prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CN(C)S(=O)(=O)c1ccc(C(=O)N(C(=O)N2CCCCC2)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)S(=O)(=O)c1ccc(C(=O)N(C(=O)N2CCCCCCC2)c2ccccc2)cc1 | CN(C)S(=O)(=O)c1ccc(C(=O)N(C(=O)N2CCCCC2)c2ccccc2)cc1 | CN(C)S(=O)(=O)c1ccc(C(=O)N(C(=O)N2CCCCCCC2)c2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1",
"old_substring": "N15CCCCC1"
} |
Can you make molecule CN(C)S(=O)(=O)c1ccc(C(=O)N(C(=O)N2CCCCC2)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)S(=O)(=O)c1ccc(C(=O)N(C(=O)N2CCCCCCCC2)c2ccccc2)cc1 | CN(C)S(=O)(=O)c1ccc(C(=O)N(C(=O)N2CCCCC2)c2ccccc2)cc1 | CN(C)S(=O)(=O)c1ccc(C(=O)N(C(=O)N2CCCCCCCC2)c2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCCC1",
"old_substring": "N15CCCCC1"
} |
Can you make molecule CN(C)S(=O)(=O)c1ccc(C(=O)N(C(=O)N2CCCCC2)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)S(=O)(=O)c1ccc(C(=O)N(C(=O)N2CCCC(C)(C)C2)c2ccccc2)cc1 | CN(C)S(=O)(=O)c1ccc(C(=O)N(C(=O)N2CCCCC2)c2ccccc2)cc1 | CN(C)S(=O)(=O)c1ccc(C(=O)N(C(=O)N2CCCC(C)(C)C2)c2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(C)(C)C1",
"old_substring": "N15CCCCC1"
} |
Can you make molecule CN(C)S(=O)(=O)c1ccc(C(=O)N(C(=O)N2CCCCC2)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)S(=O)(=O)c1ccc(C(=O)N(C(=O)N2CCCC(C)(C)CC2)c2ccccc2)cc1 | CN(C)S(=O)(=O)c1ccc(C(=O)N(C(=O)N2CCCCC2)c2ccccc2)cc1 | CN(C)S(=O)(=O)c1ccc(C(=O)N(C(=O)N2CCCC(C)(C)CC2)c2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(C)(C)CC1",
"old_substring": "N15CCCCC1"
} |
Can you make molecule CN(C)S(=O)(=O)c1ccc(C(=O)N(C(=O)N2CCCCC2)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)S(=O)(=O)c1ccc(C(=O)N(C(=O)N2CC3(CCCCC3)C2)c2ccccc2)cc1 | CN(C)S(=O)(=O)c1ccc(C(=O)N(C(=O)N2CCCCC2)c2ccccc2)cc1 | CN(C)S(=O)(=O)c1ccc(C(=O)N(C(=O)N2CC3(CCCCC3)C2)c2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC2(CCCCC2)C1",
"old_substring": "N15CCCCC1"
} |
Can you make molecule CC[NH2+][C@@H](CC)c1ccccc1OCc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH2+][C@@H](CC)c1ccccc1OCc1cc2cc(F)ccc2s1 | CC[NH2+][C@@H](CC)c1ccccc1OCc1cccc(F)c1 | CC[NH2+][C@@H](CC)c1ccccc1OCc1cc2cc(F)ccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc(F)ccc2s1",
"old_substring": "c17cccc(F)c1"
} |
Can you make molecule CC[NH2+][C@@H](CC)c1ccccc1OCc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH2+][C@@H](CC)c1ccccc1OC=Cc1cccc(F)c1F | CC[NH2+][C@@H](CC)c1ccccc1OCc1cccc(F)c1 | CC[NH2+][C@@H](CC)c1ccccc1OC=Cc1cccc(F)c1F | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1cccc(F)c1F",
"old_substring": "c17cccc(F)c1"
} |
Can you make molecule CC[NH2+][C@@H](CC)c1ccccc1OCc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH2+][C@@H](CC)c1ccccc1OCc1cccc(Br)c1C | CC[NH2+][C@@H](CC)c1ccccc1OCc1cccc(F)c1 | CC[NH2+][C@@H](CC)c1ccccc1OCc1cccc(Br)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Br)c1C",
"old_substring": "c17cccc(F)c1"
} |
Can you make molecule CC[NH2+][C@@H](CC)c1ccccc1OCc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH2+][C@@H](CC)c1ccccc1OCc1oc2ccc(F)cc2c1C | CC[NH2+][C@@H](CC)c1ccccc1OCc1cccc(F)c1 | CC[NH2+][C@@H](CC)c1ccccc1OCc1oc2ccc(F)cc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&oc2ccc(F)cc2c1C",
"old_substring": "c17cccc(F)c1"
} |
Can you make molecule CC[NH2+][C@@H](CC)c1ccccc1OCc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH2+][C@@H](CC)c1ccccc1OCc1cc(F)ccc1Br | CC[NH2+][C@@H](CC)c1ccccc1OCc1cccc(F)c1 | CC[NH2+][C@@H](CC)c1ccccc1OCc1cc(F)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c17cccc(F)c1"
} |
Can you make molecule C=CCOC(=O)C1=C(C)N=C2S[C@H](C)C(=O)N2[C@H]1c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCOC(=O)C1=C(C)N=C2S[C@H](C)C(=O)N2[C@H]1c1ccc(F)cc1 | C=CCOC(=O)C1=C(C)N=C2S[C@H](C)C(=O)N2[C@H]1c1ccc(F)cc1 | C=CCCCOC(=O)C1=C(C)N=C2S[C@H](C)C(=O)N2[C@H]1c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "C=CC4"
} |
Can you make molecule C=CCOC(=O)C1=C(C)N=C2S[C@H](C)C(=O)N2[C@H]1c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCOC(=O)C1=C(C)N=C2S[C@H](C)C(=O)N2[C@H]1c1ccc(F)cc1 | C=CCOC(=O)C1=C(C)N=C2S[C@H](C)C(=O)N2[C@H]1c1ccc(F)cc1 | C=CCCCCOC(=O)C1=C(C)N=C2S[C@H](C)C(=O)N2[C@H]1c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "C=CC4"
} |
Can you make molecule C=CCOC(=O)C1=C(C)N=C2S[C@H](C)C(=O)N2[C@H]1c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC(=O)OC(=O)C1=C(C)N=C2S[C@H](C)C(=O)N2[C@H]1c1ccc(F)cc1 | C=CCOC(=O)C1=C(C)N=C2S[C@H](C)C(=O)N2[C@H]1c1ccc(F)cc1 | C=CCCCC(=O)OC(=O)C1=C(C)N=C2S[C@H](C)C(=O)N2[C@H]1c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&=O",
"old_substring": "C=CC4"
} |
Can you make molecule C=CCOC(=O)C1=C(C)N=C2S[C@H](C)C(=O)N2[C@H]1c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC(CC=C)OC(=O)C1=C(C)N=C2S[C@H](C)C(=O)N2[C@H]1c1ccc(F)cc1 | C=CCOC(=O)C1=C(C)N=C2S[C@H](C)C(=O)N2[C@H]1c1ccc(F)cc1 | C=CCC(CC=C)OC(=O)C1=C(C)N=C2S[C@H](C)C(=O)N2[C@H]1c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&CC=C",
"old_substring": "C=CC4"
} |
Can you make molecule C=CCOC(=O)C1=C(C)N=C2S[C@H](C)C(=O)N2[C@H]1c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CC1CCN(OC(=O)C2=C(C)N=C3S[C@H](C)C(=O)N3[C@H]2c2ccc(F)cc2)CC1 | C=CCOC(=O)C1=C(C)N=C2S[C@H](C)C(=O)N2[C@H]1c1ccc(F)cc1 | C=CC1CCN(OC(=O)C2=C(C)N=C3S[C@H](C)C(=O)N3[C@H]2c2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CC1CCN&CC1",
"old_substring": "C=CC4"
} |
Can you make molecule CCC[NH2+][C@]1(C(=O)OCC)CC[C@H](n2cc(Cl)c(C)n2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@]1(C(=O)OCC)CC[C@H](n2c(C)nc(Cl)c2Cl)C1 | CCC[NH2+][C@]1(C(=O)OCC)CC[C@H](n2cc(Cl)c(C)n2)C1 | CCC[NH2+][C@]1(C(=O)OCC)CC[C@H](n2c(C)nc(Cl)c2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&c(C)nc(Cl)c1Cl",
"old_substring": "n18cc(Cl)c(C)n1"
} |
Can you make molecule CCC[NH2+][C@]1(C(=O)OCC)CC[C@H](n2cc(Cl)c(C)n2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@]1(C(=O)OCC)CC[C@H](c2c(Cl)cc(C)nc2Cl)C1 | CCC[NH2+][C@]1(C(=O)OCC)CC[C@H](n2cc(Cl)c(C)n2)C1 | CCC[NH2+][C@]1(C(=O)OCC)CC[C@H](c2c(Cl)cc(C)nc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc(C)nc1Cl",
"old_substring": "n18cc(Cl)c(C)n1"
} |
Can you make molecule CCC[NH2+][C@]1(C(=O)OCC)CC[C@H](n2cc(Cl)c(C)n2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@]1(C(=O)OCC)CC[C@H](n2ncc(Cl)c(Cl)c2=O)C1 | CCC[NH2+][C@]1(C(=O)OCC)CC[C@H](n2cc(Cl)c(C)n2)C1 | CCC[NH2+][C@]1(C(=O)OCC)CC[C@H](n2ncc(Cl)c(Cl)c2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c(Cl)c(Cl)cnn1&",
"old_substring": "n18cc(Cl)c(C)n1"
} |
Can you make molecule CCC[NH2+][C@]1(C(=O)OCC)CC[C@H](n2cc(Cl)c(C)n2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@]1(C(=O)OCC)CC[C@H](c2c(Cl)cc(Cl)nc2Cl)C1 | CCC[NH2+][C@]1(C(=O)OCC)CC[C@H](n2cc(Cl)c(C)n2)C1 | CCC[NH2+][C@]1(C(=O)OCC)CC[C@H](c2c(Cl)cc(Cl)nc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc(Cl)nc1Cl",
"old_substring": "n18cc(Cl)c(C)n1"
} |
Can you make molecule CCC[NH2+][C@]1(C(=O)OCC)CC[C@H](n2cc(Cl)c(C)n2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@]1(C(=O)OCC)CC[C@H](c2c(C)cc(C)nc2C)C1 | CCC[NH2+][C@]1(C(=O)OCC)CC[C@H](n2cc(Cl)c(C)n2)C1 | CCC[NH2+][C@]1(C(=O)OCC)CC[C@H](c2c(C)cc(C)nc2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(C)cc(C)nc1C",
"old_substring": "n18cc(Cl)c(C)n1"
} |
Can you make molecule Cc1cc(NC(=O)CSc2nnc3c4ccccc4n(C)c3n2)ccc1Br less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-c2snc(C(=O)CSc3nnc4c5ccccc5n(C)c4n3)c2N)ccc1Br | Cc1cc(NC(=O)CSc2nnc3c4ccccc4n(C)c3n2)ccc1Br | Cc1cc(-c2snc(C(=O)CSc3nnc4c5ccccc5n(C)c4n3)c2N)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N57"
} |
Can you make molecule Cc1cc(NC(=O)CSc2nnc3c4ccccc4n(C)c3n2)ccc1Br less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(SC(=S)N(C)C(=O)CSc2nnc3c4ccccc4n(C)c3n2)ccc1Br | Cc1cc(NC(=O)CSc2nnc3c4ccccc4n(C)c3n2)ccc1Br | Cc1cc(SC(=S)N(C)C(=O)CSc2nnc3c4ccccc4n(C)c3n2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N57"
} |
Can you make molecule Cc1cc(NC(=O)CSc2nnc3c4ccccc4n(C)c3n2)ccc1Br less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-c2cc(C(=O)CSc3nnc4c5ccccc5n(C)c4n3)oc2N)ccc1Br | Cc1cc(NC(=O)CSc2nnc3c4ccccc4n(C)c3n2)ccc1Br | Cc1cc(-c2cc(C(=O)CSc3nnc4c5ccccc5n(C)c4n3)oc2N)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N57"
} |
Can you make molecule Cc1cc(NC(=O)CSc2nnc3c4ccccc4n(C)c3n2)ccc1Br less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(SC2=NCCN2C(=O)CSc2nnc3c4ccccc4n(C)c3n2)ccc1Br | Cc1cc(NC(=O)CSc2nnc3c4ccccc4n(C)c3n2)ccc1Br | Cc1cc(SC2=NCCN2C(=O)CSc2nnc3c4ccccc4n(C)c3n2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N57"
} |
Can you make molecule Cc1cc(NC(=O)CSc2nnc3c4ccccc4n(C)c3n2)ccc1Br less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C2CCN(CC(=O)CSc3nnc4c5ccccc5n(C)c4n3)CC2)ccc1Br | Cc1cc(NC(=O)CSc2nnc3c4ccccc4n(C)c3n2)ccc1Br | Cc1cc(C2CCN(CC(=O)CSc3nnc4c5ccccc5n(C)c4n3)CC2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N57"
} |
Can you make molecule CCOC(=O)c1sc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CCOSC(=O)Cc1sc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1C | CCOC(=O)c1sc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1C | CCOSC(=O)Cc1sc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C59=O"
} |
Can you make molecule CCOC(=O)c1sc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCCC(=O)c1sc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1C | CCOC(=O)c1sc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1C | CCOC(=O)CCCC(=O)c1sc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C59=O"
} |
Can you make molecule CCOC(=O)c1sc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CC(C)(C)c1sc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1C | CCOC(=O)c1sc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1C | CCOC(=O)CC(C)(C)c1sc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C59=O"
} |
Can you make molecule CCOC(=O)c1sc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCC(C)(C)c1sc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1C | CCOC(=O)c1sc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1C | CCOC(=O)CCC(C)(C)c1sc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C59=O"
} |
Can you make molecule CCOC(=O)c1sc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CCOSC(=O)[C@@H](C)c1sc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1C | CCOC(=O)c1sc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1C | CCOSC(=O)[C@@H](C)c1sc(NC(=O)c2ccc(-n3c(C)nc4ccccc4c3=O)cc2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C59=O"
} |
Can you make molecule CC#CCC(=O)C1([NH+](CC)CC)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CS[NH+](CC)C1(C(=O)CC#CC)CCCC1 | CC#CCC(=O)C1([NH+](CC)CC)CCCC1 | C=CS[NH+](CC)C1(C(=O)CC#CC)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "C3C"
} |
Can you make molecule CC#CCC(=O)C1([NH+](CC)CC)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[NH+](CC)C1(C(=O)CC#CC)CCCC1 | CC#CCC(=O)C1([NH+](CC)CC)CCCC1 | C=CCC[NH+](CC)C1(C(=O)CC#CC)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "C3C"
} |
Can you make molecule CC#CCC(=O)C1([NH+](CC)CC)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC#CCC(=O)C1([NH+](CC)CCCCl)CCCC1 | CC#CCC(=O)C1([NH+](CC)CC)CCCC1 | CC#CCC(=O)C1([NH+](CC)CCCCl)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "C3C"
} |
Can you make molecule CC#CCC(=O)C1([NH+](CC)CC)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC#CCC(=O)C1([NH+](CC)CCCCS)CCCC1 | CC#CCC(=O)C1([NH+](CC)CC)CCCC1 | CC#CCC(=O)C1([NH+](CC)CCCCS)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "C3C"
} |
Can you make molecule CC#CCC(=O)C1([NH+](CC)CC)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC#CCC(=O)C1([NH+](CC)CCCBr)CCCC1 | CC#CCC(=O)C1([NH+](CC)CC)CCCC1 | CC#CCC(=O)C1([NH+](CC)CCCBr)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "C3C"
} |
Can you make molecule O=C(NCCCc1ccccc1)C1CCN(C(=O)[C@@H]2CC(=O)N(c3ccccc3)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccccc1.O=C1C[C@@H](C(=O)N2CCC(C(=O)NCCCc3ccccc3)CC2)CN1 | O=C(NCCCc1ccccc1)C1CCN(C(=O)[C@@H]2CC(=O)N(c3ccccc3)C2)CC1 | Clc1ccccc1.O=C1C[C@@H](C(=O)N2CCC(C(=O)NCCCc3ccccc3)CC2)CN1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c1%10ccccc1"
} |
Can you make molecule O=C(NCCCc1ccccc1)C1CCN(C(=O)[C@@H]2CC(=O)N(c3ccccc3)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Ic1ccccc1.O=C1C[C@@H](C(=O)N2CCC(C(=O)NCCCc3ccccc3)CC2)CN1 | O=C(NCCCc1ccccc1)C1CCN(C(=O)[C@@H]2CC(=O)N(c3ccccc3)C2)CC1 | Ic1ccccc1.O=C1C[C@@H](C(=O)N2CCC(C(=O)NCCCc3ccccc3)CC2)CN1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c1%10ccccc1"
} |
Can you make molecule O=C(NCCCc1ccccc1)C1CCN(C(=O)[C@@H]2CC(=O)N(c3ccccc3)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C.O=C1C[C@@H](C(=O)N2CCC(C(=O)NCCCc3ccccc3)CC2)CN1 | O=C(NCCCc1ccccc1)C1CCN(C(=O)[C@@H]2CC(=O)N(c3ccccc3)C2)CC1 | Cc1ccccc1C.O=C1C[C@@H](C(=O)N2CCC(C(=O)NCCCc3ccccc3)CC2)CN1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c1%10ccccc1"
} |
Can you make molecule O=C(NCCCc1ccccc1)C1CCN(C(=O)[C@@H]2CC(=O)N(c3ccccc3)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(F)cc1.O=C1C[C@@H](C(=O)N2CCC(C(=O)NCCCc3ccccc3)CC2)CN1 | O=C(NCCCc1ccccc1)C1CCN(C(=O)[C@@H]2CC(=O)N(c3ccccc3)C2)CC1 | Cc1ccc(F)cc1.O=C1C[C@@H](C(=O)N2CCC(C(=O)NCCCc3ccccc3)CC2)CN1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1C",
"old_substring": "c1%10ccccc1"
} |
Can you make molecule O=C(NCCCc1ccccc1)C1CCN(C(=O)[C@@H]2CC(=O)N(c3ccccc3)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cccc(I)c1.O=C1C[C@@H](C(=O)N2CCC(C(=O)NCCCc3ccccc3)CC2)CN1 | O=C(NCCCc1ccccc1)C1CCN(C(=O)[C@@H]2CC(=O)N(c3ccccc3)C2)CC1 | Fc1cccc(I)c1.O=C1C[C@@H](C(=O)N2CCC(C(=O)NCCCc3ccccc3)CC2)CN1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c1%10ccccc1"
} |
Can you make molecule O=Cc1ccc(OCc2ccn(-c3cccc(F)c3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccc(SC(=S)OCc2ccn(-c3cccc(F)c3)n2)cc1 | O=Cc1ccc(OCc2ccn(-c3cccc(F)c3)n2)cc1 | O=Cc1ccc(SC(=S)OCc2ccn(-c3cccc(F)c3)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O45"
} |
Can you make molecule O=Cc1ccc(OCc2ccn(-c3cccc(F)c3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N=C(Cc1ccc(C=O)cc1)OCc1ccn(-c2cccc(F)c2)n1 | O=Cc1ccc(OCc2ccn(-c3cccc(F)c3)n2)cc1 | N=C(Cc1ccc(C=O)cc1)OCc1ccn(-c2cccc(F)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O45"
} |
Can you make molecule O=Cc1ccc(OCc2ccn(-c3cccc(F)c3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccc(C(=O)CCC(=O)Cc2ccn(-c3cccc(F)c3)n2)cc1 | O=Cc1ccc(OCc2ccn(-c3cccc(F)c3)n2)cc1 | O=Cc1ccc(C(=O)CCC(=O)Cc2ccn(-c3cccc(F)c3)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O45"
} |
Can you make molecule O=Cc1ccc(OCc2ccn(-c3cccc(F)c3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccc(S/C=C/C(=O)Cc2ccn(-c3cccc(F)c3)n2)cc1 | O=Cc1ccc(OCc2ccn(-c3cccc(F)c3)n2)cc1 | O=Cc1ccc(S/C=C/C(=O)Cc2ccn(-c3cccc(F)c3)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O45"
} |
Can you make molecule O=Cc1ccc(OCc2ccn(-c3cccc(F)c3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccc(CCC[C@@H](O)Cc2ccn(-c3cccc(F)c3)n2)cc1 | O=Cc1ccc(OCc2ccn(-c3cccc(F)c3)n2)cc1 | O=Cc1ccc(CCC[C@@H](O)Cc2ccn(-c3cccc(F)c3)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CCC&",
"old_substring": "O45"
} |
Can you make molecule Clc1ccccc1Cn1ccnc1 less soluble in water? The output molecule should be similar to the input molecule. | C=Cn1ccnc1Cc1ccccc1Cl | Clc1ccccc1Cn1ccnc1 | C=Cn1ccnc1Cc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C=Cn1ccnc1&",
"old_substring": "n12ccnc1"
} |
Can you make molecule Clc1ccccc1Cn1ccnc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(CCCCc2ccccc2Cl)c2nn1-2 | Clc1ccccc1Cn1ccnc1 | Cc1c(CCCCc2ccccc2Cl)c2nn1-2 | 102 | {
"fragment_index": 0,
"new_substring": "n1&nc2c(c1C)CCC2",
"old_substring": "n12ccnc1"
} |
Can you make molecule Clc1ccccc1Cn1ccnc1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccccc1Cn1cc(I)cn1 | Clc1ccccc1Cn1ccnc1 | Clc1ccccc1Cn1cc(I)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc(I)cn1",
"old_substring": "n12ccnc1"
} |
Can you make molecule Clc1ccccc1Cn1ccnc1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1sccn1Cc1ccccc1Cl | Clc1ccccc1Cn1ccnc1 | O=c1sccn1Cc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccsc1=O",
"old_substring": "n12ccnc1"
} |
Can you make molecule Clc1ccccc1Cn1ccnc1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1c(Cc2ccccc2Cl)cccnc2ccn1-2 | Clc1ccccc1Cn1ccnc1 | O=c1c(Cc2ccccc2Cl)cccnc2ccn1-2 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccc2ncccc2c1=O",
"old_substring": "n12ccnc1"
} |
Can you make molecule Cc1[nH]c(=O)c(C(=O)N2CCN(c3ccccc3)C(=O)C2)c(C)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]c(=O)c(C(=O)N2CCN(c3ccccc3Cl)C(=O)C2)c(C)c1C | Cc1[nH]c(=O)c(C(=O)N2CCN(c3ccccc3)C(=O)C2)c(C)c1C | Cc1[nH]c(=O)c(C(=O)N2CCN(c3ccccc3Cl)C(=O)C2)c(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1[nH]c(=O)c(C(=O)N2CCN(c3ccccc3)C(=O)C2)c(C)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]c(=O)c(C(=O)N2CCN(c3ccc(I)cc3)C(=O)C2)c(C)c1C | Cc1[nH]c(=O)c(C(=O)N2CCN(c3ccccc3)C(=O)C2)c(C)c1C | Cc1[nH]c(=O)c(C(=O)N2CCN(c3ccc(I)cc3)C(=O)C2)c(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1[nH]c(=O)c(C(=O)N2CCN(c3ccccc3)C(=O)C2)c(C)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2CCN(C(=O)c3c(C)c(C)c(C)[nH]c3=O)CC2=O)cc1I | Cc1[nH]c(=O)c(C(=O)N2CCN(c3ccccc3)C(=O)C2)c(C)c1C | Cc1ccc(N2CCN(C(=O)c3c(C)c(C)c(C)[nH]c3=O)CC2=O)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1[nH]c(=O)c(C(=O)N2CCN(c3ccccc3)C(=O)C2)c(C)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]c(=O)c(C(=O)N2CCN(c3cccc(Br)c3)C(=O)C2)c(C)c1C | Cc1[nH]c(=O)c(C(=O)N2CCN(c3ccccc3)C(=O)C2)c(C)c1C | Cc1[nH]c(=O)c(C(=O)N2CCN(c3cccc(Br)c3)C(=O)C2)c(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1[nH]c(=O)c(C(=O)N2CCN(c3ccccc3)C(=O)C2)c(C)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(N2CCN(C(=O)c3c(C)c(C)c(C)[nH]c3=O)CC2=O)c1C | Cc1[nH]c(=O)c(C(=O)N2CCN(c3ccccc3)C(=O)C2)c(C)c1C | Cc1cccc(N2CCN(C(=O)c3c(C)c(C)c(C)[nH]c3=O)CC2=O)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c16ccccc1"
} |
Can you make molecule C[C@@H](NC(=O)NC[C@H]1CCCN(c2ncccn2)C1)C1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCC1CCOCC1)NC(=O)NC[C@H]1CCCN(c2ncccn2)C1 | C[C@@H](NC(=O)NC[C@H]1CCCN(c2ncccn2)C1)C1CCOCC1 | C[C@@H](CCC1CCOCC1)NC(=O)NC[C@H]1CCCN(c2ncccn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C[C@@H]58"
} |
Can you make molecule C[C@@H](NC(=O)NC[C@H]1CCCN(c2ncccn2)C1)C1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)C1CCOCC1)NC(=O)NC[C@H]1CCCN(c2ncccn2)C1 | C[C@@H](NC(=O)NC[C@H]1CCCN(c2ncccn2)C1)C1CCOCC1 | C[C@H](CC(C)(C)C1CCOCC1)NC(=O)NC[C@H]1CCCN(c2ncccn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@@H]58"
} |
Can you make molecule C[C@@H](NC(=O)NC[C@H]1CCCN(c2ncccn2)C1)C1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNC(=O)NC[C@H]1CCCN(c2ncccn2)C1)CC(=O)C1CCOCC1 | C[C@@H](NC(=O)NC[C@H]1CCCN(c2ncccn2)C1)C1CCOCC1 | C[C@@H](CCNC(=O)NC[C@H]1CCCN(c2ncccn2)C1)CC(=O)C1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@@H]58"
} |
Can you make molecule C[C@@H](NC(=O)NC[C@H]1CCCN(c2ncccn2)C1)C1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCC[C@H](Cl)C1CCOCC1)NC[C@H]1CCCN(c2ncccn2)C1 | C[C@@H](NC(=O)NC[C@H]1CCCN(c2ncccn2)C1)C1CCOCC1 | O=C(NCC[C@H](Cl)C1CCOCC1)NC[C@H]1CCCN(c2ncccn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "C[C@@H]58"
} |
Can you make molecule C[C@@H](NC(=O)NC[C@H]1CCCN(c2ncccn2)C1)C1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCC1CCOCC1)C(=O)NC(=O)NC[C@H]1CCCN(c2ncccn2)C1 | C[C@@H](NC(=O)NC[C@H]1CCCN(c2ncccn2)C1)C1CCOCC1 | C[C@@H](CCC1CCOCC1)C(=O)NC(=O)NC[C@H]1CCCN(c2ncccn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@@H](C)CC&",
"old_substring": "C[C@@H]58"
} |
Can you make molecule O=C(NCCS(=O)(=O)c1ccccc1)N1CCC[C@@H]2CCC[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SN1CCC[C@@H]2CCC[C@@H]21)NCCS(=O)(=O)c1ccccc1 | O=C(NCCS(=O)(=O)c1ccccc1)N1CCC[C@@H]2CCC[C@@H]21 | O=C(/C=C/SN1CCC[C@@H]2CCC[C@@H]21)NCCS(=O)(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NCCS(=O)(=O)c1ccccc1)N1CCC[C@@H]2CCC[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(CCNO/N=C/c1ccc(N2CCC[C@@H]3CCC[C@@H]32)o1)c1ccccc1 | O=C(NCCS(=O)(=O)c1ccccc1)N1CCC[C@@H]2CCC[C@@H]21 | O=S(=O)(CCNO/N=C/c1ccc(N2CCC[C@@H]3CCC[C@@H]32)o1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NCCS(=O)(=O)c1ccccc1)N1CCC[C@@H]2CCC[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCS(=O)(=O)c1ccccc1)NN=C1CCC(N2CCC[C@@H]3CCC[C@@H]32)CC1 | O=C(NCCS(=O)(=O)c1ccccc1)N1CCC[C@@H]2CCC[C@@H]21 | O=C(NCCS(=O)(=O)c1ccccc1)NN=C1CCC(N2CCC[C@@H]3CCC[C@@H]32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NCCS(=O)(=O)c1ccccc1)N1CCC[C@@H]2CCC[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCS(=O)(=O)c1ccccc1)C1=CC[C@H](N2CCC[C@@H]3CCC[C@@H]32)S1 | O=C(NCCS(=O)(=O)c1ccccc1)N1CCC[C@@H]2CCC[C@@H]21 | O=C(NCCS(=O)(=O)c1ccccc1)C1=CC[C@H](N2CCC[C@@H]3CCC[C@@H]32)S1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NCCS(=O)(=O)c1ccccc1)N1CCC[C@@H]2CCC[C@@H]21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/N=c1\ccccn1N1CCC[C@@H]2CCC[C@@H]21)NCCS(=O)(=O)c1ccccc1 | O=C(NCCS(=O)(=O)c1ccccc1)N1CCC[C@@H]2CCC[C@@H]21 | O=C(/N=c1\ccccn1N1CCC[C@@H]2CCC[C@@H]21)NCCS(=O)(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/N=c1\\ccccn1&",
"old_substring": "O=C34"
} |
Can you make molecule Cc1ccc(-c2cc(NC(=O)C(C)C)c(=O)n(CC(=O)Nc3cccc(C)c3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)Cn2nc(-c3ccc(C)c(I)c3)cc(NC(=O)C(C)C)c2=O)c1 | Cc1ccc(-c2cc(NC(=O)C(C)C)c(=O)n(CC(=O)Nc3cccc(C)c3)n2)cc1 | Cc1cccc(NC(=O)Cn2nc(-c3ccc(C)c(I)c3)cc(NC(=O)C(C)C)c2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "Cc1ccc9cc1"
} |
Can you make molecule Cc1ccc(-c2cc(NC(=O)C(C)C)c(=O)n(CC(=O)Nc3cccc(C)c3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)Cn2nc(-c3ccc(C)c(Cl)c3)cc(NC(=O)C(C)C)c2=O)c1 | Cc1ccc(-c2cc(NC(=O)C(C)C)c(=O)n(CC(=O)Nc3cccc(C)c3)n2)cc1 | Cc1cccc(NC(=O)Cn2nc(-c3ccc(C)c(Cl)c3)cc(NC(=O)C(C)C)c2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1Cl",
"old_substring": "Cc1ccc9cc1"
} |
Can you make molecule Cc1ccc(-c2cc(NC(=O)C(C)C)c(=O)n(CC(=O)Nc3cccc(C)c3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)Cn2nc(-c3ccc(I)cc3C)cc(NC(=O)C(C)C)c2=O)c1 | Cc1ccc(-c2cc(NC(=O)C(C)C)c(=O)n(CC(=O)Nc3cccc(C)c3)n2)cc1 | Cc1cccc(NC(=O)Cn2nc(-c3ccc(I)cc3C)cc(NC(=O)C(C)C)c2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(I)ccc1&",
"old_substring": "Cc1ccc9cc1"
} |
Can you make molecule Cc1ccc(-c2cc(NC(=O)C(C)C)c(=O)n(CC(=O)Nc3cccc(C)c3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)Cn2nc(-c3cc(C)ccc3I)cc(NC(=O)C(C)C)c2=O)c1 | Cc1ccc(-c2cc(NC(=O)C(C)C)c(=O)n(CC(=O)Nc3cccc(C)c3)n2)cc1 | Cc1cccc(NC(=O)Cn2nc(-c3cc(C)ccc3I)cc(NC(=O)C(C)C)c2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(I)c&c1",
"old_substring": "Cc1ccc9cc1"
} |
Can you make molecule Cc1ccc(-c2cc(NC(=O)C(C)C)c(=O)n(CC(=O)Nc3cccc(C)c3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)Cn2nc(-c3cc(C)ccc3Br)cc(NC(=O)C(C)C)c2=O)c1 | Cc1ccc(-c2cc(NC(=O)C(C)C)c(=O)n(CC(=O)Nc3cccc(C)c3)n2)cc1 | Cc1cccc(NC(=O)Cn2nc(-c3cc(C)ccc3Br)cc(NC(=O)C(C)C)c2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(Br)c&c1",
"old_substring": "Cc1ccc9cc1"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2CCN(C(=O)[C@H]3CCCC[C@@H]3C(=O)[O-])CC2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)N2CCN(SC(=O)C[C@H]3CCCC[C@@H]3C(=O)[O-])CC2)cc1C | Cc1ccc(S(=O)(=O)N2CCN(C(=O)[C@H]3CCCC[C@@H]3C(=O)[O-])CC2)cc1C | Cc1ccc(S(=O)(=O)N2CCN(SC(=O)C[C@H]3CCCC[C@@H]3C(=O)[O-])CC2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2CCN(C(=O)[C@H]3CCCC[C@@H]3C(=O)[O-])CC2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)N2CCN(CC(=C=O)C[C@H]3CCCC[C@@H]3C(=O)[O-])CC2)cc1C | Cc1ccc(S(=O)(=O)N2CCN(C(=O)[C@H]3CCCC[C@@H]3C(=O)[O-])CC2)cc1C | Cc1ccc(S(=O)(=O)N2CCN(CC(=C=O)C[C@H]3CCCC[C@@H]3C(=O)[O-])CC2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2CCN(C(=O)[C@H]3CCCC[C@@H]3C(=O)[O-])CC2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)N2CCN(C(=O)CCCC(=O)[C@H]3CCCC[C@@H]3C(=O)[O-])CC2)cc1C | Cc1ccc(S(=O)(=O)N2CCN(C(=O)[C@H]3CCCC[C@@H]3C(=O)[O-])CC2)cc1C | Cc1ccc(S(=O)(=O)N2CCN(C(=O)CCCC(=O)[C@H]3CCCC[C@@H]3C(=O)[O-])CC2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2CCN(C(=O)[C@H]3CCCC[C@@H]3C(=O)[O-])CC2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)N2CCN(C(=O)CC(C)(C)[C@H]3CCCC[C@@H]3C(=O)[O-])CC2)cc1C | Cc1ccc(S(=O)(=O)N2CCN(C(=O)[C@H]3CCCC[C@@H]3C(=O)[O-])CC2)cc1C | Cc1ccc(S(=O)(=O)N2CCN(C(=O)CC(C)(C)[C@H]3CCCC[C@@H]3C(=O)[O-])CC2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2CCN(C(=O)[C@H]3CCCC[C@@H]3C(=O)[O-])CC2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)N2CCN(C[S@+]([O-])CCC[C@H]3CCCC[C@@H]3C(=O)[O-])CC2)cc1C | Cc1ccc(S(=O)(=O)N2CCN(C(=O)[C@H]3CCCC[C@@H]3C(=O)[O-])CC2)cc1C | Cc1ccc(S(=O)(=O)N2CCN(C[S@+]([O-])CCC[C@H]3CCCC[C@@H]3C(=O)[O-])CC2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C46=O"
} |
Can you make molecule CCc1ccc(-c2nc(C(=O)N3CCO[C@H](CC)C3)cs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(-c2nc(CC(=O)SN3CCO[C@H](CC)C3)cs2)cc1 | CCc1ccc(-c2nc(C(=O)N3CCO[C@H](CC)C3)cs2)cc1 | CCc1ccc(-c2nc(CC(=O)SN3CCO[C@H](CC)C3)cs2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C45=O"
} |
Can you make molecule CCc1ccc(-c2nc(C(=O)N3CCO[C@H](CC)C3)cs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(-c2nc(C(=O)CCCC(=O)N3CCO[C@H](CC)C3)cs2)cc1 | CCc1ccc(-c2nc(C(=O)N3CCO[C@H](CC)C3)cs2)cc1 | CCc1ccc(-c2nc(C(=O)CCCC(=O)N3CCO[C@H](CC)C3)cs2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C45=O"
} |
Can you make molecule CCc1ccc(-c2nc(C(=O)N3CCO[C@H](CC)C3)cs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(-c2nc(C(C)(C)CC(=O)N3CCO[C@H](CC)C3)cs2)cc1 | CCc1ccc(-c2nc(C(=O)N3CCO[C@H](CC)C3)cs2)cc1 | CCc1ccc(-c2nc(C(C)(C)CC(=O)N3CCO[C@H](CC)C3)cs2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule CCc1ccc(-c2nc(C(=O)N3CCO[C@H](CC)C3)cs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(-c2nc(C(C)(C)CCC(=O)N3CCO[C@H](CC)C3)cs2)cc1 | CCc1ccc(-c2nc(C(=O)N3CCO[C@H](CC)C3)cs2)cc1 | CCc1ccc(-c2nc(C(C)(C)CCC(=O)N3CCO[C@H](CC)C3)cs2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule CCc1ccc(-c2nc(C(=O)N3CCO[C@H](CC)C3)cs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(-c2nc([C@H](C)C(=O)SN3CCO[C@H](CC)C3)cs2)cc1 | CCc1ccc(-c2nc(C(=O)N3CCO[C@H](CC)C3)cs2)cc1 | CCc1ccc(-c2nc([C@H](C)C(=O)SN3CCO[C@H](CC)C3)cs2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1cc(C)cc(OCC(C)(C)C[NH2+]C2CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(SC(=S)OCC(C)(C)C[NH2+]C2CC2)c1 | Cc1cc(C)cc(OCC(C)(C)C[NH2+]C2CC2)c1 | Cc1cc(C)cc(SC(=S)OCC(C)(C)C[NH2+]C2CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O34"
} |
Can you make molecule Cc1cc(C)cc(OCC(C)(C)C[NH2+]C2CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(CC(=N)OCC(C)(C)C[NH2+]C2CC2)c1 | Cc1cc(C)cc(OCC(C)(C)C[NH2+]C2CC2)c1 | Cc1cc(C)cc(CC(=N)OCC(C)(C)C[NH2+]C2CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O34"
} |
Can you make molecule Cc1cc(C)cc(OCC(C)(C)C[NH2+]C2CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(C(=O)CCC(=O)CC(C)(C)C[NH2+]C2CC2)c1 | Cc1cc(C)cc(OCC(C)(C)C[NH2+]C2CC2)c1 | Cc1cc(C)cc(C(=O)CCC(=O)CC(C)(C)C[NH2+]C2CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O34"
} |
Can you make molecule Cc1cc(C)cc(OCC(C)(C)C[NH2+]C2CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(CC[C@@H](O)CC(C)(C)C[NH2+]C2CC2)c1 | Cc1cc(C)cc(OCC(C)(C)C[NH2+]C2CC2)c1 | Cc1cc(C)cc(CC[C@@H](O)CC(C)(C)C[NH2+]C2CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O34"
} |
Can you make molecule Cc1cc(C)cc(OCC(C)(C)C[NH2+]C2CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(S/C=C/C(=O)CC(C)(C)C[NH2+]C2CC2)c1 | Cc1cc(C)cc(OCC(C)(C)C[NH2+]C2CC2)c1 | Cc1cc(C)cc(S/C=C/C(=O)CC(C)(C)C[NH2+]C2CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O34"
} |
Can you make molecule CCOC(=O)[C@H](F)[C@@]1(O)CCC[NH+](C(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSOC(=O)[C@H](F)[C@@]1(O)CCC[NH+](C(C)C)CC1 | CCOC(=O)[C@H](F)[C@@]1(O)CCC[NH+](C(C)C)CC1 | C=CSOC(=O)[C@H](F)[C@@]1(O)CCC[NH+](C(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CCOC(=O)[C@H](F)[C@@]1(O)CCC[NH+](C(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOC(=O)[C@H](F)[C@@]1(O)CCC[NH+](C(C)C)CC1 | CCOC(=O)[C@H](F)[C@@]1(O)CCC[NH+](C(C)C)CC1 | C=CCCOC(=O)[C@H](F)[C@@]1(O)CCC[NH+](C(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CCOC(=O)[C@H](F)[C@@]1(O)CCC[NH+](C(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[NH+]1CCC[C@](O)([C@@H](F)C(=O)OCCCCl)CC1 | CCOC(=O)[C@H](F)[C@@]1(O)CCC[NH+](C(C)C)CC1 | CC(C)[NH+]1CCC[C@](O)([C@@H](F)C(=O)OCCCCl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CCOC(=O)[C@H](F)[C@@]1(O)CCC[NH+](C(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[NH+]1CCC[C@](O)([C@@H](F)C(=O)OCCCCS)CC1 | CCOC(=O)[C@H](F)[C@@]1(O)CCC[NH+](C(C)C)CC1 | CC(C)[NH+]1CCC[C@](O)([C@@H](F)C(=O)OCCCCS)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule CCOC(=O)[C@H](F)[C@@]1(O)CCC[NH+](C(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[NH+]1CCC[C@](O)([C@@H](F)C(=O)OCCCBr)CC1 | CCOC(=O)[C@H](F)[C@@]1(O)CCC[NH+](C(C)C)CC1 | CC(C)[NH+]1CCC[C@](O)([C@@H](F)C(=O)OCCCBr)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3"
} |
Can you make molecule CCn1cc(C=CC(=O)c2ccc3ccccc3c2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C=Cc1cnn(CC)c1)C(=O)c1ccc2ccccc2c1 | CCn1cc(C=CC(=O)c2ccc3ccccc3c2)cn1 | C=C(C=Cc1cnn(CC)c1)C(=O)c1ccc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C&)C&=O",
"old_substring": "C=5C4=O"
} |
Can you make molecule CCn1cc(C=CC(=O)c2ccc3ccccc3c2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(C=CCCc2ccc3ccccc3c2)cn1 | CCn1cc(C=CC(=O)c2ccc3ccccc3c2)cn1 | CCn1cc(C=CCCc2ccc3ccccc3c2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C=5C4=O"
} |
Can you make molecule CCn1cc(C=CC(=O)c2ccc3ccccc3c2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(C=C(C)CCc2ccc3ccccc3c2)cn1 | CCn1cc(C=CC(=O)c2ccc3ccccc3c2)cn1 | CCn1cc(C=C(C)CCc2ccc3ccccc3c2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C=5C4=O"
} |
Can you make molecule CCn1cc(C=CC(=O)c2ccc3ccccc3c2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(C=CCCc2ccc3ccccc3c2)cn1 | CCn1cc(C=CC(=O)c2ccc3ccccc3c2)cn1 | CCn1cc(C=CCCc2ccc3ccccc3c2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC&",
"old_substring": "C=5C4=O"
} |
Can you make molecule CCn1cc(C=CC(=O)c2ccc3ccccc3c2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(C=C2CCC(O)(c3ccc4ccccc4c3)CC2)cn1 | CCn1cc(C=CC(=O)c2ccc3ccccc3c2)cn1 | CCn1cc(C=C2CCC(O)(c3ccc4ccccc4c3)CC2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&(O)CC1",
"old_substring": "C=5C4=O"
} |
Can you make molecule CCC(CC)C(=O)Nc1cnn(-c2ccccc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)C(=O)Nc1c(C)nn(-c2ccccc2F)c1Cl | CCC(CC)C(=O)Nc1cnn(-c2ccccc2F)c1 | CCC(CC)C(=O)Nc1c(C)nn(-c2ccccc2F)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(C)nn&c1Cl",
"old_substring": "c14cnn5c1"
} |
Can you make molecule CCC(CC)C(=O)Nc1cnn(-c2ccccc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)C(=O)Nc1nc(-c2ccccc2F)ncc1I | CCC(CC)C(=O)Nc1cnn(-c2ccccc2F)c1 | CCC(CC)C(=O)Nc1nc(-c2ccccc2F)ncc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1I",
"old_substring": "c14cnn5c1"
} |
Can you make molecule CCC(CC)C(=O)Nc1cnn(-c2ccccc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)C(=O)Nc1cnn2ccc(-c3ccccc3F)cc12 | CCC(CC)C(=O)Nc1cnn(-c2ccccc2F)c1 | CCC(CC)C(=O)Nc1cnn2ccc(-c3ccccc3F)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnn2ccc&cc12",
"old_substring": "c14cnn5c1"
} |
Can you make molecule CCC(CC)C(=O)Nc1cnn(-c2ccccc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)C(=O)Nc1sc(-c2ccccc2F)nc1Cl | CCC(CC)C(=O)Nc1cnn(-c2ccccc2F)c1 | CCC(CC)C(=O)Nc1sc(-c2ccccc2F)nc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc&nc1Cl",
"old_substring": "c14cnn5c1"
} |
Can you make molecule CCC(CC)C(=O)Nc1cnn(-c2ccccc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)C(=O)Nc1ncc(-c2ccccc2F)s1 | CCC(CC)C(=O)Nc1cnn(-c2ccccc2F)c1 | CCC(CC)C(=O)Nc1ncc(-c2ccccc2F)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc&s1",
"old_substring": "c14cnn5c1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.