prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(C)(C)c1nc(CC[NH2+]C2CCN(Cc3cccnc3)CC2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1ccc(CC[NH2+]C2CCN(Cc3cccnc3)CC2)s1 | CC(C)(C)c1nc(CC[NH2+]C2CCN(Cc3cccnc3)CC2)cs1 | CC(C)(C)c1ccc(CC[NH2+]C2CCN(Cc3cccnc3)CC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&s1",
"old_substring": "c17nc8cs1"
} |
Can you make molecule CC(C)(C)c1nc(CC[NH2+]C2CCN(Cc3cccnc3)CC2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1sc(CC[NH2+]C2CCN(Cc3cccnc3)CC2)nc1Cl | CC(C)(C)c1nc(CC[NH2+]C2CCN(Cc3cccnc3)CC2)cs1 | CC(C)(C)c1sc(CC[NH2+]C2CCN(Cc3cccnc3)CC2)nc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc&nc1Cl",
"old_substring": "c17nc8cs1"
} |
Can you make molecule CC(C)(C)c1nc(CC[NH2+]C2CCN(Cc3cccnc3)CC2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1nc2c(CC[NH2+]C3CCN(Cc4cccnc4)CC3)cccc2s1 | CC(C)(C)c1nc(CC[NH2+]C2CCN(Cc3cccnc3)CC2)cs1 | CC(C)(C)c1nc2c(CC[NH2+]C3CCN(Cc4cccnc4)CC3)cccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2c&cccc2s1",
"old_substring": "c17nc8cs1"
} |
Can you make molecule CC(C)(C)c1nc(CC[NH2+]C2CCN(Cc3cccnc3)CC2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1nccc(CC[NH2+]C2CCN(Cc3cccnc3)CC2)c1I | CC(C)(C)c1nc(CC[NH2+]C2CCN(Cc3cccnc3)CC2)cs1 | CC(C)(C)c1nccc(CC[NH2+]C2CCN(Cc3cccnc3)CC2)c1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&nccc&c1I",
"old_substring": "c17nc8cs1"
} |
Can you make molecule CC(C)(C)c1nc(CC[NH2+]C2CCN(Cc3cccnc3)CC2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1cc(CC[NH2+]C2CCN(Cc3cccnc3)CC2)sc1Br | CC(C)(C)c1nc(CC[NH2+]C2CCN(Cc3cccnc3)CC2)cs1 | CC(C)(C)c1cc(CC[NH2+]C2CCN(Cc3cccnc3)CC2)sc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&sc1Br",
"old_substring": "c17nc8cs1"
} |
Can you make molecule COc1ccc(S(=O)(=O)N(CC(=O)N2CC[NH2+]CC2)C(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(S(=O)(=O)C2(C(C)C)CCCN(CC(=O)N3CC[NH2+]CC3)C2)cc1 | COc1ccc(S(=O)(=O)N(CC(=O)N2CC[NH2+]CC2)C(C)C)cc1 | COc1ccc(S(=O)(=O)C2(C(C)C)CCCN(CC(=O)N3CC[NH2+]CC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N567"
} |
Can you make molecule COc1ccc(S(=O)(=O)N(CC(=O)N2CC[NH2+]CC2)C(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(S(=O)(=O)c2c(C(C)C)oc(CC(=O)N3CC[NH2+]CC3)c2C#N)cc1 | COc1ccc(S(=O)(=O)N(CC(=O)N2CC[NH2+]CC2)C(C)C)cc1 | COc1ccc(S(=O)(=O)c2c(C(C)C)oc(CC(=O)N3CC[NH2+]CC3)c2C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N567"
} |
Can you make molecule COc1ccc(S(=O)(=O)N(CC(=O)N2CC[NH2+]CC2)C(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(S(=O)(=O)[C@]2(C(C)C)CCCN(CC(=O)N3CC[NH2+]CC3)C2)cc1 | COc1ccc(S(=O)(=O)N(CC(=O)N2CC[NH2+]CC2)C(C)C)cc1 | COc1ccc(S(=O)(=O)[C@]2(C(C)C)CCCN(CC(=O)N3CC[NH2+]CC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@]&&C1",
"old_substring": "N567"
} |
Can you make molecule COc1ccc(S(=O)(=O)N(CC(=O)N2CC[NH2+]CC2)C(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(S(=O)(=O)N2C(=O)C(=C(C)C)N=C2SCC(=O)N2CC[NH2+]CC2)cc1 | COc1ccc(S(=O)(=O)N(CC(=O)N2CC[NH2+]CC2)C(C)C)cc1 | COc1ccc(S(=O)(=O)N2C(=O)C(=C(C)C)N=C2SCC(=O)N2CC[NH2+]CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C1=NC=&C(=O)N1&",
"old_substring": "N567"
} |
Can you make molecule COc1ccc(S(=O)(=O)N(CC(=O)N2CC[NH2+]CC2)C(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(S(=O)(=O)c2ccc(C(C)C)cc2/C=N/OCC(=O)N2CC[NH2+]CC2)cc1 | COc1ccc(S(=O)(=O)N(CC(=O)N2CC[NH2+]CC2)C(C)C)cc1 | COc1ccc(S(=O)(=O)c2ccc(C(C)C)cc2/C=N/OCC(=O)N2CC[NH2+]CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1cc&ccc1&",
"old_substring": "N567"
} |
Can you make molecule CCn1nnnc1/N=C/c1ccccc1OC less soluble in water? The output molecule should be similar to the input molecule. | C=CSn1nnnc1/N=C/c1ccccc1OC | CCn1nnnc1/N=C/c1ccccc1OC | C=CSn1nnnc1/N=C/c1ccccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CCn1nnnc1/N=C/c1ccccc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1/C=N/c1nnnn1C(C)C | CCn1nnnc1/N=C/c1ccccc1OC | COc1ccccc1/C=N/c1nnnn1C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC3"
} |
Can you make molecule CCn1nnnc1/N=C/c1ccccc1OC less soluble in water? The output molecule should be similar to the input molecule. | C=CCCn1nnnc1/N=C/c1ccccc1OC | CCn1nnnc1/N=C/c1ccccc1OC | C=CCCn1nnnc1/N=C/c1ccccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CCn1nnnc1/N=C/c1ccccc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1/C=N/c1nnnn1CCCCl | CCn1nnnc1/N=C/c1ccccc1OC | COc1ccccc1/C=N/c1nnnn1CCCCl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CCn1nnnc1/N=C/c1ccccc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1/C=N/c1nnnn1CCCCS | CCn1nnnc1/N=C/c1ccccc1OC | COc1ccccc1/C=N/c1nnnn1CCCCS | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule CC(=Cc1ccc2c(c1)CCO2)C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)([NH3+])CCC=Cc1ccc2c(c1)CCO2 | CC(=Cc1ccc2c(c1)CCO2)C[NH3+] | CC(C)([NH3+])CCC=Cc1ccc2c(c1)CCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C3CCC(C)(C)[NH3+]",
"old_substring": "CC=3C[NH3+]"
} |
Can you make molecule CC(=Cc1ccc2c(c1)CCO2)C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | C=C1CC[NH2+]C1.C=Cc1ccc2c(c1)CCO2 | CC(=Cc1ccc2c(c1)CCO2)C[NH3+] | C=C1CC[NH2+]C1.C=Cc1ccc2c(c1)CCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C1=2CC[NH2+]C1",
"old_substring": "CC=3C[NH3+]"
} |
Can you make molecule CC(=Cc1ccc2c(c1)CCO2)C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | C=C1CC[NH2+]CC1.C=Cc1ccc2c(c1)CCO2 | CC(=Cc1ccc2c(c1)CCO2)C[NH3+] | C=C1CC[NH2+]CC1.C=Cc1ccc2c(c1)CCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C1=2CC[NH2+]CC1",
"old_substring": "CC=3C[NH3+]"
} |
Can you make molecule CC(=Cc1ccc2c(c1)CCO2)C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | CCC([NH3+])(C=Cc1ccc2c(c1)CCO2)CC | CC(=Cc1ccc2c(c1)CCO2)C[NH3+] | CCC([NH3+])(C=Cc1ccc2c(c1)CCO2)CC | 102 | {
"fragment_index": 0,
"new_substring": "C3C([NH3+])(CC)CC",
"old_substring": "CC=3C[NH3+]"
} |
Can you make molecule CC(=Cc1ccc2c(c1)CCO2)C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C[NH3+])CC=Cc1ccc2c(c1)CCO2 | CC(=Cc1ccc2c(c1)CCO2)C[NH3+] | CC(C)(C[NH3+])CC=Cc1ccc2c(c1)CCO2 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C[NH3+])CC3",
"old_substring": "CC=3C[NH3+]"
} |
Can you make molecule COc1ccc2oc(=O)c(C(=O)Nc3cc(OC)c(Cl)cc3OC)cc2c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc2oc(=O)c(C(=O)Nc3cc(OC)c(Cl)cc3OC)cc2c1 | COc1ccc2oc(=O)c(C(=O)Nc3cc(OC)c(Cl)cc3OC)cc2c1 | COCc1ccc2oc(=O)c(C(=O)Nc3cc(OC)c(Cl)cc3OC)cc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc2oc(=O)c(C(=O)Nc3cc(OC)c(Cl)cc3OC)cc2c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc2oc(=O)c(C(=O)Nc3cc(OC)c(Cl)cc3OC)cc2c1 | COc1ccc2oc(=O)c(C(=O)Nc3cc(OC)c(Cl)cc3OC)cc2c1 | COCSc1ccc2oc(=O)c(C(=O)Nc3cc(OC)c(Cl)cc3OC)cc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc2oc(=O)c(C(=O)Nc3cc(OC)c(Cl)cc3OC)cc2c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)c2cc3cc(SC(C)=O)ccc3oc2=O)c(OC)cc1Cl | COc1ccc2oc(=O)c(C(=O)Nc3cc(OC)c(Cl)cc3OC)cc2c1 | COc1cc(NC(=O)c2cc3cc(SC(C)=O)ccc3oc2=O)c(OC)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc2oc(=O)c(C(=O)Nc3cc(OC)c(Cl)cc3OC)cc2c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)c2cc3cc(C(=O)CS)ccc3oc2=O)c(OC)cc1Cl | COc1ccc2oc(=O)c(C(=O)Nc3cc(OC)c(Cl)cc3OC)cc2c1 | COc1cc(NC(=O)c2cc3cc(C(=O)CS)ccc3oc2=O)c(OC)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc2oc(=O)c(C(=O)Nc3cc(OC)c(Cl)cc3OC)cc2c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)c2cc3cc(C(=O)CI)ccc3oc2=O)c(OC)cc1Cl | COc1ccc2oc(=O)c(C(=O)Nc3cc(OC)c(Cl)cc3OC)cc2c1 | COc1cc(NC(=O)c2cc3cc(C(=O)CI)ccc3oc2=O)c(OC)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule O=C(Nc1ccc(Cl)cc1)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl)Nc1ccc(Cl)cc1 | O=C(Nc1ccc(Cl)cc1)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl | O=C(/C=C/Sc1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl)Nc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(Nc1ccc(Cl)cc1)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(Nc2ccc(Cl)cc2)nc1-c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl | O=C(Nc1ccc(Cl)cc1)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl | O=Cc1sc(Nc2ccc(Cl)cc2)nc1-c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(Nc1ccc(Cl)cc1)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(Nc2ccc(Cl)cc2)sc1-c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl | O=C(Nc1ccc(Cl)cc1)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl | O=Cc1nc(Nc2ccc(Cl)cc2)sc1-c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(Nc1ccc(Cl)cc1)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(Cl)cc1)n1nc(-c2cc(S(=O)(=O)N3CCOCC3)c(Cl)cc2Cl)oc1=S | O=C(Nc1ccc(Cl)cc1)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl | O=C(Nc1ccc(Cl)cc1)n1nc(-c2cc(S(=O)(=O)N3CCOCC3)c(Cl)cc2Cl)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C36"
} |
Can you make molecule O=C(Nc1ccc(Cl)cc1)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1cc(-c2ccc(/C=N/ONc3ccc(Cl)cc3)o2)c(Cl)cc1Cl)N1CCOCC1 | O=C(Nc1ccc(Cl)cc1)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl | O=S(=O)(c1cc(-c2ccc(/C=N/ONc3ccc(Cl)cc3)o2)c(Cl)cc1Cl)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C36"
} |
Can you make molecule CC1([C@H]([NH3+])Cc2cccs2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1([C@H]([NH3+])Cc2ccc(Cl)s2)CCCC1 | CC1([C@H]([NH3+])Cc2cccs2)CCCC1 | CC1([C@H]([NH3+])Cc2ccc(Cl)s2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c13cccs1"
} |
Can you make molecule CC1([C@H]([NH3+])Cc2cccs2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1([C@H]([NH3+])Cc2ccc(Br)s2)CCCC1 | CC1([C@H]([NH3+])Cc2cccs2)CCCC1 | CC1([C@H]([NH3+])Cc2ccc(Br)s2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c13cccs1"
} |
Can you make molecule CC1([C@H]([NH3+])Cc2cccs2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1([C@H]([NH3+])Cc2sccc2Br)CCCC1 | CC1([C@H]([NH3+])Cc2cccs2)CCCC1 | CC1([C@H]([NH3+])Cc2sccc2Br)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c13cccs1"
} |
Can you make molecule CC1([C@H]([NH3+])Cc2cccs2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1([C@H]([NH3+])Cc2csc(I)c2)CCCC1 | CC1([C@H]([NH3+])Cc2cccs2)CCCC1 | CC1([C@H]([NH3+])Cc2csc(I)c2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(I)c1",
"old_substring": "c13cccs1"
} |
Can you make molecule CC1([C@H]([NH3+])Cc2cccs2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1([C@H]([NH3+])Cc2cc3c(s2)CSC3)CCCC1 | CC1([C@H]([NH3+])Cc2cccs2)CCCC1 | CC1([C@H]([NH3+])Cc2cc3c(s2)CSC3)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(s1)CSC2",
"old_substring": "c13cccs1"
} |
Can you make molecule C#CCOc1ccc(C=C2SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCCCOc1ccc(C=C2SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1 | C#CCOc1ccc(C=C2SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1 | C#CCCCOc1ccc(C=C2SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C#CCCC&",
"old_substring": "C#CC4"
} |
Can you make molecule C#CCOc1ccc(C=C2SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCCCCOc1ccc(C=C2SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1 | C#CCOc1ccc(C=C2SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1 | C#CCCCCOc1ccc(C=C2SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C#CCCCC&",
"old_substring": "C#CC4"
} |
Can you make molecule C#CCOc1ccc(C=C2SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C#CC(C)(C)Oc1ccc(C=C2SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1 | C#CCOc1ccc(C=C2SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1 | C#CC(C)(C)Oc1ccc(C=C2SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C#CC&(C)C",
"old_substring": "C#CC4"
} |
Can you make molecule C#CCOc1ccc(C=C2SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCC(C)(C)Oc1ccc(C=C2SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1 | C#CCOc1ccc(C=C2SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1 | C#CCC(C)(C)Oc1ccc(C=C2SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C#CCC&(C)C",
"old_substring": "C#CC4"
} |
Can you make molecule C#CCOc1ccc(C=C2SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C#CC(CC)(CC)Oc1ccc(C=C2SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1 | C#CCOc1ccc(C=C2SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1 | C#CC(CC)(CC)Oc1ccc(C=C2SC(=O)N(Cc3ccc(F)cc3)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C#CC&(CC)CC",
"old_substring": "C#CC4"
} |
Can you make molecule CC1=C(C(=O)Nc2ccccc2Cl)[C@H](c2ccccc2Cl)NC(=S)N1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)Nc2ccccc2Cl)[C@H](c2cc(I)ccc2Cl)NC(=S)N1 | CC1=C(C(=O)Nc2ccccc2Cl)[C@H](c2ccccc2Cl)NC(=S)N1 | CC1=C(C(=O)Nc2ccccc2Cl)[C@H](c2cc(I)ccc2Cl)NC(=S)N1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1Cl",
"old_substring": "c15ccccc1Cl"
} |
Can you make molecule CC1=C(C(=O)Nc2ccccc2Cl)[C@H](c2ccccc2Cl)NC(=S)N1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)Nc2ccccc2Cl)[C@H](c2cc(Br)ccc2Cl)NC(=S)N1 | CC1=C(C(=O)Nc2ccccc2Cl)[C@H](c2ccccc2Cl)NC(=S)N1 | CC1=C(C(=O)Nc2ccccc2Cl)[C@H](c2cc(Br)ccc2Cl)NC(=S)N1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Cl",
"old_substring": "c15ccccc1Cl"
} |
Can you make molecule CC1=C(C(=O)Nc2ccccc2Cl)[C@H](c2ccccc2Cl)NC(=S)N1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)Nc2ccccc2Cl)[C@H](c2sc3sccc3c2Cl)NC(=S)N1 | CC1=C(C(=O)Nc2ccccc2Cl)[C@H](c2ccccc2Cl)NC(=S)N1 | CC1=C(C(=O)Nc2ccccc2Cl)[C@H](c2sc3sccc3c2Cl)NC(=S)N1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2sccc2c1Cl",
"old_substring": "c15ccccc1Cl"
} |
Can you make molecule CC1=C(C(=O)Nc2ccccc2Cl)[C@H](c2ccccc2Cl)NC(=S)N1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)Nc2ccccc2Cl)[C@H](c2sc3ccccc3c2Cl)NC(=S)N1 | CC1=C(C(=O)Nc2ccccc2Cl)[C@H](c2ccccc2Cl)NC(=S)N1 | CC1=C(C(=O)Nc2ccccc2Cl)[C@H](c2sc3ccccc3c2Cl)NC(=S)N1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2ccccc2c1Cl",
"old_substring": "c15ccccc1Cl"
} |
Can you make molecule CC1=C(C(=O)Nc2ccccc2Cl)[C@H](c2ccccc2Cl)NC(=S)N1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)Nc2ccccc2Cl)[C@H](c2cc(Br)c(F)cc2Cl)NC(=S)N1 | CC1=C(C(=O)Nc2ccccc2Cl)[C@H](c2ccccc2Cl)NC(=S)N1 | CC1=C(C(=O)Nc2ccccc2Cl)[C@H](c2cc(Br)c(F)cc2Cl)NC(=S)N1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c(F)cc1Cl",
"old_substring": "c15ccccc1Cl"
} |
Can you make molecule CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)[C@@H]1CCOc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C[C@H](CC)NC(=O)[C@@H]1CCOc2ccccc21 | CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)[C@@H]1CCOc2ccccc21 | CC[C@@H](C)C[C@H](CC)NC(=O)[C@@H]1CCOc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&C[C@H](C)CC",
"old_substring": "CC[S@](=O)[C@H]1CCCC[C@@H]14"
} |
Can you make molecule CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)[C@@H]1CCOc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CCCCCC=NC(=O)[C@@H]1CCOc2ccccc21 | CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)[C@@H]1CCOc2ccccc21 | CC(=O)CCCCCC=NC(=O)[C@@H]1CCOc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)CCCCCC=&",
"old_substring": "CC[S@](=O)[C@H]1CCCC[C@@H]14"
} |
Can you make molecule CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)[C@@H]1CCOc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CC(=O)NC(=O)[C@@H]1CCOc2ccccc21)C(C)C | CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)[C@@H]1CCOc2ccccc21 | CC[C@H](CC(=O)NC(=O)[C@@H]1CCOc2ccccc21)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](CC&=O)C(C)C",
"old_substring": "CC[S@](=O)[C@H]1CCCC[C@@H]14"
} |
Can you make molecule CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)[C@@H]1CCOc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCC1=C(C)C[C@H](NC(=O)[C@@H]2CCOc3ccccc32)S1 | CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)[C@@H]1CCOc2ccccc21 | CCC1=C(C)C[C@H](NC(=O)[C@@H]2CCOc3ccccc32)S1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC1=C(C)C[C@H]&S1",
"old_substring": "CC[S@](=O)[C@H]1CCCC[C@@H]14"
} |
Can you make molecule CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)[C@@H]1CCOc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(=NC(=O)[C@@H]1CCOc2ccccc21)C1CCCCC1 | CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)[C@@H]1CCOc2ccccc21 | CC(=NC(=O)[C@@H]1CCOc2ccccc21)C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)C1CCCCC1",
"old_substring": "CC[S@](=O)[C@H]1CCCC[C@@H]14"
} |
Can you make molecule C[C@H]1CC(=O)N(CC(=O)Nc2cccc3ccccc23)c2ccccc2S1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC(=O)N(CC(=O)Nc2ccc(Cl)c3ccccc23)c2ccccc2S1 | C[C@H]1CC(=O)N(CC(=O)Nc2cccc3ccccc23)c2ccccc2S1 | C[C@H]1CC(=O)N(CC(=O)Nc2ccc(Cl)c3ccccc23)c2ccccc2S1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c2ccccc12",
"old_substring": "c15cccc2ccccc12"
} |
Can you make molecule C[C@H]1CC(=O)N(CC(=O)Nc2cccc3ccccc23)c2ccccc2S1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=NC(=O)CN1C(=O)C[C@H](C)Sc2ccccc21)c1cccc2ccccc12 | C[C@H]1CC(=O)N(CC(=O)Nc2cccc3ccccc23)c2ccccc2S1 | CC(=NC(=O)CN1C(=O)C[C@H](C)Sc2ccccc21)c1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&c1cccc2ccccc12",
"old_substring": "c15cccc2ccccc12"
} |
Can you make molecule C[C@H]1CC(=O)N(CC(=O)Nc2cccc3ccccc23)c2ccccc2S1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC(=O)N(CC(=O)Nc2ccc3ccccc3c2Br)c2ccccc2S1 | C[C@H]1CC(=O)N(CC(=O)Nc2cccc3ccccc23)c2ccccc2S1 | C[C@H]1CC(=O)N(CC(=O)Nc2ccc3ccccc3c2Br)c2ccccc2S1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2ccccc2c1Br",
"old_substring": "c15cccc2ccccc12"
} |
Can you make molecule C[C@H]1CC(=O)N(CC(=O)Nc2cccc3ccccc23)c2ccccc2S1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC(=O)N(CC(=O)Nc2cc3sc4ccccc4c3s2)c2ccccc2S1 | C[C@H]1CC(=O)N(CC(=O)Nc2cccc3ccccc23)c2ccccc2S1 | C[C@H]1CC(=O)N(CC(=O)Nc2cc3sc4ccccc4c3s2)c2ccccc2S1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sc3ccccc3c2s1",
"old_substring": "c15cccc2ccccc12"
} |
Can you make molecule C[C@H]1CC(=O)N(CC(=O)Nc2cccc3ccccc23)c2ccccc2S1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC(=O)N(CC(=O)Nc2ccc3cc(Br)ccc3c2)c2ccccc2S1 | C[C@H]1CC(=O)N(CC(=O)Nc2cccc3ccccc23)c2ccccc2S1 | C[C@H]1CC(=O)N(CC(=O)Nc2ccc3cc(Br)ccc3c2)c2ccccc2S1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1ccc2cc&ccc2c1",
"old_substring": "c15cccc2ccccc12"
} |
Can you make molecule COc1ccc(-n2c(C)cc(C=C3C(=N)N4N=C(SC)SC4=NC3=O)c2C)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Br)cc(-n2c(C)cc(C=C3C(=N)N4N=C(SC)SC4=NC3=O)c2C)c1Cl | COc1ccc(-n2c(C)cc(C=C3C(=N)N4N=C(SC)SC4=NC3=O)c2C)cc1Cl | COc1cc(Br)cc(-n2c(C)cc(C=C3C(=N)N4N=C(SC)SC4=NC3=O)c2C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)cc&c1Cl",
"old_substring": "c15ccc7cc1Cl"
} |
Can you make molecule COc1ccc(-n2c(C)cc(C=C3C(=N)N4N=C(SC)SC4=NC3=O)c2C)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1c(Cl)cc(-n2c(C)cc(C=C3C(=N)N4N=C(SC)SC4=NC3=O)c2C)cc1Cl | COc1ccc(-n2c(C)cc(C=C3C(=N)N4N=C(SC)SC4=NC3=O)c2C)cc1Cl | COc1c(Cl)cc(-n2c(C)cc(C=C3C(=N)N4N=C(SC)SC4=NC3=O)c2C)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc&cc1Cl",
"old_substring": "c15ccc7cc1Cl"
} |
Can you make molecule COc1ccc(-n2c(C)cc(C=C3C(=N)N4N=C(SC)SC4=NC3=O)c2C)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Cl)c(-n2c(C)cc(C=C3C(=N)N4N=C(SC)SC4=NC3=O)c2C)cc1Cl | COc1ccc(-n2c(C)cc(C=C3C(=N)N4N=C(SC)SC4=NC3=O)c2C)cc1Cl | COc1cc(Cl)c(-n2c(C)cc(C=C3C(=N)N4N=C(SC)SC4=NC3=O)c2C)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)c&cc1Cl",
"old_substring": "c15ccc7cc1Cl"
} |
Can you make molecule COc1ccc(-n2c(C)cc(C=C3C(=N)N4N=C(SC)SC4=NC3=O)c2C)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-n2c(C)cc(C=C3C(=N)N4N=C(SC)SC4=NC3=O)c2C)c(Cl)cc1Cl | COc1ccc(-n2c(C)cc(C=C3C(=N)N4N=C(SC)SC4=NC3=O)c2C)cc1Cl | COc1cc(-n2c(C)cc(C=C3C(=N)N4N=C(SC)SC4=NC3=O)c2C)c(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c(Cl)cc1Cl",
"old_substring": "c15ccc7cc1Cl"
} |
Can you make molecule COc1ccc(-n2c(C)cc(C=C3C(=N)N4N=C(SC)SC4=NC3=O)c2C)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2c(C)cc(C=C3C(=N)N4N=C(SC)SC4=NC3=O)c2C)c(Cl)c1Cl | COc1ccc(-n2c(C)cc(C=C3C(=N)N4N=C(SC)SC4=NC3=O)c2C)cc1Cl | COc1ccc(-n2c(C)cc(C=C3C(=N)N4N=C(SC)SC4=NC3=O)c2C)c(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&c(Cl)c1Cl",
"old_substring": "c15ccc7cc1Cl"
} |
Can you make molecule O=C(C=Cc1cc(Br)cs1)Nc1ccc(Cl)nn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=Cc2cc(Br)cs2)CCC1=Nc1ccc(Cl)nn1 | O=C(C=Cc1cc(Br)cs1)Nc1ccc(Cl)nn1 | O=C1C(=Cc2cc(Br)cs2)CCC1=Nc1ccc(Cl)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1C=&CCC1=&",
"old_substring": "O=C2C=4"
} |
Can you make molecule O=C(C=Cc1cc(Br)cs1)Nc1ccc(Cl)nn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=O)C(=Nc2ccc(Cl)nn2)CCCC1=Cc1cc(Br)cs1 | O=C(C=Cc1cc(Br)cs1)Nc1ccc(Cl)nn1 | O=C1C(=O)C(=Nc2ccc(Cl)nn2)CCCC1=Cc1cc(Br)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1C=&CCCC=&C1=O",
"old_substring": "O=C2C=4"
} |
Can you make molecule O=C(C=Cc1cc(Br)cs1)Nc1ccc(Cl)nn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(=Cc2cc(Br)cs2)CC1)Nc1ccc(Cl)nn1 | O=C(C=Cc1cc(Br)cs1)Nc1ccc(Cl)nn1 | O=C(NN=C1CCC(=Cc2cc(Br)cs2)CC1)Nc1ccc(Cl)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C2C=4"
} |
Can you make molecule O=C(C=Cc1cc(Br)cs1)Nc1ccc(Cl)nn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(Cl)nn1)C1=C(N=Cc2cc(Br)cs2)CCS1 | O=C(C=Cc1cc(Br)cs1)Nc1ccc(Cl)nn1 | O=C(Nc1ccc(Cl)nn1)C1=C(N=Cc2cc(Br)cs2)CCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=C(N&)CCS1",
"old_substring": "O=C2C=4"
} |
Can you make molecule O=C(C=Cc1cc(Br)cs1)Nc1ccc(Cl)nn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(Cl)nn1)C(N=Cc1cc(Br)cs1)=C(Cl)Cl | O=C(C=Cc1cc(Br)cs1)Nc1ccc(Cl)nn1 | O=C(Nc1ccc(Cl)nn1)C(N=Cc1cc(Br)cs1)=C(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(N&)=C(Cl)Cl",
"old_substring": "O=C2C=4"
} |
Can you make molecule COC(=O)/C(C#N)=C\Nc1ccc(S(=O)(=O)NC(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NS(=O)(=O)c1ccc(N/C=C(/C#N)C(=O)C2OCc3ccccc3CO2)cc1 | COC(=O)/C(C#N)=C\Nc1ccc(S(=O)(=O)NC(C)C)cc1 | CC(C)NS(=O)(=O)c1ccc(N/C=C(/C#N)C(=O)C2OCc3ccccc3CO2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCc2ccccc2CO1",
"old_substring": "CO2"
} |
Can you make molecule COC(=O)/C(C#N)=C\Nc1ccc(S(=O)(=O)NC(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NS(=O)(=O)c1ccc(N/C=C(/C#N)C(=O)C2(O)Cc3ccccc3C2)cc1 | COC(=O)/C(C#N)=C\Nc1ccc(S(=O)(=O)NC(C)C)cc1 | CC(C)NS(=O)(=O)c1ccc(N/C=C(/C#N)C(=O)C2(O)Cc3ccccc3C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(O)Cc2ccccc2C1",
"old_substring": "CO2"
} |
Can you make molecule COC(=O)/C(C#N)=C\Nc1ccc(S(=O)(=O)NC(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NS(=O)(=O)c1ccc(N/C=C(/C#N)C(=O)C2=CC3=NN3C[C@@H](C)CO2)cc1 | COC(=O)/C(C#N)=C\Nc1ccc(S(=O)(=O)NC(C)C)cc1 | CC(C)NS(=O)(=O)c1ccc(N/C=C(/C#N)C(=O)C2=CC3=NN3C[C@@H](C)CO2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1COc2cc&nn2C1",
"old_substring": "CO2"
} |
Can you make molecule COC(=O)/C(C#N)=C\Nc1ccc(S(=O)(=O)NC(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NS(=O)(=O)c1ccc(N/C=C(/C#N)C(=O)N2CCOC23CCCCC3)cc1 | COC(=O)/C(C#N)=C\Nc1ccc(S(=O)(=O)NC(C)C)cc1 | CC(C)NS(=O)(=O)c1ccc(N/C=C(/C#N)C(=O)N2CCOC23CCCCC3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOC12CCCCC2",
"old_substring": "CO2"
} |
Can you make molecule COC(=O)/C(C#N)=C\Nc1ccc(S(=O)(=O)NC(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NS(=O)(=O)c1ccc(N/C=C(/C#N)C(=O)N2CCOC3(CCC3)C2)cc1 | COC(=O)/C(C#N)=C\Nc1ccc(S(=O)(=O)NC(C)C)cc1 | CC(C)NS(=O)(=O)c1ccc(N/C=C(/C#N)C(=O)N2CCOC3(CCC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOC2(CCC2)C1",
"old_substring": "CO2"
} |
Can you make molecule O=C(OCCOc1cccc(Br)c1)c1cc(=O)c2ccccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(OCCCCOc1cccc(Br)c1)c1cc(=O)c2ccccc2o1 | O=C(OCCOc1cccc(Br)c1)c1cc(=O)c2ccccc2o1 | O=C(OCCCCOc1cccc(Br)c1)c1cc(=O)c2ccccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C4C5"
} |
Can you make molecule O=C(OCCOc1cccc(Br)c1)c1cc(=O)c2ccccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(OCCCCCOc1cccc(Br)c1)c1cc(=O)c2ccccc2o1 | O=C(OCCOc1cccc(Br)c1)c1cc(=O)c2ccccc2o1 | O=C(OCCCCCOc1cccc(Br)c1)c1cc(=O)c2ccccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4C5"
} |
Can you make molecule O=C(OCCOc1cccc(Br)c1)c1cc(=O)c2ccccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(OC1CC(Oc2cccc(Br)c2)C1)c1cc(=O)c2ccccc2o1 | O=C(OCCOc1cccc(Br)c1)c1cc(=O)c2ccccc2o1 | O=C(OC1CC(Oc2cccc(Br)c2)C1)c1cc(=O)c2ccccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C4C5"
} |
Can you make molecule O=C(OCCOc1cccc(Br)c1)c1cc(=O)c2ccccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCOc1cccc(Br)c1)OC(=O)c1cc(=O)c2ccccc2o1 | O=C(OCCOc1cccc(Br)c1)c1cc(=O)c2ccccc2o1 | C[C@@H](CCOc1cccc(Br)c1)OC(=O)c1cc(=O)c2ccccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C4C5"
} |
Can you make molecule O=C(OCCOc1cccc(Br)c1)c1cc(=O)c2ccccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(OC1CCC(Oc2cccc(Br)c2)CC1)c1cc(=O)c2ccccc2o1 | O=C(OCCOc1cccc(Br)c1)c1cc(=O)c2ccccc2o1 | O=C(OC1CCC(Oc2cccc(Br)c2)CC1)c1cc(=O)c2ccccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C4C5"
} |
Can you make molecule Cc1cccc(C)c1OCC(=O)OCCN1C(=O)c2ccccc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1OCC(=O)OCCCCN1C(=O)c2ccccc2C1=O | Cc1cccc(C)c1OCC(=O)OCCN1C(=O)c2ccccc2C1=O | Cc1cccc(C)c1OCC(=O)OCCCCN1C(=O)c2ccccc2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C5C7"
} |
Can you make molecule Cc1cccc(C)c1OCC(=O)OCCN1C(=O)c2ccccc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1OCC(=O)OCCCCCN1C(=O)c2ccccc2C1=O | Cc1cccc(C)c1OCC(=O)OCCN1C(=O)c2ccccc2C1=O | Cc1cccc(C)c1OCC(=O)OCCCCCN1C(=O)c2ccccc2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C5C7"
} |
Can you make molecule Cc1cccc(C)c1OCC(=O)OCCN1C(=O)c2ccccc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1OCC(=O)OC1CC(N2C(=O)c3ccccc3C2=O)C1 | Cc1cccc(C)c1OCC(=O)OCCN1C(=O)c2ccccc2C1=O | Cc1cccc(C)c1OCC(=O)OC1CC(N2C(=O)c3ccccc3C2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C5C7"
} |
Can you make molecule Cc1cccc(C)c1OCC(=O)OCCN1C(=O)c2ccccc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1OCC(=O)O[C@@H](C)CCN1C(=O)c2ccccc2C1=O | Cc1cccc(C)c1OCC(=O)OCCN1C(=O)c2ccccc2C1=O | Cc1cccc(C)c1OCC(=O)O[C@@H](C)CCN1C(=O)c2ccccc2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C5C7"
} |
Can you make molecule Cc1cccc(C)c1OCC(=O)OCCN1C(=O)c2ccccc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1OCC(=O)OC1CCC(N2C(=O)c3ccccc3C2=O)CC1 | Cc1cccc(C)c1OCC(=O)OCCN1C(=O)c2ccccc2C1=O | Cc1cccc(C)c1OCC(=O)OC1CCC(N2C(=O)c3ccccc3C2=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C5C7"
} |
Can you make molecule Cc1cccc([C@@H](C[NH3+])S[C@H](C)CCO)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H]2C[C@H](S)CN2[C@H](C)CCO)c1 | Cc1cccc([C@@H](C[NH3+])S[C@H](C)CCO)c1 | Cc1cccc([C@H]2C[C@H](S)CN2[C@H](C)CCO)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C[C@H]&N&C1",
"old_substring": "[C@H]24C[NH3+]"
} |
Can you make molecule Cc1cccc([C@@H](C[NH3+])S[C@H](C)CCO)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@@H]2C[C@H](S)CN2[C@H](C)CCO)c1 | Cc1cccc([C@@H](C[NH3+])S[C@H](C)CCO)c1 | Cc1cccc([C@@H]2C[C@H](S)CN2[C@H](C)CCO)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C[C@@H]&N&C1",
"old_substring": "[C@H]24C[NH3+]"
} |
Can you make molecule Cc1cccc([C@@H](C[NH3+])S[C@H](C)CCO)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@@H]2SC[C@H](S)N2[C@H](C)CCO)c1 | Cc1cccc([C@@H](C[NH3+])S[C@H](C)CCO)c1 | Cc1cccc([C@@H]2SC[C@H](S)N2[C@H](C)CCO)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CS[C@@H]&N1&",
"old_substring": "[C@H]24C[NH3+]"
} |
Can you make molecule Cc1cccc([C@@H](C[NH3+])S[C@H](C)CCO)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@@H]2CS[C@H](S)N2[C@H](C)CCO)c1 | Cc1cccc([C@@H](C[NH3+])S[C@H](C)CCO)c1 | Cc1cccc([C@@H]2CS[C@H](S)N2[C@H](C)CCO)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&SC[C@@H]&N1&",
"old_substring": "[C@H]24C[NH3+]"
} |
Can you make molecule Cc1cccc([C@@H](C[NH3+])S[C@H](C)CCO)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H]2C[C@H](S)CN([C@H](C)CCO)C2)c1 | Cc1cccc([C@@H](C[NH3+])S[C@H](C)CCO)c1 | Cc1cccc([C@H]2C[C@H](S)CN([C@H](C)CCO)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C[C@H]&CN&C1",
"old_substring": "[C@H]24C[NH3+]"
} |
Can you make molecule CCCN(CC(=O)NC)C(=O)Cc1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CN(CCC(C)C)C(=O)Cc1cccc(Cl)c1 | CCCN(CC(=O)NC)C(=O)Cc1cccc(Cl)c1 | CNC(=O)CN(CCC(C)C)C(=O)Cc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC4"
} |
Can you make molecule CCCN(CC(=O)NC)C(=O)Cc1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CN(CCCCBr)C(=O)Cc1cccc(Cl)c1 | CCCN(CC(=O)NC)C(=O)Cc1cccc(Cl)c1 | CNC(=O)CN(CCCCBr)C(=O)Cc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC4"
} |
Can you make molecule CCCN(CC(=O)NC)C(=O)Cc1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCN(CC(=O)NC)C(=O)Cc1cccc(Cl)c1 | CCCN(CC(=O)NC)C(=O)Cc1cccc(Cl)c1 | C=CCCCN(CC(=O)NC)C(=O)Cc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC4"
} |
Can you make molecule CCCN(CC(=O)NC)C(=O)Cc1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CN(CCCCCl)C(=O)Cc1cccc(Cl)c1 | CCCN(CC(=O)NC)C(=O)Cc1cccc(Cl)c1 | CNC(=O)CN(CCCCCl)C(=O)Cc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC4"
} |
Can you make molecule CCCN(CC(=O)NC)C(=O)Cc1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCN(CC(=O)NC)C(=O)Cc1cccc(Cl)c1 | CCCN(CC(=O)NC)C(=O)Cc1cccc(Cl)c1 | C=CCCCCN(CC(=O)NC)C(=O)Cc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CCC4"
} |
Can you make molecule C[C@H](C#N)CNC(=O)C(=O)Nc1ccc2nc(C3CC3)oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C#N)CNC(=O)C(=O)Nc1ccc2nc(C3SCCS3)oc2c1 | C[C@H](C#N)CNC(=O)C(=O)Nc1ccc2nc(C3CC3)oc2c1 | C[C@H](C#N)CNC(=O)C(=O)Nc1ccc2nc(C3SCCS3)oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C18CC1"
} |
Can you make molecule C[C@H](C#N)CNC(=O)C(=O)Nc1ccc2nc(C3CC3)oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C#N)CNC(=O)C(=O)Nc1ccc2nc(C3CCCCC3)oc2c1 | C[C@H](C#N)CNC(=O)C(=O)Nc1ccc2nc(C3CC3)oc2c1 | C[C@H](C#N)CNC(=O)C(=O)Nc1ccc2nc(C3CCCCC3)oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C18CC1"
} |
Can you make molecule C[C@H](C#N)CNC(=O)C(=O)Nc1ccc2nc(C3CC3)oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C#N)CNC(=O)C(=O)Nc1ccc2nc(C3SCCCS3)oc2c1 | C[C@H](C#N)CNC(=O)C(=O)Nc1ccc2nc(C3CC3)oc2c1 | C[C@H](C#N)CNC(=O)C(=O)Nc1ccc2nc(C3SCCCS3)oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C18CC1"
} |
Can you make molecule C[C@H](C#N)CNC(=O)C(=O)Nc1ccc2nc(C3CC3)oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C#N)CNC(=O)C(=O)Nc1ccc2nc(C3SCSCS3)oc2c1 | C[C@H](C#N)CNC(=O)C(=O)Nc1ccc2nc(C3CC3)oc2c1 | C[C@H](C#N)CNC(=O)C(=O)Nc1ccc2nc(C3SCSCS3)oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C18CC1"
} |
Can you make molecule C[C@H](C#N)CNC(=O)C(=O)Nc1ccc2nc(C3CC3)oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C#N)CNC(=O)C(=O)Nc1ccc2nc(C3CCCCCC3)oc2c1 | C[C@H](C#N)CNC(=O)C(=O)Nc1ccc2nc(C3CC3)oc2c1 | C[C@H](C#N)CNC(=O)C(=O)Nc1ccc2nc(C3CCCCCC3)oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C18CC1"
} |
Can you make molecule CCc1ccc([C@H](CNC(=O)N2CCC[C@@H]2c2ccc3c(c2)OCCO3)[NH+](C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc([C@]2(NC(=O)N3CCC[C@@H]3c3ccc4c(c3)OCCO4)CCC[C@@H]([NH+](C)C)C2)cc1 | CCc1ccc([C@H](CNC(=O)N2CCC[C@@H]2c2ccc3c(c2)OCCO3)[NH+](C)C)cc1 | CCc1ccc([C@]2(NC(=O)N3CCC[C@@H]3c3ccc4c(c3)OCCO4)CCC[C@@H]([NH+](C)C)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCC[C@]&&C1",
"old_substring": "[C@@H]69C7"
} |
Can you make molecule CCc1ccc([C@H](CNC(=O)N2CCC[C@@H]2c2ccc3c(c2)OCCO3)[NH+](C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc([C@]2(NC(=O)N3CCC[C@@H]3c3ccc4c(c3)OCCO4)CC[C@H]([NH+](C)C)C2)cc1 | CCc1ccc([C@H](CNC(=O)N2CCC[C@@H]2c2ccc3c(c2)OCCO3)[NH+](C)C)cc1 | CCc1ccc([C@]2(NC(=O)N3CCC[C@@H]3c3ccc4c(c3)OCCO4)CC[C@H]([NH+](C)C)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@]&&C1",
"old_substring": "[C@@H]69C7"
} |
Can you make molecule CCc1ccc([C@H](CNC(=O)N2CCC[C@@H]2c2ccc3c(c2)OCCO3)[NH+](C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(CCC[C@H]([NH+](C)C)C(C)(C)NC(=O)N2CCC[C@@H]2c2ccc3c(c2)OCCO3)cc1 | CCc1ccc([C@H](CNC(=O)N2CCC[C@@H]2c2ccc3c(c2)OCCO3)[NH+](C)C)cc1 | CCc1ccc(CCC[C@H]([NH+](C)C)C(C)(C)NC(=O)N2CCC[C@@H]2c2ccc3c(c2)OCCO3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCC&)C&(C)C",
"old_substring": "[C@@H]69C7"
} |
Can you make molecule CCc1ccc([C@H](CNC(=O)N2CCC[C@@H]2c2ccc3c(c2)OCCO3)[NH+](C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc([C@@]2(NC(=O)N3CCC[C@@H]3c3ccc4c(c3)OCCO4)CC[C@H]([NH+](C)C)C2)cc1 | CCc1ccc([C@H](CNC(=O)N2CCC[C@@H]2c2ccc3c(c2)OCCO3)[NH+](C)C)cc1 | CCc1ccc([C@@]2(NC(=O)N3CCC[C@@H]3c3ccc4c(c3)OCCO4)CC[C@H]([NH+](C)C)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@@]&&C1",
"old_substring": "[C@@H]69C7"
} |
Can you make molecule CCc1ccc([C@H](CNC(=O)N2CCC[C@@H]2c2ccc3c(c2)OCCO3)[NH+](C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(-c2[nH]c([NH+](C)C)c(NC(=O)N3CCC[C@@H]3c3ccc4c(c3)OCCO4)c2C)cc1 | CCc1ccc([C@H](CNC(=O)N2CCC[C@@H]2c2ccc3c(c2)OCCO3)[NH+](C)C)cc1 | CCc1ccc(-c2[nH]c([NH+](C)C)c(NC(=O)N3CCC[C@@H]3c3ccc4c(c3)OCCO4)c2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH]c&c(C)c1&",
"old_substring": "[C@@H]69C7"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.