prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1ncccc1NC(=O)C(=O)NCC[NH+](C)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncccc1NC(=O)CCCC(=O)NCC[NH+](C)C(C)C | Cc1ncccc1NC(=O)C(=O)NCC[NH+](C)C(C)C | Cc1ncccc1NC(=O)CCCC(=O)NCC[NH+](C)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C2(=O)C3=O"
} |
Can you make molecule Cc1ncccc1NC(=O)C(=O)NCC[NH+](C)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncccc1NC(=O)CCC(=O)CNCC[NH+](C)C(C)C | Cc1ncccc1NC(=O)C(=O)NCC[NH+](C)C(C)C | Cc1ncccc1NC(=O)CCC(=O)CNCC[NH+](C)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC(=O)C&",
"old_substring": "C2(=O)C3=O"
} |
Can you make molecule Cc1ncccc1NC(=O)C(=O)NCC[NH+](C)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncccc1NC[S@+]([O-])CCC(=O)NCC[NH+](C)C(C)C | Cc1ncccc1NC(=O)C(=O)NCC[NH+](C)C(C)C | Cc1ncccc1NC[S@+]([O-])CCC(=O)NCC[NH+](C)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&=O",
"old_substring": "C2(=O)C3=O"
} |
Can you make molecule Cc1ncccc1NC(=O)C(=O)NCC[NH+](C)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncccc1NC(=O)CCCS(=O)(=O)NCC[NH+](C)C(C)C | Cc1ncccc1NC(=O)C(=O)NCC[NH+](C)C(C)C | Cc1ncccc1NC(=O)CCCS(=O)(=O)NCC[NH+](C)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCS&(=O)=O",
"old_substring": "C2(=O)C3=O"
} |
Can you make molecule Cc1ncccc1NC(=O)C(=O)NCC[NH+](C)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncccc1NC(=O)C(C)(F)C(=O)NCC[NH+](C)C(C)C | Cc1ncccc1NC(=O)C(=O)NCC[NH+](C)C(C)C | Cc1ncccc1NC(=O)C(C)(F)C(=O)NCC[NH+](C)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(F)C&=O",
"old_substring": "C2(=O)C3=O"
} |
Can you make molecule C[C@@H](CCCO)NC(=O)N(C)[C@@H]1CCN(c2ccccc2Cl)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCCO)NC(=O)CC(C)(C)N(C)[C@@H]1CCN(c2ccccc2Cl)C1=O | C[C@@H](CCCO)NC(=O)N(C)[C@@H]1CCN(c2ccccc2Cl)C1=O | C[C@@H](CCCO)NC(=O)CC(C)(C)N(C)[C@@H]1CCN(c2ccccc2Cl)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule C[C@@H](CCCO)NC(=O)N(C)[C@@H]1CCN(c2ccccc2Cl)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCCO)NC(=O)CCC(C)(C)N(C)[C@@H]1CCN(c2ccccc2Cl)C1=O | C[C@@H](CCCO)NC(=O)N(C)[C@@H]1CCN(c2ccccc2Cl)C1=O | C[C@@H](CCCO)NC(=O)CCC(C)(C)N(C)[C@@H]1CCN(c2ccccc2Cl)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule C[C@@H](CCCO)NC(=O)N(C)[C@@H]1CCN(c2ccccc2Cl)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCCO)NC(=O)C[C@@H](Br)N(C)[C@@H]1CCN(c2ccccc2Cl)C1=O | C[C@@H](CCCO)NC(=O)N(C)[C@@H]1CCN(c2ccccc2Cl)C1=O | C[C@@H](CCCO)NC(=O)C[C@@H](Br)N(C)[C@@H]1CCN(c2ccccc2Cl)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule C[C@@H](CCCO)NC(=O)N(C)[C@@H]1CCN(c2ccccc2Cl)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N[C@@H](C)CCCO)cc(=O)n1N(C)[C@@H]1CCN(c2ccccc2Cl)C1=O | C[C@@H](CCCO)NC(=O)N(C)[C@@H]1CCN(c2ccccc2Cl)C1=O | Cc1cc(N[C@@H](C)CCCO)cc(=O)n1N(C)[C@@H]1CCN(c2ccccc2Cl)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule C[C@@H](CCCO)NC(=O)N(C)[C@@H]1CCN(c2ccccc2Cl)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(N[C@@H](C)CCCO)c(=O)ccn1N(C)[C@@H]1CCN(c2ccccc2Cl)C1=O | C[C@@H](CCCO)NC(=O)N(C)[C@@H]1CCN(c2ccccc2Cl)C1=O | Cc1c(N[C@@H](C)CCCO)c(=O)ccn1N(C)[C@@H]1CCN(c2ccccc2Cl)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule C[C@H](SCC[NH3+])c1ccc(C(=O)[O-])o1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](SCC[NH3+])c1ccc(CCS(=O)(=O)[O-])o1 | C[C@H](SCC[NH3+])c1ccc(C(=O)[O-])o1 | C[C@H](SCC[NH3+])c1ccc(CCS(=O)(=O)[O-])o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CS(=O)(=O)[O-]",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule C[C@H](SCC[NH3+])c1ccc(C(=O)[O-])o1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](SCC[NH3+])c1ccc(C(=O)CO)o1 | C[C@H](SCC[NH3+])c1ccc(C(=O)[O-])o1 | C[C@H](SCC[NH3+])c1ccc(C(=O)CO)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CO",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule C[C@H](SCC[NH3+])c1ccc(C(=O)[O-])o1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](SCC[NH3+])c1ccc(C(O)O)o1 | C[C@H](SCC[NH3+])c1ccc(C(=O)[O-])o1 | C[C@H](SCC[NH3+])c1ccc(C(O)O)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(O)O",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule C[C@H](SCC[NH3+])c1ccc(C(=O)[O-])o1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)[O-])c1ccc([C@H](C)SCC[NH3+])o1 | C[C@H](SCC[NH3+])c1ccc(C(=O)[O-])o1 | CCC(CC)(C(=O)[O-])c1ccc([C@H](C)SCC[NH3+])o1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)[O-]",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule C[C@H](SCC[NH3+])c1ccc(C(=O)[O-])o1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](SCC[NH3+])c1ccc(CCCS(=O)(=O)[O-])o1 | C[C@H](SCC[NH3+])c1ccc(C(=O)[O-])o1 | C[C@H](SCC[NH3+])c1ccc(CCCS(=O)(=O)[O-])o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCS(=O)(=O)[O-]",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule Cc1ccc(C)c([C@@](C)(O)[C@@H]2CCCc3cccnc32)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc([C@@](C)(O)[C@@H]2CCCc3cccnc32)c(C)cc1I | Cc1ccc(C)c([C@@](C)(O)[C@@H]2CCCc3cccnc32)c1 | Cc1cc([C@@](C)(O)[C@@H]2CCCc3cccnc32)c(C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1I",
"old_substring": "Cc1ccc(C)c4c1"
} |
Can you make molecule Cc1ccc(C)c([C@@](C)(O)[C@@H]2CCCc3cccnc32)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc([C@@](C)(O)[C@@H]2CCCc3cccnc32)c(C)cc1Br | Cc1ccc(C)c([C@@](C)(O)[C@@H]2CCCc3cccnc32)c1 | Cc1cc([C@@](C)(O)[C@@H]2CCCc3cccnc32)c(C)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1Br",
"old_substring": "Cc1ccc(C)c4c1"
} |
Can you make molecule Cc1ccc(C)c([C@@](C)(O)[C@@H]2CCCc3cccnc32)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc([C@@](C)(O)[C@@H]2CCCc3cccnc32)c(Cl)cc1F | Cc1ccc(C)c([C@@](C)(O)[C@@H]2CCCc3cccnc32)c1 | Cc1cc([C@@](C)(O)[C@@H]2CCCc3cccnc32)c(Cl)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(Cl)cc1F",
"old_substring": "Cc1ccc(C)c4c1"
} |
Can you make molecule Cc1ccc(C)c([C@@](C)(O)[C@@H]2CCCc3cccnc32)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c([C@@](C)(O)[C@@H]2CCCc3cccnc32)c1Cl | Cc1ccc(C)c([C@@](C)(O)[C@@H]2CCCc3cccnc32)c1 | Cc1ccc(C)c([C@@](C)(O)[C@@H]2CCCc3cccnc32)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(C)c&c1Cl",
"old_substring": "Cc1ccc(C)c4c1"
} |
Can you make molecule Cc1ccc(C)c([C@@](C)(O)[C@@H]2CCCc3cccnc32)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Br)c([C@@](C)(O)[C@@H]2CCCc3cccnc32)c1 | Cc1ccc(C)c([C@@](C)(O)[C@@H]2CCCc3cccnc32)c1 | Cc1ccc(Br)c([C@@](C)(O)[C@@H]2CCCc3cccnc32)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(Br)c&c1",
"old_substring": "Cc1ccc(C)c4c1"
} |
Can you make molecule CC[S@+]([O-])[C@@H]1CCC[C@H]([NH2+][C@@H]2CCc3c(Br)cccc32)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C[C@H](CC)[NH2+][C@@H]1CCc2c(Br)cccc21 | CC[S@+]([O-])[C@@H]1CCC[C@H]([NH2+][C@@H]2CCc3c(Br)cccc32)C1 | CC[C@@H](C)C[C@H](CC)[NH2+][C@@H]1CCc2c(Br)cccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&C[C@H](C)CC",
"old_substring": "CC[S@](=O)[C@@H]1CCC[C@H]4C1"
} |
Can you make molecule CC[S@+]([O-])[C@@H]1CCC[C@H]([NH2+][C@@H]2CCc3c(Br)cccc32)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CC(=O)[NH2+][C@@H]1CCc2c(Br)cccc21)C(C)C | CC[S@+]([O-])[C@@H]1CCC[C@H]([NH2+][C@@H]2CCc3c(Br)cccc32)C1 | CC[C@H](CC(=O)[NH2+][C@@H]1CCc2c(Br)cccc21)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](CC&=O)C(C)C",
"old_substring": "CC[S@](=O)[C@@H]1CCC[C@H]4C1"
} |
Can you make molecule CC[S@+]([O-])[C@@H]1CCC[C@H]([NH2+][C@@H]2CCc3c(Br)cccc32)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1=C(C)C[C@H]([NH2+][C@@H]2CCc3c(Br)cccc32)S1 | CC[S@+]([O-])[C@@H]1CCC[C@H]([NH2+][C@@H]2CCc3c(Br)cccc32)C1 | CCC1=C(C)C[C@H]([NH2+][C@@H]2CCc3c(Br)cccc32)S1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC1=C(C)C[C@H]&S1",
"old_substring": "CC[S@](=O)[C@@H]1CCC[C@H]4C1"
} |
Can you make molecule CC[S@+]([O-])[C@@H]1CCC[C@H]([NH2+][C@@H]2CCc3c(Br)cccc32)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCCl)C[NH2+][C@@H]1CCc2c(Br)cccc21 | CC[S@+]([O-])[C@@H]1CCC[C@H]([NH2+][C@@H]2CCc3c(Br)cccc32)C1 | CC[C@@H](CCCl)C[NH2+][C@@H]1CCc2c(Br)cccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&)CCCl",
"old_substring": "CC[S@](=O)[C@@H]1CCC[C@H]4C1"
} |
Can you make molecule CC[S@+]([O-])[C@@H]1CCC[C@H]([NH2+][C@@H]2CCc3c(Br)cccc32)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH2+][C@@H]1CCc2c(Br)cccc21)C1=CCCCC1 | CC[S@+]([O-])[C@@H]1CCC[C@H]([NH2+][C@@H]2CCc3c(Br)cccc32)C1 | C[C@H]([NH2+][C@@H]1CCc2c(Br)cccc21)C1=CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&C1=CCCCC1",
"old_substring": "CC[S@](=O)[C@@H]1CCC[C@H]4C1"
} |
Can you make molecule CC[C@@H](NC(=O)NCc1ccccc1C)c1nc(C(F)(F)F)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](NC(=O)NCc1ccccc1C)c1nc(SC(F)(F)F)cs1 | CC[C@@H](NC(=O)NCc1ccccc1C)c1nc(C(F)(F)F)cs1 | CC[C@@H](NC(=O)NCc1ccccc1C)c1nc(SC(F)(F)F)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C7(F)(F)F"
} |
Can you make molecule CC[C@@H](NC(=O)NCc1ccccc1C)c1nc(C(F)(F)F)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](NC(=O)NCc1ccccc1C)c1nc(CCCC(F)(F)F)cs1 | CC[C@@H](NC(=O)NCc1ccccc1C)c1nc(C(F)(F)F)cs1 | CC[C@@H](NC(=O)NCc1ccccc1C)c1nc(CCCC(F)(F)F)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C7(F)(F)F"
} |
Can you make molecule CC[C@@H](NC(=O)NCc1ccccc1C)c1nc(C(F)(F)F)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](NC(=O)NCc1ccccc1C)c1nc(CCCCC(F)(F)F)cs1 | CC[C@@H](NC(=O)NCc1ccccc1C)c1nc(C(F)(F)F)cs1 | CC[C@@H](NC(=O)NCc1ccccc1C)c1nc(CCCCC(F)(F)F)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C7(F)(F)F"
} |
Can you make molecule CC[C@@H](NC(=O)NCc1ccccc1C)c1nc(C(F)(F)F)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](NC(=O)NCc1ccccc1C)c1nc(C(F)(F)C(F)(F)F)cs1 | CC[C@@H](NC(=O)NCc1ccccc1C)c1nc(C(F)(F)F)cs1 | CC[C@@H](NC(=O)NCc1ccccc1C)c1nc(C(F)(F)C(F)(F)F)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C7(F)(F)F"
} |
Can you make molecule CC[C@@H](NC(=O)NCc1ccccc1C)c1nc(C(F)(F)F)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](NC(=O)NCc1ccccc1C)c1nc(CC(F)(F)C(F)(F)F)cs1 | CC[C@@H](NC(=O)NCc1ccccc1C)c1nc(C(F)(F)F)cs1 | CC[C@@H](NC(=O)NCc1ccccc1C)c1nc(CC(F)(F)C(F)(F)F)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C7(F)(F)F"
} |
Can you make molecule Cc1cccc(CSC2=NC(=O)[C@H]3C(=N2)NC(=O)C[C@H]3C(=O)Nc2ccc(F)c(Cl)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CSC2=NC(=O)[C@H]3C(=N2)NC(=O)C[C@H]3CC(=O)SNc2ccc(F)c(Cl)c2)c1 | Cc1cccc(CSC2=NC(=O)[C@H]3C(=N2)NC(=O)C[C@H]3C(=O)Nc2ccc(F)c(Cl)c2)c1 | Cc1cccc(CSC2=NC(=O)[C@H]3C(=N2)NC(=O)C[C@H]3CC(=O)SNc2ccc(F)c(Cl)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule Cc1cccc(CSC2=NC(=O)[C@H]3C(=N2)NC(=O)C[C@H]3C(=O)Nc2ccc(F)c(Cl)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CSC2=NC(=O)[C@H]3C(=N2)NC(=O)C[C@H]3CC(=C=O)CNc2ccc(F)c(Cl)c2)c1 | Cc1cccc(CSC2=NC(=O)[C@H]3C(=N2)NC(=O)C[C@H]3C(=O)Nc2ccc(F)c(Cl)c2)c1 | Cc1cccc(CSC2=NC(=O)[C@H]3C(=N2)NC(=O)C[C@H]3CC(=C=O)CNc2ccc(F)c(Cl)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule Cc1cccc(CSC2=NC(=O)[C@H]3C(=N2)NC(=O)C[C@H]3C(=O)Nc2ccc(F)c(Cl)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CSC2=NC(=O)[C@H]3C(=N2)NC(=O)C[C@H]3C(=O)CCCC(=O)Nc2ccc(F)c(Cl)c2)c1 | Cc1cccc(CSC2=NC(=O)[C@H]3C(=N2)NC(=O)C[C@H]3C(=O)Nc2ccc(F)c(Cl)c2)c1 | Cc1cccc(CSC2=NC(=O)[C@H]3C(=N2)NC(=O)C[C@H]3C(=O)CCCC(=O)Nc2ccc(F)c(Cl)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule Cc1cccc(CSC2=NC(=O)[C@H]3C(=N2)NC(=O)C[C@H]3C(=O)Nc2ccc(F)c(Cl)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CSC2=NC(=O)[C@H]3C(=N2)NC(=O)C[C@H]3C(C)(C)CC(=O)Nc2ccc(F)c(Cl)c2)c1 | Cc1cccc(CSC2=NC(=O)[C@H]3C(=N2)NC(=O)C[C@H]3C(=O)Nc2ccc(F)c(Cl)c2)c1 | Cc1cccc(CSC2=NC(=O)[C@H]3C(=N2)NC(=O)C[C@H]3C(C)(C)CC(=O)Nc2ccc(F)c(Cl)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule Cc1cccc(CSC2=NC(=O)[C@H]3C(=N2)NC(=O)C[C@H]3C(=O)Nc2ccc(F)c(Cl)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CSC2=NC(=O)[C@H]3C(=N2)NC(=O)C[C@H]3CCC[S@@+]([O-])CNc2ccc(F)c(Cl)c2)c1 | Cc1cccc(CSC2=NC(=O)[C@H]3C(=N2)NC(=O)C[C@H]3C(=O)Nc2ccc(F)c(Cl)c2)c1 | Cc1cccc(CSC2=NC(=O)[C@H]3C(=N2)NC(=O)C[C@H]3CCC[S@@+]([O-])CNc2ccc(F)c(Cl)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C47=O"
} |
Can you make molecule O=C(Nc1cccc(-n2cccn2)c1)[C@@H]1CCC[NH+](Cc2ccc(C#CCCO)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(-n2cccn2)cc1I)[C@@H]1CCC[NH+](Cc2ccc(C#CCCO)cc2)C1 | O=C(Nc1cccc(-n2cccn2)c1)[C@@H]1CCC[NH+](Cc2ccc(C#CCCO)cc2)C1 | O=C(Nc1ccc(-n2cccn2)cc1I)[C@@H]1CCC[NH+](Cc2ccc(C#CCCO)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15cccc8c1"
} |
Can you make molecule O=C(Nc1cccc(-n2cccn2)c1)[C@@H]1CCC[NH+](Cc2ccc(C#CCCO)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1cc(-n2cccn2)ccc1Br)[C@@H]1CCC[NH+](Cc2ccc(C#CCCO)cc2)C1 | O=C(Nc1cccc(-n2cccn2)c1)[C@@H]1CCC[NH+](Cc2ccc(C#CCCO)cc2)C1 | O=C(Nc1cc(-n2cccn2)ccc1Br)[C@@H]1CCC[NH+](Cc2ccc(C#CCCO)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15cccc8c1"
} |
Can you make molecule O=C(Nc1cccc(-n2cccn2)c1)[C@@H]1CCC[NH+](Cc2ccc(C#CCCO)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(-n2cccn2)cc1Cl)[C@@H]1CCC[NH+](Cc2ccc(C#CCCO)cc2)C1 | O=C(Nc1cccc(-n2cccn2)c1)[C@@H]1CCC[NH+](Cc2ccc(C#CCCO)cc2)C1 | O=C(Nc1ccc(-n2cccn2)cc1Cl)[C@@H]1CCC[NH+](Cc2ccc(C#CCCO)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15cccc8c1"
} |
Can you make molecule O=C(Nc1cccc(-n2cccn2)c1)[C@@H]1CCC[NH+](Cc2ccc(C#CCCO)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1cccc(-n2cccn2)c1Br)[C@@H]1CCC[NH+](Cc2ccc(C#CCCO)cc2)C1 | O=C(Nc1cccc(-n2cccn2)c1)[C@@H]1CCC[NH+](Cc2ccc(C#CCCO)cc2)C1 | O=C(Nc1cccc(-n2cccn2)c1Br)[C@@H]1CCC[NH+](Cc2ccc(C#CCCO)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15cccc8c1"
} |
Can you make molecule O=C(Nc1cccc(-n2cccn2)c1)[C@@H]1CCC[NH+](Cc2ccc(C#CCCO)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1cccc(-n2cccn2)c1Cl)[C@@H]1CCC[NH+](Cc2ccc(C#CCCO)cc2)C1 | O=C(Nc1cccc(-n2cccn2)c1)[C@@H]1CCC[NH+](Cc2ccc(C#CCCO)cc2)C1 | O=C(Nc1cccc(-n2cccn2)c1Cl)[C@@H]1CCC[NH+](Cc2ccc(C#CCCO)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15cccc8c1"
} |
Can you make molecule O=C([O-])CCNC(=O)N[C@@H]1CCOC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])CCc1nc2c(s1)CN(C(=O)N[C@@H]1CCOC1)C2 | O=C([O-])CCNC(=O)N[C@@H]1CCOC1 | O=C([O-])CCc1nc2c(s1)CN(C(=O)N[C@@H]1CCOC1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N24"
} |
Can you make molecule O=C([O-])CCNC(=O)N[C@@H]1CCOC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])CCn1ncc2c1CN(C(=O)N[C@@H]1CCOC1)C2 | O=C([O-])CCNC(=O)N[C@@H]1CCOC1 | O=C([O-])CCn1ncc2c1CN(C(=O)N[C@@H]1CCOC1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2cnn&c2C1",
"old_substring": "N24"
} |
Can you make molecule O=C([O-])CCNC(=O)N[C@@H]1CCOC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])CCc1onc2c1CN(C(=O)N[C@@H]1CCOC1)CC2 | O=C([O-])CCNC(=O)N[C@@H]1CCOC1 | O=C([O-])CCc1onc2c1CN(C(=O)N[C@@H]1CCOC1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N24"
} |
Can you make molecule O=C([O-])CCNC(=O)N[C@@H]1CCOC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])CCc1cc2n(n1)CCCN2C(=O)N[C@@H]1CCOC1 | O=C([O-])CCNC(=O)N[C@@H]1CCOC1 | O=C([O-])CCc1cc2n(n1)CCCN2C(=O)N[C@@H]1CCOC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc21",
"old_substring": "N24"
} |
Can you make molecule O=C([O-])CCNC(=O)N[C@@H]1CCOC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])CCc1ccc2c(c1)CCN2C(=O)N[C@@H]1CCOC1 | O=C([O-])CCNC(=O)N[C@@H]1CCOC1 | O=C([O-])CCc1ccc2c(c1)CCN2C(=O)N[C@@H]1CCOC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N24"
} |
Can you make molecule Cc1cccc(NC(=O)CN(C[C@@H]2CCCO2)C(=O)Cc2ccccc2Cl)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NSC(=O)CN(C[C@@H]2CCCO2)C(=O)Cc2ccccc2Cl)c1C | Cc1cccc(NC(=O)CN(C[C@@H]2CCCO2)C(=O)Cc2ccccc2Cl)c1C | Cc1cccc(NSC(=O)CN(C[C@@H]2CCCO2)C(=O)Cc2ccccc2Cl)c1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C5"
} |
Can you make molecule Cc1cccc(NC(=O)CN(C[C@@H]2CCCO2)C(=O)Cc2ccccc2Cl)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)CCCC(=O)N(C[C@@H]2CCCO2)C(=O)Cc2ccccc2Cl)c1C | Cc1cccc(NC(=O)CN(C[C@@H]2CCCO2)C(=O)Cc2ccccc2Cl)c1C | Cc1cccc(NC(=O)CCCC(=O)N(C[C@@H]2CCCO2)C(=O)Cc2ccccc2Cl)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C5"
} |
Can you make molecule Cc1cccc(NC(=O)CN(C[C@@H]2CCCO2)C(=O)Cc2ccccc2Cl)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)CC(C)(C)N(C[C@@H]2CCCO2)C(=O)Cc2ccccc2Cl)c1C | Cc1cccc(NC(=O)CN(C[C@@H]2CCCO2)C(=O)Cc2ccccc2Cl)c1C | Cc1cccc(NC(=O)CC(C)(C)N(C[C@@H]2CCCO2)C(=O)Cc2ccccc2Cl)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C5"
} |
Can you make molecule Cc1cccc(NC(=O)CN(C[C@@H]2CCCO2)C(=O)Cc2ccccc2Cl)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC[S@+]([O-])CCCN(C[C@@H]2CCCO2)C(=O)Cc2ccccc2Cl)c1C | Cc1cccc(NC(=O)CN(C[C@@H]2CCCO2)C(=O)Cc2ccccc2Cl)c1C | Cc1cccc(NC[S@+]([O-])CCCN(C[C@@H]2CCCO2)C(=O)Cc2ccccc2Cl)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C5"
} |
Can you make molecule Cc1cccc(NC(=O)CN(C[C@@H]2CCCO2)C(=O)Cc2ccccc2Cl)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)CCC(C)(C)N(C[C@@H]2CCCO2)C(=O)Cc2ccccc2Cl)c1C | Cc1cccc(NC(=O)CN(C[C@@H]2CCCO2)C(=O)Cc2ccccc2Cl)c1C | Cc1cccc(NC(=O)CCC(C)(C)N(C[C@@H]2CCCO2)C(=O)Cc2ccccc2Cl)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C5"
} |
Can you make molecule O=C1C[C@H](c2ccccc2C(F)(F)F)[C@H]2C(=O)N=C(c3ccccc3)N=C2N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H](c2ccc(C(F)(F)F)cc2I)[C@H]2C(=O)N=C(c3ccccc3)N=C2N1 | O=C1C[C@H](c2ccccc2C(F)(F)F)[C@H]2C(=O)N=C(c3ccccc3)N=C2N1 | O=C1C[C@H](c2ccc(C(F)(F)F)cc2I)[C@H]2C(=O)N=C(c3ccccc3)N=C2N1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15ccccc14"
} |
Can you make molecule O=C1C[C@H](c2ccccc2C(F)(F)F)[C@H]2C(=O)N=C(c3ccccc3)N=C2N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H](c2cc(C(F)(F)F)ccc2Br)[C@H]2C(=O)N=C(c3ccccc3)N=C2N1 | O=C1C[C@H](c2ccccc2C(F)(F)F)[C@H]2C(=O)N=C(c3ccccc3)N=C2N1 | O=C1C[C@H](c2cc(C(F)(F)F)ccc2Br)[C@H]2C(=O)N=C(c3ccccc3)N=C2N1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15ccccc14"
} |
Can you make molecule O=C1C[C@H](c2ccccc2C(F)(F)F)[C@H]2C(=O)N=C(c3ccccc3)N=C2N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H](c2ccc(C(F)(F)F)cc2Cl)[C@H]2C(=O)N=C(c3ccccc3)N=C2N1 | O=C1C[C@H](c2ccccc2C(F)(F)F)[C@H]2C(=O)N=C(c3ccccc3)N=C2N1 | O=C1C[C@H](c2ccc(C(F)(F)F)cc2Cl)[C@H]2C(=O)N=C(c3ccccc3)N=C2N1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15ccccc14"
} |
Can you make molecule O=C1C[C@H](c2ccccc2C(F)(F)F)[C@H]2C(=O)N=C(c3ccccc3)N=C2N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H](c2cccc(C(F)(F)F)c2Br)[C@H]2C(=O)N=C(c3ccccc3)N=C2N1 | O=C1C[C@H](c2ccccc2C(F)(F)F)[C@H]2C(=O)N=C(c3ccccc3)N=C2N1 | O=C1C[C@H](c2cccc(C(F)(F)F)c2Br)[C@H]2C(=O)N=C(c3ccccc3)N=C2N1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15ccccc14"
} |
Can you make molecule O=C1C[C@H](c2ccccc2C(F)(F)F)[C@H]2C(=O)N=C(c3ccccc3)N=C2N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H](c2cccc(C(F)(F)F)c2Cl)[C@H]2C(=O)N=C(c3ccccc3)N=C2N1 | O=C1C[C@H](c2ccccc2C(F)(F)F)[C@H]2C(=O)N=C(c3ccccc3)N=C2N1 | O=C1C[C@H](c2cccc(C(F)(F)F)c2Cl)[C@H]2C(=O)N=C(c3ccccc3)N=C2N1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15ccccc14"
} |
Can you make molecule C[C@H](NC(=O)c1cc(-c2ccco2)[nH]n1)c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1ccc(Cl)s1)NC(=O)c1cc(-c2ccco2)[nH]n1 | C[C@H](NC(=O)c1cc(-c2ccco2)[nH]n1)c1ccc(Cl)s1 | C[C@H](CC(C)(C)c1ccc(Cl)s1)NC(=O)c1cc(-c2ccco2)[nH]n1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@H]46"
} |
Can you make molecule C[C@H](NC(=O)c1cc(-c2ccco2)[nH]n1)c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCNC(=O)c1cc(-c2ccco2)[nH]n1)CC(=O)c1ccc(Cl)s1 | C[C@H](NC(=O)c1cc(-c2ccco2)[nH]n1)c1ccc(Cl)s1 | C[C@H](CCNC(=O)c1cc(-c2ccco2)[nH]n1)CC(=O)c1ccc(Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@H]46"
} |
Can you make molecule C[C@H](NC(=O)c1cc(-c2ccco2)[nH]n1)c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1ccc(Cl)s1)[C@H](C)NC(=O)c1cc(-c2ccco2)[nH]n1 | C[C@H](NC(=O)c1cc(-c2ccco2)[nH]n1)c1ccc(Cl)s1 | C[C@H](Cc1ccc(Cl)s1)[C@H](C)NC(=O)c1cc(-c2ccco2)[nH]n1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "C[C@H]46"
} |
Can you make molecule C[C@H](NC(=O)c1cc(-c2ccco2)[nH]n1)c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNC(=O)c1cc(-c2ccco2)[nH]n1)CC(=O)c1ccc(Cl)s1 | C[C@H](NC(=O)c1cc(-c2ccco2)[nH]n1)c1ccc(Cl)s1 | C[C@@H](CCNC(=O)c1cc(-c2ccco2)[nH]n1)CC(=O)c1ccc(Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@H]46"
} |
Can you make molecule C[C@H](NC(=O)c1cc(-c2ccco2)[nH]n1)c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1ccc(Cl)s1)NC(=O)c1cc(-c2ccco2)[nH]n1 | C[C@H](NC(=O)c1cc(-c2ccco2)[nH]n1)c1ccc(Cl)s1 | CCC[C@@H](CCc1ccc(Cl)s1)NC(=O)c1cc(-c2ccco2)[nH]n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C[C@H]46"
} |
Can you make molecule C[C@H]1CCCCN1c1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1N less soluble in water? The output molecule should be similar to the input molecule. | C[C@]1(c2ncnc(N(Cc3ccccc3)Cc3ccccc3)c2N)CCCS1 | C[C@H]1CCCCN1c1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1N | C[C@]1(c2ncnc(N(Cc3ccccc3)Cc3ccccc3)c2N)CCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@]1&CCCS1",
"old_substring": "C[C@H]1CCCCN15"
} |
Can you make molecule C[C@H]1CCCCN1c1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1N less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C1=CCCCC1)c1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1N | C[C@H]1CCCCN1c1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1N | C[C@@H](C1=CCCCC1)c1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&C1=CCCCC1",
"old_substring": "C[C@H]1CCCCN15"
} |
Can you make molecule C[C@H]1CCCCN1c1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1N less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC=CC[C@H]1c1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1N | C[C@H]1CCCCN1c1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1N | C[C@H]1CC=CC[C@H]1c1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CC=CC[C@H]1&",
"old_substring": "C[C@H]1CCCCN15"
} |
Can you make molecule C[C@H]1CCCCN1c1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1N less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1SCCC[C@@H]1c1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1N | C[C@H]1CCCCN1c1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1N | C[C@H]1SCCC[C@@H]1c1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1SCCC[C@@H]1&",
"old_substring": "C[C@H]1CCCCN15"
} |
Can you make molecule C[C@H]1CCCCN1c1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1N less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCCCl)c1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1N | C[C@H]1CCCCN1c1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1N | C[C@H](CCCCl)c1ncnc(N(Cc2ccccc2)Cc2ccccc2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CCCCl",
"old_substring": "C[C@H]1CCCCN15"
} |
Can you make molecule Cc1nc(C2CCCC2)sc1-c1nc(-c2ccc(C#N)cn2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C2CCCC2)sc1-c1nc(-c2ccc(C#N)cn2)co1 | Cc1nc(C2CCCC2)sc1-c1nc(-c2ccc(C#N)cn2)no1 | Cc1nc(C2CCCC2)sc1-c1nc(-c2ccc(C#N)cn2)co1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&co1",
"old_substring": "c13nc4no1"
} |
Can you make molecule Cc1nc(C2CCCC2)sc1-c1nc(-c2ccc(C#N)cn2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C2CCCC2)sc1-c1ncnc(-c2ccc(C#N)cn2)c1C | Cc1nc(C2CCCC2)sc1-c1nc(-c2ccc(C#N)cn2)no1 | Cc1nc(C2CCCC2)sc1-c1ncnc(-c2ccc(C#N)cn2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1C",
"old_substring": "c13nc4no1"
} |
Can you make molecule Cc1nc(C2CCCC2)sc1-c1nc(-c2ccc(C#N)cn2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(-c2ccc(C#N)cn2)nc1-c1sc(C2CCCC2)nc1C | Cc1nc(C2CCCC2)sc1-c1nc(-c2ccc(C#N)cn2)no1 | Cc1cnc(-c2ccc(C#N)cn2)nc1-c1sc(C2CCCC2)nc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1C",
"old_substring": "c13nc4no1"
} |
Can you make molecule Cc1nc(C2CCCC2)sc1-c1nc(-c2ccc(C#N)cn2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C2CCCC2)sc1-c1ncnc(-c2ccc(C#N)cn2)c1F | Cc1nc(C2CCCC2)sc1-c1nc(-c2ccc(C#N)cn2)no1 | Cc1nc(C2CCCC2)sc1-c1ncnc(-c2ccc(C#N)cn2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1F",
"old_substring": "c13nc4no1"
} |
Can you make molecule Cc1nc(C2CCCC2)sc1-c1nc(-c2ccc(C#N)cn2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C2CCCC2)sc1-c1nc(-c2ccc(C#N)cn2)ncc1I | Cc1nc(C2CCCC2)sc1-c1nc(-c2ccc(C#N)cn2)no1 | Cc1nc(C2CCCC2)sc1-c1nc(-c2ccc(C#N)cn2)ncc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1I",
"old_substring": "c13nc4no1"
} |
Can you make molecule Cc1ccc(-n2ncc(C(=O)N3CC[C@@H](C)[C@H](O)C3)c2C2CC2)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2ncc(CC(=O)SN3CC[C@@H](C)[C@H](O)C3)c2C2CC2)cc1Cl | Cc1ccc(-n2ncc(C(=O)N3CC[C@@H](C)[C@H](O)C3)c2C2CC2)cc1Cl | Cc1ccc(-n2ncc(CC(=O)SN3CC[C@@H](C)[C@H](O)C3)c2C2CC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C45=O"
} |
Can you make molecule Cc1ccc(-n2ncc(C(=O)N3CC[C@@H](C)[C@H](O)C3)c2C2CC2)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2ncc(C(=O)CCCC(=O)N3CC[C@@H](C)[C@H](O)C3)c2C2CC2)cc1Cl | Cc1ccc(-n2ncc(C(=O)N3CC[C@@H](C)[C@H](O)C3)c2C2CC2)cc1Cl | Cc1ccc(-n2ncc(C(=O)CCCC(=O)N3CC[C@@H](C)[C@H](O)C3)c2C2CC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C45=O"
} |
Can you make molecule Cc1ccc(-n2ncc(C(=O)N3CC[C@@H](C)[C@H](O)C3)c2C2CC2)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2ncc(C(C)(C)CC(=O)N3CC[C@@H](C)[C@H](O)C3)c2C2CC2)cc1Cl | Cc1ccc(-n2ncc(C(=O)N3CC[C@@H](C)[C@H](O)C3)c2C2CC2)cc1Cl | Cc1ccc(-n2ncc(C(C)(C)CC(=O)N3CC[C@@H](C)[C@H](O)C3)c2C2CC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1ccc(-n2ncc(C(=O)N3CC[C@@H](C)[C@H](O)C3)c2C2CC2)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2ncc(C(C)(C)CCC(=O)N3CC[C@@H](C)[C@H](O)C3)c2C2CC2)cc1Cl | Cc1ccc(-n2ncc(C(=O)N3CC[C@@H](C)[C@H](O)C3)c2C2CC2)cc1Cl | Cc1ccc(-n2ncc(C(C)(C)CCC(=O)N3CC[C@@H](C)[C@H](O)C3)c2C2CC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1ccc(-n2ncc(C(=O)N3CC[C@@H](C)[C@H](O)C3)c2C2CC2)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2ncc([C@H](C)C(=O)SN3CC[C@@H](C)[C@H](O)C3)c2C2CC2)cc1Cl | Cc1ccc(-n2ncc(C(=O)N3CC[C@@H](C)[C@H](O)C3)c2C2CC2)cc1Cl | Cc1ccc(-n2ncc([C@H](C)C(=O)SN3CC[C@@H](C)[C@H](O)C3)c2C2CC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C45=O"
} |
Can you make molecule NC(=O)c1c(F)cccc1Nc1cccc(N)c1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)CCCc1c(F)cccc1Nc1cccc(N)c1 | NC(=O)c1c(F)cccc1Nc1cccc(N)c1 | NC(=O)CCCc1c(F)cccc1Nc1cccc(N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "NC(=O)CCC&",
"old_substring": "NC4=O"
} |
Can you make molecule NC(=O)c1c(F)cccc1Nc1cccc(N)c1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1cccc(Nc2cccc(F)c2N2CCCC(=O)C2)c1 | NC(=O)c1c(F)cccc1Nc1cccc(N)c1 | Nc1cccc(Nc2cccc(F)c2N2CCCC(=O)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(=O)C1",
"old_substring": "NC4=O"
} |
Can you make molecule NC(=O)c1c(F)cccc1Nc1cccc(N)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)c1c(F)cccc1Nc1cccc(N)c1 | NC(=O)c1c(F)cccc1Nc1cccc(N)c1 | CCC(=O)c1c(F)cccc1Nc1cccc(N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&=O",
"old_substring": "NC4=O"
} |
Can you make molecule NC(=O)c1c(F)cccc1Nc1cccc(N)c1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1cccc(Nc2cccc(F)c2N2CCC(C=O)CC2)c1 | NC(=O)c1c(F)cccc1Nc1cccc(N)c1 | Nc1cccc(Nc2cccc(F)c2N2CCC(C=O)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C=O)CC1",
"old_substring": "NC4=O"
} |
Can you make molecule NC(=O)c1c(F)cccc1Nc1cccc(N)c1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1cccc(Nc2cccc(F)c2N2C(=O)CSC2=S)c1 | NC(=O)c1c(F)cccc1Nc1cccc(N)c1 | Nc1cccc(Nc2cccc(F)c2N2C(=O)CSC2=S)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&C(=O)CSC1=S",
"old_substring": "NC4=O"
} |
Can you make molecule CC(=O)N1CN(CCC2=CCCCC2)Cc2c1sc1c2CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N1CN(C2CCCCCCCCCCC2)Cc2c1sc1c2CCCC1 | CC(=O)N1CN(CCC2=CCCCC2)Cc2c1sc1c2CCCC1 | CC(=O)N1CN(C2CCCCCCCCCCC2)Cc2c1sc1c2CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCCCCCC1",
"old_substring": "C4CC1=CCCCC1"
} |
Can you make molecule CC(=O)N1CN(CCC2=CCCCC2)Cc2c1sc1c2CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N1CN(SC2=CCCCCC2)Cc2c1sc1c2CCCC1 | CC(=O)N1CN(CCC2=CCCCC2)Cc2c1sc1c2CCCC1 | CC(=O)N1CN(SC2=CCCCCC2)Cc2c1sc1c2CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C4CC1=CCCCC1"
} |
Can you make molecule CC(=O)N1CN(CCC2=CCCCC2)Cc2c1sc1c2CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCC(C)(C)CN1Cc2c(sc3c2CCCC3)N(C(C)=O)C1 | CC(=O)N1CN(CCC2=CCCCC2)Cc2c1sc1c2CCCC1 | CCCCCC(C)(C)CN1Cc2c(sc3c2CCCC3)N(C(C)=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCC(C)(C)C&",
"old_substring": "C4CC1=CCCCC1"
} |
Can you make molecule CC(=O)N1CN(CCC2=CCCCC2)Cc2c1sc1c2CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(CBr)(CCC)CN1Cc2c(sc3c2CCCC3)N(C(C)=O)C1 | CC(=O)N1CN(CCC2=CCCCC2)Cc2c1sc1c2CCCC1 | CCCC(CBr)(CCC)CN1Cc2c(sc3c2CCCC3)N(C(C)=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC(C&)(CBr)CCC",
"old_substring": "C4CC1=CCCCC1"
} |
Can you make molecule CC(=O)N1CN(CCC2=CCCCC2)Cc2c1sc1c2CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N1CN([C@H](CBr)CCC(C)(C)C)Cc2c1sc1c2CCCC1 | CC(=O)N1CN(CCC2=CCCCC2)Cc2c1sc1c2CCCC1 | CC(=O)N1CN([C@H](CBr)CCC(C)(C)C)Cc2c1sc1c2CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)CC[C@H]&CBr",
"old_substring": "C4CC1=CCCCC1"
} |
Can you make molecule O=C([O-])c1ccccc1/C=N/n1cnnc1SCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccccc1/C=N/n1cnnc1C1=CC=C2SCCN2C(Cc2ccccc2)=C1 | O=C([O-])c1ccccc1/C=N/n1cnnc1SCc1ccccc1 | O=C([O-])c1ccccc1/C=N/n1cnnc1C1=CC=C2SCCN2C(Cc2ccccc2)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "S25"
} |
Can you make molecule O=C([O-])c1ccccc1/C=N/n1cnnc1SCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccccc1/C=N/n1cnnc1SCSCc1ccccc1 | O=C([O-])c1ccccc1/C=N/n1cnnc1SCc1ccccc1 | O=C([O-])c1ccccc1/C=N/n1cnnc1SCSCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&CS&",
"old_substring": "S25"
} |
Can you make molecule O=C([O-])c1ccccc1/C=N/n1cnnc1SCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccccc1/C=N/n1cnnc1-n1cc2cc-2sc(Cc2ccccc2)c1 | O=C([O-])c1ccccc1/C=N/n1cnnc1SCc1ccccc1 | O=C([O-])c1ccccc1/C=N/n1cnnc1-n1cc2cc-2sc(Cc2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cn&cc2s1",
"old_substring": "S25"
} |
Can you make molecule O=C([O-])c1ccccc1/C=N/n1cnnc1SCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccccc1/C=N/n1cnnc1-c1ccc(Cc2ccccc2)n2ccc-2c1 | O=C([O-])c1ccccc1/C=N/n1cnnc1SCc1ccccc1 | O=C([O-])c1ccccc1/C=N/n1cnnc1-c1ccc(Cc2ccccc2)n2ccc-2c1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccc2cc&ccc21",
"old_substring": "S25"
} |
Can you make molecule O=C([O-])c1ccccc1/C=N/n1cnnc1SCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccccc1/C=N/n1cnnc1-c1nc(Cc2ccccc2)cc2ccc-2s1 | O=C([O-])c1ccccc1/C=N/n1cnnc1SCc1ccccc1 | O=C([O-])c1ccccc1/C=N/n1cnnc1-c1nc(Cc2ccccc2)cc2ccc-2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2sc&nc2c1",
"old_substring": "S25"
} |
Can you make molecule CC[NH2+]Cc1cnn(-c2ccc(Cl)c(F)c2)c1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CS[NH2+]Cc1cnn(-c2ccc(Cl)c(F)c2)c1C1CC1 | CC[NH2+]Cc1cnn(-c2ccc(Cl)c(F)c2)c1C1CC1 | C=CS[NH2+]Cc1cnn(-c2ccc(Cl)c(F)c2)c1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CC[NH2+]Cc1cnn(-c2ccc(Cl)c(F)c2)c1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[NH2+]Cc1cnn(-c2ccc(Cl)c(F)c2)c1C1CC1 | CC[NH2+]Cc1cnn(-c2ccc(Cl)c(F)c2)c1C1CC1 | C=CCC[NH2+]Cc1cnn(-c2ccc(Cl)c(F)c2)c1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CC[NH2+]Cc1cnn(-c2ccc(Cl)c(F)c2)c1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cc(-n2ncc(C[NH2+]CCCCl)c2C2CC2)ccc1Cl | CC[NH2+]Cc1cnn(-c2ccc(Cl)c(F)c2)c1C1CC1 | Fc1cc(-n2ncc(C[NH2+]CCCCl)c2C2CC2)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CC[NH2+]Cc1cnn(-c2ccc(Cl)c(F)c2)c1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cc(-n2ncc(C[NH2+]CCCCS)c2C2CC2)ccc1Cl | CC[NH2+]Cc1cnn(-c2ccc(Cl)c(F)c2)c1C1CC1 | Fc1cc(-n2ncc(C[NH2+]CCCCS)c2C2CC2)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule CC[NH2+]Cc1cnn(-c2ccc(Cl)c(F)c2)c1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cc(-n2ncc(C[NH2+]CCCBr)c2C2CC2)ccc1Cl | CC[NH2+]Cc1cnn(-c2ccc(Cl)c(F)c2)c1C1CC1 | Fc1cc(-n2ncc(C[NH2+]CCCBr)c2C2CC2)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3"
} |
Can you make molecule CC1(C)Cc2occc2[C@@H]([NH2+]Cc2ccc(COC3CCOCC3)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)Cc2occc2[C@@H]([NH2+]CCCCc2ccc(COC3CCOCC3)cc2)C1 | CC1(C)Cc2occc2[C@@H]([NH2+]Cc2ccc(COC3CCOCC3)cc2)C1 | CC1(C)Cc2occc2[C@@H]([NH2+]CCCCc2ccc(COC3CCOCC3)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C67"
} |
Can you make molecule CC1(C)Cc2occc2[C@@H]([NH2+]Cc2ccc(COC3CCOCC3)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)Cc2occc2[C@@H]([NH2+]CCCCCc2ccc(COC3CCOCC3)cc2)C1 | CC1(C)Cc2occc2[C@@H]([NH2+]Cc2ccc(COC3CCOCC3)cc2)C1 | CC1(C)Cc2occc2[C@@H]([NH2+]CCCCCc2ccc(COC3CCOCC3)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C67"
} |
Can you make molecule CC1(C)Cc2occc2[C@@H]([NH2+]Cc2ccc(COC3CCOCC3)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)Cc2occc2[C@@H]([NH2+]C2CC(c3ccc(COC4CCOCC4)cc3)C2)C1 | CC1(C)Cc2occc2[C@@H]([NH2+]Cc2ccc(COC3CCOCC3)cc2)C1 | CC1(C)Cc2occc2[C@@H]([NH2+]C2CC(c3ccc(COC4CCOCC4)cc3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C67"
} |
Can you make molecule CC1(C)Cc2occc2[C@@H]([NH2+]Cc2ccc(COC3CCOCC3)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)Cc2occc2[C@@H]([NH2+]OC(=S)Sc2ccc(COC3CCOCC3)cc2)C1 | CC1(C)Cc2occc2[C@@H]([NH2+]Cc2ccc(COC3CCOCC3)cc2)C1 | CC1(C)Cc2occc2[C@@H]([NH2+]OC(=S)Sc2ccc(COC3CCOCC3)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C67"
} |
Can you make molecule CC1(C)Cc2occc2[C@@H]([NH2+]Cc2ccc(COC3CCOCC3)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)Cc2occc2[C@@H]([NH2+]SC(=S)Nc2ccc(COC3CCOCC3)cc2)C1 | CC1(C)Cc2occc2[C@@H]([NH2+]Cc2ccc(COC3CCOCC3)cc2)C1 | CC1(C)Cc2occc2[C@@H]([NH2+]SC(=S)Nc2ccc(COC3CCOCC3)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C67"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.