c1OC1CC[NH+](Cc2ccco2)CC1.C[C@H]1[CH]CCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCS[C@H]1C",
"old_substring": "[C@H]1%10C[C@@H]1C"
} |
Can you make molecule COc1cccc(OC)c1OC1CC[NH+](Cc2ccc([C@H]3C[C@@H]3C)o2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(OC)c1OC1CC[NH+](Cc2ccco2)CC1.[CH]1CCCSC1 | COc1cccc(OC)c1OC1CC[NH+](Cc2ccc([C@H]3C[C@@H]3C)o2)CC1 | COc1cccc(OC)c1OC1CC[NH+](Cc2ccco2)CC1.[CH]1CCCSC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCSC1",
"old_substring": "[C@H]1%10C[C@@H]1C"
} |
Can you make molecule COC(=O)c1cc(CSc2nnc(-c3cccnc3)n2-c2ccccc2F)oc1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(CSc2nncn2-c2ccccc2F)oc1C.c1ccccc1 | COC(=O)c1cc(CSc2nnc(-c3cccnc3)n2-c2ccccc2F)oc1C | COC(=O)c1cc(CSc2nncn2-c2ccccc2F)oc1C.c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c1%10cccnc1"
} |
Can you make molecule COC(=O)c1cc(CSc2nnc(-c3cccnc3)n2-c2ccccc2F)oc1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(CSc2nncn2-c2ccccc2F)oc1C.Fc1cccnc1 | COC(=O)c1cc(CSc2nnc(-c3cccnc3)n2-c2ccccc2F)oc1C | COC(=O)c1cc(CSc2nncn2-c2ccccc2F)oc1C.Fc1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "Fc1ccc&nc1",
"old_substring": "c1%10cccnc1"
} |
Can you make molecule COC(=O)c1cc(CSc2nnc(-c3cccnc3)n2-c2ccccc2F)oc1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(CSc2nncn2-c2ccccc2F)oc1C.Cc1cccnc1 | COC(=O)c1cc(CSc2nnc(-c3cccnc3)n2-c2ccccc2F)oc1C | COC(=O)c1cc(CSc2nncn2-c2ccccc2F)oc1C.Cc1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1C",
"old_substring": "c1%10cccnc1"
} |
Can you make molecule COC(=O)c1cc(CSc2nnc(-c3cccnc3)n2-c2ccccc2F)oc1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(CSc2nncn2-c2ccccc2F)oc1C.Ic1ccccn1 | COC(=O)c1cc(CSc2nnc(-c3cccnc3)n2-c2ccccc2F)oc1C | COC(=O)c1cc(CSc2nncn2-c2ccccc2F)oc1C.Ic1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)nc1",
"old_substring": "c1%10cccnc1"
} |
Can you make molecule COC(=O)c1cc(CSc2nnc(-c3cccnc3)n2-c2ccccc2F)oc1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(CSc2nncn2-c2ccccc2F)oc1C.c1cc2cnsc2s1 | COC(=O)c1cc(CSc2nnc(-c3cccnc3)n2-c2ccccc2F)oc1C | COC(=O)c1cc(CSc2nncn2-c2ccccc2F)oc1C.c1cc2cnsc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cnsc2s1",
"old_substring": "c1%10cccnc1"
} |
Can you make molecule CCOc1ccc2cc(C(=O)NCc3ccccc3)c(=[NH2+])oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc2cc(C(=O)NCc3ccccc3Cl)c(=[NH2+])oc2c1 | CCOc1ccc2cc(C(=O)NCc3ccccc3)c(=[NH2+])oc2c1 | CCOc1ccc2cc(C(=O)NCc3ccccc3Cl)c(=[NH2+])oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c19ccccc1"
} |
Can you make molecule CCOc1ccc2cc(C(=O)NCc3ccccc3)c(=[NH2+])oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc2cc(C(=O)NCc3ccc(I)cc3)c(=[NH2+])oc2c1 | CCOc1ccc2cc(C(=O)NCc3ccccc3)c(=[NH2+])oc2c1 | CCOc1ccc2cc(C(=O)NCc3ccc(I)cc3)c(=[NH2+])oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c19ccccc1"
} |
Can you make molecule CCOc1ccc2cc(C(=O)NCc3ccccc3)c(=[NH2+])oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc2cc(C(=O)NCc3ccc(C)c(I)c3)c(=[NH2+])oc2c1 | CCOc1ccc2cc(C(=O)NCc3ccccc3)c(=[NH2+])oc2c1 | CCOc1ccc2cc(C(=O)NCc3ccc(C)c(I)c3)c(=[NH2+])oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c19ccccc1"
} |
Can you make molecule CCOc1ccc2cc(C(=O)NCc3ccccc3)c(=[NH2+])oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc2cc(C(=O)NCc3cccc(Br)c3)c(=[NH2+])oc2c1 | CCOc1ccc2cc(C(=O)NCc3ccccc3)c(=[NH2+])oc2c1 | CCOc1ccc2cc(C(=O)NCc3cccc(Br)c3)c(=[NH2+])oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c19ccccc1"
} |
Can you make molecule CCOc1ccc2cc(C(=O)NCc3ccccc3)c(=[NH2+])oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc2cc(C(=O)NCc3cccc(C)c3C)c(=[NH2+])oc2c1 | CCOc1ccc2cc(C(=O)NCc3ccccc3)c(=[NH2+])oc2c1 | CCOc1ccc2cc(C(=O)NCc3cccc(C)c3C)c(=[NH2+])oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c19ccccc1"
} |
Can you make molecule O[C@H]1CCN(c2ccnc(N3CCc4[nH]c5ccc(Cl)cc5c4C3)n2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H]1CCN(c2ccn(N3CCc4[nH]c5ccc(Cl)cc5c4C3)c2)C1 | O[C@H]1CCN(c2ccnc(N3CCc4[nH]c5ccc(Cl)cc5c4C3)n2)C1 | O[C@H]1CCN(c2ccn(N3CCc4[nH]c5ccc(Cl)cc5c4C3)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccn&c1",
"old_substring": "c16ccnc7n1"
} |
Can you make molecule O[C@H]1CCN(c2ccnc(N3CCc4[nH]c5ccc(Cl)cc5c4C3)n2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H]1CCN(c2nc(N3CCc4[nH]c5ccc(Cl)cc5c4C3)ncc2I)C1 | O[C@H]1CCN(c2ccnc(N3CCc4[nH]c5ccc(Cl)cc5c4C3)n2)C1 | O[C@H]1CCN(c2nc(N3CCc4[nH]c5ccc(Cl)cc5c4C3)ncc2I)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1I",
"old_substring": "c16ccnc7n1"
} |
Can you make molecule O[C@H]1CCN(c2ccnc(N3CCc4[nH]c5ccc(Cl)cc5c4C3)n2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H]1CCN(c2ccnc(N3CCc4[nH]c5ccc(Cl)cc5c4C3)c2)C1 | O[C@H]1CCN(c2ccnc(N3CCc4[nH]c5ccc(Cl)cc5c4C3)n2)C1 | O[C@H]1CCN(c2ccnc(N3CCc4[nH]c5ccc(Cl)cc5c4C3)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccnc&c1",
"old_substring": "c16ccnc7n1"
} |
Can you make molecule O[C@H]1CCN(c2ccnc(N3CCc4[nH]c5ccc(Cl)cc5c4C3)n2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H]1CCN(c2csc3nc(N4CCc5[nH]c6ccc(Cl)cc6c5C4)cn23)C1 | O[C@H]1CCN(c2ccnc(N3CCc4[nH]c5ccc(Cl)cc5c4C3)n2)C1 | O[C@H]1CCN(c2csc3nc(N4CCc5[nH]c6ccc(Cl)cc6c5C4)cn23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc2nc&cn12",
"old_substring": "c16ccnc7n1"
} |
Can you make molecule O[C@H]1CCN(c2ccnc(N3CCc4[nH]c5ccc(Cl)cc5c4C3)n2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H]1CCN(c2cc(N3CCc4[nH]c5ccc(Cl)cc5c4C3)nc(Cl)n2)C1 | O[C@H]1CCN(c2ccnc(N3CCc4[nH]c5ccc(Cl)cc5c4C3)n2)C1 | O[C@H]1CCN(c2cc(N3CCc4[nH]c5ccc(Cl)cc5c4C3)nc(Cl)n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&nc(Cl)n1",
"old_substring": "c16ccnc7n1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.