prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(C)c1noc(-c2cc[nH+]c(N3CCN(C(=O)[C@H]4C[C@H]4C)CC3)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1noc(-c2cc[nH+]c(N3CCN(C(=O)[C@H]4CCCC[C@@H]4I)CC3)c2)n1 | CC(C)c1noc(-c2cc[nH+]c(N3CCN(C(=O)[C@H]4C[C@H]4C)CC3)c2)n1 | CC(C)c1noc(-c2cc[nH+]c(N3CCN(C(=O)[C@H]4CCCC[C@@H]4I)CC3)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@@H]1I",
"old_substring": "[C@H]17C[C@H]1C"
} |
Can you make molecule CC(C)c1noc(-c2cc[nH+]c(N3CCN(C(=O)[C@H]4C[C@H]4C)CC3)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1noc(-c2cc[nH+]c(N3CCN(C(=O)[C@H]4CC4(Cl)Cl)CC3)c2)n1 | CC(C)c1noc(-c2cc[nH+]c(N3CCN(C(=O)[C@H]4C[C@H]4C)CC3)c2)n1 | CC(C)c1noc(-c2cc[nH+]c(N3CCN(C(=O)[C@H]4CC4(Cl)Cl)CC3)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC1(Cl)Cl",
"old_substring": "[C@H]17C[C@H]1C"
} |
Can you make molecule CC(C)c1noc(-c2cc[nH+]c(N3CCN(C(=O)[C@H]4C[C@H]4C)CC3)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1noc(-c2cc[nH+]c(N3CCN(C(=O)[C@H]4CC45CCCC5)CC3)c2)n1 | CC(C)c1noc(-c2cc[nH+]c(N3CCN(C(=O)[C@H]4C[C@H]4C)CC3)c2)n1 | CC(C)c1noc(-c2cc[nH+]c(N3CCN(C(=O)[C@H]4CC45CCCC5)CC3)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC12CCCC2",
"old_substring": "[C@H]17C[C@H]1C"
} |
Can you make molecule CC(C)c1noc(-c2cc[nH+]c(N3CCN(C(=O)[C@H]4C[C@H]4C)CC3)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1noc(-c2cc[nH+]c(N3CCN(C(=O)[C@H]4CC45CCCCC5)CC3)c2)n1 | CC(C)c1noc(-c2cc[nH+]c(N3CCN(C(=O)[C@H]4C[C@H]4C)CC3)c2)n1 | CC(C)c1noc(-c2cc[nH+]c(N3CCN(C(=O)[C@H]4CC45CCCCC5)CC3)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC12CCCCC2",
"old_substring": "[C@H]17C[C@H]1C"
} |
Can you make molecule CC(C)c1noc(-c2cc[nH+]c(N3CCN(C(=O)[C@H]4C[C@H]4C)CC3)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1noc(-c2cc[nH+]c(N3CCN(C(=O)[C@@H]4CCCS[C@H]4C)CC3)c2)n1 | CC(C)c1noc(-c2cc[nH+]c(N3CCN(C(=O)[C@H]4C[C@H]4C)CC3)c2)n1 | CC(C)c1noc(-c2cc[nH+]c(N3CCN(C(=O)[C@@H]4CCCS[C@H]4C)CC3)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCS[C@H]1C",
"old_substring": "[C@H]17C[C@H]1C"
} |
Can you make molecule O=C(NCc1cccnc1)NCc1ccnc(OCC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C2=CC=CC2=C(NCc2cccnc2)CCN1NCc1ccnc(OCC(F)F)c1 | O=C(NCc1cccnc1)NCc1ccnc(OCC(F)F)c1 | O=C1C2=CC=CC2=C(NCc2cccnc2)CCN1NCc1ccnc(OCC(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1c2cccc&c2CCN1&",
"old_substring": "O=C23"
} |
Can you make molecule O=C(NCc1cccnc1)NCc1ccnc(OCC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1c(NCc2cccnc2)cc(NCc2ccnc(OCC(F)F)c2)ccc2oc1-2 | O=C(NCc1cccnc1)NCc1ccnc(OCC(F)F)c1 | O=Cc1c(NCc2cccnc2)cc(NCc2ccnc(OCC(F)F)c2)ccc2oc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1c&oc2ccc&cc12",
"old_substring": "O=C23"
} |
Can you make molecule O=C(NCc1cccnc1)NCc1ccnc(OCC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SNCc1ccnc(OCC(F)F)c1)NCc1cccnc1 | O=C(NCc1cccnc1)NCc1ccnc(OCC(F)F)c1 | O=C(/C=C/SNCc1ccnc(OCC(F)F)c1)NCc1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C23"
} |
Can you make molecule O=C(NCc1cccnc1)NCc1ccnc(OCC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NCc2cccnc2)nc1NCc1ccnc(OCC(F)F)c1 | O=C(NCc1cccnc1)NCc1ccnc(OCC(F)F)c1 | O=Cc1sc(NCc2cccnc2)nc1NCc1ccnc(OCC(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C23"
} |
Can you make molecule O=C(NCc1cccnc1)NCc1ccnc(OCC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NCc2cccnc2)sc1NCc1ccnc(OCC(F)F)c1 | O=C(NCc1cccnc1)NCc1ccnc(OCC(F)F)c1 | O=Cc1nc(NCc2cccnc2)sc1NCc1ccnc(OCC(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C23"
} |
Can you make molecule C[C@@H](NC(=O)N1CCCCCCC1)[C@@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)CC(C)(C)N1CCCCCCC1)[C@@H]1CCCO1 | C[C@@H](NC(=O)N1CCCCCCC1)[C@@H]1CCCO1 | C[C@@H](NC(=O)CC(C)(C)N1CCCCCCC1)[C@@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule C[C@@H](NC(=O)N1CCCCCCC1)[C@@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)CCC(C)(C)N1CCCCCCC1)[C@@H]1CCCO1 | C[C@@H](NC(=O)N1CCCCCCC1)[C@@H]1CCCO1 | C[C@@H](NC(=O)CCC(C)(C)N1CCCCCCC1)[C@@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule C[C@@H](NC(=O)N1CCCCCCC1)[C@@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)C[C@@H](Br)N1CCCCCCC1)[C@@H]1CCCO1 | C[C@@H](NC(=O)N1CCCCCCC1)[C@@H]1CCCO1 | C[C@@H](NC(=O)C[C@@H](Br)N1CCCCCCC1)[C@@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule C[C@@H](NC(=O)N1CCCCCCC1)[C@@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N[C@H](C)[C@@H]2CCCO2)cc(=O)n1N1CCCCCCC1 | C[C@@H](NC(=O)N1CCCCCCC1)[C@@H]1CCCO1 | Cc1cc(N[C@H](C)[C@@H]2CCCO2)cc(=O)n1N1CCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C23=O"
} |
Can you make molecule C[C@@H](NC(=O)N1CCCCCCC1)[C@@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(N[C@H](C)[C@@H]2CCCO2)c(=O)ccn1N1CCCCCCC1 | C[C@@H](NC(=O)N1CCCCCCC1)[C@@H]1CCCO1 | Cc1c(N[C@H](C)[C@@H]2CCCO2)c(=O)ccn1N1CCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C23=O"
} |
Can you make molecule COc1ccc([C@H]2C(C(=O)NCc3ccccc3)=C(C)Nc3ncnn32)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2C(C(=O)NCSCc3ccccc3)=C(C)Nc3ncnn32)cc1OC | COc1ccc([C@H]2C(C(=O)NCc3ccccc3)=C(C)Nc3ncnn32)cc1OC | COc1ccc([C@H]2C(C(=O)NCSCc3ccccc3)=C(C)Nc3ncnn32)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N47"
} |
Can you make molecule COc1ccc([C@H]2C(C(=O)NCc3ccccc3)=C(C)Nc3ncnn32)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2C(C(=O)NC(=N)SCc3ccccc3)=C(C)Nc3ncnn32)cc1OC | COc1ccc([C@H]2C(C(=O)NCc3ccccc3)=C(C)Nc3ncnn32)cc1OC | COc1ccc([C@H]2C(C(=O)NC(=N)SCc3ccccc3)=C(C)Nc3ncnn32)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N47"
} |
Can you make molecule COc1ccc([C@H]2C(C(=O)NCc3ccccc3)=C(C)Nc3ncnn32)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2C(C(=O)c3nsc(Cc4ccccc4)c3N)=C(C)Nc3ncnn32)cc1OC | COc1ccc([C@H]2C(C(=O)NCc3ccccc3)=C(C)Nc3ncnn32)cc1OC | COc1ccc([C@H]2C(C(=O)c3nsc(Cc4ccccc4)c3N)=C(C)Nc3ncnn32)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N47"
} |
Can you make molecule COc1ccc([C@H]2C(C(=O)NCc3ccccc3)=C(C)Nc3ncnn32)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2C(C(=O)N(C)C(=S)SCc3ccccc3)=C(C)Nc3ncnn32)cc1OC | COc1ccc([C@H]2C(C(=O)NCc3ccccc3)=C(C)Nc3ncnn32)cc1OC | COc1ccc([C@H]2C(C(=O)N(C)C(=S)SCc3ccccc3)=C(C)Nc3ncnn32)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N47"
} |
Can you make molecule COc1ccc([C@H]2C(C(=O)NCc3ccccc3)=C(C)Nc3ncnn32)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2C(C(=O)c3ccc(Cc4ccccc4)n3N)=C(C)Nc3ncnn32)cc1OC | COc1ccc([C@H]2C(C(=O)NCc3ccccc3)=C(C)Nc3ncnn32)cc1OC | COc1ccc([C@H]2C(C(=O)c3ccc(Cc4ccccc4)n3N)=C(C)Nc3ncnn32)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "Nn1c&ccc1&",
"old_substring": "N47"
} |
Can you make molecule Cc1cc(=O)n2c(n1)SC[C@@H]2CC(=O)NCCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(CC)NC(=O)C[C@H]1CSc2nc(C)cc(=O)n21 | Cc1cc(=O)n2c(n1)SC[C@@H]2CC(=O)NCCC(C)C | CCC(C)(CC)NC(=O)C[C@H]1CSc2nc(C)cc(=O)n21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "C4CC(C)C"
} |
Can you make molecule Cc1cc(=O)n2c(n1)SC[C@@H]2CC(=O)NCCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(=NC(=O)C[C@H]1CSc2nc(C)cc(=O)n21)C(C)(C)C | Cc1cc(=O)n2c(n1)SC[C@@H]2CC(=O)NCCC(C)C | CC(=NC(=O)C[C@H]1CSc2nc(C)cc(=O)n21)C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC=&C(C)(C)C",
"old_substring": "C4CC(C)C"
} |
Can you make molecule Cc1cc(=O)n2c(n1)SC[C@@H]2CC(=O)NCCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(CS)CNC(=O)C[C@H]1CSc2nc(C)cc(=O)n21 | Cc1cc(=O)n2c(n1)SC[C@@H]2CC(=O)NCCC(C)C | CCC(CC)(CS)CNC(=O)C[C@H]1CSc2nc(C)cc(=O)n21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC(C&)(CC)CS",
"old_substring": "C4CC(C)C"
} |
Can you make molecule Cc1cc(=O)n2c(n1)SC[C@@H]2CC(=O)NCCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(CC)CNC(=O)C[C@H]1CSc2nc(C)cc(=O)n21 | Cc1cc(=O)n2c(n1)SC[C@@H]2CC(=O)NCCC(C)C | CCC(CC)(CC)CNC(=O)C[C@H]1CSc2nc(C)cc(=O)n21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC(C&)(CC)CC",
"old_substring": "C4CC(C)C"
} |
Can you make molecule Cc1cc(=O)n2c(n1)SC[C@@H]2CC(=O)NCCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(CCl)NC(=O)C[C@H]1CSc2nc(C)cc(=O)n21 | Cc1cc(=O)n2c(n1)SC[C@@H]2CC(=O)NCCC(C)C | CCC(CC)(CCl)NC(=O)C[C@H]1CSc2nc(C)cc(=O)n21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)CCl",
"old_substring": "C4CC(C)C"
} |
Can you make molecule CC(C)C1=CN=N[C@H]1[C@H]1CCC[NH+](C[C@@H](C)Cc2ccc3c(c2)OCO3)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C1=CN=N[C@H]1[C@H]1CN(C[C@@H](C)Cc2ccc3c(c2)OCO3)C[C@@H]1C | CC(C)C1=CN=N[C@H]1[C@H]1CCC[NH+](C[C@@H](C)Cc2ccc3c(c2)OCO3)C1 | CC(C)C1=CN=N[C@H]1[C@H]1CN(C[C@@H](C)Cc2ccc3c(c2)OCO3)C[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C[C@@H]1C",
"old_substring": "[C@H]16CCC[NH+]4C1"
} |
Can you make molecule CC(C)C1=CN=N[C@H]1[C@H]1CCC[NH+](C[C@@H](C)Cc2ccc3c(c2)OCO3)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C1=CN=N[C@H]1[C@H]1C=C[C@H](C[C@@H](C)Cc2ccc3c(c2)OCO3)C1 | CC(C)C1=CN=N[C@H]1[C@H]1CCC[NH+](C[C@@H](C)Cc2ccc3c(c2)OCO3)C1 | CC(C)C1=CN=N[C@H]1[C@H]1C=C[C@H](C[C@@H](C)Cc2ccc3c(c2)OCO3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@H]&C1",
"old_substring": "[C@H]16CCC[NH+]4C1"
} |
Can you make molecule CC(C)C1=CN=N[C@H]1[C@H]1CCC[NH+](C[C@@H](C)Cc2ccc3c(c2)OCO3)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C1=CN=N[C@H]1[C@H]1CCC[C@H](C[C@@H](C)Cc2ccc3c(c2)OCO3)C1 | CC(C)C1=CN=N[C@H]1[C@H]1CCC[NH+](C[C@@H](C)Cc2ccc3c(c2)OCO3)C1 | CC(C)C1=CN=N[C@H]1[C@H]1CCC[C@H](C[C@@H](C)Cc2ccc3c(c2)OCO3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]16CCC[NH+]4C1"
} |
Can you make molecule CC(C)C1=CN=N[C@H]1[C@H]1CCC[NH+](C[C@@H](C)Cc2ccc3c(c2)OCO3)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C1=CN=N[C@H]1[C@H]1C=C[C@@H](C[C@@H](C)Cc2ccc3c(c2)OCO3)C1 | CC(C)C1=CN=N[C@H]1[C@H]1CCC[NH+](C[C@@H](C)Cc2ccc3c(c2)OCO3)C1 | CC(C)C1=CN=N[C@H]1[C@H]1C=C[C@@H](C[C@@H](C)Cc2ccc3c(c2)OCO3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@@H]&C1",
"old_substring": "[C@H]16CCC[NH+]4C1"
} |
Can you make molecule CC(C)C1=CN=N[C@H]1[C@H]1CCC[NH+](C[C@@H](C)Cc2ccc3c(c2)OCO3)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C1=CN=N[C@H]1[C@H]1CCC[C@H](C[C@@H](C)Cc2ccc3c(c2)OCO3)CC1 | CC(C)C1=CN=N[C@H]1[C@H]1CCC[NH+](C[C@@H](C)Cc2ccc3c(c2)OCO3)C1 | CC(C)C1=CN=N[C@H]1[C@H]1CCC[C@H](C[C@@H](C)Cc2ccc3c(c2)OCO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&CC1",
"old_substring": "[C@H]16CCC[NH+]4C1"
} |
Can you make molecule COc1cc(CNC(=O)c2occc2Br)ccn1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(CNC(=O)c2occc2Br)ccn1 | COc1cc(CNC(=O)c2occc2Br)ccn1 | COCc1cc(CNC(=O)c2occc2Br)ccn1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(CNC(=O)c2occc2Br)ccn1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc(CNC(=O)c2occc2Br)ccn1 | COc1cc(CNC(=O)c2occc2Br)ccn1 | COCSc1cc(CNC(=O)c2occc2Br)ccn1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(CNC(=O)c2occc2Br)ccn1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1cc(CNC(=O)c2occc2Br)ccn1 | COc1cc(CNC(=O)c2occc2Br)ccn1 | CC(=O)Sc1cc(CNC(=O)c2occc2Br)ccn1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(CNC(=O)c2occc2Br)ccn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS)c1cc(CNC(=O)c2occc2Br)ccn1 | COc1cc(CNC(=O)c2occc2Br)ccn1 | O=C(CS)c1cc(CNC(=O)c2occc2Br)ccn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(CNC(=O)c2occc2Br)ccn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CI)c1cc(CNC(=O)c2occc2Br)ccn1 | COc1cc(CNC(=O)c2occc2Br)ccn1 | O=C(CI)c1cc(CNC(=O)c2occc2Br)ccn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule Cc1cccc(COc2ccc(Br)cc2C=C2SC(=S)NC2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CCCCOc2ccc(Br)cc2C=C2SC(=S)NC2=O)c1 | Cc1cccc(COc2ccc(Br)cc2C=C2SC(=S)NC2=O)c1 | Cc1cccc(CCCCOc2ccc(Br)cc2C=C2SC(=S)NC2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C36"
} |
Can you make molecule Cc1cccc(COc2ccc(Br)cc2C=C2SC(=S)NC2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CCCCCOc2ccc(Br)cc2C=C2SC(=S)NC2=O)c1 | Cc1cccc(COc2ccc(Br)cc2C=C2SC(=S)NC2=O)c1 | Cc1cccc(CCCCCOc2ccc(Br)cc2C=C2SC(=S)NC2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C36"
} |
Can you make molecule Cc1cccc(COc2ccc(Br)cc2C=C2SC(=S)NC2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C2CC(Oc3ccc(Br)cc3C=C3SC(=S)NC3=O)C2)c1 | Cc1cccc(COc2ccc(Br)cc2C=C2SC(=S)NC2=O)c1 | Cc1cccc(C2CC(Oc3ccc(Br)cc3C=C3SC(=S)NC3=O)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C36"
} |
Can you make molecule Cc1cccc(COc2ccc(Br)cc2C=C2SC(=S)NC2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(SC(=S)OOc2ccc(Br)cc2C=C2SC(=S)NC2=O)c1 | Cc1cccc(COc2ccc(Br)cc2C=C2SC(=S)NC2=O)c1 | Cc1cccc(SC(=S)OOc2ccc(Br)cc2C=C2SC(=S)NC2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C36"
} |
Can you make molecule Cc1cccc(COc2ccc(Br)cc2C=C2SC(=S)NC2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=S)SOc2ccc(Br)cc2C=C2SC(=S)NC2=O)c1 | Cc1cccc(COc2ccc(Br)cc2C=C2SC(=S)NC2=O)c1 | Cc1cccc(NC(=S)SOc2ccc(Br)cc2C=C2SC(=S)NC2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C36"
} |
Can you make molecule O=C(N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1)[C@H]1Cc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/S[C@H]1Cc2ccccc2O1)N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1 | O=C(N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1)[C@H]1Cc2ccccc2O1 | O=C(/C=C/S[C@H]1Cc2ccccc2O1)N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1)[C@H]1Cc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(N[C@@H]2CCO[C@@H]2c2ccc(Cl)c(F)c2)nc1[C@H]1Cc2ccccc2O1 | O=C(N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1)[C@H]1Cc2ccccc2O1 | O=Cc1sc(N[C@@H]2CCO[C@@H]2c2ccc(Cl)c(F)c2)nc1[C@H]1Cc2ccccc2O1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1)[C@H]1Cc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(N[C@@H]2CCO[C@@H]2c2ccc(Cl)c(F)c2)sc1[C@H]1Cc2ccccc2O1 | O=C(N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1)[C@H]1Cc2ccccc2O1 | O=Cc1nc(N[C@@H]2CCO[C@@H]2c2ccc(Cl)c(F)c2)sc1[C@H]1Cc2ccccc2O1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1)[C@H]1Cc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C/C[C@H]1Cc2ccccc2O1)N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1 | O=C(N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1)[C@H]1Cc2ccccc2O1 | O=C(N/N=C/C[C@H]1Cc2ccccc2O1)N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&N/N=C/C&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1)[C@H]1Cc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cc([C@H]2OCC[C@H]2NON=C2CCN([C@H]3Cc4ccccc4O3)CC2)ccc1Cl | O=C(N[C@@H]1CCO[C@@H]1c1ccc(Cl)c(F)c1)[C@H]1Cc2ccccc2O1 | Fc1cc([C@H]2OCC[C@H]2NON=C2CCN([C@H]3Cc4ccccc4O3)CC2)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C35"
} |
Can you make molecule Cc1ccc([C@]2([NH3+])CC[C@@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C[NH3+])(CCC)c1ccc(C)cc1 | Cc1ccc([C@]2([NH3+])CC[C@@H]2C)cc1 | CCCC(C[NH3+])(CCC)c1ccc(C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC3(C[NH3+])CCC",
"old_substring": "[C@@]13([NH3+])CC[C@@H]1C"
} |
Can you make molecule Cc1ccc([C@]2([NH3+])CC[C@@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H](C[NH3+])CC(C)C)cc1 | Cc1ccc([C@]2([NH3+])CC[C@@H]2C)cc1 | Cc1ccc([C@H](C[NH3+])CC(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C[C@H]3C[NH3+]",
"old_substring": "[C@@]13([NH3+])CC[C@@H]1C"
} |
Can you make molecule Cc1ccc([C@]2([NH3+])CC[C@@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@]2([NH3+])CC[C@@H]2C)cc1I | Cc1ccc([C@]2([NH3+])CC[C@@H]2C)cc1 | Cc1ccc([C@]2([NH3+])CC[C@@H]2C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "Cc1ccc3cc1"
} |
Can you make molecule Cc1ccc([C@]2([NH3+])CC[C@@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@]2([NH3+])CC[C@@H]2C)cc1Cl | Cc1ccc([C@]2([NH3+])CC[C@@H]2C)cc1 | Cc1ccc([C@]2([NH3+])CC[C@@H]2C)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1Cl",
"old_substring": "Cc1ccc3cc1"
} |
Can you make molecule Cc1ccc([C@]2([NH3+])CC[C@@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(I)ccc1[C@]1([NH3+])CC[C@@H]1C | Cc1ccc([C@]2([NH3+])CC[C@@H]2C)cc1 | Cc1cc(I)ccc1[C@]1([NH3+])CC[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(I)ccc1&",
"old_substring": "Cc1ccc3cc1"
} |
Can you make molecule O=C(CNC(=O)c1ccco1)OCC(=O)c1ccc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNC(=O)c1ccc(I)o1)OCC(=O)c1ccc2ccccc2c1 | O=C(CNC(=O)c1ccco1)OCC(=O)c1ccc2ccccc2c1 | O=C(CNC(=O)c1ccc(I)o1)OCC(=O)c1ccc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(CNC(=O)c1ccco1)OCC(=O)c1ccc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNC(=O)c1ccc(Br)o1)OCC(=O)c1ccc2ccccc2c1 | O=C(CNC(=O)c1ccco1)OCC(=O)c1ccc2ccccc2c1 | O=C(CNC(=O)c1ccc(Br)o1)OCC(=O)c1ccc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(CNC(=O)c1ccco1)OCC(=O)c1ccc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNC(=O)c1ccc(Cl)o1)OCC(=O)c1ccc2ccccc2c1 | O=C(CNC(=O)c1ccco1)OCC(=O)c1ccc2ccccc2c1 | O=C(CNC(=O)c1ccc(Cl)o1)OCC(=O)c1ccc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(CNC(=O)c1ccco1)OCC(=O)c1ccc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNC(=O)c1occc1Br)OCC(=O)c1ccc2ccccc2c1 | O=C(CNC(=O)c1ccco1)OCC(=O)c1ccc2ccccc2c1 | O=C(CNC(=O)c1occc1Br)OCC(=O)c1ccc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&occc1Br",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(CNC(=O)c1ccco1)OCC(=O)c1ccc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1C(=O)NCC(=O)OCC(=O)c1ccc2ccccc2c1 | O=C(CNC(=O)c1ccco1)OCC(=O)c1ccc2ccccc2c1 | Cc1ccsc1C(=O)NCC(=O)OCC(=O)c1ccc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(c1cc2c(F)cccc2[nH]1)N(C[C@@H]1CCCO1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1cc2c(F)cccc2[nH]1)N(C[C@@H]1CCCO1)c1ccncc1 | O=C(c1cc2c(F)cccc2[nH]1)N(C[C@@H]1CCCO1)c1ccncc1 | O=C(/C=C/Sc1cc2c(F)cccc2[nH]1)N(C[C@@H]1CCCO1)c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(c1cc2c(F)cccc2[nH]1)N(C[C@@H]1CCCO1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(N(C[C@@H]2CCCO2)c2ccncc2)nc1-c1cc2c(F)cccc2[nH]1 | O=C(c1cc2c(F)cccc2[nH]1)N(C[C@@H]1CCCO1)c1ccncc1 | O=Cc1sc(N(C[C@@H]2CCCO2)c2ccncc2)nc1-c1cc2c(F)cccc2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(c1cc2c(F)cccc2[nH]1)N(C[C@@H]1CCCO1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(N(C[C@@H]2CCCO2)c2ccncc2)sc1-c1cc2c(F)cccc2[nH]1 | O=C(c1cc2c(F)cccc2[nH]1)N(C[C@@H]1CCCO1)c1ccncc1 | O=Cc1nc(N(C[C@@H]2CCCO2)c2ccncc2)sc1-c1cc2c(F)cccc2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(c1cc2c(F)cccc2[nH]1)N(C[C@@H]1CCCO1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N(C[C@@H]1CCCO1)c1ccncc1)n1nc(-c2cc3c(F)cccc3[nH]2)oc1=S | O=C(c1cc2c(F)cccc2[nH]1)N(C[C@@H]1CCCO1)c1ccncc1 | O=C(N(C[C@@H]1CCCO1)c1ccncc1)n1nc(-c2cc3c(F)cccc3[nH]2)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C36"
} |
Can you make molecule O=C(c1cc2c(F)cccc2[nH]1)N(C[C@@H]1CCCO1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cccc2[nH]c(-c3ccc(/C=N/ON(C[C@@H]4CCCO4)c4ccncc4)o3)cc12 | O=C(c1cc2c(F)cccc2[nH]1)N(C[C@@H]1CCCO1)c1ccncc1 | Fc1cccc2[nH]c(-c3ccc(/C=N/ON(C[C@@H]4CCCO4)c4ccncc4)o3)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C36"
} |
Can you make molecule Cc1cc(C)c(NC(=O)c2cc3ccccc3n2C)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c(NSC(=O)Cc2cc3ccccc3n2C)c(C)c1 | Cc1cc(C)c(NC(=O)c2cc3ccccc3n2C)c(C)c1 | Cc1cc(C)c(NSC(=O)Cc2cc3ccccc3n2C)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cc(C)c(NC(=O)c2cc3ccccc3n2C)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c(NC(=O)CCCC(=O)c2cc3ccccc3n2C)c(C)c1 | Cc1cc(C)c(NC(=O)c2cc3ccccc3n2C)c(C)c1 | Cc1cc(C)c(NC(=O)CCCC(=O)c2cc3ccccc3n2C)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cc(C)c(NC(=O)c2cc3ccccc3n2C)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c(NC(=O)CC(C)(C)c2cc3ccccc3n2C)c(C)c1 | Cc1cc(C)c(NC(=O)c2cc3ccccc3n2C)c(C)c1 | Cc1cc(C)c(NC(=O)CC(C)(C)c2cc3ccccc3n2C)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cc(C)c(NC(=O)c2cc3ccccc3n2C)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c(NC(=O)CCC(C)(C)c2cc3ccccc3n2C)c(C)c1 | Cc1cc(C)c(NC(=O)c2cc3ccccc3n2C)c(C)c1 | Cc1cc(C)c(NC(=O)CCC(C)(C)c2cc3ccccc3n2C)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cc(C)c(NC(=O)c2cc3ccccc3n2C)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c(NSC(=O)[C@@H](C)c2cc3ccccc3n2C)c(C)c1 | Cc1cc(C)c(NC(=O)c2cc3ccccc3n2C)c(C)c1 | Cc1cc(C)c(NSC(=O)[C@@H](C)c2cc3ccccc3n2C)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule CSc1ccccc1NC(=O)N[C@@H](CO)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1ccccc1NC(=O)N[C@@H](CO)c1ccc(Cl)cc1I | CSc1ccccc1NC(=O)N[C@@H](CO)c1ccc(Cl)cc1 | CSc1ccccc1NC(=O)N[C@@H](CO)c1ccc(Cl)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c16ccc(Cl)cc1"
} |
Can you make molecule CSc1ccccc1NC(=O)N[C@@H](CO)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1ccccc1NC(=O)N[C@@H](CO)c1ccc(Cl)cc1Br | CSc1ccccc1NC(=O)N[C@@H](CO)c1ccc(Cl)cc1 | CSc1ccccc1NC(=O)N[C@@H](CO)c1ccc(Cl)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c16ccc(Cl)cc1"
} |
Can you make molecule CSc1ccccc1NC(=O)N[C@@H](CO)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1ccccc1NC(=O)N[C@@H](CO)c1ccc(Cl)c(I)c1 | CSc1ccccc1NC(=O)N[C@@H](CO)c1ccc(Cl)cc1 | CSc1ccccc1NC(=O)N[C@@H](CO)c1ccc(Cl)c(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c16ccc(Cl)cc1"
} |
Can you make molecule CSc1ccccc1NC(=O)N[C@@H](CO)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1ccccc1NC(=O)N[C@@H](CO)c1cc(Cl)ccc1Cl | CSc1ccccc1NC(=O)N[C@@H](CO)c1ccc(Cl)cc1 | CSc1ccccc1NC(=O)N[C@@H](CO)c1cc(Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Clc1ccc(Cl)c&c1",
"old_substring": "c16ccc(Cl)cc1"
} |
Can you make molecule CSc1ccccc1NC(=O)N[C@@H](CO)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1ccccc1NC(=O)N[C@@H](CO)c1ccc(Cl)c(Cl)c1 | CSc1ccccc1NC(=O)N[C@@H](CO)c1ccc(Cl)cc1 | CSc1ccccc1NC(=O)N[C@@H](CO)c1ccc(Cl)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c16ccc(Cl)cc1"
} |
Can you make molecule Cc1cc(Br)ccc1CNC(=O)C1CC=CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)ccc1CCCCNC(=O)C1CC=CC1 | Cc1cc(Br)ccc1CNC(=O)C1CC=CC1 | Cc1cc(Br)ccc1CCCCNC(=O)C1CC=CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C35"
} |
Can you make molecule Cc1cc(Br)ccc1CNC(=O)C1CC=CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)ccc1CCC=NC(=O)C1CC=CC1 | Cc1cc(Br)ccc1CNC(=O)C1CC=CC1 | Cc1cc(Br)ccc1CCC=NC(=O)C1CC=CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C35"
} |
Can you make molecule Cc1cc(Br)ccc1CNC(=O)C1CC=CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)ccc1CCCCCNC(=O)C1CC=CC1 | Cc1cc(Br)ccc1CNC(=O)C1CC=CC1 | Cc1cc(Br)ccc1CCCCCNC(=O)C1CC=CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C35"
} |
Can you make molecule Cc1cc(Br)ccc1CNC(=O)C1CC=CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)ccc1C1CC(NC(=O)C2CC=CC2)C1 | Cc1cc(Br)ccc1CNC(=O)C1CC=CC1 | Cc1cc(Br)ccc1C1CC(NC(=O)C2CC=CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C35"
} |
Can you make molecule Cc1cc(Br)ccc1CNC(=O)C1CC=CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)ccc1SC(=S)ONC(=O)C1CC=CC1 | Cc1cc(Br)ccc1CNC(=O)C1CC=CC1 | Cc1cc(Br)ccc1SC(=S)ONC(=O)C1CC=CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C35"
} |
Can you make molecule COc1ccc(CNC(C)=C2C(=O)N(c3ccc(OC)cc3)N=C2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2N=C(C)C(=C(C)NCc3ccc(OC)c(I)c3)C2=O)cc1 | COc1ccc(CNC(C)=C2C(=O)N(c3ccc(OC)cc3)N=C2C)cc1 | COc1ccc(N2N=C(C)C(=C(C)NCc3ccc(OC)c(I)c3)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c14ccc8cc1"
} |
Can you make molecule COc1ccc(CNC(C)=C2C(=O)N(c3ccc(OC)cc3)N=C2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2N=C(C)C(=C(C)NCc3ccc(Br)c(OC)c3)C2=O)cc1 | COc1ccc(CNC(C)=C2C(=O)N(c3ccc(OC)cc3)N=C2C)cc1 | COc1ccc(N2N=C(C)C(=C(C)NCc3ccc(Br)c(OC)c3)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c14ccc8cc1"
} |
Can you make molecule COc1ccc(CNC(C)=C2C(=O)N(c3ccc(OC)cc3)N=C2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2N=C(C)C(=C(C)NCc3ccc(OC)c(Cl)c3)C2=O)cc1 | COc1ccc(CNC(C)=C2C(=O)N(c3ccc(OC)cc3)N=C2C)cc1 | COc1ccc(N2N=C(C)C(=C(C)NCc3ccc(OC)c(Cl)c3)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c14ccc8cc1"
} |
Can you make molecule COc1ccc(CNC(C)=C2C(=O)N(c3ccc(OC)cc3)N=C2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2N=C(C)C(=C(C)NCc3cccc(OC)c3Br)C2=O)cc1 | COc1ccc(CNC(C)=C2C(=O)N(c3ccc(OC)cc3)N=C2C)cc1 | COc1ccc(N2N=C(C)C(=C(C)NCc3cccc(OC)c3Br)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c14ccc8cc1"
} |
Can you make molecule COc1ccc(CNC(C)=C2C(=O)N(c3ccc(OC)cc3)N=C2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2N=C(C)C(=C(C)NCc3cccc(OC)c3Cl)C2=O)cc1 | COc1ccc(CNC(C)=C2C(=O)N(c3ccc(OC)cc3)N=C2C)cc1 | COc1ccc(N2N=C(C)C(=C(C)NCc3cccc(OC)c3Cl)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c14ccc8cc1"
} |
Can you make molecule O=C(COC(=O)C1(c2ccccc2F)CCCC1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SOC(=O)C1(c2ccccc2F)CCCC1)N1CCOCC1 | O=C(COC(=O)C1(c2ccccc2F)CCCC1)N1CCOCC1 | O=C(/C=C/SOC(=O)C1(c2ccccc2F)CCCC1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C4C5"
} |
Can you make molecule O=C(COC(=O)C1(c2ccccc2F)CCCC1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(ON1CCC(=NON2CCOCC2)CC1)C1(c2ccccc2F)CCCC1 | O=C(COC(=O)C1(c2ccccc2F)CCCC1)N1CCOCC1 | O=C(ON1CCC(=NON2CCOCC2)CC1)C1(c2ccccc2F)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C4C5"
} |
Can you make molecule O=C(COC(=O)C1(c2ccccc2F)CCCC1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCN(OC(=O)C2(c3ccccc3F)CCCC2)CC1)N1CCOCC1 | O=C(COC(=O)C1(c2ccccc2F)CCCC1)N1CCOCC1 | O=C(NN=C1CCN(OC(=O)C2(c3ccccc3F)CCCC2)CC1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCN&CC1",
"old_substring": "O=C4C5"
} |
Can you make molecule O=C(COC(=O)C1(c2ccccc2F)CCCC1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(OC(=O)C2(c3ccccc3F)CCCC2)CC1)N1CCOCC1 | O=C(COC(=O)C1(c2ccccc2F)CCCC1)N1CCOCC1 | O=C(NN=C1CCC(OC(=O)C2(c3ccccc3F)CCCC2)CC1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C4C5"
} |
Can you make molecule O=C(COC(=O)C1(c2ccccc2F)CCCC1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ON1CCOCC1)C(=O)SOC(=O)C1(c2ccccc2F)CCCC1 | O=C(COC(=O)C1(c2ccccc2F)CCCC1)N1CCOCC1 | C/C(=N\ON1CCOCC1)C(=O)SOC(=O)C1(c2ccccc2F)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C4C5"
} |
Can you make molecule CC1(C)C(=O)NCC[NH+]1Cc1ccc(OCC(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)C(=O)NCC[NH+]1CCCCc1ccc(OCC(F)F)cc1 | CC1(C)C(=O)NCC[NH+]1Cc1ccc(OCC(F)F)cc1 | CC1(C)C(=O)NCC[NH+]1CCCCc1ccc(OCC(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C45"
} |
Can you make molecule CC1(C)C(=O)NCC[NH+]1Cc1ccc(OCC(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)C(=O)NCC[NH+]1CCCCCc1ccc(OCC(F)F)cc1 | CC1(C)C(=O)NCC[NH+]1Cc1ccc(OCC(F)F)cc1 | CC1(C)C(=O)NCC[NH+]1CCCCCc1ccc(OCC(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C45"
} |
Can you make molecule CC1(C)C(=O)NCC[NH+]1Cc1ccc(OCC(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)C(=O)NCC[NH+]1C1CC(c2ccc(OCC(F)F)cc2)C1 | CC1(C)C(=O)NCC[NH+]1Cc1ccc(OCC(F)F)cc1 | CC1(C)C(=O)NCC[NH+]1C1CC(c2ccc(OCC(F)F)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C45"
} |
Can you make molecule CC1(C)C(=O)NCC[NH+]1Cc1ccc(OCC(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)C(=O)NCC[NH+]1OC(=S)Sc1ccc(OCC(F)F)cc1 | CC1(C)C(=O)NCC[NH+]1Cc1ccc(OCC(F)F)cc1 | CC1(C)C(=O)NCC[NH+]1OC(=S)Sc1ccc(OCC(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C45"
} |
Can you make molecule CC1(C)C(=O)NCC[NH+]1Cc1ccc(OCC(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)C(=O)NCC[NH+]1SC(=S)Nc1ccc(OCC(F)F)cc1 | CC1(C)C(=O)NCC[NH+]1Cc1ccc(OCC(F)F)cc1 | CC1(C)C(=O)NCC[NH+]1SC(=S)Nc1ccc(OCC(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C45"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(C(=O)NC(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(C(=O)NC(C)C)cc1I | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(C(=O)NC(C)C)cc1 | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(C(=O)NC(C)C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15ccc7cc1"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(C(=O)NC(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1cc(C(=O)NC(C)C)ccc1Br | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(C(=O)NC(C)C)cc1 | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1cc(C(=O)NC(C)C)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15ccc7cc1"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(C(=O)NC(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(C(=O)NC(C)C)cc1Cl | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(C(=O)NC(C)C)cc1 | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(C(=O)NC(C)C)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15ccc7cc1"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(C(=O)NC(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1cccc(C(=O)NC(C)C)c1Br | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(C(=O)NC(C)C)cc1 | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1cccc(C(=O)NC(C)C)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15ccc7cc1"
} |
Can you make molecule Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(C(=O)NC(C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1cccc(C(=O)NC(C)C)c1Cl | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc(C(=O)NC(C)C)cc1 | Cc1ccc([N+](=O)[O-])cc1C(=O)Nc1cccc(C(=O)NC(C)C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15ccc7cc1"
} |
Can you make molecule C[C@@H]([C@@H](O)c1ccc2ncnn2c1)[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](O)CCC(=O)c1ccc2ncnn2c1 | C[C@@H]([C@@H](O)c1ccc2ncnn2c1)[N+](=O)[O-] | C[C@@H](O)CCC(=O)c1ccc2ncnn2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](O)CCC&=O",
"old_substring": "C[C@@H]([C@H]3O)[N+](=O)[O-]"
} |
Can you make molecule C[C@@H]([C@@H](O)c1ccc2ncnn2c1)[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C#N)C(=O)c1ccc2ncnn2c1 | C[C@@H]([C@@H](O)c1ccc2ncnn2c1)[N+](=O)[O-] | C[C@@H](C#N)C(=O)c1ccc2ncnn2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](C#N)C&=O",
"old_substring": "C[C@@H]([C@H]3O)[N+](=O)[O-]"
} |
Can you make molecule C[C@@H]([C@@H](O)c1ccc2ncnn2c1)[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1ccc2ncnn2c1)N=O | C[C@@H]([C@@H](O)c1ccc2ncnn2c1)[N+](=O)[O-] | C[C@H](Cc1ccc2ncnn2c1)N=O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](C&)N=O",
"old_substring": "C[C@@H]([C@H]3O)[N+](=O)[O-]"
} |
Can you make molecule C[C@@H]([C@@H](O)c1ccc2ncnn2c1)[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Cc1ccc2ncnn2c1)C(N)=S | C[C@@H]([C@@H](O)c1ccc2ncnn2c1)[N+](=O)[O-] | C[C@@H](Cc1ccc2ncnn2c1)C(N)=S | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](C&)C(N)=S",
"old_substring": "C[C@@H]([C@H]3O)[N+](=O)[O-]"
} |
Can you make molecule C[C@@H]([C@@H](O)c1ccc2ncnn2c1)[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C#N)CC(=O)c1ccc2ncnn2c1 | C[C@@H]([C@@H](O)c1ccc2ncnn2c1)[N+](=O)[O-] | C[C@@H](C#N)CC(=O)c1ccc2ncnn2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](C#N)CC&=O",
"old_substring": "C[C@@H]([C@H]3O)[N+](=O)[O-]"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.