prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC[NH2+]Cc1ccc(OCC(=O)Nc2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CS[NH2+]Cc1ccc(OCC(=O)Nc2ccccc2)cc1 | CC[NH2+]Cc1ccc(OCC(=O)Nc2ccccc2)cc1 | C=CS[NH2+]Cc1ccc(OCC(=O)Nc2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC6"
} |
Can you make molecule CC[NH2+]Cc1ccc(OCC(=O)Nc2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[NH2+]Cc1ccc(OCC(=O)Nc2ccccc2)cc1 | CC[NH2+]Cc1ccc(OCC(=O)Nc2ccccc2)cc1 | C=CCC[NH2+]Cc1ccc(OCC(=O)Nc2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC6"
} |
Can you make molecule CC[NH2+]Cc1ccc(OCC(=O)Nc2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COc1ccc(C[NH2+]CCCCl)cc1)Nc1ccccc1 | CC[NH2+]Cc1ccc(OCC(=O)Nc2ccccc2)cc1 | O=C(COc1ccc(C[NH2+]CCCCl)cc1)Nc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC6"
} |
Can you make molecule CC[NH2+]Cc1ccc(OCC(=O)Nc2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COc1ccc(C[NH2+]CCCCS)cc1)Nc1ccccc1 | CC[NH2+]Cc1ccc(OCC(=O)Nc2ccccc2)cc1 | O=C(COc1ccc(C[NH2+]CCCCS)cc1)Nc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC6"
} |
Can you make molecule CC[NH2+]Cc1ccc(OCC(=O)Nc2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COc1ccc(C[NH2+]CCCBr)cc1)Nc1ccccc1 | CC[NH2+]Cc1ccc(OCC(=O)Nc2ccccc2)cc1 | O=C(COc1ccc(C[NH2+]CCCBr)cc1)Nc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC6"
} |
Can you make molecule CN(c1cc(C[NH3+])ccn1)C1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]Cc1ccnc(C2CCN(C3CCCC3)CC2)c1 | CN(c1cc(C[NH3+])ccn1)C1CCCC1 | [NH3+]Cc1ccnc(C2CCN(C3CCCC3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "CN23"
} |
Can you make molecule CN(c1cc(C[NH3+])ccn1)C1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=S)SC1CCCC1)c1cc(C[NH3+])ccn1 | CN(c1cc(C[NH3+])ccn1)C1CCCC1 | CN(C(=S)SC1CCCC1)c1cc(C[NH3+])ccn1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "CN23"
} |
Can you make molecule CN(c1cc(C[NH3+])ccn1)C1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]Cc1ccnc(CN2CCC(C3CCCC3)CC2)c1 | CN(c1cc(C[NH3+])ccn1)C1CCCC1 | [NH3+]Cc1ccnc(CN2CCC(C3CCCC3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "CN23"
} |
Can you make molecule CN(c1cc(C[NH3+])ccn1)C1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]Cc1ccnc(N2CSC(=S)N(C3CCCC3)C2)c1 | CN(c1cc(C[NH3+])ccn1)C1CCCC1 | [NH3+]Cc1ccnc(N2CSC(=S)N(C3CCCC3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S=C1SCN&CN1&",
"old_substring": "CN23"
} |
Can you make molecule CN(c1cc(C[NH3+])ccn1)C1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(c2cc(C[NH3+])ccn2)CCC(C2CCCC2)CC1 | CN(c1cc(C[NH3+])ccn1)C1CCCC1 | N#CC1(c2cc(C[NH3+])ccn2)CCC(C2CCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "CN23"
} |
Can you make molecule C=C1c2ccccc2C(=O)N1CC(=O)Nc1cccc(C(=O)NCCC)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=C1c2ccccc2C(=O)N1CC(=O)Nc1ccc(C(=O)NCCC)cc1I | C=C1c2ccccc2C(=O)N1CC(=O)Nc1cccc(C(=O)NCCC)c1 | C=C1c2ccccc2C(=O)N1CC(=O)Nc1ccc(C(=O)NCCC)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16cccc7c1"
} |
Can you make molecule C=C1c2ccccc2C(=O)N1CC(=O)Nc1cccc(C(=O)NCCC)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=C1c2ccccc2C(=O)N1CC(=O)Nc1cc(C(=O)NCCC)ccc1Br | C=C1c2ccccc2C(=O)N1CC(=O)Nc1cccc(C(=O)NCCC)c1 | C=C1c2ccccc2C(=O)N1CC(=O)Nc1cc(C(=O)NCCC)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16cccc7c1"
} |
Can you make molecule C=C1c2ccccc2C(=O)N1CC(=O)Nc1cccc(C(=O)NCCC)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=C1c2ccccc2C(=O)N1CC(=O)Nc1ccc(C(=O)NCCC)cc1Cl | C=C1c2ccccc2C(=O)N1CC(=O)Nc1cccc(C(=O)NCCC)c1 | C=C1c2ccccc2C(=O)N1CC(=O)Nc1ccc(C(=O)NCCC)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16cccc7c1"
} |
Can you make molecule C=C1c2ccccc2C(=O)N1CC(=O)Nc1cccc(C(=O)NCCC)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=C1c2ccccc2C(=O)N1CC(=O)Nc1cccc(C(=O)NCCC)c1Br | C=C1c2ccccc2C(=O)N1CC(=O)Nc1cccc(C(=O)NCCC)c1 | C=C1c2ccccc2C(=O)N1CC(=O)Nc1cccc(C(=O)NCCC)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c16cccc7c1"
} |
Can you make molecule C=C1c2ccccc2C(=O)N1CC(=O)Nc1cccc(C(=O)NCCC)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=C1c2ccccc2C(=O)N1CC(=O)Nc1cccc(C(=O)NCCC)c1Cl | C=C1c2ccccc2C(=O)N1CC(=O)Nc1cccc(C(=O)NCCC)c1 | C=C1c2ccccc2C(=O)N1CC(=O)Nc1cccc(C(=O)NCCC)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c16cccc7c1"
} |
Can you make molecule CC(C)NC(=O)CCNC(=O)[C@@H]1C[C@@H]1c1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NC(=O)CC(C)(C)NC(=O)[C@@H]1C[C@@H]1c1cccc2ccccc12 | CC(C)NC(=O)CCNC(=O)[C@@H]1C[C@@H]1c1cccc2ccccc12 | CC(C)NC(=O)CC(C)(C)NC(=O)[C@@H]1C[C@@H]1c1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)CC6"
} |
Can you make molecule CC(C)NC(=O)CCNC(=O)[C@@H]1C[C@@H]1c1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NC(=O)CCC(C)(C)NC(=O)[C@@H]1C[C@@H]1c1cccc2ccccc12 | CC(C)NC(=O)CCNC(=O)[C@@H]1C[C@@H]1c1cccc2ccccc12 | CC(C)NC(=O)CCC(C)(C)NC(=O)[C@@H]1C[C@@H]1c1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)CC6"
} |
Can you make molecule CC(C)NC(=O)CCNC(=O)[C@@H]1C[C@@H]1c1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NC(=O)C[C@@H](Br)NC(=O)[C@@H]1C[C@@H]1c1cccc2ccccc12 | CC(C)NC(=O)CCNC(=O)[C@@H]1C[C@@H]1c1cccc2ccccc12 | CC(C)NC(=O)C[C@@H](Br)NC(=O)[C@@H]1C[C@@H]1c1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C3(=O)CC6"
} |
Can you make molecule CC(C)NC(=O)CCNC(=O)[C@@H]1C[C@@H]1c1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NSC(=O)[C@@H](C)NC(=O)[C@@H]1C[C@@H]1c1cccc2ccccc12 | CC(C)NC(=O)CCNC(=O)[C@@H]1C[C@@H]1c1cccc2ccccc12 | CC(C)NSC(=O)[C@@H](C)NC(=O)[C@@H]1C[C@@H]1c1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C3(=O)CC6"
} |
Can you make molecule CC(C)NC(=O)CCNC(=O)[C@@H]1C[C@@H]1c1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NC(=O)[C@H](C)CCNC(=O)[C@@H]1C[C@@H]1c1cccc2ccccc12 | CC(C)NC(=O)CCNC(=O)[C@@H]1C[C@@H]1c1cccc2ccccc12 | CC(C)NC(=O)[C@H](C)CCNC(=O)[C@@H]1C[C@@H]1c1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@H](C)CC&",
"old_substring": "C3(=O)CC6"
} |
Can you make molecule CC(=O)N[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCC(CO)=N[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F | CC(=O)N[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F | CCC(CO)=N[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&CO",
"old_substring": "CC2=O"
} |
Can you make molecule CC(=O)N[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)N[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F | CC(=O)N[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F | CCCC(=O)N[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC2=O"
} |
Can you make molecule CC(=O)N[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SN[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F | CC(=O)N[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F | CC(=O)SN[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CC2=O"
} |
Can you make molecule CC(=O)N[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)N[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F | CC(=O)N[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F | CCCCC(=O)N[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC2=O"
} |
Can you make molecule CC(=O)N[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCC(C=O)=N[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F | CC(=O)N[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F | CCC(C=O)=N[C@@H](CC(=O)N[C@H](C(N)=O)C(C)(C)C)c1c(F)cccc1F | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&C=O",
"old_substring": "CC2=O"
} |
Can you make molecule O=C(Cc1ccc2ccccc2c1)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccc2ccccc2c1)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 | O=C(Cc1ccc2ccccc2c1)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 | O=C(/C=C/Sc1ccc2ccccc2c1)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C3C6"
} |
Can you make molecule O=C(Cc1ccc2ccccc2c1)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(c2ccc3ccccc3c2)CC1)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 | O=C(Cc1ccc2ccccc2c1)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 | O=C(NN=C1CCC(c2ccc3ccccc3c2)CC1)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C3C6"
} |
Can you make molecule O=C(Cc1ccc2ccccc2c1)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ON(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1)C(=O)Sc1ccc2ccccc2c1 | O=C(Cc1ccc2ccccc2c1)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 | C/C(=N\ON(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1)C(=O)Sc1ccc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C3C6"
} |
Can you make molecule O=C(Cc1ccc2ccccc2c1)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C1=CC[C@H](c2ccc3ccccc3c2)S1)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 | O=C(Cc1ccc2ccccc2c1)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 | O=C(C1=CC[C@H](c2ccc3ccccc3c2)S1)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C3C6"
} |
Can you make molecule O=C(Cc1ccc2ccccc2c1)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=Cc1ccc(-c2ccc3ccccc3c2)cc1)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 | O=C(Cc1ccc2ccccc2c1)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 | O=C(NN=Cc1ccc(-c2ccc3ccccc3c2)cc1)N(Cc1ccccc1)[C@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=Cc1ccc&cc1",
"old_substring": "O=C3C6"
} |
Can you make molecule C[C@H]1CCC[C@H](NC(=O)CN2CC[NH+](CC=Cc3ccco3)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@H](NSC(=O)CN2CC[NH+](CC=Cc3ccco3)CC2)C1 | C[C@H]1CCC[C@H](NC(=O)CN2CC[NH+](CC=Cc3ccco3)CC2)C1 | C[C@H]1CCC[C@H](NSC(=O)CN2CC[NH+](CC=Cc3ccco3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C4(=O)C5"
} |
Can you make molecule C[C@H]1CCC[C@H](NC(=O)CN2CC[NH+](CC=Cc3ccco3)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@H](NC(=O)CCCC(=O)N2CC[NH+](CC=Cc3ccco3)CC2)C1 | C[C@H]1CCC[C@H](NC(=O)CN2CC[NH+](CC=Cc3ccco3)CC2)C1 | C[C@H]1CCC[C@H](NC(=O)CCCC(=O)N2CC[NH+](CC=Cc3ccco3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C4(=O)C5"
} |
Can you make molecule C[C@H]1CCC[C@H](NC(=O)CN2CC[NH+](CC=Cc3ccco3)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@H](NC(=O)CC(C)(C)N2CC[NH+](CC=Cc3ccco3)CC2)C1 | C[C@H]1CCC[C@H](NC(=O)CN2CC[NH+](CC=Cc3ccco3)CC2)C1 | C[C@H]1CCC[C@H](NC(=O)CC(C)(C)N2CC[NH+](CC=Cc3ccco3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)C5"
} |
Can you make molecule C[C@H]1CCC[C@H](NC(=O)CN2CC[NH+](CC=Cc3ccco3)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@H](NC[S@+]([O-])CCCN2CC[NH+](CC=Cc3ccco3)CC2)C1 | C[C@H]1CCC[C@H](NC(=O)CN2CC[NH+](CC=Cc3ccco3)CC2)C1 | C[C@H]1CCC[C@H](NC[S@+]([O-])CCCN2CC[NH+](CC=Cc3ccco3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C4(=O)C5"
} |
Can you make molecule C[C@H]1CCC[C@H](NC(=O)CN2CC[NH+](CC=Cc3ccco3)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@H](NC(=O)CCC(C)(C)N2CC[NH+](CC=Cc3ccco3)CC2)C1 | C[C@H]1CCC[C@H](NC(=O)CN2CC[NH+](CC=Cc3ccco3)CC2)C1 | C[C@H]1CCC[C@H](NC(=O)CCC(C)(C)N2CC[NH+](CC=Cc3ccco3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C4(=O)C5"
} |
Can you make molecule CC[C@@](C)(C[NH3+])[C@](C)(O)Cc1ccc(OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@](C)(C[NH3+])[C@](C)(O)Cc1ccc(OC)cc1I | CC[C@@](C)(C[NH3+])[C@](C)(O)Cc1ccc(OC)cc1 | CC[C@@](C)(C[NH3+])[C@](C)(O)Cc1ccc(OC)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c13ccc2cc1"
} |
Can you make molecule CC[C@@](C)(C[NH3+])[C@](C)(O)Cc1ccc(OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@](C)(C[NH3+])[C@](C)(O)Cc1cc(OC)ccc1Br | CC[C@@](C)(C[NH3+])[C@](C)(O)Cc1ccc(OC)cc1 | CC[C@@](C)(C[NH3+])[C@](C)(O)Cc1cc(OC)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c13ccc2cc1"
} |
Can you make molecule CC[C@@](C)(C[NH3+])[C@](C)(O)Cc1ccc(OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@](C)(C[NH3+])[C@](C)(O)Cc1ccc(OC)cc1Cl | CC[C@@](C)(C[NH3+])[C@](C)(O)Cc1ccc(OC)cc1 | CC[C@@](C)(C[NH3+])[C@](C)(O)Cc1ccc(OC)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c13ccc2cc1"
} |
Can you make molecule CC[C@@](C)(C[NH3+])[C@](C)(O)Cc1ccc(OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@](C)(C[NH3+])[C@](C)(O)Cc1cccc(OC)c1Br | CC[C@@](C)(C[NH3+])[C@](C)(O)Cc1ccc(OC)cc1 | CC[C@@](C)(C[NH3+])[C@](C)(O)Cc1cccc(OC)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c13ccc2cc1"
} |
Can you make molecule CC[C@@](C)(C[NH3+])[C@](C)(O)Cc1ccc(OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@](C)(C[NH3+])[C@](C)(O)Cc1cccc(OC)c1Cl | CC[C@@](C)(C[NH3+])[C@](C)(O)Cc1ccc(OC)cc1 | CC[C@@](C)(C[NH3+])[C@](C)(O)Cc1cccc(OC)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c13ccc2cc1"
} |
Can you make molecule CS(=O)(=O)NCC[NH2+]Cc1ccc(C(=O)[O-])cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCCS(=O)(=O)NCC[NH2+]Cc1ccc(C(=O)[O-])cn1 | CS(=O)(=O)NCC[NH2+]Cc1ccc(C(=O)[O-])cn1 | CCCS(=O)(=O)NCC[NH2+]Cc1ccc(C(=O)[O-])cn1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCS&(=O)=O",
"old_substring": "CS5(=O)=O"
} |
Can you make molecule CS(=O)(=O)NCC[NH2+]Cc1ccc(C(=O)[O-])cn1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)SNCC[NH2+]Cc1ccc(C(=O)[O-])cn1 | CS(=O)(=O)NCC[NH2+]Cc1ccc(C(=O)[O-])cn1 | CS(=O)(=O)SNCC[NH2+]Cc1ccc(C(=O)[O-])cn1 | 102 | {
"fragment_index": 0,
"new_substring": "CS(=O)(=O)S&",
"old_substring": "CS5(=O)=O"
} |
Can you make molecule CS(=O)(=O)NCC[NH2+]Cc1ccc(C(=O)[O-])cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCS(=O)(=O)NCC[NH2+]Cc1ccc(C(=O)[O-])cn1 | CS(=O)(=O)NCC[NH2+]Cc1ccc(C(=O)[O-])cn1 | CCCCS(=O)(=O)NCC[NH2+]Cc1ccc(C(=O)[O-])cn1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCS&(=O)=O",
"old_substring": "CS5(=O)=O"
} |
Can you make molecule CS(=O)(=O)NCC[NH2+]Cc1ccc(C(=O)[O-])cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCS(=O)(=O)NCC[NH2+]Cc1ccc(C(=O)[O-])cn1 | CS(=O)(=O)NCC[NH2+]Cc1ccc(C(=O)[O-])cn1 | CCCCCS(=O)(=O)NCC[NH2+]Cc1ccc(C(=O)[O-])cn1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCS&(=O)=O",
"old_substring": "CS5(=O)=O"
} |
Can you make molecule CS(=O)(=O)NCC[NH2+]Cc1ccc(C(=O)[O-])cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCCS(=O)(=O)SNCC[NH2+]Cc1ccc(C(=O)[O-])cn1 | CS(=O)(=O)NCC[NH2+]Cc1ccc(C(=O)[O-])cn1 | CCCS(=O)(=O)SNCC[NH2+]Cc1ccc(C(=O)[O-])cn1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCS(=O)(=O)S&",
"old_substring": "CS5(=O)=O"
} |
Can you make molecule Cc1cnn(CCCNC(=O)N2CCCC[C@H](N3CC[NH+](C)CC3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnn(CCCCCNC(=O)N2CCCC[C@H](N3CC[NH+](C)CC3)C2)c1 | Cc1cnn(CCCNC(=O)N2CCCC[C@H](N3CC[NH+](C)CC3)C2)c1 | Cc1cnn(CCCCCNC(=O)N2CCCC[C@H](N3CC[NH+](C)CC3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C8CC6"
} |
Can you make molecule Cc1cnn(CCCNC(=O)N2CCCC[C@H](N3CC[NH+](C)CC3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnn([C@@H](C)CCNC(=O)N2CCCC[C@H](N3CC[NH+](C)CC3)C2)c1 | Cc1cnn(CCCNC(=O)N2CCCC[C@H](N3CC[NH+](C)CC3)C2)c1 | Cc1cnn([C@@H](C)CCNC(=O)N2CCCC[C@H](N3CC[NH+](C)CC3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C8CC6"
} |
Can you make molecule Cc1cnn(CCCNC(=O)N2CCCC[C@H](N3CC[NH+](C)CC3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnn(C2CCC(NC(=O)N3CCCC[C@H](N4CC[NH+](C)CC4)C3)CC2)c1 | Cc1cnn(CCCNC(=O)N2CCCC[C@H](N3CC[NH+](C)CC3)C2)c1 | Cc1cnn(C2CCC(NC(=O)N3CCCC[C@H](N4CC[NH+](C)CC4)C3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C8CC6"
} |
Can you make molecule Cc1cnn(CCCNC(=O)N2CCCC[C@H](N3CC[NH+](C)CC3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnn(CC(C)(C)CNC(=O)N2CCCC[C@H](N3CC[NH+](C)CC3)C2)c1 | Cc1cnn(CCCNC(=O)N2CCCC[C@H](N3CC[NH+](C)CC3)C2)c1 | Cc1cnn(CC(C)(C)CNC(=O)N2CCCC[C@H](N3CC[NH+](C)CC3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)C&",
"old_substring": "C8CC6"
} |
Can you make molecule Cc1cnn(CCCNC(=O)N2CCCC[C@H](N3CC[NH+](C)CC3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnn(C2CCC(=NC(=O)N3CCCC[C@H](N4CC[NH+](C)CC4)C3)CC2)c1 | Cc1cnn(CCCNC(=O)N2CCCC[C@H](N3CC[NH+](C)CC3)C2)c1 | Cc1cnn(C2CCC(=NC(=O)N3CCCC[C@H](N4CC[NH+](C)CC4)C3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC=&CC1",
"old_substring": "C8CC6"
} |
Can you make molecule Cc1ccccc1CC(=O)N1CCC[C@@H]1CNC(=O)OC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CC(=O)N1CCC[C@@H]1CNC(=O)OC(Cl)(Cl)Cl | Cc1ccccc1CC(=O)N1CCC[C@@H]1CNC(=O)OC(C)(C)C | Cc1ccccc1CC(=O)N1CCC[C@@H]1CNC(=O)OC(Cl)(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule Cc1ccccc1CC(=O)N1CCC[C@@H]1CNC(=O)OC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CC(=O)N1CCC[C@@H]1CNC(=O)OC(C)(C)CC(C)(C)C | Cc1ccccc1CC(=O)N1CCC[C@@H]1CNC(=O)OC(C)(C)C | Cc1ccccc1CC(=O)N1CCC[C@@H]1CNC(=O)OC(C)(C)CC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)(C)CC(C)(C)C",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule Cc1ccccc1CC(=O)N1CCC[C@@H]1CNC(=O)OC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CC(=O)N1CCC[C@@H]1CNC(=O)OCCCC(C)(C)C | Cc1ccccc1CC(=O)N1CCC[C@@H]1CNC(=O)OC(C)(C)C | Cc1ccccc1CC(=O)N1CCC[C@@H]1CNC(=O)OCCCC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(C)(C)C",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule Cc1ccccc1CC(=O)N1CCC[C@@H]1CNC(=O)OC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CC(=O)N1CCC[C@@H]1CNC(=O)OCCCC(F)(F)F | Cc1ccccc1CC(=O)N1CCC[C@@H]1CNC(=O)OC(C)(C)C | Cc1ccccc1CC(=O)N1CCC[C@@H]1CNC(=O)OCCCC(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule Cc1ccccc1CC(=O)N1CCC[C@@H]1CNC(=O)OC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CC(=O)N1CCC[C@@H]1CNC(=O)OCCCCC(F)(F)F | Cc1ccccc1CC(=O)N1CCC[C@@H]1CNC(=O)OC(C)(C)C | Cc1ccccc1CC(=O)N1CCC[C@@H]1CNC(=O)OCCCCC(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2CCC[C@@H]2C(=O)N(C)Cc2cccc(Cl)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)N2CCC[C@@H]2CC(=O)SN(C)Cc2cccc(Cl)c2)cc1 | Cc1ccc(S(=O)(=O)N2CCC[C@@H]2C(=O)N(C)Cc2cccc(Cl)c2)cc1 | Cc1ccc(S(=O)(=O)N2CCC[C@@H]2CC(=O)SN(C)Cc2cccc(Cl)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2CCC[C@@H]2C(=O)N(C)Cc2cccc(Cl)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)N2CCC[C@@H]2CC(=C=O)CN(C)Cc2cccc(Cl)c2)cc1 | Cc1ccc(S(=O)(=O)N2CCC[C@@H]2C(=O)N(C)Cc2cccc(Cl)c2)cc1 | Cc1ccc(S(=O)(=O)N2CCC[C@@H]2CC(=C=O)CN(C)Cc2cccc(Cl)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2CCC[C@@H]2C(=O)N(C)Cc2cccc(Cl)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)N2CCC[C@@H]2C(=O)CCCC(=O)N(C)Cc2cccc(Cl)c2)cc1 | Cc1ccc(S(=O)(=O)N2CCC[C@@H]2C(=O)N(C)Cc2cccc(Cl)c2)cc1 | Cc1ccc(S(=O)(=O)N2CCC[C@@H]2C(=O)CCCC(=O)N(C)Cc2cccc(Cl)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2CCC[C@@H]2C(=O)N(C)Cc2cccc(Cl)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)N2CCC[C@@H]2C(C)(C)CC(=O)N(C)Cc2cccc(Cl)c2)cc1 | Cc1ccc(S(=O)(=O)N2CCC[C@@H]2C(=O)N(C)Cc2cccc(Cl)c2)cc1 | Cc1ccc(S(=O)(=O)N2CCC[C@@H]2C(C)(C)CC(=O)N(C)Cc2cccc(Cl)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2CCC[C@@H]2C(=O)N(C)Cc2cccc(Cl)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)N2CCC[C@@H]2CCC[S@@+]([O-])CN(C)Cc2cccc(Cl)c2)cc1 | Cc1ccc(S(=O)(=O)N2CCC[C@@H]2C(=O)N(C)Cc2cccc(Cl)c2)cc1 | Cc1ccc(S(=O)(=O)N2CCC[C@@H]2CCC[S@@+]([O-])CN(C)Cc2cccc(Cl)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C36=O"
} |
Can you make molecule CC(C)CC[C@@H](C)NC(=O)Nc1ccc([S@@+](C)[O-])c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@@H](C)c1nc2c(s1)CN(C(=O)Nc1ccc([S@@+](C)[O-])c(F)c1)C2 | CC(C)CC[C@@H](C)NC(=O)Nc1ccc([S@@+](C)[O-])c(F)c1 | CC(C)CC[C@@H](C)c1nc2c(s1)CN(C(=O)Nc1ccc([S@@+](C)[O-])c(F)c1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N24"
} |
Can you make molecule CC(C)CC[C@@H](C)NC(=O)Nc1ccc([S@@+](C)[O-])c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@@H](C)n1ncc2c1CN(C(=O)Nc1ccc([S@@+](C)[O-])c(F)c1)C2 | CC(C)CC[C@@H](C)NC(=O)Nc1ccc([S@@+](C)[O-])c(F)c1 | CC(C)CC[C@@H](C)n1ncc2c1CN(C(=O)Nc1ccc([S@@+](C)[O-])c(F)c1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2cnn&c2C1",
"old_substring": "N24"
} |
Can you make molecule CC(C)CC[C@@H](C)NC(=O)Nc1ccc([S@@+](C)[O-])c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@@H](C)c1onc2c1CN(C(=O)Nc1ccc([S@@+](C)[O-])c(F)c1)CC2 | CC(C)CC[C@@H](C)NC(=O)Nc1ccc([S@@+](C)[O-])c(F)c1 | CC(C)CC[C@@H](C)c1onc2c1CN(C(=O)Nc1ccc([S@@+](C)[O-])c(F)c1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N24"
} |
Can you make molecule CC(C)CC[C@@H](C)NC(=O)Nc1ccc([S@@+](C)[O-])c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@@H](C)c1cc2n(n1)CCCN2C(=O)Nc1ccc([S@@+](C)[O-])c(F)c1 | CC(C)CC[C@@H](C)NC(=O)Nc1ccc([S@@+](C)[O-])c(F)c1 | CC(C)CC[C@@H](C)c1cc2n(n1)CCCN2C(=O)Nc1ccc([S@@+](C)[O-])c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc21",
"old_substring": "N24"
} |
Can you make molecule CC(C)CC[C@@H](C)NC(=O)Nc1ccc([S@@+](C)[O-])c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@@H](C)c1ccc2c(c1)CCN2C(=O)Nc1ccc([S@@+](C)[O-])c(F)c1 | CC(C)CC[C@@H](C)NC(=O)Nc1ccc([S@@+](C)[O-])c(F)c1 | CC(C)CC[C@@H](C)c1ccc2c(c1)CCN2C(=O)Nc1ccc([S@@+](C)[O-])c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N24"
} |
Can you make molecule Fc1cccc(Oc2nc(-c3ccncc3)nc3c2CCC3)c1F less soluble in water? The output molecule should be similar to the input molecule. | Fc1cccc(Oc2nc(-c3ccncc3Cl)nc3c2CCC3)c1F | Fc1cccc(Oc2nc(-c3ccncc3)nc3c2CCC3)c1F | Fc1cccc(Oc2nc(-c3ccncc3Cl)nc3c2CCC3)c1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c16ccncc1"
} |
Can you make molecule Fc1cccc(Oc2nc(-c3ccncc3)nc3c2CCC3)c1F less soluble in water? The output molecule should be similar to the input molecule. | Fc1cccc(Oc2nc(-c3ccccc3)nc3c2CCC3)c1F | Fc1cccc(Oc2nc(-c3ccncc3)nc3c2CCC3)c1F | Fc1cccc(Oc2nc(-c3ccccc3)nc3c2CCC3)c1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c16ccncc1"
} |
Can you make molecule Fc1cccc(Oc2nc(-c3ccncc3)nc3c2CCC3)c1F less soluble in water? The output molecule should be similar to the input molecule. | Fc1cccc(Oc2nc(-c3cnccc3Cl)nc3c2CCC3)c1F | Fc1cccc(Oc2nc(-c3ccncc3)nc3c2CCC3)c1F | Fc1cccc(Oc2nc(-c3cnccc3Cl)nc3c2CCC3)c1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnccc1Cl",
"old_substring": "c16ccncc1"
} |
Can you make molecule Fc1cccc(Oc2nc(-c3ccncc3)nc3c2CCC3)c1F less soluble in water? The output molecule should be similar to the input molecule. | Fc1cnc(Br)cc1-c1nc2c(c(Oc3cccc(F)c3F)n1)CCC2 | Fc1cccc(Oc2nc(-c3ccncc3)nc3c2CCC3)c1F | Fc1cnc(Br)cc1-c1nc2c(c(Oc3cccc(F)c3F)n1)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ncc1F",
"old_substring": "c16ccncc1"
} |
Can you make molecule Fc1cccc(Oc2nc(-c3ccncc3)nc3c2CCC3)c1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-c2nc3c(c(Oc4cccc(F)c4F)n2)CCC3)ncc1Br | Fc1cccc(Oc2nc(-c3ccncc3)nc3c2CCC3)c1F | Cc1cc(-c2nc3c(c(Oc4cccc(F)c4F)n2)CCC3)ncc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&ncc1Br",
"old_substring": "c16ccncc1"
} |
Can you make molecule Cc1ccc(NC(=O)NC(=O)COC(=O)c2ccc(-n3cccc3)cc2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)NSC(=O)COC(=O)c2ccc(-n3cccc3)cc2)c(C)c1 | Cc1ccc(NC(=O)NC(=O)COC(=O)c2ccc(-n3cccc3)cc2)c(C)c1 | Cc1ccc(NC(=O)NSC(=O)COC(=O)c2ccc(-n3cccc3)cc2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C7(=O)C8"
} |
Can you make molecule Cc1ccc(NC(=O)NC(=O)COC(=O)c2ccc(-n3cccc3)cc2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)NC(=O)CCCC(=O)OC(=O)c2ccc(-n3cccc3)cc2)c(C)c1 | Cc1ccc(NC(=O)NC(=O)COC(=O)c2ccc(-n3cccc3)cc2)c(C)c1 | Cc1ccc(NC(=O)NC(=O)CCCC(=O)OC(=O)c2ccc(-n3cccc3)cc2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C7(=O)C8"
} |
Can you make molecule Cc1ccc(NC(=O)NC(=O)COC(=O)c2ccc(-n3cccc3)cc2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)NC(=O)CC(C)(C)OC(=O)c2ccc(-n3cccc3)cc2)c(C)c1 | Cc1ccc(NC(=O)NC(=O)COC(=O)c2ccc(-n3cccc3)cc2)c(C)c1 | Cc1ccc(NC(=O)NC(=O)CC(C)(C)OC(=O)c2ccc(-n3cccc3)cc2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C7(=O)C8"
} |
Can you make molecule Cc1ccc(NC(=O)NC(=O)COC(=O)c2ccc(-n3cccc3)cc2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)NC[S@+]([O-])CCCOC(=O)c2ccc(-n3cccc3)cc2)c(C)c1 | Cc1ccc(NC(=O)NC(=O)COC(=O)c2ccc(-n3cccc3)cc2)c(C)c1 | Cc1ccc(NC(=O)NC[S@+]([O-])CCCOC(=O)c2ccc(-n3cccc3)cc2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C7(=O)C8"
} |
Can you make molecule Cc1ccc(NC(=O)NC(=O)COC(=O)c2ccc(-n3cccc3)cc2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)NC(=O)CCC(C)(C)OC(=O)c2ccc(-n3cccc3)cc2)c(C)c1 | Cc1ccc(NC(=O)NC(=O)COC(=O)c2ccc(-n3cccc3)cc2)c(C)c1 | Cc1ccc(NC(=O)NC(=O)CCC(C)(C)OC(=O)c2ccc(-n3cccc3)cc2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C7(=O)C8"
} |
Can you make molecule COc1cccc(CNC(=O)CSc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CNSC(=O)CSc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 | COc1cccc(CNC(=O)CSc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 | COc1cccc(CNSC(=O)CSc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C5(=O)C8"
} |
Can you make molecule COc1cccc(CNC(=O)CSc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CNC(=O)CCCC(=O)Sc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 | COc1cccc(CNC(=O)CSc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 | COc1cccc(CNC(=O)CCCC(=O)Sc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C5(=O)C8"
} |
Can you make molecule COc1cccc(CNC(=O)CSc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CNC(=O)CC(C)(C)Sc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 | COc1cccc(CNC(=O)CSc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 | COc1cccc(CNC(=O)CC(C)(C)Sc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C5(=O)C8"
} |
Can you make molecule COc1cccc(CNC(=O)CSc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CNC[S@+]([O-])CCCSc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 | COc1cccc(CNC(=O)CSc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 | COc1cccc(CNC[S@+]([O-])CCCSc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C5(=O)C8"
} |
Can you make molecule COc1cccc(CNC(=O)CSc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CNC(=O)CCC(C)(C)Sc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 | COc1cccc(CNC(=O)CSc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 | COc1cccc(CNC(=O)CCC(C)(C)Sc2nnc(-c3ccc4[nH]c(C)c(C)c4c3)o2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C5(=O)C8"
} |
Can you make molecule NC(=O)c1c(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)sc2c1CCC2 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)CCCc1c(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)sc2c1CCC2 | NC(=O)c1c(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)sc2c1CCC2 | NC(=O)CCCc1c(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)sc2c1CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "NC(=O)CCC&",
"old_substring": "NC6=O"
} |
Can you make molecule NC(=O)c1c(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)sc2c1CCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CCCN(c2c(NC(=O)c3cc([N+](=O)[O-])ccc3N3CCOCC3)sc3c2CCC3)C1 | NC(=O)c1c(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)sc2c1CCC2 | O=C1CCCN(c2c(NC(=O)c3cc([N+](=O)[O-])ccc3N3CCOCC3)sc3c2CCC3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(=O)C1",
"old_substring": "NC6=O"
} |
Can you make molecule NC(=O)c1c(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)sc2c1CCC2 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)c1c(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)sc2c1CCC2 | NC(=O)c1c(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)sc2c1CCC2 | CCC(=O)c1c(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)sc2c1CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&=O",
"old_substring": "NC6=O"
} |
Can you make molecule NC(=O)c1c(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)sc2c1CCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=CC1CCN(c2c(NC(=O)c3cc([N+](=O)[O-])ccc3N3CCOCC3)sc3c2CCC3)CC1 | NC(=O)c1c(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)sc2c1CCC2 | O=CC1CCN(c2c(NC(=O)c3cc([N+](=O)[O-])ccc3N3CCOCC3)sc3c2CCC3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C=O)CC1",
"old_substring": "NC6=O"
} |
Can you make molecule NC(=O)c1c(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)sc2c1CCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1sc2c(c1N1C(=O)CSC1=S)CCC2)c1cc([N+](=O)[O-])ccc1N1CCOCC1 | NC(=O)c1c(NC(=O)c2cc([N+](=O)[O-])ccc2N2CCOCC2)sc2c1CCC2 | O=C(Nc1sc2c(c1N1C(=O)CSC1=S)CCC2)c1cc([N+](=O)[O-])ccc1N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&C(=O)CSC1=S",
"old_substring": "NC6=O"
} |
Can you make molecule O=C(C=C1CCSCC1)NC[C@H](O)C[NH+]1CCc2ccccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=NC[C@H](O)C[NH+]2CCc3ccccc3C2)CCC1=C1CCSCC1 | O=C(C=C1CCSCC1)NC[C@H](O)C[NH+]1CCc2ccccc2C1 | O=C1C(=NC[C@H](O)C[NH+]2CCc3ccccc3C2)CCC1=C1CCSCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1C=&CCC1=&",
"old_substring": "O=C3C=6"
} |
Can you make molecule O=C(C=C1CCSCC1)NC[C@H](O)C[NH+]1CCc2ccccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=O)C(=C2CCSCC2)CCCC1=NC[C@H](O)C[NH+]1CCc2ccccc2C1 | O=C(C=C1CCSCC1)NC[C@H](O)C[NH+]1CCc2ccccc2C1 | O=C1C(=O)C(=C2CCSCC2)CCCC1=NC[C@H](O)C[NH+]1CCc2ccccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1C=&CCCC=&C1=O",
"old_substring": "O=C3C=6"
} |
Can you make molecule O=C(C=C1CCSCC1)NC[C@H](O)C[NH+]1CCc2ccccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H](O)C[NH+]1CCc2ccccc2C1)NN=C1CCC(=C2CCSCC2)CC1 | O=C(C=C1CCSCC1)NC[C@H](O)C[NH+]1CCc2ccccc2C1 | O=C(NC[C@H](O)C[NH+]1CCc2ccccc2C1)NN=C1CCC(=C2CCSCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C3C=6"
} |
Can you make molecule O=C(C=C1CCSCC1)NC[C@H](O)C[NH+]1CCc2ccccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H](O)C[NH+]1CCc2ccccc2C1)C1=C(N=C2CCSCC2)CCS1 | O=C(C=C1CCSCC1)NC[C@H](O)C[NH+]1CCc2ccccc2C1 | O=C(NC[C@H](O)C[NH+]1CCc2ccccc2C1)C1=C(N=C2CCSCC2)CCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=C(N&)CCS1",
"old_substring": "O=C3C=6"
} |
Can you make molecule O=C(C=C1CCSCC1)NC[C@H](O)C[NH+]1CCc2ccccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H](O)C[NH+]1CCc2ccccc2C1)C(N=C1CCSCC1)=C(Cl)Cl | O=C(C=C1CCSCC1)NC[C@H](O)C[NH+]1CCc2ccccc2C1 | O=C(NC[C@H](O)C[NH+]1CCc2ccccc2C1)C(N=C1CCSCC1)=C(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(N&)=C(Cl)Cl",
"old_substring": "O=C3C=6"
} |
Can you make molecule CCCN1CCO[C@H]([C@H](O)Cc2cc(C)cc(C)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCN1CCO[C@H]([C@H](CCl)CCCc2cc(C)cc(C)c2)C1 | CCCN1CCO[C@H]([C@H](O)Cc2cc(C)cc(C)c2)C1 | CCCN1CCO[C@H]([C@H](CCl)CCCc2cc(C)cc(C)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]4(O)C5"
} |
Can you make molecule CCCN1CCO[C@H]([C@H](O)Cc2cc(C)cc(C)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCN1CCO[C@H]([C@@H]2CCN(Cc3cc(C)cc(C)c3)C2)C1 | CCCN1CCO[C@H]([C@H](O)Cc2cc(C)cc(C)c2)C1 | CCCN1CCO[C@H]([C@@H]2CCN(Cc3cc(C)cc(C)c3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCN(C&)C1",
"old_substring": "[C@@H]4(O)C5"
} |
Can you make molecule CCCN1CCO[C@H]([C@H](O)Cc2cc(C)cc(C)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCN1CCO[C@H]([C@]2(F)CCN(c3cc(C)cc(C)c3)C2)C1 | CCCN1CCO[C@H]([C@H](O)Cc2cc(C)cc(C)c2)C1 | CCCN1CCO[C@H]([C@]2(F)CCN(c3cc(C)cc(C)c3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@]1&(F)CCN&C1",
"old_substring": "[C@@H]4(O)C5"
} |
Can you make molecule CCCN1CCO[C@H]([C@H](O)Cc2cc(C)cc(C)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCN1CCO[C@H]([C@@H]2C=C(Cc3cc(C)cc(C)c3)N=N2)C1 | CCCN1CCO[C@H]([C@H](O)Cc2cc(C)cc(C)c2)C1 | CCCN1CCO[C@H]([C@@H]2C=C(Cc3cc(C)cc(C)c3)N=N2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=C(C&)N=N1",
"old_substring": "[C@@H]4(O)C5"
} |
Can you make molecule CCCN1CCO[C@H]([C@H](O)Cc2cc(C)cc(C)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCN1CCO[C@H]([C@H](C)C(C)(C)Cc2cc(C)cc(C)c2)C1 | CCCN1CCO[C@H]([C@H](O)Cc2cc(C)cc(C)c2)C1 | CCCN1CCO[C@H]([C@H](C)C(C)(C)Cc2cc(C)cc(C)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "[C@@H]4(O)C5"
} |
Can you make molecule CN(C)/C=C/C(=O)Oc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)/C=C/C(=O)Oc1ccc(Cl)cc1I | CN(C)/C=C/C(=O)Oc1ccc(Cl)cc1 | CN(C)/C=C/C(=O)Oc1ccc(Cl)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c13ccc(Cl)cc1"
} |
Can you make molecule CN(C)/C=C/C(=O)Oc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)/C=C/C(=O)Oc1ccc(Cl)cc1Br | CN(C)/C=C/C(=O)Oc1ccc(Cl)cc1 | CN(C)/C=C/C(=O)Oc1ccc(Cl)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c13ccc(Cl)cc1"
} |
Can you make molecule CN(C)/C=C/C(=O)Oc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)/C=C/C(=O)Oc1ccc(Cl)c(I)c1 | CN(C)/C=C/C(=O)Oc1ccc(Cl)cc1 | CN(C)/C=C/C(=O)Oc1ccc(Cl)c(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c13ccc(Cl)cc1"
} |
Can you make molecule CN(C)/C=C/C(=O)Oc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)/C=C/C(=O)Oc1cc(Cl)ccc1Cl | CN(C)/C=C/C(=O)Oc1ccc(Cl)cc1 | CN(C)/C=C/C(=O)Oc1cc(Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Clc1ccc(Cl)c&c1",
"old_substring": "c13ccc(Cl)cc1"
} |
Can you make molecule CN(C)/C=C/C(=O)Oc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)/C=C/C(=O)Oc1ccc(Cl)c(Cl)c1 | CN(C)/C=C/C(=O)Oc1ccc(Cl)cc1 | CN(C)/C=C/C(=O)Oc1ccc(Cl)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c13ccc(Cl)cc1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.