prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCCCC(=O)c1c(C)cc(C)[nH]c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCCCCC(=O)c1c(C)cc(C)[nH]c1=O | CCCCC(=O)c1c(C)cc(C)[nH]c1=O | CCCCCCC(=O)c1c(C)cc(C)[nH]c1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCCC&=O",
"old_substring": "CCCCC2=O"
} |
Can you make molecule CCCCC(=O)c1c(C)cc(C)[nH]c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCC(CCC)C(=O)c1c(C)cc(C)[nH]c1=O | CCCCC(=O)c1c(C)cc(C)[nH]c1=O | CCCC(CCC)C(=O)c1c(C)cc(C)[nH]c1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCC(CCC)C&=O",
"old_substring": "CCCCC2=O"
} |
Can you make molecule CCCCC(=O)c1c(C)cc(C)[nH]c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCC(CCC)CC(=O)c1c(C)cc(C)[nH]c1=O | CCCCC(=O)c1c(C)cc(C)[nH]c1=O | CCCC(CCC)CC(=O)c1c(C)cc(C)[nH]c1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCC(CCC)CC&=O",
"old_substring": "CCCCC2=O"
} |
Can you make molecule CCCCC(=O)c1c(C)cc(C)[nH]c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)CC(=O)c1c(C)cc(C)[nH]c1=O | CCCCC(=O)c1c(C)cc(C)[nH]c1=O | CCC(CC)CC(=O)c1c(C)cc(C)[nH]c1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC(CC)CC&=O",
"old_substring": "CCCCC2=O"
} |
Can you make molecule CCCCC(=O)c1c(C)cc(C)[nH]c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)C(C)(C)c1c(C)cc(C)[nH]c1=O | CCCCC(=O)c1c(C)cc(C)[nH]c1=O | CCCCC(=O)C(C)(C)c1c(C)cc(C)[nH]c1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC(=O)C&(C)C",
"old_substring": "CCCCC2=O"
} |
Can you make molecule CC[NH+](C)CCNC(=O)N1CCC(CC(=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C(=O)[O-])=C1CCN(C(=O)NCC[NH+](C)CC)CC1 | CC[NH+](C)CCNC(=O)N1CCC(CC(=O)[O-])CC1 | CCC(C(=O)[O-])=C1CCN(C(=O)NCC[NH+](C)CC)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&C(=O)[O-]",
"old_substring": "C7C(=O)[O-]"
} |
Can you make molecule CC[NH+](C)CCNC(=O)N1CCC(CC(=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](C)CCNC(=O)N1CCC(=C(C)[O-])CC1 | CC[NH+](C)CCNC(=O)N1CCC(CC(=O)[O-])CC1 | CC[NH+](C)CCNC(=O)N1CCC(=C(C)[O-])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)[O-]",
"old_substring": "C7C(=O)[O-]"
} |
Can you make molecule CC[NH+](C)CCNC(=O)N1CCC(CC(=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](C)CCNC(=O)N1CCC(CCS(=O)(=O)[O-])CC1 | CC[NH+](C)CCNC(=O)N1CCC(CC(=O)[O-])CC1 | CC[NH+](C)CCNC(=O)N1CCC(CCS(=O)(=O)[O-])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CS(=O)(=O)[O-]",
"old_substring": "C7C(=O)[O-]"
} |
Can you make molecule CC[NH+](C)CCNC(=O)N1CCC(CC(=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](C)CCNC(=O)N1CCC(ONC(C)=O)CC1 | CC[NH+](C)CCNC(=O)N1CCC(CC(=O)[O-])CC1 | CC[NH+](C)CCNC(=O)N1CCC(ONC(C)=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)NO&",
"old_substring": "C7C(=O)[O-]"
} |
Can you make molecule CC[NH+](C)CCNC(=O)N1CCC(CC(=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](C)CCNC(=O)N1CCC(CCC(=O)O)CC1 | CC[NH+](C)CCNC(=O)N1CCC(CC(=O)[O-])CC1 | CC[NH+](C)CCNC(=O)N1CCC(CCC(=O)O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC(=O)O",
"old_substring": "C7C(=O)[O-]"
} |
Can you make molecule CC1(C)CSC[C@H]([NH2+]CCC(=O)[O-])C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CSC[C@H]([NH2+]CCC(=O)O)C1 | CC1(C)CSC[C@H]([NH2+]CCC(=O)[O-])C1 | CC1(C)CSC[C@H]([NH2+]CCC(=O)O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC(=O)O",
"old_substring": "C2CC(=O)[O-]"
} |
Can you make molecule CC1(C)CSC[C@H]([NH2+]CCC(=O)[O-])C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)([NH2+][C@H]1CSCC(C)(C)C1)C(=O)[O-] | CC1(C)CSC[C@H]([NH2+]CCC(=O)[O-])C1 | CCC(CC)([NH2+][C@H]1CSCC(C)(C)C1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)[O-]",
"old_substring": "C2CC(=O)[O-]"
} |
Can you make molecule CC1(C)CSC[C@H]([NH2+]CCC(=O)[O-])C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CSC[C@H]([NH2+]CCCS(=O)(=O)[O-])C1 | CC1(C)CSC[C@H]([NH2+]CCC(=O)[O-])C1 | CC1(C)CSC[C@H]([NH2+]CCCS(=O)(=O)[O-])C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCS(=O)(=O)[O-]",
"old_substring": "C2CC(=O)[O-]"
} |
Can you make molecule CC1(C)CSC[C@H]([NH2+]CCC(=O)[O-])C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CSC[C@H]([NH2+]S/C=C/C(=O)[O-])C1 | CC1(C)CSC[C@H]([NH2+]CCC(=O)[O-])C1 | CC1(C)CSC[C@H]([NH2+]S/C=C/C(=O)[O-])C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&/C=C/C(=O)[O-]",
"old_substring": "C2CC(=O)[O-]"
} |
Can you make molecule CC1(C)CSC[C@H]([NH2+]CCC(=O)[O-])C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCS(=O)(=O)[NH2+][C@H]1CSCC(C)(C)C1 | CC1(C)CSC[C@H]([NH2+]CCC(=O)[O-])C1 | CCCS(=O)(=O)[NH2+][C@H]1CSCC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCS&(=O)=O",
"old_substring": "C2CC(=O)[O-]"
} |
Can you make molecule COc1ccc(O[C@H](C)C(=O)N(C)[C@@H](C)Cc2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(O[C@H](C)C(C)(C)CN(C)[C@@H](C)Cc2cccs2)cc1 | COc1ccc(O[C@H](C)C(=O)N(C)[C@@H](C)Cc2cccs2)cc1 | COc1ccc(O[C@H](C)C(C)(C)CN(C)[C@@H](C)Cc2cccs2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "[C@@H]4(C)C3=O"
} |
Can you make molecule COc1ccc(O[C@H](C)C(=O)N(C)[C@@H](C)Cc2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(O[C@H](CCl)CCCN(C)[C@@H](C)Cc2cccs2)cc1 | COc1ccc(O[C@H](C)C(=O)N(C)[C@@H](C)Cc2cccs2)cc1 | COc1ccc(O[C@H](CCl)CCCN(C)[C@@H](C)Cc2cccs2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]4(C)C3=O"
} |
Can you make molecule COc1ccc(O[C@H](C)C(=O)N(C)[C@@H](C)Cc2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(O[C@@H]2C=C(CN(C)[C@@H](C)Cc3cccs3)N=N2)cc1 | COc1ccc(O[C@H](C)C(=O)N(C)[C@@H](C)Cc2cccs2)cc1 | COc1ccc(O[C@@H]2C=C(CN(C)[C@@H](C)Cc3cccs3)N=N2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=C(C&)N=N1",
"old_substring": "[C@@H]4(C)C3=O"
} |
Can you make molecule COc1ccc(O[C@H](C)C(=O)N(C)[C@@H](C)Cc2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(O[C@]2(C)CCCN(N(C)[C@@H](C)Cc3cccs3)C2)cc1 | COc1ccc(O[C@H](C)C(=O)N(C)[C@@H](C)Cc2cccs2)cc1 | COc1ccc(O[C@]2(C)CCCN(N(C)[C@@H](C)Cc3cccs3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@]1&(C)CCCN&C1",
"old_substring": "[C@@H]4(C)C3=O"
} |
Can you make molecule COc1ccc(O[C@H](C)C(=O)N(C)[C@@H](C)Cc2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(O[C@@H](CBr)CCN(C)[C@@H](C)Cc2cccs2)cc1 | COc1ccc(O[C@H](C)C(=O)N(C)[C@@H](C)Cc2cccs2)cc1 | COc1ccc(O[C@@H](CBr)CCN(C)[C@@H](C)Cc2cccs2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@@H]4(C)C3=O"
} |
Can you make molecule CN(Cc1ccccn1)S(=O)(=O)c1ccc(OC2CCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1ccc(OC2CCCC2)cc1)N1CCC(Cc2ccccn2)CC1 | CN(Cc1ccccn1)S(=O)(=O)c1ccc(OC2CCCC2)cc1 | O=S(=O)(c1ccc(OC2CCCC2)cc1)N1CCC(Cc2ccccn2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "CN56"
} |
Can you make molecule CN(Cc1ccccn1)S(=O)(=O)c1ccc(OC2CCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1ccccn1)C(=S)SS(=O)(=O)c1ccc(OC2CCCC2)cc1 | CN(Cc1ccccn1)S(=O)(=O)c1ccc(OC2CCCC2)cc1 | CN(Cc1ccccn1)C(=S)SS(=O)(=O)c1ccc(OC2CCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "CN56"
} |
Can you make molecule CN(Cc1ccccn1)S(=O)(=O)c1ccc(OC2CCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1ccc(OC2CCCC2)cc1)C1CCN(CCc2ccccn2)CC1 | CN(Cc1ccccn1)S(=O)(=O)c1ccc(OC2CCCC2)cc1 | O=S(=O)(c1ccc(OC2CCCC2)cc1)C1CCN(CCc2ccccn2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "CN56"
} |
Can you make molecule CN(Cc1ccccn1)S(=O)(=O)c1ccc(OC2CCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1ccc(OC2CCCC2)cc1)N1CN(Cc2ccccn2)CSC1=S | CN(Cc1ccccn1)S(=O)(=O)c1ccc(OC2CCCC2)cc1 | O=S(=O)(c1ccc(OC2CCCC2)cc1)N1CN(Cc2ccccn2)CSC1=S | 102 | {
"fragment_index": 0,
"new_substring": "S=C1SCN&CN1&",
"old_substring": "CN56"
} |
Can you make molecule CN(Cc1ccccn1)S(=O)(=O)c1ccc(OC2CCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(Cc2ccccn2)CCC(S(=O)(=O)c2ccc(OC3CCCC3)cc2)CC1 | CN(Cc1ccccn1)S(=O)(=O)c1ccc(OC2CCCC2)cc1 | N#CC1(Cc2ccccn2)CCC(S(=O)(=O)c2ccc(OC3CCCC3)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "CN56"
} |
Can you make molecule O=C(CNC(=O)c1ccccc1)N[C@@H](CO)Cc1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNC(=O)c1ccccc1Cl)N[C@@H](CO)Cc1c[nH]c2ccccc12 | O=C(CNC(=O)c1ccccc1)N[C@@H](CO)Cc1c[nH]c2ccccc12 | O=C(CNC(=O)c1ccccc1Cl)N[C@@H](CO)Cc1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c17ccccc1"
} |
Can you make molecule O=C(CNC(=O)c1ccccc1)N[C@@H](CO)Cc1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNC(=O)c1ccc(I)cc1)N[C@@H](CO)Cc1c[nH]c2ccccc12 | O=C(CNC(=O)c1ccccc1)N[C@@H](CO)Cc1c[nH]c2ccccc12 | O=C(CNC(=O)c1ccc(I)cc1)N[C@@H](CO)Cc1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c17ccccc1"
} |
Can you make molecule O=C(CNC(=O)c1ccccc1)N[C@@H](CO)Cc1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)NCC(=O)N[C@@H](CO)Cc2c[nH]c3ccccc23)cc1I | O=C(CNC(=O)c1ccccc1)N[C@@H](CO)Cc1c[nH]c2ccccc12 | Cc1ccc(C(=O)NCC(=O)N[C@@H](CO)Cc2c[nH]c3ccccc23)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c17ccccc1"
} |
Can you make molecule O=C(CNC(=O)c1ccccc1)N[C@@H](CO)Cc1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNC(=O)c1cccc(Br)c1)N[C@@H](CO)Cc1c[nH]c2ccccc12 | O=C(CNC(=O)c1ccccc1)N[C@@H](CO)Cc1c[nH]c2ccccc12 | O=C(CNC(=O)c1cccc(Br)c1)N[C@@H](CO)Cc1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c17ccccc1"
} |
Can you make molecule O=C(CNC(=O)c1ccccc1)N[C@@H](CO)Cc1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C(=O)NCC(=O)N[C@@H](CO)Cc2c[nH]c3ccccc23)c1C | O=C(CNC(=O)c1ccccc1)N[C@@H](CO)Cc1c[nH]c2ccccc12 | Cc1cccc(C(=O)NCC(=O)N[C@@H](CO)Cc2c[nH]c3ccccc23)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c17ccccc1"
} |
Can you make molecule CC[NH2+][C@]1(C(=O)[O-])CC[C@@H](N2C[C@@H](C)O[C@@H](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CS[NH2+][C@]1(C(=O)[O-])CC[C@@H](N2C[C@@H](C)O[C@@H](C)C2)C1 | CC[NH2+][C@]1(C(=O)[O-])CC[C@@H](N2C[C@@H](C)O[C@@H](C)C2)C1 | C=CS[NH2+][C@]1(C(=O)[O-])CC[C@@H](N2C[C@@H](C)O[C@@H](C)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CC[NH2+][C@]1(C(=O)[O-])CC[C@@H](N2C[C@@H](C)O[C@@H](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[NH2+][C@]1(C(=O)[O-])CC[C@@H](N2C[C@@H](C)O[C@@H](C)C2)C1 | CC[NH2+][C@]1(C(=O)[O-])CC[C@@H](N2C[C@@H](C)O[C@@H](C)C2)C1 | C=CCC[NH2+][C@]1(C(=O)[O-])CC[C@@H](N2C[C@@H](C)O[C@@H](C)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CC[NH2+][C@]1(C(=O)[O-])CC[C@@H](N2C[C@@H](C)O[C@@H](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN([C@@H]2CC[C@]([NH2+]CCCCl)(C(=O)[O-])C2)C[C@H](C)O1 | CC[NH2+][C@]1(C(=O)[O-])CC[C@@H](N2C[C@@H](C)O[C@@H](C)C2)C1 | C[C@@H]1CN([C@@H]2CC[C@]([NH2+]CCCCl)(C(=O)[O-])C2)C[C@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CC[NH2+][C@]1(C(=O)[O-])CC[C@@H](N2C[C@@H](C)O[C@@H](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN([C@@H]2CC[C@]([NH2+]CCCCS)(C(=O)[O-])C2)C[C@H](C)O1 | CC[NH2+][C@]1(C(=O)[O-])CC[C@@H](N2C[C@@H](C)O[C@@H](C)C2)C1 | C[C@@H]1CN([C@@H]2CC[C@]([NH2+]CCCCS)(C(=O)[O-])C2)C[C@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule CC[NH2+][C@]1(C(=O)[O-])CC[C@@H](N2C[C@@H](C)O[C@@H](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN([C@@H]2CC[C@]([NH2+]CCCBr)(C(=O)[O-])C2)C[C@H](C)O1 | CC[NH2+][C@]1(C(=O)[O-])CC[C@@H](N2C[C@@H](C)O[C@@H](C)C2)C1 | C[C@@H]1CN([C@@H]2CC[C@]([NH2+]CCCBr)(C(=O)[O-])C2)C[C@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3"
} |
Can you make molecule Cc1ccc(Cl)cc1N1CCN(C(=O)[C@@H]2CCC[NH2+]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cl)cc1N1CCN(C(=O)[C@H]2CCCC[NH2+]C2)CC1 | Cc1ccc(Cl)cc1N1CCN(C(=O)[C@@H]2CCC[NH2+]2)CC1 | Cc1ccc(Cl)cc1N1CCN(C(=O)[C@H]2CCCC[NH2+]C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[NH+]&C1",
"old_substring": "[C@@H]15CCC[NH2+]1"
} |
Can you make molecule Cc1ccc(Cl)cc1N1CCN(C(=O)[C@@H]2CCC[NH2+]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cl)cc1N1CCN(C(=O)[C@@H]2CNC[C@H]2C)CC1 | Cc1ccc(Cl)cc1N1CCN(C(=O)[C@@H]2CCC[NH2+]2)CC1 | Cc1ccc(Cl)cc1N1CCN(C(=O)[C@@H]2CNC[C@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CN&C[C@H]1C",
"old_substring": "[C@@H]15CCC[NH2+]1"
} |
Can you make molecule Cc1ccc(Cl)cc1N1CCN(C(=O)[C@@H]2CCC[NH2+]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cl)cc1N1CCN(C(=O)[C@@H]2CCCO2)CC1 | Cc1ccc(Cl)cc1N1CCN(C(=O)[C@@H]2CCC[NH2+]2)CC1 | Cc1ccc(Cl)cc1N1CCN(C(=O)[C@@H]2CCCO2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@H]&O1",
"old_substring": "[C@@H]15CCC[NH2+]1"
} |
Can you make molecule Cc1ccc(Cl)cc1N1CCN(C(=O)[C@@H]2CCC[NH2+]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cl)cc1N1CCN(C(=O)C2CCCC2)CC1 | Cc1ccc(Cl)cc1N1CCN(C(=O)[C@@H]2CCC[NH2+]2)CC1 | Cc1ccc(Cl)cc1N1CCN(C(=O)C2CCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]15CCC[NH2+]1"
} |
Can you make molecule Cc1ccc(Cl)cc1N1CCN(C(=O)[C@@H]2CCC[NH2+]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cl)cc1N1CCN(C(=O)[C@@H]2CCCO2)CC1 | Cc1ccc(Cl)cc1N1CCN(C(=O)[C@@H]2CCC[NH2+]2)CC1 | Cc1ccc(Cl)cc1N1CCN(C(=O)[C@@H]2CCCO2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&O1",
"old_substring": "[C@@H]15CCC[NH2+]1"
} |
Can you make molecule COc1ccc(-c2cc(C(=O)N3CCC(O)(Cn4cc[nH+]c4)CC3)[nH]n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1C.O=C(c1ccn[nH]1)N1CCC(O)(Cn2cc[nH+]c2)CC1 | COc1ccc(-c2cc(C(=O)N3CCC(O)(Cn4cc[nH+]c4)CC3)[nH]n2)cc1 | COc1ccccc1C.O=C(c1ccn[nH]1)N1CCC(O)(Cn2cc[nH+]c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1C",
"old_substring": "c16ccc%10cc1"
} |
Can you make molecule COc1ccc(-c2cc(C(=O)N3CCC(O)(Cn4cc[nH+]c4)CC3)[nH]n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1F.O=C(c1ccn[nH]1)N1CCC(O)(Cn2cc[nH+]c2)CC1 | COc1ccc(-c2cc(C(=O)N3CCC(O)(Cn4cc[nH+]c4)CC3)[nH]n2)cc1 | COc1ccccc1F.O=C(c1ccn[nH]1)N1CCC(O)(Cn2cc[nH+]c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1F",
"old_substring": "c16ccc%10cc1"
} |
Can you make molecule COc1ccc(-c2cc(C(=O)N3CCC(O)(Cn4cc[nH+]c4)CC3)[nH]n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1I.O=C(c1ccn[nH]1)N1CCC(O)(Cn2cc[nH+]c2)CC1 | COc1ccc(-c2cc(C(=O)N3CCC(O)(Cn4cc[nH+]c4)CC3)[nH]n2)cc1 | COc1ccccc1I.O=C(c1ccn[nH]1)N1CCC(O)(Cn2cc[nH+]c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16ccc%10cc1"
} |
Can you make molecule COc1ccc(-c2cc(C(=O)N3CCC(O)(Cn4cc[nH+]c4)CC3)[nH]n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1Br.O=C(c1ccn[nH]1)N1CCC(O)(Cn2cc[nH+]c2)CC1 | COc1ccc(-c2cc(C(=O)N3CCC(O)(Cn4cc[nH+]c4)CC3)[nH]n2)cc1 | COc1ccccc1Br.O=C(c1ccn[nH]1)N1CCC(O)(Cn2cc[nH+]c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16ccc%10cc1"
} |
Can you make molecule COc1ccc(-c2cc(C(=O)N3CCC(O)(Cn4cc[nH+]c4)CC3)[nH]n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1Cl.O=C(c1ccn[nH]1)N1CCC(O)(Cn2cc[nH+]c2)CC1 | COc1ccc(-c2cc(C(=O)N3CCC(O)(Cn4cc[nH+]c4)CC3)[nH]n2)cc1 | COc1ccccc1Cl.O=C(c1ccn[nH]1)N1CCC(O)(Cn2cc[nH+]c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16ccc%10cc1"
} |
Can you make molecule O=S(=O)(CC1CCC1)N[C@H](c1cccc(F)c1)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(CC1CCCCC1)N[C@H](c1cccc(F)c1)c1ccccn1 | O=S(=O)(CC1CCC1)N[C@H](c1cccc(F)c1)c1ccccn1 | O=S(=O)(CC1CCCCC1)N[C@H](c1cccc(F)c1)c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C15CCC1"
} |
Can you make molecule O=S(=O)(CC1CCC1)N[C@H](c1cccc(F)c1)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(C=C1CCCC1)N[C@H](c1cccc(F)c1)c1ccccn1 | O=S(=O)(CC1CCC1)N[C@H](c1cccc(F)c1)c1ccccn1 | O=S(=O)(C=C1CCCC1)N[C@H](c1cccc(F)c1)c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCC1",
"old_substring": "C15CCC1"
} |
Can you make molecule O=S(=O)(CC1CCC1)N[C@H](c1cccc(F)c1)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(C=C1CCCCC1)N[C@H](c1cccc(F)c1)c1ccccn1 | O=S(=O)(CC1CCC1)N[C@H](c1cccc(F)c1)c1ccccn1 | O=S(=O)(C=C1CCCCC1)N[C@H](c1cccc(F)c1)c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCCC1",
"old_substring": "C15CCC1"
} |
Can you make molecule O=S(=O)(CC1CCC1)N[C@H](c1cccc(F)c1)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(C=C1CCSCC1)N[C@H](c1cccc(F)c1)c1ccccn1 | O=S(=O)(CC1CCC1)N[C@H](c1cccc(F)c1)c1ccccn1 | O=S(=O)(C=C1CCSCC1)N[C@H](c1cccc(F)c1)c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCSCC1",
"old_substring": "C15CCC1"
} |
Can you make molecule O=S(=O)(CC1CCC1)N[C@H](c1cccc(F)c1)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(CC1CCCCCC1)N[C@H](c1cccc(F)c1)c1ccccn1 | O=S(=O)(CC1CCC1)N[C@H](c1cccc(F)c1)c1ccccn1 | O=S(=O)(CC1CCCCCC1)N[C@H](c1cccc(F)c1)c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C15CCC1"
} |
Can you make molecule CCC1(CO)CC[NH+](Cc2cc(OC)c(O)cc2Br)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1(COC)CC[NH+](Cc2cc(OC)c(O)cc2Br)CC1 | CCC1(CO)CC[NH+](Cc2cc(OC)c(O)cc2Br)CC1 | CCC1(COC)CC[NH+](Cc2cc(OC)c(O)cc2Br)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "C6O"
} |
Can you make molecule CCC1(CO)CC[NH+](Cc2cc(OC)c(O)cc2Br)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1(SCOC)CC[NH+](Cc2cc(OC)c(O)cc2Br)CC1 | CCC1(CO)CC[NH+](Cc2cc(OC)c(O)cc2Br)CC1 | CCC1(SCOC)CC[NH+](Cc2cc(OC)c(O)cc2Br)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "C6O"
} |
Can you make molecule CCC1(CO)CC[NH+](Cc2cc(OC)c(O)cc2Br)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=COC1(CC)CC[NH+](Cc2cc(OC)c(O)cc2Br)CC1 | CCC1(CO)CC[NH+](Cc2cc(OC)c(O)cc2Br)CC1 | C=COC1(CC)CC[NH+](Cc2cc(OC)c(O)cc2Br)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CO&",
"old_substring": "C6O"
} |
Can you make molecule CCC1(CO)CC[NH+](Cc2cc(OC)c(O)cc2Br)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1(C2COC2)CC[NH+](Cc2cc(OC)c(O)cc2Br)CC1 | CCC1(CO)CC[NH+](Cc2cc(OC)c(O)cc2Br)CC1 | CCC1(C2COC2)CC[NH+](Cc2cc(OC)c(O)cc2Br)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&COC1",
"old_substring": "C6O"
} |
Can you make molecule CCC1(CO)CC[NH+](Cc2cc(OC)c(O)cc2Br)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1(C2(C)COC2)CC[NH+](Cc2cc(OC)c(O)cc2Br)CC1 | CCC1(CO)CC[NH+](Cc2cc(OC)c(O)cc2Br)CC1 | CCC1(C2(C)COC2)CC[NH+](Cc2cc(OC)c(O)cc2Br)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&COC1",
"old_substring": "C6O"
} |
Can you make molecule Cc1cc(=O)c(OCC(=O)Nc2nc(-c3cccnc3)cs2)c[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)c(OCCC(CO)=Nc2nc(-c3cccnc3)cs2)c[nH]1 | Cc1cc(=O)c(OCC(=O)Nc2nc(-c3cccnc3)cs2)c[nH]1 | Cc1cc(=O)c(OCCC(CO)=Nc2nc(-c3cccnc3)cs2)c[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C5C4=O"
} |
Can you make molecule Cc1cc(=O)c(OCC(=O)Nc2nc(-c3cccnc3)cs2)c[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(COc1c[nH]c(C)cc1=O)=N/ONc1nc(-c2cccnc2)cs1 | Cc1cc(=O)c(OCC(=O)Nc2nc(-c3cccnc3)cs2)c[nH]1 | C/C(COc1c[nH]c(C)cc1=O)=N/ONc1nc(-c2cccnc2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C5C4=O"
} |
Can you make molecule Cc1cc(=O)c(OCC(=O)Nc2nc(-c3cccnc3)cs2)c[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Oc1c[nH]c(C)cc1=O)C(=O)CNc1nc(-c2cccnc2)cs1 | Cc1cc(=O)c(OCC(=O)Nc2nc(-c3cccnc3)cs2)c[nH]1 | CCC(CC)(Oc1c[nH]c(C)cc1=O)C(=O)CNc1nc(-c2cccnc2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C5C4=O"
} |
Can you make molecule Cc1cc(=O)c(OCC(=O)Nc2nc(-c3cccnc3)cs2)c[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)c(OSSC(=O)Nc2nc(-c3cccnc3)cs2)c[nH]1 | Cc1cc(=O)c(OCC(=O)Nc2nc(-c3cccnc3)cs2)c[nH]1 | Cc1cc(=O)c(OSSC(=O)Nc2nc(-c3cccnc3)cs2)c[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C5C4=O"
} |
Can you make molecule Cc1cc(=O)c(OCC(=O)Nc2nc(-c3cccnc3)cs2)c[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Oc1c[nH]c(C)cc1=O)C(=O)CCNc1nc(-c2cccnc2)cs1 | Cc1cc(=O)c(OCC(=O)Nc2nc(-c3cccnc3)cs2)c[nH]1 | CCC(CC)(Oc1c[nH]c(C)cc1=O)C(=O)CCNc1nc(-c2cccnc2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C5C4=O"
} |
Can you make molecule C[C@H]1CC[C@H](C(=O)[O-])[C@H]([NH+]2CCN3CCC[C@@H]3C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])N1CCC2(CCC([NH+]3CCN4CCC[C@@H]4C3)CC2)CC1 | C[C@H]1CC[C@H](C(=O)[O-])[C@H]([NH+]2CCN3CCC[C@@H]3C2)C1 | O=C([O-])N1CCC2(CCC([NH+]3CCN4CCC[C@@H]4C3)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC2(CCC&CC2)CC1",
"old_substring": "C[C@H]1CC[C@H]5[C@H]4C1"
} |
Can you make molecule C[C@H]1CC[C@H](C(=O)[O-])[C@H]([NH+]2CCN3CCC[C@@H]3C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(OC(=O)[O-])c1ccc([NH+]2CCN3CCC[C@@H]3C2)cc1 | C[C@H]1CC[C@H](C(=O)[O-])[C@H]([NH+]2CCN3CCC[C@@H]3C2)C1 | C=C(OC(=O)[O-])c1ccc([NH+]2CCN3CCC[C@@H]3C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(O&)c1ccc&cc1",
"old_substring": "C[C@H]1CC[C@H]5[C@H]4C1"
} |
Can you make molecule C[C@H]1CC[C@H](C(=O)[O-])[C@H]([NH+]2CCN3CCC[C@@H]3C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCc2c(C(=O)[O-])cc([NH+]3CCN4CCC[C@@H]4C3)cc21 | C[C@H]1CC[C@H](C(=O)[O-])[C@H]([NH+]2CCN3CCC[C@@H]3C2)C1 | CC1(C)CCc2c(C(=O)[O-])cc([NH+]3CCN4CCC[C@@H]4C3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc2c1CCC2(C)C",
"old_substring": "C[C@H]1CC[C@H]5[C@H]4C1"
} |
Can you make molecule C[C@H]1CC[C@H](C(=O)[O-])[C@H]([NH+]2CCN3CCC[C@@H]3C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C)c([NH+]2CCN3CCC[C@@H]3C2)c(C)c(C)c1C(=O)[O-] | C[C@H]1CC[C@H](C(=O)[O-])[C@H]([NH+]2CCN3CCC[C@@H]3C2)C1 | Cc1c(C)c([NH+]2CCN3CCC[C@@H]3C2)c(C)c(C)c1C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(C)c(C)c&c1C",
"old_substring": "C[C@H]1CC[C@H]5[C@H]4C1"
} |
Can you make molecule C[C@H]1CC[C@H](C(=O)[O-])[C@H]([NH+]2CCN3CCC[C@@H]3C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1sc([NH+]2CCN3CCC[C@@H]3C2)c(Br)c1Br | C[C@H]1CC[C@H](C(=O)[O-])[C@H]([NH+]2CCN3CCC[C@@H]3C2)C1 | O=C([O-])c1sc([NH+]2CCN3CCC[C@@H]3C2)c(Br)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc&c(Br)c1Br",
"old_substring": "C[C@H]1CC[C@H]5[C@H]4C1"
} |
Can you make molecule CC[C@@H](C)[NH+]1CCN([C@H]2CC[C@H]([NH2+]C)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CBr)C[NH+]1CCN([C@H]2CC[C@H]([NH2+]C)C2)CC1 | CC[C@@H](C)[NH+]1CCN([C@H]2CC[C@H]([NH2+]C)C2)CC1 | CC[C@@H](CBr)C[NH+]1CCN([C@H]2CC[C@H]([NH2+]C)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&)CBr",
"old_substring": "CC[C@H]3C"
} |
Can you make molecule CC[C@@H](C)[NH+]1CCN([C@H]2CC[C@H]([NH2+]C)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCCl)C[NH+]1CCN([C@H]2CC[C@H]([NH2+]C)C2)CC1 | CC[C@@H](C)[NH+]1CCN([C@H]2CC[C@H]([NH2+]C)C2)CC1 | CC[C@@H](CCCl)C[NH+]1CCN([C@H]2CC[C@H]([NH2+]C)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&)CCCl",
"old_substring": "CC[C@H]3C"
} |
Can you make molecule CC[C@@H](C)[NH+]1CCN([C@H]2CC[C@H]([NH2+]C)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CBr)C[NH+]1CCN([C@H]2CC[C@H]([NH2+]C)C2)CC1 | CC[C@@H](C)[NH+]1CCN([C@H]2CC[C@H]([NH2+]C)C2)CC1 | CC[C@H](CBr)C[NH+]1CCN([C@H]2CC[C@H]([NH2+]C)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](C&)CBr",
"old_substring": "CC[C@H]3C"
} |
Can you make molecule CC[C@@H](C)[NH+]1CCN([C@H]2CC[C@H]([NH2+]C)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CCCl)C[NH+]1CCN([C@H]2CC[C@H]([NH2+]C)C2)CC1 | CC[C@@H](C)[NH+]1CCN([C@H]2CC[C@H]([NH2+]C)C2)CC1 | CC[C@H](CCCl)C[NH+]1CCN([C@H]2CC[C@H]([NH2+]C)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](C&)CCCl",
"old_substring": "CC[C@H]3C"
} |
Can you make molecule CC[C@@H](C)[NH+]1CCN([C@H]2CC[C@H]([NH2+]C)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](Cl)CCC[NH+]1CCN([C@H]2CC[C@H]([NH2+]C)C2)CC1 | CC[C@@H](C)[NH+]1CCN([C@H]2CC[C@H]([NH2+]C)C2)CC1 | CC[C@@H](Cl)CCC[NH+]1CCN([C@H]2CC[C@H]([NH2+]C)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](Cl)CCC&",
"old_substring": "CC[C@H]3C"
} |
Can you make molecule COc1ccc([C@@H]2CC(=O)C3=C(C2)N[C@@H]2N=NC(O)=C2[C@H]3c2ccc(Cl)c(Cl)c2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc([C@@H]2CC(=O)C3=C(C2)N[C@@H]2N=NC(O)=C2[C@H]3c2ccc(Cl)c(Cl)c2)cc1OC | COc1ccc([C@@H]2CC(=O)C3=C(C2)N[C@@H]2N=NC(O)=C2[C@H]3c2ccc(Cl)c(Cl)c2)cc1OC | COCc1ccc([C@@H]2CC(=O)C3=C(C2)N[C@@H]2N=NC(O)=C2[C@H]3c2ccc(Cl)c(Cl)c2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc([C@@H]2CC(=O)C3=C(C2)N[C@@H]2N=NC(O)=C2[C@H]3c2ccc(Cl)c(Cl)c2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc([C@@H]2CC(=O)C3=C(C2)N[C@@H]2N=NC(O)=C2[C@H]3c2ccc(Cl)c(Cl)c2)cc1OC | COc1ccc([C@@H]2CC(=O)C3=C(C2)N[C@@H]2N=NC(O)=C2[C@H]3c2ccc(Cl)c(Cl)c2)cc1OC | COCSc1ccc([C@@H]2CC(=O)C3=C(C2)N[C@@H]2N=NC(O)=C2[C@H]3c2ccc(Cl)c(Cl)c2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc([C@@H]2CC(=O)C3=C(C2)N[C@@H]2N=NC(O)=C2[C@H]3c2ccc(Cl)c(Cl)c2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@@H]2CC(=O)C3=C(C2)N[C@@H]2N=NC(O)=C2[C@H]3c2ccc(Cl)c(Cl)c2)ccc1SC(C)=O | COc1ccc([C@@H]2CC(=O)C3=C(C2)N[C@@H]2N=NC(O)=C2[C@H]3c2ccc(Cl)c(Cl)c2)cc1OC | COc1cc([C@@H]2CC(=O)C3=C(C2)N[C@@H]2N=NC(O)=C2[C@H]3c2ccc(Cl)c(Cl)c2)ccc1SC(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc([C@@H]2CC(=O)C3=C(C2)N[C@@H]2N=NC(O)=C2[C@H]3c2ccc(Cl)c(Cl)c2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@@H]2CC(=O)C3=C(C2)N[C@@H]2N=NC(O)=C2[C@H]3c2ccc(Cl)c(Cl)c2)ccc1C(=O)CS | COc1ccc([C@@H]2CC(=O)C3=C(C2)N[C@@H]2N=NC(O)=C2[C@H]3c2ccc(Cl)c(Cl)c2)cc1OC | COc1cc([C@@H]2CC(=O)C3=C(C2)N[C@@H]2N=NC(O)=C2[C@H]3c2ccc(Cl)c(Cl)c2)ccc1C(=O)CS | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc([C@@H]2CC(=O)C3=C(C2)N[C@@H]2N=NC(O)=C2[C@H]3c2ccc(Cl)c(Cl)c2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@@H]2CC(=O)C3=C(C2)N[C@@H]2N=NC(O)=C2[C@H]3c2ccc(Cl)c(Cl)c2)ccc1C(=O)CI | COc1ccc([C@@H]2CC(=O)C3=C(C2)N[C@@H]2N=NC(O)=C2[C@H]3c2ccc(Cl)c(Cl)c2)cc1OC | COc1cc([C@@H]2CC(=O)C3=C(C2)N[C@@H]2N=NC(O)=C2[C@H]3c2ccc(Cl)c(Cl)c2)ccc1C(=O)CI | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule Cc1ccoc1C[NH+]1CC[C@@H](C)[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)oc1C[NH+]1CC[C@@H](C)[C@H](C)C1 | Cc1ccoc1C[NH+]1CC[C@@H](C)[C@H](C)C1 | Cc1cc(Br)oc1C[NH+]1CC[C@@H](C)[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(Br)oc1&",
"old_substring": "Cc1ccoc13"
} |
Can you make molecule Cc1ccoc1C[NH+]1CC[C@@H](C)[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C[NH+]2CC[C@@H](C)[C@H](C)C2)sc1C | Cc1ccoc1C[NH+]1CC[C@@H](C)[C@H](C)C1 | Cc1cc(C[NH+]2CC[C@@H](C)[C@H](C)C2)sc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&sc1C",
"old_substring": "Cc1ccoc13"
} |
Can you make molecule Cc1ccoc1C[NH+]1CC[C@@H](C)[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[NH+]2CC[C@@H](C)[C@H](C)C2)cc1I | Cc1ccoc1C[NH+]1CC[C@@H](C)[C@H](C)C1 | Cc1ccc(C[NH+]2CC[C@@H](C)[C@H](C)C2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "Cc1ccoc13"
} |
Can you make molecule Cc1ccoc1C[NH+]1CC[C@@H](C)[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1C=C[NH+]1CC[C@@H](C)[C@H](C)C1 | Cc1ccoc1C[NH+]1CC[C@@H](C)[C@H](C)C1 | Cc1ccsc1C=C[NH+]1CC[C@@H](C)[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccsc1C=&",
"old_substring": "Cc1ccoc13"
} |
Can you make molecule Cc1ccoc1C[NH+]1CC[C@@H](C)[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(C[NH+]2CC[C@@H](C)[C@H](C)C2)c1Cl | Cc1ccoc1C[NH+]1CC[C@@H](C)[C@H](C)C1 | Cc1csc(C[NH+]2CC[C@@H](C)[C@H](C)C2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1csc&c1Cl",
"old_substring": "Cc1ccoc13"
} |
Can you make molecule C[C@H](c1cccc(F)c1)N1CCN(C(=O)C[C@H]2CCOc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](SN1CCN(C(=O)C[C@H]2CCOc3ccccc32)CC1)c1cccc(F)c1 | C[C@H](c1cccc(F)c1)N1CCN(C(=O)C[C@H]2CCOc3ccccc32)CC1 | C[C@@H](SN1CCN(C(=O)C[C@H]2CCOc3ccccc32)CC1)c1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N15CCN4CC1"
} |
Can you make molecule C[C@H](c1cccc(F)c1)N1CCN(C(=O)C[C@H]2CCOc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](c1cccc(F)c1)N1CCN=C1CC(=O)C[C@H]1CCOc2ccccc21 | C[C@H](c1cccc(F)c1)N1CCN(C(=O)C[C@H]2CCOc3ccccc32)CC1 | C[C@H](c1cccc(F)c1)N1CCN=C1CC(=O)C[C@H]1CCOc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1C&",
"old_substring": "N15CCN4CC1"
} |
Can you make molecule C[C@H](c1cccc(F)c1)N1CCN(C(=O)C[C@H]2CCOc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](c1cccc(F)c1)N1CCCN(C(=O)C[C@H]2CCOc3ccccc32)C1=O | C[C@H](c1cccc(F)c1)N1CCN(C(=O)C[C@H]2CCOc3ccccc32)CC1 | C[C@H](c1cccc(F)c1)N1CCCN(C(=O)C[C@H]2CCOc3ccccc32)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&C1=O",
"old_substring": "N15CCN4CC1"
} |
Can you make molecule C[C@H](c1cccc(F)c1)N1CCN(C(=O)C[C@H]2CCOc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](c1cccc(F)c1)N1CCN=C1SC(=O)C[C@H]1CCOc2ccccc21 | C[C@H](c1cccc(F)c1)N1CCN(C(=O)C[C@H]2CCOc3ccccc32)CC1 | C[C@H](c1cccc(F)c1)N1CCN=C1SC(=O)C[C@H]1CCOc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N15CCN4CC1"
} |
Can you make molecule C[C@H](c1cccc(F)c1)N1CCN(C(=O)C[C@H]2CCOc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](c1cccc(F)c1)N1CCN(C(=O)C[C@H]2CCOc3ccccc32)C(C)(C)C1 | C[C@H](c1cccc(F)c1)N1CCN(C(=O)C[C@H]2CCOc3ccccc32)CC1 | C[C@H](c1cccc(F)c1)N1CCN(C(=O)C[C@H]2CCOc3ccccc32)C(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&C(C)(C)C1",
"old_substring": "N15CCN4CC1"
} |
Can you make molecule N#C/C(C=C1C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21)=C(/N)NCCO less soluble in water? The output molecule should be similar to the input molecule. | N#CC(C#N)=C(SCCO)[SH]=C1C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21 | N#C/C(C=C1C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21)=C(/N)NCCO | N#CC(C#N)=C(SCCO)[SH]=C1C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC(C#N)=C(S&)S&",
"old_substring": "N#C/C(C=4)=C(/N)N3"
} |
Can you make molecule N#C/C(C=C1C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21)=C(/N)NCCO less soluble in water? The output molecule should be similar to the input molecule. | C/C(CC=C1C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21)=N/NC(=O)CCCO | N#C/C(C=C1C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21)=C(/N)NCCO | C/C(CC=C1C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21)=N/NC(=O)CCCO | 102 | {
"fragment_index": 0,
"new_substring": "C/C(CC&)=N/NC(=O)C&",
"old_substring": "N#C/C(C=4)=C(/N)N3"
} |
Can you make molecule N#C/C(C=C1C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21)=C(/N)NCCO less soluble in water? The output molecule should be similar to the input molecule. | C/C(CC=C1C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21)=N/NC(=S)NCCO | N#C/C(C=C1C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21)=C(/N)NCCO | C/C(CC=C1C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21)=N/NC(=S)NCCO | 102 | {
"fragment_index": 0,
"new_substring": "C/C(CC&)=N/NC(=S)N&",
"old_substring": "N#C/C(C=4)=C(/N)N3"
} |
Can you make molecule N#C/C(C=C1C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21)=C(/N)NCCO less soluble in water? The output molecule should be similar to the input molecule. | CN(C)C(/C=C/NCCO)=C1C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21 | N#C/C(C=C1C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21)=C(/N)NCCO | CN(C)C(/C=C/NCCO)=C1C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CN(C)C=&/C=C/N&",
"old_substring": "N#C/C(C=4)=C(/N)N3"
} |
Can you make molecule N#C/C(C=C1C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21)=C(/N)NCCO less soluble in water? The output molecule should be similar to the input molecule. | O=C(C=C1C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21)N/N=C/CCCO | N#C/C(C=C1C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21)=C(/N)NCCO | O=C(C=C1C(=O)N(c2c(Cl)cccc2Cl)c2ccccc21)N/N=C/CCCO | 102 | {
"fragment_index": 0,
"new_substring": "O=C(C&)N/N=C/C&",
"old_substring": "N#C/C(C=4)=C(/N)N3"
} |
Can you make molecule Cc1cccc(NC(=O)[C@@H](C)[NH+]2CCC[C@H](c3nncn3C3CC3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NSC(=O)[C@@H](C)[NH+]2CCC[C@H](c3nncn3C3CC3)C2)c1 | Cc1cccc(NC(=O)[C@@H](C)[NH+]2CCC[C@H](c3nncn3C3CC3)C2)c1 | Cc1cccc(NSC(=O)[C@@H](C)[NH+]2CCC[C@H](c3nncn3C3CC3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C4(=O)[C@H]5C"
} |
Can you make molecule Cc1cccc(NC(=O)[C@@H](C)[NH+]2CCC[C@H](c3nncn3C3CC3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)[C@H](C)CC[NH+]2CCC[C@H](c3nncn3C3CC3)C2)c1 | Cc1cccc(NC(=O)[C@@H](C)[NH+]2CCC[C@H](c3nncn3C3CC3)C2)c1 | Cc1cccc(NC(=O)[C@H](C)CC[NH+]2CCC[C@H](c3nncn3C3CC3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@H](C)CC&",
"old_substring": "C4(=O)[C@H]5C"
} |
Can you make molecule Cc1cccc(NC(=O)[C@@H](C)[NH+]2CCC[C@H](c3nncn3C3CC3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)[C@@H](C)CC[NH+]2CCC[C@H](c3nncn3C3CC3)C2)c1 | Cc1cccc(NC(=O)[C@@H](C)[NH+]2CCC[C@H](c3nncn3C3CC3)C2)c1 | Cc1cccc(NC(=O)[C@@H](C)CC[NH+]2CCC[C@H](c3nncn3C3CC3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@@H](C)CC&",
"old_substring": "C4(=O)[C@H]5C"
} |
Can you make molecule Cc1cccc(NC(=O)[C@@H](C)[NH+]2CCC[C@H](c3nncn3C3CC3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)C[C@@H](Br)[NH+]2CCC[C@H](c3nncn3C3CC3)C2)c1 | Cc1cccc(NC(=O)[C@@H](C)[NH+]2CCC[C@H](c3nncn3C3CC3)C2)c1 | Cc1cccc(NC(=O)C[C@@H](Br)[NH+]2CCC[C@H](c3nncn3C3CC3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C4(=O)[C@H]5C"
} |
Can you make molecule Cc1cccc(NC(=O)[C@@H](C)[NH+]2CCC[C@H](c3nncn3C3CC3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(N[C@@H](C)CC[NH+]2CCC[C@H](c3nncn3C3CC3)C2)c1 | Cc1cccc(NC(=O)[C@@H](C)[NH+]2CCC[C@H](c3nncn3C3CC3)C2)c1 | Cc1cccc(N[C@@H](C)CC[NH+]2CCC[C@H](c3nncn3C3CC3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C4(=O)[C@H]5C"
} |
Can you make molecule COc1ccccc1CN1CCO[C@H](c2cccc(OC(F)F)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CN1CCO[C@H](c2cccc(OC(F)(F)Cl)c2)C1 | COc1ccccc1CN1CCO[C@H](c2cccc(OC(F)F)c2)C1 | COc1ccccc1CN1CCO[C@H](c2cccc(OC(F)(F)Cl)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(F)(F)Cl",
"old_substring": "O4C(F)F"
} |
Can you make molecule COc1ccccc1CN1CCO[C@H](c2cccc(OC(F)F)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CN1CCO[C@H](c2cccc(C(F)(F)F)c2)C1 | COc1ccccc1CN1CCO[C@H](c2cccc(OC(F)F)c2)C1 | COc1ccccc1CN1CCO[C@H](c2cccc(C(F)(F)F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "FC&(F)F",
"old_substring": "O4C(F)F"
} |
Can you make molecule COc1ccccc1CN1CCO[C@H](c2cccc(OC(F)F)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CN1CCO[C@H](c2cccc(SC(F)F)c2)C1 | COc1ccccc1CN1CCO[C@H](c2cccc(OC(F)F)c2)C1 | COc1ccccc1CN1CCO[C@H](c2cccc(SC(F)F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)F",
"old_substring": "O4C(F)F"
} |
Can you make molecule COc1ccccc1CN1CCO[C@H](c2cccc(OC(F)F)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CN1CCO[C@H](c2cccc([C@@H](O)CC(F)(F)F)c2)C1 | COc1ccccc1CN1CCO[C@H](c2cccc(OC(F)F)c2)C1 | COc1ccccc1CN1CCO[C@H](c2cccc([C@@H](O)CC(F)(F)F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@H]&CC(F)(F)F",
"old_substring": "O4C(F)F"
} |
Can you make molecule COc1ccccc1CN1CCO[C@H](c2cccc(OC(F)F)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CN1CCO[C@H](c2cccc(-c3c(F)cc(C=O)cc3F)c2)C1 | COc1ccccc1CN1CCO[C@H](c2cccc(OC(F)F)c2)C1 | COc1ccccc1CN1CCO[C@H](c2cccc(-c3c(F)cc(C=O)cc3F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1cc(F)c&c(F)c1",
"old_substring": "O4C(F)F"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.