prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule O=S(=O)([N-]c1ccc2nc(C3CC3)oc2c1)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1ccc2nc(C3SCCS3)oc2c1)c1ccc(Cl)cc1 | O=S(=O)([N-]c1ccc2nc(C3CC3)oc2c1)c1ccc(Cl)cc1 | O=S(=O)([N-]c1ccc2nc(C3SCCS3)oc2c1)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C16CC1"
} |
Can you make molecule O=S(=O)([N-]c1ccc2nc(C3CC3)oc2c1)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1ccc2nc(C3CCCCC3)oc2c1)c1ccc(Cl)cc1 | O=S(=O)([N-]c1ccc2nc(C3CC3)oc2c1)c1ccc(Cl)cc1 | O=S(=O)([N-]c1ccc2nc(C3CCCCC3)oc2c1)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule O=S(=O)([N-]c1ccc2nc(C3CC3)oc2c1)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1ccc2nc(C3SCCCS3)oc2c1)c1ccc(Cl)cc1 | O=S(=O)([N-]c1ccc2nc(C3CC3)oc2c1)c1ccc(Cl)cc1 | O=S(=O)([N-]c1ccc2nc(C3SCCCS3)oc2c1)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C16CC1"
} |
Can you make molecule O=S(=O)([N-]c1ccc2nc(C3CC3)oc2c1)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1ccc2nc(C3SCSCS3)oc2c1)c1ccc(Cl)cc1 | O=S(=O)([N-]c1ccc2nc(C3CC3)oc2c1)c1ccc(Cl)cc1 | O=S(=O)([N-]c1ccc2nc(C3SCSCS3)oc2c1)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C16CC1"
} |
Can you make molecule O=S(=O)([N-]c1ccc2nc(C3CC3)oc2c1)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1ccc2nc(C3CCCCCC3)oc2c1)c1ccc(Cl)cc1 | O=S(=O)([N-]c1ccc2nc(C3CC3)oc2c1)c1ccc(Cl)cc1 | O=S(=O)([N-]c1ccc2nc(C3CCCCCC3)oc2c1)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule COC(=O)c1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COSC(=O)Cc1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 | COC(=O)c1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 | COSC(=O)Cc1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C45=O"
} |
Can you make molecule COC(=O)c1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCCC(=O)c1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 | COC(=O)c1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 | COC(=O)CCCC(=O)c1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C45=O"
} |
Can you make molecule COC(=O)c1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CC(C)(C)c1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 | COC(=O)c1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 | COC(=O)CC(C)(C)c1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule COC(=O)c1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCC(C)(C)c1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 | COC(=O)c1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 | COC(=O)CCC(C)(C)c1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule COC(=O)c1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COSC(=O)[C@@H](C)c1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 | COC(=O)c1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 | COSC(=O)[C@@H](C)c1ccc([C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@@H]3C=CC[C@H]32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C45=O"
} |
Can you make molecule O=C(NCc1ncc(-c2ccccc2)o1)N[C@@H]1CCC[C@@H]1CO less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SN[C@@H]1CCC[C@@H]1CO)NCc1ncc(-c2ccccc2)o1 | O=C(NCc1ncc(-c2ccccc2)o1)N[C@@H]1CCC[C@@H]1CO | O=C(/C=C/SN[C@@H]1CCC[C@@H]1CO)NCc1ncc(-c2ccccc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NCc1ncc(-c2ccccc2)o1)N[C@@H]1CCC[C@@H]1CO less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NCc2ncc(-c3ccccc3)o2)nc1N[C@@H]1CCC[C@@H]1CO | O=C(NCc1ncc(-c2ccccc2)o1)N[C@@H]1CCC[C@@H]1CO | O=Cc1sc(NCc2ncc(-c3ccccc3)o2)nc1N[C@@H]1CCC[C@@H]1CO | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NCc1ncc(-c2ccccc2)o1)N[C@@H]1CCC[C@@H]1CO less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NCc2ncc(-c3ccccc3)o2)sc1N[C@@H]1CCC[C@@H]1CO | O=C(NCc1ncc(-c2ccccc2)o1)N[C@@H]1CCC[C@@H]1CO | O=Cc1nc(NCc2ncc(-c3ccccc3)o2)sc1N[C@@H]1CCC[C@@H]1CO | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NCc1ncc(-c2ccccc2)o1)N[C@@H]1CCC[C@@H]1CO less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=NCc2ncc(-c3ccccc3)o2)CCC1=N[C@@H]1CCC[C@@H]1CO | O=C(NCc1ncc(-c2ccccc2)o1)N[C@@H]1CCC[C@@H]1CO | O=C1C(=NCc2ncc(-c3ccccc3)o2)CCC1=N[C@@H]1CCC[C@@H]1CO | 102 | {
"fragment_index": 0,
"new_substring": "O=C1C=&CCC1=&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NCc1ncc(-c2ccccc2)o1)N[C@@H]1CCC[C@@H]1CO less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ncc(-c2ccccc2)o1)n1nc(N[C@@H]2CCC[C@@H]2CO)oc1=S | O=C(NCc1ncc(-c2ccccc2)o1)N[C@@H]1CCC[C@@H]1CO | O=C(NCc1ncc(-c2ccccc2)o1)n1nc(N[C@@H]2CCC[C@@H]2CO)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C34"
} |
Can you make molecule O=c1[nH]c2ccc(-c3csc(NC[C@H]4CCCO4)n3)cc2[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C[C@H]1CCCO1)C(=S)Sc1nc(-c2ccc3[nH]c(=O)[nH]c3c2)cs1 | O=c1[nH]c2ccc(-c3csc(NC[C@H]4CCCO4)n3)cc2[nH]1 | CN(C[C@H]1CCCO1)C(=S)Sc1nc(-c2ccc3[nH]c(=O)[nH]c3c2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N56"
} |
Can you make molecule O=c1[nH]c2ccc(-c3csc(NC[C@H]4CCCO4)n3)cc2[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1oc(C[C@H]2CCCO2)cc1-c1nc(-c2ccc3[nH]c(=O)[nH]c3c2)cs1 | O=c1[nH]c2ccc(-c3csc(NC[C@H]4CCCO4)n3)cc2[nH]1 | Nc1oc(C[C@H]2CCCO2)cc1-c1nc(-c2ccc3[nH]c(=O)[nH]c3c2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N56"
} |
Can you make molecule O=c1[nH]c2ccc(-c3csc(NC[C@H]4CCCO4)n3)cc2[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1[nH]c2ccc(-c3csc(SC4=NCCN4C[C@H]4CCCO4)n3)cc2[nH]1 | O=c1[nH]c2ccc(-c3csc(NC[C@H]4CCCO4)n3)cc2[nH]1 | O=c1[nH]c2ccc(-c3csc(SC4=NCCN4C[C@H]4CCCO4)n3)cc2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N56"
} |
Can you make molecule O=c1[nH]c2ccc(-c3csc(NC[C@H]4CCCO4)n3)cc2[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1[nH]c2ccc(-c3csc(C4CCN(CC[C@H]5CCCO5)CC4)n3)cc2[nH]1 | O=c1[nH]c2ccc(-c3csc(NC[C@H]4CCCO4)n3)cc2[nH]1 | O=c1[nH]c2ccc(-c3csc(C4CCN(CC[C@H]5CCCO5)CC4)n3)cc2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N56"
} |
Can you make molecule O=c1[nH]c2ccc(-c3csc(NC[C@H]4CCCO4)n3)cc2[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1c(C[C@H]2CCCO2)cccc1-c1nc(-c2ccc3[nH]c(=O)[nH]c3c2)cs1 | O=c1[nH]c2ccc(-c3csc(NC[C@H]4CCCO4)n3)cc2[nH]1 | Nc1c(C[C@H]2CCCO2)cccc1-c1nc(-c2ccc3[nH]c(=O)[nH]c3c2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&cccc1&",
"old_substring": "N56"
} |
Can you make molecule C[NH2+][C@H](c1ccc(OC)c(C)c1)[C@@]1(C)CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CO.Cc1cc2ccc1C[NH+]1CCC(CC1)[C@H]2[C@@]1(C)CCCO1 | C[NH2+][C@H](c1ccc(OC)c(C)c1)[C@@]1(C)CCCO1 | CO.Cc1cc2ccc1C[NH+]1CCC(CC1)[C@H]2[C@@]1(C)CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&CC1",
"old_substring": "C[NH2+]3"
} |
Can you make molecule C[NH2+][C@H](c1ccc(OC)c(C)c1)[C@@]1(C)CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CO.Cc1cc2ccc1CC1=CCC[NH+](C1)[C@H]2[C@@]1(C)CCCO1 | C[NH2+][C@H](c1ccc(OC)c(C)c1)[C@@]1(C)CCCO1 | CO.Cc1cc2ccc1CC1=CCC[NH+](C1)[C@H]2[C@@]1(C)CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C1=CCC[NH+]&C1",
"old_substring": "C[NH2+]3"
} |
Can you make molecule C[NH2+][C@H](c1ccc(OC)c(C)c1)[C@@]1(C)CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CO.Cc1cc2ccc1C1(C)CC[NH+](CC1)[C@H]2[C@@]1(C)CCCO1 | C[NH2+][C@H](c1ccc(OC)c(C)c1)[C@@]1(C)CCCO1 | CO.Cc1cc2ccc1C1(C)CC[NH+](CC1)[C@H]2[C@@]1(C)CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CC[NH+]&CC1",
"old_substring": "C[NH2+]3"
} |
Can you make molecule C[NH2+][C@H](c1ccc(OC)c(C)c1)[C@@]1(C)CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CO.Cc1cc2ccc1C[NH+]1CCC(C)(CC1)[C@H]2[C@@]1(C)CCCO1 | C[NH2+][C@H](c1ccc(OC)c(C)c1)[C@@]1(C)CCCO1 | CO.Cc1cc2ccc1C[NH+]1CCC(C)(CC1)[C@H]2[C@@]1(C)CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&(C)CC1",
"old_substring": "C[NH2+]3"
} |
Can you make molecule C[NH2+][C@H](c1ccc(OC)c(C)c1)[C@@]1(C)CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CO.Cc1cc2ccc1-c1[nH+]cn(c1C)[C@H]2[C@@]1(C)CCCO1 | C[NH2+][C@H](c1ccc(OC)c(C)c1)[C@@]1(C)CCCO1 | CO.Cc1cc2ccc1-c1[nH+]cn(c1C)[C@H]2[C@@]1(C)CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&[nH+]cn1&",
"old_substring": "C[NH2+]3"
} |
Can you make molecule FC(F)(F)c1[nH]nc2c1CN(Cc1ccccc1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)CCCc1[nH]nc2c1CN(Cc1ccccc1)CC2 | FC(F)(F)c1[nH]nc2c1CN(Cc1ccccc1)CC2 | FC(F)(F)CCCc1[nH]nc2c1CN(Cc1ccccc1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "FC4(F)F"
} |
Can you make molecule FC(F)(F)c1[nH]nc2c1CN(Cc1ccccc1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)Sc1[nH]nc2c1CN(Cc1ccccc1)CC2 | FC(F)(F)c1[nH]nc2c1CN(Cc1ccccc1)CC2 | FC(F)(F)Sc1[nH]nc2c1CN(Cc1ccccc1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "FC4(F)F"
} |
Can you make molecule FC(F)(F)c1[nH]nc2c1CN(Cc1ccccc1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)CCCCc1[nH]nc2c1CN(Cc1ccccc1)CC2 | FC(F)(F)c1[nH]nc2c1CN(Cc1ccccc1)CC2 | FC(F)(F)CCCCc1[nH]nc2c1CN(Cc1ccccc1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "FC4(F)F"
} |
Can you make molecule FC(F)(F)c1[nH]nc2c1CN(Cc1ccccc1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | FC1(F)CCC(c2[nH]nc3c2CN(Cc2ccccc2)CC3)CC1 | FC(F)(F)c1[nH]nc2c1CN(Cc1ccccc1)CC2 | FC1(F)CCC(c2[nH]nc3c2CN(Cc2ccccc2)CC3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC(F)(F)CC1",
"old_substring": "FC4(F)F"
} |
Can you make molecule FC(F)(F)c1[nH]nc2c1CN(Cc1ccccc1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)/C=C/Sc1[nH]nc2c1CN(Cc1ccccc1)CC2 | FC(F)(F)c1[nH]nc2c1CN(Cc1ccccc1)CC2 | FC(F)(F)/C=C/Sc1[nH]nc2c1CN(Cc1ccccc1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "S&/C=C/C(F)(F)F",
"old_substring": "FC4(F)F"
} |
Can you make molecule CC(C)(C)c1ccc(C(=O)N/N=C/c2ccc3c(c2)OCO3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1ccc(C(=O)N/N=C/c2ccc3c(c2)OCO3)cc1I | CC(C)(C)c1ccc(C(=O)N/N=C/c2ccc3c(c2)OCO3)cc1 | CC(C)(C)c1ccc(C(=O)N/N=C/c2ccc3c(c2)OCO3)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15ccc4cc1"
} |
Can you make molecule CC(C)(C)c1ccc(C(=O)N/N=C/c2ccc3c(c2)OCO3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1cc(C(=O)N/N=C/c2ccc3c(c2)OCO3)ccc1Br | CC(C)(C)c1ccc(C(=O)N/N=C/c2ccc3c(c2)OCO3)cc1 | CC(C)(C)c1cc(C(=O)N/N=C/c2ccc3c(c2)OCO3)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15ccc4cc1"
} |
Can you make molecule CC(C)(C)c1ccc(C(=O)N/N=C/c2ccc3c(c2)OCO3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1ccc(C(=O)N/N=C/c2ccc3c(c2)OCO3)cc1Cl | CC(C)(C)c1ccc(C(=O)N/N=C/c2ccc3c(c2)OCO3)cc1 | CC(C)(C)c1ccc(C(=O)N/N=C/c2ccc3c(c2)OCO3)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15ccc4cc1"
} |
Can you make molecule CC(C)(C)c1ccc(C(=O)N/N=C/c2ccc3c(c2)OCO3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1cccc(C(=O)N/N=C/c2ccc3c(c2)OCO3)c1Br | CC(C)(C)c1ccc(C(=O)N/N=C/c2ccc3c(c2)OCO3)cc1 | CC(C)(C)c1cccc(C(=O)N/N=C/c2ccc3c(c2)OCO3)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15ccc4cc1"
} |
Can you make molecule CC(C)(C)c1ccc(C(=O)N/N=C/c2ccc3c(c2)OCO3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1cccc(C(=O)N/N=C/c2ccc3c(c2)OCO3)c1Cl | CC(C)(C)c1ccc(C(=O)N/N=C/c2ccc3c(c2)OCO3)cc1 | CC(C)(C)c1cccc(C(=O)N/N=C/c2ccc3c(c2)OCO3)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15ccc4cc1"
} |
Can you make molecule CCc1ccc(S(=O)(=O)NCC2([NH+](C)C)CCOCC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1ccc(S(=O)(=O)NCC2([NH+](C)C)CCOCC2)s1 | CCc1ccc(S(=O)(=O)NCC2([NH+](C)C)CCOCC2)s1 | C=CSc1ccc(S(=O)(=O)NCC2([NH+](C)C)CCOCC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC6"
} |
Can you make molecule CCc1ccc(S(=O)(=O)NCC2([NH+](C)C)CCOCC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc(S(=O)(=O)NCC2([NH+](C)C)CCOCC2)s1 | CCc1ccc(S(=O)(=O)NCC2([NH+](C)C)CCOCC2)s1 | CC(C)c1ccc(S(=O)(=O)NCC2([NH+](C)C)CCOCC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC6"
} |
Can you make molecule CCc1ccc(S(=O)(=O)NCC2([NH+](C)C)CCOCC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1ccc(S(=O)(=O)NCC2([NH+](C)C)CCOCC2)s1 | CCc1ccc(S(=O)(=O)NCC2([NH+](C)C)CCOCC2)s1 | C=CCCc1ccc(S(=O)(=O)NCC2([NH+](C)C)CCOCC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC6"
} |
Can you make molecule CCc1ccc(S(=O)(=O)NCC2([NH+](C)C)CCOCC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)C1(CNS(=O)(=O)c2ccc(CCCCl)s2)CCOCC1 | CCc1ccc(S(=O)(=O)NCC2([NH+](C)C)CCOCC2)s1 | C[NH+](C)C1(CNS(=O)(=O)c2ccc(CCCCl)s2)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC6"
} |
Can you make molecule CCc1ccc(S(=O)(=O)NCC2([NH+](C)C)CCOCC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)C1(CNS(=O)(=O)c2ccc(CCCCS)s2)CCOCC1 | CCc1ccc(S(=O)(=O)NCC2([NH+](C)C)CCOCC2)s1 | C[NH+](C)C1(CNS(=O)(=O)c2ccc(CCCCS)s2)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC6"
} |
Can you make molecule COc1c(C)cccc1CN1CCO[C@@H](c2cc(C(=O)N(C)CCO)c3ccccc3n2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1c(C)cccc1CN1CCO[C@@H](c2cc(CC(=O)SN(C)CCO)c3ccccc3n2)C1 | COc1c(C)cccc1CN1CCO[C@@H](c2cc(C(=O)N(C)CCO)c3ccccc3n2)C1 | COc1c(C)cccc1CN1CCO[C@@H](c2cc(CC(=O)SN(C)CCO)c3ccccc3n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule COc1c(C)cccc1CN1CCO[C@@H](c2cc(C(=O)N(C)CCO)c3ccccc3n2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1c(C)cccc1CN1CCO[C@@H](c2cc(C(=O)CCCC(=O)N(C)CCO)c3ccccc3n2)C1 | COc1c(C)cccc1CN1CCO[C@@H](c2cc(C(=O)N(C)CCO)c3ccccc3n2)C1 | COc1c(C)cccc1CN1CCO[C@@H](c2cc(C(=O)CCCC(=O)N(C)CCO)c3ccccc3n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C48=O"
} |
Can you make molecule COc1c(C)cccc1CN1CCO[C@@H](c2cc(C(=O)N(C)CCO)c3ccccc3n2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1c(C)cccc1CN1CCO[C@@H](c2cc(C(C)(C)CC(=O)N(C)CCO)c3ccccc3n2)C1 | COc1c(C)cccc1CN1CCO[C@@H](c2cc(C(=O)N(C)CCO)c3ccccc3n2)C1 | COc1c(C)cccc1CN1CCO[C@@H](c2cc(C(C)(C)CC(=O)N(C)CCO)c3ccccc3n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule COc1c(C)cccc1CN1CCO[C@@H](c2cc(C(=O)N(C)CCO)c3ccccc3n2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1c(C)cccc1CN1CCO[C@@H](c2cc(C(C)(C)CCC(=O)N(C)CCO)c3ccccc3n2)C1 | COc1c(C)cccc1CN1CCO[C@@H](c2cc(C(=O)N(C)CCO)c3ccccc3n2)C1 | COc1c(C)cccc1CN1CCO[C@@H](c2cc(C(C)(C)CCC(=O)N(C)CCO)c3ccccc3n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule COc1c(C)cccc1CN1CCO[C@@H](c2cc(C(=O)N(C)CCO)c3ccccc3n2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1c(C)cccc1CN1CCO[C@@H](c2cc([C@H](C)C(=O)SN(C)CCO)c3ccccc3n2)C1 | COc1c(C)cccc1CN1CCO[C@@H](c2cc(C(=O)N(C)CCO)c3ccccc3n2)C1 | COc1c(C)cccc1CN1CCO[C@@H](c2cc([C@H](C)C(=O)SN(C)CCO)c3ccccc3n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C48=O"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1cnc(-c2ccccc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1CC(=O)SNc1cnc(-c2ccccc2)s1 | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1cnc(-c2ccccc2)s1 | Cc1ccc([N+](=O)[O-])cc1CC(=O)SNc1cnc(-c2ccccc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1cnc(-c2ccccc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1C(=O)CCCC(=O)Nc1cnc(-c2ccccc2)s1 | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1cnc(-c2ccccc2)s1 | Cc1ccc([N+](=O)[O-])cc1C(=O)CCCC(=O)Nc1cnc(-c2ccccc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1cnc(-c2ccccc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1C(C)(C)CC(=O)Nc1cnc(-c2ccccc2)s1 | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1cnc(-c2ccccc2)s1 | Cc1ccc([N+](=O)[O-])cc1C(C)(C)CC(=O)Nc1cnc(-c2ccccc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1cnc(-c2ccccc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1C(C)(C)CCC(=O)Nc1cnc(-c2ccccc2)s1 | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1cnc(-c2ccccc2)s1 | Cc1ccc([N+](=O)[O-])cc1C(C)(C)CCC(=O)Nc1cnc(-c2ccccc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1cnc(-c2ccccc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1[C@H](C)C(=O)SNc1cnc(-c2ccccc2)s1 | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1cnc(-c2ccccc2)s1 | Cc1ccc([N+](=O)[O-])cc1[C@H](C)C(=O)SNc1cnc(-c2ccccc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule [NH3+]C1CC(c2ccccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC([NH3+])(CC)c1ccccc1F | [NH3+]C1CC(c2ccccc2F)C1 | CCC([NH3+])(CC)c1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "CCC3([NH3+])CC",
"old_substring": "[NH3+]C1CC3C1"
} |
Can you make molecule [NH3+]C1CC(c2ccccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C[NH3+])(CCC)c1ccccc1F | [NH3+]C1CC(c2ccccc2F)C1 | CCCC(C[NH3+])(CCC)c1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "CCCC3(C[NH3+])CCC",
"old_substring": "[NH3+]C1CC3C1"
} |
Can you make molecule [NH3+]C1CC(c2ccccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C[NH3+])CCc1ccccc1F | [NH3+]C1CC(c2ccccc2F)C1 | CC(C)(C[NH3+])CCc1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C[NH3+])CC3",
"old_substring": "[NH3+]C1CC3C1"
} |
Can you make molecule [NH3+]C1CC(c2ccccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC([NH3+])(CC)Cc1ccccc1F | [NH3+]C1CC(c2ccccc2F)C1 | CCC([NH3+])(CC)Cc1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C3C([NH3+])(CC)CC",
"old_substring": "[NH3+]C1CC3C1"
} |
Can you make molecule [NH3+]C1CC(c2ccccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](C[NH3+])c1ccccc1F | [NH3+]C1CC(c2ccccc2F)C1 | CCC[C@@H](C[NH3+])c1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]3C[NH3+]",
"old_substring": "[NH3+]C1CC3C1"
} |
Can you make molecule O=C(CS(=O)(=O)C1CCCC1)NCc1cc(F)cc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS(=O)(=O)C1CCCC1)N1Cc2nc(Cc3cc(F)cc(F)c3)sc2C1 | O=C(CS(=O)(=O)C1CCCC1)NCc1cc(F)cc(F)c1 | O=C(CS(=O)(=O)C1CCCC1)N1Cc2nc(Cc3cc(F)cc(F)c3)sc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N23"
} |
Can you make molecule O=C(CS(=O)(=O)C1CCCC1)NCc1cc(F)cc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS(=O)(=O)C1CCCC1)N1CCc2noc(Cc3cc(F)cc(F)c3)c2C1 | O=C(CS(=O)(=O)C1CCCC1)NCc1cc(F)cc(F)c1 | O=C(CS(=O)(=O)C1CCCC1)N1CCc2noc(Cc3cc(F)cc(F)c3)c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N23"
} |
Can you make molecule O=C(CS(=O)(=O)C1CCCC1)NCc1cc(F)cc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS(=O)(=O)C1CCCC1)N1CCc2cc(Cc3cc(F)cc(F)c3)ccc21 | O=C(CS(=O)(=O)C1CCCC1)NCc1cc(F)cc(F)c1 | O=C(CS(=O)(=O)C1CCCC1)N1CCc2cc(Cc3cc(F)cc(F)c3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N23"
} |
Can you make molecule O=C(CS(=O)(=O)C1CCCC1)NCc1cc(F)cc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1c(C(=O)CS(=O)(=O)C2CCCC2)sc2nsc(Cc3cc(F)cc(F)c3)c12 | O=C(CS(=O)(=O)C1CCCC1)NCc1cc(F)cc(F)c1 | Nc1c(C(=O)CS(=O)(=O)C2CCCC2)sc2nsc(Cc3cc(F)cc(F)c3)c12 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&sc2nsc&c12",
"old_substring": "N23"
} |
Can you make molecule O=C(CS(=O)(=O)C1CCCC1)NCc1cc(F)cc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS(=O)(=O)C1CCCC1)N1CCc2nc(Cc3cc(F)cc(F)c3)oc2C1 | O=C(CS(=O)(=O)C1CCCC1)NCc1cc(F)cc(F)c1 | O=C(CS(=O)(=O)C1CCCC1)N1CCc2nc(Cc3cc(F)cc(F)c3)oc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2nc&oc2C1",
"old_substring": "N23"
} |
Can you make molecule C[C@H]1CCOCCN1C(=O)NCc1ccc(-n2ccnc2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCOCCN1C(=O)CC(C)(C)NCc1ccc(-n2ccnc2)nc1 | C[C@H]1CCOCCN1C(=O)NCc1ccc(-n2ccnc2)nc1 | C[C@H]1CCOCCN1C(=O)CC(C)(C)NCc1ccc(-n2ccnc2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule C[C@H]1CCOCCN1C(=O)NCc1ccc(-n2ccnc2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCOCCN1C(=O)CCC(C)(C)NCc1ccc(-n2ccnc2)nc1 | C[C@H]1CCOCCN1C(=O)NCc1ccc(-n2ccnc2)nc1 | C[C@H]1CCOCCN1C(=O)CCC(C)(C)NCc1ccc(-n2ccnc2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule C[C@H]1CCOCCN1C(=O)NCc1ccc(-n2ccnc2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCOCCN1C(=O)C[C@@H](Br)NCc1ccc(-n2ccnc2)nc1 | C[C@H]1CCOCCN1C(=O)NCc1ccc(-n2ccnc2)nc1 | C[C@H]1CCOCCN1C(=O)C[C@@H](Br)NCc1ccc(-n2ccnc2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule C[C@H]1CCOCCN1C(=O)NCc1ccc(-n2ccnc2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2CCOCC[C@@H]2C)cc(=O)n1NCc1ccc(-n2ccnc2)nc1 | C[C@H]1CCOCCN1C(=O)NCc1ccc(-n2ccnc2)nc1 | Cc1cc(N2CCOCC[C@@H]2C)cc(=O)n1NCc1ccc(-n2ccnc2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule C[C@H]1CCOCCN1C(=O)NCc1ccc(-n2ccnc2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(N2CCOCC[C@@H]2C)c(=O)ccn1NCc1ccc(-n2ccnc2)nc1 | C[C@H]1CCOCCN1C(=O)NCc1ccc(-n2ccnc2)nc1 | Cc1c(N2CCOCC[C@@H]2C)c(=O)ccn1NCc1ccc(-n2ccnc2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule CCc1cc(=O)oc2cc(C)cc(O[C@H](C)C(=O)NCc3cccnc3)c12 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(=O)oc2cc(C)cc(O[C@H](C)C(=O)NCc3ccccc3)c12 | CCc1cc(=O)oc2cc(C)cc(O[C@H](C)C(=O)NCc3cccnc3)c12 | CCc1cc(=O)oc2cc(C)cc(O[C@H](C)C(=O)NCc3ccccc3)c12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c19cccnc1"
} |
Can you make molecule CCc1cc(=O)oc2cc(C)cc(O[C@H](C)C(=O)NCc3cccnc3)c12 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(=O)oc2cc(C)cc(O[C@H](C)C(=O)NCc3ccc(I)nc3)c12 | CCc1cc(=O)oc2cc(C)cc(O[C@H](C)C(=O)NCc3cccnc3)c12 | CCc1cc(=O)oc2cc(C)cc(O[C@H](C)C(=O)NCc3ccc(I)nc3)c12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)nc1",
"old_substring": "c19cccnc1"
} |
Can you make molecule CCc1cc(=O)oc2cc(C)cc(O[C@H](C)C(=O)NCc3cccnc3)c12 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(=O)oc2cc(C)cc(O[C@H](C)C(=O)NCc3cc4cnsc4s3)c12 | CCc1cc(=O)oc2cc(C)cc(O[C@H](C)C(=O)NCc3cccnc3)c12 | CCc1cc(=O)oc2cc(C)cc(O[C@H](C)C(=O)NCc3cc4cnsc4s3)c12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cnsc2s1",
"old_substring": "c19cccnc1"
} |
Can you make molecule CCc1cc(=O)oc2cc(C)cc(O[C@H](C)C(=O)NCc3cccnc3)c12 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(=O)oc2cc(C)cc(O[C@H](C)C(=O)NCc3ccc(C)nc3C)c12 | CCc1cc(=O)oc2cc(C)cc(O[C@H](C)C(=O)NCc3cccnc3)c12 | CCc1cc(=O)oc2cc(C)cc(O[C@H](C)C(=O)NCc3ccc(C)nc3C)c12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)nc1C",
"old_substring": "c19cccnc1"
} |
Can you make molecule CCc1cc(=O)oc2cc(C)cc(O[C@H](C)C(=O)NCc3cccnc3)c12 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(=O)oc2cc(C)cc(O[C@H](C)C(=O)NCc3ccncc3Cl)c12 | CCc1cc(=O)oc2cc(C)cc(O[C@H](C)C(=O)NCc3cccnc3)c12 | CCc1cc(=O)oc2cc(C)cc(O[C@H](C)C(=O)NCc3ccncc3Cl)c12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c19cccnc1"
} |
Can you make molecule Cc1cc(Br)ccc1N1C[C@H](C)CS1(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)ccc1S(=O)(=O)[C@H](C)CCl | Cc1cc(Br)ccc1N1C[C@H](C)CS1(=O)=O | Cc1cc(Br)ccc1S(=O)(=O)[C@H](C)CCl | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CCl)S&(=O)=O",
"old_substring": "N12C[C@H](C)CS1(=O)=O"
} |
Can you make molecule Cc1cc(Br)ccc1N1C[C@H](C)CS1(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)ccc1N1C[C@@H](C)CC1=O | Cc1cc(Br)ccc1N1C[C@H](C)CS1(=O)=O | Cc1cc(Br)ccc1N1C[C@@H](C)CC1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&C[C@@H](C)CC1=O",
"old_substring": "N12C[C@H](C)CS1(=O)=O"
} |
Can you make molecule Cc1cc(Br)ccc1N1C[C@H](C)CS1(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)ccc1N1C[C@@H](C)OC1=O | Cc1cc(Br)ccc1N1C[C@H](C)CS1(=O)=O | Cc1cc(Br)ccc1N1C[C@@H](C)OC1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&C[C@@H](C)OC1=O",
"old_substring": "N12C[C@H](C)CS1(=O)=O"
} |
Can you make molecule Cc1cc(Br)ccc1N1C[C@H](C)CS1(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)ccc1[C@H](C)CS(C)(=O)=O | Cc1cc(Br)ccc1N1C[C@H](C)CS1(=O)=O | Cc1cc(Br)ccc1[C@H](C)CS(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CS(C)(=O)=O",
"old_substring": "N12C[C@H](C)CS1(=O)=O"
} |
Can you make molecule Cc1cc(Br)ccc1N1C[C@H](C)CS1(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)ccc1S(=O)(=O)CC(C)C | Cc1cc(Br)ccc1N1C[C@H](C)CS1(=O)=O | Cc1cc(Br)ccc1S(=O)(=O)CC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CS&(=O)=O",
"old_substring": "N12C[C@H](C)CS1(=O)=O"
} |
Can you make molecule Cc1nc(NC(=O)c2nn(-c3ccc(Cl)cc3)ccc2=O)sc1C(=O)OCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(NC(=O)c2nn(-c3ccc(Cl)cc3)ccc2=O)sc1C(=O)OC(C)(C)CCBr | Cc1nc(NC(=O)c2nn(-c3ccc(Cl)cc3)ccc2=O)sc1C(=O)OCC(C)C | Cc1nc(NC(=O)c2nn(-c3ccc(Cl)cc3)ccc2=O)sc1C(=O)OC(C)(C)CCBr | 102 | {
"fragment_index": 0,
"new_substring": "CC&(C)CCBr",
"old_substring": "C6C(C)C"
} |
Can you make molecule Cc1nc(NC(=O)c2nn(-c3ccc(Cl)cc3)ccc2=O)sc1C(=O)OCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)OC(=O)c1sc(NC(=O)c2nn(-c3ccc(Cl)cc3)ccc2=O)nc1C | Cc1nc(NC(=O)c2nn(-c3ccc(Cl)cc3)ccc2=O)sc1C(=O)OCC(C)C | CCCC(C)(C)OC(=O)c1sc(NC(=O)c2nn(-c3ccc(Cl)cc3)ccc2=O)nc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "C6C(C)C"
} |
Can you make molecule Cc1nc(NC(=O)c2nn(-c3ccc(Cl)cc3)ccc2=O)sc1C(=O)OCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(NC(=O)c2nn(-c3ccc(Cl)cc3)ccc2=O)sc1C(=O)OCC(C)(C)CBr | Cc1nc(NC(=O)c2nn(-c3ccc(Cl)cc3)ccc2=O)sc1C(=O)OCC(C)C | Cc1nc(NC(=O)c2nn(-c3ccc(Cl)cc3)ccc2=O)sc1C(=O)OCC(C)(C)CBr | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)(C)CBr",
"old_substring": "C6C(C)C"
} |
Can you make molecule Cc1nc(NC(=O)c2nn(-c3ccc(Cl)cc3)ccc2=O)sc1C(=O)OCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(NC(=O)c2nn(-c3ccc(Cl)cc3)ccc2=O)sc1C(=O)OC(C(C)C)C(C)C | Cc1nc(NC(=O)c2nn(-c3ccc(Cl)cc3)ccc2=O)sc1C(=O)OCC(C)C | Cc1nc(NC(=O)c2nn(-c3ccc(Cl)cc3)ccc2=O)sc1C(=O)OC(C(C)C)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&C(C)C",
"old_substring": "C6C(C)C"
} |
Can you make molecule Cc1nc(NC(=O)c2nn(-c3ccc(Cl)cc3)ccc2=O)sc1C(=O)OCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(NC(=O)c2nn(-c3ccc(Cl)cc3)ccc2=O)sc1C(=O)OC(=O)CCCC(C)C | Cc1nc(NC(=O)c2nn(-c3ccc(Cl)cc3)ccc2=O)sc1C(=O)OCC(C)C | Cc1nc(NC(=O)c2nn(-c3ccc(Cl)cc3)ccc2=O)sc1C(=O)OC(=O)CCCC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCCC&=O",
"old_substring": "C6C(C)C"
} |
Can you make molecule O=C(N[C@H]1C[C@@H]2CCCc3cccc1c32)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H]1C[C@@H]2CCCc3cccc1c32)c1ccccc1 | O=C(N[C@H]1C[C@@H]2CCCc3cccc1c32)c1ccccn1 | O=C(N[C@H]1C[C@@H]2CCCc3cccc1c32)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c15ccccn1"
} |
Can you make molecule O=C(N[C@H]1C[C@@H]2CCCc3cccc1c32)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H]1C[C@@H]2CCCc3cccc1c32)c1ccc(I)cn1 | O=C(N[C@H]1C[C@@H]2CCCc3cccc1c32)c1ccccn1 | O=C(N[C@H]1C[C@@H]2CCCc3cccc1c32)c1ccc(I)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cn1",
"old_substring": "c15ccccn1"
} |
Can you make molecule O=C(N[C@H]1C[C@@H]2CCCc3cccc1c32)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H]1C[C@@H]2CCCc3cccc1c32)c1cccc(Cl)n1 | O=C(N[C@H]1C[C@@H]2CCCc3cccc1c32)c1ccccn1 | O=C(N[C@H]1C[C@@H]2CCCc3cccc1c32)c1cccc(Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Cl)n1",
"old_substring": "c15ccccn1"
} |
Can you make molecule O=C(N[C@H]1C[C@@H]2CCCc3cccc1c32)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H]1C[C@@H]2CCCc3cccc1c32)c1cc(Br)ccn1 | O=C(N[C@H]1C[C@@H]2CCCc3cccc1c32)c1ccccn1 | O=C(N[C@H]1C[C@@H]2CCCc3cccc1c32)c1cc(Br)ccn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccn1",
"old_substring": "c15ccccn1"
} |
Can you make molecule O=C(N[C@H]1C[C@@H]2CCCc3cccc1c32)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H]1C[C@@H]2CCCc3cccc1c32)c1cc2sccn2c1 | O=C(N[C@H]1C[C@@H]2CCCc3cccc1c32)c1ccccn1 | O=C(N[C@H]1C[C@@H]2CCCc3cccc1c32)c1cc2sccn2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sccn2c1",
"old_substring": "c15ccccn1"
} |
Can you make molecule CC(C)[C@@H]1C(=O)NCC[NH+]1Cc1cc(F)cc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1NCC[NH+](Cc2cc(F)cc(F)c2)[C@@H]1CCCBr | CC(C)[C@@H]1C(=O)NCC[NH+]1Cc1cc(F)cc(F)c1 | O=C1NCC[NH+](Cc2cc(F)cc(F)c2)[C@@H]1CCCBr | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)[C@@H]1C(=O)NCC[NH+]1Cc1cc(F)cc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@@H]1C(=O)NCC[NH+]1Cc1cc(F)cc(F)c1 | CC(C)[C@@H]1C(=O)NCC[NH+]1Cc1cc(F)cc(F)c1 | CC(C)CC[C@@H]1C(=O)NCC[NH+]1Cc1cc(F)cc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)[C@@H]1C(=O)NCC[NH+]1Cc1cc(F)cc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1NCC[NH+](Cc2cc(F)cc(F)c2)[C@@H]1CCCCBr | CC(C)[C@@H]1C(=O)NCC[NH+]1Cc1cc(F)cc(F)c1 | O=C1NCC[NH+](Cc2cc(F)cc(F)c2)[C@@H]1CCCCBr | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)[C@@H]1C(=O)NCC[NH+]1Cc1cc(F)cc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[C@@H]1C(=O)NCC[NH+]1Cc1cc(F)cc(F)c1 | CC(C)[C@@H]1C(=O)NCC[NH+]1Cc1cc(F)cc(F)c1 | C=CCCC[C@@H]1C(=O)NCC[NH+]1Cc1cc(F)cc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)[C@@H]1C(=O)NCC[NH+]1Cc1cc(F)cc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1NCC[NH+](Cc2cc(F)cc(F)c2)[C@@H]1CCCCCl | CC(C)[C@@H]1C(=O)NCC[NH+]1Cc1cc(F)cc(F)c1 | O=C1NCC[NH+](Cc2cc(F)cc(F)c2)[C@@H]1CCCCCl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CC3C"
} |
Can you make molecule CC[C@H](C)NC(=O)c1sc(C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)c1nc2c(s1)CN(C(=O)c1sc(C)cc1OC)C2 | CC[C@H](C)NC(=O)c1sc(C)cc1OC | CC[C@H](C)c1nc2c(s1)CN(C(=O)c1sc(C)cc1OC)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N24"
} |
Can you make molecule CC[C@H](C)NC(=O)c1sc(C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)n1ncc2c1CN(C(=O)c1sc(C)cc1OC)C2 | CC[C@H](C)NC(=O)c1sc(C)cc1OC | CC[C@H](C)n1ncc2c1CN(C(=O)c1sc(C)cc1OC)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2cnn&c2C1",
"old_substring": "N24"
} |
Can you make molecule CC[C@H](C)NC(=O)c1sc(C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)c1onc2c1CN(C(=O)c1sc(C)cc1OC)CC2 | CC[C@H](C)NC(=O)c1sc(C)cc1OC | CC[C@H](C)c1onc2c1CN(C(=O)c1sc(C)cc1OC)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N24"
} |
Can you make molecule CC[C@H](C)NC(=O)c1sc(C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)c1cc2n(n1)CCCN2C(=O)c1sc(C)cc1OC | CC[C@H](C)NC(=O)c1sc(C)cc1OC | CC[C@H](C)c1cc2n(n1)CCCN2C(=O)c1sc(C)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc21",
"old_substring": "N24"
} |
Can you make molecule CC[C@H](C)NC(=O)c1sc(C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)c1ccc2c(c1)CCN2C(=O)c1sc(C)cc1OC | CC[C@H](C)NC(=O)c1sc(C)cc1OC | CC[C@H](C)c1ccc2c(c1)CCN2C(=O)c1sc(C)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N24"
} |
Can you make molecule C=CCN(C(=O)c1cccc(NC(C)=O)c1)c1nc(-c2ccccc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCN(C(=O)c1cccc(NC(C)=O)c1)c1nc(-c2ccccc2)cs1 | C=CCN(C(=O)c1cccc(NC(C)=O)c1)c1nc(-c2ccccc2)cs1 | C=CCCCN(C(=O)c1cccc(NC(C)=O)c1)c1nc(-c2ccccc2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "C=CC5"
} |
Can you make molecule C=CCN(C(=O)c1cccc(NC(C)=O)c1)c1nc(-c2ccccc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCN(C(=O)c1cccc(NC(C)=O)c1)c1nc(-c2ccccc2)cs1 | C=CCN(C(=O)c1cccc(NC(C)=O)c1)c1nc(-c2ccccc2)cs1 | C=CCCCCN(C(=O)c1cccc(NC(C)=O)c1)c1nc(-c2ccccc2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "C=CC5"
} |
Can you make molecule C=CCN(C(=O)c1cccc(NC(C)=O)c1)c1nc(-c2ccccc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC(=O)N(C(=O)c1cccc(NC(C)=O)c1)c1nc(-c2ccccc2)cs1 | C=CCN(C(=O)c1cccc(NC(C)=O)c1)c1nc(-c2ccccc2)cs1 | C=CCCCC(=O)N(C(=O)c1cccc(NC(C)=O)c1)c1nc(-c2ccccc2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&=O",
"old_substring": "C=CC5"
} |
Can you make molecule C=CCN(C(=O)c1cccc(NC(C)=O)c1)c1nc(-c2ccccc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC(CC=C)N(C(=O)c1cccc(NC(C)=O)c1)c1nc(-c2ccccc2)cs1 | C=CCN(C(=O)c1cccc(NC(C)=O)c1)c1nc(-c2ccccc2)cs1 | C=CCC(CC=C)N(C(=O)c1cccc(NC(C)=O)c1)c1nc(-c2ccccc2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&CC=C",
"old_substring": "C=CC5"
} |
Can you make molecule C=CCN(C(=O)c1cccc(NC(C)=O)c1)c1nc(-c2ccccc2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C=CC1CCN(N(C(=O)c2cccc(NC(C)=O)c2)c2nc(-c3ccccc3)cs2)CC1 | C=CCN(C(=O)c1cccc(NC(C)=O)c1)c1nc(-c2ccccc2)cs1 | C=CC1CCN(N(C(=O)c2cccc(NC(C)=O)c2)c2nc(-c3ccccc3)cs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CC1CCN&CC1",
"old_substring": "C=CC5"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.