prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule O=C(COc1ncnc2ccc(Br)cc12)Nc1ccccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(COC(=S)Sc1ncnc2ccc(Br)cc12)Nc1ccccc1Cl | O=C(COc1ncnc2ccc(Br)cc12)Nc1ccccc1Cl | O=C(COC(=S)Sc1ncnc2ccc(Br)cc12)Nc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O45"
} |
Can you make molecule O=C(COc1ncnc2ccc(Br)cc12)Nc1ccccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | N=C(Cc1ncnc2ccc(Br)cc12)OCC(=O)Nc1ccccc1Cl | O=C(COc1ncnc2ccc(Br)cc12)Nc1ccccc1Cl | N=C(Cc1ncnc2ccc(Br)cc12)OCC(=O)Nc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O45"
} |
Can you make molecule O=C(COc1ncnc2ccc(Br)cc12)Nc1ccccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)c1ncnc2ccc(Br)cc12)CC(=O)Nc1ccccc1Cl | O=C(COc1ncnc2ccc(Br)cc12)Nc1ccccc1Cl | O=C(CCC(=O)c1ncnc2ccc(Br)cc12)CC(=O)Nc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O45"
} |
Can you make molecule O=C(COc1ncnc2ccc(Br)cc12)Nc1ccccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(C[C@H](O)CCc1ncnc2ccc(Br)cc12)Nc1ccccc1Cl | O=C(COc1ncnc2ccc(Br)cc12)Nc1ccccc1Cl | O=C(C[C@H](O)CCc1ncnc2ccc(Br)cc12)Nc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O45"
} |
Can you make molecule O=C(COc1ncnc2ccc(Br)cc12)Nc1ccccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ncnc2ccc(Br)cc12)CC(=O)Nc1ccccc1Cl | O=C(COc1ncnc2ccc(Br)cc12)Nc1ccccc1Cl | O=C(/C=C/Sc1ncnc2ccc(Br)cc12)CC(=O)Nc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O45"
} |
Can you make molecule C[C@@H](c1ccc(Cl)cc1Cl)N(C)C(=O)c1ccc(NC(N)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccc(Cl)cc1Cl)N(C)C(=O)c1ccc(NC(N)=O)cc1I | C[C@@H](c1ccc(Cl)cc1Cl)N(C)C(=O)c1ccc(NC(N)=O)cc1 | C[C@@H](c1ccc(Cl)cc1Cl)N(C)C(=O)c1ccc(NC(N)=O)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16ccc5cc1"
} |
Can you make molecule C[C@@H](c1ccc(Cl)cc1Cl)N(C)C(=O)c1ccc(NC(N)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccc(Cl)cc1Cl)N(C)C(=O)c1cc(NC(N)=O)ccc1Br | C[C@@H](c1ccc(Cl)cc1Cl)N(C)C(=O)c1ccc(NC(N)=O)cc1 | C[C@@H](c1ccc(Cl)cc1Cl)N(C)C(=O)c1cc(NC(N)=O)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16ccc5cc1"
} |
Can you make molecule C[C@@H](c1ccc(Cl)cc1Cl)N(C)C(=O)c1ccc(NC(N)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccc(Cl)cc1Cl)N(C)C(=O)c1ccc(NC(N)=O)cc1Cl | C[C@@H](c1ccc(Cl)cc1Cl)N(C)C(=O)c1ccc(NC(N)=O)cc1 | C[C@@H](c1ccc(Cl)cc1Cl)N(C)C(=O)c1ccc(NC(N)=O)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16ccc5cc1"
} |
Can you make molecule C[C@@H](c1ccc(Cl)cc1Cl)N(C)C(=O)c1ccc(NC(N)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccc(Cl)cc1Cl)N(C)C(=O)c1cccc(NC(N)=O)c1Br | C[C@@H](c1ccc(Cl)cc1Cl)N(C)C(=O)c1ccc(NC(N)=O)cc1 | C[C@@H](c1ccc(Cl)cc1Cl)N(C)C(=O)c1cccc(NC(N)=O)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c16ccc5cc1"
} |
Can you make molecule C[C@@H](c1ccc(Cl)cc1Cl)N(C)C(=O)c1ccc(NC(N)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccc(Cl)cc1Cl)N(C)C(=O)c1cccc(NC(N)=O)c1Cl | C[C@@H](c1ccc(Cl)cc1Cl)N(C)C(=O)c1ccc(NC(N)=O)cc1 | C[C@@H](c1ccc(Cl)cc1Cl)N(C)C(=O)c1cccc(NC(N)=O)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c16ccc5cc1"
} |
Can you make molecule Cc1ccc(N2C(=O)[C@@H](Cc3cccc(C)c3)S/C2=C(/C#N)C(N)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2C(=O)[C@@H](Cc3c(Cl)cccc3Cl)S/C2=C(/C#N)C(N)=O)cc1 | Cc1ccc(N2C(=O)[C@@H](Cc3cccc(C)c3)S/C2=C(/C#N)C(N)=O)cc1 | Cc1ccc(N2C(=O)[C@@H](Cc3c(Cl)cccc3Cl)S/C2=C(/C#N)C(N)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1cccc(Cl)c1&",
"old_substring": "c15cccc(C)c1"
} |
Can you make molecule Cc1ccc(N2C(=O)[C@@H](Cc3cccc(C)c3)S/C2=C(/C#N)C(N)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2C(=O)[C@@H](C=Cc3cccc(Cl)c3)S/C2=C(/C#N)C(N)=O)cc1 | Cc1ccc(N2C(=O)[C@@H](Cc3cccc(C)c3)S/C2=C(/C#N)C(N)=O)cc1 | Cc1ccc(N2C(=O)[C@@H](C=Cc3cccc(Cl)c3)S/C2=C(/C#N)C(N)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1cccc(Cl)c1",
"old_substring": "c15cccc(C)c1"
} |
Can you make molecule Cc1ccc(N2C(=O)[C@@H](Cc3cccc(C)c3)S/C2=C(/C#N)C(N)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2C(=O)[C@@H](Cc3cc(C)c(Cl)c(C)c3)S/C2=C(/C#N)C(N)=O)cc1 | Cc1ccc(N2C(=O)[C@@H](Cc3cccc(C)c3)S/C2=C(/C#N)C(N)=O)cc1 | Cc1ccc(N2C(=O)[C@@H](Cc3cc(C)c(Cl)c(C)c3)S/C2=C(/C#N)C(N)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(C)c1Cl",
"old_substring": "c15cccc(C)c1"
} |
Can you make molecule Cc1ccc(N2C(=O)[C@@H](Cc3cccc(C)c3)S/C2=C(/C#N)C(N)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2C(=O)[C@@H](C=Cc3cccc(C)c3C)S/C2=C(/C#N)C(N)=O)cc1 | Cc1ccc(N2C(=O)[C@@H](Cc3cccc(C)c3)S/C2=C(/C#N)C(N)=O)cc1 | Cc1ccc(N2C(=O)[C@@H](C=Cc3cccc(C)c3C)S/C2=C(/C#N)C(N)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cccc(C=&)c1C",
"old_substring": "c15cccc(C)c1"
} |
Can you make molecule Cc1ccc(N2C(=O)[C@@H](Cc3cccc(C)c3)S/C2=C(/C#N)C(N)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2C(=O)[C@@H](Cc3cc4cc(Cl)ccc4o3)S/C2=C(/C#N)C(N)=O)cc1 | Cc1ccc(N2C(=O)[C@@H](Cc3cccc(C)c3)S/C2=C(/C#N)C(N)=O)cc1 | Cc1ccc(N2C(=O)[C@@H](Cc3cc4cc(Cl)ccc4o3)S/C2=C(/C#N)C(N)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc(Cl)ccc2o1",
"old_substring": "c15cccc(C)c1"
} |
Can you make molecule CC(C)CN(C(=O)NCc1ccc(C(F)(F)F)cc1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC1=C2CCN2CC(C(=O)NCc2ccc(C(F)(F)F)cc2)=NC(C2CC2)=N1 | CC(C)CN(C(=O)NCc1ccc(C(F)(F)F)cc1)C1CC1 | CC(C)CC1=C2CCN2CC(C(=O)NCc2ccc(C(F)(F)F)cc2)=NC(C2CC2)=N1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c&nc&nc2C1",
"old_substring": "N246"
} |
Can you make molecule CC(C)CN(C(=O)NCc1ccc(C(F)(F)F)cc1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC1=C2OCCN2CC(C(=O)NCc2ccc(C(F)(F)F)cc2)=CC(C2CC2)=C1 | CC(C)CN(C(=O)NCc1ccc(C(F)(F)F)cc1)C1CC1 | CC(C)CC1=C2OCCN2CC(C(=O)NCc2ccc(C(F)(F)F)cc2)=CC(C2CC2)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2c&cc&cc2C1",
"old_substring": "N246"
} |
Can you make molecule CC(C)CN(C(=O)NCc1ccc(C(F)(F)F)cc1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC1(C2CC2)CCN(C(=O)NCc2ccc(C(F)(F)F)cc2)C1 | CC(C)CN(C(=O)NCc1ccc(C(F)(F)F)cc1)C1CC1 | CC(C)CC1(C2CC2)CCN(C(=O)NCc2ccc(C(F)(F)F)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N246"
} |
Can you make molecule CC(C)CN(C(=O)NCc1ccc(C(F)(F)F)cc1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC1(C2CC2)CCCN(C(=O)NCc2ccc(C(F)(F)F)cc2)C1 | CC(C)CN(C(=O)NCc1ccc(C(F)(F)F)cc1)C1CC1 | CC(C)CC1(C2CC2)CCCN(C(=O)NCc2ccc(C(F)(F)F)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N246"
} |
Can you make molecule CC(C)CN(C(=O)NCc1ccc(C(F)(F)F)cc1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Cc1oc(C(=O)NCc2ccc(C(F)(F)F)cc2)c(C#N)c1C1CC1 | CC(C)CN(C(=O)NCc1ccc(C(F)(F)F)cc1)C1CC1 | CC(C)Cc1oc(C(=O)NCc2ccc(C(F)(F)F)cc2)c(C#N)c1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N246"
} |
Can you make molecule ClCCc1nc2cccnc2n1CCn1cccn1 less soluble in water? The output molecule should be similar to the input molecule. | ClC1CCC(c2nc3cccnc3n2CCn2cccn2)CC1 | ClCCc1nc2cccnc2n1CCn1cccn1 | ClC1CCC(c2nc3cccnc3n2CCn2cccn2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "ClC1CCC&CC1",
"old_substring": "ClCC5"
} |
Can you make molecule ClCCc1nc2cccnc2n1CCn1cccn1 less soluble in water? The output molecule should be similar to the input molecule. | Cl/C=C(/Cl)Cc1nc2cccnc2n1CCn1cccn1 | ClCCc1nc2cccnc2n1CCn1cccn1 | Cl/C=C(/Cl)Cc1nc2cccnc2n1CCn1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "Cl/C=C(/Cl)C&",
"old_substring": "ClCC5"
} |
Can you make molecule ClCCc1nc2cccnc2n1CCn1cccn1 less soluble in water? The output molecule should be similar to the input molecule. | BrCCCc1nc2cccnc2n1CCn1cccn1 | ClCCc1nc2cccnc2n1CCn1cccn1 | BrCCCc1nc2cccnc2n1CCn1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "ClCC5"
} |
Can you make molecule ClCCc1nc2cccnc2n1CCn1cccn1 less soluble in water? The output molecule should be similar to the input molecule. | FCCCCc1nc2cccnc2n1CCn1cccn1 | ClCCc1nc2cccnc2n1CCn1cccn1 | FCCCCc1nc2cccnc2n1CCn1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCF",
"old_substring": "ClCC5"
} |
Can you make molecule ClCCc1nc2cccnc2n1CCn1cccn1 less soluble in water? The output molecule should be similar to the input molecule. | ClC[C@H](Cl)Cc1nc2cccnc2n1CCn1cccn1 | ClCCc1nc2cccnc2n1CCn1cccn1 | ClC[C@H](Cl)Cc1nc2cccnc2n1CCn1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "ClC[C@H](Cl)C&",
"old_substring": "ClCC5"
} |
Can you make molecule CC[C@@](C)([C@@H]([NH3+])c1cc(Br)ccc1F)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](O)[C@H](CC)N1CCOCC1.Fc1ccc(Br)cc1 | CC[C@@](C)([C@@H]([NH3+])c1cc(Br)ccc1F)N1CCOCC1 | CC[C@H](O)[C@H](CC)N1CCOCC1.Fc1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](O)[C@@H]&CC",
"old_substring": "CC[C@@]2(C)[C@H]3[NH3+]"
} |
Can you make molecule CC[C@@](C)([C@@H]([NH3+])c1cc(Br)ccc1F)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@](C)(C#N)N1CCOCC1.Fc1ccc(Br)cc1 | CC[C@@](C)([C@@H]([NH3+])c1cc(Br)ccc1F)N1CCOCC1 | CC[C@](C)(C#N)N1CCOCC1.Fc1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@]&(C)C#N",
"old_substring": "CC[C@@]2(C)[C@H]3[NH3+]"
} |
Can you make molecule CC[C@@](C)([C@@H]([NH3+])c1cc(Br)ccc1F)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[C@@H](C=O)N1CCOCC1.Fc1ccc(Br)cc1 | CC[C@@](C)([C@@H]([NH3+])c1cc(Br)ccc1F)N1CCOCC1 | CC[C@H](C)[C@@H](C=O)N1CCOCC1.Fc1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C)[C@H]&C=O",
"old_substring": "CC[C@@]2(C)[C@H]3[NH3+]"
} |
Can you make molecule CC[C@@](C)([C@@H]([NH3+])c1cc(Br)ccc1F)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@](C)(CO)N1CCOCC1.Fc1ccc(Br)cc1 | CC[C@@](C)([C@@H]([NH3+])c1cc(Br)ccc1F)N1CCOCC1 | CC[C@](C)(CO)N1CCOCC1.Fc1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@]&(C)CO",
"old_substring": "CC[C@@]2(C)[C@H]3[NH3+]"
} |
Can you make molecule CC[C@@](C)([C@@H]([NH3+])c1cc(Br)ccc1F)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@](C)(C(N)=S)N1CCOCC1.Fc1ccc(Br)cc1 | CC[C@@](C)([C@@H]([NH3+])c1cc(Br)ccc1F)N1CCOCC1 | CC[C@@](C)(C(N)=S)N1CCOCC1.Fc1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@]&(C)C(N)=S",
"old_substring": "CC[C@@]2(C)[C@H]3[NH3+]"
} |
Can you make molecule Cc1ccc(NC(=O)c2cc3ccccc3oc2=O)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NSC(=O)Cc2cc3ccccc3oc2=O)c([N+](=O)[O-])c1 | Cc1ccc(NC(=O)c2cc3ccccc3oc2=O)c([N+](=O)[O-])c1 | Cc1ccc(NSC(=O)Cc2cc3ccccc3oc2=O)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccc(NC(=O)c2cc3ccccc3oc2=O)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CCCC(=O)c2cc3ccccc3oc2=O)c([N+](=O)[O-])c1 | Cc1ccc(NC(=O)c2cc3ccccc3oc2=O)c([N+](=O)[O-])c1 | Cc1ccc(NC(=O)CCCC(=O)c2cc3ccccc3oc2=O)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccc(NC(=O)c2cc3ccccc3oc2=O)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CC(C)(C)c2cc3ccccc3oc2=O)c([N+](=O)[O-])c1 | Cc1ccc(NC(=O)c2cc3ccccc3oc2=O)c([N+](=O)[O-])c1 | Cc1ccc(NC(=O)CC(C)(C)c2cc3ccccc3oc2=O)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccc(NC(=O)c2cc3ccccc3oc2=O)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CCC(C)(C)c2cc3ccccc3oc2=O)c([N+](=O)[O-])c1 | Cc1ccc(NC(=O)c2cc3ccccc3oc2=O)c([N+](=O)[O-])c1 | Cc1ccc(NC(=O)CCC(C)(C)c2cc3ccccc3oc2=O)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccc(NC(=O)c2cc3ccccc3oc2=O)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NSC(=O)[C@@H](C)c2cc3ccccc3oc2=O)c([N+](=O)[O-])c1 | Cc1ccc(NC(=O)c2cc3ccccc3oc2=O)c([N+](=O)[O-])c1 | Cc1ccc(NSC(=O)[C@@H](C)c2cc3ccccc3oc2=O)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](OS(C)(=O)=O)[C@H]2O1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](CCS(C)(=O)=O)[C@H]2O1 | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](OS(C)(=O)=O)[C@H]2O1 | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](CCS(C)(=O)=O)[C@H]2O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CS(C)(=O)=O",
"old_substring": "O4S(C)(=O)=O"
} |
Can you make molecule CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](OS(C)(=O)=O)[C@H]2O1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)S(=O)(=O)[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H]1COC(C)(C)O1 | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](OS(C)(=O)=O)[C@H]2O1 | CC(C)S(=O)(=O)[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H]1COC(C)(C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)S&(=O)=O",
"old_substring": "O4S(C)(=O)=O"
} |
Can you make molecule CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](OS(C)(=O)=O)[C@H]2O1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CS(=O)(=O)[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H]1COC(C)(C)O1 | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](OS(C)(=O)=O)[C@H]2O1 | CC(C)CS(=O)(=O)[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H]1COC(C)(C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CS&(=O)=O",
"old_substring": "O4S(C)(=O)=O"
} |
Can you make molecule CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](OS(C)(=O)=O)[C@H]2O1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](CCCCS(C)(=O)=O)[C@H]2O1 | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](OS(C)(=O)=O)[C@H]2O1 | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](CCCCS(C)(=O)=O)[C@H]2O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS(C)(=O)=O",
"old_substring": "O4S(C)(=O)=O"
} |
Can you make molecule CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](OS(C)(=O)=O)[C@H]2O1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCS(=O)(=O)[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H]1COC(C)(C)O1 | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)[C@H](OS(C)(=O)=O)[C@H]2O1 | CC(C)CCS(=O)(=O)[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H]1COC(C)(C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCS&(=O)=O",
"old_substring": "O4S(C)(=O)=O"
} |
Can you make molecule Cc1cccc([C@H](CCl)CCC[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CC[C@@H]1CCCO1)c1cccc(C)c1 | Cc1cccc([C@H](CCl)CCC[C@@H]2CCCO2)c1 | CCCC[C@@H](CC[C@@H]1CCCO1)c1cccc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&CC&",
"old_substring": "[C@@H]4(CCl)CCC3"
} |
Can you make molecule Cc1cccc([C@H](CCl)CCC[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2cc([C@@H]3CCCO3)cc3c2CCC3(C)C)c1 | Cc1cccc([C@H](CCl)CCC[C@@H]2CCCO2)c1 | Cc1cccc(-c2cc([C@@H]3CCCO3)cc3c2CCC3(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc2c1CCC2(C)C",
"old_substring": "[C@@H]4(CCl)CCC3"
} |
Can you make molecule Cc1cccc([C@H](CCl)CCC[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2ccc3sc([C@@H]4CCCO4)c(Cl)c3c2)c1 | Cc1cccc([C@H](CCl)CCC[C@@H]2CCCO2)c1 | Cc1cccc(-c2ccc3sc([C@@H]4CCCO4)c(Cl)c3c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2sc&c(Cl)c2c1",
"old_substring": "[C@@H]4(CCl)CCC3"
} |
Can you make molecule Cc1cccc([C@H](CCl)CCC[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2ccc([C@@H]3CCCO3)c(Cl)c2Cl)c1 | Cc1cccc([C@H](CCl)CCC[C@@H]2CCCO2)c1 | Cc1cccc(-c2ccc([C@@H]3CCCO3)c(Cl)c2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&c(Cl)c1Cl",
"old_substring": "[C@@H]4(CCl)CCC3"
} |
Can you make molecule Cc1cccc([C@H](CCl)CCC[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2cc([C@@H]3CCCO3)cc(Cl)c2Cl)c1 | Cc1cccc([C@H](CCl)CCC[C@@H]2CCCO2)c1 | Cc1cccc(-c2cc([C@@H]3CCCO3)cc(Cl)c2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc(Cl)c1Cl",
"old_substring": "[C@@H]4(CCl)CCC3"
} |
Can you make molecule [NH3+][C@@H](CSCc1nccs1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@@H](CN1CCSc2ccc(Cc3nccs3)cc21)C(=O)[O-] | [NH3+][C@@H](CSCc1nccs1)C(=O)[O-] | [NH3+][C@@H](CN1CCSc2ccc(Cc3nccs3)cc21)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "S23"
} |
Can you make molecule [NH3+][C@@H](CSCc1nccs1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@@H](CSCSCc1nccs1)C(=O)[O-] | [NH3+][C@@H](CSCc1nccs1)C(=O)[O-] | [NH3+][C@@H](CSCSCc1nccs1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "S&CS&",
"old_substring": "S23"
} |
Can you make molecule [NH3+][C@@H](CSCc1nccs1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@@H](Cc1cc(Cc2nccs2)n2c1CSC2)C(=O)[O-] | [NH3+][C@@H](CSCc1nccs1)C(=O)[O-] | [NH3+][C@@H](Cc1cc(Cc2nccs2)n2c1CSC2)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&n2c1CSC2",
"old_substring": "S23"
} |
Can you make molecule [NH3+][C@@H](CSCc1nccs1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@@H](Cc1nc2sc(Cc3nccs3)cc2s1)C(=O)[O-] | [NH3+][C@@H](CSCc1nccs1)C(=O)[O-] | [NH3+][C@@H](Cc1nc2sc(Cc3nccs3)cc2s1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2sc&cc2s1",
"old_substring": "S23"
} |
Can you make molecule [NH3+][C@@H](CSCc1nccs1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@@H](Cc1cc2cn(Cc3nccs3)cc2s1)C(=O)[O-] | [NH3+][C@@H](CSCc1nccs1)C(=O)[O-] | [NH3+][C@@H](Cc1cc2cn(Cc3nccs3)cc2s1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cn&cc2s1",
"old_substring": "S23"
} |
Can you make molecule COc1ccc(C(=O)Nc2ccc(N3CCOCC3)cc2)c(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CC(=O)SNc2ccc(N3CCOCC3)cc2)c(O)c1 | COc1ccc(C(=O)Nc2ccc(N3CCOCC3)cc2)c(O)c1 | COc1ccc(CC(=O)SNc2ccc(N3CCOCC3)cc2)c(O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule COc1ccc(C(=O)Nc2ccc(N3CCOCC3)cc2)c(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)CCCC(=O)Nc2ccc(N3CCOCC3)cc2)c(O)c1 | COc1ccc(C(=O)Nc2ccc(N3CCOCC3)cc2)c(O)c1 | COc1ccc(C(=O)CCCC(=O)Nc2ccc(N3CCOCC3)cc2)c(O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C48=O"
} |
Can you make molecule COc1ccc(C(=O)Nc2ccc(N3CCOCC3)cc2)c(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(C)(C)CC(=O)Nc2ccc(N3CCOCC3)cc2)c(O)c1 | COc1ccc(C(=O)Nc2ccc(N3CCOCC3)cc2)c(O)c1 | COc1ccc(C(C)(C)CC(=O)Nc2ccc(N3CCOCC3)cc2)c(O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule COc1ccc(C(=O)Nc2ccc(N3CCOCC3)cc2)c(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(C)(C)CCC(=O)Nc2ccc(N3CCOCC3)cc2)c(O)c1 | COc1ccc(C(=O)Nc2ccc(N3CCOCC3)cc2)c(O)c1 | COc1ccc(C(C)(C)CCC(=O)Nc2ccc(N3CCOCC3)cc2)c(O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule COc1ccc(C(=O)Nc2ccc(N3CCOCC3)cc2)c(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H](C)C(=O)SNc2ccc(N3CCOCC3)cc2)c(O)c1 | COc1ccc(C(=O)Nc2ccc(N3CCOCC3)cc2)c(O)c1 | COc1ccc([C@H](C)C(=O)SNc2ccc(N3CCOCC3)cc2)c(O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C48=O"
} |
Can you make molecule CC[C@@H](CSC)NC(=O)NCc1cccc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCCCS)NC(=O)NCc1cccc(OC)c1 | CC[C@@H](CSC)NC(=O)NCc1cccc(OC)c1 | CC[C@@H](CCCCS)NC(=O)NCc1cccc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCC&",
"old_substring": "S7C"
} |
Can you make molecule CC[C@@H](CSC)NC(=O)NCc1cccc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CSC(F)F)NC(=O)NCc1cccc(OC)c1 | CC[C@@H](CSC)NC(=O)NCc1cccc(OC)c1 | CC[C@@H](CSC(F)F)NC(=O)NCc1cccc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)F",
"old_substring": "S7C"
} |
Can you make molecule CC[C@@H](CSC)NC(=O)NCc1cccc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCCCCCS)NC(=O)NCc1cccc(OC)c1 | CC[C@@H](CSC)NC(=O)NCc1cccc(OC)c1 | CC[C@@H](CCCCCCS)NC(=O)NCc1cccc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCC&",
"old_substring": "S7C"
} |
Can you make molecule CC[C@@H](CSC)NC(=O)NCc1cccc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCCCCCCS)NC(=O)NCc1cccc(OC)c1 | CC[C@@H](CSC)NC(=O)NCc1cccc(OC)c1 | CC[C@@H](CCCCCCCS)NC(=O)NCc1cccc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCCC&",
"old_substring": "S7C"
} |
Can you make molecule CC[C@@H](CSC)NC(=O)NCc1cccc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CSC(F)(F)F)NC(=O)NCc1cccc(OC)c1 | CC[C@@H](CSC)NC(=O)NCc1cccc(OC)c1 | CC[C@@H](CSC(F)(F)F)NC(=O)NCc1cccc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "S7C"
} |
Can you make molecule Cc1ccccc1NC(=O)COC(=O)c1ccc(Br)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1NC(=O)COSC(=O)Cc1ccc(Br)o1 | Cc1ccccc1NC(=O)COC(=O)c1ccc(Br)o1 | Cc1ccccc1NC(=O)COSC(=O)Cc1ccc(Br)o1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C26=O"
} |
Can you make molecule Cc1ccccc1NC(=O)COC(=O)c1ccc(Br)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1NC(=O)COC(=O)CCCC(=O)c1ccc(Br)o1 | Cc1ccccc1NC(=O)COC(=O)c1ccc(Br)o1 | Cc1ccccc1NC(=O)COC(=O)CCCC(=O)c1ccc(Br)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C26=O"
} |
Can you make molecule Cc1ccccc1NC(=O)COC(=O)c1ccc(Br)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1NC(=O)COC(=O)CC(C)(C)c1ccc(Br)o1 | Cc1ccccc1NC(=O)COC(=O)c1ccc(Br)o1 | Cc1ccccc1NC(=O)COC(=O)CC(C)(C)c1ccc(Br)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C26=O"
} |
Can you make molecule Cc1ccccc1NC(=O)COC(=O)c1ccc(Br)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1NC(=O)COC(=O)CCC(C)(C)c1ccc(Br)o1 | Cc1ccccc1NC(=O)COC(=O)c1ccc(Br)o1 | Cc1ccccc1NC(=O)COC(=O)CCC(C)(C)c1ccc(Br)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C26=O"
} |
Can you make molecule Cc1ccccc1NC(=O)COC(=O)c1ccc(Br)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1NC(=O)COSC(=O)[C@@H](C)c1ccc(Br)o1 | Cc1ccccc1NC(=O)COC(=O)c1ccc(Br)o1 | Cc1ccccc1NC(=O)COSC(=O)[C@@H](C)c1ccc(Br)o1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C26=O"
} |
Can you make molecule COc1ccc2nc(Nc3ccc4c(c3)CCC4)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc2nc(Nc3ccc4c(c3)CCC4)sc2c1 | COc1ccc2nc(Nc3ccc4c(c3)CCC4)sc2c1 | COCc1ccc2nc(Nc3ccc4c(c3)CCC4)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc2nc(Nc3ccc4c(c3)CCC4)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc2nc(Nc3ccc4c(c3)CCC4)sc2c1 | COc1ccc2nc(Nc3ccc4c(c3)CCC4)sc2c1 | COCSc1ccc2nc(Nc3ccc4c(c3)CCC4)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc2nc(Nc3ccc4c(c3)CCC4)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc2nc(Nc3ccc4c(c3)CCC4)sc2c1 | COc1ccc2nc(Nc3ccc4c(c3)CCC4)sc2c1 | CC(=O)Sc1ccc2nc(Nc3ccc4c(c3)CCC4)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc2nc(Nc3ccc4c(c3)CCC4)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS)c1ccc2nc(Nc3ccc4c(c3)CCC4)sc2c1 | COc1ccc2nc(Nc3ccc4c(c3)CCC4)sc2c1 | O=C(CS)c1ccc2nc(Nc3ccc4c(c3)CCC4)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc2nc(Nc3ccc4c(c3)CCC4)sc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CI)c1ccc2nc(Nc3ccc4c(c3)CCC4)sc2c1 | COc1ccc2nc(Nc3ccc4c(c3)CCC4)sc2c1 | O=C(CI)c1ccc2nc(Nc3ccc4c(c3)CCC4)sc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule C[C@H](CC(=O)N(C)Cc1cccc(Cl)c1)[NH2+][C@@H](C)C1CCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH2+][C@H](CCl)CCCN(C)Cc1cccc(Cl)c1)C1CCC1 | C[C@H](CC(=O)N(C)Cc1cccc(Cl)c1)[NH2+][C@@H](C)C1CCC1 | C[C@H]([NH2+][C@H](CCl)CCCN(C)Cc1cccc(Cl)c1)C1CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]4(C)CC2=O"
} |
Can you make molecule C[C@H](CC(=O)N(C)Cc1cccc(Cl)c1)[NH2+][C@@H](C)C1CCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH2+][C@H](C)C(C)(C)CN(C)Cc1cccc(Cl)c1)C1CCC1 | C[C@H](CC(=O)N(C)Cc1cccc(Cl)c1)[NH2+][C@@H](C)C1CCC1 | C[C@H]([NH2+][C@H](C)C(C)(C)CN(C)Cc1cccc(Cl)c1)C1CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "[C@@H]4(C)CC2=O"
} |
Can you make molecule C[C@H](CC(=O)N(C)Cc1cccc(Cl)c1)[NH2+][C@@H](C)C1CCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH2+][C@@H](CBr)CCN(C)Cc1cccc(Cl)c1)C1CCC1 | C[C@H](CC(=O)N(C)Cc1cccc(Cl)c1)[NH2+][C@@H](C)C1CCC1 | C[C@H]([NH2+][C@@H](CBr)CCN(C)Cc1cccc(Cl)c1)C1CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@@H]4(C)CC2=O"
} |
Can you make molecule C[C@H](CC(=O)N(C)Cc1cccc(Cl)c1)[NH2+][C@@H](C)C1CCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCN(C)Cc1cccc(Cl)c1)[NH2+][C@@H](C)C1CCC1 | C[C@H](CC(=O)N(C)Cc1cccc(Cl)c1)[NH2+][C@@H](C)C1CCC1 | CC[C@@H](CCN(C)Cc1cccc(Cl)c1)[NH2+][C@@H](C)C1CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@@H]4(C)CC2=O"
} |
Can you make molecule C[C@H](CC(=O)N(C)Cc1cccc(Cl)c1)[NH2+][C@@H](C)C1CCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH2+][C@@H](CBr)CCCN(C)Cc1cccc(Cl)c1)C1CCC1 | C[C@H](CC(=O)N(C)Cc1cccc(Cl)c1)[NH2+][C@@H](C)C1CCC1 | C[C@H]([NH2+][C@@H](CBr)CCCN(C)Cc1cccc(Cl)c1)C1CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@@H]4(C)CC2=O"
} |
Can you make molecule CC1(C)CCCC[C@H]1[NH2+]Cc1c[nH]cn1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCCC[C@H]1[NH+]1CC2(CC2)C1.Cc1c[nH]cn1 | CC1(C)CCCC[C@H]1[NH2+]Cc1c[nH]cn1 | CC1(C)CCCC[C@H]1[NH+]1CC2(CC2)C1.Cc1c[nH]cn1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC2(CC2)C1",
"old_substring": "[NH2+]23"
} |
Can you make molecule CC1(C)CCCC[C@H]1[NH2+]Cc1c[nH]cn1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCCC[C@H]1[NH+]1CC2(CCC2)C1.Cc1c[nH]cn1 | CC1(C)CCCC[C@H]1[NH2+]Cc1c[nH]cn1 | CC1(C)CCCC[C@H]1[NH+]1CC2(CCC2)C1.Cc1c[nH]cn1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC2(CCC2)C1",
"old_substring": "[NH2+]23"
} |
Can you make molecule CC1(C)CCCC[C@H]1[NH2+]Cc1c[nH]cn1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCCC[C@H]1[N+]#N.Cc1c[nH]cn1 | CC1(C)CCCC[C@H]1[NH2+]Cc1c[nH]cn1 | CC1(C)CCCC[C@H]1[N+]#N.Cc1c[nH]cn1 | 102 | {
"fragment_index": 0,
"new_substring": "[N+]&#N",
"old_substring": "[NH2+]23"
} |
Can you make molecule CC1(C)CCCC[C@H]1[NH2+]Cc1c[nH]cn1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCCC[C@H]1[NH+]1CCCC1.Cc1c[nH]cn1 | CC1(C)CCCC[C@H]1[NH2+]Cc1c[nH]cn1 | CC1(C)CCCC[C@H]1[NH+]1CCCC1.Cc1c[nH]cn1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC1",
"old_substring": "[NH2+]23"
} |
Can you make molecule CC1(C)CCCC[C@H]1[NH2+]Cc1c[nH]cn1 less soluble in water? The output molecule should be similar to the input molecule. | CC1C[NH+]([C@@H]2CCCCC2(C)C)C1.Cc1c[nH]cn1 | CC1(C)CCCC[C@H]1[NH2+]Cc1c[nH]cn1 | CC1C[NH+]([C@@H]2CCCCC2(C)C)C1.Cc1c[nH]cn1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1C[NH+]&C1",
"old_substring": "[NH2+]23"
} |
Can you make molecule O=C(NNS(=O)(=O)c1cccs1)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(NNS(=O)(=O)c1cccs1)c1ccc(I)cc1F | O=C(NNS(=O)(=O)c1cccs1)c1ccccc1F | O=C(NNS(=O)(=O)c1cccs1)c1ccc(I)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c12ccccc1F"
} |
Can you make molecule O=C(NNS(=O)(=O)c1cccs1)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(NNS(=O)(=O)c1cccs1)c1cc(I)ccc1F | O=C(NNS(=O)(=O)c1cccs1)c1ccccc1F | O=C(NNS(=O)(=O)c1cccs1)c1cc(I)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1F",
"old_substring": "c12ccccc1F"
} |
Can you make molecule O=C(NNS(=O)(=O)c1cccs1)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(NNS(=O)(=O)c1cccs1)c1ccccc1Cl | O=C(NNS(=O)(=O)c1cccs1)c1ccccc1F | O=C(NNS(=O)(=O)c1cccs1)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c12ccccc1F"
} |
Can you make molecule O=C(NNS(=O)(=O)c1cccs1)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(NNS(=O)(=O)c1cccs1)c1cc2sccc2s1 | O=C(NNS(=O)(=O)c1cccs1)c1ccccc1F | O=C(NNS(=O)(=O)c1cccs1)c1cc2sccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sccc2s1",
"old_substring": "c12ccccc1F"
} |
Can you make molecule O=C(NNS(=O)(=O)c1cccs1)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(NNS(=O)(=O)c1cccs1)c1cc(F)ccc1Br | O=C(NNS(=O)(=O)c1cccs1)c1ccccc1F | O=C(NNS(=O)(=O)c1cccs1)c1cc(F)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c12ccccc1F"
} |
Can you make molecule O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1ccc[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1ccc[nH]c1=S | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1ccc[nH]1 | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1ccc[nH]c1=S | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc[nH]c1=S",
"old_substring": "c14ccc[nH]1"
} |
Can you make molecule O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1ccc[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1cc(Cl)c[nH]1 | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1ccc[nH]1 | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1cc(Cl)c[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)c[nH]1",
"old_substring": "c14ccc[nH]1"
} |
Can you make molecule O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1ccc[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1cc(Br)c[nH]1 | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1ccc[nH]1 | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1cc(Br)c[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c[nH]1",
"old_substring": "c14ccc[nH]1"
} |
Can you make molecule O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1ccc[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1cc2sccc2[nH]1 | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1ccc[nH]1 | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1cc2sccc2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sccc2[nH]1",
"old_substring": "c14ccc[nH]1"
} |
Can you make molecule O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1ccc[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1cc2ccccc2[nH]1 | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1ccc[nH]1 | O=C(CSc1nnc(-c2ccco2)n1-c1ccccc1)c1cc2ccccc2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2ccccc2[nH]1",
"old_substring": "c14ccc[nH]1"
} |
Can you make molecule COc1ccc(Cc2nn(C[NH+]3CCCC3)c(=S)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(Cc2nn(C[NH+]3CCCC3)c(=S)o2)cc1 | COc1ccc(Cc2nn(C[NH+]3CCCC3)c(=S)o2)cc1 | COCc1ccc(Cc2nn(C[NH+]3CCCC3)c(=S)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(Cc2nn(C[NH+]3CCCC3)c(=S)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(Cc2nn(C[NH+]3CCCC3)c(=S)o2)cc1 | COc1ccc(Cc2nn(C[NH+]3CCCC3)c(=S)o2)cc1 | COCSc1ccc(Cc2nn(C[NH+]3CCCC3)c(=S)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(Cc2nn(C[NH+]3CCCC3)c(=S)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(Cc2nn(C[NH+]3CCCC3)c(=S)o2)cc1 | COc1ccc(Cc2nn(C[NH+]3CCCC3)c(=S)o2)cc1 | CC(=O)Sc1ccc(Cc2nn(C[NH+]3CCCC3)c(=S)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(Cc2nn(C[NH+]3CCCC3)c(=S)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS)c1ccc(Cc2nn(C[NH+]3CCCC3)c(=S)o2)cc1 | COc1ccc(Cc2nn(C[NH+]3CCCC3)c(=S)o2)cc1 | O=C(CS)c1ccc(Cc2nn(C[NH+]3CCCC3)c(=S)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(Cc2nn(C[NH+]3CCCC3)c(=S)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CI)c1ccc(Cc2nn(C[NH+]3CCCC3)c(=S)o2)cc1 | COc1ccc(Cc2nn(C[NH+]3CCCC3)c(=S)o2)cc1 | O=C(CI)c1ccc(Cc2nn(C[NH+]3CCCC3)c(=S)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc2c(c1)CCN(C(=O)[C@H](C)n1nc(-c3ccccc3)ccc1=O)C2 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)CCN(SC(=O)[C@@H](C)n1nc(-c3ccccc3)ccc1=O)C2 | COc1ccc2c(c1)CCN(C(=O)[C@H](C)n1nc(-c3ccccc3)ccc1=O)C2 | COc1ccc2c(c1)CCN(SC(=O)[C@@H](C)n1nc(-c3ccccc3)ccc1=O)C2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C4(=O)[C@@H]6C"
} |
Can you make molecule COc1ccc2c(c1)CCN(C(=O)[C@H](C)n1nc(-c3ccccc3)ccc1=O)C2 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)CCN(C(=O)C[C@@H](Br)n1nc(-c3ccccc3)ccc1=O)C2 | COc1ccc2c(c1)CCN(C(=O)[C@H](C)n1nc(-c3ccccc3)ccc1=O)C2 | COc1ccc2c(c1)CCN(C(=O)C[C@@H](Br)n1nc(-c3ccccc3)ccc1=O)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C4(=O)[C@@H]6C"
} |
Can you make molecule COc1ccc2c(c1)CCN(C(=O)[C@H](C)n1nc(-c3ccccc3)ccc1=O)C2 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)CCN([C@@H](C)CCn1nc(-c3ccccc3)ccc1=O)C2 | COc1ccc2c(c1)CCN(C(=O)[C@H](C)n1nc(-c3ccccc3)ccc1=O)C2 | COc1ccc2c(c1)CCN([C@@H](C)CCn1nc(-c3ccccc3)ccc1=O)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C4(=O)[C@@H]6C"
} |
Can you make molecule COc1ccc2c(c1)CCN(C(=O)[C@H](C)n1nc(-c3ccccc3)ccc1=O)C2 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)CCN([C@@H](CCn1nc(-c3ccccc3)ccc1=O)C(C)C)C2 | COc1ccc2c(c1)CCN(C(=O)[C@H](C)n1nc(-c3ccccc3)ccc1=O)C2 | COc1ccc2c(c1)CCN([C@@H](CCn1nc(-c3ccccc3)ccc1=O)C(C)C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "C4(=O)[C@@H]6C"
} |
Can you make molecule COc1ccc2c(c1)CCN(C(=O)[C@H](C)n1nc(-c3ccccc3)ccc1=O)C2 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)CCN(C(=O)C[C@@H](C(C)C)n1nc(-c3ccccc3)ccc1=O)C2 | COc1ccc2c(c1)CCN(C(=O)[C@H](C)n1nc(-c3ccccc3)ccc1=O)C2 | COc1ccc2c(c1)CCN(C(=O)C[C@@H](C(C)C)n1nc(-c3ccccc3)ccc1=O)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&C(C)C",
"old_substring": "C4(=O)[C@@H]6C"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.