prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule O=C1O[C@H](C(=O)Nc2ccnc3ccnn23)Cc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C[C@@H]1Cc2ccccc2C(=O)O1)SNc1ccnc2ccnn12 | O=C1O[C@H](C(=O)Nc2ccnc3ccnn23)Cc2ccccc21 | O=C(C[C@@H]1Cc2ccccc2C(=O)O1)SNc1ccnc2ccnn12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule O=C1O[C@H](C(=O)Nc2ccnc3ccnn23)Cc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C=C(CNc1ccnc2ccnn12)C[C@@H]1Cc2ccccc2C(=O)O1 | O=C1O[C@H](C(=O)Nc2ccnc3ccnn23)Cc2ccccc21 | O=C=C(CNc1ccnc2ccnn12)C[C@@H]1Cc2ccccc2C(=O)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule O=C1O[C@H](C(=O)Nc2ccnc3ccnn23)Cc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCC(=O)[C@@H]1Cc2ccccc2C(=O)O1)Nc1ccnc2ccnn12 | O=C1O[C@H](C(=O)Nc2ccnc3ccnn23)Cc2ccccc21 | O=C(CCCC(=O)[C@@H]1Cc2ccccc2C(=O)O1)Nc1ccnc2ccnn12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule O=C1O[C@H](C(=O)Nc2ccnc3ccnn23)Cc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)Nc1ccnc2ccnn12)[C@@H]1Cc2ccccc2C(=O)O1 | O=C1O[C@H](C(=O)Nc2ccnc3ccnn23)Cc2ccccc21 | CC(C)(CC(=O)Nc1ccnc2ccnn12)[C@@H]1Cc2ccccc2C(=O)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule O=C1O[C@H](C(=O)Nc2ccnc3ccnn23)Cc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C1O[C@H](CCC[S@@+]([O-])CNc2ccnc3ccnn23)Cc2ccccc21 | O=C1O[C@H](C(=O)Nc2ccnc3ccnn23)Cc2ccccc21 | O=C1O[C@H](CCC[S@@+]([O-])CNc2ccnc3ccnn23)Cc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C46=O"
} |
Can you make molecule COCCn1nnnc1[C@@H](C(C)C)N1CCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | COCCCCn1nnnc1[C@@H](C(C)C)N1CCSCC1 | COCCn1nnnc1[C@@H](C(C)C)N1CCSCC1 | COCCCCn1nnnc1[C@@H](C(C)C)N1CCSCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C2C4"
} |
Can you make molecule COCCn1nnnc1[C@@H](C(C)C)N1CCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | COCCCCCn1nnnc1[C@@H](C(C)C)N1CCSCC1 | COCCn1nnnc1[C@@H](C(C)C)N1CCSCC1 | COCCCCCn1nnnc1[C@@H](C(C)C)N1CCSCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C2C4"
} |
Can you make molecule COCCn1nnnc1[C@@H](C(C)C)N1CCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | COC1CC(n2nnnc2[C@@H](C(C)C)N2CCSCC2)C1 | COCCn1nnnc1[C@@H](C(C)C)N1CCSCC1 | COC1CC(n2nnnc2[C@@H](C(C)C)N2CCSCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C2C4"
} |
Can you make molecule COCCn1nnnc1[C@@H](C(C)C)N1CCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | CO[C@@H](C)CCn1nnnc1[C@@H](C(C)C)N1CCSCC1 | COCCn1nnnc1[C@@H](C(C)C)N1CCSCC1 | CO[C@@H](C)CCn1nnnc1[C@@H](C(C)C)N1CCSCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C2C4"
} |
Can you make molecule COCCn1nnnc1[C@@H](C(C)C)N1CCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | COC1CCC(n2nnnc2[C@@H](C(C)C)N2CCSCC2)CC1 | COCCn1nnnc1[C@@H](C(C)C)N1CCSCC1 | COC1CCC(n2nnnc2[C@@H](C(C)C)N2CCSCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C2C4"
} |
Can you make molecule O=C(NCCNS(=O)(=O)c1cccc(Cl)c1F)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCCCNS(=O)(=O)c1cccc(Cl)c1F)c1cccnc1 | O=C(NCCNS(=O)(=O)c1cccc(Cl)c1F)c1cccnc1 | O=C(NCCCCNS(=O)(=O)c1cccc(Cl)c1F)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C3C4"
} |
Can you make molecule O=C(NCCNS(=O)(=O)c1cccc(Cl)c1F)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N=CCCNS(=O)(=O)c1cccc(Cl)c1F)c1cccnc1 | O=C(NCCNS(=O)(=O)c1cccc(Cl)c1F)c1cccnc1 | O=C(N=CCCNS(=O)(=O)c1cccc(Cl)c1F)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C3C4"
} |
Can you make molecule O=C(NCCNS(=O)(=O)c1cccc(Cl)c1F)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCCCCNS(=O)(=O)c1cccc(Cl)c1F)c1cccnc1 | O=C(NCCNS(=O)(=O)c1cccc(Cl)c1F)c1cccnc1 | O=C(NCCCCCNS(=O)(=O)c1cccc(Cl)c1F)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C3C4"
} |
Can you make molecule O=C(NCCNS(=O)(=O)c1cccc(Cl)c1F)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC1CC(NS(=O)(=O)c2cccc(Cl)c2F)C1)c1cccnc1 | O=C(NCCNS(=O)(=O)c1cccc(Cl)c1F)c1cccnc1 | O=C(NC1CC(NS(=O)(=O)c2cccc(Cl)c2F)C1)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C3C4"
} |
Can you make molecule O=C(NCCNS(=O)(=O)c1cccc(Cl)c1F)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(CCNS(=O)(=O)c1cccc(Cl)c1F)=NC(=O)c1cccnc1 | O=C(NCCNS(=O)(=O)c1cccc(Cl)c1F)c1cccnc1 | CC(CCNS(=O)(=O)c1cccc(Cl)c1F)=NC(=O)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C3C4"
} |
Can you make molecule Cc1ccc(CNC(=O)NCc2nnc3n2CCC3)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)c(CNC(=O)NCc2nnc3n2CCC3)s1 | Cc1ccc(CNC(=O)NCc2nnc3n2CCC3)s1 | Cc1cc(Br)c(CNC(=O)NCc2nnc3n2CCC3)s1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(Br)c&s1",
"old_substring": "Cc1ccc8s1"
} |
Can you make molecule Cc1ccc(CNC(=O)NCc2nnc3n2CCC3)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(CNC(=O)NCc2nnc3n2CCC3)c1Cl | Cc1ccc(CNC(=O)NCc2nnc3n2CCC3)s1 | Cc1csc(CNC(=O)NCc2nnc3n2CCC3)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1csc&c1Cl",
"old_substring": "Cc1ccc8s1"
} |
Can you make molecule Cc1ccc(CNC(=O)NCc2nnc3n2CCC3)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2sc(CNC(=O)NCc3nnc4n3CCC4)cc2c1 | Cc1ccc(CNC(=O)NCc2nnc3n2CCC3)s1 | Cc1ccc2sc(CNC(=O)NCc3nnc4n3CCC4)cc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc2sc&cc2c1",
"old_substring": "Cc1ccc8s1"
} |
Can you make molecule Cc1ccc(CNC(=O)NCc2nnc3n2CCC3)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CNC(=O)NCc2nnc3n2CCC3)cc1I | Cc1ccc(CNC(=O)NCc2nnc3n2CCC3)s1 | Cc1ccc(CNC(=O)NCc2nnc3n2CCC3)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "Cc1ccc8s1"
} |
Can you make molecule Cc1ccc(CNC(=O)NCc2nnc3n2CCC3)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1sc(CNC(=O)NCc2nnc3n2CCC3)cc1Br | Cc1ccc(CNC(=O)NCc2nnc3n2CCC3)s1 | Cc1sc(CNC(=O)NCc2nnc3n2CCC3)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1sc&cc1Br",
"old_substring": "Cc1ccc8s1"
} |
Can you make molecule CC=CC[C@]1(C(=O)[O-])CCN(C(=O)OC(C)(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC=CC[C@]1(C(=O)[O-])CCN(C(=O)OC(Cl)(Cl)Cl)C1 | CC=CC[C@]1(C(=O)[O-])CCN(C(=O)OC(C)(C)C)C1 | CC=CC[C@]1(C(=O)[O-])CCN(C(=O)OC(Cl)(Cl)Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C4(C)(C)C"
} |
Can you make molecule CC=CC[C@]1(C(=O)[O-])CCN(C(=O)OC(C)(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC=CC[C@]1(C(=O)[O-])CCN(C(=O)OC(C)(C)CC(C)(C)C)C1 | CC=CC[C@]1(C(=O)[O-])CCN(C(=O)OC(C)(C)C)C1 | CC=CC[C@]1(C(=O)[O-])CCN(C(=O)OC(C)(C)CC(C)(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)(C)CC(C)(C)C",
"old_substring": "C4(C)(C)C"
} |
Can you make molecule CC=CC[C@]1(C(=O)[O-])CCN(C(=O)OC(C)(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC=CC[C@]1(C(=O)[O-])CCN(C(=O)OCCCC(C)(C)C)C1 | CC=CC[C@]1(C(=O)[O-])CCN(C(=O)OC(C)(C)C)C1 | CC=CC[C@]1(C(=O)[O-])CCN(C(=O)OCCCC(C)(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(C)(C)C",
"old_substring": "C4(C)(C)C"
} |
Can you make molecule CC=CC[C@]1(C(=O)[O-])CCN(C(=O)OC(C)(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC=CC[C@]1(C(=O)[O-])CCN(C(=O)OCCCC(F)(F)F)C1 | CC=CC[C@]1(C(=O)[O-])CCN(C(=O)OC(C)(C)C)C1 | CC=CC[C@]1(C(=O)[O-])CCN(C(=O)OCCCC(F)(F)F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C4(C)(C)C"
} |
Can you make molecule CC=CC[C@]1(C(=O)[O-])CCN(C(=O)OC(C)(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC=CC[C@]1(C(=O)[O-])CCN(C(=O)OCCCCC(F)(F)F)C1 | CC=CC[C@]1(C(=O)[O-])CCN(C(=O)OC(C)(C)C)C1 | CC=CC[C@]1(C(=O)[O-])CCN(C(=O)OCCCCC(F)(F)F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C4(C)(C)C"
} |
Can you make molecule O=C(N[C@@H](CO)c1ccco1)c1cc(Cl)ccc1OC1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@@H](CO)c1ccc(I)o1)c1cc(Cl)ccc1OC1CCCC1 | O=C(N[C@@H](CO)c1ccco1)c1cc(Cl)ccc1OC1CCCC1 | O=C(N[C@@H](CO)c1ccc(I)o1)c1cc(Cl)ccc1OC1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(N[C@@H](CO)c1ccco1)c1cc(Cl)ccc1OC1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@@H](CO)c1ccc(Br)o1)c1cc(Cl)ccc1OC1CCCC1 | O=C(N[C@@H](CO)c1ccco1)c1cc(Cl)ccc1OC1CCCC1 | O=C(N[C@@H](CO)c1ccc(Br)o1)c1cc(Cl)ccc1OC1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(N[C@@H](CO)c1ccco1)c1cc(Cl)ccc1OC1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@@H](CO)c1ccc(Cl)o1)c1cc(Cl)ccc1OC1CCCC1 | O=C(N[C@@H](CO)c1ccco1)c1cc(Cl)ccc1OC1CCCC1 | O=C(N[C@@H](CO)c1ccc(Cl)o1)c1cc(Cl)ccc1OC1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(N[C@@H](CO)c1ccco1)c1cc(Cl)ccc1OC1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@@H](CO)c1occc1Br)c1cc(Cl)ccc1OC1CCCC1 | O=C(N[C@@H](CO)c1ccco1)c1cc(Cl)ccc1OC1CCCC1 | O=C(N[C@@H](CO)c1occc1Br)c1cc(Cl)ccc1OC1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&occc1Br",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(N[C@@H](CO)c1ccco1)c1cc(Cl)ccc1OC1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1[C@H](CO)NC(=O)c1cc(Cl)ccc1OC1CCCC1 | O=C(N[C@@H](CO)c1ccco1)c1cc(Cl)ccc1OC1CCCC1 | Cc1ccsc1[C@H](CO)NC(=O)c1cc(Cl)ccc1OC1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c17ccco1"
} |
Can you make molecule Cc1cc(N(C)C)ccc1NC(=O)c1c[nH]c2nccc(Cl)c12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N(C)C)ccc1NSC(=O)Cc1c[nH]c2nccc(Cl)c12 | Cc1cc(N(C)C)ccc1NC(=O)c1c[nH]c2nccc(Cl)c12 | Cc1cc(N(C)C)ccc1NSC(=O)Cc1c[nH]c2nccc(Cl)c12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule Cc1cc(N(C)C)ccc1NC(=O)c1c[nH]c2nccc(Cl)c12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N(C)C)ccc1NC(=O)CCCC(=O)c1c[nH]c2nccc(Cl)c12 | Cc1cc(N(C)C)ccc1NC(=O)c1c[nH]c2nccc(Cl)c12 | Cc1cc(N(C)C)ccc1NC(=O)CCCC(=O)c1c[nH]c2nccc(Cl)c12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule Cc1cc(N(C)C)ccc1NC(=O)c1c[nH]c2nccc(Cl)c12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N(C)C)ccc1NC(=O)CC(C)(C)c1c[nH]c2nccc(Cl)c12 | Cc1cc(N(C)C)ccc1NC(=O)c1c[nH]c2nccc(Cl)c12 | Cc1cc(N(C)C)ccc1NC(=O)CC(C)(C)c1c[nH]c2nccc(Cl)c12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule Cc1cc(N(C)C)ccc1NC(=O)c1c[nH]c2nccc(Cl)c12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N(C)C)ccc1NC(=O)CCC(C)(C)c1c[nH]c2nccc(Cl)c12 | Cc1cc(N(C)C)ccc1NC(=O)c1c[nH]c2nccc(Cl)c12 | Cc1cc(N(C)C)ccc1NC(=O)CCC(C)(C)c1c[nH]c2nccc(Cl)c12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule Cc1cc(N(C)C)ccc1NC(=O)c1c[nH]c2nccc(Cl)c12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N(C)C)ccc1NSC(=O)[C@@H](C)c1c[nH]c2nccc(Cl)c12 | Cc1cc(N(C)C)ccc1NC(=O)c1c[nH]c2nccc(Cl)c12 | Cc1cc(N(C)C)ccc1NSC(=O)[C@@H](C)c1c[nH]c2nccc(Cl)c12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule CCOC(=O)c1cccc(NC(=O)c2cn[nH]c2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cccc(NC(=O)c2cn[nH]c(=O)c2Cl)c1 | CCOC(=O)c1cccc(NC(=O)c2cn[nH]c2C)c1 | CCOC(=O)c1cccc(NC(=O)c2cn[nH]c(=O)c2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cn[nH]c(=O)c1Cl",
"old_substring": "c18cn[nH]c1C"
} |
Can you make molecule CCOC(=O)c1cccc(NC(=O)c2cn[nH]c2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cccc(NC(=O)c2cc[nH]c2C)c1 | CCOC(=O)c1cccc(NC(=O)c2cn[nH]c2C)c1 | CCOC(=O)c1cccc(NC(=O)c2cc[nH]c2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc[nH]c1C",
"old_substring": "c18cn[nH]c1C"
} |
Can you make molecule CCOC(=O)c1cccc(NC(=O)c2cn[nH]c2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cccc(NC(=O)c2nc(I)c(I)[nH]2)c1 | CCOC(=O)c1cccc(NC(=O)c2cn[nH]c2C)c1 | CCOC(=O)c1cccc(NC(=O)c2nc(I)c(I)[nH]2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Ic1nc&[nH]c1I",
"old_substring": "c18cn[nH]c1C"
} |
Can you make molecule CCOC(=O)c1cccc(NC(=O)c2cn[nH]c2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cccc(NC(=O)c2[nH]nc3c2CCCCC3)c1 | CCOC(=O)c1cccc(NC(=O)c2cn[nH]c2C)c1 | CCOC(=O)c1cccc(NC(=O)c2[nH]nc3c2CCCCC3)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH]nc2c1CCCCC2",
"old_substring": "c18cn[nH]c1C"
} |
Can you make molecule CCOC(=O)c1cccc(NC(=O)c2cn[nH]c2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cccc(NC(=O)c2n[nH]cc2Br)c1 | CCOC(=O)c1cccc(NC(=O)c2cn[nH]c2C)c1 | CCOC(=O)c1cccc(NC(=O)c2n[nH]cc2Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&n[nH]cc1Br",
"old_substring": "c18cn[nH]c1C"
} |
Can you make molecule COCc1ccc(C(=O)N(C)Cc2ccc(Cl)s2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(C(=O)N(C)Cc2ccc(Cl)cc2I)cc1 | COCc1ccc(C(=O)N(C)Cc2ccc(Cl)s2)cc1 | COCc1ccc(C(=O)N(C)Cc2ccc(Cl)cc2I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c17ccc(Cl)s1"
} |
Can you make molecule COCc1ccc(C(=O)N(C)Cc2ccc(Cl)s2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(C(=O)N(C)Cc2ccc(Cl)cc2Br)cc1 | COCc1ccc(C(=O)N(C)Cc2ccc(Cl)s2)cc1 | COCc1ccc(C(=O)N(C)Cc2ccc(Cl)cc2Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c17ccc(Cl)s1"
} |
Can you make molecule COCc1ccc(C(=O)N(C)Cc2ccc(Cl)s2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(C(=O)N(C)Cc2ccc(Cl)c(I)c2)cc1 | COCc1ccc(C(=O)N(C)Cc2ccc(Cl)s2)cc1 | COCc1ccc(C(=O)N(C)Cc2ccc(Cl)c(I)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c17ccc(Cl)s1"
} |
Can you make molecule COCc1ccc(C(=O)N(C)Cc2ccc(Cl)s2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(C(=O)N(C)Cc2cc(Cl)sc2Cl)cc1 | COCc1ccc(C(=O)N(C)Cc2ccc(Cl)s2)cc1 | COCc1ccc(C(=O)N(C)Cc2cc(Cl)sc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)sc1Cl",
"old_substring": "c17ccc(Cl)s1"
} |
Can you make molecule COCc1ccc(C(=O)N(C)Cc2ccc(Cl)s2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(C(=O)N(C)Cc2ccc(Cl)c(Cl)c2)cc1 | COCc1ccc(C(=O)N(C)Cc2ccc(Cl)s2)cc1 | COCc1ccc(C(=O)N(C)Cc2ccc(Cl)c(Cl)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c17ccc(Cl)s1"
} |
Can you make molecule O=C(CCc1nc2ccccc2c(=O)[nH]1)Nc1cc(Cl)c(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1nc2ccccc2c(=O)[nH]1)Nc1cc(Cl)c(Cl)cc1Cl | O=C(CCc1nc2ccccc2c(=O)[nH]1)Nc1cc(Cl)c(Cl)cc1Cl | O=C(/C=C/Sc1nc2ccccc2c(=O)[nH]1)Nc1cc(Cl)c(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C3CC5"
} |
Can you make molecule O=C(CCc1nc2ccccc2c(=O)[nH]1)Nc1cc(Cl)c(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(c2nc3ccccc3c(=O)[nH]2)CC1)Nc1cc(Cl)c(Cl)cc1Cl | O=C(CCc1nc2ccccc2c(=O)[nH]1)Nc1cc(Cl)c(Cl)cc1Cl | O=C(NN=C1CCC(c2nc3ccccc3c(=O)[nH]2)CC1)Nc1cc(Cl)c(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C3CC5"
} |
Can you make molecule O=C(CCc1nc2ccccc2c(=O)[nH]1)Nc1cc(Cl)c(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1cc(Cl)c(Cl)cc1Cl)C1=CC[C@H](c2nc3ccccc3c(=O)[nH]2)S1 | O=C(CCc1nc2ccccc2c(=O)[nH]1)Nc1cc(Cl)c(Cl)cc1Cl | O=C(Nc1cc(Cl)c(Cl)cc1Cl)C1=CC[C@H](c2nc3ccccc3c(=O)[nH]2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C3CC5"
} |
Can you make molecule O=C(CCc1nc2ccccc2c(=O)[nH]1)Nc1cc(Cl)c(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ONc1cc(Cl)c(Cl)cc1Cl)[C@H](C)c1nc2ccccc2c(=O)[nH]1 | O=C(CCc1nc2ccccc2c(=O)[nH]1)Nc1cc(Cl)c(Cl)cc1Cl | C/C(=N\ONc1cc(Cl)c(Cl)cc1Cl)[C@H](C)c1nc2ccccc2c(=O)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)[C@@H]&C",
"old_substring": "O=C3CC5"
} |
Can you make molecule O=C(CCc1nc2ccccc2c(=O)[nH]1)Nc1cc(Cl)c(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=c1[nH]c(C(Cl)(Cl)[S@+]([O-])CNc2cc(Cl)c(Cl)cc2Cl)nc2ccccc12 | O=C(CCc1nc2ccccc2c(=O)[nH]1)Nc1cc(Cl)c(Cl)cc1Cl | O=c1[nH]c(C(Cl)(Cl)[S@+]([O-])CNc2cc(Cl)c(Cl)cc2Cl)nc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "O=[S@](C&)C&(Cl)Cl",
"old_substring": "O=C3CC5"
} |
Can you make molecule CC[C@@H](C)NC(=O)c1ccc2c(c1)CCCN2S(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)NSC(=O)Cc1ccc2c(c1)CCCN2S(C)(=O)=O | CC[C@@H](C)NC(=O)c1ccc2c(c1)CCCN2S(C)(=O)=O | CC[C@@H](C)NSC(=O)Cc1ccc2c(c1)CCCN2S(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule CC[C@@H](C)NC(=O)c1ccc2c(c1)CCCN2S(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)NC(=O)CCCC(=O)c1ccc2c(c1)CCCN2S(C)(=O)=O | CC[C@@H](C)NC(=O)c1ccc2c(c1)CCCN2S(C)(=O)=O | CC[C@@H](C)NC(=O)CCCC(=O)c1ccc2c(c1)CCCN2S(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule CC[C@@H](C)NC(=O)c1ccc2c(c1)CCCN2S(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)NC(=O)CC(C)(C)c1ccc2c(c1)CCCN2S(C)(=O)=O | CC[C@@H](C)NC(=O)c1ccc2c(c1)CCCN2S(C)(=O)=O | CC[C@@H](C)NC(=O)CC(C)(C)c1ccc2c(c1)CCCN2S(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule CC[C@@H](C)NC(=O)c1ccc2c(c1)CCCN2S(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)NC(=O)CCC(C)(C)c1ccc2c(c1)CCCN2S(C)(=O)=O | CC[C@@H](C)NC(=O)c1ccc2c(c1)CCCN2S(C)(=O)=O | CC[C@@H](C)NC(=O)CCC(C)(C)c1ccc2c(c1)CCCN2S(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule CC[C@@H](C)NC(=O)c1ccc2c(c1)CCCN2S(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)NSC(=O)[C@@H](C)c1ccc2c(c1)CCCN2S(C)(=O)=O | CC[C@@H](C)NC(=O)c1ccc2c(c1)CCCN2S(C)(=O)=O | CC[C@@H](C)NSC(=O)[C@@H](C)c1ccc2c(c1)CCCN2S(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1cc(C)cc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1cc(Cl)cc(Cl)c1Br | COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1cc(C)cc(C)c1 | COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1cc(Cl)cc(Cl)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)cc(Cl)c1Br",
"old_substring": "c15cc(C)cc(C)c1"
} |
Can you make molecule COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1cc(C)cc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1ccc(Cl)c(Cl)c1 | COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1cc(C)cc(C)c1 | COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1ccc(Cl)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c15cc(C)cc(C)c1"
} |
Can you make molecule COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1cc(C)cc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1cc(C)c(C)cc1Br | COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1cc(C)cc(C)c1 | COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1cc(C)c(C)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(C)c(C)cc1Br",
"old_substring": "c15cc(C)cc(C)c1"
} |
Can you make molecule COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1cc(C)cc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1c(C)cc(I)cc1C | COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1cc(C)cc(C)c1 | COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1c(C)cc(I)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(I)cc(C)c1&",
"old_substring": "c15cc(C)cc(C)c1"
} |
Can you make molecule COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1cc(C)cc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1c(Cl)ccc(C)c1Cl | COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1cc(C)cc(C)c1 | COc1ccc(C)cc1-n1nnnc1SCC(=O)Nc1c(Cl)ccc(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)ccc(C)c1Cl",
"old_substring": "c15cc(C)cc(C)c1"
} |
Can you make molecule C[C@H](NC(=O)Cc1ccc[nH]1)C(=O)N1CCCC[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NSC(=O)Cc1ccc[nH]1)C(=O)N1CCCC[C@H]1C | C[C@H](NC(=O)Cc1ccc[nH]1)C(=O)N1CCCC[C@H]1C | C[C@H](NSC(=O)Cc1ccc[nH]1)C(=O)N1CCCC[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C2(=O)C5"
} |
Can you make molecule C[C@H](NC(=O)Cc1ccc[nH]1)C(=O)N1CCCC[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC(=O)CCCC(=O)c1ccc[nH]1)C(=O)N1CCCC[C@H]1C | C[C@H](NC(=O)Cc1ccc[nH]1)C(=O)N1CCCC[C@H]1C | C[C@H](NC(=O)CCCC(=O)c1ccc[nH]1)C(=O)N1CCCC[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C2(=O)C5"
} |
Can you make molecule C[C@H](NC(=O)Cc1ccc[nH]1)C(=O)N1CCCC[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC(=O)CC(C)(C)c1ccc[nH]1)C(=O)N1CCCC[C@H]1C | C[C@H](NC(=O)Cc1ccc[nH]1)C(=O)N1CCCC[C@H]1C | C[C@H](NC(=O)CC(C)(C)c1ccc[nH]1)C(=O)N1CCCC[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C2(=O)C5"
} |
Can you make molecule C[C@H](NC(=O)Cc1ccc[nH]1)C(=O)N1CCCC[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC[S@+]([O-])CCCc1ccc[nH]1)C(=O)N1CCCC[C@H]1C | C[C@H](NC(=O)Cc1ccc[nH]1)C(=O)N1CCCC[C@H]1C | C[C@H](NC[S@+]([O-])CCCc1ccc[nH]1)C(=O)N1CCCC[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C2(=O)C5"
} |
Can you make molecule C[C@H](NC(=O)Cc1ccc[nH]1)C(=O)N1CCCC[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC(=O)CCC(C)(C)c1ccc[nH]1)C(=O)N1CCCC[C@H]1C | C[C@H](NC(=O)Cc1ccc[nH]1)C(=O)N1CCCC[C@H]1C | C[C@H](NC(=O)CCC(C)(C)c1ccc[nH]1)C(=O)N1CCCC[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C2(=O)C5"
} |
Can you make molecule CCOC(=O)[C@H]1CCCN(C(=O)c2cc(C(C)C)n(C)n2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)[C@H]1CCCN(C(=O)c2cc(C(C)C)nc(Cl)n2)C1 | CCOC(=O)[C@H]1CCCN(C(=O)c2cc(C(C)C)n(C)n2)C1 | CCOC(=O)[C@H]1CCCN(C(=O)c2cc(C(C)C)nc(Cl)n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&nc(Cl)n1",
"old_substring": "c16cc8n(C)n1"
} |
Can you make molecule CCOC(=O)[C@H]1CCCN(C(=O)c2cc(C(C)C)n(C)n2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)[C@H]1CCCN(C(=O)c2cc(C(C)C)n(C)c2)C1 | CCOC(=O)[C@H]1CCCN(C(=O)c2cc(C(C)C)n(C)n2)C1 | CCOC(=O)[C@H]1CCCN(C(=O)c2cc(C(C)C)n(C)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&n(C)c1",
"old_substring": "c16cc8n(C)n1"
} |
Can you make molecule CCOC(=O)[C@H]1CCCN(C(=O)c2cc(C(C)C)n(C)n2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)[C@H]1CCCN(C(=O)c2ncc(Cl)c(C(C)C)n2)C1 | CCOC(=O)[C@H]1CCCN(C(=O)c2cc(C(C)C)n(C)n2)C1 | CCOC(=O)[C@H]1CCCN(C(=O)c2ncc(Cl)c(C(C)C)n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc(Cl)c&n1",
"old_substring": "c16cc8n(C)n1"
} |
Can you make molecule CCOC(=O)[C@H]1CCCN(C(=O)c2cc(C(C)C)n(C)n2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)[C@H]1CCCN(C(=O)c2ncc(C(C)C)c(Cl)n2)C1 | CCOC(=O)[C@H]1CCCN(C(=O)c2cc(C(C)C)n(C)n2)C1 | CCOC(=O)[C@H]1CCCN(C(=O)c2ncc(C(C)C)c(Cl)n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc&c(Cl)n1",
"old_substring": "c16cc8n(C)n1"
} |
Can you make molecule CCOC(=O)[C@H]1CCCN(C(=O)c2cc(C(C)C)n(C)n2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)[C@H]1CCCN(C(=O)c2cc(C(C)C)n(C)c2C)C1 | CCOC(=O)[C@H]1CCCN(C(=O)c2cc(C(C)C)n(C)n2)C1 | CCOC(=O)[C@H]1CCCN(C(=O)c2cc(C(C)C)n(C)c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&n(C)c1C",
"old_substring": "c16cc8n(C)n1"
} |
Can you make molecule C[C@H]([NH2+]Cc1nc(Cc2ccccc2)no1)[C@@H](C)n1cccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH2+]Cc1nc(Cc2ccccc2Cl)no1)[C@@H](C)n1cccn1 | C[C@H]([NH2+]Cc1nc(Cc2ccccc2)no1)[C@@H](C)n1cccn1 | C[C@H]([NH2+]Cc1nc(Cc2ccccc2Cl)no1)[C@@H](C)n1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c18ccccc1"
} |
Can you make molecule C[C@H]([NH2+]Cc1nc(Cc2ccccc2)no1)[C@@H](C)n1cccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH2+]Cc1nc(Cc2ccc(I)cc2)no1)[C@@H](C)n1cccn1 | C[C@H]([NH2+]Cc1nc(Cc2ccccc2)no1)[C@@H](C)n1cccn1 | C[C@H]([NH2+]Cc1nc(Cc2ccc(I)cc2)no1)[C@@H](C)n1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c18ccccc1"
} |
Can you make molecule C[C@H]([NH2+]Cc1nc(Cc2ccccc2)no1)[C@@H](C)n1cccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH2+]Cc1nc(C=Cc2ccccc2)no1)[C@@H](C)n1cccn1 | C[C@H]([NH2+]Cc1nc(Cc2ccccc2)no1)[C@@H](C)n1cccn1 | C[C@H]([NH2+]Cc1nc(C=Cc2ccccc2)no1)[C@@H](C)n1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccccc1",
"old_substring": "c18ccccc1"
} |
Can you make molecule C[C@H]([NH2+]Cc1nc(Cc2ccccc2)no1)[C@@H](C)n1cccn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cc2noc(C[NH2+][C@@H](C)[C@@H](C)n3cccn3)n2)cc1I | C[C@H]([NH2+]Cc1nc(Cc2ccccc2)no1)[C@@H](C)n1cccn1 | Cc1ccc(Cc2noc(C[NH2+][C@@H](C)[C@@H](C)n3cccn3)n2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c18ccccc1"
} |
Can you make molecule C[C@H]([NH2+]Cc1nc(Cc2ccccc2)no1)[C@@H](C)n1cccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH2+]Cc1nc(Cc2cccc(Br)c2)no1)[C@@H](C)n1cccn1 | C[C@H]([NH2+]Cc1nc(Cc2ccccc2)no1)[C@@H](C)n1cccn1 | C[C@H]([NH2+]Cc1nc(Cc2cccc(Br)c2)no1)[C@@H](C)n1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c18ccccc1"
} |
Can you make molecule c1cc(CN2CC[NH+](Cc3ccc4c(c3)OCCO4)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | c1cc(CCCCN2CC[NH+](Cc3ccc4c(c3)OCCO4)CC2)no1 | c1cc(CN2CC[NH+](Cc3ccc4c(c3)OCCO4)CC2)no1 | c1cc(CCCCN2CC[NH+](Cc3ccc4c(c3)OCCO4)CC2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C57"
} |
Can you make molecule c1cc(CN2CC[NH+](Cc3ccc4c(c3)OCCO4)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | c1cc(CCCCCN2CC[NH+](Cc3ccc4c(c3)OCCO4)CC2)no1 | c1cc(CN2CC[NH+](Cc3ccc4c(c3)OCCO4)CC2)no1 | c1cc(CCCCCN2CC[NH+](Cc3ccc4c(c3)OCCO4)CC2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C57"
} |
Can you make molecule c1cc(CN2CC[NH+](Cc3ccc4c(c3)OCCO4)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | c1cc(C2CC(N3CC[NH+](Cc4ccc5c(c4)OCCO5)CC3)C2)no1 | c1cc(CN2CC[NH+](Cc3ccc4c(c3)OCCO4)CC2)no1 | c1cc(C2CC(N3CC[NH+](Cc4ccc5c(c4)OCCO5)CC3)C2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C57"
} |
Can you make molecule c1cc(CN2CC[NH+](Cc3ccc4c(c3)OCCO4)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | S=C(ON1CC[NH+](Cc2ccc3c(c2)OCCO3)CC1)Sc1ccon1 | c1cc(CN2CC[NH+](Cc3ccc4c(c3)OCCO4)CC2)no1 | S=C(ON1CC[NH+](Cc2ccc3c(c2)OCCO3)CC1)Sc1ccon1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C57"
} |
Can you make molecule c1cc(CN2CC[NH+](Cc3ccc4c(c3)OCCO4)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | S=C(Nc1ccon1)SN1CC[NH+](Cc2ccc3c(c2)OCCO3)CC1 | c1cc(CN2CC[NH+](Cc3ccc4c(c3)OCCO4)CC2)no1 | S=C(Nc1ccon1)SN1CC[NH+](Cc2ccc3c(c2)OCCO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C57"
} |
Can you make molecule CCCCNC(=O)CCc1c(C)nc2c3ccccc3nn2c1C less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)=NC(=O)CCc1c(C)nc2c3ccccc3nn2c1C | CCCCNC(=O)CCc1c(C)nc2c3ccccc3nn2c1C | CCCC(C)=NC(=O)CCc1c(C)nc2c3ccccc3nn2c1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCC=&C",
"old_substring": "CCCC5"
} |
Can you make molecule CCCCNC(=O)CCc1c(C)nc2c3ccccc3nn2c1C less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)NC(=O)CCc1c(C)nc2c3ccccc3nn2c1C | CCCCNC(=O)CCc1c(C)nc2c3ccccc3nn2c1C | CCCC(C)(C)NC(=O)CCc1c(C)nc2c3ccccc3nn2c1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "CCCC5"
} |
Can you make molecule CCCCNC(=O)CCc1c(C)nc2c3ccccc3nn2c1C less soluble in water? The output molecule should be similar to the input molecule. | CCCC(CCC)=NC(=O)CCc1c(C)nc2c3ccccc3nn2c1C | CCCCNC(=O)CCc1c(C)nc2c3ccccc3nn2c1C | CCCC(CCC)=NC(=O)CCc1c(C)nc2c3ccccc3nn2c1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCC=&CCC",
"old_substring": "CCCC5"
} |
Can you make molecule CCCCNC(=O)CCc1c(C)nc2c3ccccc3nn2c1C less soluble in water? The output molecule should be similar to the input molecule. | CCCCCC(C)=NC(=O)CCc1c(C)nc2c3ccccc3nn2c1C | CCCCNC(=O)CCc1c(C)nc2c3ccccc3nn2c1C | CCCCCC(C)=NC(=O)CCc1c(C)nc2c3ccccc3nn2c1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCC=&C",
"old_substring": "CCCC5"
} |
Can you make molecule CCCCNC(=O)CCc1c(C)nc2c3ccccc3nn2c1C less soluble in water? The output molecule should be similar to the input molecule. | CCCCCCC(=O)NC(=O)CCc1c(C)nc2c3ccccc3nn2c1C | CCCCNC(=O)CCc1c(C)nc2c3ccccc3nn2c1C | CCCCCCC(=O)NC(=O)CCc1c(C)nc2c3ccccc3nn2c1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCCC&=O",
"old_substring": "CCCC5"
} |
Can you make molecule O=C(C[C@@H]1C[NH2+]CCO1)N[C@H]1C=CS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/S[C@@H]1C[NH2+]CCO1)N[C@H]1C=CS(=O)(=O)C1 | O=C(C[C@@H]1C[NH2+]CCO1)N[C@H]1C=CS(=O)(=O)C1 | O=C(/C=C/S[C@@H]1C[NH2+]CCO1)N[C@H]1C=CS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C2C4"
} |
Can you make molecule O=C(C[C@@H]1C[NH2+]CCO1)N[C@H]1C=CS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC([C@@H]2C[NH2+]CCO2)CC1)N[C@H]1C=CS(=O)(=O)C1 | O=C(C[C@@H]1C[NH2+]CCO1)N[C@H]1C=CS(=O)(=O)C1 | O=C(NN=C1CCC([C@@H]2C[NH2+]CCO2)CC1)N[C@H]1C=CS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C2C4"
} |
Can you make molecule O=C(C[C@@H]1C[NH2+]CCO1)N[C@H]1C=CS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ON[C@H]1C=CS(=O)(=O)C1)C(=O)S[C@@H]1C[NH2+]CCO1 | O=C(C[C@@H]1C[NH2+]CCO1)N[C@H]1C=CS(=O)(=O)C1 | C/C(=N\ON[C@H]1C=CS(=O)(=O)C1)C(=O)S[C@@H]1C[NH2+]CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C2C4"
} |
Can you make molecule O=C(C[C@@H]1C[NH2+]CCO1)N[C@H]1C=CS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H]1C=CS(=O)(=O)C1)C1=CC[C@H]([C@@H]2C[NH2+]CCO2)S1 | O=C(C[C@@H]1C[NH2+]CCO1)N[C@H]1C=CS(=O)(=O)C1 | O=C(N[C@H]1C=CS(=O)(=O)C1)C1=CC[C@H]([C@@H]2C[NH2+]CCO2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C2C4"
} |
Can you make molecule O=C(C[C@@H]1C[NH2+]CCO1)N[C@H]1C=CS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=Cc1ccc([C@@H]2C[NH2+]CCO2)cc1)N[C@H]1C=CS(=O)(=O)C1 | O=C(C[C@@H]1C[NH2+]CCO1)N[C@H]1C=CS(=O)(=O)C1 | O=C(NN=Cc1ccc([C@@H]2C[NH2+]CCO2)cc1)N[C@H]1C=CS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=Cc1ccc&cc1",
"old_substring": "O=C2C4"
} |
Can you make molecule C[C@@H]1CCO[C@@H]1C(=O)N1CC[C@H](C(N)=O)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[C@@H](C)CCN1C(=O)N1CC[C@H](C(N)=O)c2ccccc21 | C[C@@H]1CCO[C@@H]1C(=O)N1CC[C@H](C(N)=O)c2ccccc21 | C[C@@H]1[C@@H](C)CCN1C(=O)N1CC[C@H](C(N)=O)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCN&[C@@H]1C",
"old_substring": "C[C@@H]1CCO[C@@H]14"
} |
Can you make molecule C[C@@H]1CCO[C@@H]1C(=O)N1CC[C@H](C(N)=O)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1SCCC[C@@H]1C(=O)N1CC[C@H](C(N)=O)c2ccccc21 | C[C@@H]1CCO[C@@H]1C(=O)N1CC[C@H](C(N)=O)c2ccccc21 | C[C@H]1SCCC[C@@H]1C(=O)N1CC[C@H](C(N)=O)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1SCCC[C@@H]1&",
"old_substring": "C[C@@H]1CCO[C@@H]14"
} |
Can you make molecule C[C@@H]1CCO[C@@H]1C(=O)N1CC[C@H](C(N)=O)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC[C@@]1(C#N)C(=O)N1CC[C@H](C(N)=O)c2ccccc21 | C[C@@H]1CCO[C@@H]1C(=O)N1CC[C@H](C(N)=O)c2ccccc21 | C[C@@H]1CC[C@@]1(C#N)C(=O)N1CC[C@H](C(N)=O)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1CC[C@]1&C#N",
"old_substring": "C[C@@H]1CCO[C@@H]14"
} |
Can you make molecule C[C@@H]1CCO[C@@H]1C(=O)N1CC[C@H](C(N)=O)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[C@@]1(O)C(=O)N1CC[C@H](C(N)=O)c2ccccc21 | C[C@@H]1CCO[C@@H]1C(=O)N1CC[C@H](C(N)=O)c2ccccc21 | C[C@@H]1CCCC[C@@]1(O)C(=O)N1CC[C@H](C(N)=O)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1CCCC[C@]1&O",
"old_substring": "C[C@@H]1CCO[C@@H]14"
} |
Can you make molecule C[C@@H]1CCO[C@@H]1C(=O)N1CC[C@H](C(N)=O)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCC[C@]1(O)C(=O)N1CC[C@H](C(N)=O)c2ccccc21 | C[C@@H]1CCO[C@@H]1C(=O)N1CC[C@H](C(N)=O)c2ccccc21 | C[C@H]1CCCC[C@]1(O)C(=O)N1CC[C@H](C(N)=O)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCCC[C@@]1&O",
"old_substring": "C[C@@H]1CCO[C@@H]14"
} |
Can you make molecule CCC[NH2+][C@H](Cc1nn(C)c2ccccc12)c1ncc[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[NH2+][C@H](Cc1nn(C)c2ccccc12)c1ncc[nH]1 | CCC[NH2+][C@H](Cc1nn(C)c2ccccc12)c1ncc[nH]1 | CC(C)CC[NH2+][C@H](Cc1nn(C)c2ccccc12)c1ncc[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC3"
} |
Can you make molecule CCC[NH2+][C@H](Cc1nn(C)c2ccccc12)c1ncc[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nc(C[C@@H]([NH2+]CCCCBr)c2ncc[nH]2)c2ccccc21 | CCC[NH2+][C@H](Cc1nn(C)c2ccccc12)c1ncc[nH]1 | Cn1nc(C[C@@H]([NH2+]CCCCBr)c2ncc[nH]2)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC3"
} |
Can you make molecule CCC[NH2+][C@H](Cc1nn(C)c2ccccc12)c1ncc[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[NH2+][C@H](Cc1nn(C)c2ccccc12)c1ncc[nH]1 | CCC[NH2+][C@H](Cc1nn(C)c2ccccc12)c1ncc[nH]1 | C=CCCC[NH2+][C@H](Cc1nn(C)c2ccccc12)c1ncc[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC3"
} |
Can you make molecule CCC[NH2+][C@H](Cc1nn(C)c2ccccc12)c1ncc[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nc(C[C@@H]([NH2+]CCCCCl)c2ncc[nH]2)c2ccccc21 | CCC[NH2+][C@H](Cc1nn(C)c2ccccc12)c1ncc[nH]1 | Cn1nc(C[C@@H]([NH2+]CCCCCl)c2ncc[nH]2)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC3"
} |
Can you make molecule CCC[NH2+][C@H](Cc1nn(C)c2ccccc12)c1ncc[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC[NH2+][C@H](Cc1nn(C)c2ccccc12)c1ncc[nH]1 | CCC[NH2+][C@H](Cc1nn(C)c2ccccc12)c1ncc[nH]1 | C=CCCCC[NH2+][C@H](Cc1nn(C)c2ccccc12)c1ncc[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CCC3"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.