prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)NC3CC3)n2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)NC3SCCS3)n2n1 | Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)NC3CC3)n2n1 | Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)NC3SCCS3)n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C16CC1"
} |
Can you make molecule Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)NC3CC3)n2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)N=C3CCC3)n2n1 | Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)NC3CC3)n2n1 | Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)N=C3CCC3)n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCC1",
"old_substring": "C16CC1"
} |
Can you make molecule Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)NC3CC3)n2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)NC3CCCCC3)n2n1 | Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)NC3CC3)n2n1 | Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)NC3CCCCC3)n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)NC3CC3)n2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)N=C3CCCC3)n2n1 | Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)NC3CC3)n2n1 | Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)N=C3CCCC3)n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)NC3CC3)n2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)NC3SCCCS3)n2n1 | Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)NC3CC3)n2n1 | Cc1cc(C)c2c(-c3ccccc3)nc(SCC(=O)NC3SCCCS3)n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C16CC1"
} |
Can you make molecule COc1cc2c(cc1OC)[C@H](C(=O)[O-])[C@H](c1cccc(Cl)c1)N(C)C2=O less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc2c(cc1OC)[C@H](C(=O)[O-])[C@H](c1cccc(Cl)c1)N(C)C2=O | COc1cc2c(cc1OC)[C@H](C(=O)[O-])[C@H](c1cccc(Cl)c1)N(C)C2=O | COCc1cc2c(cc1OC)[C@H](C(=O)[O-])[C@H](c1cccc(Cl)c1)N(C)C2=O | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc2c(cc1OC)[C@H](C(=O)[O-])[C@H](c1cccc(Cl)c1)N(C)C2=O less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc2c(cc1OC)[C@H](C(=O)[O-])[C@H](c1cccc(Cl)c1)N(C)C2=O | COc1cc2c(cc1OC)[C@H](C(=O)[O-])[C@H](c1cccc(Cl)c1)N(C)C2=O | COCSc1cc2c(cc1OC)[C@H](C(=O)[O-])[C@H](c1cccc(Cl)c1)N(C)C2=O | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc2c(cc1OC)[C@H](C(=O)[O-])[C@H](c1cccc(Cl)c1)N(C)C2=O less soluble in water? The output molecule should be similar to the input molecule. | COc1cc2c(cc1SC(C)=O)C(=O)N(C)[C@@H](c1cccc(Cl)c1)[C@H]2C(=O)[O-] | COc1cc2c(cc1OC)[C@H](C(=O)[O-])[C@H](c1cccc(Cl)c1)N(C)C2=O | COc1cc2c(cc1SC(C)=O)C(=O)N(C)[C@@H](c1cccc(Cl)c1)[C@H]2C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc2c(cc1OC)[C@H](C(=O)[O-])[C@H](c1cccc(Cl)c1)N(C)C2=O less soluble in water? The output molecule should be similar to the input molecule. | COc1cc2c(cc1C(=O)CS)C(=O)N(C)[C@@H](c1cccc(Cl)c1)[C@H]2C(=O)[O-] | COc1cc2c(cc1OC)[C@H](C(=O)[O-])[C@H](c1cccc(Cl)c1)N(C)C2=O | COc1cc2c(cc1C(=O)CS)C(=O)N(C)[C@@H](c1cccc(Cl)c1)[C@H]2C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1cc2c(cc1OC)[C@H](C(=O)[O-])[C@H](c1cccc(Cl)c1)N(C)C2=O less soluble in water? The output molecule should be similar to the input molecule. | COc1cc2c(cc1C(=O)CI)C(=O)N(C)[C@@H](c1cccc(Cl)c1)[C@H]2C(=O)[O-] | COc1cc2c(cc1OC)[C@H](C(=O)[O-])[C@H](c1cccc(Cl)c1)N(C)C2=O | COc1cc2c(cc1C(=O)CI)C(=O)N(C)[C@@H](c1cccc(Cl)c1)[C@H]2C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule COCCN1C(=O)CC[C@@H]2C[NH+](Cc3cc(C)ccc3C)CC[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | COCSCCN1C(=O)CC[C@@H]2C[NH+](Cc3cc(C)ccc3C)CC[C@@H]21 | COCCN1C(=O)CC[C@@H]2C[NH+](Cc3cc(C)ccc3C)CC[C@@H]21 | COCSCCN1C(=O)CC[C@@H]2C[NH+](Cc3cc(C)ccc3C)CC[C@@H]21 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COCCN1C(=O)CC[C@@H]2C[NH+](Cc3cc(C)ccc3C)CC[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SCCN1C(=O)CC[C@@H]2C[NH+](Cc3cc(C)ccc3C)CC[C@@H]21 | COCCN1C(=O)CC[C@@H]2C[NH+](Cc3cc(C)ccc3C)CC[C@@H]21 | CC(=O)SCCN1C(=O)CC[C@@H]2C[NH+](Cc3cc(C)ccc3C)CC[C@@H]21 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COCCN1C(=O)CC[C@@H]2C[NH+](Cc3cc(C)ccc3C)CC[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(C[NH+]2CC[C@H]3[C@H](CCC(=O)N3CCC(=O)CI)C2)c1 | COCCN1C(=O)CC[C@@H]2C[NH+](Cc3cc(C)ccc3C)CC[C@@H]21 | Cc1ccc(C)c(C[NH+]2CC[C@H]3[C@H](CCC(=O)N3CCC(=O)CI)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule COCCN1C(=O)CC[C@@H]2C[NH+](Cc3cc(C)ccc3C)CC[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(C[NH+]2CC[C@H]3[C@H](CCC(=O)N3CCC3OCCCO3)C2)c1 | COCCN1C(=O)CC[C@@H]2C[NH+](Cc3cc(C)ccc3C)CC[C@@H]21 | Cc1ccc(C)c(C[NH+]2CC[C@H]3[C@H](CCC(=O)N3CCC3OCCCO3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCCCO1",
"old_substring": "CO4"
} |
Can you make molecule COCCN1C(=O)CC[C@@H]2C[NH+](Cc3cc(C)ccc3C)CC[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(C[NH+]2CC[C@H]3[C@H](CCC(=O)N3CCC(=O)CCl)C2)c1 | COCCN1C(=O)CC[C@@H]2C[NH+](Cc3cc(C)ccc3C)CC[C@@H]21 | Cc1ccc(C)c(C[NH+]2CC[C@H]3[C@H](CCC(=O)N3CCC(=O)CCl)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCl",
"old_substring": "CO4"
} |
Can you make molecule Cc1cnc([C@H](C)NC(=O)NNC(=O)Nc2ccccc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(CCC[C@@H](CCl)NC(=O)NNC(=O)Nc2ccccc2)s1 | Cc1cnc([C@H](C)NC(=O)NNC(=O)Nc2ccccc2)s1 | Cc1cnc(CCC[C@@H](CCl)NC(=O)NNC(=O)Nc2ccccc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]57C"
} |
Can you make molecule Cc1cnc([C@H](C)NC(=O)NNC(=O)Nc2ccccc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(CCC2=CN=N[C@H]2NC(=O)NNC(=O)Nc2ccccc2)s1 | Cc1cnc([C@H](C)NC(=O)NNC(=O)Nc2ccccc2)s1 | Cc1cnc(CCC2=CN=N[C@H]2NC(=O)NNC(=O)Nc2ccccc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=NC=C1CC&",
"old_substring": "[C@@H]57C"
} |
Can you make molecule Cc1cnc([C@H](C)NC(=O)NNC(=O)Nc2ccccc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc([C@@H]2CC[C@@H](NC(=O)NNC(=O)Nc3ccccc3)C2)s1 | Cc1cnc([C@H](C)NC(=O)NNC(=O)Nc2ccccc2)s1 | Cc1cnc([C@@H]2CC[C@@H](NC(=O)NNC(=O)Nc3ccccc3)C2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]57C"
} |
Can you make molecule Cc1cnc([C@H](C)NC(=O)NNC(=O)Nc2ccccc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(CC(C)(C)[C@@H](C)NC(=O)NNC(=O)Nc2ccccc2)s1 | Cc1cnc([C@H](C)NC(=O)NNC(=O)Nc2ccccc2)s1 | Cc1cnc(CC(C)(C)[C@@H](C)NC(=O)NNC(=O)Nc2ccccc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "[C@@H]57C"
} |
Can you make molecule Cc1cnc([C@H](C)NC(=O)NNC(=O)Nc2ccccc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1ncc(C)s1)NC(=O)NNC(=O)Nc1ccccc1 | Cc1cnc([C@H](C)NC(=O)NNC(=O)Nc2ccccc2)s1 | CC[C@@H](CCc1ncc(C)s1)NC(=O)NNC(=O)Nc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@@H]57C"
} |
Can you make molecule CNC(=O)c1ccc(NC(=O)c2csc(-c3ccccc3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)c1ccc(NC(=O)c2csc(-c3ccccc3)c2)cc1 | CNC(=O)c1ccc(NC(=O)c2csc(-c3ccccc3)n2)cc1 | CNC(=O)c1ccc(NC(=O)c2csc(-c3ccccc3)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc&c1",
"old_substring": "c17csc9n1"
} |
Can you make molecule CNC(=O)c1ccc(NC(=O)c2csc(-c3ccccc3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)c1ccc(NC(=O)c2csc(-c3ccccc3)c2C)cc1 | CNC(=O)c1ccc(NC(=O)c2csc(-c3ccccc3)n2)cc1 | CNC(=O)c1ccc(NC(=O)c2csc(-c3ccccc3)c2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc&c1C",
"old_substring": "c17csc9n1"
} |
Can you make molecule CNC(=O)c1ccc(NC(=O)c2csc(-c3ccccc3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)c1ccc(NC(=O)c2ccc(-c3ccccc3)s2)cc1 | CNC(=O)c1ccc(NC(=O)c2csc(-c3ccccc3)n2)cc1 | CNC(=O)c1ccc(NC(=O)c2ccc(-c3ccccc3)s2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&s1",
"old_substring": "c17csc9n1"
} |
Can you make molecule CNC(=O)c1ccc(NC(=O)c2csc(-c3ccccc3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)c1ccc(NC(=O)c2cc(-c3ccccc3)cnc2Cl)cc1 | CNC(=O)c1ccc(NC(=O)c2csc(-c3ccccc3)n2)cc1 | CNC(=O)c1ccc(NC(=O)c2cc(-c3ccccc3)cnc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cnc1Cl",
"old_substring": "c17csc9n1"
} |
Can you make molecule CNC(=O)c1ccc(NC(=O)c2csc(-c3ccccc3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)c1ccc(NC(=O)c2cc(-c3ccccc3)ncc2Cl)cc1 | CNC(=O)c1ccc(NC(=O)c2csc(-c3ccccc3)n2)cc1 | CNC(=O)c1ccc(NC(=O)c2cc(-c3ccccc3)ncc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ncc1Cl",
"old_substring": "c17csc9n1"
} |
Can you make molecule CNc1nc(C2CCN(C(=O)Cc3ccccn3)CC2)[nH+]c2c1CN(C(C)=O)CC2 less soluble in water? The output molecule should be similar to the input molecule. | CNc1nc(C2CCN(SC(=O)Cc3ccccn3)CC2)[nH+]c2c1CN(C(C)=O)CC2 | CNc1nc(C2CCN(C(=O)Cc3ccccn3)CC2)[nH+]c2c1CN(C(C)=O)CC2 | CNc1nc(C2CCN(SC(=O)Cc3ccccn3)CC2)[nH+]c2c1CN(C(C)=O)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C4(=O)C7"
} |
Can you make molecule CNc1nc(C2CCN(C(=O)Cc3ccccn3)CC2)[nH+]c2c1CN(C(C)=O)CC2 less soluble in water? The output molecule should be similar to the input molecule. | CNc1nc(C2CCN(C(=O)CCCC(=O)c3ccccn3)CC2)[nH+]c2c1CN(C(C)=O)CC2 | CNc1nc(C2CCN(C(=O)Cc3ccccn3)CC2)[nH+]c2c1CN(C(C)=O)CC2 | CNc1nc(C2CCN(C(=O)CCCC(=O)c3ccccn3)CC2)[nH+]c2c1CN(C(C)=O)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C4(=O)C7"
} |
Can you make molecule CNc1nc(C2CCN(C(=O)Cc3ccccn3)CC2)[nH+]c2c1CN(C(C)=O)CC2 less soluble in water? The output molecule should be similar to the input molecule. | CNc1nc(C2CCN(C(=O)CC(C)(C)c3ccccn3)CC2)[nH+]c2c1CN(C(C)=O)CC2 | CNc1nc(C2CCN(C(=O)Cc3ccccn3)CC2)[nH+]c2c1CN(C(C)=O)CC2 | CNc1nc(C2CCN(C(=O)CC(C)(C)c3ccccn3)CC2)[nH+]c2c1CN(C(C)=O)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)C7"
} |
Can you make molecule CNc1nc(C2CCN(C(=O)Cc3ccccn3)CC2)[nH+]c2c1CN(C(C)=O)CC2 less soluble in water? The output molecule should be similar to the input molecule. | CNc1nc(C2CCN(C[S@+]([O-])CCCc3ccccn3)CC2)[nH+]c2c1CN(C(C)=O)CC2 | CNc1nc(C2CCN(C(=O)Cc3ccccn3)CC2)[nH+]c2c1CN(C(C)=O)CC2 | CNc1nc(C2CCN(C[S@+]([O-])CCCc3ccccn3)CC2)[nH+]c2c1CN(C(C)=O)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C4(=O)C7"
} |
Can you make molecule CNc1nc(C2CCN(C(=O)Cc3ccccn3)CC2)[nH+]c2c1CN(C(C)=O)CC2 less soluble in water? The output molecule should be similar to the input molecule. | CNc1nc(C2CCN(C(=O)CCC(C)(C)c3ccccn3)CC2)[nH+]c2c1CN(C(C)=O)CC2 | CNc1nc(C2CCN(C(=O)Cc3ccccn3)CC2)[nH+]c2c1CN(C(C)=O)CC2 | CNc1nc(C2CCN(C(=O)CCC(C)(C)c3ccccn3)CC2)[nH+]c2c1CN(C(C)=O)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C4(=O)C7"
} |
Can you make molecule Cc1cc(C)n(C[C@@H](C)CNC(=O)NCc2cc3ccccc3o2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)n1C[C@@H](C)CNC(=O)NCc1cc2ccccc2o1 | Cc1cc(C)n(C[C@@H](C)CNC(=O)NCc2cc3ccccc3o2)n1 | Cc1ccc(C)n1C[C@@H](C)CNC(=O)NCc1cc2ccccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(C)n1&",
"old_substring": "Cc1cc(C)n8n1"
} |
Can you make molecule Cc1cc(C)n(C[C@@H](C)CNC(=O)NCc2cc3ccccc3o2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c(C[C@@H](C)CNC(=O)NCc2cc3ccccc3o2)cn1 | Cc1cc(C)n(C[C@@H](C)CNC(=O)NCc2cc3ccccc3o2)n1 | Cc1cc(C)c(C[C@@H](C)CNC(=O)NCc2cc3ccccc3o2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(C)c&cn1",
"old_substring": "Cc1cc(C)n8n1"
} |
Can you make molecule Cc1cc(C)n(C[C@@H](C)CNC(=O)NCc2cc3ccccc3o2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C[C@@H](C)CNC(=O)NCc2cc3ccccc3o2)c(C)n1C | Cc1cc(C)n(C[C@@H](C)CNC(=O)NCc2cc3ccccc3o2)n1 | Cc1cc(C[C@@H](C)CNC(=O)NCc2cc3ccccc3o2)c(C)n1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)n1C",
"old_substring": "Cc1cc(C)n8n1"
} |
Can you make molecule Cc1cc(C)n(C[C@@H](C)CNC(=O)NCc2cc3ccccc3o2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cl)cnc1C[C@@H](C)CNC(=O)NCc1cc2ccccc2o1 | Cc1cc(C)n(C[C@@H](C)CNC(=O)NCc2cc3ccccc3o2)n1 | Cc1cc(Cl)cnc1C[C@@H](C)CNC(=O)NCc1cc2ccccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(Cl)cnc1&",
"old_substring": "Cc1cc(C)n8n1"
} |
Can you make molecule Cc1cc(C)n(C[C@@H](C)CNC(=O)NCc2cc3ccccc3o2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C=C[C@@H](C)CNC(=O)NCc2cc3ccccc3o2)n1 | Cc1cc(C)n(C[C@@H](C)CNC(=O)NCc2cc3ccccc3o2)n1 | Cc1cccc(C=C[C@@H](C)CNC(=O)NCc2cc3ccccc3o2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cccc(C=&)n1",
"old_substring": "Cc1cc(C)n8n1"
} |
Can you make molecule Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)CN(C)Cc1ccccc1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)C[C@H](N)CCCc1ccccc1)CC2 | Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)CN(C)Cc1ccccc1)CC2 | Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)C[C@H](N)CCCc1ccccc1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N[C@@H]&CC&",
"old_substring": "N45C"
} |
Can you make molecule Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)CN(C)Cc1ccccc1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)CC/N=C(\N)SCc1ccccc1)CC2 | Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)CN(C)Cc1ccccc1)CC2 | Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)CC/N=C(\N)SCc1ccccc1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N/C(=N\\C&)S&",
"old_substring": "N45C"
} |
Can you make molecule Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)CN(C)Cc1ccccc1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)Cc1cc(C#N)c(Cc3ccccc3)s1)CC2 | Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)CN(C)Cc1ccccc1)CC2 | Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)Cc1cc(C#N)c(Cc3ccccc3)s1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N45C"
} |
Can you make molecule Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)CN(C)Cc1ccccc1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)Cc1ccc(Cc3ccccc3)c(C#N)c1)CC2 | Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)CN(C)Cc1ccccc1)CC2 | Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)Cc1ccc(Cc3ccccc3)c(C#N)c1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N45C"
} |
Can you make molecule Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)CN(C)Cc1ccccc1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)CON=C1CCN(Cc3ccccc3)CC1)CC2 | Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)CN(C)Cc1ccccc1)CC2 | Cc1nc2n(n1)C[C@H]([NH2+]C[C@@H](O)CON=C1CCN(Cc3ccccc3)CC1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N45C"
} |
Can you make molecule c1ccc(Cn2c(SCc3ncon3)nnc2-c2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccccc1Cn1c(SCc2ncon2)nnc1-c1cccs1 | c1ccc(Cn2c(SCc3ncon3)nnc2-c2cccs2)cc1 | Clc1ccccc1Cn1c(SCc2ncon2)nnc1-c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c1ccc7cc1"
} |
Can you make molecule c1ccc(Cn2c(SCc3ncon3)nnc2-c2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Ic1ccc(Cn2c(SCc3ncon3)nnc2-c2cccs2)cc1 | c1ccc(Cn2c(SCc3ncon3)nnc2-c2cccs2)cc1 | Ic1ccc(Cn2c(SCc3ncon3)nnc2-c2cccs2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c1ccc7cc1"
} |
Can you make molecule c1ccc(Cn2c(SCc3ncon3)nnc2-c2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C(=Cn1c(SCc2ncon2)nnc1-c1cccs1)c1ccccc1 | c1ccc(Cn2c(SCc3ncon3)nnc2-c2cccs2)cc1 | C(=Cn1c(SCc2ncon2)nnc1-c1cccs1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccccc1",
"old_substring": "c1ccc7cc1"
} |
Can you make molecule c1ccc(Cn2c(SCc3ncon3)nnc2-c2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cn2c(SCc3ncon3)nnc2-c2cccs2)cc1I | c1ccc(Cn2c(SCc3ncon3)nnc2-c2cccs2)cc1 | Cc1ccc(Cn2c(SCc3ncon3)nnc2-c2cccs2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c1ccc7cc1"
} |
Can you make molecule c1ccc(Cn2c(SCc3ncon3)nnc2-c2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Brc1cccc(Cn2c(SCc3ncon3)nnc2-c2cccs2)c1 | c1ccc(Cn2c(SCc3ncon3)nnc2-c2cccs2)cc1 | Brc1cccc(Cn2c(SCc3ncon3)nnc2-c2cccs2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c1ccc7cc1"
} |
Can you make molecule COc1ccc(-n2nc(C)c3c2C[C@H](c2cc(OC)c(OC)c(OC)c2)CC3=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(-n2nc(C)c3c2C[C@H](c2cc(OC)c(OC)c(OC)c2)CC3=O)cc1 | COc1ccc(-n2nc(C)c3c2C[C@H](c2cc(OC)c(OC)c(OC)c2)CC3=O)cc1 | COCc1ccc(-n2nc(C)c3c2C[C@H](c2cc(OC)c(OC)c(OC)c2)CC3=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(-n2nc(C)c3c2C[C@H](c2cc(OC)c(OC)c(OC)c2)CC3=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(-n2nc(C)c3c2C[C@H](c2cc(OC)c(OC)c(OC)c2)CC3=O)cc1 | COc1ccc(-n2nc(C)c3c2C[C@H](c2cc(OC)c(OC)c(OC)c2)CC3=O)cc1 | COCSc1ccc(-n2nc(C)c3c2C[C@H](c2cc(OC)c(OC)c(OC)c2)CC3=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(-n2nc(C)c3c2C[C@H](c2cc(OC)c(OC)c(OC)c2)CC3=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@@H]2CC(=O)c3c(C)nn(-c4ccc(SC(C)=O)cc4)c3C2)cc(OC)c1OC | COc1ccc(-n2nc(C)c3c2C[C@H](c2cc(OC)c(OC)c(OC)c2)CC3=O)cc1 | COc1cc([C@@H]2CC(=O)c3c(C)nn(-c4ccc(SC(C)=O)cc4)c3C2)cc(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(-n2nc(C)c3c2C[C@H](c2cc(OC)c(OC)c(OC)c2)CC3=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@@H]2CC(=O)c3c(C)nn(-c4ccc(C(=O)CS)cc4)c3C2)cc(OC)c1OC | COc1ccc(-n2nc(C)c3c2C[C@H](c2cc(OC)c(OC)c(OC)c2)CC3=O)cc1 | COc1cc([C@@H]2CC(=O)c3c(C)nn(-c4ccc(C(=O)CS)cc4)c3C2)cc(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(-n2nc(C)c3c2C[C@H](c2cc(OC)c(OC)c(OC)c2)CC3=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@@H]2CC(=O)c3c(C)nn(-c4ccc(C(=O)CI)cc4)c3C2)cc(OC)c1OC | COc1ccc(-n2nc(C)c3c2C[C@H](c2cc(OC)c(OC)c(OC)c2)CC3=O)cc1 | COc1cc([C@@H]2CC(=O)c3c(C)nn(-c4ccc(C(=O)CI)cc4)c3C2)cc(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(OC)c(C=CC(=O)OCC(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(OC)c(C=CC(=O)OCC(C)C)c1 | COc1ccc(OC)c(C=CC(=O)OCC(C)C)c1 | COCc1ccc(OC)c(C=CC(=O)OCC(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(OC)c(C=CC(=O)OCC(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(OC)c(C=CC(=O)OCC(C)C)c1 | COc1ccc(OC)c(C=CC(=O)OCC(C)C)c1 | COCSc1ccc(OC)c(C=CC(=O)OCC(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(OC)c(C=CC(=O)OCC(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(SC(C)=O)cc1C=CC(=O)OCC(C)C | COc1ccc(OC)c(C=CC(=O)OCC(C)C)c1 | COc1ccc(SC(C)=O)cc1C=CC(=O)OCC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(OC)c(C=CC(=O)OCC(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)CS)cc1C=CC(=O)OCC(C)C | COc1ccc(OC)c(C=CC(=O)OCC(C)C)c1 | COc1ccc(C(=O)CS)cc1C=CC(=O)OCC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(OC)c(C=CC(=O)OCC(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)CI)cc1C=CC(=O)OCC(C)C | COc1ccc(OC)c(C=CC(=O)OCC(C)C)c1 | COc1ccc(C(=O)CI)cc1C=CC(=O)OCC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule C[C@H](NC(=O)[C@H]1CC[C@H](C[NH3+])O1)C(=O)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(=O)[C@H](C)NC(=O)[C@H]1CC[C@H](C[NH3+])O1 | C[C@H](NC(=O)[C@H]1CC[C@H](C[NH3+])O1)C(=O)N(C)C | CC(C)C(=O)[C@H](C)NC(=O)[C@H]1CC[C@H](C[NH3+])O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "N3(C)C"
} |
Can you make molecule C[C@H](NC(=O)[C@H]1CC[C@H](C[NH3+])O1)C(=O)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC(=O)[C@H]1CC[C@H](C[NH3+])O1)C(=O)CC(=N)S | C[C@H](NC(=O)[C@H]1CC[C@H](C[NH3+])O1)C(=O)N(C)C | C[C@H](NC(=O)[C@H]1CC[C@H](C[NH3+])O1)C(=O)CC(=N)S | 102 | {
"fragment_index": 0,
"new_substring": "N=C(S)C&",
"old_substring": "N3(C)C"
} |
Can you make molecule C[C@H](NC(=O)[C@H]1CC[C@H](C[NH3+])O1)C(=O)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC(=O)[C@H]1CC[C@H](C[NH3+])O1)C(=O)N(C)C1=CCCC1 | C[C@H](NC(=O)[C@H]1CC[C@H](C[NH3+])O1)C(=O)N(C)C | C[C@H](NC(=O)[C@H]1CC[C@H](C[NH3+])O1)C(=O)N(C)C1=CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N&(C)C1=CCCC1",
"old_substring": "N3(C)C"
} |
Can you make molecule C[C@H](NC(=O)[C@H]1CC[C@H](C[NH3+])O1)C(=O)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC(=O)[C@H]1CC[C@H](C[NH3+])O1)C(=O)C(F)(F)C#N | C[C@H](NC(=O)[C@H]1CC[C@H](C[NH3+])O1)C(=O)N(C)C | C[C@H](NC(=O)[C@H]1CC[C@H](C[NH3+])O1)C(=O)C(F)(F)C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#CC&(F)F",
"old_substring": "N3(C)C"
} |
Can you make molecule C[C@H](NC(=O)[C@H]1CC[C@H](C[NH3+])O1)C(=O)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(C(=O)[C@H](C)NC(=O)[C@H]2CC[C@H](C[NH3+])O2)CC1 | C[C@H](NC(=O)[C@H]1CC[C@H](C[NH3+])O1)C(=O)N(C)C | CC1CCN(C(=O)[C@H](C)NC(=O)[C@H]2CC[C@H](C[NH3+])O2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)CC1",
"old_substring": "N3(C)C"
} |
Can you make molecule Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nnc(-c2cccs2)n1N less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nn(-c2cccs2)nc1C#N | Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nnc(-c2cccs2)n1N | Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nn(-c2cccs2)nc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn&nc1C#N",
"old_substring": "c17nnc8n1N"
} |
Can you make molecule Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nnc(-c2cccs2)n1N less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nnc2n1CCN(c1cccs1)CC2 | Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nnc(-c2cccs2)n1N | Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nnc2n1CCN(c1cccs1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc2n1CCN&CC2",
"old_substring": "c17nnc8n1N"
} |
Can you make molecule Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nnc(-c2cccs2)n1N less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nnc(-c2cccs2)o1 | Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nnc(-c2cccs2)n1N | Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nnc(-c2cccs2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc&o1",
"old_substring": "c17nnc8n1N"
} |
Can you make molecule Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nnc(-c2cccs2)n1N less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nnc(-c2cccs2)s1 | Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nnc(-c2cccs2)n1N | Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nnc(-c2cccs2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc&s1",
"old_substring": "c17nnc8n1N"
} |
Can you make molecule Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nnc(-c2cccs2)n1N less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nc(-c2cccs2)cn1N | Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nnc(-c2cccs2)n1N | Cc1cccc(C(C)C)c1NC(=O)[C@@H](C)Sc1nc(-c2cccs2)cn1N | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&cn1N",
"old_substring": "c17nnc8n1N"
} |
Can you make molecule Cn1cc(C(=O)Nc2ccccc2C(=O)NCCc2ccccc2)c(=O)c2cccn21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(CC(=O)SNc2ccccc2C(=O)NCCc2ccccc2)c(=O)c2cccn21 | Cn1cc(C(=O)Nc2ccccc2C(=O)NCCc2ccccc2)c(=O)c2cccn21 | Cn1cc(CC(=O)SNc2ccccc2C(=O)NCCc2ccccc2)c(=O)c2cccn21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C37=O"
} |
Can you make molecule Cn1cc(C(=O)Nc2ccccc2C(=O)NCCc2ccccc2)c(=O)c2cccn21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(=O)CCCC(=O)Nc2ccccc2C(=O)NCCc2ccccc2)c(=O)c2cccn21 | Cn1cc(C(=O)Nc2ccccc2C(=O)NCCc2ccccc2)c(=O)c2cccn21 | Cn1cc(C(=O)CCCC(=O)Nc2ccccc2C(=O)NCCc2ccccc2)c(=O)c2cccn21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C37=O"
} |
Can you make molecule Cn1cc(C(=O)Nc2ccccc2C(=O)NCCc2ccccc2)c(=O)c2cccn21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(C)(C)CC(=O)Nc2ccccc2C(=O)NCCc2ccccc2)c(=O)c2cccn21 | Cn1cc(C(=O)Nc2ccccc2C(=O)NCCc2ccccc2)c(=O)c2cccn21 | Cn1cc(C(C)(C)CC(=O)Nc2ccccc2C(=O)NCCc2ccccc2)c(=O)c2cccn21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule Cn1cc(C(=O)Nc2ccccc2C(=O)NCCc2ccccc2)c(=O)c2cccn21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(C)(C)CCC(=O)Nc2ccccc2C(=O)NCCc2ccccc2)c(=O)c2cccn21 | Cn1cc(C(=O)Nc2ccccc2C(=O)NCCc2ccccc2)c(=O)c2cccn21 | Cn1cc(C(C)(C)CCC(=O)Nc2ccccc2C(=O)NCCc2ccccc2)c(=O)c2cccn21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule Cn1cc(C(=O)Nc2ccccc2C(=O)NCCc2ccccc2)c(=O)c2cccn21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SNc1ccccc1C(=O)NCCc1ccccc1)c1cn(C)n2cccc2c1=O | Cn1cc(C(=O)Nc2ccccc2C(=O)NCCc2ccccc2)c(=O)c2cccn21 | C[C@H](C(=O)SNc1ccccc1C(=O)NCCc1ccccc1)c1cn(C)n2cccc2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C37=O"
} |
Can you make molecule Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)[C@@H](C)Sc2ccccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1[C@@H]1C[C@H](C)N(SC(=O)[C@@H](C)Sc2ccccn2)C1 | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)[C@@H](C)Sc2ccccn2)C1 | Cc1ccccc1[C@@H]1C[C@H](C)N(SC(=O)[C@@H](C)Sc2ccccn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C3(=O)[C@H]4C"
} |
Can you make molecule Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)[C@@H](C)Sc2ccccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)[C@H](C)CCSc2ccccn2)C1 | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)[C@@H](C)Sc2ccccn2)C1 | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)[C@H](C)CCSc2ccccn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@H](C)CC&",
"old_substring": "C3(=O)[C@H]4C"
} |
Can you make molecule Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)[C@@H](C)Sc2ccccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)[C@@H](C)CCSc2ccccn2)C1 | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)[C@@H](C)Sc2ccccn2)C1 | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)[C@@H](C)CCSc2ccccn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@@H](C)CC&",
"old_substring": "C3(=O)[C@H]4C"
} |
Can you make molecule Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)[C@@H](C)Sc2ccccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)C[C@@H](Br)Sc2ccccn2)C1 | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)[C@@H](C)Sc2ccccn2)C1 | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)C[C@@H](Br)Sc2ccccn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C3(=O)[C@H]4C"
} |
Can you make molecule Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)[C@@H](C)Sc2ccccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1[C@@H]1C[C@H](C)N([C@@H](C)CCSc2ccccn2)C1 | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)[C@@H](C)Sc2ccccn2)C1 | Cc1ccccc1[C@@H]1C[C@H](C)N([C@@H](C)CCSc2ccccn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C3(=O)[C@H]4C"
} |
Can you make molecule Cc1occc1C(=O)C(C#N)=Cc1ccc([C@@H]2C[C@H]2C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1occc1C(=O)C1=C(N=Cc2ccc([C@@H]3C[C@H]3C)o2)CCS1 | Cc1occc1C(=O)C(C#N)=Cc1ccc([C@@H]2C[C@H]2C)o1 | Cc1occc1C(=O)C1=C(N=Cc2ccc([C@@H]3C[C@H]3C)o2)CCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=C(N&)CCS1",
"old_substring": "C3(=O)C=4C#N"
} |
Can you make molecule Cc1occc1C(=O)C(C#N)=Cc1ccc([C@@H]2C[C@H]2C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1occc1C(=O)C(N=Cc1ccc([C@@H]2C[C@H]2C)o1)=C(Cl)Cl | Cc1occc1C(=O)C(C#N)=Cc1ccc([C@@H]2C[C@H]2C)o1 | Cc1occc1C(=O)C(N=Cc1ccc([C@@H]2C[C@H]2C)o1)=C(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(N&)=C(Cl)Cl",
"old_substring": "C3(=O)C=4C#N"
} |
Can you make molecule Cc1occc1C(=O)C(C#N)=Cc1ccc([C@@H]2C[C@H]2C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1occc1C[S@+]([O-])CCC=Cc1ccc([C@@H]2C[C@H]2C)o1 | Cc1occc1C(=O)C(C#N)=Cc1ccc([C@@H]2C[C@H]2C)o1 | Cc1occc1C[S@+]([O-])CCC=Cc1ccc([C@@H]2C[C@H]2C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C=4C#N"
} |
Can you make molecule Cc1occc1C(=O)C(C#N)=Cc1ccc([C@@H]2C[C@H]2C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1occc1C(=O)[C@H](C)CC=Cc1ccc([C@@H]2C[C@H]2C)o1 | Cc1occc1C(=O)C(C#N)=Cc1ccc([C@@H]2C[C@H]2C)o1 | Cc1occc1C(=O)[C@H](C)CC=Cc1ccc([C@@H]2C[C@H]2C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@H](C)CC&",
"old_substring": "C3(=O)C=4C#N"
} |
Can you make molecule Cc1occc1C(=O)C(C#N)=Cc1ccc([C@@H]2C[C@H]2C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1occc1C(=O)C(C)(C)CCC=Cc1ccc([C@@H]2C[C@H]2C)o1 | Cc1occc1C(=O)C(C#N)=Cc1ccc([C@@H]2C[C@H]2C)o1 | Cc1occc1C(=O)C(C)(C)CCC=Cc1ccc([C@@H]2C[C@H]2C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(C)CCC&",
"old_substring": "C3(=O)C=4C#N"
} |
Can you make molecule CC[C@](C)(C[NH3+])[C@H](O)c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H]([NH3+])Cc1ccc2c(c1)OCO2 | CC[C@](C)(C[NH3+])[C@H](O)c1ccc2c(c1)OCO2 | CCCC[C@H]([NH3+])Cc1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]([NH3+])C3",
"old_substring": "CC[C@](C)(C[NH3+])[C@@H]3O"
} |
Can you make molecule CC[C@](C)(C[NH3+])[C@H](O)c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H](C[NH3+])c1ccc2c(c1)OCO2 | CC[C@](C)(C[NH3+])[C@H](O)c1ccc2c(c1)OCO2 | CC(C)C[C@@H](C[NH3+])c1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C[C@H]3C[NH3+]",
"old_substring": "CC[C@](C)(C[NH3+])[C@@H]3O"
} |
Can you make molecule CC[C@](C)(C[NH3+])[C@H](O)c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]([NH3+])CCc1ccc2c(c1)OCO2 | CC[C@](C)(C[NH3+])[C@H](O)c1ccc2c(c1)OCO2 | CCC[C@H]([NH3+])CCc1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]([NH3+])CC3",
"old_substring": "CC[C@](C)(C[NH3+])[C@@H]3O"
} |
Can you make molecule CC[C@](C)(C[NH3+])[C@H](O)c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C[NH3+])CCc1ccc2c(c1)OCO2 | CC[C@](C)(C[NH3+])[C@H](O)c1ccc2c(c1)OCO2 | CC(C)(C[NH3+])CCc1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C[NH3+])CC3",
"old_substring": "CC[C@](C)(C[NH3+])[C@@H]3O"
} |
Can you make molecule CC[C@](C)(C[NH3+])[C@H](O)c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C[NH3+])c1ccc2c(c1)OCO2 | CC[C@](C)(C[NH3+])[C@H](O)c1ccc2c(c1)OCO2 | CCC(CC)(C[NH3+])c1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "CCC3(CC)C[NH3+]",
"old_substring": "CC[C@](C)(C[NH3+])[C@@H]3O"
} |
Can you make molecule CCc1nn(CC)c(C[C@@]2(C3CC3)CCC[NH2+]2)c1Br less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1nn(CC)c(C[C@@]2(C3CC3)CCC[NH2+]2)c1Br | CCc1nn(CC)c(C[C@@]2(C3CC3)CCC[NH2+]2)c1Br | C=CSc1nn(CC)c(C[C@@]2(C3CC3)CCC[NH2+]2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC6"
} |
Can you make molecule CCc1nn(CC)c(C[C@@]2(C3CC3)CCC[NH2+]2)c1Br less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(C(C)C)c(Br)c1C[C@@]1(C2CC2)CCC[NH2+]1 | CCc1nn(CC)c(C[C@@]2(C3CC3)CCC[NH2+]2)c1Br | CCn1nc(C(C)C)c(Br)c1C[C@@]1(C2CC2)CCC[NH2+]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC6"
} |
Can you make molecule CCc1nn(CC)c(C[C@@]2(C3CC3)CCC[NH2+]2)c1Br less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1nn(CC)c(C[C@@]2(C3CC3)CCC[NH2+]2)c1Br | CCc1nn(CC)c(C[C@@]2(C3CC3)CCC[NH2+]2)c1Br | C=CCCc1nn(CC)c(C[C@@]2(C3CC3)CCC[NH2+]2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC6"
} |
Can you make molecule CCc1nn(CC)c(C[C@@]2(C3CC3)CCC[NH2+]2)c1Br less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(CCCCl)c(Br)c1C[C@@]1(C2CC2)CCC[NH2+]1 | CCc1nn(CC)c(C[C@@]2(C3CC3)CCC[NH2+]2)c1Br | CCn1nc(CCCCl)c(Br)c1C[C@@]1(C2CC2)CCC[NH2+]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC6"
} |
Can you make molecule CCc1nn(CC)c(C[C@@]2(C3CC3)CCC[NH2+]2)c1Br less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(CCCCS)c(Br)c1C[C@@]1(C2CC2)CCC[NH2+]1 | CCc1nn(CC)c(C[C@@]2(C3CC3)CCC[NH2+]2)c1Br | CCn1nc(CCCCS)c(Br)c1C[C@@]1(C2CC2)CCC[NH2+]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC6"
} |
Can you make molecule CC(=O)Nc1ccc(CN2CC[NH+](C3CCCC3)[C@H](CCO)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(CN2CC[NH+](C3CCCC3)[C@H](CCO)C2)cc1I | CC(=O)Nc1ccc(CN2CC[NH+](C3CCCC3)[C@H](CCO)C2)cc1 | CC(=O)Nc1ccc(CN2CC[NH+](C3CCCC3)[C@H](CCO)C2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16ccc9cc1"
} |
Can you make molecule CC(=O)Nc1ccc(CN2CC[NH+](C3CCCC3)[C@H](CCO)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cc(CN2CC[NH+](C3CCCC3)[C@H](CCO)C2)ccc1Br | CC(=O)Nc1ccc(CN2CC[NH+](C3CCCC3)[C@H](CCO)C2)cc1 | CC(=O)Nc1cc(CN2CC[NH+](C3CCCC3)[C@H](CCO)C2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16ccc9cc1"
} |
Can you make molecule CC(=O)Nc1ccc(CN2CC[NH+](C3CCCC3)[C@H](CCO)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(CN2CC[NH+](C3CCCC3)[C@H](CCO)C2)cc1Cl | CC(=O)Nc1ccc(CN2CC[NH+](C3CCCC3)[C@H](CCO)C2)cc1 | CC(=O)Nc1ccc(CN2CC[NH+](C3CCCC3)[C@H](CCO)C2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16ccc9cc1"
} |
Can you make molecule CC(=O)Nc1ccc(CN2CC[NH+](C3CCCC3)[C@H](CCO)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cccc(CN2CC[NH+](C3CCCC3)[C@H](CCO)C2)c1Br | CC(=O)Nc1ccc(CN2CC[NH+](C3CCCC3)[C@H](CCO)C2)cc1 | CC(=O)Nc1cccc(CN2CC[NH+](C3CCCC3)[C@H](CCO)C2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c16ccc9cc1"
} |
Can you make molecule CC(=O)Nc1ccc(CN2CC[NH+](C3CCCC3)[C@H](CCO)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cccc(CN2CC[NH+](C3CCCC3)[C@H](CCO)C2)c1Cl | CC(=O)Nc1ccc(CN2CC[NH+](C3CCCC3)[C@H](CCO)C2)cc1 | CC(=O)Nc1cccc(CN2CC[NH+](C3CCCC3)[C@H](CCO)C2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c16ccc9cc1"
} |
Can you make molecule COc1ccc([C@H](O)[C@@H](C)NC(=O)[C@@H](C)SC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc([C@H](O)[C@@H](C)NC(=O)[C@@H](C)SC)cc1 | COc1ccc([C@H](O)[C@@H](C)NC(=O)[C@@H](C)SC)cc1 | COCc1ccc([C@H](O)[C@@H](C)NC(=O)[C@@H](C)SC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc([C@H](O)[C@@H](C)NC(=O)[C@@H](C)SC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc([C@H](O)[C@@H](C)NC(=O)[C@@H](C)SC)cc1 | COc1ccc([C@H](O)[C@@H](C)NC(=O)[C@@H](C)SC)cc1 | COCSc1ccc([C@H](O)[C@@H](C)NC(=O)[C@@H](C)SC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc([C@H](O)[C@@H](C)NC(=O)[C@@H](C)SC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CS[C@H](C)C(=O)N[C@H](C)[C@@H](O)c1ccc(SC(C)=O)cc1 | COc1ccc([C@H](O)[C@@H](C)NC(=O)[C@@H](C)SC)cc1 | CS[C@H](C)C(=O)N[C@H](C)[C@@H](O)c1ccc(SC(C)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc([C@H](O)[C@@H](C)NC(=O)[C@@H](C)SC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CS[C@H](C)C(=O)N[C@H](C)[C@@H](O)c1ccc(C(=O)CS)cc1 | COc1ccc([C@H](O)[C@@H](C)NC(=O)[C@@H](C)SC)cc1 | CS[C@H](C)C(=O)N[C@H](C)[C@@H](O)c1ccc(C(=O)CS)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc([C@H](O)[C@@H](C)NC(=O)[C@@H](C)SC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CS[C@H](C)C(=O)N[C@H](C)[C@@H](O)c1ccc(C(=O)CI)cc1 | COc1ccc([C@H](O)[C@@H](C)NC(=O)[C@@H](C)SC)cc1 | CS[C@H](C)C(=O)N[C@H](C)[C@@H](O)c1ccc(C(=O)CI)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.