prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule COc1ccc(NC(=O)C2CCN(S(C)(=O)=O)CC2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)C2CCC(S(C)(=O)=O)CC2)c(OC)c1 | COc1ccc(NC(=O)C2CCN(S(C)(=O)=O)CC2)c(OC)c1 | COc1ccc(NC(=O)C2CCC(S(C)(=O)=O)CC2)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C18CCN6CC1"
} |
Can you make molecule COc1ccc(NC(=O)C2CCN(S(C)(=O)=O)CC2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)C2CCC(C)(S(C)(=O)=O)CC2)c(OC)c1 | COc1ccc(NC(=O)C2CCN(S(C)(=O)=O)CC2)c(OC)c1 | COc1ccc(NC(=O)C2CCC(C)(S(C)(=O)=O)CC2)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&(C)CC1",
"old_substring": "C18CCN6CC1"
} |
Can you make molecule COc1ccc(NC(=O)C2CCN(S(C)(=O)=O)CC2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)C2(C#N)CCC(S(C)(=O)=O)CC2)c(OC)c1 | COc1ccc(NC(=O)C2CCN(S(C)(=O)=O)CC2)c(OC)c1 | COc1ccc(NC(=O)C2(C#N)CCC(S(C)(=O)=O)CC2)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "C18CCN6CC1"
} |
Can you make molecule COc1ccc(NC(=O)C2CCN(S(C)(=O)=O)CC2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)CCCCCS(C)(=O)=O)c(OC)c1 | COc1ccc(NC(=O)C2CCN(S(C)(=O)=O)CC2)c(OC)c1 | COc1ccc(NC(=O)CCCCCS(C)(=O)=O)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C18CCN6CC1"
} |
Can you make molecule COc1ccc(NC(=O)C2CCN(S(C)(=O)=O)CC2)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)N2CCC=C(CS(C)(=O)=O)C2)c(OC)c1 | COc1ccc(NC(=O)C2CCN(S(C)(=O)=O)CC2)c(OC)c1 | COc1ccc(NC(=O)N2CCC=C(CS(C)(=O)=O)C2)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "C18CCN6CC1"
} |
Can you make molecule Cc1cccc(NC(=O)Nc2cc(NC(=O)Nc3cccc(C)c3)c(C)nc2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)CC(C)(C)Nc2cc(NC(=O)Nc3cccc(C)c3)c(C)nc2C)c1 | Cc1cccc(NC(=O)Nc2cc(NC(=O)Nc3cccc(C)c3)c(C)nc2C)c1 | Cc1cccc(NC(=O)CC(C)(C)Nc2cc(NC(=O)Nc3cccc(C)c3)c(C)nc2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1cccc(NC(=O)Nc2cc(NC(=O)Nc3cccc(C)c3)c(C)nc2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)CCC(C)(C)Nc2cc(NC(=O)Nc3cccc(C)c3)c(C)nc2C)c1 | Cc1cccc(NC(=O)Nc2cc(NC(=O)Nc3cccc(C)c3)c(C)nc2C)c1 | Cc1cccc(NC(=O)CCC(C)(C)Nc2cc(NC(=O)Nc3cccc(C)c3)c(C)nc2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1cccc(NC(=O)Nc2cc(NC(=O)Nc3cccc(C)c3)c(C)nc2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)C[C@@H](Br)Nc2cc(NC(=O)Nc3cccc(C)c3)c(C)nc2C)c1 | Cc1cccc(NC(=O)Nc2cc(NC(=O)Nc3cccc(C)c3)c(C)nc2C)c1 | Cc1cccc(NC(=O)C[C@@H](Br)Nc2cc(NC(=O)Nc3cccc(C)c3)c(C)nc2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C45=O"
} |
Can you make molecule Cc1cccc(NC(=O)Nc2cc(NC(=O)Nc3cccc(C)c3)c(C)nc2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)Nc2cc(Nn3c(C)cc(Nc4cccc(C)c4)cc3=O)c(C)nc2C)c1 | Cc1cccc(NC(=O)Nc2cc(NC(=O)Nc3cccc(C)c3)c(C)nc2C)c1 | Cc1cccc(NC(=O)Nc2cc(Nn3c(C)cc(Nc4cccc(C)c4)cc3=O)c(C)nc2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C45=O"
} |
Can you make molecule Cc1cccc(NC(=O)Nc2cc(NC(=O)Nc3cccc(C)c3)c(C)nc2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)Nc2cc(Nn3ccc(=O)c(Nc4cccc(C)c4)c3C)c(C)nc2C)c1 | Cc1cccc(NC(=O)Nc2cc(NC(=O)Nc3cccc(C)c3)c(C)nc2C)c1 | Cc1cccc(NC(=O)Nc2cc(Nn3ccc(=O)c(Nc4cccc(C)c4)c3C)c(C)nc2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C45=O"
} |
Can you make molecule C=CC[NH+](CC(=O)[O-])[C@H](C)c1ccc(F)cc1O less soluble in water? The output molecule should be similar to the input molecule. | C=CC[NH+]1CCC(CC(=O)[O-])([C@H](C)c2ccc(F)cc2O)C1 | C=CC[NH+](CC(=O)[O-])[C@H](C)c1ccc(F)cc1O | C=CC[NH+]1CCC(CC(=O)[O-])([C@H](C)c2ccc(F)cc2O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&&C1",
"old_substring": "[NH+]234"
} |
Can you make molecule C=CC[NH+](CC(=O)[O-])[C@H](C)c1ccc(F)cc1O less soluble in water? The output molecule should be similar to the input molecule. | C=CC[NH+]1CCC[C@](CC(=O)[O-])([C@H](C)c2ccc(F)cc2O)C1 | C=CC[NH+](CC(=O)[O-])[C@H](C)c1ccc(F)cc1O | C=CC[NH+]1CCC[C@](CC(=O)[O-])([C@H](C)c2ccc(F)cc2O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH+]234"
} |
Can you make molecule C=CC[NH+](CC(=O)[O-])[C@H](C)c1ccc(F)cc1O less soluble in water? The output molecule should be similar to the input molecule. | C=CCc1[nH+]cn(CC(=O)[O-])c1[C@H](C)c1ccc(F)cc1O | C=CC[NH+](CC(=O)[O-])[C@H](C)c1ccc(F)cc1O | C=CCc1[nH+]cn(CC(=O)[O-])c1[C@H](C)c1ccc(F)cc1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH+]234"
} |
Can you make molecule C=CC[NH+](CC(=O)[O-])[C@H](C)c1ccc(F)cc1O less soluble in water? The output molecule should be similar to the input molecule. | C=CCn1[nH+]c(CC(=O)[O-])cc1[C@H](C)c1ccc(F)cc1O | C=CC[NH+](CC(=O)[O-])[C@H](C)c1ccc(F)cc1O | C=CCn1[nH+]c(CC(=O)[O-])cc1[C@H](C)c1ccc(F)cc1O | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH+]234"
} |
Can you make molecule C=CC[NH+](CC(=O)[O-])[C@H](C)c1ccc(F)cc1O less soluble in water? The output molecule should be similar to the input molecule. | C=CCc1[nH+]n(C)c(CC(=O)[O-])c1[C@H](C)c1ccc(F)cc1O | C=CC[NH+](CC(=O)[O-])[C@H](C)c1ccc(F)cc1O | C=CCc1[nH+]n(C)c(CC(=O)[O-])c1[C@H](C)c1ccc(F)cc1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH+]234"
} |
Can you make molecule COCC[N+]1=C(C)C[C@@H](C(=O)CSc2nccc([O-])n2)[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | COCSCC[N+]1=C(C)C[C@@H](C(=O)CSc2nccc([O-])n2)[C@H]1C | COCC[N+]1=C(C)C[C@@H](C(=O)CSc2nccc([O-])n2)[C@H]1C | COCSCC[N+]1=C(C)C[C@@H](C(=O)CSc2nccc([O-])n2)[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COCC[N+]1=C(C)C[C@@H](C(=O)CSc2nccc([O-])n2)[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SCC[N+]1=C(C)C[C@@H](C(=O)CSc2nccc([O-])n2)[C@H]1C | COCC[N+]1=C(C)C[C@@H](C(=O)CSc2nccc([O-])n2)[C@H]1C | CC(=O)SCC[N+]1=C(C)C[C@@H](C(=O)CSc2nccc([O-])n2)[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COCC[N+]1=C(C)C[C@@H](C(=O)CSc2nccc([O-])n2)[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CC1=[N+](CCC(=O)CI)[C@H](C)[C@H](C(=O)CSc2nccc([O-])n2)C1 | COCC[N+]1=C(C)C[C@@H](C(=O)CSc2nccc([O-])n2)[C@H]1C | CC1=[N+](CCC(=O)CI)[C@H](C)[C@H](C(=O)CSc2nccc([O-])n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule COCC[N+]1=C(C)C[C@@H](C(=O)CSc2nccc([O-])n2)[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CC1=[N+](CCC2OCCCO2)[C@H](C)[C@H](C(=O)CSc2nccc([O-])n2)C1 | COCC[N+]1=C(C)C[C@@H](C(=O)CSc2nccc([O-])n2)[C@H]1C | CC1=[N+](CCC2OCCCO2)[C@H](C)[C@H](C(=O)CSc2nccc([O-])n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCCCO1",
"old_substring": "CO3"
} |
Can you make molecule COCC[N+]1=C(C)C[C@@H](C(=O)CSc2nccc([O-])n2)[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CC1=[N+](CCC(=O)CCl)[C@H](C)[C@H](C(=O)CSc2nccc([O-])n2)C1 | COCC[N+]1=C(C)C[C@@H](C(=O)CSc2nccc([O-])n2)[C@H]1C | CC1=[N+](CCC(=O)CCl)[C@H](C)[C@H](C(=O)CSc2nccc([O-])n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCl",
"old_substring": "CO3"
} |
Can you make molecule CC(C)[NH+]1CCC(N2CCN(CC3=c4ccccc4=[NH+]C3)C[C@@H]2CCO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[NH+]1CCC(N2CCN(CC3=c4ccccc4=[NH+]C3)C[C@@H]2CCO)CC1 | CC(C)[NH+]1CCC(N2CCN(CC3=c4ccccc4=[NH+]C3)C[C@@H]2CCO)CC1 | CC(C)CC[NH+]1CCC(N2CCN(CC3=c4ccccc4=[NH+]C3)C[C@@H]2CCO)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)[NH+]1CCC(N2CCN(CC3=c4ccccc4=[NH+]C3)C[C@@H]2CCO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | OCC[C@H]1CN(CC2=c3ccccc3=[NH+]C2)CCN1C1CC[NH+](CCCCBr)CC1 | CC(C)[NH+]1CCC(N2CCN(CC3=c4ccccc4=[NH+]C3)C[C@@H]2CCO)CC1 | OCC[C@H]1CN(CC2=c3ccccc3=[NH+]C2)CCN1C1CC[NH+](CCCCBr)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)[NH+]1CCC(N2CCN(CC3=c4ccccc4=[NH+]C3)C[C@@H]2CCO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[NH+]1CCC(N2CCN(CC3=c4ccccc4=[NH+]C3)C[C@@H]2CCO)CC1 | CC(C)[NH+]1CCC(N2CCN(CC3=c4ccccc4=[NH+]C3)C[C@@H]2CCO)CC1 | C=CCCC[NH+]1CCC(N2CCN(CC3=c4ccccc4=[NH+]C3)C[C@@H]2CCO)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)[NH+]1CCC(N2CCN(CC3=c4ccccc4=[NH+]C3)C[C@@H]2CCO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | OCC[C@H]1CN(CC2=c3ccccc3=[NH+]C2)CCN1C1CC[NH+](CCCCCl)CC1 | CC(C)[NH+]1CCC(N2CCN(CC3=c4ccccc4=[NH+]C3)C[C@@H]2CCO)CC1 | OCC[C@H]1CN(CC2=c3ccccc3=[NH+]C2)CCN1C1CC[NH+](CCCCCl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)[NH+]1CCC(N2CCN(CC3=c4ccccc4=[NH+]C3)C[C@@H]2CCO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC[NH+]1CCC(N2CCN(CC3=c4ccccc4=[NH+]C3)C[C@@H]2CCO)CC1 | CC(C)[NH+]1CCC(N2CCN(CC3=c4ccccc4=[NH+]C3)C[C@@H]2CCO)CC1 | C=CCCCC[NH+]1CCC(N2CCN(CC3=c4ccccc4=[NH+]C3)C[C@@H]2CCO)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CC5C"
} |
Can you make molecule Cc1nc(C[C@H]([NH3+])[C@@H]2COc3ccccc3C2)sc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(C[C@H]([NH3+])[C@@H]2COc3ccccc3C2)c1Cl | Cc1nc(C[C@H]([NH3+])[C@@H]2COc3ccccc3C2)sc1C | Cc1csc(C[C@H]([NH3+])[C@@H]2COc3ccccc3C2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1csc&c1Cl",
"old_substring": "Cc1nc4sc1C"
} |
Can you make molecule Cc1nc(C[C@H]([NH3+])[C@@H]2COc3ccccc3C2)sc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C[C@H]([NH3+])[C@@H]2COc3ccccc3C2)sc1C | Cc1nc(C[C@H]([NH3+])[C@@H]2COc3ccccc3C2)sc1C | Cc1cc(C[C@H]([NH3+])[C@@H]2COc3ccccc3C2)sc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&sc1C",
"old_substring": "Cc1nc4sc1C"
} |
Can you make molecule Cc1nc(C[C@H]([NH3+])[C@@H]2COc3ccccc3C2)sc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1C=C[C@H]([NH3+])[C@@H]1COc2ccccc2C1 | Cc1nc(C[C@H]([NH3+])[C@@H]2COc3ccccc3C2)sc1C | Cc1ccsc1C=C[C@H]([NH3+])[C@@H]1COc2ccccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccsc1C=&",
"old_substring": "Cc1nc4sc1C"
} |
Can you make molecule Cc1nc(C[C@H]([NH3+])[C@@H]2COc3ccccc3C2)sc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2nc(C[C@H]([NH3+])[C@@H]3COc4ccccc4C3)sc2cc1C | Cc1nc(C[C@H]([NH3+])[C@@H]2COc3ccccc3C2)sc1C | Cc1cc2nc(C[C@H]([NH3+])[C@@H]3COc4ccccc4C3)sc2cc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc2nc&sc2cc1C",
"old_substring": "Cc1nc4sc1C"
} |
Can you make molecule Cc1nc(C[C@H]([NH3+])[C@@H]2COc3ccccc3C2)sc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2sc(C[C@H]([NH3+])[C@@H]3COc4ccccc4C3)nc2c1C | Cc1nc(C[C@H]([NH3+])[C@@H]2COc3ccccc3C2)sc1C | Cc1ccc2sc(C[C@H]([NH3+])[C@@H]3COc4ccccc4C3)nc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc2sc&nc2c1C",
"old_substring": "Cc1nc4sc1C"
} |
Can you make molecule CNC(=O)Cn1ccc2ccc(NC(=O)Cc3cccc([N+](=O)[O-])c3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)Cn1ccc2ccc(NSC(=O)Cc3cccc([N+](=O)[O-])c3)cc21 | CNC(=O)Cn1ccc2ccc(NC(=O)Cc3cccc([N+](=O)[O-])c3)cc21 | CNC(=O)Cn1ccc2ccc(NSC(=O)Cc3cccc([N+](=O)[O-])c3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C5(=O)C8"
} |
Can you make molecule CNC(=O)Cn1ccc2ccc(NC(=O)Cc3cccc([N+](=O)[O-])c3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)Cn1ccc2ccc(NC(=O)CCCC(=O)c3cccc([N+](=O)[O-])c3)cc21 | CNC(=O)Cn1ccc2ccc(NC(=O)Cc3cccc([N+](=O)[O-])c3)cc21 | CNC(=O)Cn1ccc2ccc(NC(=O)CCCC(=O)c3cccc([N+](=O)[O-])c3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C5(=O)C8"
} |
Can you make molecule CNC(=O)Cn1ccc2ccc(NC(=O)Cc3cccc([N+](=O)[O-])c3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)Cn1ccc2ccc(NC(=O)CC(C)(C)c3cccc([N+](=O)[O-])c3)cc21 | CNC(=O)Cn1ccc2ccc(NC(=O)Cc3cccc([N+](=O)[O-])c3)cc21 | CNC(=O)Cn1ccc2ccc(NC(=O)CC(C)(C)c3cccc([N+](=O)[O-])c3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C5(=O)C8"
} |
Can you make molecule CNC(=O)Cn1ccc2ccc(NC(=O)Cc3cccc([N+](=O)[O-])c3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)Cn1ccc2ccc(NC[S@+]([O-])CCCc3cccc([N+](=O)[O-])c3)cc21 | CNC(=O)Cn1ccc2ccc(NC(=O)Cc3cccc([N+](=O)[O-])c3)cc21 | CNC(=O)Cn1ccc2ccc(NC[S@+]([O-])CCCc3cccc([N+](=O)[O-])c3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C5(=O)C8"
} |
Can you make molecule CNC(=O)Cn1ccc2ccc(NC(=O)Cc3cccc([N+](=O)[O-])c3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)Cn1ccc2ccc(NC(=O)CCC(C)(C)c3cccc([N+](=O)[O-])c3)cc21 | CNC(=O)Cn1ccc2ccc(NC(=O)Cc3cccc([N+](=O)[O-])c3)cc21 | CNC(=O)Cn1ccc2ccc(NC(=O)CCC(C)(C)c3cccc([N+](=O)[O-])c3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C5(=O)C8"
} |
Can you make molecule Cc1ccc(CCN2C[C@]34C=C[C@H](O3)[C@H](C(=O)N3CC(O)C3)[C@H]4C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CCCCN2C[C@]34C=C[C@H](O3)[C@H](C(=O)N3CC(O)C3)[C@H]4C2=O)cc1 | Cc1ccc(CCN2C[C@]34C=C[C@H](O3)[C@H](C(=O)N3CC(O)C3)[C@H]4C2=O)cc1 | Cc1ccc(CCCCN2C[C@]34C=C[C@H](O3)[C@H](C(=O)N3CC(O)C3)[C@H]4C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C8C7"
} |
Can you make molecule Cc1ccc(CCN2C[C@]34C=C[C@H](O3)[C@H](C(=O)N3CC(O)C3)[C@H]4C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CCCCCN2C[C@]34C=C[C@H](O3)[C@H](C(=O)N3CC(O)C3)[C@H]4C2=O)cc1 | Cc1ccc(CCN2C[C@]34C=C[C@H](O3)[C@H](C(=O)N3CC(O)C3)[C@H]4C2=O)cc1 | Cc1ccc(CCCCCN2C[C@]34C=C[C@H](O3)[C@H](C(=O)N3CC(O)C3)[C@H]4C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C8C7"
} |
Can you make molecule Cc1ccc(CCN2C[C@]34C=C[C@H](O3)[C@H](C(=O)N3CC(O)C3)[C@H]4C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C2CC(N3C[C@]45C=C[C@H](O4)[C@H](C(=O)N4CC(O)C4)[C@H]5C3=O)C2)cc1 | Cc1ccc(CCN2C[C@]34C=C[C@H](O3)[C@H](C(=O)N3CC(O)C3)[C@H]4C2=O)cc1 | Cc1ccc(C2CC(N3C[C@]45C=C[C@H](O4)[C@H](C(=O)N4CC(O)C4)[C@H]5C3=O)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C8C7"
} |
Can you make molecule Cc1ccc(CCN2C[C@]34C=C[C@H](O3)[C@H](C(=O)N3CC(O)C3)[C@H]4C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C2CCN(N3C[C@]45C=C[C@H](O4)[C@H](C(=O)N4CC(O)C4)[C@H]5C3=O)CC2)cc1 | Cc1ccc(CCN2C[C@]34C=C[C@H](O3)[C@H](C(=O)N3CC(O)C3)[C@H]4C2=O)cc1 | Cc1ccc(C2CCN(N3C[C@]45C=C[C@H](O4)[C@H](C(=O)N4CC(O)C4)[C@H]5C3=O)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "C8C7"
} |
Can you make molecule Cc1ccc(CCN2C[C@]34C=C[C@H](O3)[C@H](C(=O)N3CC(O)C3)[C@H]4C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@H](C)CCN2C[C@]34C=C[C@H](O3)[C@H](C(=O)N3CC(O)C3)[C@H]4C2=O)cc1 | Cc1ccc(CCN2C[C@]34C=C[C@H](O3)[C@H](C(=O)N3CC(O)C3)[C@H]4C2=O)cc1 | Cc1ccc([C@@H](C)CCN2C[C@]34C=C[C@H](O3)[C@H](C(=O)N3CC(O)C3)[C@H]4C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C8C7"
} |
Can you make molecule CCn1nc(C)cc1C(=O)Nc1nc(-c2ccco2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(C)cc1CC(=O)SNc1nc(-c2ccco2)cs1 | CCn1nc(C)cc1C(=O)Nc1nc(-c2ccco2)cs1 | CCn1nc(C)cc1CC(=O)SNc1nc(-c2ccco2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule CCn1nc(C)cc1C(=O)Nc1nc(-c2ccco2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(C)cc1C(=O)CCCC(=O)Nc1nc(-c2ccco2)cs1 | CCn1nc(C)cc1C(=O)Nc1nc(-c2ccco2)cs1 | CCn1nc(C)cc1C(=O)CCCC(=O)Nc1nc(-c2ccco2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule CCn1nc(C)cc1C(=O)Nc1nc(-c2ccco2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(C)cc1C(C)(C)CC(=O)Nc1nc(-c2ccco2)cs1 | CCn1nc(C)cc1C(=O)Nc1nc(-c2ccco2)cs1 | CCn1nc(C)cc1C(C)(C)CC(=O)Nc1nc(-c2ccco2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CCn1nc(C)cc1C(=O)Nc1nc(-c2ccco2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(C)cc1C(C)(C)CCC(=O)Nc1nc(-c2ccco2)cs1 | CCn1nc(C)cc1C(=O)Nc1nc(-c2ccco2)cs1 | CCn1nc(C)cc1C(C)(C)CCC(=O)Nc1nc(-c2ccco2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CCn1nc(C)cc1C(=O)Nc1nc(-c2ccco2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(C)cc1[C@H](C)C(=O)SNc1nc(-c2ccco2)cs1 | CCn1nc(C)cc1C(=O)Nc1nc(-c2ccco2)cs1 | CCn1nc(C)cc1[C@H](C)C(=O)SNc1nc(-c2ccco2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule O=C(c1ccc(-c2ccccc2)cc1)N1CCN=C1SCc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccc(-c2ccccc2Cl)cc1)N1CCN=C1SCc1cccc(F)c1 | O=C(c1ccc(-c2ccccc2)cc1)N1CCN=C1SCc1cccc(F)c1 | O=C(c1ccc(-c2ccccc2Cl)cc1)N1CCN=C1SCc1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c17ccccc1"
} |
Can you make molecule O=C(c1ccc(-c2ccccc2)cc1)N1CCN=C1SCc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccc(-c2ccc(I)cc2)cc1)N1CCN=C1SCc1cccc(F)c1 | O=C(c1ccc(-c2ccccc2)cc1)N1CCN=C1SCc1cccc(F)c1 | O=C(c1ccc(-c2ccc(I)cc2)cc1)N1CCN=C1SCc1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c17ccccc1"
} |
Can you make molecule O=C(c1ccc(-c2ccccc2)cc1)N1CCN=C1SCc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2ccc(C(=O)N3CCN=C3SCc3cccc(F)c3)cc2)cc1I | O=C(c1ccc(-c2ccccc2)cc1)N1CCN=C1SCc1cccc(F)c1 | Cc1ccc(-c2ccc(C(=O)N3CCN=C3SCc3cccc(F)c3)cc2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c17ccccc1"
} |
Can you make molecule O=C(c1ccc(-c2ccccc2)cc1)N1CCN=C1SCc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccc(-c2cccc(Br)c2)cc1)N1CCN=C1SCc1cccc(F)c1 | O=C(c1ccc(-c2ccccc2)cc1)N1CCN=C1SCc1cccc(F)c1 | O=C(c1ccc(-c2cccc(Br)c2)cc1)N1CCN=C1SCc1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c17ccccc1"
} |
Can you make molecule O=C(c1ccc(-c2ccccc2)cc1)N1CCN=C1SCc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2ccc(C(=O)N3CCN=C3SCc3cccc(F)c3)cc2)c1C | O=C(c1ccc(-c2ccccc2)cc1)N1CCN=C1SCc1cccc(F)c1 | Cc1cccc(-c2ccc(C(=O)N3CCN=C3SCc3cccc(F)c3)cc2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c17ccccc1"
} |
Can you make molecule COc1ccc(OCCCC(=O)N[C@@H]2CCOc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(OCCCC(=O)N[C@@H]2CCOc3ccccc32)cc1 | COc1ccc(OCCCC(=O)N[C@@H]2CCOc3ccccc32)cc1 | COCc1ccc(OCCCC(=O)N[C@@H]2CCOc3ccccc32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO6"
} |
Can you make molecule COc1ccc(OCCCC(=O)N[C@@H]2CCOc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(OCCCC(=O)N[C@@H]2CCOc3ccccc32)cc1 | COc1ccc(OCCCC(=O)N[C@@H]2CCOc3ccccc32)cc1 | COCSc1ccc(OCCCC(=O)N[C@@H]2CCOc3ccccc32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO6"
} |
Can you make molecule COc1ccc(OCCCC(=O)N[C@@H]2CCOc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(OCCCC(=O)N[C@@H]2CCOc3ccccc32)cc1 | COc1ccc(OCCCC(=O)N[C@@H]2CCOc3ccccc32)cc1 | CC(=O)Sc1ccc(OCCCC(=O)N[C@@H]2CCOc3ccccc32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO6"
} |
Can you make molecule COc1ccc(OCCCC(=O)N[C@@H]2CCOc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCOc1ccc(C(=O)CS)cc1)N[C@@H]1CCOc2ccccc21 | COc1ccc(OCCCC(=O)N[C@@H]2CCOc3ccccc32)cc1 | O=C(CCCOc1ccc(C(=O)CS)cc1)N[C@@H]1CCOc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO6"
} |
Can you make molecule COc1ccc(OCCCC(=O)N[C@@H]2CCOc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCOc1ccc(C(=O)CI)cc1)N[C@@H]1CCOc2ccccc21 | COc1ccc(OCCCC(=O)N[C@@H]2CCOc3ccccc32)cc1 | O=C(CCCOc1ccc(C(=O)CI)cc1)N[C@@H]1CCOc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO6"
} |
Can you make molecule CCn1c(CC[NH3+])nnc1Sc1ncnc2ccc(F)cc12 less soluble in water? The output molecule should be similar to the input molecule. | C=CSn1c(CC[NH3+])nnc1Sc1ncnc2ccc(F)cc12 | CCn1c(CC[NH3+])nnc1Sc1ncnc2ccc(F)cc12 | C=CSn1c(CC[NH3+])nnc1Sc1ncnc2ccc(F)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CCn1c(CC[NH3+])nnc1Sc1ncnc2ccc(F)cc12 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)n1c(CC[NH3+])nnc1Sc1ncnc2ccc(F)cc12 | CCn1c(CC[NH3+])nnc1Sc1ncnc2ccc(F)cc12 | CC(C)n1c(CC[NH3+])nnc1Sc1ncnc2ccc(F)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC3"
} |
Can you make molecule CCn1c(CC[NH3+])nnc1Sc1ncnc2ccc(F)cc12 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCn1c(CC[NH3+])nnc1Sc1ncnc2ccc(F)cc12 | CCn1c(CC[NH3+])nnc1Sc1ncnc2ccc(F)cc12 | C=CCCn1c(CC[NH3+])nnc1Sc1ncnc2ccc(F)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CCn1c(CC[NH3+])nnc1Sc1ncnc2ccc(F)cc12 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]CCc1nnc(Sc2ncnc3ccc(F)cc23)n1CCCCl | CCn1c(CC[NH3+])nnc1Sc1ncnc2ccc(F)cc12 | [NH3+]CCc1nnc(Sc2ncnc3ccc(F)cc23)n1CCCCl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CCn1c(CC[NH3+])nnc1Sc1ncnc2ccc(F)cc12 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]CCc1nnc(Sc2ncnc3ccc(F)cc23)n1CCCCS | CCn1c(CC[NH3+])nnc1Sc1ncnc2ccc(F)cc12 | [NH3+]CCc1nnc(Sc2ncnc3ccc(F)cc23)n1CCCCS | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)N(C)Cc1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)c1nc(C#N)c(Cc2ccccc2F)o1 | CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)N(C)Cc1ccccc1F | CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)c1nc(C#N)c(Cc2ccccc2F)o1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1nc&oc1&",
"old_substring": "N24C"
} |
Can you make molecule CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)N(C)Cc1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)c1cc(C#N)c(Cc2ccccc2F)s1 | CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)N(C)Cc1ccccc1F | CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)c1cc(C#N)c(Cc2ccccc2F)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N24C"
} |
Can you make molecule CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)N(C)Cc1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)c1ccc(Cc2ccccc2F)c(C#N)c1 | CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)N(C)Cc1ccccc1F | CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)c1ccc(Cc2ccccc2F)c(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N24C"
} |
Can you make molecule CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)N(C)Cc1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)ON=C1CCN(Cc2ccccc2F)CC1 | CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)N(C)Cc1ccccc1F | CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)ON=C1CCN(Cc2ccccc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N24C"
} |
Can you make molecule CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)N(C)Cc1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)c1cnc(C#N)c(Cc2ccccc2F)c1 | CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)N(C)Cc1ccccc1F | CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)c1cnc(C#N)c(Cc2ccccc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1ncc&cc1&",
"old_substring": "N24C"
} |
Can you make molecule CC[C@H](C(=O)Nc1cc(Cl)cc(Br)c1O)N1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)Nc1cc(Cl)cc(Br)c1O)N1CCCCCCC1=O | CC[C@H](C(=O)Nc1cc(Cl)cc(Br)c1O)N1CCCC1=O | CC[C@H](C(=O)Nc1cc(Cl)cc(Br)c1O)N1CCCCCCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1=O",
"old_substring": "N14CCCC1=O"
} |
Can you make molecule CC[C@H](C(=O)Nc1cc(Cl)cc(Br)c1O)N1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)Nc1cc(Cl)cc(Br)c1O)N1CCCCC1 | CC[C@H](C(=O)Nc1cc(Cl)cc(Br)c1O)N1CCCC1=O | CC[C@H](C(=O)Nc1cc(Cl)cc(Br)c1O)N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "N14CCCC1=O"
} |
Can you make molecule CC[C@H](C(=O)Nc1cc(Cl)cc(Br)c1O)N1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)Nc1cc(Cl)cc(Br)c1O)N1CC=CCC1 | CC[C@H](C(=O)Nc1cc(Cl)cc(Br)c1O)N1CCCC1=O | CC[C@H](C(=O)Nc1cc(Cl)cc(Br)c1O)N1CC=CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=CCC1",
"old_substring": "N14CCCC1=O"
} |
Can you make molecule CC[C@H](C(=O)Nc1cc(Cl)cc(Br)c1O)N1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)Nc1cc(Cl)cc(Br)c1O)N1CCCCCC1 | CC[C@H](C(=O)Nc1cc(Cl)cc(Br)c1O)N1CCCC1=O | CC[C@H](C(=O)Nc1cc(Cl)cc(Br)c1O)N1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCC1",
"old_substring": "N14CCCC1=O"
} |
Can you make molecule CC[C@H](C(=O)Nc1cc(Cl)cc(Br)c1O)N1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)Nc1cc(Cl)cc(Br)c1O)N1CCCSCC1 | CC[C@H](C(=O)Nc1cc(Cl)cc(Br)c1O)N1CCCC1=O | CC[C@H](C(=O)Nc1cc(Cl)cc(Br)c1O)N1CCCSCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCSCC1",
"old_substring": "N14CCCC1=O"
} |
Can you make molecule Cn1ncnc1NC(=O)NCCCC[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncnc1NC(=O)CC(C)(C)NCCCC[NH+]1CCCC1 | Cn1ncnc1NC(=O)NCCCC[NH+]1CCCC1 | Cn1ncnc1NC(=O)CC(C)(C)NCCCC[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule Cn1ncnc1NC(=O)NCCCC[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncnc1NC(=O)CCC(C)(C)NCCCC[NH+]1CCCC1 | Cn1ncnc1NC(=O)NCCCC[NH+]1CCCC1 | Cn1ncnc1NC(=O)CCC(C)(C)NCCCC[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule Cn1ncnc1NC(=O)NCCCC[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncnc1NC(=O)C[C@@H](Br)NCCCC[NH+]1CCCC1 | Cn1ncnc1NC(=O)NCCCC[NH+]1CCCC1 | Cn1ncnc1NC(=O)C[C@@H](Br)NCCCC[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule Cn1ncnc1NC(=O)NCCCC[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Nc2ncnn2C)cc(=O)n1NCCCC[NH+]1CCCC1 | Cn1ncnc1NC(=O)NCCCC[NH+]1CCCC1 | Cc1cc(Nc2ncnn2C)cc(=O)n1NCCCC[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C23=O"
} |
Can you make molecule Cn1ncnc1NC(=O)NCCCC[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Nc2ncnn2C)c(=O)ccn1NCCCC[NH+]1CCCC1 | Cn1ncnc1NC(=O)NCCCC[NH+]1CCCC1 | Cc1c(Nc2ncnn2C)c(=O)ccn1NCCCC[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C23=O"
} |
Can you make molecule C[C@H](Nc1cc(F)cc(F)c1)c1cc(F)ccc1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1cc(F)ccc1O)Nc1cc(F)cc(F)c1 | C[C@H](Nc1cc(F)cc(F)c1)c1cc(F)ccc1O | C[C@H](CC(C)(C)c1cc(F)ccc1O)Nc1cc(F)cc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@H]24"
} |
Can you make molecule C[C@H](Nc1cc(F)cc(F)c1)c1cc(F)ccc1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCNc1cc(F)cc(F)c1)CC(=O)c1cc(F)ccc1O | C[C@H](Nc1cc(F)cc(F)c1)c1cc(F)ccc1O | C[C@H](CCNc1cc(F)cc(F)c1)CC(=O)c1cc(F)ccc1O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@H]24"
} |
Can you make molecule C[C@H](Nc1cc(F)cc(F)c1)c1cc(F)ccc1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1cc(F)ccc1O)[C@H](C)Nc1cc(F)cc(F)c1 | C[C@H](Nc1cc(F)cc(F)c1)c1cc(F)ccc1O | C[C@H](Cc1cc(F)ccc1O)[C@H](C)Nc1cc(F)cc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "C[C@H]24"
} |
Can you make molecule C[C@H](Nc1cc(F)cc(F)c1)c1cc(F)ccc1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNc1cc(F)cc(F)c1)CC(=O)c1cc(F)ccc1O | C[C@H](Nc1cc(F)cc(F)c1)c1cc(F)ccc1O | C[C@@H](CCNc1cc(F)cc(F)c1)CC(=O)c1cc(F)ccc1O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@H]24"
} |
Can you make molecule C[C@H](Nc1cc(F)cc(F)c1)c1cc(F)ccc1O less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1cc(F)ccc1O)Nc1cc(F)cc(F)c1 | C[C@H](Nc1cc(F)cc(F)c1)c1cc(F)ccc1O | CCC[C@@H](CCc1cc(F)ccc1O)Nc1cc(F)cc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C[C@H]24"
} |
Can you make molecule C=CCNC(=O)C(C#N)=Cc1ccc(OCC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCc1nc2c(s1)CN(C(=O)C(C#N)=Cc1ccc(OCC)cc1)C2 | C=CCNC(=O)C(C#N)=Cc1ccc(OCC)cc1 | C=CCc1nc2c(s1)CN(C(=O)C(C#N)=Cc1ccc(OCC)cc1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N25"
} |
Can you make molecule C=CCNC(=O)C(C#N)=Cc1ccc(OCC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCn1ncc2c1CN(C(=O)C(C#N)=Cc1ccc(OCC)cc1)C2 | C=CCNC(=O)C(C#N)=Cc1ccc(OCC)cc1 | C=CCn1ncc2c1CN(C(=O)C(C#N)=Cc1ccc(OCC)cc1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2cnn&c2C1",
"old_substring": "N25"
} |
Can you make molecule C=CCNC(=O)C(C#N)=Cc1ccc(OCC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCc1onc2c1CN(C(=O)C(C#N)=Cc1ccc(OCC)cc1)CC2 | C=CCNC(=O)C(C#N)=Cc1ccc(OCC)cc1 | C=CCc1onc2c1CN(C(=O)C(C#N)=Cc1ccc(OCC)cc1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N25"
} |
Can you make molecule C=CCNC(=O)C(C#N)=Cc1ccc(OCC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCc1cc2n(n1)CCCN2C(=O)C(C#N)=Cc1ccc(OCC)cc1 | C=CCNC(=O)C(C#N)=Cc1ccc(OCC)cc1 | C=CCc1cc2n(n1)CCCN2C(=O)C(C#N)=Cc1ccc(OCC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc21",
"old_substring": "N25"
} |
Can you make molecule C=CCNC(=O)C(C#N)=Cc1ccc(OCC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCc1ccc2c(c1)CCN2C(=O)C(C#N)=Cc1ccc(OCC)cc1 | C=CCNC(=O)C(C#N)=Cc1ccc(OCC)cc1 | C=CCc1ccc2c(c1)CCN2C(=O)C(C#N)=Cc1ccc(OCC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N25"
} |
Can you make molecule CC(C)[C@H](NC(=O)c1cccs1)C(=O)NN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](NSC(=O)Cc1cccs1)C(=O)NN1CCOCC1 | CC(C)[C@H](NC(=O)c1cccs1)C(=O)NN1CCOCC1 | CC(C)[C@H](NSC(=O)Cc1cccs1)C(=O)NN1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule CC(C)[C@H](NC(=O)c1cccs1)C(=O)NN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](NC(=O)CCCC(=O)c1cccs1)C(=O)NN1CCOCC1 | CC(C)[C@H](NC(=O)c1cccs1)C(=O)NN1CCOCC1 | CC(C)[C@H](NC(=O)CCCC(=O)c1cccs1)C(=O)NN1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C24=O"
} |
Can you make molecule CC(C)[C@H](NC(=O)c1cccs1)C(=O)NN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](NC(=O)CC(C)(C)c1cccs1)C(=O)NN1CCOCC1 | CC(C)[C@H](NC(=O)c1cccs1)C(=O)NN1CCOCC1 | CC(C)[C@H](NC(=O)CC(C)(C)c1cccs1)C(=O)NN1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule CC(C)[C@H](NC(=O)c1cccs1)C(=O)NN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](NC(=O)CCC(C)(C)c1cccs1)C(=O)NN1CCOCC1 | CC(C)[C@H](NC(=O)c1cccs1)C(=O)NN1CCOCC1 | CC(C)[C@H](NC(=O)CCC(C)(C)c1cccs1)C(=O)NN1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule CC(C)[C@H](NC(=O)c1cccs1)C(=O)NN1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](NSC(=O)[C@@H](C)c1cccs1)C(=O)NN1CCOCC1 | CC(C)[C@H](NC(=O)c1cccs1)C(=O)NN1CCOCC1 | CC(C)[C@H](NSC(=O)[C@@H](C)c1cccs1)C(=O)NN1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C24=O"
} |
Can you make molecule C[C@H]1COC2(CCN(Cc3cc4ccccc4s3)CC2)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1COC2(CCN(Cc3cc4sc5ccccc5c4s3)CC2)O1 | C[C@H]1COC2(CCN(Cc3cc4ccccc4s3)CC2)O1 | C[C@H]1COC2(CCN(Cc3cc4sc5ccccc5c4s3)CC2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sc3ccccc3c2s1",
"old_substring": "c16cc2ccccc2s1"
} |
Can you make molecule C[C@H]1COC2(CCN(Cc3cc4ccccc4s3)CC2)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1COC2(CCN(Cc3ccc4ccccc4c3Br)CC2)O1 | C[C@H]1COC2(CCN(Cc3cc4ccccc4s3)CC2)O1 | C[C@H]1COC2(CCN(Cc3ccc4ccccc4c3Br)CC2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2ccccc2c1Br",
"old_substring": "c16cc2ccccc2s1"
} |
Can you make molecule C[C@H]1COC2(CCN(Cc3cc4ccccc4s3)CC2)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1COC2(CCN(C=Cc3sc4ccccc4c3Cl)CC2)O1 | C[C@H]1COC2(CCN(Cc3cc4ccccc4s3)CC2)O1 | C[C@H]1COC2(CCN(C=Cc3sc4ccccc4c3Cl)CC2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1sc2ccccc2c1Cl",
"old_substring": "c16cc2ccccc2s1"
} |
Can you make molecule C[C@H]1COC2(CCN(Cc3cc4ccccc4s3)CC2)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1COC2(CCN(Cc3sc4ccccc4c3Cl)CC2)O1 | C[C@H]1COC2(CCN(Cc3cc4ccccc4s3)CC2)O1 | C[C@H]1COC2(CCN(Cc3sc4ccccc4c3Cl)CC2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2ccccc2c1Cl",
"old_substring": "c16cc2ccccc2s1"
} |
Can you make molecule C[C@H]1COC2(CCN(Cc3cc4ccccc4s3)CC2)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1COC2(CCN(Cc3sc4ccccc4c3Br)CC2)O1 | C[C@H]1COC2(CCN(Cc3cc4ccccc4s3)CC2)O1 | C[C@H]1COC2(CCN(Cc3sc4ccccc4c3Br)CC2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2ccccc2c1Br",
"old_substring": "c16cc2ccccc2s1"
} |
Can you make molecule Cc1cc(CCl)cnc1N(C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CCl)cnc1NCSc1ccccc1 | Cc1cc(CCl)cnc1N(C)c1ccccc1 | Cc1cc(CCl)cnc1NCSc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N23C"
} |
Can you make molecule Cc1cc(CCl)cnc1N(C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CCl)cnc1NC(=N)Sc1ccccc1 | Cc1cc(CCl)cnc1N(C)c1ccccc1 | Cc1cc(CCl)cnc1NC(=N)Sc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N23C"
} |
Can you make molecule Cc1cc(CCl)cnc1N(C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CCl)cnc1[C@H](N)CCc1ccccc1 | Cc1cc(CCl)cnc1N(C)c1ccccc1 | Cc1cc(CCl)cnc1[C@H](N)CCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "N[C@@H]&CC&",
"old_substring": "N23C"
} |
Can you make molecule Cc1cc(CCl)cnc1N(C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CCl)cnc1-c1cc(C#N)c(-c2ccccc2)s1 | Cc1cc(CCl)cnc1N(C)c1ccccc1 | Cc1cc(CCl)cnc1-c1cc(C#N)c(-c2ccccc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N23C"
} |
Can you make molecule Cc1cc(CCl)cnc1N(C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CCl)cnc1-c1ccc(-c2ccccc2)c(C#N)c1 | Cc1cc(CCl)cnc1N(C)c1ccccc1 | Cc1cc(CCl)cnc1-c1ccc(-c2ccccc2)c(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N23C"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.