prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule O=C(N[C@@H](C(=O)[O-])c1ccccc1)C1CCC(CNC(=O)[C@@H]2Cc3ccccc3C[NH2+]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1NC[C@@H](NC(=O)C2CCC(CNC(=O)[C@@H]3Cc4ccccc4C[NH2+]3)CC2)O1.c1ccccc1 | O=C(N[C@@H](C(=O)[O-])c1ccccc1)C1CCC(CNC(=O)[C@@H]2Cc3ccccc3C[NH2+]2)CC1 | O=C1NC[C@@H](NC(=O)C2CCC(CNC(=O)[C@@H]3Cc4ccccc4C[NH2+]3)CC2)O1.c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CN&C(=O)O1",
"old_substring": "[C@@H]6%11C(=O)[O-]"
} |
Can you make molecule O=C(N[C@@H](C(=O)[O-])c1ccccc1)C1CCC(CNC(=O)[C@@H]2Cc3ccccc3C[NH2+]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@@H]1OCCNC1=O)C1CCC(CNC(=O)[C@@H]2Cc3ccccc3C[NH2+]2)CC1.c1ccccc1 | O=C(N[C@@H](C(=O)[O-])c1ccccc1)C1CCC(CNC(=O)[C@@H]2Cc3ccccc3C[NH2+]2)CC1 | O=C(N[C@@H]1OCCNC1=O)C1CCC(CNC(=O)[C@@H]2Cc3ccccc3C[NH2+]2)CC1.c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&OCCN&C1=O",
"old_substring": "[C@@H]6%11C(=O)[O-]"
} |
Can you make molecule O=C(N[C@@H](C(=O)[O-])c1ccccc1)C1CCC(CNC(=O)[C@@H]2Cc3ccccc3C[NH2+]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H]1O[CH]CO1)C1CCC(CNC(=O)[C@@H]2Cc3ccccc3C[NH2+]2)CC1.c1ccccc1 | O=C(N[C@@H](C(=O)[O-])c1ccccc1)C1CCC(CNC(=O)[C@@H]2Cc3ccccc3C[NH2+]2)CC1 | O=C(N[C@H]1O[CH]CO1)C1CCC(CNC(=O)[C@@H]2Cc3ccccc3C[NH2+]2)CC1.c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&OC[C@H]&O1",
"old_substring": "[C@@H]6%11C(=O)[O-]"
} |
Can you make molecule O=C(N[C@@H](C(=O)[O-])c1ccccc1)C1CCC(CNC(=O)[C@@H]2Cc3ccccc3C[NH2+]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=NO[C@H](NC(=O)C2CCC(CNC(=O)[C@@H]3Cc4ccccc4C[NH2+]3)CC2)N1.c1ccccc1 | O=C(N[C@@H](C(=O)[O-])c1ccccc1)C1CCC(CNC(=O)[C@@H]2Cc3ccccc3C[NH2+]2)CC1 | CC1=NO[C@H](NC(=O)C2CCC(CNC(=O)[C@@H]3Cc4ccccc4C[NH2+]3)CC2)N1.c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&NC(C&)=NO1",
"old_substring": "[C@@H]6%11C(=O)[O-]"
} |
Can you make molecule O=C(N[C@@H](C(=O)[O-])c1ccccc1)C1CCC(CNC(=O)[C@@H]2Cc3ccccc3C[NH2+]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | NC1=NN[C@@H](NC(=O)C2CCC(CNC(=O)[C@@H]3Cc4ccccc4C[NH2+]3)CC2)S1.c1ccccc1 | O=C(N[C@@H](C(=O)[O-])c1ccccc1)C1CCC(CNC(=O)[C@@H]2Cc3ccccc3C[NH2+]2)CC1 | NC1=NN[C@@H](NC(=O)C2CCC(CNC(=O)[C@@H]3Cc4ccccc4C[NH2+]3)CC2)S1.c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&NN=C(N&)S1",
"old_substring": "[C@@H]6%11C(=O)[O-]"
} |
Can you make molecule Cc1ccc(Oc2cccc(C(=O)Nc3nccs3)c2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Oc2cccc(CC(=O)SNc3nccs3)c2)nn1 | Cc1ccc(Oc2cccc(C(=O)Nc3nccs3)c2)nn1 | Cc1ccc(Oc2cccc(CC(=O)SNc3nccs3)c2)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule Cc1ccc(Oc2cccc(C(=O)Nc3nccs3)c2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Oc2cccc(C(=O)CCCC(=O)Nc3nccs3)c2)nn1 | Cc1ccc(Oc2cccc(C(=O)Nc3nccs3)c2)nn1 | Cc1ccc(Oc2cccc(C(=O)CCCC(=O)Nc3nccs3)c2)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C48=O"
} |
Can you make molecule Cc1ccc(Oc2cccc(C(=O)Nc3nccs3)c2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Oc2cccc(C(C)(C)CC(=O)Nc3nccs3)c2)nn1 | Cc1ccc(Oc2cccc(C(=O)Nc3nccs3)c2)nn1 | Cc1ccc(Oc2cccc(C(C)(C)CC(=O)Nc3nccs3)c2)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule Cc1ccc(Oc2cccc(C(=O)Nc3nccs3)c2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Oc2cccc(C(C)(C)CCC(=O)Nc3nccs3)c2)nn1 | Cc1ccc(Oc2cccc(C(=O)Nc3nccs3)c2)nn1 | Cc1ccc(Oc2cccc(C(C)(C)CCC(=O)Nc3nccs3)c2)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule Cc1ccc(Oc2cccc(C(=O)Nc3nccs3)c2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Oc2cccc([C@H](C)C(=O)SNc3nccs3)c2)nn1 | Cc1ccc(Oc2cccc(C(=O)Nc3nccs3)c2)nn1 | Cc1ccc(Oc2cccc([C@H](C)C(=O)SNc3nccs3)c2)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C48=O"
} |
Can you make molecule CCCCC(=O)OCc1nc2scc(-c3ccccc3)c2c(=O)[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)OC(=S)SCc1nc2scc(-c3ccccc3)c2c(=O)[nH]1 | CCCCC(=O)OCc1nc2scc(-c3ccccc3)c2c(=O)[nH]1 | CCCCC(=O)OC(=S)SCc1nc2scc(-c3ccccc3)c2c(=O)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O45"
} |
Can you make molecule CCCCC(=O)OCc1nc2scc(-c3ccccc3)c2c(=O)[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)C(=O)/C=C/SCc1nc2scc(-c3ccccc3)c2c(=O)[nH]1 | CCCCC(=O)OCc1nc2scc(-c3ccccc3)c2c(=O)[nH]1 | CCCCC(=O)C(=O)/C=C/SCc1nc2scc(-c3ccccc3)c2c(=O)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O45"
} |
Can you make molecule CCCCC(=O)OCc1nc2scc(-c3ccccc3)c2c(=O)[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)[C@H](O)CCCCc1nc2scc(-c3ccccc3)c2c(=O)[nH]1 | CCCCC(=O)OCc1nc2scc(-c3ccccc3)c2c(=O)[nH]1 | CCCCC(=O)[C@H](O)CCCCc1nc2scc(-c3ccccc3)c2c(=O)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CCC&",
"old_substring": "O45"
} |
Can you make molecule CCCCC(=O)OCc1nc2scc(-c3ccccc3)c2c(=O)[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)c1cnn(Cc2nc3scc(-c4ccccc4)c3c(=O)[nH]2)c(=O)c1 | CCCCC(=O)OCc1nc2scc(-c3ccccc3)c2c(=O)[nH]1 | CCCCC(=O)c1cnn(Cc2nc3scc(-c4ccccc4)c3c(=O)[nH]2)c(=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=c1cc&cnn1&",
"old_substring": "O45"
} |
Can you make molecule CCCCC(=O)OCc1nc2scc(-c3ccccc3)c2c(=O)[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)c1nc(Cc2nc3scc(-c4ccccc4)c3c(=O)[nH]2)c(C=O)s1 | CCCCC(=O)OCc1nc2scc(-c3ccccc3)c2c(=O)[nH]1 | CCCCC(=O)c1nc(Cc2nc3scc(-c4ccccc4)c3c(=O)[nH]2)c(C=O)s1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O45"
} |
Can you make molecule Cc1nc(-c2cnn(C)c2)sc1C(=O)Oc1cc(F)cc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2cnn(C)c2)sc1CC(=O)SOc1cc(F)cc(Br)c1 | Cc1nc(-c2cnn(C)c2)sc1C(=O)Oc1cc(F)cc(Br)c1 | Cc1nc(-c2cnn(C)c2)sc1CC(=O)SOc1cc(F)cc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1nc(-c2cnn(C)c2)sc1C(=O)Oc1cc(F)cc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2cnn(C)c2)sc1C(=O)CCCC(=O)Oc1cc(F)cc(Br)c1 | Cc1nc(-c2cnn(C)c2)sc1C(=O)Oc1cc(F)cc(Br)c1 | Cc1nc(-c2cnn(C)c2)sc1C(=O)CCCC(=O)Oc1cc(F)cc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule Cc1nc(-c2cnn(C)c2)sc1C(=O)Oc1cc(F)cc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2cnn(C)c2)sc1C(C)(C)CC(=O)Oc1cc(F)cc(Br)c1 | Cc1nc(-c2cnn(C)c2)sc1C(=O)Oc1cc(F)cc(Br)c1 | Cc1nc(-c2cnn(C)c2)sc1C(C)(C)CC(=O)Oc1cc(F)cc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1nc(-c2cnn(C)c2)sc1C(=O)Oc1cc(F)cc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2cnn(C)c2)sc1C(C)(C)CCC(=O)Oc1cc(F)cc(Br)c1 | Cc1nc(-c2cnn(C)c2)sc1C(=O)Oc1cc(F)cc(Br)c1 | Cc1nc(-c2cnn(C)c2)sc1C(C)(C)CCC(=O)Oc1cc(F)cc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1nc(-c2cnn(C)c2)sc1C(=O)Oc1cc(F)cc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2cnn(C)c2)sc1[C@H](C)C(=O)SOc1cc(F)cc(Br)c1 | Cc1nc(-c2cnn(C)c2)sc1C(=O)Oc1cc(F)cc(Br)c1 | Cc1nc(-c2cnn(C)c2)sc1[C@H](C)C(=O)SOc1cc(F)cc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule CC(=O)Oc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)Oc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 | CC(=O)Oc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 | CCCC(=O)Oc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Oc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SOc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 | CC(=O)Oc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 | CC(=O)SOc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Oc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Oc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 | CC(=O)Oc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 | CCCCC(=O)Oc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Oc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CCCOc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 | CC(=O)Oc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 | CC(=O)CCCOc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)CCC&",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Oc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)CCCOc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 | CC(=O)Oc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 | CCC(=O)CCCOc1ccc(C(=O)NNC(=O)c2cccnc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC(=O)CCC&",
"old_substring": "CC3=O"
} |
Can you make molecule Cc1c(F)cccc1NC(=O)NCCCC[NH+]1CCC[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(F)cccc1NC(=O)CC(C)(C)NCCCC[NH+]1CCC[C@@H](C)C1 | Cc1c(F)cccc1NC(=O)NCCCC[NH+]1CCC[C@@H](C)C1 | Cc1c(F)cccc1NC(=O)CC(C)(C)NCCCC[NH+]1CCC[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule Cc1c(F)cccc1NC(=O)NCCCC[NH+]1CCC[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(F)cccc1NC(=O)CCC(C)(C)NCCCC[NH+]1CCC[C@@H](C)C1 | Cc1c(F)cccc1NC(=O)NCCCC[NH+]1CCC[C@@H](C)C1 | Cc1c(F)cccc1NC(=O)CCC(C)(C)NCCCC[NH+]1CCC[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule Cc1c(F)cccc1NC(=O)NCCCC[NH+]1CCC[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(F)cccc1NC(=O)C[C@@H](Br)NCCCC[NH+]1CCC[C@@H](C)C1 | Cc1c(F)cccc1NC(=O)NCCCC[NH+]1CCC[C@@H](C)C1 | Cc1c(F)cccc1NC(=O)C[C@@H](Br)NCCCC[NH+]1CCC[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule Cc1c(F)cccc1NC(=O)NCCCC[NH+]1CCC[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(F)cccc1Nc1cc(C)n(NCCCC[NH+]2CCC[C@@H](C)C2)c(=O)c1 | Cc1c(F)cccc1NC(=O)NCCCC[NH+]1CCC[C@@H](C)C1 | Cc1c(F)cccc1Nc1cc(C)n(NCCCC[NH+]2CCC[C@@H](C)C2)c(=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C23=O"
} |
Can you make molecule Cc1c(F)cccc1NC(=O)NCCCC[NH+]1CCC[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(F)cccc1Nc1c(C)n(NCCCC[NH+]2CCC[C@@H](C)C2)ccc1=O | Cc1c(F)cccc1NC(=O)NCCCC[NH+]1CCC[C@@H](C)C1 | Cc1c(F)cccc1Nc1c(C)n(NCCCC[NH+]2CCC[C@@H](C)C2)ccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C23=O"
} |
Can you make molecule Cc1cn2c([nH+]1)CC[C@H](NS(=O)(=O)N1CCO[C@H](C)C1)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(n1NS(=O)(=O)N1CCO[C@H](C)C1)CCCC2 | Cc1cn2c([nH+]1)CC[C@H](NS(=O)(=O)N1CCO[C@H](C)C1)C2 | Cc1cc2c(n1NS(=O)(=O)N1CCO[C@H](C)C1)CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc2c(n1&)CCCC2",
"old_substring": "Cc1cn2c([nH+]1)CC[C@H]3C2"
} |
Can you make molecule Cc1cn2c([nH+]1)CC[C@H](NS(=O)(=O)N1CCO[C@H](C)C1)C2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN(S(=O)(=O)Nc2nc3c([nH]2)CCCC3)CCO1 | Cc1cn2c([nH+]1)CC[C@H](NS(=O)(=O)N1CCO[C@H](C)C1)C2 | C[C@@H]1CN(S(=O)(=O)Nc2nc3c([nH]2)CCCC3)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2c([nH]1)CCCC2",
"old_substring": "Cc1cn2c([nH+]1)CC[C@H]3C2"
} |
Can you make molecule Cc1cn2c([nH+]1)CC[C@H](NS(=O)(=O)N1CCO[C@H](C)C1)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(cc1NS(=O)(=O)N1CCO[C@H](C)C1)CCCC2 | Cc1cn2c([nH+]1)CC[C@H](NS(=O)(=O)N1CCO[C@H](C)C1)C2 | Cc1cc2c(cc1NS(=O)(=O)N1CCO[C@H](C)C1)CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc2c(cc1&)CCCC2",
"old_substring": "Cc1cn2c([nH+]1)CC[C@H]3C2"
} |
Can you make molecule Cc1cn2c([nH+]1)CC[C@H](NS(=O)(=O)N1CCO[C@H](C)C1)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(NS(=O)(=O)N2CCO[C@H](C)C2)nc2c1CCCC2 | Cc1cn2c([nH+]1)CC[C@H](NS(=O)(=O)N1CCO[C@H](C)C1)C2 | Cc1nc(NS(=O)(=O)N2CCO[C@H](C)C2)nc2c1CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc&nc2c1CCCC2",
"old_substring": "Cc1cn2c([nH+]1)CC[C@H]3C2"
} |
Can you make molecule Cc1cn2c([nH+]1)CC[C@H](NS(=O)(=O)N1CCO[C@H](C)C1)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc2nc(NS(=O)(=O)N3CCO[C@H](C)C3)[nH]c12 | Cc1cn2c([nH+]1)CC[C@H](NS(=O)(=O)N1CCO[C@H](C)C1)C2 | Cc1cccc2nc(NS(=O)(=O)N3CCO[C@H](C)C3)[nH]c12 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cccc2nc&[nH]c12",
"old_substring": "Cc1cn2c([nH+]1)CC[C@H]3C2"
} |
Can you make molecule NC(=O)c1ccsc1NC(=O)COC(=O)c1cccc(-n2cccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1ccsc1NSC(=O)COC(=O)c1cccc(-n2cccc2)c1 | NC(=O)c1ccsc1NC(=O)COC(=O)c1cccc(-n2cccc2)c1 | NC(=O)c1ccsc1NSC(=O)COC(=O)c1cccc(-n2cccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C4(=O)C5"
} |
Can you make molecule NC(=O)c1ccsc1NC(=O)COC(=O)c1cccc(-n2cccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1ccsc1NC(=O)CCCC(=O)OC(=O)c1cccc(-n2cccc2)c1 | NC(=O)c1ccsc1NC(=O)COC(=O)c1cccc(-n2cccc2)c1 | NC(=O)c1ccsc1NC(=O)CCCC(=O)OC(=O)c1cccc(-n2cccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C4(=O)C5"
} |
Can you make molecule NC(=O)c1ccsc1NC(=O)COC(=O)c1cccc(-n2cccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)Nc1sccc1C(N)=O)OC(=O)c1cccc(-n2cccc2)c1 | NC(=O)c1ccsc1NC(=O)COC(=O)c1cccc(-n2cccc2)c1 | CC(C)(CC(=O)Nc1sccc1C(N)=O)OC(=O)c1cccc(-n2cccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)C5"
} |
Can you make molecule NC(=O)c1ccsc1NC(=O)COC(=O)c1cccc(-n2cccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1ccsc1NC[S@+]([O-])CCCOC(=O)c1cccc(-n2cccc2)c1 | NC(=O)c1ccsc1NC(=O)COC(=O)c1cccc(-n2cccc2)c1 | NC(=O)c1ccsc1NC[S@+]([O-])CCCOC(=O)c1cccc(-n2cccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C4(=O)C5"
} |
Can you make molecule NC(=O)c1ccsc1NC(=O)COC(=O)c1cccc(-n2cccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)Nc1sccc1C(N)=O)OC(=O)c1cccc(-n2cccc2)c1 | NC(=O)c1ccsc1NC(=O)COC(=O)c1cccc(-n2cccc2)c1 | CC(C)(CCC(=O)Nc1sccc1C(N)=O)OC(=O)c1cccc(-n2cccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C4(=O)C5"
} |
Can you make molecule Cc1cc(C(=O)NCC2CCN(C(=O)Cc3cccs3)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccoc1C(=O)NCC1CCN(C(=O)Cc2cccs2)CC1 | Cc1cc(C(=O)NCC2CCN(C(=O)Cc3cccs3)CC2)no1 | Cc1ccoc1C(=O)NCC1CCN(C(=O)Cc2cccs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccoc1&",
"old_substring": "Cc1cc7no1"
} |
Can you make molecule Cc1cc(C(=O)NCC2CCN(C(=O)Cc3cccs3)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(C(=O)NCC3CCN(C(=O)Cc4cccs4)CC3)oc2c1 | Cc1cc(C(=O)NCC2CCN(C(=O)Cc3cccs3)CC2)no1 | Cc1ccc2nc(C(=O)NCC3CCN(C(=O)Cc4cccs4)CC3)oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc2nc&oc2c1",
"old_substring": "Cc1cc7no1"
} |
Can you make molecule Cc1cc(C(=O)NCC2CCN(C(=O)Cc3cccs3)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)NCC2CCN(C(=O)Cc3cccs3)CC2)ncc1Br | Cc1cc(C(=O)NCC2CCN(C(=O)Cc3cccs3)CC2)no1 | Cc1cc(C(=O)NCC2CCN(C(=O)Cc3cccs3)CC2)ncc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&ncc1Br",
"old_substring": "Cc1cc7no1"
} |
Can you make molecule Cc1cc(C(=O)NCC2CCN(C(=O)Cc3cccs3)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)n1C(=O)NCC1CCN(C(=O)Cc2cccs2)CC1 | Cc1cc(C(=O)NCC2CCN(C(=O)Cc3cccs3)CC2)no1 | Cc1ccc(C)n1C(=O)NCC1CCN(C(=O)Cc2cccs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(C)n1&",
"old_substring": "Cc1cc7no1"
} |
Can you make molecule Cc1cc(C(=O)NCC2CCN(C(=O)Cc3cccs3)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)NCC2CCN(C(=O)Cc3cccs3)CC2)cnc1Cl | Cc1cc(C(=O)NCC2CCN(C(=O)Cc3cccs3)CC2)no1 | Cc1cc(C(=O)NCC2CCN(C(=O)Cc3cccs3)CC2)cnc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cnc1Cl",
"old_substring": "Cc1cc7no1"
} |
Can you make molecule CCc1nc2n(n1)[C@@H](CC(=O)Nc1ccccc1OC)C(=O)N2 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2n(n1)[C@@H](CC(=O)c1nsc(-c3ccccc3OC)c1N)C(=O)N2 | CCc1nc2n(n1)[C@@H](CC(=O)Nc1ccccc1OC)C(=O)N2 | CCc1nc2n(n1)[C@@H](CC(=O)c1nsc(-c3ccccc3OC)c1N)C(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N35"
} |
Can you make molecule CCc1nc2n(n1)[C@@H](CC(=O)Nc1ccccc1OC)C(=O)N2 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2n(n1)[C@@H](CC(=O)N(C)C(=S)Sc1ccccc1OC)C(=O)N2 | CCc1nc2n(n1)[C@@H](CC(=O)Nc1ccccc1OC)C(=O)N2 | CCc1nc2n(n1)[C@@H](CC(=O)N(C)C(=S)Sc1ccccc1OC)C(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N35"
} |
Can you make molecule CCc1nc2n(n1)[C@@H](CC(=O)Nc1ccccc1OC)C(=O)N2 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2n(n1)[C@@H](CC(=O)c1cc(-c3ccccc3OC)c(N)o1)C(=O)N2 | CCc1nc2n(n1)[C@@H](CC(=O)Nc1ccccc1OC)C(=O)N2 | CCc1nc2n(n1)[C@@H](CC(=O)c1cc(-c3ccccc3OC)c(N)o1)C(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N35"
} |
Can you make molecule CCc1nc2n(n1)[C@@H](CC(=O)Nc1ccccc1OC)C(=O)N2 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2n(n1)[C@@H](CC(=O)N1CCN=C1Sc1ccccc1OC)C(=O)N2 | CCc1nc2n(n1)[C@@H](CC(=O)Nc1ccccc1OC)C(=O)N2 | CCc1nc2n(n1)[C@@H](CC(=O)N1CCN=C1Sc1ccccc1OC)C(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N35"
} |
Can you make molecule CCc1nc2n(n1)[C@@H](CC(=O)Nc1ccccc1OC)C(=O)N2 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2n(n1)[C@@H](CC(=O)CN1CCC(c3ccccc3OC)CC1)C(=O)N2 | CCc1nc2n(n1)[C@@H](CC(=O)Nc1ccccc1OC)C(=O)N2 | CCc1nc2n(n1)[C@@H](CC(=O)CN1CCC(c3ccccc3OC)CC1)C(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N35"
} |
Can you make molecule N#Cc1cccc(NS(=O)(=O)c2ccccc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1cccc(NS(=O)(=O)c2ccccc2F)c1Br | N#Cc1cccc(NS(=O)(=O)c2ccccc2F)c1 | N#Cc1cccc(NS(=O)(=O)c2ccccc2F)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cccc&c1Br",
"old_substring": "N#Cc1cccc4c1"
} |
Can you make molecule N#Cc1cccc(NS(=O)(=O)c2ccccc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(Cl)c(NS(=O)(=O)c2ccccc2F)c1 | N#Cc1cccc(NS(=O)(=O)c2ccccc2F)c1 | N#Cc1ccc(Cl)c(NS(=O)(=O)c2ccccc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1ccc(Cl)c&c1",
"old_substring": "N#Cc1cccc4c1"
} |
Can you make molecule N#Cc1cccc(NS(=O)(=O)c2ccccc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1cc(F)c(NS(=O)(=O)c2ccccc2F)cc1Cl | N#Cc1cccc(NS(=O)(=O)c2ccccc2F)c1 | N#Cc1cc(F)c(NS(=O)(=O)c2ccccc2F)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc(F)c&cc1Cl",
"old_substring": "N#Cc1cccc4c1"
} |
Can you make molecule N#Cc1cccc(NS(=O)(=O)c2ccccc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC(=NS(=O)(=O)c1ccccc1F)c1ccc(F)cc1 | N#Cc1cccc(NS(=O)(=O)c2ccccc2F)c1 | N#CC(=NS(=O)(=O)c1ccccc1F)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC=&c1ccc(F)cc1",
"old_substring": "N#Cc1cccc4c1"
} |
Can you make molecule N#Cc1cccc(NS(=O)(=O)c2ccccc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC(=NS(=O)(=O)c1ccccc1F)c1cccc(F)c1 | N#Cc1cccc(NS(=O)(=O)c2ccccc2F)c1 | N#CC(=NS(=O)(=O)c1ccccc1F)c1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC=&c1cccc(F)c1",
"old_substring": "N#Cc1cccc4c1"
} |
Can you make molecule Fc1cccc([C@H](C[NH2+]C2CC2)Cc2cccs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cccc([C@H](C[NH2+]C2SCCS2)Cc2cccs2)c1 | Fc1cccc([C@H](C[NH2+]C2CC2)Cc2cccs2)c1 | Fc1cccc([C@H](C[NH2+]C2SCCS2)Cc2cccs2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C14CC1"
} |
Can you make molecule Fc1cccc([C@H](C[NH2+]C2CC2)Cc2cccs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cccc([C@H](C[NH2+]C2CCCCC2)Cc2cccs2)c1 | Fc1cccc([C@H](C[NH2+]C2CC2)Cc2cccs2)c1 | Fc1cccc([C@H](C[NH2+]C2CCCCC2)Cc2cccs2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C14CC1"
} |
Can you make molecule Fc1cccc([C@H](C[NH2+]C2CC2)Cc2cccs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cccc([C@H](C[NH2+]C2SCCCS2)Cc2cccs2)c1 | Fc1cccc([C@H](C[NH2+]C2CC2)Cc2cccs2)c1 | Fc1cccc([C@H](C[NH2+]C2SCCCS2)Cc2cccs2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C14CC1"
} |
Can you make molecule Fc1cccc([C@H](C[NH2+]C2CC2)Cc2cccs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cccc([C@H](C[NH2+]C2SCSCS2)Cc2cccs2)c1 | Fc1cccc([C@H](C[NH2+]C2CC2)Cc2cccs2)c1 | Fc1cccc([C@H](C[NH2+]C2SCSCS2)Cc2cccs2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C14CC1"
} |
Can you make molecule Fc1cccc([C@H](C[NH2+]C2CC2)Cc2cccs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cccc([C@H](C[NH2+]C2CCCCCC2)Cc2cccs2)c1 | Fc1cccc([C@H](C[NH2+]C2CC2)Cc2cccs2)c1 | Fc1cccc([C@H](C[NH2+]C2CCCCCC2)Cc2cccs2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C14CC1"
} |
Can you make molecule CC(C)C(=O)Nc1ccc(S(=O)(=O)NCC2CCN(c3ncccc3C#N)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(N2CCC(CNS(=O)(=O)c3ccc(NC(=O)C(C)C)cc3)CC2)c1C#N | CC(C)C(=O)Nc1ccc(S(=O)(=O)NCC2CCN(c3ncccc3C#N)CC2)cc1 | Cc1cccc(N2CCC(CNS(=O)(=O)c3ccc(NC(=O)C(C)C)cc3)CC2)c1C#N | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cccc&c1C#N",
"old_substring": "c17ncccc1C#N"
} |
Can you make molecule CC(C)C(=O)Nc1ccc(S(=O)(=O)NCC2CCN(c3ncccc3C#N)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(=O)Nc1ccc(S(=O)(=O)NCC2CCN(c3ccc(F)cc3C#N)CC2)cc1 | CC(C)C(=O)Nc1ccc(S(=O)(=O)NCC2CCN(c3ncccc3C#N)CC2)cc1 | CC(C)C(=O)Nc1ccc(S(=O)(=O)NCC2CCN(c3ccc(F)cc3C#N)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1C#N",
"old_substring": "c17ncccc1C#N"
} |
Can you make molecule CC(C)C(=O)Nc1ccc(S(=O)(=O)NCC2CCN(c3ncccc3C#N)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(=O)Nc1ccc(S(=O)(=O)NCC2CCN(c3cccc(F)c3C#N)CC2)cc1 | CC(C)C(=O)Nc1ccc(S(=O)(=O)NCC2CCN(c3ncccc3C#N)CC2)cc1 | CC(C)C(=O)Nc1ccc(S(=O)(=O)NCC2CCN(c3cccc(F)c3C#N)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(F)c1C#N",
"old_substring": "c17ncccc1C#N"
} |
Can you make molecule CC(C)C(=O)Nc1ccc(S(=O)(=O)NCC2CCN(c3ncccc3C#N)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(=O)Nc1ccc(S(=O)(=O)NCC2CCN(c3cc(Br)ccc3C#N)CC2)cc1 | CC(C)C(=O)Nc1ccc(S(=O)(=O)NCC2CCN(c3ncccc3C#N)CC2)cc1 | CC(C)C(=O)Nc1ccc(S(=O)(=O)NCC2CCN(c3cc(Br)ccc3C#N)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1C#N",
"old_substring": "c17ncccc1C#N"
} |
Can you make molecule CC(C)C(=O)Nc1ccc(S(=O)(=O)NCC2CCN(c3ncccc3C#N)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(=O)Nc1ccc(S(=O)(=O)NCC2CCN(c3ccc(Br)cc3C#N)CC2)cc1 | CC(C)C(=O)Nc1ccc(S(=O)(=O)NCC2CCN(c3ncccc3C#N)CC2)cc1 | CC(C)C(=O)Nc1ccc(S(=O)(=O)NCC2CCN(c3ccc(Br)cc3C#N)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1C#N",
"old_substring": "c17ncccc1C#N"
} |
Can you make molecule CNC(=O)CN1CCN(C(=O)c2nc(C)n[nH]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CN1CCN(SC(=O)Cc2nc(C)n[nH]2)CC1 | CNC(=O)CN1CCN(C(=O)c2nc(C)n[nH]2)CC1 | CNC(=O)CN1CCN(SC(=O)Cc2nc(C)n[nH]2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule CNC(=O)CN1CCN(C(=O)c2nc(C)n[nH]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CN1CCN(C(=O)CCCC(=O)c2nc(C)n[nH]2)CC1 | CNC(=O)CN1CCN(C(=O)c2nc(C)n[nH]2)CC1 | CNC(=O)CN1CCN(C(=O)CCCC(=O)c2nc(C)n[nH]2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule CNC(=O)CN1CCN(C(=O)c2nc(C)n[nH]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CN1CCN(C(=O)CC(C)(C)c2nc(C)n[nH]2)CC1 | CNC(=O)CN1CCN(C(=O)c2nc(C)n[nH]2)CC1 | CNC(=O)CN1CCN(C(=O)CC(C)(C)c2nc(C)n[nH]2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CNC(=O)CN1CCN(C(=O)c2nc(C)n[nH]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CN1CCN(C(=O)CCC(C)(C)c2nc(C)n[nH]2)CC1 | CNC(=O)CN1CCN(C(=O)c2nc(C)n[nH]2)CC1 | CNC(=O)CN1CCN(C(=O)CCC(C)(C)c2nc(C)n[nH]2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CNC(=O)CN1CCN(C(=O)c2nc(C)n[nH]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CN1CCN(SC(=O)[C@@H](C)c2nc(C)n[nH]2)CC1 | CNC(=O)CN1CCN(C(=O)c2nc(C)n[nH]2)CC1 | CNC(=O)CN1CCN(SC(=O)[C@@H](C)c2nc(C)n[nH]2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule C[C@H]1CC[C@H]([C@H](O)C2([NH+]3CCCC3)CCCC2)C[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@H]([C@H](O)C2([NH+]3CCCCCC3)CCCC2)C[C@@H]1C | C[C@H]1CC[C@H]([C@H](O)C2([NH+]3CCCC3)CCCC2)C[C@@H]1C | C[C@H]1CC[C@H]([C@H](O)C2([NH+]3CCCCCC3)CCCC2)C[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCCCC1",
"old_substring": "[NH+]14CCCC1"
} |
Can you make molecule C[C@H]1CC[C@H]([C@H](O)C2([NH+]3CCCC3)CCCC2)C[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@H]([C@H](O)C2([NH+]3CCCCCCC3)CCCC2)C[C@@H]1C | C[C@H]1CC[C@H]([C@H](O)C2([NH+]3CCCC3)CCCC2)C[C@@H]1C | C[C@H]1CC[C@H]([C@H](O)C2([NH+]3CCCCCCC3)CCCC2)C[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCCCCC1",
"old_substring": "[NH+]14CCCC1"
} |
Can you make molecule C[C@H]1CC[C@H]([C@H](O)C2([NH+]3CCCC3)CCCC2)C[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@H]([C@H](O)C2([NH+]3CCCC3(C)C)CCCC2)C[C@@H]1C | C[C@H]1CC[C@H]([C@H](O)C2([NH+]3CCCC3)CCCC2)C[C@@H]1C | C[C@H]1CC[C@H]([C@H](O)C2([NH+]3CCCC3(C)C)CCCC2)C[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC1(C)C",
"old_substring": "[NH+]14CCCC1"
} |
Can you make molecule C[C@H]1CC[C@H]([C@H](O)C2([NH+]3CCCC3)CCCC2)C[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[NH+]1C1([C@@H](O)[C@H]2CC[C@H](C)[C@@H](C)C2)CCCC1 | C[C@H]1CC[C@H]([C@H](O)C2([NH+]3CCCC3)CCCC2)C[C@@H]1C | C[C@@H]1CCCC[NH+]1C1([C@@H](O)[C@H]2CC[C@H](C)[C@@H](C)C2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC[C@H]1C",
"old_substring": "[NH+]14CCCC1"
} |
Can you make molecule C[C@H]1CC[C@H]([C@H](O)C2([NH+]3CCCC3)CCCC2)C[C@@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@H]([C@H](O)C2([NH+]3CCC(C)(C)C3)CCCC2)C[C@@H]1C | C[C@H]1CC[C@H]([C@H](O)C2([NH+]3CCCC3)CCCC2)C[C@@H]1C | C[C@H]1CC[C@H]([C@H](O)C2([NH+]3CCC(C)(C)C3)CCCC2)C[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC(C)(C)C1",
"old_substring": "[NH+]14CCCC1"
} |
Can you make molecule CC(C)(C)c1ccc(C(=O)N(Cc2cccnc2)c2nc3ccc(S(C)(=O)=O)cc3s2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1ccc(C(=O)N(Cc2cccnc2)c2nc3ccc(S(C)(=O)=O)cc3s2)cc1I | CC(C)(C)c1ccc(C(=O)N(Cc2cccnc2)c2nc3ccc(S(C)(=O)=O)cc3s2)cc1 | CC(C)(C)c1ccc(C(=O)N(Cc2cccnc2)c2nc3ccc(S(C)(=O)=O)cc3s2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c18ccc7cc1"
} |
Can you make molecule CC(C)(C)c1ccc(C(=O)N(Cc2cccnc2)c2nc3ccc(S(C)(=O)=O)cc3s2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1cc(C(=O)N(Cc2cccnc2)c2nc3ccc(S(C)(=O)=O)cc3s2)ccc1Br | CC(C)(C)c1ccc(C(=O)N(Cc2cccnc2)c2nc3ccc(S(C)(=O)=O)cc3s2)cc1 | CC(C)(C)c1cc(C(=O)N(Cc2cccnc2)c2nc3ccc(S(C)(=O)=O)cc3s2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c18ccc7cc1"
} |
Can you make molecule CC(C)(C)c1ccc(C(=O)N(Cc2cccnc2)c2nc3ccc(S(C)(=O)=O)cc3s2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1ccc(C(=O)N(Cc2cccnc2)c2nc3ccc(S(C)(=O)=O)cc3s2)cc1Cl | CC(C)(C)c1ccc(C(=O)N(Cc2cccnc2)c2nc3ccc(S(C)(=O)=O)cc3s2)cc1 | CC(C)(C)c1ccc(C(=O)N(Cc2cccnc2)c2nc3ccc(S(C)(=O)=O)cc3s2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c18ccc7cc1"
} |
Can you make molecule CC(C)(C)c1ccc(C(=O)N(Cc2cccnc2)c2nc3ccc(S(C)(=O)=O)cc3s2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1cccc(C(=O)N(Cc2cccnc2)c2nc3ccc(S(C)(=O)=O)cc3s2)c1Br | CC(C)(C)c1ccc(C(=O)N(Cc2cccnc2)c2nc3ccc(S(C)(=O)=O)cc3s2)cc1 | CC(C)(C)c1cccc(C(=O)N(Cc2cccnc2)c2nc3ccc(S(C)(=O)=O)cc3s2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c18ccc7cc1"
} |
Can you make molecule CC(C)(C)c1ccc(C(=O)N(Cc2cccnc2)c2nc3ccc(S(C)(=O)=O)cc3s2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1cccc(C(=O)N(Cc2cccnc2)c2nc3ccc(S(C)(=O)=O)cc3s2)c1Cl | CC(C)(C)c1ccc(C(=O)N(Cc2cccnc2)c2nc3ccc(S(C)(=O)=O)cc3s2)cc1 | CC(C)(C)c1cccc(C(=O)N(Cc2cccnc2)c2nc3ccc(S(C)(=O)=O)cc3s2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c18ccc7cc1"
} |
Can you make molecule CC(C)c1ccc([C@H]2C[C@@H]2C(=O)N2CCN(CC(N)=O)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc([C@H]2C[C@@H]2C(=O)N2CCN(CCCCC(N)=O)CC2)cc1 | CC(C)c1ccc([C@H]2C[C@@H]2C(=O)N2CCN(CC(N)=O)CC2)cc1 | CC(C)c1ccc([C@H]2C[C@@H]2C(=O)N2CCN(CCCCC(N)=O)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C4C(N)=O"
} |
Can you make molecule CC(C)c1ccc([C@H]2C[C@@H]2C(=O)N2CCN(CC(N)=O)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc([C@H]2C[C@@H]2C(=O)N2CCN(CC(N)=S)CC2)cc1 | CC(C)c1ccc([C@H]2C[C@@H]2C(=O)N2CCN(CC(N)=O)CC2)cc1 | CC(C)c1ccc([C@H]2C[C@@H]2C(=O)N2CCN(CC(N)=S)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(N)=S",
"old_substring": "C4C(N)=O"
} |
Can you make molecule CC(C)c1ccc([C@H]2C[C@@H]2C(=O)N2CCN(CC(N)=O)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CN1CCN(C(=O)[C@H]2C[C@@H]2c2ccc(C(C)C)cc2)CC1 | CC(C)c1ccc([C@H]2C[C@@H]2C(=O)N2CCN(CC(N)=O)CC2)cc1 | CC(=O)CN1CCN(C(=O)[C@H]2C[C@@H]2c2ccc(C(C)C)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)=O",
"old_substring": "C4C(N)=O"
} |
Can you make molecule CC(C)c1ccc([C@H]2C[C@@H]2C(=O)N2CCN(CC(N)=O)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc([C@H]2C[C@@H]2C(=O)N2CCN(CC/C(N)=N/O)CC2)cc1 | CC(C)c1ccc([C@H]2C[C@@H]2C(=O)N2CCN(CC(N)=O)CC2)cc1 | CC(C)c1ccc([C@H]2C[C@@H]2C(=O)N2CCN(CC/C(N)=N/O)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N/O",
"old_substring": "C4C(N)=O"
} |
Can you make molecule CC(C)c1ccc([C@H]2C[C@@H]2C(=O)N2CCN(CC(N)=O)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc([C@H]2C[C@@H]2C(=O)N2CCN(CC/C(N)=N\O)CC2)cc1 | CC(C)c1ccc([C@H]2C[C@@H]2C(=O)N2CCN(CC(N)=O)CC2)cc1 | CC(C)c1ccc([C@H]2C[C@@H]2C(=O)N2CCN(CC/C(N)=N\O)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N\\O",
"old_substring": "C4C(N)=O"
} |
Can you make molecule Cc1ccc(C)c(N2C[C@@H](C(=O)Nc3nnc(CCNC(=O)c4ccccc4Cl)s3)CC2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)c1ccccc1Cl.Cc1ccc(C)c(N2C[C@@H](C(=O)Nc3nncs3)CC2=O)c1 | Cc1ccc(C)c(N2C[C@@H](C(=O)Nc3nnc(CCNC(=O)c4ccccc4Cl)s3)CC2=O)c1 | CCNC(=O)c1ccccc1Cl.Cc1ccc(C)c(N2C[C@@H](C(=O)Nc3nncs3)CC2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc&s1",
"old_substring": "c18nnc%11s1"
} |
Can you make molecule Cc1ccc(C)c(N2C[C@@H](C(=O)Nc3nnc(CCNC(=O)c4ccccc4Cl)s3)CC2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)c1ccccc1Cl.Cc1ccc(C)c(N2C[C@@H](C(=O)Nc3nn4cc(C)nc4s3)CC2=O)c1 | Cc1ccc(C)c(N2C[C@@H](C(=O)Nc3nnc(CCNC(=O)c4ccccc4Cl)s3)CC2=O)c1 | CCNC(=O)c1ccccc1Cl.Cc1ccc(C)c(N2C[C@@H](C(=O)Nc3nn4cc(C)nc4s3)CC2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn2c&c(C)nc2s1",
"old_substring": "c18nnc%11s1"
} |
Can you make molecule Cc1ccc(C)c(N2C[C@@H](C(=O)Nc3nnc(CCNC(=O)c4ccccc4Cl)s3)CC2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)c1ccccc1Cl.Cc1ccc(C)c(N2C[C@@H](C(=O)Nc3nccs3)CC2=O)c1 | Cc1ccc(C)c(N2C[C@@H](C(=O)Nc3nnc(CCNC(=O)c4ccccc4Cl)s3)CC2=O)c1 | CCNC(=O)c1ccccc1Cl.Cc1ccc(C)c(N2C[C@@H](C(=O)Nc3nccs3)CC2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc&s1",
"old_substring": "c18nnc%11s1"
} |
Can you make molecule Cc1ccc(C)c(N2C[C@@H](C(=O)Nc3nnc(CCNC(=O)c4ccccc4Cl)s3)CC2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)c1ccccc1Cl.Cc1ccc(C)c(N2C[C@@H](C(=O)Nc3ncsn3)CC2=O)c1 | Cc1ccc(C)c(N2C[C@@H](C(=O)Nc3nnc(CCNC(=O)c4ccccc4Cl)s3)CC2=O)c1 | CCNC(=O)c1ccccc1Cl.Cc1ccc(C)c(N2C[C@@H](C(=O)Nc3ncsn3)CC2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nsc&n1",
"old_substring": "c18nnc%11s1"
} |
Can you make molecule Cc1ccc(C)c(N2C[C@@H](C(=O)Nc3nnc(CCNC(=O)c4ccccc4Cl)s3)CC2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)c1ccccc1Cl.Cc1ccc(C)c(N2C[C@@H](C(=O)Nc3nccs3)CC2=O)c1 | Cc1ccc(C)c(N2C[C@@H](C(=O)Nc3nnc(CCNC(=O)c4ccccc4Cl)s3)CC2=O)c1 | CCNC(=O)c1ccccc1Cl.Cc1ccc(C)c(N2C[C@@H](C(=O)Nc3nccs3)CC2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1nc&sc1&",
"old_substring": "c18nnc%11s1"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])c(C)c1OCC(N)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])c(C)c1OCCCCC(N)=O | Cc1ccc([N+](=O)[O-])c(C)c1OCC(N)=O | Cc1ccc([N+](=O)[O-])c(C)c1OCCCCC(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C2C(N)=O"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])c(C)c1OCC(N)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])c(C)c1OCC(N)=S | Cc1ccc([N+](=O)[O-])c(C)c1OCC(N)=O | Cc1ccc([N+](=O)[O-])c(C)c1OCC(N)=S | 102 | {
"fragment_index": 0,
"new_substring": "C&C(N)=S",
"old_substring": "C2C(N)=O"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])c(C)c1OCC(N)=O less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)COc1c(C)ccc([N+](=O)[O-])c1C | Cc1ccc([N+](=O)[O-])c(C)c1OCC(N)=O | CC(=O)COc1c(C)ccc([N+](=O)[O-])c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)=O",
"old_substring": "C2C(N)=O"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])c(C)c1OCC(N)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])c(C)c1OCC/C(N)=N/O | Cc1ccc([N+](=O)[O-])c(C)c1OCC(N)=O | Cc1ccc([N+](=O)[O-])c(C)c1OCC/C(N)=N/O | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N/O",
"old_substring": "C2C(N)=O"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])c(C)c1OCC(N)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])c(C)c1OCC/C(N)=N\O | Cc1ccc([N+](=O)[O-])c(C)c1OCC(N)=O | Cc1ccc([N+](=O)[O-])c(C)c1OCC/C(N)=N\O | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N\\O",
"old_substring": "C2C(N)=O"
} |
Can you make molecule O=C(Nc1ccc(Cn2cncn2)cc1)c1ccc(-n2cc(Br)cn2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(Cn2cncn2)cc1)c1ccc(-n2cc(Br)cn2)nc1 | O=C(Nc1ccc(Cn2cncn2)cc1)c1ccc(-n2cc(Br)cn2)nn1 | O=C(Nc1ccc(Cn2cncn2)cc1)c1ccc(-n2cc(Br)cn2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&nc1",
"old_substring": "c15ccc8nn1"
} |
Can you make molecule O=C(Nc1ccc(Cn2cncn2)cc1)c1ccc(-n2cc(Br)cn2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(C(=O)Nc2ccc(Cn3cncn3)cc2)ccc1-n1cc(Br)cn1 | O=C(Nc1ccc(Cn2cncn2)cc1)c1ccc(-n2cc(Br)cn2)nn1 | Cn1c(C(=O)Nc2ccc(Cn3cncn3)cc2)ccc1-n1cc(Br)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&n1C",
"old_substring": "c15ccc8nn1"
} |
Can you make molecule O=C(Nc1ccc(Cn2cncn2)cc1)c1ccc(-n2cc(Br)cn2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-n2cc(Br)cn2)ccc1C(=O)Nc1ccc(Cn2cncn2)cc1 | O=C(Nc1ccc(Cn2cncn2)cc1)c1ccc(-n2cc(Br)cn2)nn1 | Cc1nc(-n2cc(Br)cn2)ccc1C(=O)Nc1ccc(Cn2cncn2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&nc1C",
"old_substring": "c15ccc8nn1"
} |
Can you make molecule O=C(Nc1ccc(Cn2cncn2)cc1)c1ccc(-n2cc(Br)cn2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(Cn2cncn2)cc1)c1ccn(-n2cc(Br)cn2)c1 | O=C(Nc1ccc(Cn2cncn2)cc1)c1ccc(-n2cc(Br)cn2)nn1 | O=C(Nc1ccc(Cn2cncn2)cc1)c1ccn(-n2cc(Br)cn2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccn&c1",
"old_substring": "c15ccc8nn1"
} |
Can you make molecule O=C(Nc1ccc(Cn2cncn2)cc1)c1ccc(-n2cc(Br)cn2)nn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(Cn2cncn2)cc1)c1ccc2nc(-n3cc(Br)cn3)cn2c1 | O=C(Nc1ccc(Cn2cncn2)cc1)c1ccc(-n2cc(Br)cn2)nn1 | O=C(Nc1ccc(Cn2cncn2)cc1)c1ccc2nc(-n3cc(Br)cn3)cn2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2nc&cn2c1",
"old_substring": "c15ccc8nn1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.