prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCC(=O)NNC(C)=CC(=O)NCC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)NNC(C)=CC(=O)C=NCC(C)(C)C | CCC(=O)NNC(C)=CC(=O)NCC(C)(C)C | CCC(=O)NNC(C)=CC(=O)C=NCC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C=&C(=O)C=&",
"old_substring": "C=3C1=O"
} |
Can you make molecule CCC(=O)NNC(C)=CC(=O)NCC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | C=C(C=C(C)NNC(=O)CC)C(=O)NCC(C)(C)C | CCC(=O)NNC(C)=CC(=O)NCC(C)(C)C | C=C(C=C(C)NNC(=O)CC)C(=O)NCC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C&)C&=O",
"old_substring": "C=3C1=O"
} |
Can you make molecule CCC(=O)NNC(C)=CC(=O)NCC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)NNC(C)=CCCC(C)=NCC(C)(C)C | CCC(=O)NNC(C)=CC(=O)NCC(C)(C)C | CCC(=O)NNC(C)=CCCC(C)=NCC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C=&CCC=&C",
"old_substring": "C=3C1=O"
} |
Can you make molecule CCC(=O)NNC(C)=CC(=O)NCC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)NNC(C)=CCCNCC(C)(C)C | CCC(=O)NNC(C)=CC(=O)NCC(C)(C)C | CCC(=O)NNC(C)=CCCNCC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C=3C1=O"
} |
Can you make molecule CCC(=O)NNC(C)=CC(=O)NCC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)NNC(C)=C/C(C)=N\ONCC(C)(C)C | CCC(=O)NNC(C)=CC(=O)NCC(C)(C)C | CCC(=O)NNC(C)=C/C(C)=N\ONCC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C=3C1=O"
} |
Can you make molecule CCC(=O)N1CCC([NH+](C)Cc2ccc(SC)c(OC)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)N1CCCc2cc([NH+](C)Cc3ccc(SC)c(OC)c3)ccc2C1 | CCC(=O)N1CCC([NH+](C)Cc2ccc(SC)c(OC)c2)CC1 | CCC(=O)N1CCCc2cc([NH+](C)Cc3ccc(SC)c(OC)c3)ccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2cc&ccc2C1",
"old_substring": "N13CCC6CC1"
} |
Can you make molecule CCC(=O)N1CCC([NH+](C)Cc2ccc(SC)c(OC)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)C1CCC([NH+](C)Cc2ccc(SC)c(OC)c2)CC1 | CCC(=O)N1CCC([NH+](C)Cc2ccc(SC)c(OC)c2)CC1 | CCC(=O)C1CCC([NH+](C)Cc2ccc(SC)c(OC)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "N13CCC6CC1"
} |
Can you make molecule CCC(=O)N1CCC([NH+](C)Cc2ccc(SC)c(OC)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)CCCCC[NH+](C)Cc1ccc(SC)c(OC)c1 | CCC(=O)N1CCC([NH+](C)Cc2ccc(SC)c(OC)c2)CC1 | CCC(=O)CCCCC[NH+](C)Cc1ccc(SC)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "N13CCC6CC1"
} |
Can you make molecule CCC(=O)N1CCC([NH+](C)Cc2ccc(SC)c(OC)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)C1(C#N)CCC([NH+](C)Cc2ccc(SC)c(OC)c2)CC1 | CCC(=O)N1CCC([NH+](C)Cc2ccc(SC)c(OC)c2)CC1 | CCC(=O)C1(C#N)CCC([NH+](C)Cc2ccc(SC)c(OC)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "N13CCC6CC1"
} |
Can you make molecule CCC(=O)N1CCC([NH+](C)Cc2ccc(SC)c(OC)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)C1(C)CCN([NH+](C)Cc2ccc(SC)c(OC)c2)CC1 | CCC(=O)N1CCC([NH+](C)Cc2ccc(SC)c(OC)c2)CC1 | CCC(=O)C1(C)CCN([NH+](C)Cc2ccc(SC)c(OC)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCN&CC1",
"old_substring": "N13CCC6CC1"
} |
Can you make molecule Clc1ccc(CNc2ncccc2Cl)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc(CCCCNc2ncccc2Cl)cn1 | Clc1ccc(CNc2ncccc2Cl)cn1 | Clc1ccc(CCCCNc2ncccc2Cl)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C35"
} |
Can you make molecule Clc1ccc(CNc2ncccc2Cl)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc(CCC=Nc2ncccc2Cl)cn1 | Clc1ccc(CNc2ncccc2Cl)cn1 | Clc1ccc(CCC=Nc2ncccc2Cl)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C35"
} |
Can you make molecule Clc1ccc(CNc2ncccc2Cl)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc(CCCCCNc2ncccc2Cl)cn1 | Clc1ccc(CNc2ncccc2Cl)cn1 | Clc1ccc(CCCCCNc2ncccc2Cl)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C35"
} |
Can you make molecule Clc1ccc(CNc2ncccc2Cl)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc(C2CC(Nc3ncccc3Cl)C2)cn1 | Clc1ccc(CNc2ncccc2Cl)cn1 | Clc1ccc(C2CC(Nc3ncccc3Cl)C2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C35"
} |
Can you make molecule Clc1ccc(CNc2ncccc2Cl)cn1 less soluble in water? The output molecule should be similar to the input molecule. | S=C(ONc1ncccc1Cl)Sc1ccc(Cl)nc1 | Clc1ccc(CNc2ncccc2Cl)cn1 | S=C(ONc1ncccc1Cl)Sc1ccc(Cl)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C35"
} |
Can you make molecule C[C@H](c1nc(C(C)(C)C)no1)[S@+]([O-])Cc1ncn(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](c1nc(C(C)(C)C)no1)[S@+]([O-])Cc1ncn(-c2ccccc2Cl)n1 | C[C@H](c1nc(C(C)(C)C)no1)[S@+]([O-])Cc1ncn(-c2ccccc2)n1 | C[C@H](c1nc(C(C)(C)C)no1)[S@+]([O-])Cc1ncn(-c2ccccc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c16ccccc1"
} |
Can you make molecule C[C@H](c1nc(C(C)(C)C)no1)[S@+]([O-])Cc1ncn(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](c1nc(C(C)(C)C)no1)[S@+]([O-])Cc1ncn(-c2ccc(I)cc2)n1 | C[C@H](c1nc(C(C)(C)C)no1)[S@+]([O-])Cc1ncn(-c2ccccc2)n1 | C[C@H](c1nc(C(C)(C)C)no1)[S@+]([O-])Cc1ncn(-c2ccc(I)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c16ccccc1"
} |
Can you make molecule C[C@H](c1nc(C(C)(C)C)no1)[S@+]([O-])Cc1ncn(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2cnc(C[S@@+]([O-])[C@H](C)c3nc(C(C)(C)C)no3)n2)cc1I | C[C@H](c1nc(C(C)(C)C)no1)[S@+]([O-])Cc1ncn(-c2ccccc2)n1 | Cc1ccc(-n2cnc(C[S@@+]([O-])[C@H](C)c3nc(C(C)(C)C)no3)n2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c16ccccc1"
} |
Can you make molecule C[C@H](c1nc(C(C)(C)C)no1)[S@+]([O-])Cc1ncn(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](c1nc(C(C)(C)C)no1)[S@+]([O-])Cc1ncn(-c2cccc(Br)c2)n1 | C[C@H](c1nc(C(C)(C)C)no1)[S@+]([O-])Cc1ncn(-c2ccccc2)n1 | C[C@H](c1nc(C(C)(C)C)no1)[S@+]([O-])Cc1ncn(-c2cccc(Br)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c16ccccc1"
} |
Can you make molecule C[C@H](c1nc(C(C)(C)C)no1)[S@+]([O-])Cc1ncn(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-n2cnc(C[S@@+]([O-])[C@H](C)c3nc(C(C)(C)C)no3)n2)c1C | C[C@H](c1nc(C(C)(C)C)no1)[S@+]([O-])Cc1ncn(-c2ccccc2)n1 | Cc1cccc(-n2cnc(C[S@@+]([O-])[C@H](C)c3nc(C(C)(C)C)no3)n2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2CC2)c1=S less soluble in water? The output molecule should be similar to the input molecule. | Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2SCCS2)c1=S | Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2CC2)c1=S | Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2SCCS2)c1=S | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C14CC1"
} |
Can you make molecule Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2CC2)c1=S less soluble in water? The output molecule should be similar to the input molecule. | Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2CCCCC2)c1=S | Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2CC2)c1=S | Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2CCCCC2)c1=S | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C14CC1"
} |
Can you make molecule Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2CC2)c1=S less soluble in water? The output molecule should be similar to the input molecule. | Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2SCCCS2)c1=S | Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2CC2)c1=S | Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2SCCCS2)c1=S | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C14CC1"
} |
Can you make molecule Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2CC2)c1=S less soluble in water? The output molecule should be similar to the input molecule. | Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2SCSCS2)c1=S | Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2CC2)c1=S | Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2SCSCS2)c1=S | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C14CC1"
} |
Can you make molecule Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2CC2)c1=S less soluble in water? The output molecule should be similar to the input molecule. | Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2CCCCCC2)c1=S | Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2CC2)c1=S | Cn1cnn(C[NH+](Cc2ccc(F)cc2)C2CCCCCC2)c1=S | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C14CC1"
} |
Can you make molecule C#CC(C)(C)NC[C@H]1CN(C)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | C#CC(C)(C)N1Cc2nc(C[C@H]3CN(C)CCO3)sc2C1 | C#CC(C)(C)NC[C@H]1CN(C)CCO1 | C#CC(C)(C)N1Cc2nc(C[C@H]3CN(C)CCO3)sc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N23"
} |
Can you make molecule C#CC(C)(C)NC[C@H]1CN(C)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | C#CC(C)(C)N1Cc2cnn(C[C@H]3CN(C)CCO3)c2C1 | C#CC(C)(C)NC[C@H]1CN(C)CCO1 | C#CC(C)(C)N1Cc2cnn(C[C@H]3CN(C)CCO3)c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2cnn&c2C1",
"old_substring": "N23"
} |
Can you make molecule C#CC(C)(C)NC[C@H]1CN(C)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | C#CC(C)(C)N1CCc2noc(C[C@H]3CN(C)CCO3)c2C1 | C#CC(C)(C)NC[C@H]1CN(C)CCO1 | C#CC(C)(C)N1CCc2noc(C[C@H]3CN(C)CCO3)c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N23"
} |
Can you make molecule C#CC(C)(C)NC[C@H]1CN(C)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | C#CC(C)(C)N1CCCn2nc(C[C@H]3CN(C)CCO3)cc21 | C#CC(C)(C)NC[C@H]1CN(C)CCO1 | C#CC(C)(C)N1CCCn2nc(C[C@H]3CN(C)CCO3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc21",
"old_substring": "N23"
} |
Can you make molecule C#CC(C)(C)NC[C@H]1CN(C)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | C#CC(C)(C)N1CCc2cc(C[C@H]3CN(C)CCO3)ccc21 | C#CC(C)(C)NC[C@H]1CN(C)CCO1 | C#CC(C)(C)N1CCc2cc(C[C@H]3CN(C)CCO3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N23"
} |
Can you make molecule C[C@H](NC(=O)[C@H]1CCCN1S(C)(=O)=O)c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1ccc2c(c1)OCO2)NC(=O)[C@H]1CCCN1S(C)(=O)=O | C[C@H](NC(=O)[C@H]1CCCN1S(C)(=O)=O)c1ccc2c(c1)OCO2 | C[C@H](CC(C)(C)c1ccc2c(c1)OCO2)NC(=O)[C@H]1CCCN1S(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@H]47"
} |
Can you make molecule C[C@H](NC(=O)[C@H]1CCCN1S(C)(=O)=O)c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCNC(=O)[C@H]1CCCN1S(C)(=O)=O)CC(=O)c1ccc2c(c1)OCO2 | C[C@H](NC(=O)[C@H]1CCCN1S(C)(=O)=O)c1ccc2c(c1)OCO2 | C[C@H](CCNC(=O)[C@H]1CCCN1S(C)(=O)=O)CC(=O)c1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@H]47"
} |
Can you make molecule C[C@H](NC(=O)[C@H]1CCCN1S(C)(=O)=O)c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1ccc2c(c1)OCO2)[C@H](C)NC(=O)[C@H]1CCCN1S(C)(=O)=O | C[C@H](NC(=O)[C@H]1CCCN1S(C)(=O)=O)c1ccc2c(c1)OCO2 | C[C@H](Cc1ccc2c(c1)OCO2)[C@H](C)NC(=O)[C@H]1CCCN1S(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "C[C@H]47"
} |
Can you make molecule C[C@H](NC(=O)[C@H]1CCCN1S(C)(=O)=O)c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNC(=O)[C@H]1CCCN1S(C)(=O)=O)CC(=O)c1ccc2c(c1)OCO2 | C[C@H](NC(=O)[C@H]1CCCN1S(C)(=O)=O)c1ccc2c(c1)OCO2 | C[C@@H](CCNC(=O)[C@H]1CCCN1S(C)(=O)=O)CC(=O)c1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@H]47"
} |
Can you make molecule C[C@H](NC(=O)[C@H]1CCCN1S(C)(=O)=O)c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1ccc2c(c1)OCO2)NC(=O)[C@H]1CCCN1S(C)(=O)=O | C[C@H](NC(=O)[C@H]1CCCN1S(C)(=O)=O)c1ccc2c(c1)OCO2 | CCC[C@@H](CCc1ccc2c(c1)OCO2)NC(=O)[C@H]1CCCN1S(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C[C@H]47"
} |
Can you make molecule O=C(Nc1ccc2ncccc2c1)C(=O)NC1CCC(O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1c(C(=O)C(=O)NC2CCC(O)CC2)nsc1-c1ccc2ncccc2c1 | O=C(Nc1ccc2ncccc2c1)C(=O)NC1CCC(O)CC1 | Nc1c(C(=O)C(=O)NC2CCC(O)CC2)nsc1-c1ccc2ncccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N35"
} |
Can you make molecule O=C(Nc1ccc2ncccc2c1)C(=O)NC1CCC(O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)C(=O)NC1CCC(O)CC1)C(=S)Sc1ccc2ncccc2c1 | O=C(Nc1ccc2ncccc2c1)C(=O)NC1CCC(O)CC1 | CN(C(=O)C(=O)NC1CCC(O)CC1)C(=S)Sc1ccc2ncccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N35"
} |
Can you make molecule O=C(Nc1ccc2ncccc2c1)C(=O)NC1CCC(O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1oc(C(=O)C(=O)NC2CCC(O)CC2)cc1-c1ccc2ncccc2c1 | O=C(Nc1ccc2ncccc2c1)C(=O)NC1CCC(O)CC1 | Nc1oc(C(=O)C(=O)NC2CCC(O)CC2)cc1-c1ccc2ncccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N35"
} |
Can you make molecule O=C(Nc1ccc2ncccc2c1)C(=O)NC1CCC(O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC1CCC(O)CC1)C(=O)N1CCN=C1Sc1ccc2ncccc2c1 | O=C(Nc1ccc2ncccc2c1)C(=O)NC1CCC(O)CC1 | O=C(NC1CCC(O)CC1)C(=O)N1CCN=C1Sc1ccc2ncccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N35"
} |
Can you make molecule O=C(Nc1ccc2ncccc2c1)C(=O)NC1CCC(O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CN1CCC(c2ccc3ncccc3c2)CC1)C(=O)NC1CCC(O)CC1 | O=C(Nc1ccc2ncccc2c1)C(=O)NC1CCC(O)CC1 | O=C(CN1CCC(c2ccc3ncccc3c2)CC1)C(=O)NC1CCC(O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N35"
} |
Can you make molecule CC(C)[C@H]([NH2+]CC1CCN(C(=O)OC(C)(C)C)CC1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H]([NH2+]CC1CCN(C(=O)OC(Cl)(Cl)Cl)CC1)c1cccnc1 | CC(C)[C@H]([NH2+]CC1CCN(C(=O)OC(C)(C)C)CC1)c1cccnc1 | CC(C)[C@H]([NH2+]CC1CCN(C(=O)OC(Cl)(Cl)Cl)CC1)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C4(C)(C)C"
} |
Can you make molecule CC(C)[C@H]([NH2+]CC1CCN(C(=O)OC(C)(C)C)CC1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H]([NH2+]CC1CCN(C(=O)OC(C)(C)CC(C)(C)C)CC1)c1cccnc1 | CC(C)[C@H]([NH2+]CC1CCN(C(=O)OC(C)(C)C)CC1)c1cccnc1 | CC(C)[C@H]([NH2+]CC1CCN(C(=O)OC(C)(C)CC(C)(C)C)CC1)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)(C)CC(C)(C)C",
"old_substring": "C4(C)(C)C"
} |
Can you make molecule CC(C)[C@H]([NH2+]CC1CCN(C(=O)OC(C)(C)C)CC1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H]([NH2+]CC1CCN(C(=O)OCCCC(C)(C)C)CC1)c1cccnc1 | CC(C)[C@H]([NH2+]CC1CCN(C(=O)OC(C)(C)C)CC1)c1cccnc1 | CC(C)[C@H]([NH2+]CC1CCN(C(=O)OCCCC(C)(C)C)CC1)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(C)(C)C",
"old_substring": "C4(C)(C)C"
} |
Can you make molecule CC(C)[C@H]([NH2+]CC1CCN(C(=O)OC(C)(C)C)CC1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H]([NH2+]CC1CCN(C(=O)OCCCC(F)(F)F)CC1)c1cccnc1 | CC(C)[C@H]([NH2+]CC1CCN(C(=O)OC(C)(C)C)CC1)c1cccnc1 | CC(C)[C@H]([NH2+]CC1CCN(C(=O)OCCCC(F)(F)F)CC1)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C4(C)(C)C"
} |
Can you make molecule CC(C)[C@H]([NH2+]CC1CCN(C(=O)OC(C)(C)C)CC1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H]([NH2+]CC1CCN(C(=O)OCCCCC(F)(F)F)CC1)c1cccnc1 | CC(C)[C@H]([NH2+]CC1CCN(C(=O)OC(C)(C)C)CC1)c1cccnc1 | CC(C)[C@H]([NH2+]CC1CCN(C(=O)OCCCCC(F)(F)F)CC1)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C4(C)(C)C"
} |
Can you make molecule CCC[C@H](C)NC(=O)C[NH2+]Cc1cscc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](C)c1nc2c(s1)CN(C(=O)C[NH2+]Cc1cscc1C)C2 | CCC[C@H](C)NC(=O)C[NH2+]Cc1cscc1C | CCC[C@H](C)c1nc2c(s1)CN(C(=O)C[NH2+]Cc1cscc1C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N23"
} |
Can you make molecule CCC[C@H](C)NC(=O)C[NH2+]Cc1cscc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](C)n1ncc2c1CN(C(=O)C[NH2+]Cc1cscc1C)C2 | CCC[C@H](C)NC(=O)C[NH2+]Cc1cscc1C | CCC[C@H](C)n1ncc2c1CN(C(=O)C[NH2+]Cc1cscc1C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2cnn&c2C1",
"old_substring": "N23"
} |
Can you make molecule CCC[C@H](C)NC(=O)C[NH2+]Cc1cscc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](C)c1onc2c1CN(C(=O)C[NH2+]Cc1cscc1C)CC2 | CCC[C@H](C)NC(=O)C[NH2+]Cc1cscc1C | CCC[C@H](C)c1onc2c1CN(C(=O)C[NH2+]Cc1cscc1C)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N23"
} |
Can you make molecule CCC[C@H](C)NC(=O)C[NH2+]Cc1cscc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](C)c1cc2n(n1)CCCN2C(=O)C[NH2+]Cc1cscc1C | CCC[C@H](C)NC(=O)C[NH2+]Cc1cscc1C | CCC[C@H](C)c1cc2n(n1)CCCN2C(=O)C[NH2+]Cc1cscc1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc21",
"old_substring": "N23"
} |
Can you make molecule CCC[C@H](C)NC(=O)C[NH2+]Cc1cscc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](C)c1ccc2c(c1)CCN2C(=O)C[NH2+]Cc1cscc1C | CCC[C@H](C)NC(=O)C[NH2+]Cc1cscc1C | CCC[C@H](C)c1ccc2c(c1)CCN2C(=O)C[NH2+]Cc1cscc1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N23"
} |
Can you make molecule CS(=O)(=O)N1CCC(C(=O)Nc2sc3c(c2C#N)CCCC3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)N1CCC(=C(CO)CCNc2sc3c(c2C#N)CCCC3)CC1 | CS(=O)(=O)N1CCC(C(=O)Nc2sc3c(c2C#N)CCCC3)CC1 | CS(=O)(=O)N1CCC(=C(CO)CCNc2sc3c(c2C#N)CCCC3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C47=O"
} |
Can you make molecule CS(=O)(=O)N1CCC(C(=O)Nc2sc3c(c2C#N)CCCC3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)N1CCC(CC(=O)SNc2sc3c(c2C#N)CCCC3)CC1 | CS(=O)(=O)N1CCC(C(=O)Nc2sc3c(c2C#N)CCCC3)CC1 | CS(=O)(=O)N1CCC(CC(=O)SNc2sc3c(c2C#N)CCCC3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule CS(=O)(=O)N1CCC(C(=O)Nc2sc3c(c2C#N)CCCC3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)N1CCC(=CC(=O)C=Nc2sc3c(c2C#N)CCCC3)CC1 | CS(=O)(=O)N1CCC(C(=O)Nc2sc3c(c2C#N)CCCC3)CC1 | CS(=O)(=O)N1CCC(=CC(=O)C=Nc2sc3c(c2C#N)CCCC3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&C(=O)C=&",
"old_substring": "C47=O"
} |
Can you make molecule CS(=O)(=O)N1CCC(C(=O)Nc2sc3c(c2C#N)CCCC3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)N1CCC(CC(=C=O)CNc2sc3c(c2C#N)CCCC3)CC1 | CS(=O)(=O)N1CCC(C(=O)Nc2sc3c(c2C#N)CCCC3)CC1 | CS(=O)(=O)N1CCC(CC(=C=O)CNc2sc3c(c2C#N)CCCC3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule CS(=O)(=O)N1CCC(C(=O)Nc2sc3c(c2C#N)CCCC3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)N1CCC(C(=O)CCCC(=O)Nc2sc3c(c2C#N)CCCC3)CC1 | CS(=O)(=O)N1CCC(C(=O)Nc2sc3c(c2C#N)CCCC3)CC1 | CS(=O)(=O)N1CCC(C(=O)CCCC(=O)Nc2sc3c(c2C#N)CCCC3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule O=C(CN(C(=O)Cn1nnc2ccccc21)c1ccccc1)NC[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SN(C(=O)Cn1nnc2ccccc21)c1ccccc1)NC[C@H]1CCCO1 | O=C(CN(C(=O)Cn1nnc2ccccc21)c1ccccc1)NC[C@H]1CCCO1 | O=C(/C=C/SN(C(=O)Cn1nnc2ccccc21)c1ccccc1)NC[C@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C3C5"
} |
Can you make molecule O=C(CN(C(=O)Cn1nnc2ccccc21)c1ccccc1)NC[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1nnc2ccccc21)N(c1ccccc1)N1CCC(=NONC[C@H]2CCCO2)CC1 | O=C(CN(C(=O)Cn1nnc2ccccc21)c1ccccc1)NC[C@H]1CCCO1 | O=C(Cn1nnc2ccccc21)N(c1ccccc1)N1CCC(=NONC[C@H]2CCCO2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C3C5"
} |
Can you make molecule O=C(CN(C(=O)Cn1nnc2ccccc21)c1ccccc1)NC[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1CCCO1)NN=C1CCN(N(C(=O)Cn2nnc3ccccc32)c2ccccc2)CC1 | O=C(CN(C(=O)Cn1nnc2ccccc21)c1ccccc1)NC[C@H]1CCCO1 | O=C(NC[C@H]1CCCO1)NN=C1CCN(N(C(=O)Cn2nnc3ccccc32)c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCN&CC1",
"old_substring": "O=C3C5"
} |
Can you make molecule O=C(CN(C(=O)Cn1nnc2ccccc21)c1ccccc1)NC[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1CCCO1)NN=C1CCC(N(C(=O)Cn2nnc3ccccc32)c2ccccc2)CC1 | O=C(CN(C(=O)Cn1nnc2ccccc21)c1ccccc1)NC[C@H]1CCCO1 | O=C(NC[C@H]1CCCO1)NN=C1CCC(N(C(=O)Cn2nnc3ccccc32)c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C3C5"
} |
Can you make molecule O=C(CN(C(=O)Cn1nnc2ccccc21)c1ccccc1)NC[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ONC[C@H]1CCCO1)C(=O)SN(C(=O)Cn1nnc2ccccc21)c1ccccc1 | O=C(CN(C(=O)Cn1nnc2ccccc21)c1ccccc1)NC[C@H]1CCCO1 | C/C(=N\ONC[C@H]1CCCO1)C(=O)SN(C(=O)Cn1nnc2ccccc21)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C3C5"
} |
Can you make molecule O=C(Nc1cccc(N2CCCNC2=O)c1)C(=O)N1CCc2cc(F)ccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)N1CCc2cc(F)ccc2C1)Nc1cccc(N2CCCNC2=O)c1 | O=C(Nc1cccc(N2CCCNC2=O)c1)C(=O)N1CCc2cc(F)ccc2C1 | O=C(CCC(=O)N1CCc2cc(F)ccc2C1)Nc1cccc(N2CCCNC2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O=C3C4=O"
} |
Can you make molecule O=C(Nc1cccc(N2CCCNC2=O)c1)C(=O)N1CCc2cc(F)ccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CC[S@+]([O-])CN1CCc2cc(F)ccc2C1)Nc1cccc(N2CCCNC2=O)c1 | O=C(Nc1cccc(N2CCCNC2=O)c1)C(=O)N1CCc2cc(F)ccc2C1 | O=C(CC[S@+]([O-])CN1CCc2cc(F)ccc2C1)Nc1cccc(N2CCCNC2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CC[S@](=O)C&",
"old_substring": "O=C3C4=O"
} |
Can you make molecule O=C(Nc1cccc(N2CCCNC2=O)c1)C(=O)N1CCc2cc(F)ccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1cccc(N2CCCNC2=O)c1)C1=NO[C@H](N2CCc3cc(F)ccc3C2)C1 | O=C(Nc1cccc(N2CCCNC2=O)c1)C(=O)N1CCc2cc(F)ccc2C1 | O=C(Nc1cccc(N2CCCNC2=O)c1)C1=NO[C@H](N2CCc3cc(F)ccc3C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=NO[C@H]&C1",
"old_substring": "O=C3C4=O"
} |
Can you make molecule O=C(Nc1cccc(N2CCCNC2=O)c1)C(=O)N1CCc2cc(F)ccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ONc1cccc(N2CCCNC2=O)c1)C(=O)SN1CCc2cc(F)ccc2C1 | O=C(Nc1cccc(N2CCCNC2=O)c1)C(=O)N1CCc2cc(F)ccc2C1 | C/C(=N\ONc1cccc(N2CCCNC2=O)c1)C(=O)SN1CCc2cc(F)ccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C3C4=O"
} |
Can you make molecule O=C(Nc1cccc(N2CCCNC2=O)c1)C(=O)N1CCc2cc(F)ccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCS(=O)(=O)CN1CCc2cc(F)ccc2C1)Nc1cccc(N2CCCNC2=O)c1 | O=C(Nc1cccc(N2CCCNC2=O)c1)C(=O)N1CCc2cc(F)ccc2C1 | O=C(CCCS(=O)(=O)CN1CCc2cc(F)ccc2C1)Nc1cccc(N2CCCNC2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCCS(=O)(=O)C&",
"old_substring": "O=C3C4=O"
} |
Can you make molecule C[C@@H]1CC[NH+](CCCN2C(=O)CNC2=O)C[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC[NH+](CCCN2C(=O)CCCC2=O)C[C@@H]1O | C[C@@H]1CC[NH+](CCCN2C(=O)CNC2=O)C[C@@H]1O | C[C@@H]1CC[NH+](CCCN2C(=O)CCCC2=O)C[C@@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "N1&C(=O)CCCC1=O",
"old_substring": "N14C(=O)CNC1=O"
} |
Can you make molecule C[C@@H]1CC[NH+](CCCN2C(=O)CNC2=O)C[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC[NH+](CCCN2C(=O)CSCC2=O)C[C@@H]1O | C[C@@H]1CC[NH+](CCCN2C(=O)CNC2=O)C[C@@H]1O | C[C@@H]1CC[NH+](CCCN2C(=O)CSCC2=O)C[C@@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "N1&C(=O)CSCC1=O",
"old_substring": "N14C(=O)CNC1=O"
} |
Can you make molecule C[C@@H]1CC[NH+](CCCN2C(=O)CNC2=O)C[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC[NH+](CCCN2C(=O)CSC2=S)C[C@@H]1O | C[C@@H]1CC[NH+](CCCN2C(=O)CNC2=O)C[C@@H]1O | C[C@@H]1CC[NH+](CCCN2C(=O)CSC2=S)C[C@@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "N1&C(=O)CSC1=S",
"old_substring": "N14C(=O)CNC1=O"
} |
Can you make molecule C[C@@H]1CC[NH+](CCCN2C(=O)CNC2=O)C[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC[NH+](CCCN2C(=O)CN(C)C2=S)C[C@@H]1O | C[C@@H]1CC[NH+](CCCN2C(=O)CNC2=O)C[C@@H]1O | C[C@@H]1CC[NH+](CCCN2C(=O)CN(C)C2=S)C[C@@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "N1&C(=O)CN(C)C1=S",
"old_substring": "N14C(=O)CNC1=O"
} |
Can you make molecule C[C@@H]1CC[NH+](CCCN2C(=O)CNC2=O)C[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC[NH+](CCCN2C(=O)CCSC2=S)C[C@@H]1O | C[C@@H]1CC[NH+](CCCN2C(=O)CNC2=O)C[C@@H]1O | C[C@@H]1CC[NH+](CCCN2C(=O)CCSC2=S)C[C@@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "N1&C(=O)CCSC1=S",
"old_substring": "N14C(=O)CNC1=O"
} |
Can you make molecule O=C(COc1ccc(Br)cc1)NOCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1ccc(O)c(-c2ccc(Br)cc2)c2onc1-2)NOCc1ccccc1 | O=C(COc1ccc(Br)cc1)NOCc1ccccc1 | O=C(Cc1ccc(O)c(-c2ccc(Br)cc2)c2onc1-2)NOCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Oc1ccc2c&noc2c1&",
"old_substring": "O24"
} |
Can you make molecule O=C(COc1ccc(Br)cc1)NOCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CN1CCOc2ccc(-c3ccc(Br)cc3)cc2C1)NOCc1ccccc1 | O=C(COc1ccc(Br)cc1)NOCc1ccccc1 | O=C(CN1CCOc2ccc(-c3ccc(Br)cc3)cc2C1)NOCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccc&cc2C1",
"old_substring": "O24"
} |
Can you make molecule O=C(COc1ccc(Br)cc1)NOCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1cc2ccc-2ncn(-c2ccc(Br)cc2)c1=O)NOCc1ccccc1 | O=C(COc1ccc(Br)cc1)NOCc1ccccc1 | O=C(Cc1cc2ccc-2ncn(-c2ccc(Br)cc2)c1=O)NOCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cc&ccc2ncn1&",
"old_substring": "O24"
} |
Can you make molecule O=C(COc1ccc(Br)cc1)NOCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1ccc2nc-2ccn(-c2ccc(Br)cc2)c1=O)NOCc1ccccc1 | O=C(COc1ccc(Br)cc1)NOCc1ccccc1 | O=C(Cc1ccc2nc-2ccn(-c2ccc(Br)cc2)c1=O)NOCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2ccc&nc2ccn1&",
"old_substring": "O24"
} |
Can you make molecule O=C(COc1ccc(Br)cc1)NOCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1cnc2nc-2ccn(-c2ccc(Br)cc2)c1=O)NOCc1ccccc1 | O=C(COc1ccc(Br)cc1)NOCc1ccccc1 | O=C(Cc1cnc2nc-2ccn(-c2ccc(Br)cc2)c1=O)NOCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cnc&nc2ccn1&",
"old_substring": "O24"
} |
Can you make molecule CC(=O)C[C@]1(O)C(=O)N(Cc2ccc(C)cc2)c2c(C)cccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)C[C@]1(O)C(=O)N(Cc2ccc(C)cc2Cl)c2c(C)cccc21 | CC(=O)C[C@]1(O)C(=O)N(Cc2ccc(C)cc2)c2c(C)cccc21 | CC(=O)C[C@]1(O)C(=O)N(Cc2ccc(C)cc2Cl)c2c(C)cccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)cc1Cl",
"old_substring": "c13ccc(C)cc1"
} |
Can you make molecule CC(=O)C[C@]1(O)C(=O)N(Cc2ccc(C)cc2)c2c(C)cccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)C[C@]1(O)C(=O)N(Cc2ccc(Cl)cc2I)c2c(C)cccc21 | CC(=O)C[C@]1(O)C(=O)N(Cc2ccc(C)cc2)c2c(C)cccc21 | CC(=O)C[C@]1(O)C(=O)N(Cc2ccc(Cl)cc2I)c2c(C)cccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c13ccc(C)cc1"
} |
Can you make molecule CC(=O)C[C@]1(O)C(=O)N(Cc2ccc(C)cc2)c2c(C)cccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)C[C@]1(O)C(=O)N(Cc2ccc(Cl)cc2Br)c2c(C)cccc21 | CC(=O)C[C@]1(O)C(=O)N(Cc2ccc(C)cc2)c2c(C)cccc21 | CC(=O)C[C@]1(O)C(=O)N(Cc2ccc(Cl)cc2Br)c2c(C)cccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c13ccc(C)cc1"
} |
Can you make molecule CC(=O)C[C@]1(O)C(=O)N(Cc2ccc(C)cc2)c2c(C)cccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)C[C@]1(O)C(=O)N(Cc2cc(C)c(I)cc2C)c2c(C)cccc21 | CC(=O)C[C@]1(O)C(=O)N(Cc2ccc(C)cc2)c2c(C)cccc21 | CC(=O)C[C@]1(O)C(=O)N(Cc2cc(C)c(I)cc2C)c2c(C)cccc21 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1I",
"old_substring": "c13ccc(C)cc1"
} |
Can you make molecule CC(=O)C[C@]1(O)C(=O)N(Cc2ccc(C)cc2)c2c(C)cccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)C[C@]1(O)C(=O)N(Cc2ccc(Cl)c(I)c2)c2c(C)cccc21 | CC(=O)C[C@]1(O)C(=O)N(Cc2ccc(C)cc2)c2c(C)cccc21 | CC(=O)C[C@]1(O)C(=O)N(Cc2ccc(Cl)c(I)c2)c2c(C)cccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c13ccc(C)cc1"
} |
Can you make molecule C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)NCC1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)NCC1CCCCCCC1 | C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)NCC1CCCCC1 | C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)NCC1CCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C18CCCCC1"
} |
Can you make molecule C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)NCC1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)NCSC1=CCCCCC1 | C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)NCC1CCCCC1 | C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)NCSC1=CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C18CCCCC1"
} |
Can you make molecule C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)NCC1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)NC=CC1CCCCC1 | C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)NCC1CCCCC1 | C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)NC=CC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&C1CCCCC1",
"old_substring": "C18CCCCC1"
} |
Can you make molecule C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)NCC1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)NCC1CCCCCCCCCCC1 | C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)NCC1CCCCC1 | C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)NCC1CCCCCCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCCCCCC1",
"old_substring": "C18CCCCC1"
} |
Can you make molecule C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)NCC1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)NCC1(C#N)CCCCCCC1 | C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)NCC1CCCCC1 | C[C@H](OC(=O)c1ccc2ccccc2n1)C(=O)NCC1(C#N)CCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCCCCCC1",
"old_substring": "C18CCCCC1"
} |
Can you make molecule C[C@@H](Sc1cc(Cl)ccc1Cl)C(=O)N1CCC[C@H](CCC(N)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Sc1cc(Cl)ccc1Cl)C(=O)N1CCC[C@H](CCCCC(N)=O)C1 | C[C@@H](Sc1cc(Cl)ccc1Cl)C(=O)N1CCC[C@H](CCC(N)=O)C1 | C[C@@H](Sc1cc(Cl)ccc1Cl)C(=O)N1CCC[C@H](CCCCC(N)=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C4CC(N)=O"
} |
Can you make molecule C[C@@H](Sc1cc(Cl)ccc1Cl)C(=O)N1CCC[C@H](CCC(N)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)C[C@H]1CCCN(C(=O)[C@@H](C)Sc2cc(Cl)ccc2Cl)C1 | C[C@@H](Sc1cc(Cl)ccc1Cl)C(=O)N1CCC[C@H](CCC(N)=O)C1 | CC(=O)C[C@H]1CCCN(C(=O)[C@@H](C)Sc2cc(Cl)ccc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)=O",
"old_substring": "C4CC(N)=O"
} |
Can you make molecule C[C@@H](Sc1cc(Cl)ccc1Cl)C(=O)N1CCC[C@H](CCC(N)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)=NO[C@H]1CCCN(C(=O)[C@@H](C)Sc2cc(Cl)ccc2Cl)C1 | C[C@@H](Sc1cc(Cl)ccc1Cl)C(=O)N1CCC[C@H](CCC(N)=O)C1 | CCC(CC)=NO[C@H]1CCCN(C(=O)[C@@H](C)Sc2cc(Cl)ccc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC(CC)=NO&",
"old_substring": "C4CC(N)=O"
} |
Can you make molecule C[C@@H](Sc1cc(Cl)ccc1Cl)C(=O)N1CCC[C@H](CCC(N)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Sc1cc(Cl)ccc1Cl)C(=O)N1CCC[C@H](CCCC(N)=S)C1 | C[C@@H](Sc1cc(Cl)ccc1Cl)C(=O)N1CCC[C@H](CCC(N)=O)C1 | C[C@@H](Sc1cc(Cl)ccc1Cl)C(=O)N1CCC[C@H](CCCC(N)=S)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(N)=S",
"old_substring": "C4CC(N)=O"
} |
Can you make molecule C[C@@H](Sc1cc(Cl)ccc1Cl)C(=O)N1CCC[C@H](CCC(N)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Sc1cc(Cl)ccc1Cl)C(=O)N1CCC[C@H](CCCC/C(N)=N/O)C1 | C[C@@H](Sc1cc(Cl)ccc1Cl)C(=O)N1CCC[C@H](CCC(N)=O)C1 | C[C@@H](Sc1cc(Cl)ccc1Cl)C(=O)N1CCC[C@H](CCCC/C(N)=N/O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC/C(N)=N/O",
"old_substring": "C4CC(N)=O"
} |
Can you make molecule COc1cc(-c2ccno2)ccc1S(=O)(=O)NCc1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(-c2ccno2)ccc1S(=O)(=O)NCc1ccco1 | COc1cc(-c2ccno2)ccc1S(=O)(=O)NCc1ccco1 | COCc1cc(-c2ccno2)ccc1S(=O)(=O)NCc1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(-c2ccno2)ccc1S(=O)(=O)NCc1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc(-c2ccno2)ccc1S(=O)(=O)NCc1ccco1 | COc1cc(-c2ccno2)ccc1S(=O)(=O)NCc1ccco1 | COCSc1cc(-c2ccno2)ccc1S(=O)(=O)NCc1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(-c2ccno2)ccc1S(=O)(=O)NCc1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1cc(-c2ccno2)ccc1S(=O)(=O)NCc1ccco1 | COc1cc(-c2ccno2)ccc1S(=O)(=O)NCc1ccco1 | CC(=O)Sc1cc(-c2ccno2)ccc1S(=O)(=O)NCc1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(-c2ccno2)ccc1S(=O)(=O)NCc1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS)c1cc(-c2ccno2)ccc1S(=O)(=O)NCc1ccco1 | COc1cc(-c2ccno2)ccc1S(=O)(=O)NCc1ccco1 | O=C(CS)c1cc(-c2ccno2)ccc1S(=O)(=O)NCc1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(-c2ccno2)ccc1S(=O)(=O)NCc1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CI)c1cc(-c2ccno2)ccc1S(=O)(=O)NCc1ccco1 | COc1cc(-c2ccno2)ccc1S(=O)(=O)NCc1ccco1 | O=C(CI)c1cc(-c2ccno2)ccc1S(=O)(=O)NCc1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule CCC[C@@H](CC)Nc1c(F)c(F)nc(F)c1F less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](Cl)CCCNc1c(F)c(F)nc(F)c1F | CCC[C@@H](CC)Nc1c(F)c(F)nc(F)c1F | CCC[C@@H](Cl)CCCNc1c(F)c(F)nc(F)c1F | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@@H](Cl)CCC&",
"old_substring": "CCC[C@H]2CC"
} |
Can you make molecule CCC[C@@H](CC)Nc1c(F)c(F)nc(F)c1F less soluble in water? The output molecule should be similar to the input molecule. | CCCCCC[C@@H](C)Nc1c(F)c(F)nc(F)c1F | CCC[C@@H](CC)Nc1c(F)c(F)nc(F)c1F | CCCCCC[C@@H](C)Nc1c(F)c(F)nc(F)c1F | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCC[C@H]&C",
"old_substring": "CCC[C@H]2CC"
} |
Can you make molecule CCC[C@@H](CC)Nc1c(F)c(F)nc(F)c1F less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H](CC)CNc1c(F)c(F)nc(F)c1F | CCC[C@@H](CC)Nc1c(F)c(F)nc(F)c1F | CCCC[C@H](CC)CNc1c(F)c(F)nc(F)c1F | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@@H](C&)CC",
"old_substring": "CCC[C@H]2CC"
} |
Can you make molecule CCC[C@@H](CC)Nc1c(F)c(F)nc(F)c1F less soluble in water? The output molecule should be similar to the input molecule. | CCCC(CCC)=Nc1c(F)c(F)nc(F)c1F | CCC[C@@H](CC)Nc1c(F)c(F)nc(F)c1F | CCCC(CCC)=Nc1c(F)c(F)nc(F)c1F | 102 | {
"fragment_index": 0,
"new_substring": "CCCC=&CCC",
"old_substring": "CCC[C@H]2CC"
} |
Can you make molecule CCC[C@@H](CC)Nc1c(F)c(F)nc(F)c1F less soluble in water? The output molecule should be similar to the input molecule. | CCCCCC(C)=Nc1c(F)c(F)nc(F)c1F | CCC[C@@H](CC)Nc1c(F)c(F)nc(F)c1F | CCCCCC(C)=Nc1c(F)c(F)nc(F)c1F | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCC=&C",
"old_substring": "CCC[C@H]2CC"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.