prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CN(c1ncncc1N)[C@H]1CCSC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(c1ncncc1N)[C@@H]1CCSS1 | CN(c1ncncc1N)[C@H]1CCSC1 | CN(c1ncncc1N)[C@@H]1CCSS1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCSS1",
"old_substring": "[C@H]13CCSC1"
} |
Can you make molecule CN(c1ncncc1N)[C@H]1CCSC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(c1ncncc1N)[C@H]1CCCC1(C)C | CN(c1ncncc1N)[C@H]1CCSC1 | CN(c1ncncc1N)[C@H]1CCCC1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC1(C)C",
"old_substring": "[C@H]13CCSC1"
} |
Can you make molecule CN(c1ncncc1N)[C@H]1CCSC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(c1ncncc1N)[C@H]1CCC=CCCC1 | CN(c1ncncc1N)[C@H]1CCSC1 | CN(c1ncncc1N)[C@H]1CCC=CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC=CCCC1",
"old_substring": "[C@H]13CCSC1"
} |
Can you make molecule CN(c1ncncc1N)[C@H]1CCSC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(c1ncncc1N)[C@H]1CC=CC=C1Cl | CN(c1ncncc1N)[C@H]1CCSC1 | CN(c1ncncc1N)[C@H]1CC=CC=C1Cl | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC=CC=C1Cl",
"old_substring": "[C@H]13CCSC1"
} |
Can you make molecule CN(c1ncncc1N)[C@H]1CCSC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C)[C@@H](N(C)c2ncncc2N)N=N1 | CN(c1ncncc1N)[C@H]1CCSC1 | CC1=C(C)[C@@H](N(C)c2ncncc2N)N=N1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&N=NC(C)=C1C",
"old_substring": "[C@H]13CCSC1"
} |
Can you make molecule CCn1c(C[NH2+][C@@H]2CCCc3c2cnn3C)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C=CSn1c(C[NH2+][C@@H]2CCCc3c2cnn3C)nc2ccccc21 | CCn1c(C[NH2+][C@@H]2CCCc3c2cnn3C)nc2ccccc21 | C=CSn1c(C[NH2+][C@@H]2CCCc3c2cnn3C)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC5"
} |
Can you make molecule CCn1c(C[NH2+][C@@H]2CCCc3c2cnn3C)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)n1c(C[NH2+][C@@H]2CCCc3c2cnn3C)nc2ccccc21 | CCn1c(C[NH2+][C@@H]2CCCc3c2cnn3C)nc2ccccc21 | CC(C)n1c(C[NH2+][C@@H]2CCCc3c2cnn3C)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC5"
} |
Can you make molecule CCn1c(C[NH2+][C@@H]2CCCc3c2cnn3C)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCn1c(C[NH2+][C@@H]2CCCc3c2cnn3C)nc2ccccc21 | CCn1c(C[NH2+][C@@H]2CCCc3c2cnn3C)nc2ccccc21 | C=CCCn1c(C[NH2+][C@@H]2CCCc3c2cnn3C)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CCn1c(C[NH2+][C@@H]2CCCc3c2cnn3C)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncc2c1CCC[C@H]2[NH2+]Cc1nc2ccccc2n1CCCCl | CCn1c(C[NH2+][C@@H]2CCCc3c2cnn3C)nc2ccccc21 | Cn1ncc2c1CCC[C@H]2[NH2+]Cc1nc2ccccc2n1CCCCl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC5"
} |
Can you make molecule CCn1c(C[NH2+][C@@H]2CCCc3c2cnn3C)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncc2c1CCC[C@H]2[NH2+]Cc1nc2ccccc2n1CCCCS | CCn1c(C[NH2+][C@@H]2CCCc3c2cnn3C)nc2ccccc21 | Cn1ncc2c1CCC[C@H]2[NH2+]Cc1nc2ccccc2n1CCCCS | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC5"
} |
Can you make molecule CC[C@H](C#N)NCCCC(=O)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C#N)NCSCCCC(=O)NC1CC1 | CC[C@H](C#N)NCCCC(=O)NC1CC1 | CC[C@H](C#N)NCSCCCC(=O)NC1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N34"
} |
Can you make molecule CC[C@H](C#N)NCCCC(=O)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C#N)N1CC(CCCC(=O)NC2CC2)C1 | CC[C@H](C#N)NCCCC(=O)NC1CC1 | CC[C@H](C#N)N1CC(CCCC(=O)NC2CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N34"
} |
Can you make molecule CC[C@H](C#N)NCCCC(=O)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C#N)NC(=N)SCCCC(=O)NC1CC1 | CC[C@H](C#N)NCCCC(=O)NC1CC1 | CC[C@H](C#N)NC(=N)SCCCC(=O)NC1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N34"
} |
Can you make molecule CC[C@H](C#N)NCCCC(=O)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C#N)c1nsc(CCCC(=O)NC2CC2)c1N | CC[C@H](C#N)NCCCC(=O)NC1CC1 | CC[C@H](C#N)c1nsc(CCCC(=O)NC2CC2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N34"
} |
Can you make molecule CC[C@H](C#N)NCCCC(=O)NC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C#N)N(C)C(=S)SCCCC(=O)NC1CC1 | CC[C@H](C#N)NCCCC(=O)NC1CC1 | CC[C@H](C#N)N(C)C(=S)SCCCC(=O)NC1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N34"
} |
Can you make molecule CC1CCN(C(=O)c2cccc(NC(=O)c3ccccc3OC(C)C)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(SC(=O)Cc2cccc(NC(=O)c3ccccc3OC(C)C)c2)CC1 | CC1CCN(C(=O)c2cccc(NC(=O)c3ccccc3OC(C)C)c2)CC1 | CC1CCN(SC(=O)Cc2cccc(NC(=O)c3ccccc3OC(C)C)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C49=O"
} |
Can you make molecule CC1CCN(C(=O)c2cccc(NC(=O)c3ccccc3OC(C)C)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(C(=O)CCCC(=O)c2cccc(NC(=O)c3ccccc3OC(C)C)c2)CC1 | CC1CCN(C(=O)c2cccc(NC(=O)c3ccccc3OC(C)C)c2)CC1 | CC1CCN(C(=O)CCCC(=O)c2cccc(NC(=O)c3ccccc3OC(C)C)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C49=O"
} |
Can you make molecule CC1CCN(C(=O)c2cccc(NC(=O)c3ccccc3OC(C)C)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(C(=O)CC(C)(C)c2cccc(NC(=O)c3ccccc3OC(C)C)c2)CC1 | CC1CCN(C(=O)c2cccc(NC(=O)c3ccccc3OC(C)C)c2)CC1 | CC1CCN(C(=O)CC(C)(C)c2cccc(NC(=O)c3ccccc3OC(C)C)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C49=O"
} |
Can you make molecule CC1CCN(C(=O)c2cccc(NC(=O)c3ccccc3OC(C)C)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(C(=O)CCC(C)(C)c2cccc(NC(=O)c3ccccc3OC(C)C)c2)CC1 | CC1CCN(C(=O)c2cccc(NC(=O)c3ccccc3OC(C)C)c2)CC1 | CC1CCN(C(=O)CCC(C)(C)c2cccc(NC(=O)c3ccccc3OC(C)C)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C49=O"
} |
Can you make molecule CC1CCN(C(=O)c2cccc(NC(=O)c3ccccc3OC(C)C)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(SC(=O)[C@@H](C)c2cccc(NC(=O)c3ccccc3OC(C)C)c2)CC1 | CC1CCN(C(=O)c2cccc(NC(=O)c3ccccc3OC(C)C)c2)CC1 | CC1CCN(SC(=O)[C@@H](C)c2cccc(NC(=O)c3ccccc3OC(C)C)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C49=O"
} |
Can you make molecule CS(=O)(=O)Oc1ccc(CN(C[C@H]2CCCO2)C(=O)Nc2cccc(F)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)Oc1ccc(CN(C[C@H]2CCCOCC2)C(=O)Nc2cccc(F)c2)cc1 | CS(=O)(=O)Oc1ccc(CN(C[C@H]2CCCO2)C(=O)Nc2cccc(F)c2)cc1 | CS(=O)(=O)Oc1ccc(CN(C[C@H]2CCCOCC2)C(=O)Nc2cccc(F)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCOCC1",
"old_substring": "[C@H]19CCCO1"
} |
Can you make molecule CS(=O)(=O)Oc1ccc(CN(C[C@H]2CCCO2)C(=O)Nc2cccc(F)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)Oc1ccc(CN(C[C@H]2CSCCS2)C(=O)Nc2cccc(F)c2)cc1 | CS(=O)(=O)Oc1ccc(CN(C[C@H]2CCCO2)C(=O)Nc2cccc(F)c2)cc1 | CS(=O)(=O)Oc1ccc(CN(C[C@H]2CSCCS2)C(=O)Nc2cccc(F)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CSCCS1",
"old_substring": "[C@H]19CCCO1"
} |
Can you make molecule CS(=O)(=O)Oc1ccc(CN(C[C@H]2CCCO2)C(=O)Nc2cccc(F)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)Oc1ccc(CN(C[C@H]2CC=CS2)C(=O)Nc2cccc(F)c2)cc1 | CS(=O)(=O)Oc1ccc(CN(C[C@H]2CCCO2)C(=O)Nc2cccc(F)c2)cc1 | CS(=O)(=O)Oc1ccc(CN(C[C@H]2CC=CS2)C(=O)Nc2cccc(F)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC=CS1",
"old_substring": "[C@H]19CCCO1"
} |
Can you make molecule CS(=O)(=O)Oc1ccc(CN(C[C@H]2CCCO2)C(=O)Nc2cccc(F)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)Oc1ccc(CN(C[C@@H]2CCSC2)C(=O)Nc2cccc(F)c2)cc1 | CS(=O)(=O)Oc1ccc(CN(C[C@H]2CCCO2)C(=O)Nc2cccc(F)c2)cc1 | CS(=O)(=O)Oc1ccc(CN(C[C@@H]2CCSC2)C(=O)Nc2cccc(F)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCSC1",
"old_substring": "[C@H]19CCCO1"
} |
Can you make molecule CS(=O)(=O)Oc1ccc(CN(C[C@H]2CCCO2)C(=O)Nc2cccc(F)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)Oc1ccc(CN(C[C@H]2CC23CCOCC3)C(=O)Nc2cccc(F)c2)cc1 | CS(=O)(=O)Oc1ccc(CN(C[C@H]2CCCO2)C(=O)Nc2cccc(F)c2)cc1 | CS(=O)(=O)Oc1ccc(CN(C[C@H]2CC23CCOCC3)C(=O)Nc2cccc(F)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC12CCOCC2",
"old_substring": "[C@H]19CCCO1"
} |
Can you make molecule O=C([O-])C1([C@@H]2CCCC[C@H]2O)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])CCCC1([C@@H]2CCCC[C@H]2O)CCOCC1 | O=C([O-])C1([C@@H]2CCCC[C@H]2O)CCOCC1 | O=C([O-])CCCC1([C@@H]2CCCC[C@H]2O)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C([O-])CCC&",
"old_substring": "O=C3[O-]"
} |
Can you make molecule O=C([O-])C1([C@@H]2CCCC[C@H]2O)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])CCCCCC1([C@@H]2CCCC[C@H]2O)CCOCC1 | O=C([O-])C1([C@@H]2CCCC[C@H]2O)CCOCC1 | O=C([O-])CCCCCC1([C@@H]2CCCC[C@H]2O)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C([O-])CCCCC&",
"old_substring": "O=C3[O-]"
} |
Can you make molecule O=C([O-])C1([C@@H]2CCCC[C@H]2O)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])CCCC(=O)C1([C@@H]2CCCC[C@H]2O)CCOCC1 | O=C([O-])C1([C@@H]2CCCC[C@H]2O)CCOCC1 | O=C([O-])CCCC(=O)C1([C@@H]2CCCC[C@H]2O)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C([O-])CCCC&=O",
"old_substring": "O=C3[O-]"
} |
Can you make molecule O=C([O-])C1([C@@H]2CCCC[C@H]2O)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=COC1([C@@H]2CCCC[C@H]2O)CCOCC1 | O=C([O-])C1([C@@H]2CCCC[C@H]2O)CCOCC1 | O=COC1([C@@H]2CCCC[C@H]2O)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=CO&",
"old_substring": "O=C3[O-]"
} |
Can you make molecule O=C([O-])C1([C@@H]2CCCC[C@H]2O)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NO)C1([C@@H]2CCCC[C@H]2O)CCOCC1 | O=C([O-])C1([C@@H]2CCCC[C@H]2O)CCOCC1 | O=C(NO)C1([C@@H]2CCCC[C@H]2O)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NO",
"old_substring": "O=C3[O-]"
} |
Can you make molecule COCCN1CCN(C(=O)N[C@@H]2CCN(c3ccc(Cl)c(F)c3)C2)CC1=O less soluble in water? The output molecule should be similar to the input molecule. | COCCN1CCN(C(=O)N[C@@H]2CCN(c3ccc(Cl)c(Cl)c3)C2)CC1=O | COCCN1CCN(C(=O)N[C@@H]2CCN(c3ccc(Cl)c(F)c3)C2)CC1=O | COCCN1CCN(C(=O)N[C@@H]2CCN(c3ccc(Cl)c(Cl)c3)C2)CC1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c17ccc(Cl)c(F)c1"
} |
Can you make molecule COCCN1CCN(C(=O)N[C@@H]2CCN(c3ccc(Cl)c(F)c3)C2)CC1=O less soluble in water? The output molecule should be similar to the input molecule. | COCCN1CCN(C(=O)N[C@@H]2CCN(c3ccc(Cl)c(Br)c3)C2)CC1=O | COCCN1CCN(C(=O)N[C@@H]2CCN(c3ccc(Cl)c(F)c3)C2)CC1=O | COCCN1CCN(C(=O)N[C@@H]2CCN(c3ccc(Cl)c(Br)c3)C2)CC1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Br)c1",
"old_substring": "c17ccc(Cl)c(F)c1"
} |
Can you make molecule COCCN1CCN(C(=O)N[C@@H]2CCN(c3ccc(Cl)c(F)c3)C2)CC1=O less soluble in water? The output molecule should be similar to the input molecule. | COCCN1CCN(C(=O)N[C@@H]2CCN(c3ccc(Cl)c(Cl)c3Cl)C2)CC1=O | COCCN1CCN(C(=O)N[C@@H]2CCN(c3ccc(Cl)c(F)c3)C2)CC1=O | COCCN1CCN(C(=O)N[C@@H]2CCN(c3ccc(Cl)c(Cl)c3Cl)C2)CC1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1Cl",
"old_substring": "c17ccc(Cl)c(F)c1"
} |
Can you make molecule COCCN1CCN(C(=O)N[C@@H]2CCN(c3ccc(Cl)c(F)c3)C2)CC1=O less soluble in water? The output molecule should be similar to the input molecule. | COCCN1CCN(C(=O)N[C@@H]2CCN(c3ccc(Cl)cc3Br)C2)CC1=O | COCCN1CCN(C(=O)N[C@@H]2CCN(c3ccc(Cl)c(F)c3)C2)CC1=O | COCCN1CCN(C(=O)N[C@@H]2CCN(c3ccc(Cl)cc3Br)C2)CC1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c17ccc(Cl)c(F)c1"
} |
Can you make molecule COCCN1CCN(C(=O)N[C@@H]2CCN(c3ccc(Cl)c(F)c3)C2)CC1=O less soluble in water? The output molecule should be similar to the input molecule. | COCCN1CCN(C(=O)N[C@@H]2CCN(c3cc(F)c(Cl)cc3Cl)C2)CC1=O | COCCN1CCN(C(=O)N[C@@H]2CCN(c3ccc(Cl)c(F)c3)C2)CC1=O | COCCN1CCN(C(=O)N[C@@H]2CCN(c3cc(F)c(Cl)cc3Cl)C2)CC1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)c(Cl)cc1Cl",
"old_substring": "c17ccc(Cl)c(F)c1"
} |
Can you make molecule CC[C@H](CSC)N(C)C(=O)NCc1cccc2c1OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@](C)(CCSC)N(C)C(=O)NCc1cccc2c1OCCCO2 | CC[C@H](CSC)N(C)C(=O)NCc1cccc2c1OCCCO2 | CC[C@](C)(CCSC)N(C)C(=O)NCc1cccc2c1OCCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@]&(C)CC&",
"old_substring": "CC[C@@H]5C7"
} |
Can you make molecule CC[C@H](CSC)N(C)C(=O)NCc1cccc2c1OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CS[C@H]1CCC=C1CCN(C)C(=O)NCc1cccc2c1OCCCO2 | CC[C@H](CSC)N(C)C(=O)NCc1cccc2c1OCCCO2 | CS[C@H]1CCC=C1CCN(C)C(=O)NCc1cccc2c1OCCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCC[C@@H]1&",
"old_substring": "CC[C@@H]5C7"
} |
Can you make molecule CC[C@H](CSC)N(C)C(=O)NCc1cccc2c1OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CSC(C)(C)C[C@@H](C)N(C)C(=O)NCc1cccc2c1OCCCO2 | CC[C@H](CSC)N(C)C(=O)NCc1cccc2c1OCCCO2 | CSC(C)(C)C[C@@H](C)N(C)C(=O)NCc1cccc2c1OCCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "CC[C@@H]5C7"
} |
Can you make molecule CC[C@H](CSC)N(C)C(=O)NCc1cccc2c1OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CSCC[C@@H](C(C)C)N(C)C(=O)NCc1cccc2c1OCCCO2 | CC[C@H](CSC)N(C)C(=O)NCc1cccc2c1OCCCO2 | CSCC[C@@H](C(C)C)N(C)C(=O)NCc1cccc2c1OCCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "CC[C@@H]5C7"
} |
Can you make molecule CC[C@H](CSC)N(C)C(=O)NCc1cccc2c1OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CSCCC[C@@H](CCl)N(C)C(=O)NCc1cccc2c1OCCCO2 | CC[C@H](CSC)N(C)C(=O)NCc1cccc2c1OCCCO2 | CSCCC[C@@H](CCl)N(C)C(=O)NCc1cccc2c1OCCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "CC[C@@H]5C7"
} |
Can you make molecule Cc1cscc1C[NH2+]C[C@@H](O)C[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cscc1C1=CC=C([NH2+]C[C@@H](O)C[NH+]2CCCC2)N2CCC2=C1 | Cc1cscc1C[NH2+]C[C@@H](O)C[NH+]1CCCC1 | Cc1cscc1C1=CC=C([NH2+]C[C@@H](O)C[NH+]2CCCC2)N2CCC2=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "C25"
} |
Can you make molecule Cc1cscc1C[NH2+]C[C@@H](O)C[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cscc1-c1ncnc2sc-2c(C)c1[NH2+]C[C@@H](O)C[NH+]1CCCC1 | Cc1cscc1C[NH2+]C[C@@H](O)C[NH+]1CCCC1 | Cc1cscc1-c1ncnc2sc-2c(C)c1[NH2+]C[C@@H](O)C[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&sc2ncnc&c12",
"old_substring": "C25"
} |
Can you make molecule Cc1cscc1C[NH2+]C[C@@H](O)C[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cscc1C1=CC=C2SCCN2C([NH2+]C[C@@H](O)C[NH+]2CCCC2)=C1 | Cc1cscc1C[NH2+]C[C@@H](O)C[NH+]1CCCC1 | Cc1cscc1C1=CC=C2SCCN2C([NH2+]C[C@@H](O)C[NH+]2CCCC2)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "C25"
} |
Can you make molecule Cc1cscc1C[NH2+]C[C@@H](O)C[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cscc1C1=C2CCN2CC([NH2+]C[C@@H](O)C[NH+]2CCCC2)=CC=C1 | Cc1cscc1C[NH2+]C[C@@H](O)C[NH+]1CCCC1 | Cc1cscc1C1=C2CCN2CC([NH2+]C[C@@H](O)C[NH+]2CCCC2)=CC=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c&cccc2C1",
"old_substring": "C25"
} |
Can you make molecule Cc1cscc1C[NH2+]C[C@@H](O)C[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cscc1-c1ccc([NH2+]C[C@@H](O)C[NH+]2CCCC2)c(C)c2sc-2n1 | Cc1cscc1C[NH2+]C[C@@H](O)C[NH+]1CCCC1 | Cc1cscc1-c1ccc([NH2+]C[C@@H](O)C[NH+]2CCCC2)c(C)c2sc-2n1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&sc2nc&ccc12",
"old_substring": "C25"
} |
Can you make molecule CC(C)c1ccc(OC(=O)C[C@H]2CCCO2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C[C@H]1CCCO1)Oc1ccc(CCCCBr)cc1 | CC(C)c1ccc(OC(=O)C[C@H]2CCCO2)cc1 | O=C(C[C@H]1CCCO1)Oc1ccc(CCCCBr)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC6C"
} |
Can you make molecule CC(C)c1ccc(OC(=O)C[C@H]2CCCO2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCc1ccc(OC(=O)C[C@H]2CCCO2)cc1 | CC(C)c1ccc(OC(=O)C[C@H]2CCCO2)cc1 | C=CCCCCc1ccc(OC(=O)C[C@H]2CCCO2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CC6C"
} |
Can you make molecule CC(C)c1ccc(OC(=O)C[C@H]2CCCO2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C[C@H]1CCCO1)Oc1ccc(CCCCCBr)cc1 | CC(C)c1ccc(OC(=O)C[C@H]2CCCO2)cc1 | O=C(C[C@H]1CCCO1)Oc1ccc(CCCCCBr)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCBr",
"old_substring": "CC6C"
} |
Can you make molecule CC(C)c1ccc(OC(=O)C[C@H]2CCCO2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C[C@H]1CCCO1)Oc1ccc(CCCCCS)cc1 | CC(C)c1ccc(OC(=O)C[C@H]2CCCO2)cc1 | O=C(C[C@H]1CCCO1)Oc1ccc(CCCCCS)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCC&",
"old_substring": "CC6C"
} |
Can you make molecule CC(C)c1ccc(OC(=O)C[C@H]2CCCO2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C[C@H]1CCCO1)Oc1ccc(CCCCCCS)cc1 | CC(C)c1ccc(OC(=O)C[C@H]2CCCO2)cc1 | O=C(C[C@H]1CCCO1)Oc1ccc(CCCCCCS)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCCC&",
"old_substring": "CC6C"
} |
Can you make molecule C[NH+](C)CCN(C(=O)c1ccco1)c1nc2ccc(S(C)(=O)=O)cc2s1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)CCCCN(C(=O)c1ccco1)c1nc2ccc(S(C)(=O)=O)cc2s1 | C[NH+](C)CCN(C(=O)c1ccco1)c1nc2ccc(S(C)(=O)=O)cc2s1 | C[NH+](C)CCCCN(C(=O)c1ccco1)c1nc2ccc(S(C)(=O)=O)cc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C4C5"
} |
Can you make molecule C[NH+](C)CCN(C(=O)c1ccco1)c1nc2ccc(S(C)(=O)=O)cc2s1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)CCCCCN(C(=O)c1ccco1)c1nc2ccc(S(C)(=O)=O)cc2s1 | C[NH+](C)CCN(C(=O)c1ccco1)c1nc2ccc(S(C)(=O)=O)cc2s1 | C[NH+](C)CCCCCN(C(=O)c1ccco1)c1nc2ccc(S(C)(=O)=O)cc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4C5"
} |
Can you make molecule C[NH+](C)CCN(C(=O)c1ccco1)c1nc2ccc(S(C)(=O)=O)cc2s1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)C1CC(N(C(=O)c2ccco2)c2nc3ccc(S(C)(=O)=O)cc3s2)C1 | C[NH+](C)CCN(C(=O)c1ccco1)c1nc2ccc(S(C)(=O)=O)cc2s1 | C[NH+](C)C1CC(N(C(=O)c2ccco2)c2nc3ccc(S(C)(=O)=O)cc3s2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C4C5"
} |
Can you make molecule C[NH+](C)CCN(C(=O)c1ccco1)c1nc2ccc(S(C)(=O)=O)cc2s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCN(C(=O)c1ccco1)c1nc2ccc(S(C)(=O)=O)cc2s1)[NH+](C)C | C[NH+](C)CCN(C(=O)c1ccco1)c1nc2ccc(S(C)(=O)=O)cc2s1 | C[C@@H](CCN(C(=O)c1ccco1)c1nc2ccc(S(C)(=O)=O)cc2s1)[NH+](C)C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C4C5"
} |
Can you make molecule C[NH+](C)CCN(C(=O)c1ccco1)c1nc2ccc(S(C)(=O)=O)cc2s1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)C1CCC(N(C(=O)c2ccco2)c2nc3ccc(S(C)(=O)=O)cc3s2)CC1 | C[NH+](C)CCN(C(=O)c1ccco1)c1nc2ccc(S(C)(=O)=O)cc2s1 | C[NH+](C)C1CCC(N(C(=O)c2ccco2)c2nc3ccc(S(C)(=O)=O)cc3s2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C4C5"
} |
Can you make molecule CC[C@H](C)[NH2+]CCc1n[nH]c(-c2ccco2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[NH2+]CCCCc1n[nH]c(-c2ccco2)n1 | CC[C@H](C)[NH2+]CCc1n[nH]c(-c2ccco2)n1 | CC[C@H](C)[NH2+]CCCCc1n[nH]c(-c2ccco2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C4C5"
} |
Can you make molecule CC[C@H](C)[NH2+]CCc1n[nH]c(-c2ccco2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[NH2+]CCCCCc1n[nH]c(-c2ccco2)n1 | CC[C@H](C)[NH2+]CCc1n[nH]c(-c2ccco2)n1 | CC[C@H](C)[NH2+]CCCCCc1n[nH]c(-c2ccco2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4C5"
} |
Can you make molecule CC[C@H](C)[NH2+]CCc1n[nH]c(-c2ccco2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[NH2+]C1CC(c2n[nH]c(-c3ccco3)n2)C1 | CC[C@H](C)[NH2+]CCc1n[nH]c(-c2ccco2)n1 | CC[C@H](C)[NH2+]C1CC(c2n[nH]c(-c3ccco3)n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C4C5"
} |
Can you make molecule CC[C@H](C)[NH2+]CCc1n[nH]c(-c2ccco2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[NH2+][C@@H](C)CCc1n[nH]c(-c2ccco2)n1 | CC[C@H](C)[NH2+]CCc1n[nH]c(-c2ccco2)n1 | CC[C@H](C)[NH2+][C@@H](C)CCc1n[nH]c(-c2ccco2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C4C5"
} |
Can you make molecule CC[C@H](C)[NH2+]CCc1n[nH]c(-c2ccco2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[NH2+]C1CCC(c2n[nH]c(-c3ccco3)n2)CC1 | CC[C@H](C)[NH2+]CCc1n[nH]c(-c2ccco2)n1 | CC[C@H](C)[NH2+]C1CCC(c2n[nH]c(-c3ccco3)n2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C4C5"
} |
Can you make molecule C[C@H](Oc1ccc(Br)cc1)C(=O)NCCc1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Oc1ccc(Br)cc1)C(=O)NCCCCc1c[nH]c2ccccc12 | C[C@H](Oc1ccc(Br)cc1)C(=O)NCCc1c[nH]c2ccccc12 | C[C@H](Oc1ccc(Br)cc1)C(=O)NCCCCc1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C6C7"
} |
Can you make molecule C[C@H](Oc1ccc(Br)cc1)C(=O)NCCc1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Oc1ccc(Br)cc1)C(=O)N=CCCc1c[nH]c2ccccc12 | C[C@H](Oc1ccc(Br)cc1)C(=O)NCCc1c[nH]c2ccccc12 | C[C@H](Oc1ccc(Br)cc1)C(=O)N=CCCc1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C6C7"
} |
Can you make molecule C[C@H](Oc1ccc(Br)cc1)C(=O)NCCc1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Oc1ccc(Br)cc1)C(=O)NCCCCCc1c[nH]c2ccccc12 | C[C@H](Oc1ccc(Br)cc1)C(=O)NCCc1c[nH]c2ccccc12 | C[C@H](Oc1ccc(Br)cc1)C(=O)NCCCCCc1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C6C7"
} |
Can you make molecule C[C@H](Oc1ccc(Br)cc1)C(=O)NCCc1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Oc1ccc(Br)cc1)C(=O)NC1CC(c2c[nH]c3ccccc23)C1 | C[C@H](Oc1ccc(Br)cc1)C(=O)NCCc1c[nH]c2ccccc12 | C[C@H](Oc1ccc(Br)cc1)C(=O)NC1CC(c2c[nH]c3ccccc23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C6C7"
} |
Can you make molecule C[C@H](Oc1ccc(Br)cc1)C(=O)NCCc1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CC(CCc1c[nH]c2ccccc12)=NC(=O)[C@H](C)Oc1ccc(Br)cc1 | C[C@H](Oc1ccc(Br)cc1)C(=O)NCCc1c[nH]c2ccccc12 | CC(CCc1c[nH]c2ccccc12)=NC(=O)[C@H](C)Oc1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C6C7"
} |
Can you make molecule C[C@@H](c1ccccc1)N(C)C(=O)Nc1cccc(C[NH+](C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccccc1)c1sc(C(=O)Nc2cccc(C[NH+](C)C)c2)cc1C#N | C[C@@H](c1ccccc1)N(C)C(=O)Nc1cccc(C[NH+](C)C)c1 | C[C@@H](c1ccccc1)c1sc(C(=O)Nc2cccc(C[NH+](C)C)c2)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N24C"
} |
Can you make molecule C[C@@H](c1ccccc1)N(C)C(=O)Nc1cccc(C[NH+](C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccccc1)c1ccc(C(=O)Nc2cccc(C[NH+](C)C)c2)cc1C#N | C[C@@H](c1ccccc1)N(C)C(=O)Nc1cccc(C[NH+](C)C)c1 | C[C@@H](c1ccccc1)c1ccc(C(=O)Nc2cccc(C[NH+](C)C)c2)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N24C"
} |
Can you make molecule C[C@@H](c1ccccc1)N(C)C(=O)Nc1cccc(C[NH+](C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccccc1)N1CCC(=NOC(=O)Nc2cccc(C[NH+](C)C)c2)CC1 | C[C@@H](c1ccccc1)N(C)C(=O)Nc1cccc(C[NH+](C)C)c1 | C[C@@H](c1ccccc1)N1CCC(=NOC(=O)Nc2cccc(C[NH+](C)C)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N24C"
} |
Can you make molecule C[C@@H](c1ccccc1)N(C)C(=O)Nc1cccc(C[NH+](C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC1=CCCN(C(=O)Nc2cccc(C[NH+](C)C)c2)C1)c1ccccc1 | C[C@@H](c1ccccc1)N(C)C(=O)Nc1cccc(C[NH+](C)C)c1 | C[C@H](CC1=CCCN(C(=O)Nc2cccc(C[NH+](C)C)c2)C1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "N24C"
} |
Can you make molecule C[C@@H](c1ccccc1)N(C)C(=O)Nc1cccc(C[NH+](C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccccc1)C1(C#N)CCN(C(=O)Nc2cccc(C[NH+](C)C)c2)CC1 | C[C@@H](c1ccccc1)N(C)C(=O)Nc1cccc(C[NH+](C)C)c1 | C[C@@H](c1ccccc1)C1(C#N)CCN(C(=O)Nc2cccc(C[NH+](C)C)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&(C#N)CC1",
"old_substring": "N24C"
} |
Can you make molecule CCN(Cc1cc(Cl)ccn1)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CC1(N(Cc2cc(Cl)ccn2)c2ccccc2F)Cc2ccccc2C1 | CCN(Cc1cc(Cl)ccn1)c1ccccc1F | CC1(N(Cc2cc(Cl)ccn2)c2ccccc2F)Cc2ccccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&Cc2ccccc2C1",
"old_substring": "CC2"
} |
Can you make molecule CCN(Cc1cc(Cl)ccn1)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CC(N(Cc2cc(Cl)ccn2)c2ccccc2F)=CC2=CC=C2O1 | CCN(Cc1cc(Cl)ccn1)c1ccccc1F | CC1(C)CC(N(Cc2cc(Cl)ccn2)c2ccccc2F)=CC2=CC=C2O1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)Cc2cc&ccc2O1",
"old_substring": "CC2"
} |
Can you make molecule CCN(Cc1cc(Cl)ccn1)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CN(N(Cc2cc(Cl)ccn2)c2ccccc2F)c2ccccc2O1 | CCN(Cc1cc(Cl)ccn1)c1ccccc1F | CC1(C)CN(N(Cc2cc(Cl)ccn2)c2ccccc2F)c2ccccc2O1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CN&c2ccccc2O1",
"old_substring": "CC2"
} |
Can you make molecule CCN(Cc1cc(Cl)ccn1)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CN(N(Cc2cc(Cl)ccn2)c2ccccc2F)c2ccccc2S1 | CCN(Cc1cc(Cl)ccn1)c1ccccc1F | CC1(C)CN(N(Cc2cc(Cl)ccn2)c2ccccc2F)c2ccccc2S1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CN&c2ccccc2S1",
"old_substring": "CC2"
} |
Can you make molecule CCN(Cc1cc(Cl)ccn1)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccccc1N(Cc1cc(Cl)ccn1)C1C2CCC1CC2 | CCN(Cc1cc(Cl)ccn1)c1ccccc1F | Fc1ccccc1N(Cc1cc(Cl)ccn1)C1C2CCC1CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C2CCC1CC2",
"old_substring": "CC2"
} |
Can you make molecule COc1ccc(C)cc1[C@H](C)[NH2+]Cc1cccc(C(N)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1[C@H](C)[NH2+]Cc1ccc(C(N)=O)cc1I | COc1ccc(C)cc1[C@H](C)[NH2+]Cc1cccc(C(N)=O)c1 | COc1ccc(C)cc1[C@H](C)[NH2+]Cc1ccc(C(N)=O)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c17cccc5c1"
} |
Can you make molecule COc1ccc(C)cc1[C@H](C)[NH2+]Cc1cccc(C(N)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1[C@H](C)[NH2+]Cc1cc(C(N)=O)ccc1Br | COc1ccc(C)cc1[C@H](C)[NH2+]Cc1cccc(C(N)=O)c1 | COc1ccc(C)cc1[C@H](C)[NH2+]Cc1cc(C(N)=O)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c17cccc5c1"
} |
Can you make molecule COc1ccc(C)cc1[C@H](C)[NH2+]Cc1cccc(C(N)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1[C@H](C)[NH2+]Cc1ccc(C(N)=O)cc1Cl | COc1ccc(C)cc1[C@H](C)[NH2+]Cc1cccc(C(N)=O)c1 | COc1ccc(C)cc1[C@H](C)[NH2+]Cc1ccc(C(N)=O)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c17cccc5c1"
} |
Can you make molecule COc1ccc(C)cc1[C@H](C)[NH2+]Cc1cccc(C(N)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1[C@H](C)[NH2+]Cc1cccc(C(N)=O)c1Br | COc1ccc(C)cc1[C@H](C)[NH2+]Cc1cccc(C(N)=O)c1 | COc1ccc(C)cc1[C@H](C)[NH2+]Cc1cccc(C(N)=O)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c17cccc5c1"
} |
Can you make molecule COc1ccc(C)cc1[C@H](C)[NH2+]Cc1cccc(C(N)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1[C@H](C)[NH2+]Cc1cccc(C(N)=O)c1Cl | COc1ccc(C)cc1[C@H](C)[NH2+]Cc1cccc(C(N)=O)c1 | COc1ccc(C)cc1[C@H](C)[NH2+]Cc1cccc(C(N)=O)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c17cccc5c1"
} |
Can you make molecule CCn1c([O-])c(C(=O)C[C@@H]2NCCc3ccccc32)c(=O)n(CC)c1=S less soluble in water? The output molecule should be similar to the input molecule. | C=CSn1c([O-])c(C(=O)C[C@@H]2NCCc3ccccc32)c(=O)n(CC)c1=S | CCn1c([O-])c(C(=O)C[C@@H]2NCCc3ccccc32)c(=O)n(CC)c1=S | C=CSn1c([O-])c(C(=O)C[C@@H]2NCCc3ccccc32)c(=O)n(CC)c1=S | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC5"
} |
Can you make molecule CCn1c([O-])c(C(=O)C[C@@H]2NCCc3ccccc32)c(=O)n(CC)c1=S less soluble in water? The output molecule should be similar to the input molecule. | CCn1c(=O)c(C(=O)C[C@@H]2NCCc3ccccc32)c([O-])n(C(C)C)c1=S | CCn1c([O-])c(C(=O)C[C@@H]2NCCc3ccccc32)c(=O)n(CC)c1=S | CCn1c(=O)c(C(=O)C[C@@H]2NCCc3ccccc32)c([O-])n(C(C)C)c1=S | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC5"
} |
Can you make molecule CCn1c([O-])c(C(=O)C[C@@H]2NCCc3ccccc32)c(=O)n(CC)c1=S less soluble in water? The output molecule should be similar to the input molecule. | C=CCCn1c([O-])c(C(=O)C[C@@H]2NCCc3ccccc32)c(=O)n(CC)c1=S | CCn1c([O-])c(C(=O)C[C@@H]2NCCc3ccccc32)c(=O)n(CC)c1=S | C=CCCn1c([O-])c(C(=O)C[C@@H]2NCCc3ccccc32)c(=O)n(CC)c1=S | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CCn1c([O-])c(C(=O)C[C@@H]2NCCc3ccccc32)c(=O)n(CC)c1=S less soluble in water? The output molecule should be similar to the input molecule. | CCn1c(=O)c(C(=O)C[C@@H]2NCCc3ccccc32)c([O-])n(CCCCl)c1=S | CCn1c([O-])c(C(=O)C[C@@H]2NCCc3ccccc32)c(=O)n(CC)c1=S | CCn1c(=O)c(C(=O)C[C@@H]2NCCc3ccccc32)c([O-])n(CCCCl)c1=S | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC5"
} |
Can you make molecule CCn1c([O-])c(C(=O)C[C@@H]2NCCc3ccccc32)c(=O)n(CC)c1=S less soluble in water? The output molecule should be similar to the input molecule. | CCn1c(=O)c(C(=O)C[C@@H]2NCCc3ccccc32)c([O-])n(CCCCS)c1=S | CCn1c([O-])c(C(=O)C[C@@H]2NCCc3ccccc32)c(=O)n(CC)c1=S | CCn1c(=O)c(C(=O)C[C@@H]2NCCc3ccccc32)c([O-])n(CCCCS)c1=S | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC5"
} |
Can you make molecule C[C@@H]1CCC[C@@H](C(=O)O[C@@H](C)[C@@H]2CCCO2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[C@@H](CC(=O)SO[C@@H](C)[C@@H]2CCCO2)C1 | C[C@@H]1CCC[C@@H](C(=O)O[C@@H](C)[C@@H]2CCCO2)C1 | C[C@@H]1CCC[C@@H](CC(=O)SO[C@@H](C)[C@@H]2CCCO2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule C[C@@H]1CCC[C@@H](C(=O)O[C@@H](C)[C@@H]2CCCO2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[C@@H](CC(=C=O)CO[C@@H](C)[C@@H]2CCCO2)C1 | C[C@@H]1CCC[C@@H](C(=O)O[C@@H](C)[C@@H]2CCCO2)C1 | C[C@@H]1CCC[C@@H](CC(=C=O)CO[C@@H](C)[C@@H]2CCCO2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule C[C@@H]1CCC[C@@H](C(=O)O[C@@H](C)[C@@H]2CCCO2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[C@@H](C(=O)CCCC(=O)O[C@@H](C)[C@@H]2CCCO2)C1 | C[C@@H]1CCC[C@@H](C(=O)O[C@@H](C)[C@@H]2CCCO2)C1 | C[C@@H]1CCC[C@@H](C(=O)CCCC(=O)O[C@@H](C)[C@@H]2CCCO2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C24=O"
} |
Can you make molecule C[C@@H]1CCC[C@@H](C(=O)O[C@@H](C)[C@@H]2CCCO2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[C@@H](C(C)(C)CC(=O)O[C@@H](C)[C@@H]2CCCO2)C1 | C[C@@H]1CCC[C@@H](C(=O)O[C@@H](C)[C@@H]2CCCO2)C1 | C[C@@H]1CCC[C@@H](C(C)(C)CC(=O)O[C@@H](C)[C@@H]2CCCO2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule C[C@@H]1CCC[C@@H](C(=O)O[C@@H](C)[C@@H]2CCCO2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[C@@H](CCC[S@@+]([O-])CO[C@@H](C)[C@@H]2CCCO2)C1 | C[C@@H]1CCC[C@@H](C(=O)O[C@@H](C)[C@@H]2CCCO2)C1 | C[C@@H]1CCC[C@@H](CCC[S@@+]([O-])CO[C@@H](C)[C@@H]2CCCO2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C24=O"
} |
Can you make molecule O=C1COc2cc(OCc3c(F)cccc3Cl)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C1COc2cc(SC(=S)OCc3c(F)cccc3Cl)ccc21 | O=C1COc2cc(OCc3c(F)cccc3Cl)ccc21 | O=C1COc2cc(SC(=S)OCc3c(F)cccc3Cl)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O45"
} |
Can you make molecule O=C1COc2cc(OCc3c(F)cccc3Cl)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | N=C(Cc1ccc2c(c1)OCC2=O)OCc1c(F)cccc1Cl | O=C1COc2cc(OCc3c(F)cccc3Cl)ccc21 | N=C(Cc1ccc2c(c1)OCC2=O)OCc1c(F)cccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O45"
} |
Can you make molecule O=C1COc2cc(OCc3c(F)cccc3Cl)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)c1ccc2c(c1)OCC2=O)Cc1c(F)cccc1Cl | O=C1COc2cc(OCc3c(F)cccc3Cl)ccc21 | O=C(CCC(=O)c1ccc2c(c1)OCC2=O)Cc1c(F)cccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O45"
} |
Can you make molecule O=C1COc2cc(OCc3c(F)cccc3Cl)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccc2c(c1)OCC2=O)Cc1c(F)cccc1Cl | O=C1COc2cc(OCc3c(F)cccc3Cl)ccc21 | O=C(/C=C/Sc1ccc2c(c1)OCC2=O)Cc1c(F)cccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O45"
} |
Can you make molecule O=C1COc2cc(OCc3c(F)cccc3Cl)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C1COc2cc(CCC[C@@H](O)Cc3c(F)cccc3Cl)ccc21 | O=C1COc2cc(OCc3c(F)cccc3Cl)ccc21 | O=C1COc2cc(CCC[C@@H](O)Cc3c(F)cccc3Cl)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CCC&",
"old_substring": "O45"
} |
Can you make molecule O=C1C[C@H](C(=O)N2CCOC[C@@H]2CCO)CN1c1cc(Cl)cc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C[C@H]1CC(=O)N(c2cc(Cl)cc(Cl)c2)C1)SN1CCOC[C@@H]1CCO | O=C1C[C@H](C(=O)N2CCOC[C@@H]2CCO)CN1c1cc(Cl)cc(Cl)c1 | O=C(C[C@H]1CC(=O)N(c2cc(Cl)cc(Cl)c2)C1)SN1CCOC[C@@H]1CCO | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C34=O"
} |
Can you make molecule O=C1C[C@H](C(=O)N2CCOC[C@@H]2CCO)CN1c1cc(Cl)cc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C=C(C[C@H]1CC(=O)N(c2cc(Cl)cc(Cl)c2)C1)CN1CCOC[C@@H]1CCO | O=C1C[C@H](C(=O)N2CCOC[C@@H]2CCO)CN1c1cc(Cl)cc(Cl)c1 | O=C=C(C[C@H]1CC(=O)N(c2cc(Cl)cc(Cl)c2)C1)CN1CCOC[C@@H]1CCO | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C34=O"
} |
Can you make molecule O=C1C[C@H](C(=O)N2CCOC[C@@H]2CCO)CN1c1cc(Cl)cc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCC(=O)N1CCOC[C@@H]1CCO)[C@H]1CC(=O)N(c2cc(Cl)cc(Cl)c2)C1 | O=C1C[C@H](C(=O)N2CCOC[C@@H]2CCO)CN1c1cc(Cl)cc(Cl)c1 | O=C(CCCC(=O)N1CCOC[C@@H]1CCO)[C@H]1CC(=O)N(c2cc(Cl)cc(Cl)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C34=O"
} |
Can you make molecule O=C1C[C@H](C(=O)N2CCOC[C@@H]2CCO)CN1c1cc(Cl)cc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)N1CCOC[C@@H]1CCO)[C@H]1CC(=O)N(c2cc(Cl)cc(Cl)c2)C1 | O=C1C[C@H](C(=O)N2CCOC[C@@H]2CCO)CN1c1cc(Cl)cc(Cl)c1 | CC(C)(CC(=O)N1CCOC[C@@H]1CCO)[C@H]1CC(=O)N(c2cc(Cl)cc(Cl)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule O=C1C[C@H](C(=O)N2CCOC[C@@H]2CCO)CN1c1cc(Cl)cc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H](CCC[S@@+]([O-])CN2CCOC[C@@H]2CCO)CN1c1cc(Cl)cc(Cl)c1 | O=C1C[C@H](C(=O)N2CCOC[C@@H]2CCO)CN1c1cc(Cl)cc(Cl)c1 | O=C1C[C@H](CCC[S@@+]([O-])CN2CCOC[C@@H]2CCO)CN1c1cc(Cl)cc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C34=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.